Isotretinoin
(SHGAZHPCJJPHSC-XFYACQKRSA-N)
Structure
- SMILES
- C/C(=C\C=C\C(=C/C(=O)O)\C)/C=C/C1=C(C)CCCC1(C)C
- Type(s)
- Approved
- ATC code(s)
- D10AD04; D10AD54; D10BA01
- Molecular Formula:
- C20H28O2
- Molecular Weight:
- 300.435
- Log P:
- 5.6026
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 1
- TPSA:
- 37.3
- CAS Number(s):
- 4759-48-2
Synonym(s)
1.
Isotretinoin
2.
13-cis-Retinoic Acid
3.
Accutane
4.
Isotretinoin Zinc Salt, 13-cis-Isomer
5.
Ro 4-3780
6.
Roaccutane
7.
13 cis Retinoic Acid
8.
Isotretinoin Zinc Salt, 13 cis Isomer
9.
Ro 4 3780
10.
Ro 43780
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pregnancy | FAERS: 3051 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Irritable Bowel Syndrome | FAERS: 2829 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Anxiety | FAERS: 2443 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 4 | Colitis | FAERS: 2176 | US FAERS | |
| 5 | Drug exposure during pregnancy | FAERS: 1865 | US FAERS | |
| 6 | Dry skin | FAERS: 1807 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 7 | Headache | FAERS: 1564 Canada Vigilance: 4 | CTD Canada Vigilance US FAERS | |
| 8 | Arthralgia | FAERS: 1523 Canada Vigilance: 3 | 17286159 | CTD Canada Vigilance US FAERS |
| 9 | Intestinal Obstruction | FAERS: 1342 | US FAERS | |
| 10 | Blood triglycerides increased | FAERS: 1192 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 11 | Abdominal Pain | FAERS: 948 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Back Pain | FAERS: 946 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 13 | Emotional distress | FAERS: 929 | US FAERS | |
| 14 | No adverse effect | FAERS: 879 | US FAERS | |
| 15 | Multi-organ disorder | FAERS: 876 | US FAERS | |
| 16 | Blood cholesterol increased | FAERS: 875 | US FAERS | |
| 17 | Epistaxis | FAERS: 829 Canada Vigilance: 1 | 17286159 | CTD Canada Vigilance US FAERS |
| 18 | No adverse event | FAERS: 772 | US FAERS | |
| 19 | Nausea | FAERS: 769 Canada Vigilance: 1 | 10928138 | CTD Canada Vigilance US FAERS |
| 20 | Fatigue | FAERS: 727 Canada Vigilance: 4 | 8961893 | CTD Canada Vigilance US FAERS |
| 21 | Acne | FAERS: 682 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 22 | Stress | FAERS: 623 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 23 | Anal Fissure | FAERS: 579 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Arthritis | FAERS: 569 | US FAERS | |
| 25 | Myalgia | FAERS: 561 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 26 | Anal Fistula | FAERS: 541 | US FAERS | |
| 27 | Weight decreased | FAERS: 532 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 28 | Suicide attempt | FAERS: 521 | US FAERS | |
| 29 | Vomiting | FAERS: 464 Canada Vigilance: 1 | 7707116 10928138 | CTD Canada Vigilance US FAERS |
| 30 | Alopecia | FAERS: 442 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 31 | Pain | FAERS: 441 Canada Vigilance: 2 | 2933601 8961893 17286159 | CTD Canada Vigilance US FAERS |
| 32 | Mood swings | FAERS: 412 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Dizziness | FAERS: 408 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 34 | Drug ineffective | FAERS: 400 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 35 | Proctitis | FAERS: 369 | US FAERS | |
| 36 | Depressed mood | FAERS: 343 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Anger | FAERS: 337 | US FAERS | |
| 38 | Cheilitis | FAERS: 332 | 17286159 | CTD US FAERS |
| 39 | Gastritis | FAERS: 323 | US FAERS | |
| 40 | Aspartate Aminotransferase Increased | FAERS: 296 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 41 | Completed Suicide | FAERS: 292 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 42 | Alanine Aminotransferase Increased | FAERS: 289 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 43 | Chest Pain | FAERS: 288 Canada Vigilance: 3 | 17223888 | CTD Canada Vigilance US FAERS |
| 44 | Ileitis | FAERS: 286 | US FAERS | |
| 45 | Malaise | FAERS: 285 | US FAERS | |
| 46 | Dehydration | FAERS: 278 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Bipolar Disorder | FAERS: 271 | US FAERS | |
| 48 | Nephrolithiasis | FAERS: 270 | US FAERS | |
| 49 | Perirectal abscess | FAERS: 262 | US FAERS | |
| 50 | Pouchitis | FAERS: 245 | US FAERS | |
| 51 | Anhedonia | FAERS: 243 | US FAERS | |
| 52 | Adverse event | FAERS: 242 | US FAERS | |
| 53 | Sinusitis | FAERS: 241 | US FAERS | |
| 54 | Osteopenia | FAERS: 238 | US FAERS | |
| 55 | Constipation | FAERS: 236 | US FAERS | |
| 56 | Erythema | FAERS: 236 Canada Vigilance: 3 | 17286159 | CTD Canada Vigilance US FAERS |
| 57 | Diverticulitis | FAERS: 230 | US FAERS | |
| 58 | Maternal exposure during pregnancy | FAERS: 230 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 59 | Pancreatitis | FAERS: 228 | US FAERS | |
| 60 | Rheumatoid Arthritis | FAERS: 225 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Dyspepsia | FAERS: 202 | US FAERS | |
| 62 | Asthenia | FAERS: 197 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 63 | Crying | FAERS: 194 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Drug exposure before pregnancy | FAERS: 194 | US FAERS | |
| 65 | Xerosis | FAERS: 188 | US FAERS | |
| 66 | Pruritus | FAERS: 184 Canada Vigilance: 1 | 17286159 | CTD Canada Vigilance US FAERS |
| 67 | Emotional disorder | FAERS: 183 | US FAERS | |
| 68 | Feeling abnormal | FAERS: 178 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 69 | Ileus | FAERS: 176 | 10928138 | CTD US FAERS |
| 70 | Eczema | FAERS: 174 | US FAERS | |
| 71 | Somnolence | FAERS: 170 | US FAERS | |
| 72 | Erectile dysfunction | FAERS: 169 Canada Vigilance: 5 | 16447596 | CTD Canada Vigilance US FAERS |
| 73 | Anal abscess | FAERS: 162 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Bronchitis | FAERS: 153 | US FAERS | |
| 75 | Deep Vein Thrombosis | FAERS: 153 | US FAERS | |
| 76 | Sacroiliitis | FAERS: 152 | 17725657 19533139 | CTD US FAERS |
| 77 | Hypersensitivity | FAERS: 151 | US FAERS | |
| 78 | Unevaluable event | FAERS: 151 | US FAERS | |
| 79 | Rectal polyp | FAERS: 150 | US FAERS | |
| 80 | Chronic Fatigue Syndrome | FAERS: 148 | US FAERS | |
| 81 | Live Birth | FAERS: 148 | US FAERS | |
| 82 | Drug prescribing error | FAERS: 146 | US FAERS | |
| 83 | Intervertebral Disc Degeneration | FAERS: 142 | US FAERS | |
| 84 | Nasopharyngitis | FAERS: 142 | US FAERS | |
| 85 | Drug dispensing error | FAERS: 141 | US FAERS | |
| 86 | Influenza | FAERS: 141 | US FAERS | |
| 87 | Drug dose omission | FAERS: 140 | US FAERS | |
| 88 | Neck Pain | FAERS: 140 | US FAERS | |
| 89 | Abdominal Abscess | FAERS: 138 | US FAERS | |
| 90 | Product quality issue | FAERS: 137 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 91 | Urinary tract infection | FAERS: 136 | US FAERS | |
| 92 | Visual Impairment | FAERS: 136 | US FAERS | |
| 93 | Agitation | FAERS: 135 | US FAERS | |
| 94 | Cholelithiasis | FAERS: 131 | US FAERS | |
| 95 | Hernia | FAERS: 129 | US FAERS | |
| 96 | Palpitations | FAERS: 128 | US FAERS | |
| 97 | Pharyngitis | FAERS: 124 | US FAERS | |
| 98 | Urticaria | FAERS: 121 Canada Vigilance: 1 | 16405632 | CTD Canada Vigilance US FAERS |
| 99 | Duodenitis | FAERS: 120 | US FAERS | |
| 100 | Gastroenteritis | FAERS: 119 | US FAERS | |
| 101 | Abdominal discomfort | FAERS: 118 | US FAERS | |
| 102 | Appendicitis | FAERS: 115 | US FAERS | |
| 103 | Osteoporosis | FAERS: 114 | US FAERS | |
| 104 | Tinnitus | FAERS: 114 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 105 | Internal injury | FAERS: 112 | US FAERS | |
| 106 | Diverticulum | FAERS: 109 | US FAERS | |
| 107 | Pneumonia | FAERS: 107 | US FAERS | |
| 108 | Inappropriate schedule of drug administration | FAERS: 106 | US FAERS | |
| 109 | Gastric ulcer | FAERS: 105 | US FAERS | |
| 110 | Anorexia | FAERS: 104 | US FAERS | |
| 111 | Aphthous Stomatitis | FAERS: 102 | US FAERS | |
| 112 | Infectious Mononucleosis | FAERS: 102 | US FAERS | |
| 113 | Blood alkaline phosphatase increased | FAERS: 99 | US FAERS | |
| 114 | Fracture | FAERS: 99 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 115 | Oropharyngeal pain | FAERS: 99 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 116 | Peptic Ulcer | FAERS: 99 | US FAERS | |
| 117 | Rectal fissure | FAERS: 99 | US FAERS | |
| 118 | Syncope | FAERS: 99 | US FAERS | |
| 119 | Conjunctivitis | FAERS: 98 | 2931989 17286159 | CTD US FAERS |
| 120 | Cyst | FAERS: 98 | US FAERS | |
| 121 | Pregnancy on oral contraceptive | FAERS: 98 | US FAERS | |
| 122 | Lymphadenopathy | FAERS: 97 | US FAERS | |
| 123 | Asthma | FAERS: 92 | US FAERS | |
| 124 | Large intestine perforation | FAERS: 92 | US FAERS | |
| 125 | Rectal abscess | FAERS: 92 | US FAERS | |
| 126 | Cellulitis | FAERS: 91 | 17223888 | CTD US FAERS |
| 127 | White blood cell count decreased | FAERS: 91 | US FAERS | |
| 128 | Pregnancy test false positive | FAERS: 89 | US FAERS | |
| 129 | Amnesia | FAERS: 88 | US FAERS | |
| 130 | Arthropathy | FAERS: 86 | US FAERS | |
| 131 | Maternal exposure before pregnancy | FAERS: 86 | US FAERS | |
| 132 | Dysuria | FAERS: 85 | US FAERS | |
| 133 | Intentional self-injury | FAERS: 85 | US FAERS | |
| 134 | Tachycardia | FAERS: 85 | 15826276 17709681 | CTD US FAERS |
| 135 | Bone pain | FAERS: 84 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 136 | Transmission of drug via semen | FAERS: 84 | US FAERS | |
| 137 | Sepsis | FAERS: 83 | US FAERS | |
| 138 | Abscess | FAERS: 81 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 139 | Chest discomfort | FAERS: 81 | US FAERS | |
| 140 | Flatulence | FAERS: 81 | US FAERS | |
| 141 | Hepatitis | FAERS: 81 | US FAERS | |
| 142 | Thrombocytopenia | FAERS: 81 | 7707116 | CTD US FAERS |
| 143 | Cholecystitis | FAERS: 80 | US FAERS | |
| 144 | Visual disturbance | FAERS: 79 | US FAERS | |
| 145 | Erythema Nodosum | FAERS: 78 | 9330049 | CTD US FAERS |
| 146 | Memory impairment | FAERS: 78 | US FAERS | |
| 147 | Pulmonary Embolism | FAERS: 76 | US FAERS | |
| 148 | Blood creatine phosphokinase increased | FAERS: 75 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 149 | Dermatitis | FAERS: 75 | CTD US FAERS | |
| 150 | Pharyngolaryngeal Pain | FAERS: 75 | US FAERS | |
| 151 | Pregnancy with contraceptive device | FAERS: 74 | US FAERS | |
| 152 | Duodenal Ulcer | FAERS: 73 | US FAERS | |
| 153 | Eye pain | FAERS: 73 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Impaired work ability | FAERS: 72 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 155 | Tonsillitis | FAERS: 72 | US FAERS | |
| 156 | Atelectasis | FAERS: 71 | US FAERS | |
| 157 | Cataract | FAERS: 71 | US FAERS | |
| 158 | Obsessive-Compulsive Disorder | FAERS: 71 | US FAERS | |
| 159 | Pelvic abscess | FAERS: 71 | US FAERS | |
| 160 | Chills | FAERS: 69 | US FAERS | |
| 161 | Musculoskeletal Pain | FAERS: 69 | US FAERS | |
| 162 | Vertigo | FAERS: 68 | 7116351 | CTD US FAERS |
| 163 | Enterocutaneous Fistula | FAERS: 67 | US FAERS | |
| 164 | Infection | FAERS: 67 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 165 | nervous system disorder | FAERS: 67 | US FAERS | |
| 166 | No adverse reaction | FAERS: 66 | US FAERS | |
| 167 | Personality Change | FAERS: 66 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 168 | Skin Papilloma | FAERS: 66 | US FAERS | |
| 169 | Inflammation | FAERS: 65 | US FAERS | |
| 170 | Joint injury | FAERS: 65 | US FAERS | |
| 171 | Megacolon | FAERS: 65 | US FAERS | |
| 172 | Blood glucose increased | FAERS: 63 | US FAERS | |
| 173 | Hypothyroidism | FAERS: 63 | US FAERS | |
| 174 | Paranoia | FAERS: 63 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 175 | Proteinuria | FAERS: 63 | US FAERS | |
| 176 | Colonic fistula | FAERS: 62 | US FAERS | |
| 177 | Malnutrition | FAERS: 61 | US FAERS | |
| 178 | Schizophrenia | FAERS: 61 | US FAERS | |
| 179 | Angina Pectoris | FAERS: 60 | US FAERS | |
| 180 | Eye irritation | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 181 | Low density lipoprotein increased | FAERS: 60 | US FAERS | |
| 182 | Intestinal Perforation | FAERS: 59 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 183 | Lip swelling | FAERS: 59 | US FAERS | |
| 184 | Pyoderma Gangrenosum | FAERS: 59 | US FAERS | |
| 185 | Folliculitis | FAERS: 58 | US FAERS | |
| 186 | Joint swelling | FAERS: 58 | US FAERS | |
| 187 | Pilonidal Cyst | FAERS: 58 | US FAERS | |
| 188 | Pregnancy of partner | FAERS: 58 | US FAERS | |
| 189 | Psoriasis | FAERS: 58 | 1938411 | CTD US FAERS |
| 190 | Vulvovaginal mycotic infection | FAERS: 58 | US FAERS | |
| 191 | Enteritis | FAERS: 57 | US FAERS | |
| 192 | Fibromyalgia | FAERS: 57 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 193 | Lethargy | FAERS: 56 | US FAERS | |
| 194 | Leukocytosis | FAERS: 56 | US FAERS | |
| 195 | Peritonitis | FAERS: 56 | US FAERS | |
| 196 | Disease recurrence | FAERS: 55 | US FAERS | |
| 197 | Educational problem | FAERS: 55 | US FAERS | |
| 198 | Endometriosis | FAERS: 55 | US FAERS | |
| 199 | Incorrect dose administered | FAERS: 55 | US FAERS | |
| 200 | Apathy | FAERS: 54 | US FAERS | |
| 201 | Drug Dependence | FAERS: 54 | US FAERS | |
| 202 | Ligament rupture | FAERS: 53 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 203 | Ileal Stenosis | FAERS: 52 | US FAERS | |
| 204 | Myopia | FAERS: 52 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 205 | Overdose | FAERS: 52 | US FAERS | |
| 206 | Stomatitis | FAERS: 52 | US FAERS | |
| 207 | Panic Disorder | FAERS: 51 | 17277875 | CTD US FAERS |
| 208 | Polyarthritis | FAERS: 51 | US FAERS | |
| 209 | Clostridium difficile colitis | FAERS: 50 | US FAERS | |
| 210 | Musculoskeletal stiffness | FAERS: 50 | US FAERS | |
| 211 | Night sweats | FAERS: 50 | US FAERS | |
| 212 | Blindness | FAERS: 49 | US FAERS | |
| 213 | Economic problem | FAERS: 49 | US FAERS | |
| 214 | Flushing | FAERS: 49 | US FAERS | |
| 215 | Photophobia | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 216 | Leukopenia | FAERS: 48 | 10928138 | CTD US FAERS |
| 217 | Sunburn | FAERS: 48 | US FAERS | |
| 218 | Therapy non-responder | FAERS: 48 | US FAERS | |
| 219 | Thrombosis | FAERS: 48 | US FAERS | |
| 220 | Cystitis | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 221 | Pregnancy on contraceptive | FAERS: 47 | US FAERS | |
| 222 | Proctocolitis | FAERS: 47 | US FAERS | |
| 223 | Deafness | FAERS: 46 | US FAERS | |
| 224 | Tremor | FAERS: 46 | US FAERS | |
| 225 | Vasculitis | FAERS: 46 | 1967805 2572922 | CTD US FAERS |
| 226 | Burning sensation | FAERS: 45 | US FAERS | |
| 227 | Exposure via body fluid | FAERS: 45 | US FAERS | |
| 228 | Joint sprain | FAERS: 45 | US FAERS | |
| 229 | Epicondylitis | FAERS: 44 | US FAERS | |
| 230 | Pericardial effusion | FAERS: 43 | US FAERS | |
| 231 | Neutropenia | FAERS: 42 | US FAERS | |
| 232 | Chronic sinusitis | FAERS: 41 | US FAERS | |
| 233 | Delirium | FAERS: 41 | US FAERS | |
| 234 | Dysthymic Disorder | FAERS: 41 | US FAERS | |
| 235 | Gastrointestinal stoma complication | FAERS: 41 | US FAERS | |
| 236 | Hysterectomy | FAERS: 41 | US FAERS | |
| 237 | Swelling | FAERS: 41 | US FAERS | |
| 238 | Ankylosing spondylitis | FAERS: 40 | US FAERS | |
| 239 | Cervicobrachial syndrome | FAERS: 40 | US FAERS | |
| 240 | Ectopic Pregnancy | FAERS: 40 | US FAERS | |
| 241 | Post-Traumatic Stress Disorder | FAERS: 40 | US FAERS | |
| 242 | Sinus bradycardia | FAERS: 40 | US FAERS | |
| 243 | Bone density decreased | FAERS: 39 | US FAERS | |
| 244 | Colonic Stenosis | FAERS: 39 | US FAERS | |
| 245 | Drug abuser | FAERS: 39 | US FAERS | |
| 246 | Sinus Tachycardia | FAERS: 39 | US FAERS | |
| 247 | Blepharitis | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 248 | Facial Pain | FAERS: 38 | US FAERS | |
| 249 | Growth retardation | FAERS: 38 | US FAERS | |
| 250 | Hypersomnia | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 251 | Joint stiffness | FAERS: 38 | US FAERS | |
| 252 | Lip exfoliation | FAERS: 38 | US FAERS | |
| 253 | Obesity | FAERS: 38 | US FAERS | |
| 254 | Sexual Dysfunction | FAERS: 38 | US FAERS | |
| 255 | Psychiatric symptom | FAERS: 37 | US FAERS | |
| 256 | Thirst | FAERS: 37 | US FAERS | |
| 257 | prostatitis | FAERS: 37 | US FAERS | |
| 258 | Eructation | FAERS: 36 | US FAERS | |
| 259 | Violence-related symptom | FAERS: 36 | US FAERS | |
| 260 | Angioedema | FAERS: 35 | 16405632 | CTD US FAERS |
| 261 | Hordeolum | FAERS: 35 | US FAERS | |
| 262 | Pelvic Pain | FAERS: 35 | US FAERS | |
| 263 | Subcutaneous Abscess | FAERS: 35 | US FAERS | |
| 264 | Thrombophlebitis | FAERS: 35 | US FAERS | |
| 265 | Transaminases increased | FAERS: 35 | US FAERS | |
| 266 | Ulcer | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 267 | Blood urine present | FAERS: 34 | US FAERS | |
| 268 | Discomfort | FAERS: 34 | US FAERS | |
| 269 | Intervertebral disc disorder | FAERS: 34 | US FAERS | |
| 270 | Intestinal Fistula | FAERS: 34 | US FAERS | |
| 271 | Lupus Nephritis | FAERS: 34 | US FAERS | |
| 272 | Pancytopenia | FAERS: 34 | US FAERS | |
| 273 | Premenstrual syndrome | FAERS: 34 | US FAERS | |
| 274 | Sciatica | FAERS: 34 | US FAERS | |
| 275 | Uveitis | FAERS: 34 | US FAERS | |
| 276 | Flight of ideas | FAERS: 33 | US FAERS | |
| 277 | Hydronephrosis | FAERS: 33 | US FAERS | |
| 278 | Limb injury | FAERS: 33 | US FAERS | |
| 279 | Oral pain | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 280 | Pallor | FAERS: 33 | US FAERS | |
| 281 | Postoperative abscess | FAERS: 33 | US FAERS | |
| 282 | Rhabdomyolysis | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 283 | Skin Ulcer | FAERS: 33 Canada Vigilance: 1 | 2938008 | CTD Canada Vigilance US FAERS |
| 284 | Tension Headache | FAERS: 33 | US FAERS | |
| 285 | Multiple Sclerosis | FAERS: 32 | US FAERS | |
| 286 | Nervousness | FAERS: 32 | US FAERS | |
| 287 | Nodule | FAERS: 32 | US FAERS | |
| 288 | Pruritus Ani | FAERS: 32 | US FAERS | |
| 289 | Rotator cuff syndrome | FAERS: 32 | US FAERS | |
| 290 | Hidradenitis | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 291 | Hypotension | FAERS: 31 | US FAERS | |
| 292 | Skin irritation | FAERS: 31 | US FAERS | |
| 293 | Skin lesion | FAERS: 31 | US FAERS | |
| 294 | Supraventricular tachycardia | FAERS: 31 | US FAERS | |
| 295 | Acne fulminans | FAERS: 30 | US FAERS | |
| 296 | Ascites | FAERS: 30 | US FAERS | |
| 297 | Neutrophil count decreased | FAERS: 30 | US FAERS | |
| 298 | Oral candidiasis | FAERS: 30 | US FAERS | |
| 299 | Pneumothorax | FAERS: 30 | US FAERS | |
| 300 | Pyogenic granuloma | FAERS: 30 | US FAERS | |
| 301 | Bipolar I disorder | FAERS: 29 | US FAERS | |
| 302 | Blood albumin decreased | FAERS: 29 | US FAERS | |
| 303 | Cerebrovascular accident | FAERS: 29 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 304 | Keratoconjunctivitis Sicca | FAERS: 29 | US FAERS | |
| 305 | Laceration | FAERS: 29 | US FAERS | |
| 306 | Menorrhagia | FAERS: 29 | US FAERS | |
| 307 | Shoulder Pain | FAERS: 29 | US FAERS | |
| 308 | Autoimmune thyroiditis | FAERS: 28 | US FAERS | |
| 309 | Feelings of worthlessness | FAERS: 28 | US FAERS | |
| 310 | Mental impairment | FAERS: 28 | US FAERS | |
| 311 | Aphasia | FAERS: 27 | US FAERS | |
| 312 | Gamma-Glutamyltransferase Increased | FAERS: 27 | US FAERS | |
| 313 | Glomerulonephritis | FAERS: 27 | US FAERS | |
| 314 | Impetigo | FAERS: 27 | US FAERS | |
| 315 | Medication Error | FAERS: 27 | US FAERS | |
| 316 | Mononucleosis syndrome | FAERS: 27 | US FAERS | |
| 317 | Musculoskeletal chest pain | FAERS: 27 | US FAERS | |
| 318 | Otitis Media | FAERS: 27 | US FAERS | |
| 319 | Splenomegaly | FAERS: 27 | US FAERS | |
| 320 | Synovial Cyst | FAERS: 27 | US FAERS | |
| 321 | Tonsillectomy | FAERS: 27 | US FAERS | |
| 322 | Varicocele | FAERS: 27 | US FAERS | |
| 323 | Bulimia Nervosa | FAERS: 26 | US FAERS | |
| 324 | Patellofemoral Pain Syndrome | FAERS: 26 | US FAERS | |
| 325 | Pyelonephritis | FAERS: 26 | US FAERS | |
| 326 | Rash erythematous | FAERS: 26 | US FAERS | |
| 327 | Restlessness | FAERS: 26 | US FAERS | |
| 328 | Thyroid Neoplasm | FAERS: 26 | US FAERS | |
| 329 | Anal Ulcer | FAERS: 25 | US FAERS | |
| 330 | Chromaturia | FAERS: 25 | US FAERS | |
| 331 | Diabetes Mellitus | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 332 | Drug ineffective for unapproved indication | FAERS: 25 | US FAERS | |
| 333 | Mental status changes | FAERS: 25 | US FAERS | |
| 334 | Muscle strain | FAERS: 25 | US FAERS | |
| 335 | Myocardial Infarction | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 336 | Rhinitis | FAERS: 25 | US FAERS | |
| 337 | Vitreous floaters | FAERS: 25 | US FAERS | |
| 338 | pseudomembranous colitis | FAERS: 25 | US FAERS | |
| 339 | Basal cell carcinoma | FAERS: 24 | US FAERS | |
| 340 | Electrocardiogram change | FAERS: 24 | US FAERS | |
| 341 | Enterocolitis | FAERS: 24 | US FAERS | |
| 342 | Excoriation | FAERS: 24 | US FAERS | |
| 343 | Exposure via semen | FAERS: 24 | US FAERS | |
| 344 | Gastrointestinal Pain | FAERS: 24 | US FAERS | |
| 345 | Laryngitis | FAERS: 24 | US FAERS | |
| 346 | Portal Vein Thrombosis | FAERS: 24 | US FAERS | |
| 347 | Product substitution issue | FAERS: 24 | US FAERS | |
| 348 | Spondylitis | FAERS: 24 | US FAERS | |
| 349 | Dysphonia | FAERS: 23 | US FAERS | |
| 350 | Gastrointestinal infection | FAERS: 23 | US FAERS | |
| 351 | Infertility | FAERS: 23 | US FAERS | |
| 352 | Intestinal anastomosis complication | FAERS: 23 | US FAERS | |
| 353 | Iritis | FAERS: 23 | US FAERS | |
| 354 | Maternal exposure timing unspecified | FAERS: 23 | US FAERS | |
| 355 | Pharmaceutical product complaint | FAERS: 23 | US FAERS | |
| 356 | Pregnancy test positive | FAERS: 23 | US FAERS | |
| 357 | Viral upper respiratory tract infection | FAERS: 23 | US FAERS | |
| 358 | Arthrodesis | FAERS: 22 | US FAERS | |
| 359 | Autoimmune hepatitis | FAERS: 22 | US FAERS | |
| 360 | Dandy-Walker Syndrome | FAERS: 22 | US FAERS | |
| 361 | Hepatotoxicity | FAERS: 22 | US FAERS | |
| 362 | Hirsutism | FAERS: 22 | US FAERS | |
| 363 | Osteomyelitis | FAERS: 22 | US FAERS | |
| 364 | Pericarditis | FAERS: 22 | US FAERS | |
| 365 | Respiratory Failure | FAERS: 22 | US FAERS | |
| 366 | Biliary Dyskinesia | FAERS: 21 | US FAERS | |
| 367 | Blood glucose decreased | FAERS: 21 | US FAERS | |
| 368 | Blood potassium increased | FAERS: 21 | US FAERS | |
| 369 | Circumstance or information capable of leading to medication error | FAERS: 21 | US FAERS | |
| 370 | Eosinophilia | FAERS: 21 | US FAERS | |
| 371 | Gastrointestinal motility disorder | FAERS: 21 | US FAERS | |
| 372 | Hydrocephalus | FAERS: 21 | 2933136 6237184 6591112 | CTD US FAERS |
| 373 | Petechiae | FAERS: 21 | US FAERS | |
| 374 | Pleurisy | FAERS: 21 | US FAERS | |
| 375 | Product physical issue | FAERS: 21 | US FAERS | |
| 376 | Skin necrosis | FAERS: 21 | US FAERS | |
| 377 | Therapy cessation | FAERS: 21 | US FAERS | |
| 378 | Vitamin D Deficiency | FAERS: 21 | US FAERS | |
| 379 | muscle injury | FAERS: 21 | US FAERS | |
| 380 | Acid fast bacilli infection | FAERS: 20 | US FAERS | |
| 381 | Alanine aminotransferase decreased | FAERS: 20 | US FAERS | |
| 382 | Blood creatinine increased | FAERS: 20 | US FAERS | |
| 383 | Blood iron decreased | FAERS: 20 | US FAERS | |
| 384 | Blood lactate dehydrogenase increased | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 385 | Cardiac Arrest | FAERS: 20 | US FAERS | |
| 386 | Cholangitis | FAERS: 20 | US FAERS | |
| 387 | Disease Progression | FAERS: 20 | US FAERS | |
| 388 | Fibroadenoma of breast | FAERS: 20 | US FAERS | |
| 389 | Granuloma | FAERS: 20 | US FAERS | |
| 390 | Hunger | FAERS: 20 | US FAERS | |
| 391 | Intentional product misuse | FAERS: 20 | US FAERS | |
| 392 | Renal cyst | FAERS: 20 | US FAERS | |
| 393 | Sjogren's Syndrome | FAERS: 20 | US FAERS | |
| 394 | Activities of daily living impaired | FAERS: 19 | US FAERS | |
| 395 | Cleft Palate | FAERS: 19 | 3162101 | CTD US FAERS |
| 396 | Colon adenoma | FAERS: 19 | US FAERS | |
| 397 | Complications of maternal exposure to therapeutic drugs | FAERS: 19 | US FAERS | |
| 398 | Diplopia | FAERS: 19 | US FAERS | |
| 399 | Drug administration error | FAERS: 19 | US FAERS | |
| 400 | Drug effect incomplete | FAERS: 19 | US FAERS | |
| 401 | Enterovesical Fistula | FAERS: 19 | US FAERS | |
| 402 | Erosive Duodenitis | FAERS: 19 | US FAERS | |
| 403 | Hyperkeratosis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 404 | Hyperthyroidism | FAERS: 19 | US FAERS | |
| 405 | Lymphoid tissue hyperplasia | FAERS: 19 | US FAERS | |
| 406 | Myocarditis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 407 | Neuralgia | FAERS: 19 | US FAERS | |
| 408 | Neuroblastoma | FAERS: 19 | CTD US FAERS | |
| 409 | Sigmoiditis | FAERS: 19 | US FAERS | |
| 410 | Skin laceration | FAERS: 19 | US FAERS | |
| 411 | Stillbirth | FAERS: 19 | US FAERS | |
| 412 | Total cholesterol/HDL ratio increased | FAERS: 19 | US FAERS | |
| 413 | Urinary Retention | FAERS: 19 | 12653758 | CTD US FAERS |
| 414 | Viral pharyngitis | FAERS: 19 | US FAERS | |
| 415 | Ankle Fracture | FAERS: 18 | US FAERS | |
| 416 | Benign Prostatic Hyperplasia | FAERS: 18 | US FAERS | |
| 417 | Drug toxicity | FAERS: 18 | US FAERS | |
| 418 | Epididymitis | FAERS: 18 | US FAERS | |
| 419 | Guillain-Barre Syndrome | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 420 | Multiple allergies | FAERS: 18 | US FAERS | |
| 421 | Rectal tenesmus | FAERS: 18 | US FAERS | |
| 422 | Sneezing | FAERS: 18 | US FAERS | |
| 423 | Abdominal sepsis | FAERS: 17 | US FAERS | |
| 424 | Acute prerenal failure | FAERS: 17 | US FAERS | |
| 425 | Alopecia effluvium | FAERS: 17 | US FAERS | |
| 426 | Anal polyp | FAERS: 17 | US FAERS | |
| 427 | Breast Cyst | FAERS: 17 | US FAERS | |
| 428 | Candidiasis | FAERS: 17 | US FAERS | |
| 429 | Carcinoembryonic antigen increased | FAERS: 17 | US FAERS | |
| 430 | Eye Infection | FAERS: 17 | US FAERS | |
| 431 | Eye inflammation | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 432 | Food Poisoning | FAERS: 17 | US FAERS | |
| 433 | Glaucoma | FAERS: 17 | US FAERS | |
| 434 | Homicide | FAERS: 17 | US FAERS | |
| 435 | Ileal Fistula | FAERS: 17 | US FAERS | |
| 436 | Lymphocytic infiltration | FAERS: 17 | US FAERS | |
| 437 | Meningitis | FAERS: 17 | US FAERS | |
| 438 | Nail Infection | FAERS: 17 | US FAERS | |
| 439 | Nerve injury | FAERS: 17 | US FAERS | |
| 440 | Poor quality sleep | FAERS: 17 | US FAERS | |
| 441 | Purpura | FAERS: 17 | US FAERS | |
| 442 | Restless Legs Syndrome | FAERS: 17 | US FAERS | |
| 443 | Toothache | FAERS: 17 | US FAERS | |
| 444 | Umbilical hernia | FAERS: 17 | US FAERS | |
| 445 | Bursitis | FAERS: 16 | US FAERS | |
| 446 | Cartilage injury | FAERS: 16 | US FAERS | |
| 447 | Dermoid Cyst | FAERS: 16 | US FAERS | |
| 448 | Hormone level abnormal | FAERS: 16 | US FAERS | |
| 449 | Product dose omission | FAERS: 16 | US FAERS | |
| 450 | Radiculitis | FAERS: 16 | US FAERS | |
| 451 | Vulvovaginal dryness | FAERS: 16 | US FAERS | |
| 452 | jaundice | FAERS: 16 | US FAERS | |
| 453 | Alcohol abuse | FAERS: 15 | US FAERS | |
| 454 | Blood potassium decreased | FAERS: 15 | US FAERS | |
| 455 | Clostridium colitis | FAERS: 15 | US FAERS | |
| 456 | Dyspareunia | FAERS: 15 | US FAERS | |
| 457 | Hepatic Vein Thrombosis | FAERS: 15 | US FAERS | |
| 458 | Hepatomegaly | FAERS: 15 | US FAERS | |
| 459 | Hepatosplenomegaly | FAERS: 15 | US FAERS | |
| 460 | Hypogonadism | FAERS: 15 | US FAERS | |
| 461 | Keratitis | FAERS: 15 | US FAERS | |
| 462 | Ligament injury | FAERS: 15 | US FAERS | |
| 463 | Myositis | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 464 | Nasal vestibulitis | FAERS: 15 | US FAERS | |
| 465 | Pulmonary Hypertension | FAERS: 15 | US FAERS | |
| 466 | Radiculopathy | FAERS: 15 | US FAERS | |
| 467 | Rosacea | FAERS: 15 | 11763399 | CTD US FAERS |
| 468 | Vaginal Discharge | FAERS: 15 | US FAERS | |
| 469 | treatment failure | FAERS: 15 | US FAERS | |
| 470 | Abasia | FAERS: 14 | US FAERS | |
| 471 | Blood amylase increased | FAERS: 14 | US FAERS | |
| 472 | Cervical dysplasia | FAERS: 14 | US FAERS | |
| 473 | Dysmorphism | FAERS: 14 | US FAERS | |
| 474 | Episcleritis | FAERS: 14 | US FAERS | |
| 475 | Escherichia infection | FAERS: 14 | US FAERS | |
| 476 | Exposure via father | FAERS: 14 | US FAERS | |
| 477 | Gestational Diabetes | FAERS: 14 | US FAERS | |
| 478 | Low set ears | FAERS: 14 | US FAERS | |
| 479 | Lymphocyte count decreased | FAERS: 14 | US FAERS | |
| 480 | Mallory-Weiss Syndrome | FAERS: 14 | US FAERS | |
| 481 | Measles | FAERS: 14 | US FAERS | |
| 482 | Nasal discomfort | FAERS: 14 | US FAERS | |
| 483 | Neuritis | FAERS: 14 | US FAERS | |
| 484 | Onychomycosis | FAERS: 14 | US FAERS | |
| 485 | Pain of skin | FAERS: 14 | US FAERS | |
| 486 | Palindromic rheumatism | FAERS: 14 | US FAERS | |
| 487 | Post procedural complication | FAERS: 14 | US FAERS | |
| 488 | Product storage error | FAERS: 14 | US FAERS | |
| 489 | Product use in unapproved indication | FAERS: 14 | US FAERS | |
| 490 | Stevens-Johnson Syndrome | FAERS: 14 | 25811541 | CTD US FAERS |
| 491 | furuncle | FAERS: 14 | US FAERS | |
| 492 | Accidental exposure | FAERS: 13 | US FAERS | |
| 493 | Acute sinusitis | FAERS: 13 | US FAERS | |
| 494 | Blood albumin increased | FAERS: 13 | US FAERS | |
| 495 | Bowel movement irregularity | FAERS: 13 | US FAERS | |
| 496 | Bradycardia | FAERS: 13 | US FAERS | |
| 497 | Cerebellar Hypoplasia | FAERS: 13 | US FAERS | |
| 498 | Colectomy | FAERS: 13 | US FAERS | |
| 499 | Gastrointestinal ulcer | FAERS: 13 | US FAERS | |
| 500 | Head deformity | FAERS: 13 | US FAERS | |
| 501 | Hyperplasia | FAERS: 13 | US FAERS | |
| 502 | Impaired gastric emptying | FAERS: 13 | US FAERS | |
| 503 | Labyrinthitis | FAERS: 13 | US FAERS | |
| 504 | Lymphadenitis | FAERS: 13 | US FAERS | |
| 505 | Lymphocyte count increased | FAERS: 13 | US FAERS | |
| 506 | Malignant neoplasm of uterine adnexa | FAERS: 13 | US FAERS | |
| 507 | Middle insomnia | FAERS: 13 | US FAERS | |
| 508 | Optic Neuritis | FAERS: 13 | US FAERS | |
| 509 | Otitis Externa | FAERS: 13 | US FAERS | |
| 510 | Peripheral swelling | FAERS: 13 | US FAERS | |
| 511 | Product dispensing error | FAERS: 13 | US FAERS | |
| 512 | Product use issue | FAERS: 13 | US FAERS | |
| 513 | Protein total decreased | FAERS: 13 | US FAERS | |
| 514 | Scab | FAERS: 13 | US FAERS | |
| 515 | Septic Shock | FAERS: 13 | US FAERS | |
| 516 | Sinus headache | FAERS: 13 | US FAERS | |
| 517 | Spousal Abuse | FAERS: 13 | US FAERS | |
| 518 | Temperature intolerance | FAERS: 13 | US FAERS | |
| 519 | Urethritis | FAERS: 13 | 7116351 9228237 | CTD US FAERS |
| 520 | VIIth nerve paralysis | FAERS: 13 | US FAERS | |
| 521 | Abdominal adhesions | FAERS: 12 | US FAERS | |
| 522 | Acquired Immunodeficiency Syndrome | FAERS: 12 | US FAERS | |
| 523 | Back disorder | FAERS: 12 | US FAERS | |
| 524 | Blighted ovum | FAERS: 12 | US FAERS | |
| 525 | Bronchospasm | FAERS: 12 | US FAERS | |
| 526 | Cardiomegaly | FAERS: 12 | US FAERS | |
| 527 | Contrast media reaction | FAERS: 12 | US FAERS | |
| 528 | Deformity | FAERS: 12 | US FAERS | |
| 529 | Device breakage | FAERS: 12 | US FAERS | |
| 530 | Ejection Fraction Decreased | FAERS: 12 | US FAERS | |
| 531 | Extremity necrosis | FAERS: 12 | US FAERS | |
| 532 | Feeling jittery | FAERS: 12 | US FAERS | |
| 533 | Flat affect | FAERS: 12 | US FAERS | |
| 534 | Frustration | FAERS: 12 | US FAERS | |
| 535 | Fuchs' syndrome | FAERS: 12 | US FAERS | |
| 536 | Hypocomplementaemia | FAERS: 12 | US FAERS | |
| 537 | Infarction | FAERS: 12 | US FAERS | |
| 538 | Injury asphyxiation | FAERS: 12 | US FAERS | |
| 539 | Iron deficiency | FAERS: 12 | US FAERS | |
| 540 | Joint Range of Motion Decreased | FAERS: 12 | US FAERS | |
| 541 | Lipase increased | FAERS: 12 | US FAERS | |
| 542 | Lyme Disease | FAERS: 12 | US FAERS | |
| 543 | Negative thoughts | FAERS: 12 | US FAERS | |
| 544 | Quality of life decreased | FAERS: 12 | US FAERS | |
| 545 | Skin Wrinkling | FAERS: 12 | US FAERS | |
| 546 | Wheezing | FAERS: 12 | US FAERS | |
| 547 | Acute respiratory failure | FAERS: 11 | US FAERS | |
| 548 | Alcohol poisoning | FAERS: 11 | US FAERS | |
| 549 | Aphonia | FAERS: 11 | US FAERS | |
| 550 | Atrial tachycardia | FAERS: 11 | US FAERS | |
| 551 | Balanitis | FAERS: 11 | US FAERS | |
| 552 | Blood bilirubin unconjugated increased | FAERS: 11 | US FAERS | |
| 553 | Breech Presentation | FAERS: 11 | US FAERS | |
| 554 | Disorientation | FAERS: 11 | US FAERS | |
| 555 | Drug screen positive | FAERS: 11 | US FAERS | |
| 556 | Genital burning sensation | FAERS: 11 | US FAERS | |
| 557 | Hepatitis C | FAERS: 11 | US FAERS | |
| 558 | Incorrect product storage | FAERS: 11 | US FAERS | |
| 559 | Induration | FAERS: 11 | US FAERS | |
| 560 | Intestinal resection | FAERS: 11 | US FAERS | |
| 561 | Leukocytoclastic vasculitis | FAERS: 11 | US FAERS | |
| 562 | Metrorrhagia | FAERS: 11 | US FAERS | |
| 563 | Morbid thoughts | FAERS: 11 | US FAERS | |
| 564 | Musculoskeletal discomfort | FAERS: 11 | US FAERS | |
| 565 | Mydriasis | FAERS: 11 | US FAERS | |
| 566 | Nephrotic Syndrome | FAERS: 11 | 10831665 | CTD US FAERS |
| 567 | Pelvic Inflammatory Disease | FAERS: 11 | US FAERS | |
| 568 | Serositis | FAERS: 11 | US FAERS | |
| 569 | Trichotillomania | FAERS: 11 | US FAERS | |
| 570 | Vaginal mycosis | FAERS: 11 | US FAERS | |
| 571 | Wound dehiscence | FAERS: 11 | US FAERS | |
| 572 | Abdominal tenderness | FAERS: 10 | US FAERS | |
| 573 | Acute psychosis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 574 | Calcinosis | FAERS: 10 | US FAERS | |
| 575 | Congenital Hydrocephalus | FAERS: 10 | US FAERS | |
| 576 | Congenital cerebellar agenesis | FAERS: 10 | US FAERS | |
| 577 | Diverticular perforation | FAERS: 10 | US FAERS | |
| 578 | Ear discomfort | FAERS: 10 | US FAERS | |
| 579 | Fibrosis | FAERS: 10 | US FAERS | |
| 580 | Genital discharge | FAERS: 10 | US FAERS | |
| 581 | Gout | FAERS: 10 | US FAERS | |
| 582 | Head discomfort | FAERS: 10 | US FAERS | |
| 583 | Hypotrichosis | FAERS: 10 | US FAERS | |
| 584 | Ileal ulcer | FAERS: 10 | US FAERS | |
| 585 | Incontinence | FAERS: 10 | US FAERS | |
| 586 | Malignant neoplasm progression | FAERS: 10 | US FAERS | |
| 587 | Neuropathy | FAERS: 10 | US FAERS | |
| 588 | Paresis | FAERS: 10 | US FAERS | |
| 589 | Perineal fistula | FAERS: 10 | US FAERS | |
| 590 | Pleuritic pain | FAERS: 10 | US FAERS | |
| 591 | Self Mutilation | FAERS: 10 | US FAERS | |
| 592 | Throat irritation | FAERS: 10 | US FAERS | |
| 593 | Tinea Pedis | FAERS: 10 | US FAERS | |
| 594 | Torticollis | FAERS: 10 | US FAERS | |
| 595 | Urinary Incontinence | FAERS: 10 | US FAERS | |
| 596 | Wrong technique in product usage process | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 597 | Acne Conglobata | FAERS: 9 | US FAERS | |
| 598 | Asphyxia | FAERS: 9 | US FAERS | |
| 599 | Bacteria stool identified | FAERS: 9 | US FAERS | |
| 600 | Blood cholesterol abnormal | FAERS: 9 | US FAERS | |
| 601 | Blood phosphorus increased | FAERS: 9 | US FAERS | |
| 602 | Blood triglycerides abnormal | FAERS: 9 | US FAERS | |
| 603 | Cerebral Infarction | FAERS: 9 | US FAERS | |
| 604 | Cervical spine flattening | FAERS: 9 | US FAERS | |
| 605 | Depression suicidal | FAERS: 9 | US FAERS | |
| 606 | Dysarthria | FAERS: 9 | US FAERS | |
| 607 | Electrocardiogram abnormal | FAERS: 9 | US FAERS | |
| 608 | Flank Pain | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 609 | Gastrointestinal inflammation | FAERS: 9 | US FAERS | |
| 610 | Incision site complication | FAERS: 9 | US FAERS | |
| 611 | Infectious peritonitis | FAERS: 9 | US FAERS | |
| 612 | Meibomian gland dysfunction | FAERS: 9 | US FAERS | |
| 613 | Molluscum Contagiosum | FAERS: 9 | US FAERS | |
| 614 | Neonatal disorder | FAERS: 9 | US FAERS | |
| 615 | Onychoclasis | FAERS: 9 | US FAERS | |
| 616 | Patent ductus arteriosus | FAERS: 9 | US FAERS | |
| 617 | Periumbilical abscess | FAERS: 9 | US FAERS | |
| 618 | Procedural complication | FAERS: 9 | US FAERS | |
| 619 | Productive Cough | FAERS: 9 | US FAERS | |
| 620 | Psoas Abscess | FAERS: 9 | US FAERS | |
| 621 | Pyloric Stenosis | FAERS: 9 | US FAERS | |
| 622 | Retinal Detachment | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 623 | Sperm count decreased | FAERS: 9 | US FAERS | |
| 624 | Squamous cell carcinoma | FAERS: 9 | US FAERS | |
| 625 | Strabismus | FAERS: 9 | US FAERS | |
| 626 | Thermal burn | FAERS: 9 | US FAERS | |
| 627 | Ventricular Fibrillation | FAERS: 9 | US FAERS | |
| 628 | Victim of sexual abuse | FAERS: 9 | US FAERS | |
| 629 | Wound Infection | FAERS: 9 | US FAERS | |
| 630 | Adjustment disorder with mixed anxiety and depressed mood | FAERS: 8 | US FAERS | |
| 631 | Arteriosclerosis | FAERS: 8 | US FAERS | |
| 632 | Arthropod bite | FAERS: 8 | US FAERS | |
| 633 | Blood sodium decreased | FAERS: 8 | US FAERS | |
| 634 | Bone lesion | FAERS: 8 | US FAERS | |
| 635 | Breast tenderness | FAERS: 8 | US FAERS | |
| 636 | Cholesteatoma | FAERS: 8 | US FAERS | |
| 637 | Disseminated Intravascular Coagulation | FAERS: 8 | US FAERS | |
| 638 | Duodenal Obstruction | FAERS: 8 | US FAERS | |
| 639 | Dysgeusia | FAERS: 8 | US FAERS | |
| 640 | Ear congestion | FAERS: 8 | US FAERS | |
| 641 | Enterococcal infection | FAERS: 8 | US FAERS | |
| 642 | Erysipelas | FAERS: 8 | US FAERS | |
| 643 | Essential Hypertension | FAERS: 8 | US FAERS | |
| 644 | Fibroadenoma | FAERS: 8 | US FAERS | |
| 645 | Hepatic Infarction | FAERS: 8 | US FAERS | |
| 646 | Hyperventilation | FAERS: 8 | US FAERS | |
| 647 | Hypoaesthesia facial | FAERS: 8 | US FAERS | |
| 648 | Juvenile arthritis | FAERS: 8 | US FAERS | |
| 649 | Lactose Intolerance | FAERS: 8 | US FAERS | |
| 650 | Large intestinal stenosis | FAERS: 8 | US FAERS | |
| 651 | Metaplasia | FAERS: 8 | US FAERS | |
| 652 | Microcephaly | FAERS: 8 | US FAERS | |
| 653 | Muscle tightness | FAERS: 8 | US FAERS | |
| 654 | Myoclonus | FAERS: 8 | US FAERS | |
| 655 | Occult blood positive | FAERS: 8 | US FAERS | |
| 656 | Osteochondrosis | FAERS: 8 | US FAERS | |
| 657 | Partner stress | FAERS: 8 | US FAERS | |
| 658 | Peritonsillar Abscess | FAERS: 8 | US FAERS | |
| 659 | Phlebitis | FAERS: 8 | US FAERS | |
| 660 | Pre-Eclampsia | FAERS: 8 | US FAERS | |
| 661 | Presyncope | FAERS: 8 | US FAERS | |
| 662 | Product prescribing error | FAERS: 8 | US FAERS | |
| 663 | Retching | FAERS: 8 | US FAERS | |
| 664 | Rheumatic Fever | FAERS: 8 | US FAERS | |
| 665 | Skin reaction | FAERS: 8 | US FAERS | |
| 666 | Spinal column stenosis | FAERS: 8 | US FAERS | |
| 667 | Stargardt's disease | FAERS: 8 | US FAERS | |
| 668 | Synovitis | FAERS: 8 | US FAERS | |
| 669 | Theft | FAERS: 8 | US FAERS | |
| 670 | Therapeutic response unexpected with drug substitution | FAERS: 8 | US FAERS | |
| 671 | Urine ketone body present | FAERS: 8 | US FAERS | |
| 672 | Uterine Polyp | FAERS: 8 | US FAERS | |
| 673 | Wound infection staphylococcal | FAERS: 8 | US FAERS | |
| 674 | Actinic keratosis | FAERS: 7 | US FAERS | |
| 675 | Agnosia | FAERS: 7 | US FAERS | |
| 676 | Alcohol Intolerance | FAERS: 7 | US FAERS | |
| 677 | Anosmia | FAERS: 7 | US FAERS | |
| 678 | Astigmatism | FAERS: 7 | US FAERS | |
| 679 | Atrial Fibrillation | FAERS: 7 | US FAERS | |
| 680 | Biliary dilatation | FAERS: 7 | US FAERS | |
| 681 | Blood thyroid stimulating hormone decreased | FAERS: 7 | US FAERS | |
| 682 | Blood triglycerides decreased | FAERS: 7 | US FAERS | |
| 683 | Bone infarction | FAERS: 7 | US FAERS | |
| 684 | Budd-Chiari Syndrome | FAERS: 7 | US FAERS | |
| 685 | Catatonia | FAERS: 7 | US FAERS | |
| 686 | Cold sweat | FAERS: 7 | US FAERS | |
| 687 | Dental caries | FAERS: 7 | US FAERS | |
| 688 | Dermatomyositis | FAERS: 7 | US FAERS | |
| 689 | Device Failure | FAERS: 7 | US FAERS | |
| 690 | Dysplasia | FAERS: 7 | US FAERS | |
| 691 | Encephalitis | FAERS: 7 | US FAERS | |
| 692 | Enzyme level increased | FAERS: 7 | US FAERS | |
| 693 | Focal glomerulosclerosis | FAERS: 7 | US FAERS | |
| 694 | General physical health deterioration | FAERS: 7 | US FAERS | |
| 695 | Giardiasis | FAERS: 7 | US FAERS | |
| 696 | Incisional hernia | FAERS: 7 | US FAERS | |
| 697 | Keratoconus | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 698 | Lipoma | FAERS: 7 | US FAERS | |
| 699 | Lupus-like syndrome | FAERS: 7 | US FAERS | |
| 700 | Lymphoma | FAERS: 7 | 18380168 | CTD US FAERS |
| 701 | Malabsorption | FAERS: 7 | US FAERS | |
| 702 | Monocyte percentage increased | FAERS: 7 | US FAERS | |
| 703 | Myasthenia Gravis | FAERS: 7 | US FAERS | |
| 704 | Nephritis | FAERS: 7 | US FAERS | |
| 705 | Nystagmus | FAERS: 7 | US FAERS | |
| 706 | Parovarian Cyst | FAERS: 7 | US FAERS | |
| 707 | Periarthritis | FAERS: 7 | US FAERS | |
| 708 | Physical assault | FAERS: 7 | US FAERS | |
| 709 | Product use complaint | FAERS: 7 | US FAERS | |
| 710 | Psychomotor skills impaired | FAERS: 7 | US FAERS | |
| 711 | Pulmonary congestion | FAERS: 7 | US FAERS | |
| 712 | Pulmonary vasculitis | FAERS: 7 | US FAERS | |
| 713 | Rectal Prolapse | FAERS: 7 | US FAERS | |
| 714 | Small Intestinal Stenosis | FAERS: 7 | US FAERS | |
| 715 | Tinea cruris | FAERS: 7 | US FAERS | |
| 716 | Ageusia | FAERS: 6 | US FAERS | |
| 717 | Anaphylactic shock | FAERS: 6 | US FAERS | |
| 718 | Anencephaly | FAERS: 6 | US FAERS | |
| 719 | Angular cheilitis | FAERS: 6 | US FAERS | |
| 720 | Animal bite | FAERS: 6 | US FAERS | |
| 721 | Azoospermia | FAERS: 6 | US FAERS | |
| 722 | Blood testosterone decreased | FAERS: 6 | US FAERS | |
| 723 | Calcium deficiency | FAERS: 6 | US FAERS | |
| 724 | Cardiac Tamponade | FAERS: 6 | US FAERS | |
| 725 | Carpal Tunnel Syndrome | FAERS: 6 | US FAERS | |
| 726 | Cerebral Palsy | FAERS: 6 | US FAERS | |
| 727 | Cerebral disorder | FAERS: 6 | US FAERS | |
| 728 | Clostridium difficile infection | FAERS: 6 | US FAERS | |
| 729 | Cluster Headache | FAERS: 6 | US FAERS | |
| 730 | Congenital anomaly in offspring | FAERS: 6 | US FAERS | |
| 731 | Corneal erosion | FAERS: 6 | US FAERS | |
| 732 | Diabetic Ketoacidosis | FAERS: 6 | US FAERS | |
| 733 | Drug screen false positive | FAERS: 6 | US FAERS | |
| 734 | Drug withdrawal syndrome | FAERS: 6 | US FAERS | |
| 735 | Dysphemia | FAERS: 6 | US FAERS | |
| 736 | Electroencephalogram abnormal | FAERS: 6 | US FAERS | |
| 737 | Endometritis | FAERS: 6 | US FAERS | |
| 738 | Epilepsy | FAERS: 6 | US FAERS | |
| 739 | Epstein-Barr virus antibody positive | FAERS: 6 | US FAERS | |
| 740 | Exfoliative rash | FAERS: 6 | US FAERS | |
| 741 | Expired product administered | FAERS: 6 | US FAERS | |
| 742 | Feeling Cold | FAERS: 6 | US FAERS | |
| 743 | Food Allergy | FAERS: 6 | US FAERS | |
| 744 | Forceps delivery | FAERS: 6 | US FAERS | |
| 745 | Granulomatous liver disease | FAERS: 6 | US FAERS | |
| 746 | Hepatitis B | FAERS: 6 | US FAERS | |
| 747 | Hyperacusis | FAERS: 6 | US FAERS | |
| 748 | Hypervitaminosis | FAERS: 6 | US FAERS | |
| 749 | Incoherent | FAERS: 6 | US FAERS | |
| 750 | Insulin Resistance | FAERS: 6 | US FAERS | |
| 751 | Ketonuria | FAERS: 6 | US FAERS | |
| 752 | Lichen Planus | FAERS: 6 | US FAERS | |
| 753 | Meningomyelocele | FAERS: 6 | US FAERS | |
| 754 | Menopause | FAERS: 6 | US FAERS | |
| 755 | Monocyte count decreased | FAERS: 6 | US FAERS | |
| 756 | Monocyte count increased | FAERS: 6 | US FAERS | |
| 757 | Poisoning | FAERS: 6 | US FAERS | |
| 758 | Polyuria | FAERS: 6 | US FAERS | |
| 759 | Postoperative ileus | FAERS: 6 | US FAERS | |
| 760 | Product packaging quantity issue | FAERS: 6 | US FAERS | |
| 761 | Protein total increased | FAERS: 6 | US FAERS | |
| 762 | Pseudomeningocele | FAERS: 6 | US FAERS | |
| 763 | Rectal discharge | FAERS: 6 | US FAERS | |
| 764 | Scleroderma | FAERS: 6 | US FAERS | |
| 765 | Screaming | FAERS: 6 | US FAERS | |
| 766 | Splenic Infarction | FAERS: 6 | US FAERS | |
| 767 | Vitiligo | FAERS: 6 | US FAERS | |
| 768 | Wrong technique in drug usage process | FAERS: 6 | US FAERS | |
| 769 | Accidental overdose | FAERS: 5 | US FAERS | |
| 770 | Acquired night blindness | FAERS: 5 | US FAERS | |
| 771 | Anastomotic stenosis | FAERS: 5 | US FAERS | |
| 772 | Arthropod sting | FAERS: 5 | US FAERS | |
| 773 | Aspartate aminotransferase decreased | FAERS: 5 | US FAERS | |
| 774 | Atrioventricular Block | FAERS: 5 | US FAERS | |
| 775 | Automatism | FAERS: 5 | US FAERS | |
| 776 | Blepharospasm | FAERS: 5 | US FAERS | |
| 777 | Blood creatinine decreased | FAERS: 5 | US FAERS | |
| 778 | Bone marrow depression | FAERS: 5 | US FAERS | |
| 779 | Bronchopneumonia | FAERS: 5 | US FAERS | |
| 780 | CD4 Lymphocytes Decreased | FAERS: 5 | US FAERS | |
| 781 | Chloasma | FAERS: 5 | US FAERS | |
| 782 | Choking | FAERS: 5 | US FAERS | |
| 783 | Chorioamnionitis | FAERS: 5 | US FAERS | |
| 784 | Clumsiness | FAERS: 5 | US FAERS | |
| 785 | Cyclothymic Disorder | FAERS: 5 | US FAERS | |
| 786 | Depressed Level of Consciousness | FAERS: 5 | US FAERS | |
| 787 | Disability | FAERS: 5 | US FAERS | |
| 788 | Dissociation | FAERS: 5 | US FAERS | |
| 789 | Disturbance in sexual arousal | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 790 | Double Outlet Right Ventricle | FAERS: 5 | 11105626 | CTD US FAERS |
| 791 | Drug abuse | FAERS: 5 | US FAERS | |
| 792 | Dysgraphia | FAERS: 5 | US FAERS | |
| 793 | Electrolyte imbalance | FAERS: 5 | US FAERS | |
| 794 | Full blood count abnormal | FAERS: 5 | US FAERS | |
| 795 | Gait inability | FAERS: 5 | US FAERS | |
| 796 | Gastrointestinal hypomotility | FAERS: 5 | US FAERS | |
| 797 | Gastrointestinal obstruction | FAERS: 5 | US FAERS | |
| 798 | Gingival Recession | FAERS: 5 | US FAERS | |
| 799 | Glioblastoma Multiforme | FAERS: 5 | US FAERS | |
| 800 | Granulomatosis with polyangiitis | FAERS: 5 | US FAERS | |
| 801 | Hemiparesis | FAERS: 5 | US FAERS | |
| 802 | Hemiplegia | FAERS: 5 | US FAERS | |
| 803 | Human chorionic gonadotropin increased | FAERS: 5 | US FAERS | |
| 804 | Hyperreflexia | FAERS: 5 | US FAERS | |
| 805 | Hypoxia | FAERS: 5 | US FAERS | |
| 806 | Immunosuppression | FAERS: 5 | US FAERS | |
| 807 | Impaired driving ability | FAERS: 5 | US FAERS | |
| 808 | Initial insomnia | FAERS: 5 | US FAERS | |
| 809 | Intussusception | FAERS: 5 | US FAERS | |
| 810 | Liver Abscess | FAERS: 5 | US FAERS | |
| 811 | Lobar Pneumonia | FAERS: 5 | US FAERS | |
| 812 | Meniscus injury | FAERS: 5 | US FAERS | |
| 813 | Muscle hypertrophy | FAERS: 5 | US FAERS | |
| 814 | Myelofibrosis | FAERS: 5 | US FAERS | |
| 815 | Myopathy | FAERS: 5 | US FAERS | |
| 816 | Normal delivery | FAERS: 5 | US FAERS | |
| 817 | Obsessive thoughts | FAERS: 5 | US FAERS | |
| 818 | Ocular discomfort | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 819 | Oral infection | FAERS: 5 | US FAERS | |
| 820 | Pelvic sepsis | FAERS: 5 | US FAERS | |
| 821 | Perianal abscess | FAERS: 5 | US FAERS | |
| 822 | Phimosis | FAERS: 5 | US FAERS | |
| 823 | Pituitary enlargement | FAERS: 5 | US FAERS | |
| 824 | Pityriasis Lichenoides et Varioliformis Acuta | FAERS: 5 | US FAERS | |
| 825 | Portal Hypertension | FAERS: 5 | US FAERS | |
| 826 | Product prescribing issue | FAERS: 5 | US FAERS | |
| 827 | Protein urine present | FAERS: 5 | US FAERS | |
| 828 | Pulmonary Fibrosis | FAERS: 5 | US FAERS | |
| 829 | Pulmonary thrombosis | FAERS: 5 | US FAERS | |
| 830 | Purulent discharge | FAERS: 5 | US FAERS | |
| 831 | Pyoderma | FAERS: 5 | US FAERS | |
| 832 | Renal pain | FAERS: 5 | US FAERS | |
| 833 | Retinal Degeneration | FAERS: 5 | US FAERS | |
| 834 | Salivary gland adenoma | FAERS: 5 | US FAERS | |
| 835 | Secretion discharge | FAERS: 5 | US FAERS | |
| 836 | Splenic cyst | FAERS: 5 | US FAERS | |
| 837 | Streptococcus test positive | FAERS: 5 | US FAERS | |
| 838 | Sweat gland infection | FAERS: 5 | US FAERS | |
| 839 | Tension | FAERS: 5 | US FAERS | |
| 840 | Therapeutic response unexpected | FAERS: 5 | US FAERS | |
| 841 | Toxicity to various agents | FAERS: 5 | US FAERS | |
| 842 | Ultrasound scan abnormal | FAERS: 5 | US FAERS | |
| 843 | Upper respiratory tract congestion | FAERS: 5 | US FAERS | |
| 844 | Vulvovaginal pain | FAERS: 5 | US FAERS | |
| 845 | Abdominal symptom | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 846 | Abortion induced complete | FAERS: 4 | US FAERS | |
| 847 | Acrochordon excision | FAERS: 4 | US FAERS | |
| 848 | Acute myocardial infarction | FAERS: 4 | US FAERS | |
| 849 | Anal discomfort | FAERS: 4 | US FAERS | |
| 850 | Anastomotic complication | FAERS: 4 | US FAERS | |
| 851 | Angle Closure Glaucoma | FAERS: 4 | US FAERS | |
| 852 | Anophthalmos | FAERS: 4 | US FAERS | |
| 853 | Anorexia Nervosa | FAERS: 4 | US FAERS | |
| 854 | Ataxia | FAERS: 4 | 7116351 | CTD US FAERS |
| 855 | Blood chloride increased | FAERS: 4 | US FAERS | |
| 856 | Blood thyroid stimulating hormone increased | FAERS: 4 | US FAERS | |
| 857 | Blood urea increased | FAERS: 4 | US FAERS | |
| 858 | Body height below normal | FAERS: 4 | US FAERS | |
| 859 | CD4/CD8 ratio decreased | FAERS: 4 | US FAERS | |
| 860 | Cerebellar infarction | FAERS: 4 | US FAERS | |
| 861 | Cerebral Thrombosis | FAERS: 4 | US FAERS | |
| 862 | Cerebral atrophy | FAERS: 4 | US FAERS | |
| 863 | Cerebral ventricle dilatation | FAERS: 4 | US FAERS | |
| 864 | Cheilosis | FAERS: 4 | US FAERS | |
| 865 | Chronic tonsillitis | FAERS: 4 | US FAERS | |
| 866 | Citrobacter infection | FAERS: 4 | US FAERS | |
| 867 | Clostridium difficile toxin test positive | FAERS: 4 | US FAERS | |
| 868 | Coma scale abnormal | FAERS: 4 | US FAERS | |
| 869 | Congenital neurological disorder | FAERS: 4 | US FAERS | |
| 870 | Coronary Artery Disease | FAERS: 4 | US FAERS | |
| 871 | Culture urine positive | FAERS: 4 | US FAERS | |
| 872 | Death of relative | FAERS: 4 | US FAERS | |
| 873 | Demyelination | FAERS: 4 | US FAERS | |
| 874 | Dependence | FAERS: 4 | US FAERS | |
| 875 | Dermatitis acneiform | FAERS: 4 | US FAERS | |
| 876 | Diffuse alopecia | FAERS: 4 | US FAERS | |
| 877 | Drug level below therapeutic | FAERS: 4 | US FAERS | |
| 878 | Endodontic procedure | FAERS: 4 | US FAERS | |
| 879 | Endometrial Hyperplasia | FAERS: 4 | US FAERS | |
| 880 | Epididymal enlargement | FAERS: 4 | US FAERS | |
| 881 | Exposure via partner | FAERS: 4 | US FAERS | |
| 882 | Extra dose administered | FAERS: 4 | US FAERS | |
| 883 | Facial Paresis | FAERS: 4 | US FAERS | |
| 884 | Fear of weight gain | FAERS: 4 | US FAERS | |
| 885 | Focal Nodular Hyperplasia | FAERS: 4 | US FAERS | |
| 886 | Frustration tolerance decreased | FAERS: 4 | US FAERS | |
| 887 | Gastric Stenosis | FAERS: 4 | US FAERS | |
| 888 | Gastrointestinal mucosal disorder | FAERS: 4 | US FAERS | |
| 889 | Gaze palsy | FAERS: 4 | US FAERS | |
| 890 | Gingivitis | FAERS: 4 | US FAERS | |
| 891 | Glioblastoma | FAERS: 4 | US FAERS | |
| 892 | Hallucinations, mixed | FAERS: 4 | US FAERS | |
| 893 | High density lipoprotein increased | FAERS: 4 | US FAERS | |
| 894 | Horseshoe Kidney | FAERS: 4 | US FAERS | |
| 895 | Hostility | FAERS: 4 | US FAERS | |
| 896 | Hypertensive crisis | FAERS: 4 | US FAERS | |
| 897 | Hypervitaminosis A | FAERS: 4 | US FAERS | |
| 898 | Iliotibial Band Syndrome | FAERS: 4 | US FAERS | |
| 899 | Immobile | FAERS: 4 | US FAERS | |
| 900 | Incorrect drug administration duration | FAERS: 4 | US FAERS | |
| 901 | Increased upper airway secretion | FAERS: 4 | US FAERS | |
| 902 | Infant | FAERS: 4 | US FAERS | |
| 903 | Intelligence test abnormal | FAERS: 4 | US FAERS | |
| 904 | Intentional product use issue | FAERS: 4 | US FAERS | |
| 905 | Lipids abnormal | FAERS: 4 | US FAERS | |
| 906 | Lung consolidation | FAERS: 4 | US FAERS | |
| 907 | Lupus vasculitis | FAERS: 4 | US FAERS | |
| 908 | Lymphocyte percentage decreased | FAERS: 4 | US FAERS | |
| 909 | Lymphocyte percentage increased | FAERS: 4 | US FAERS | |
| 910 | Metatarsalgia | FAERS: 4 | US FAERS | |
| 911 | Microphthalmos | FAERS: 4 | US FAERS | |
| 912 | Migraine with Aura | FAERS: 4 | US FAERS | |
| 913 | Morose | FAERS: 4 | US FAERS | |
| 914 | Muscle Fatigue | FAERS: 4 | US FAERS | |
| 915 | Neutrophil percentage decreased | FAERS: 4 | US FAERS | |
| 916 | Neutrophilic dermatosis | FAERS: 4 | US FAERS | |
| 917 | Osteitis | FAERS: 4 | US FAERS | |
| 918 | Paranasal sinus discomfort | FAERS: 4 | US FAERS | |
| 919 | Pneumonitis | FAERS: 4 | US FAERS | |
| 920 | Polydipsia | FAERS: 4 | US FAERS | |
| 921 | Polyhydramnios | FAERS: 4 | US FAERS | |
| 922 | Polysubstance abuse | FAERS: 4 | US FAERS | |
| 923 | Post-traumatic pain | FAERS: 4 | US FAERS | |
| 924 | Precancerous cells present | FAERS: 4 | US FAERS | |
| 925 | Protein total abnormal | FAERS: 4 | US FAERS | |
| 926 | Purging | FAERS: 4 | US FAERS | |
| 927 | Purulence | FAERS: 4 | US FAERS | |
| 928 | Pylorospasm | FAERS: 4 | US FAERS | |
| 929 | Rheumatoid factor increased | FAERS: 4 | US FAERS | |
| 930 | Schizoaffective Disorder | FAERS: 4 | US FAERS | |
| 931 | School refusal | FAERS: 4 | US FAERS | |
| 932 | Seroma | FAERS: 4 | US FAERS | |
| 933 | Single functional kidney | FAERS: 4 | US FAERS | |
| 934 | Sinus operation | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 935 | Skin hypertrophy | FAERS: 4 | US FAERS | |
| 936 | Skin tightness | FAERS: 4 | US FAERS | |
| 937 | Sluggishness | FAERS: 4 | US FAERS | |
| 938 | Snoring | FAERS: 4 | US FAERS | |
| 939 | Spermatocele | FAERS: 4 | US FAERS | |
| 940 | Spina Bifida | FAERS: 4 | US FAERS | |
| 941 | Tachyphrenia | FAERS: 4 | US FAERS | |
| 942 | Talipes | FAERS: 4 | US FAERS | |
| 943 | Tenosynovitis | FAERS: 4 | US FAERS | |
| 944 | Thrombocytosis | FAERS: 4 | US FAERS | |
| 945 | Tooth Infection | FAERS: 4 | US FAERS | |
| 946 | Traumatic delivery | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 947 | Trichorrhexis | FAERS: 4 | US FAERS | |
| 948 | Trisomy 21 | FAERS: 4 | US FAERS | |
| 949 | Troponin increased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 950 | Unwanted pregnancy | FAERS: 4 | US FAERS | |
| 951 | Urethritis noninfective | FAERS: 4 | US FAERS | |
| 952 | Vasectomy | FAERS: 4 | US FAERS | |
| 953 | Venous Insufficiency | FAERS: 4 | US FAERS | |
| 954 | Ventricular hypertrophy | FAERS: 4 | US FAERS | |
| 955 | Ventricular internal diameter abnormal | FAERS: 4 | US FAERS | |
| 956 | White blood cell count abnormal | FAERS: 4 | US FAERS | |
| 957 | Wrong drug administered | FAERS: 4 | US FAERS | |
| 958 | Xerophthalmia | FAERS: 4 | 2931989 | CTD US FAERS |
| 959 | liposarcoma | FAERS: 4 | US FAERS | |
| 960 | skin abrasion | FAERS: 4 | US FAERS | |
| 961 | Abdominal strangulated hernia | FAERS: 3 | US FAERS | |
| 962 | Accidental death | FAERS: 3 | US FAERS | |
| 963 | Activated partial thromboplastin time abnormal | FAERS: 3 | US FAERS | |
| 964 | Adenoidectomy | FAERS: 3 | US FAERS | |
| 965 | Alanine aminotransferase abnormal | FAERS: 3 | US FAERS | |
| 966 | Alopecia Areata | FAERS: 3 | US FAERS | |
| 967 | Anastomotic Leak | FAERS: 3 | US FAERS | |
| 968 | Aortic Aneurysm | FAERS: 3 | US FAERS | |
| 969 | Bacterial sepsis | FAERS: 3 | US FAERS | |
| 970 | Bedridden | FAERS: 3 | US FAERS | |
| 971 | Biliary cirrhosis | FAERS: 3 | US FAERS | |
| 972 | Bipolar II disorder | FAERS: 3 | US FAERS | |
| 973 | Blood alkaline phosphatase abnormal | FAERS: 3 | US FAERS | |
| 974 | Blood bilirubin abnormal | FAERS: 3 | US FAERS | |
| 975 | Blood chloride decreased | FAERS: 3 | US FAERS | |
| 976 | Blood cortisol decreased | FAERS: 3 | US FAERS | |
| 977 | Blood creatine phosphokinase | FAERS: 3 | US FAERS | |
| 978 | Blood glucose abnormal | FAERS: 3 | US FAERS | |
| 979 | Blood immunoglobulin A increased | FAERS: 3 | US FAERS | |
| 980 | Blood iron increased | FAERS: 3 | US FAERS | |
| 981 | Blood prolactin increased | FAERS: 3 | US FAERS | |
| 982 | Blood sodium increased | FAERS: 3 | US FAERS | |
| 983 | Borderline Personality Disorder | FAERS: 3 | US FAERS | |
| 984 | Brain stem syndrome | FAERS: 3 | US FAERS | |
| 985 | C-reactive protein decreased | FAERS: 3 | US FAERS | |
| 986 | Carbon dioxide increased | FAERS: 3 | US FAERS | |
| 987 | Chronic pigmented purpura | FAERS: 3 | US FAERS | |
| 988 | Conduct Disorder | FAERS: 3 | US FAERS | |
| 989 | Contraceptive device complication | FAERS: 3 | US FAERS | |
| 990 | Conversion disorder | FAERS: 3 | US FAERS | |
| 991 | Culture wound positive | FAERS: 3 | US FAERS | |
| 992 | Cytomegalovirus antibody positive | FAERS: 3 | US FAERS | |
| 993 | Delusional disorder, unspecified type | FAERS: 3 | US FAERS | |
| 994 | Diabetes Insipidus | FAERS: 3 | US FAERS | |
| 995 | Drug administered to patient of inappropriate age | FAERS: 3 | US FAERS | |
| 996 | Drug exposure via breast milk | FAERS: 3 | US FAERS | |
| 997 | Early satiety | FAERS: 3 | US FAERS | |
| 998 | Encephalocele | FAERS: 3 | US FAERS | |
| 999 | Endometrial disorder | FAERS: 3 | US FAERS | |
| 1000 | Enthesopathy | FAERS: 3 | US FAERS | |
| 1001 | Epstein-Barr virus antigen positive | FAERS: 3 | US FAERS | |
| 1002 | Eye Redness | FAERS: 3 | US FAERS | |
| 1003 | Facial paralysis | FAERS: 3 | US FAERS | |
| 1004 | False positive investigation result | FAERS: 3 | US FAERS | |
| 1005 | Febrile Neutropenia | FAERS: 3 | US FAERS | |
| 1006 | Feeding disorder neonatal | FAERS: 3 | US FAERS | |
| 1007 | Foreign body trauma | FAERS: 3 | US FAERS | |
| 1008 | Gastrointestinal candidiasis | FAERS: 3 | US FAERS | |
| 1009 | Gastrointestinal stenosis | FAERS: 3 | US FAERS | |
| 1010 | Gastrointestinal tract adenoma | FAERS: 3 | US FAERS | |
| 1011 | Heat Exhaustion | FAERS: 3 | US FAERS | |
| 1012 | Heat Stroke | FAERS: 3 | US FAERS | |
| 1013 | Hip surgery | FAERS: 3 | US FAERS | |
| 1014 | Hypersplenism | FAERS: 3 | US FAERS | |
| 1015 | Hypertrophy | FAERS: 3 | US FAERS | |
| 1016 | Hypokinesia | FAERS: 3 | US FAERS | |
| 1017 | Hypophagia | FAERS: 3 | US FAERS | |
| 1018 | Impatience | FAERS: 3 | US FAERS | |
| 1019 | Inability to afford medication | FAERS: 3 | US FAERS | |
| 1020 | Inappropriate schedule of product administration | FAERS: 3 | US FAERS | |
| 1021 | Infantile apnoeic attack | FAERS: 3 | US FAERS | |
| 1022 | Infected cyst | FAERS: 3 | US FAERS | |
| 1023 | Infrequent bowel movements | FAERS: 3 | US FAERS | |
| 1024 | Intentional drug misuse | FAERS: 3 | US FAERS | |
| 1025 | Intentional misuse | FAERS: 3 | US FAERS | |
| 1026 | Intestinal fistula infection | FAERS: 3 | US FAERS | |
| 1027 | Intracranial Hypotension | FAERS: 3 | US FAERS | |
| 1028 | Keratomileusis | FAERS: 3 | US FAERS | |
| 1029 | Laboratory test interference | FAERS: 3 | US FAERS | |
| 1030 | Laziness | FAERS: 3 | US FAERS | |
| 1031 | Lentigo | FAERS: 3 | US FAERS | |
| 1032 | Lipoprotein (a) increased | FAERS: 3 | US FAERS | |
| 1033 | Livedo Reticularis | FAERS: 3 | US FAERS | |
| 1034 | Loss of personal independence in daily activities | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1035 | Lumbar radiculopathy | FAERS: 3 | US FAERS | |
| 1036 | Lymphadenitis bacterial | FAERS: 3 | US FAERS | |
| 1037 | Male Orgasmic Disorder | FAERS: 3 | US FAERS | |
| 1038 | Male sexual dysfunction | FAERS: 3 | US FAERS | |
| 1039 | Melanosis coli | FAERS: 3 | US FAERS | |
| 1040 | Mental retardation severity unspecified | FAERS: 3 | US FAERS | |
| 1041 | Merycism | FAERS: 3 | US FAERS | |
| 1042 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 1043 | Murder | FAERS: 3 | US FAERS | |
| 1044 | Muscle Spasticity | FAERS: 3 | US FAERS | |
| 1045 | Mutism | FAERS: 3 | US FAERS | |
| 1046 | Myofascitis | FAERS: 3 | US FAERS | |
| 1047 | Necrosis | FAERS: 3 | US FAERS | |
| 1048 | Neonatal aspiration | FAERS: 3 | US FAERS | |
| 1049 | Neonatal neuroblastoma | FAERS: 3 | US FAERS | |
| 1050 | Nerve Root Compression | FAERS: 3 | US FAERS | |
| 1051 | Neuroblastoma recurrent | FAERS: 3 | US FAERS | |
| 1052 | Neutrophil count abnormal | FAERS: 3 | US FAERS | |
| 1053 | Non-high-density lipoprotein cholesterol increased | FAERS: 3 | US FAERS | |
| 1054 | Oliguria | FAERS: 3 | US FAERS | |
| 1055 | Optic Neuropathy | FAERS: 3 | US FAERS | |
| 1056 | Oral mucosal exfoliation | FAERS: 3 | US FAERS | |
| 1057 | Osteolysis | FAERS: 3 | US FAERS | |
| 1058 | Osteoma | FAERS: 3 | US FAERS | |
| 1059 | Papule | FAERS: 3 | US FAERS | |
| 1060 | Pectus excavatum | FAERS: 3 | US FAERS | |
| 1061 | Pelvic mass | FAERS: 3 | US FAERS | |
| 1062 | Performance status decreased | FAERS: 3 | US FAERS | |
| 1063 | Pharyngeal lesion | FAERS: 3 | US FAERS | |
| 1064 | Polydactyly | FAERS: 3 | US FAERS | |
| 1065 | Post inflammatory pigmentation change | FAERS: 3 | US FAERS | |
| 1066 | Postoperative fever | FAERS: 3 | US FAERS | |
| 1067 | Pregnancy with injectable contraceptive | FAERS: 3 | US FAERS | |
| 1068 | Product blister packaging issue | FAERS: 3 | US FAERS | |
| 1069 | Product packaging issue | FAERS: 3 | US FAERS | |
| 1070 | Product size issue | FAERS: 3 | US FAERS | |
| 1071 | Prostate examination abnormal | FAERS: 3 | US FAERS | |
| 1072 | Pterygium | FAERS: 3 | US FAERS | |
| 1073 | Pulmonary malformation | FAERS: 3 | US FAERS | |
| 1074 | Punctate keratitis | FAERS: 3 | US FAERS | |
| 1075 | Radicular pain | FAERS: 3 | US FAERS | |
| 1076 | Renal Colic | FAERS: 3 | US FAERS | |
| 1077 | Respiratory distress | FAERS: 3 | US FAERS | |
| 1078 | Retrograde ejaculation | FAERS: 3 | US FAERS | |
| 1079 | Schizotypal Personality Disorder | FAERS: 3 | US FAERS | |
| 1080 | Scleritis | FAERS: 3 | US FAERS | |
| 1081 | Shock | FAERS: 3 | US FAERS | |
| 1082 | Skeletal injury | FAERS: 3 | US FAERS | |
| 1083 | Skin nodule | FAERS: 3 | US FAERS | |
| 1084 | Spinal fusion surgery | FAERS: 3 | US FAERS | |
| 1085 | Spondylolisthesis | FAERS: 3 | US FAERS | |
| 1086 | Staphylococcal abscess | FAERS: 3 | US FAERS | |
| 1087 | Staphylococcal impetigo | FAERS: 3 | US FAERS | |
| 1088 | Stress at work | FAERS: 3 | US FAERS | |
| 1089 | Syndactyly | FAERS: 3 | US FAERS | |
| 1090 | Testicular mass | FAERS: 3 | US FAERS | |
| 1091 | Therapeutic response delayed | FAERS: 3 | US FAERS | |
| 1092 | Thoracic Outlet Syndrome | FAERS: 3 | US FAERS | |
| 1093 | Tobacco user | FAERS: 3 | US FAERS | |
| 1094 | Toxic Epidermal Necrolysis | FAERS: 3 | US FAERS | |
| 1095 | Tuberculosis | FAERS: 3 | US FAERS | |
| 1096 | Tubo-ovarian abscess | FAERS: 3 | US FAERS | |
| 1097 | Tympanic Membrane Perforation | FAERS: 3 | US FAERS | |
| 1098 | Urine leukocyte esterase positive | FAERS: 3 | US FAERS | |
| 1099 | Vaginal burning sensation | FAERS: 3 | US FAERS | |
| 1100 | Venous thrombosis limb | FAERS: 3 | US FAERS | |
| 1101 | Vestibulitis | FAERS: 3 | US FAERS | |
| 1102 | Vitreous degeneration | FAERS: 3 | US FAERS | |
| 1103 | Wheelchair user | FAERS: 3 | US FAERS | |
| 1104 | rhinoplasty | FAERS: 3 | US FAERS | |
| 1105 | Abortion complete | FAERS: 2 | US FAERS | |
| 1106 | Abulia | FAERS: 2 | US FAERS | |
| 1107 | Acanthosis Nigricans | FAERS: 2 | US FAERS | |
| 1108 | Acarodermatitis | FAERS: 2 | US FAERS | |
| 1109 | Acoustic Neuroma | FAERS: 2 | US FAERS | |
| 1110 | Activated partial thromboplastin time shortened | FAERS: 2 | US FAERS | |
| 1111 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 1112 | Acute tonsillitis | FAERS: 2 | US FAERS | |
| 1113 | Adnexa uteri mass | FAERS: 2 | US FAERS | |
| 1114 | Akathisia | FAERS: 2 | US FAERS | |
| 1115 | Allergic colitis | FAERS: 2 | US FAERS | |
| 1116 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 1117 | Amblyopia | FAERS: 2 | US FAERS | |
| 1118 | Amniotic fluid volume decreased | FAERS: 2 | US FAERS | |
| 1119 | Anal infection | FAERS: 2 | US FAERS | |
| 1120 | Anal inflammation | FAERS: 2 | US FAERS | |
| 1121 | Anaplastic astrocytoma | FAERS: 2 | US FAERS | |
| 1122 | Animal scratch | FAERS: 2 | US FAERS | |
| 1123 | Anorectal discomfort | FAERS: 2 | US FAERS | |
| 1124 | Anorectal infection | FAERS: 2 | US FAERS | |
| 1125 | Anorgasmia | FAERS: 2 | US FAERS | |
| 1126 | Anti-neutrophil cytoplasmic antibody positive vasculitis | FAERS: 2 | US FAERS | |
| 1127 | Antinuclear antibody increased | FAERS: 2 | US FAERS | |
| 1128 | Anuria | FAERS: 2 | US FAERS | |
| 1129 | Aortic Rupture | FAERS: 2 | US FAERS | |
| 1130 | Aphagia | FAERS: 2 | US FAERS | |
| 1131 | Atopy | FAERS: 2 | US FAERS | |
| 1132 | Auricular swelling | FAERS: 2 | US FAERS | |
| 1133 | Avoidant Personality Disorder | FAERS: 2 | US FAERS | |
| 1134 | Avulsion fracture | FAERS: 2 | US FAERS | |
| 1135 | Bacteria urine identified | FAERS: 2 | US FAERS | |
| 1136 | Bacterial culture positive | FAERS: 2 | US FAERS | |
| 1137 | Benign congenital hypotonia | FAERS: 2 | US FAERS | |
| 1138 | Benign neoplasm of thyroid gland | FAERS: 2 | US FAERS | |
| 1139 | Bile Duct Stenosis | FAERS: 2 | US FAERS | |
| 1140 | Bile output increased | FAERS: 2 | US FAERS | |
| 1141 | Biopsy colon abnormal | FAERS: 2 | US FAERS | |
| 1142 | Bladder pain | FAERS: 2 | US FAERS | |
| 1143 | Blood 1,25-dihydroxycholecalciferol decreased | FAERS: 2 | US FAERS | |
| 1144 | Blood alkaline phosphatase decreased | FAERS: 2 | US FAERS | |
| 1145 | Blood blister | FAERS: 2 | US FAERS | |
| 1146 | Blood cholesterol | FAERS: 2 | US FAERS | |
| 1147 | Blood count abnormal | FAERS: 2 | US FAERS | |
| 1148 | Blood folate increased | FAERS: 2 | US FAERS | |
| 1149 | Blood growth hormone decreased | FAERS: 2 | US FAERS | |
| 1150 | Blood immunoglobulin G increased | FAERS: 2 | US FAERS | |
| 1151 | Blood iron abnormal | FAERS: 2 | US FAERS | |
| 1152 | Blood ketone body increased | FAERS: 2 | US FAERS | |
| 1153 | Blood lactate dehydrogenase decreased | FAERS: 2 | US FAERS | |
| 1154 | Blood osmolarity decreased | FAERS: 2 | US FAERS | |
| 1155 | Blood pH increased | FAERS: 2 | US FAERS | |
| 1156 | Blood phosphorus decreased | FAERS: 2 | US FAERS | |
| 1157 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 1158 | Blood urea nitrogen/creatinine ratio increased | FAERS: 2 | US FAERS | |
| 1159 | Blood uric acid decreased | FAERS: 2 | US FAERS | |
| 1160 | Bone scan abnormal | FAERS: 2 | US FAERS | |
| 1161 | Brachydactyly | FAERS: 2 | US FAERS | |
| 1162 | Brain Death | FAERS: 2 | US FAERS | |
| 1163 | Brain scan abnormal | FAERS: 2 | US FAERS | |
| 1164 | Breast discomfort | FAERS: 2 | US FAERS | |
| 1165 | Bronchial Hyperreactivity | FAERS: 2 | US FAERS | |
| 1166 | Bruxism | FAERS: 2 | US FAERS | |
| 1167 | Bullous impetigo | FAERS: 2 | US FAERS | |
| 1168 | Bunion operation | FAERS: 2 | US FAERS | |
| 1169 | Carbon dioxide decreased | FAERS: 2 | US FAERS | |
| 1170 | Central Nervous System Infection | FAERS: 2 | US FAERS | |
| 1171 | Central nervous system lesion | FAERS: 2 | US FAERS | |
| 1172 | Cerebral cyst | FAERS: 2 | US FAERS | |
| 1173 | Cervical polyp | FAERS: 2 | US FAERS | |
| 1174 | Childhood depression | FAERS: 2 | US FAERS | |
| 1175 | Choanal Atresia | FAERS: 2 | US FAERS | |
| 1176 | Choking sensation | FAERS: 2 | US FAERS | |
| 1177 | Collagen-vascular disease | FAERS: 2 | US FAERS | |
| 1178 | Complication of delivery | FAERS: 2 | US FAERS | |
| 1179 | Compulsive hoarding | FAERS: 2 | US FAERS | |
| 1180 | Congenital choroid plexus cyst | FAERS: 2 | US FAERS | |
| 1181 | Congenital cranial nerve paralysis | FAERS: 2 | US FAERS | |
| 1182 | Congenital kyphoscoliosis | FAERS: 2 | US FAERS | |
| 1183 | Congenital scoliosis | FAERS: 2 | US FAERS | |
| 1184 | Conjunctival abrasion | FAERS: 2 | US FAERS | |
| 1185 | Corneal Opacity | FAERS: 2 | 2931989 | CTD US FAERS |
| 1186 | Corneal thinning | FAERS: 2 | US FAERS | |
| 1187 | Croup infectious | FAERS: 2 | US FAERS | |
| 1188 | Cyanosis | FAERS: 2 | US FAERS | |
| 1189 | Dactylitis | FAERS: 2 | US FAERS | |
| 1190 | Dark circles under eyes | FAERS: 2 | US FAERS | |
| 1191 | Decompression Sickness | FAERS: 2 | US FAERS | |
| 1192 | Delayed delivery | FAERS: 2 | US FAERS | |
| 1193 | Delusional disorder, persecutory type | FAERS: 2 | US FAERS | |
| 1194 | Dengue Fever | FAERS: 2 | US FAERS | |
| 1195 | Device related infection | FAERS: 2 | US FAERS | |
| 1196 | Dextrocardia | FAERS: 2 | US FAERS | |
| 1197 | Diplegia | FAERS: 2 | US FAERS | |
| 1198 | Dissociative Identity Disorder | FAERS: 2 | US FAERS | |
| 1199 | Dissociative disorder | FAERS: 2 | US FAERS | |
| 1200 | Drowning | FAERS: 2 | US FAERS | |
| 1201 | Drug dispensed to wrong patient | FAERS: 2 | US FAERS | |
| 1202 | Drug level decreased | FAERS: 2 | US FAERS | |
| 1203 | Drug therapy changed | FAERS: 2 | US FAERS | |
| 1204 | Dwarfism | FAERS: 2 | US FAERS | |
| 1205 | Dystonia | FAERS: 2 | US FAERS | |
| 1206 | Ear canal injury | FAERS: 2 | US FAERS | |
| 1207 | Ecchymosis | FAERS: 2 | US FAERS | |
| 1208 | Electrocardiogram repolarisation abnormality | FAERS: 2 | US FAERS | |
| 1209 | Endocarditis | FAERS: 2 | US FAERS | |
| 1210 | Enterocolitis bacterial | FAERS: 2 | US FAERS | |
| 1211 | Eosinophil percentage increased | FAERS: 2 | US FAERS | |
| 1212 | Erythema Multiforme | FAERS: 2 | US FAERS | |
| 1213 | Euphoric mood | FAERS: 2 | US FAERS | |
| 1214 | Eustachian tube disorder | FAERS: 2 | US FAERS | |
| 1215 | Exposure to toxic agent | FAERS: 2 | US FAERS | |
| 1216 | Eyelid margin crusting | FAERS: 2 | US FAERS | |
| 1217 | Facial asymmetry | FAERS: 2 | US FAERS | |
| 1218 | Failure to Thrive | FAERS: 2 | US FAERS | |
| 1219 | Familial Periodic Paralysis | FAERS: 2 | US FAERS | |
| 1220 | Fat necrosis | FAERS: 2 | US FAERS | |
| 1221 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 1222 | Female sexual arousal disorder | FAERS: 2 | US FAERS | |
| 1223 | Fistula repair | FAERS: 2 | US FAERS | |
| 1224 | Formication | FAERS: 2 | US FAERS | |
| 1225 | Gallbladder necrosis | FAERS: 2 | US FAERS | |
| 1226 | Gastric Bypass | FAERS: 2 | US FAERS | |
| 1227 | Gastrointestinal bacterial infection | FAERS: 2 | US FAERS | |
| 1228 | Gastrointestinal carcinoma | FAERS: 2 | US FAERS | |
| 1229 | Gastrointestinal toxicity | FAERS: 2 | US FAERS | |
| 1230 | General nutrition disorder | FAERS: 2 | US FAERS | |
| 1231 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 1232 | Genital Herpes | FAERS: 2 | US FAERS | |
| 1233 | Genital infection fungal | FAERS: 2 | US FAERS | |
| 1234 | Genital pain | FAERS: 2 | US FAERS | |
| 1235 | Gingival Hyperplasia | FAERS: 2 | US FAERS | |
| 1236 | Glioma | FAERS: 2 | US FAERS | |
| 1237 | Granuloma Annulare | FAERS: 2 | US FAERS | |
| 1238 | Growth failure | FAERS: 2 | US FAERS | |
| 1239 | Head circumference abnormal | FAERS: 2 | US FAERS | |
| 1240 | Hemiplegic migraine | FAERS: 2 | US FAERS | |
| 1241 | Hepatitis A antibody positive | FAERS: 2 | US FAERS | |
| 1242 | Hepatitis A | FAERS: 2 | US FAERS | |
| 1243 | Hernia pain | FAERS: 2 | US FAERS | |
| 1244 | Herpes simplex serology positive | FAERS: 2 | US FAERS | |
| 1245 | Human chorionic gonadotropin negative | FAERS: 2 | US FAERS | |
| 1246 | Human papilloma virus test positive | FAERS: 2 | US FAERS | |
| 1247 | Hypertrichosis | FAERS: 2 | US FAERS | |
| 1248 | Hypertrophic Cardiomyopathy | FAERS: 2 | US FAERS | |
| 1249 | Hypochondriasis | FAERS: 2 | US FAERS | |
| 1250 | Hypomania | FAERS: 2 | US FAERS | |
| 1251 | Hypothermia neonatal | FAERS: 2 | US FAERS | |
| 1252 | Hypoventilation | FAERS: 2 | US FAERS | |
| 1253 | Iatrogenic injury | FAERS: 2 | US FAERS | |
| 1254 | Inadequate analgesia | FAERS: 2 | US FAERS | |
| 1255 | Inappropriate affect | FAERS: 2 | US FAERS | |
| 1256 | Incorrect drug dosage form administered | FAERS: 2 | US FAERS | |
| 1257 | Increased tendency to bruise | FAERS: 2 | US FAERS | |
| 1258 | Infectious colitis | FAERS: 2 | US FAERS | |
| 1259 | Intestinal gangrene | FAERS: 2 | US FAERS | |
| 1260 | Intestinal mucosal hypertrophy | FAERS: 2 | US FAERS | |
| 1261 | Intestinal stoma complication | FAERS: 2 | US FAERS | |
| 1262 | Intraocular pressure test abnormal | FAERS: 2 | US FAERS | |
| 1263 | Libido disorder | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1264 | Limb discomfort | FAERS: 2 | US FAERS | |
| 1265 | Lip erosion | FAERS: 2 | US FAERS | |
| 1266 | Lipohypertrophy | FAERS: 2 | US FAERS | |
| 1267 | Lissencephaly | FAERS: 2 | US FAERS | |
| 1268 | Liver transplant rejection | FAERS: 2 | US FAERS | |
| 1269 | Lymphocyte count abnormal | FAERS: 2 | US FAERS | |
| 1270 | Lymphocytosis | FAERS: 2 | US FAERS | |
| 1271 | Lymphopenia | FAERS: 2 | US FAERS | |
| 1272 | Macrocytosis | FAERS: 2 | US FAERS | |
| 1273 | Mastitis | FAERS: 2 | US FAERS | |
| 1274 | Medial Tibial Stress Syndrome | FAERS: 2 | US FAERS | |
| 1275 | Medulloblastoma | FAERS: 2 | US FAERS | |
| 1276 | Meibomianitis | FAERS: 2 | US FAERS | |
| 1277 | Meningeal disorder | FAERS: 2 | US FAERS | |
| 1278 | Metastatic Neoplasm | FAERS: 2 | US FAERS | |
| 1279 | Milk Allergy | FAERS: 2 | US FAERS | |
| 1280 | Mole excision | FAERS: 2 | US FAERS | |
| 1281 | Mononucleosis heterophile test positive | FAERS: 2 | US FAERS | |
| 1282 | Monoplegia | FAERS: 2 | US FAERS | |
| 1283 | Muscle Cramp | FAERS: 2 | US FAERS | |
| 1284 | Muscle abscess | FAERS: 2 | US FAERS | |
| 1285 | Myelitis | FAERS: 2 | US FAERS | |
| 1286 | Myopericarditis | FAERS: 2 | US FAERS | |
| 1287 | Myositis Ossificans | FAERS: 2 | US FAERS | |
| 1288 | Nasal Polyps | FAERS: 2 | US FAERS | |
| 1289 | Nasal mucosal disorder | FAERS: 2 | US FAERS | |
| 1290 | Neonatal respiratory failure | FAERS: 2 | US FAERS | |
| 1291 | Nerve root injury | FAERS: 2 | US FAERS | |
| 1292 | Nerve root lesion | FAERS: 2 | US FAERS | |
| 1293 | Neurodermatitis | FAERS: 2 | US FAERS | |
| 1294 | Neurological examination abnormal | FAERS: 2 | US FAERS | |
| 1295 | Neurological eyelid disorder | FAERS: 2 | US FAERS | |
| 1296 | Nocturia | FAERS: 2 | US FAERS | |
| 1297 | Ocular Hypertension | FAERS: 2 | US FAERS | |
| 1298 | Ocular icterus | FAERS: 2 | US FAERS | |
| 1299 | Olfactory Nerve Disorder | FAERS: 2 | US FAERS | |
| 1300 | Ophthalmoplegia | FAERS: 2 | 12149069 | CTD US FAERS |
| 1301 | Oppositional Defiant Disorder | FAERS: 2 | US FAERS | |
| 1302 | Optic nerve cup/disc ratio increased | FAERS: 2 | US FAERS | |
| 1303 | Orgasmic sensation decreased | FAERS: 2 | US FAERS | |
| 1304 | Oropharyngeal blistering | FAERS: 2 | US FAERS | |
| 1305 | Orthodontic procedure | FAERS: 2 | US FAERS | |
| 1306 | Ovarian Rupture | FAERS: 2 | US FAERS | |
| 1307 | Ovarian adenoma | FAERS: 2 | US FAERS | |
| 1308 | Pancreatic Pseudocyst | FAERS: 2 | US FAERS | |
| 1309 | Papilloma | FAERS: 2 | US FAERS | |
| 1310 | Paradoxical drug reaction | FAERS: 2 | US FAERS | |
| 1311 | Parent-child problem | FAERS: 2 | US FAERS | |
| 1312 | Paternal exposure timing unspecified | FAERS: 2 | US FAERS | |
| 1313 | Pelvic venous thrombosis | FAERS: 2 | US FAERS | |
| 1314 | Penile size reduced | FAERS: 2 | US FAERS | |
| 1315 | Perineal operation | FAERS: 2 | US FAERS | |
| 1316 | Phonophobia | FAERS: 2 | US FAERS | |
| 1317 | Physical disability | FAERS: 2 | US FAERS | |
| 1318 | Pilonidal sinus repair | FAERS: 2 | US FAERS | |
| 1319 | Pityriasis Rosea | FAERS: 2 | US FAERS | |
| 1320 | Poor quality product administered | FAERS: 2 | US FAERS | |
| 1321 | Post procedural infection | FAERS: 2 | US FAERS | |
| 1322 | Postoperative adhesion | FAERS: 2 | US FAERS | |
| 1323 | Postoperative wound complication | FAERS: 2 | US FAERS | |
| 1324 | Pregnancy test negative | FAERS: 2 | US FAERS | |
| 1325 | Pregnancy with contraceptive patch | FAERS: 2 | US FAERS | |
| 1326 | Premature Menopause | FAERS: 2 | US FAERS | |
| 1327 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 1328 | Prescribed underdose | FAERS: 2 | US FAERS | |
| 1329 | Procedural site reaction | FAERS: 2 | US FAERS | |
| 1330 | Product label issue | FAERS: 2 | US FAERS | |
| 1331 | Prostatic pain | FAERS: 2 | US FAERS | |
| 1332 | Prothrombin level abnormal | FAERS: 2 | US FAERS | |
| 1333 | Prothrombin level decreased | FAERS: 2 | US FAERS | |
| 1334 | Pseudoporphyria | FAERS: 2 | US FAERS | |
| 1335 | Pyuria | FAERS: 2 | US FAERS | |
| 1336 | Rectal spasm | FAERS: 2 | US FAERS | |
| 1337 | Reflux gastritis | FAERS: 2 | US FAERS | |
| 1338 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 1339 | Retinal Vein Occlusion | FAERS: 2 | US FAERS | |
| 1340 | Retroperitoneal abscess | FAERS: 2 | US FAERS | |
| 1341 | Retroperitoneal fibrosis | FAERS: 2 | US FAERS | |
| 1342 | Rhinalgia | FAERS: 2 | US FAERS | |
| 1343 | Rhinitis perennial | FAERS: 2 | US FAERS | |
| 1344 | Rhonchi | FAERS: 2 | US FAERS | |
| 1345 | Rickets | FAERS: 2 | US FAERS | |
| 1346 | Salpingitis | FAERS: 2 | US FAERS | |
| 1347 | Sarcoidosis | FAERS: 2 | US FAERS | |
| 1348 | Schizoid Personality Disorder | FAERS: 2 | US FAERS | |
| 1349 | Shoulder Dystocia | FAERS: 2 | US FAERS | |
| 1350 | Single umbilical artery | FAERS: 2 | US FAERS | |
| 1351 | Skin Erosion | FAERS: 2 | US FAERS | |
| 1352 | Skin test positive | FAERS: 2 | US FAERS | |
| 1353 | Smoker | FAERS: 2 | US FAERS | |
| 1354 | Soliloquy | FAERS: 2 | US FAERS | |
| 1355 | Splenic Rupture | FAERS: 2 | US FAERS | |
| 1356 | Splinter | FAERS: 2 | US FAERS | |
| 1357 | Spondylolysis | FAERS: 2 | US FAERS | |
| 1358 | Squamous cell carcinoma of skin | FAERS: 2 | US FAERS | |
| 1359 | Stitch abscess | FAERS: 2 | US FAERS | |
| 1360 | Stoma site reaction | FAERS: 2 | US FAERS | |
| 1361 | Subcutaneous Emphysema | FAERS: 2 | US FAERS | |
| 1362 | Surgical failure | FAERS: 2 | US FAERS | |
| 1363 | Systemic lupus erythematosus rash | FAERS: 2 | US FAERS | |
| 1364 | Systolic hypertension | FAERS: 2 | US FAERS | |
| 1365 | Tattoo | FAERS: 2 | US FAERS | |
| 1366 | Teeth brittle | FAERS: 2 | US FAERS | |
| 1367 | Throat clearing | FAERS: 2 | US FAERS | |
| 1368 | Thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 1369 | Tooth Extraction | FAERS: 2 | US FAERS | |
| 1370 | Tooth Resorption | FAERS: 2 | US FAERS | |
| 1371 | Total cholesterol/HDL ratio decreased | FAERS: 2 | US FAERS | |
| 1372 | Transaminases abnormal | FAERS: 2 | US FAERS | |
| 1373 | Transfusion Reaction | FAERS: 2 | US FAERS | |
| 1374 | Unmasking of previously unidentified disease | FAERS: 2 | US FAERS | |
| 1375 | Upper-airway cough syndrome | FAERS: 2 | US FAERS | |
| 1376 | Urethral discharge | FAERS: 2 | US FAERS | |
| 1377 | Urethroperineal fistula | FAERS: 2 | US FAERS | |
| 1378 | Urinary hesitation | FAERS: 2 | US FAERS | |
| 1379 | Urine flow decreased | FAERS: 2 | US FAERS | |
| 1380 | Urobilin urine present | FAERS: 2 | US FAERS | |
| 1381 | Uterine contractions during pregnancy | FAERS: 2 | US FAERS | |
| 1382 | Uvulitis | FAERS: 2 | US FAERS | |
| 1383 | Vaginal abscess | FAERS: 2 | US FAERS | |
| 1384 | Vaginal pain | FAERS: 2 | US FAERS | |
| 1385 | Varicella virus test positive | FAERS: 2 | US FAERS | |
| 1386 | Vascular occlusion | FAERS: 2 | US FAERS | |
| 1387 | Vascular rupture | FAERS: 2 | US FAERS | |
| 1388 | Vasculitic rash | FAERS: 2 | US FAERS | |
| 1389 | Vasculitis gastrointestinal | FAERS: 2 | US FAERS | |
| 1390 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 1391 | Venous occlusion | FAERS: 2 | US FAERS | |
| 1392 | Very low density lipoprotein increased | FAERS: 2 | US FAERS | |
| 1393 | Victim of spousal abuse | FAERS: 2 | US FAERS | |
| 1394 | Viral load increased | FAERS: 2 | US FAERS | |
| 1395 | Vitreous Detachment | FAERS: 2 | US FAERS | |
| 1396 | Vulvitis | FAERS: 2 | US FAERS | |
| 1397 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 1398 | White blood cells stool positive | FAERS: 2 | US FAERS | |
| 1399 | colonoscopy | FAERS: 2 | US FAERS | |
| 1400 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 1401 | Abdominal mass | FAERS: 1 | US FAERS | |
| 1402 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 1403 | Abnormal clotting factor | FAERS: 1 | US FAERS | |
| 1404 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 1405 | Abscess soft tissue | FAERS: 1 | US FAERS | |
| 1406 | Acanthosis | FAERS: 1 | US FAERS | |
| 1407 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 1408 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 1409 | Acid fast stain positive | FAERS: 1 | US FAERS | |
| 1410 | Acidosis | FAERS: 1 | US FAERS | |
| 1411 | Adjustment disorder with depressed mood | FAERS: 1 | US FAERS | |
| 1412 | Adnexa uteri cyst | FAERS: 1 | US FAERS | |
| 1413 | Adnexa uteri pain | FAERS: 1 | US FAERS | |
| 1414 | Agoraphobia | FAERS: 1 | US FAERS | |
| 1415 | Albumin globulin ratio decreased | FAERS: 1 | US FAERS | |
| 1416 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 1417 | Aldolase increased | FAERS: 1 | US FAERS | |
| 1418 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 1419 | Allergy test positive | FAERS: 1 | US FAERS | |
| 1420 | Allergy to animal | FAERS: 1 | US FAERS | |
| 1421 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 1422 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 1423 | Amaurosis Fugax | FAERS: 1 | US FAERS | |
| 1424 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 1425 | Amylase increased | FAERS: 1 | US FAERS | |
| 1426 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 1427 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 1428 | Anaplastic large cell lymphoma T- and null-cell types | FAERS: 1 | US FAERS | |
| 1429 | Anastomotic ulcer | FAERS: 1 | US FAERS | |
| 1430 | Androgenetic Alopecia | FAERS: 1 | US FAERS | |
| 1431 | Anembryonic gestation | FAERS: 1 | US FAERS | |
| 1432 | Angiokeratoma | FAERS: 1 | US FAERS | |
| 1433 | Angiomyolipoma | FAERS: 1 | US FAERS | |
| 1434 | Aniridia | FAERS: 1 | US FAERS | |
| 1435 | Anisocytosis | FAERS: 1 | US FAERS | |
| 1436 | Anogenital dysplasia | FAERS: 1 | US FAERS | |
| 1437 | Anorectal cellulitis | FAERS: 1 | US FAERS | |
| 1438 | Antibody test abnormal | FAERS: 1 | US FAERS | |
| 1439 | Antibody test positive | FAERS: 1 | US FAERS | |
| 1440 | Antiphospholipid Antibodies | FAERS: 1 | US FAERS | |
| 1441 | Antiphospholipid Syndrome | FAERS: 1 | US FAERS | |
| 1442 | Antiphospholipid antibodies positive | FAERS: 1 | US FAERS | |
| 1443 | Antisynthetase syndrome | FAERS: 1 | US FAERS | |
| 1444 | Apparent death | FAERS: 1 | US FAERS | |
| 1445 | Appendicitis noninfective | FAERS: 1 | US FAERS | |
| 1446 | Aquagenic pruritus | FAERS: 1 | US FAERS | |
| 1447 | Aqueductal Stenosis | FAERS: 1 | US FAERS | |
| 1448 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 1449 | Arthroscopy | FAERS: 1 | US FAERS | |
| 1450 | Ascariasis | FAERS: 1 | US FAERS | |
| 1451 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 1452 | Aspermia | FAERS: 1 | US FAERS | |
| 1453 | Asthenopia | FAERS: 1 | US FAERS | |
| 1454 | Atherosclerosis | FAERS: 1 | US FAERS | |
| 1455 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 1456 | Atrioventricular Septal Defect | FAERS: 1 | US FAERS | |
| 1457 | Aura | FAERS: 1 | US FAERS | |
| 1458 | Autoimmune Pancreatitis | FAERS: 1 | US FAERS | |
| 1459 | Autophobia | FAERS: 1 | US FAERS | |
| 1460 | B-lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 1461 | Bacteria blood identified | FAERS: 1 | US FAERS | |
| 1462 | Bacteriuria | FAERS: 1 | US FAERS | |
| 1463 | Bankruptcy | FAERS: 1 | US FAERS | |
| 1464 | Belligerence | FAERS: 1 | US FAERS | |
| 1465 | Benign bone neoplasm | FAERS: 1 | US FAERS | |
| 1466 | Benign neoplasm of testis | FAERS: 1 | US FAERS | |
| 1467 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 1468 | Biloma | FAERS: 1 | US FAERS | |
| 1469 | Binge Drinking | FAERS: 1 | US FAERS | |
| 1470 | Biopsy rectum abnormal | FAERS: 1 | US FAERS | |
| 1471 | Biopsy site unspecified abnormal | FAERS: 1 | US FAERS | |
| 1472 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 1473 | Blister rupture | FAERS: 1 | US FAERS | |
| 1474 | Blood albumin abnormal | FAERS: 1 | US FAERS | |
| 1475 | Blood alkaline phosphatase | FAERS: 1 | US FAERS | |
| 1476 | Blood amylase decreased | FAERS: 1 | US FAERS | |
| 1477 | Blood bilirubin decreased | FAERS: 1 | US FAERS | |
| 1478 | Blood calcium abnormal | FAERS: 1 | US FAERS | |
| 1479 | Blood cholesterol normal | FAERS: 1 | US FAERS | |
| 1480 | Blood cortisol increased | FAERS: 1 | US FAERS | |
| 1481 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 1482 | Blood creatine phosphokinase abnormal | FAERS: 1 | US FAERS | |
| 1483 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 1484 | Blood erythropoietin increased | FAERS: 1 | US FAERS | |
| 1485 | Blood folate decreased | FAERS: 1 | US FAERS | |
| 1486 | Blood follicle stimulating hormone increased | FAERS: 1 | US FAERS | |
| 1487 | Blood homocysteine increased | FAERS: 1 | US FAERS | |
| 1488 | Blood human chorionic gonadotropin positive | FAERS: 1 | US FAERS | |
| 1489 | Blood immunoglobulin M increased | FAERS: 1 | US FAERS | |
| 1490 | Blood ketone body | FAERS: 1 | US FAERS | |
| 1491 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 1492 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 1493 | Blood parathyroid hormone decreased | FAERS: 1 | US FAERS | |
| 1494 | Blood testosterone increased | FAERS: 1 | US FAERS | |
| 1495 | Blood urea nitrogen/creatinine ratio decreased | FAERS: 1 | US FAERS | |
| 1496 | Body fat disorder | FAERS: 1 | US FAERS | |
| 1497 | Bone Tuberculosis | FAERS: 1 | US FAERS | |
| 1498 | Boredom | FAERS: 1 | US FAERS | |
| 1499 | Brachycephaly | FAERS: 1 | US FAERS | |
| 1500 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 1501 | Brain Contusion | FAERS: 1 | US FAERS | |
| 1502 | Brain Stem Glioma | FAERS: 1 | US FAERS | |
| 1503 | Breast cancer stage II | FAERS: 1 | US FAERS | |
| 1504 | Breath alcohol test positive | FAERS: 1 | US FAERS | |
| 1505 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 1506 | Bronchopleural Fistula | FAERS: 1 | US FAERS | |
| 1507 | Bunion | FAERS: 1 | US FAERS | |
| 1508 | CD8 lymphocytes decreased | FAERS: 1 | US FAERS | |
| 1509 | CHARGE Syndrome | FAERS: 1 | US FAERS | |
| 1510 | Cachexia | FAERS: 1 | US FAERS | |
| 1511 | Calcification of muscle | FAERS: 1 | US FAERS | |
| 1512 | Carbon Monoxide Poisoning | FAERS: 1 | US FAERS | |
| 1513 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 1514 | Cardiac Hypertrophy | FAERS: 1 | US FAERS | |
| 1515 | Cardiac valve replacement complication | FAERS: 1 | US FAERS | |
| 1516 | Cardiac ventricular disorder | FAERS: 1 | US FAERS | |
| 1517 | Carotidynia | FAERS: 1 | US FAERS | |
| 1518 | Cataract operation | FAERS: 1 | US FAERS | |
| 1519 | Catheter bacteraemia | FAERS: 1 | US FAERS | |
| 1520 | Catheter related complication | FAERS: 1 | US FAERS | |
| 1521 | Catheter related infection | FAERS: 1 | US FAERS | |
| 1522 | Catheter site pain | FAERS: 1 | US FAERS | |
| 1523 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 1524 | Cerebrospinal fluid retention | FAERS: 1 | US FAERS | |
| 1525 | Cervicitis human papilloma virus | FAERS: 1 | US FAERS | |
| 1526 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 1527 | Change in sustained attention | FAERS: 1 | US FAERS | |
| 1528 | Chemotherapy | FAERS: 1 | US FAERS | |
| 1529 | Chest wall pain | FAERS: 1 | US FAERS | |
| 1530 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 1531 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 1532 | Cholecystostomy | FAERS: 1 | US FAERS | |
| 1533 | Cholestasis | FAERS: 1 | US FAERS | |
| 1534 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 1535 | Chondromalacia | FAERS: 1 | US FAERS | |
| 1536 | Chorea | FAERS: 1 | US FAERS | |
| 1537 | Chorioretinitis | FAERS: 1 | US FAERS | |
| 1538 | Circumstance or information capable of leading to device use error | FAERS: 1 | US FAERS | |
| 1539 | Claustrophobia | FAERS: 1 | US FAERS | |
| 1540 | Clubbing | FAERS: 1 | US FAERS | |
| 1541 | Colitis erosive | FAERS: 1 | US FAERS | |
| 1542 | Comedone | FAERS: 1 | US FAERS | |
| 1543 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 1544 | Congenital brain damage | FAERS: 1 | US FAERS | |
| 1545 | Congenital cerebral cyst | FAERS: 1 | US FAERS | |
| 1546 | Congenital facial nerve hypoplasia | FAERS: 1 | US FAERS | |
| 1547 | Congenital hearing disorder | FAERS: 1 | US FAERS | |
| 1548 | Congenital mitochondrial cytopathy | FAERS: 1 | US FAERS | |
| 1549 | Congenital renal disorder | FAERS: 1 | US FAERS | |
| 1550 | Congenital teratoma | FAERS: 1 | US FAERS | |
| 1551 | Conjunctival irritation | FAERS: 1 | US FAERS | |
| 1552 | Contact lens complication | FAERS: 1 | US FAERS | |
| 1553 | Contact lens intolerance | FAERS: 1 | US FAERS | |
| 1554 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 1555 | Corneal Ulcer | FAERS: 1 | 19831559 | CTD US FAERS |
| 1556 | Corneal cyst | FAERS: 1 | US FAERS | |
| 1557 | Corneal defect | FAERS: 1 | US FAERS | |
| 1558 | Corneal degeneration | FAERS: 1 | US FAERS | |
| 1559 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 1560 | Corneal epithelium defect | FAERS: 1 | US FAERS | |
| 1561 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 1562 | Cubital Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 1563 | Culture positive | FAERS: 1 | US FAERS | |
| 1564 | Cyclic neutropenia | FAERS: 1 | US FAERS | |
| 1565 | Cyst aspiration | FAERS: 1 | US FAERS | |
| 1566 | Cyst removal | FAERS: 1 | US FAERS | |
| 1567 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 1568 | Dacryoadenitis acquired | FAERS: 1 | US FAERS | |
| 1569 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 1570 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 1571 | Dehydroepiandrosterone increased | FAERS: 1 | US FAERS | |
| 1572 | Deja Vu | FAERS: 1 | US FAERS | |
| 1573 | Dental Plaque | FAERS: 1 | US FAERS | |
| 1574 | Dental prosthesis user | FAERS: 1 | US FAERS | |
| 1575 | Dependent Personality Disorder | FAERS: 1 | US FAERS | |
| 1576 | Developmental Coordination Disorder | FAERS: 1 | US FAERS | |
| 1577 | Device occlusion | FAERS: 1 | US FAERS | |
| 1578 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 1579 | Diet refusal | FAERS: 1 | US FAERS | |
| 1580 | Distal ileal obstruction syndrome | FAERS: 1 | US FAERS | |
| 1581 | Drooling | FAERS: 1 | US FAERS | |
| 1582 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 1583 | Drug diversion | FAERS: 1 | US FAERS | |
| 1584 | Drug monitoring procedure incorrectly performed | FAERS: 1 | US FAERS | |
| 1585 | Drug monitoring procedure not performed | FAERS: 1 | US FAERS | |
| 1586 | Drug resistance | FAERS: 1 | US FAERS | |
| 1587 | Dysacusis | FAERS: 1 | US FAERS | |
| 1588 | Echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 1589 | Eczema Herpeticum | FAERS: 1 | US FAERS | |
| 1590 | Electromyogram abnormal | FAERS: 1 | US FAERS | |
| 1591 | Elevated mood | FAERS: 1 | US FAERS | |
| 1592 | Emergency Care | FAERS: 1 | US FAERS | |
| 1593 | Encephalomalacia | FAERS: 1 | US FAERS | |
| 1594 | Encephalomyelitis | FAERS: 1 | US FAERS | |
| 1595 | Endoscopy abnormal | FAERS: 1 | US FAERS | |
| 1596 | Enterobiasis | FAERS: 1 | US FAERS | |
| 1597 | Enuresis | FAERS: 1 | US FAERS | |
| 1598 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 1599 | Epiploic appendagitis | FAERS: 1 | US FAERS | |
| 1600 | Epstein-Barr virus serology positive | FAERS: 1 | US FAERS | |
| 1601 | Erection increased | FAERS: 1 | US FAERS | |
| 1602 | Erythema Infectiosum | FAERS: 1 | US FAERS | |
| 1603 | Erythromelalgia | FAERS: 1 | US FAERS | |
| 1604 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 1605 | Exertional headache | FAERS: 1 | US FAERS | |
| 1606 | Exposure to allergen | FAERS: 1 | US FAERS | |
| 1607 | Exposure to chemical pollution | FAERS: 1 | US FAERS | |
| 1608 | Exposure via ingestion | FAERS: 1 | US FAERS | |
| 1609 | Extravasation | FAERS: 1 | US FAERS | |
| 1610 | Eye Burns | FAERS: 1 | US FAERS | |
| 1611 | Eye allergy | FAERS: 1 | US FAERS | |
| 1612 | Eye laser surgery | FAERS: 1 | US FAERS | |
| 1613 | Eye muscle operation | FAERS: 1 | US FAERS | |
| 1614 | Eyelid infection | FAERS: 1 | US FAERS | |
| 1615 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 1616 | Eyelid rash | FAERS: 1 | US FAERS | |
| 1617 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 1618 | Facial Neuralgia | FAERS: 1 | US FAERS | |
| 1619 | False positive tuberculosis test | FAERS: 1 | US FAERS | |
| 1620 | Fasciitis | FAERS: 1 | US FAERS | |
| 1621 | Fight in school | FAERS: 1 | US FAERS | |
| 1622 | Fingerprint loss | FAERS: 1 | US FAERS | |
| 1623 | Fixed eruption | FAERS: 1 | US FAERS | |
| 1624 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 1625 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 1626 | Frostbite | FAERS: 1 | US FAERS | |
| 1627 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 1628 | Fungal rash | FAERS: 1 | US FAERS | |
| 1629 | Fungal test positive | FAERS: 1 | US FAERS | |
| 1630 | Fungus serology test positive | FAERS: 1 | US FAERS | |
| 1631 | Fungus stool identified | FAERS: 1 | US FAERS | |
| 1632 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 1633 | Gastroenteritis helicobacter | FAERS: 1 | US FAERS | |
| 1634 | Gastrointestinal bacterial overgrowth | FAERS: 1 | US FAERS | |
| 1635 | Gastrointestinal disorder postoperative | FAERS: 1 | US FAERS | |
| 1636 | Gastrointestinal dysplasia | FAERS: 1 | US FAERS | |
| 1637 | Gastrointestinal erosion | FAERS: 1 | US FAERS | |
| 1638 | Gastrointestinal mucosal necrosis | FAERS: 1 | US FAERS | |
| 1639 | Gastrointestinal mucositis | FAERS: 1 | US FAERS | |
| 1640 | Gastrointestinal ulcer perforation | FAERS: 1 | US FAERS | |
| 1641 | Gastrooesophageal heterotopia | FAERS: 1 | US FAERS | |
| 1642 | Genital infection viral | FAERS: 1 | US FAERS | |
| 1643 | Genital swelling | FAERS: 1 | US FAERS | |
| 1644 | Gingival discomfort | FAERS: 1 | US FAERS | |
| 1645 | Gingival graft | FAERS: 1 | US FAERS | |
| 1646 | Glossitis | FAERS: 1 | US FAERS | |
| 1647 | Gram stain positive | FAERS: 1 | US FAERS | |
| 1648 | Granulocyte count increased | FAERS: 1 | US FAERS | |
| 1649 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 1650 | Growing pains | FAERS: 1 | US FAERS | |
| 1651 | HELLP Syndrome | FAERS: 1 | US FAERS | |
| 1652 | HLA marker study positive | FAERS: 1 | US FAERS | |
| 1653 | Haptoglobin increased | FAERS: 1 | US FAERS | |
| 1654 | Hepatic enzyme decreased | FAERS: 1 | US FAERS | |
| 1655 | Hepatitis A virus test positive | FAERS: 1 | US FAERS | |
| 1656 | Hepatitis C antibody positive | FAERS: 1 | US FAERS | |
| 1657 | Hepatitis C virus test positive | FAERS: 1 | US FAERS | |
| 1658 | Hepatitis E | FAERS: 1 | US FAERS | |
| 1659 | Hernia obstructive | FAERS: 1 | US FAERS | |
| 1660 | Herpangina | FAERS: 1 | US FAERS | |
| 1661 | Hip swelling | FAERS: 1 | US FAERS | |
| 1662 | Homosexuality | FAERS: 1 | US FAERS | |
| 1663 | Hospice Care | FAERS: 1 | US FAERS | |
| 1664 | Human chorionic gonadotropin positive | FAERS: 1 | US FAERS | |
| 1665 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 1666 | Hypogeusia | FAERS: 1 | US FAERS | |
| 1667 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 1668 | Idiosyncratic drug reaction | FAERS: 1 | US FAERS | |
| 1669 | Ileorectal fistula | FAERS: 1 | US FAERS | |
| 1670 | Immature respiratory system | FAERS: 1 | US FAERS | |
| 1671 | Immunodeficiency congenital | FAERS: 1 | US FAERS | |
| 1672 | Implant site extravasation | FAERS: 1 | US FAERS | |
| 1673 | Implant site rash | FAERS: 1 | US FAERS | |
| 1674 | Implant site reaction | FAERS: 1 | US FAERS | |
| 1675 | Inadequate lubrication | FAERS: 1 | US FAERS | |
| 1676 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 1677 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 1678 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 1679 | Inguinal mass | FAERS: 1 | US FAERS | |
| 1680 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 1681 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 1682 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 1683 | Intercepted product dispensing error | FAERS: 1 | US FAERS | |
| 1684 | Intercepted product storage error | FAERS: 1 | US FAERS | |
| 1685 | Intestinal anastomotic leak | FAERS: 1 | US FAERS | |
| 1686 | Intestinal ulcer perforation | FAERS: 1 | US FAERS | |
| 1687 | Intestinal villi atrophy | FAERS: 1 | US FAERS | |
| 1688 | Intrusive thoughts | FAERS: 1 | US FAERS | |
| 1689 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 1690 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 1691 | Jejunal ulcer | FAERS: 1 | US FAERS | |
| 1692 | Keratosis pilaris | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1693 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 1694 | Klebsiella sepsis | FAERS: 1 | US FAERS | |
| 1695 | LDL/HDL ratio increased | FAERS: 1 | US FAERS | |
| 1696 | Lactose tolerance test abnormal | FAERS: 1 | US FAERS | |
| 1697 | Laser Therapy | FAERS: 1 | US FAERS | |
| 1698 | Latent Autoimmune Diabetes in Adults | FAERS: 1 | US FAERS | |
| 1699 | Laxative supportive care | FAERS: 1 | US FAERS | |
| 1700 | Leiomyosarcoma recurrent | FAERS: 1 | US FAERS | |
| 1701 | Leptospirosis | FAERS: 1 | US FAERS | |
| 1702 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 1703 | Ligament pain | FAERS: 1 | US FAERS | |
| 1704 | Ligamentitis | FAERS: 1 | US FAERS | |
| 1705 | Limb crushing injury | FAERS: 1 | US FAERS | |
| 1706 | Limb mass | FAERS: 1 | US FAERS | |
| 1707 | Lip Infection | FAERS: 1 | US FAERS | |
| 1708 | Lip erythema | FAERS: 1 | US FAERS | |
| 1709 | Lipase decreased | FAERS: 1 | US FAERS | |
| 1710 | Lordosis | FAERS: 1 | US FAERS | |
| 1711 | Low density lipoprotein abnormal | FAERS: 1 | US FAERS | |
| 1712 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 1713 | Lung hyperinflation | FAERS: 1 | US FAERS | |
| 1714 | Lymphangitis | FAERS: 1 | US FAERS | |
| 1715 | Macular degeneration | FAERS: 1 | US FAERS | |
| 1716 | Male Contraception | FAERS: 1 | US FAERS | |
| 1717 | Manufacturing production issue | FAERS: 1 | US FAERS | |
| 1718 | Maternal exposure during delivery | FAERS: 1 | US FAERS | |
| 1719 | May-Thurner Syndrome | FAERS: 1 | US FAERS | |
| 1720 | Meconium increased | FAERS: 1 | US FAERS | |
| 1721 | Medication residue | FAERS: 1 | US FAERS | |
| 1722 | Mental Retardation | FAERS: 1 | US FAERS | |
| 1723 | Mental disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 1724 | Mesenteric Panniculitis | FAERS: 1 | US FAERS | |
| 1725 | Microcytosis | FAERS: 1 | US FAERS | |
| 1726 | Micrographia | FAERS: 1 | US FAERS | |
| 1727 | Micrographic skin surgery | FAERS: 1 | US FAERS | |
| 1728 | Mixed liver injury | FAERS: 1 | US FAERS | |
| 1729 | Mononucleosis heterophile test | FAERS: 1 | US FAERS | |
| 1730 | Monoparesis | FAERS: 1 | US FAERS | |
| 1731 | Mood disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 1732 | Motion Sickness | FAERS: 1 | US FAERS | |
| 1733 | Mouth cyst | FAERS: 1 | US FAERS | |
| 1734 | Mucosal atrophy | FAERS: 1 | US FAERS | |
| 1735 | Mucosal erosion | FAERS: 1 | US FAERS | |
| 1736 | Multiple Myeloma | FAERS: 1 | US FAERS | |
| 1737 | Mumps | FAERS: 1 | US FAERS | |
| 1738 | Muscular Dystrophy | FAERS: 1 | US FAERS | |
| 1739 | Mycobacterium tuberculosis complex test positive | FAERS: 1 | US FAERS | |
| 1740 | Mycoplasma test positive | FAERS: 1 | US FAERS | |
| 1741 | Myocardial strain | FAERS: 1 | US FAERS | |
| 1742 | Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 1743 | Nail bed infection | FAERS: 1 | US FAERS | |
| 1744 | Narcolepsy | FAERS: 1 | US FAERS | |
| 1745 | Narcotic intoxication | FAERS: 1 | US FAERS | |
| 1746 | Nasal sinus drainage | FAERS: 1 | US FAERS | |
| 1747 | Neonatal hypotension | FAERS: 1 | US FAERS | |
| 1748 | Nephrocalcinosis | FAERS: 1 | US FAERS | |
| 1749 | Nerve stimulation test abnormal | FAERS: 1 | US FAERS | |
| 1750 | Neuropsychological test abnormal | FAERS: 1 | US FAERS | |
| 1751 | Nodding of head | FAERS: 1 | US FAERS | |
| 1752 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 1753 | Obsessive-compulsive symptom | FAERS: 1 | US FAERS | |
| 1754 | Ocular Toxicity | FAERS: 1 | US FAERS | |
| 1755 | Oculomotor study abnormal | FAERS: 1 | US FAERS | |
| 1756 | Onycholysis | FAERS: 1 | US FAERS | |
| 1757 | Oocyte donor | FAERS: 1 | US FAERS | |
| 1758 | Open wound | FAERS: 1 | US FAERS | |
| 1759 | Opiates positive | FAERS: 1 | US FAERS | |
| 1760 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 1761 | Optic Nerve Hypoplasia | FAERS: 1 | US FAERS | |
| 1762 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 1763 | Oral viral infection | FAERS: 1 | US FAERS | |
| 1764 | Oropharyngeal candidiasis | FAERS: 1 | US FAERS | |
| 1765 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 1766 | Osteosclerosis | FAERS: 1 | US FAERS | |
| 1767 | Ototoxicity | FAERS: 1 | US FAERS | |
| 1768 | Ovarian enlargement | FAERS: 1 | US FAERS | |
| 1769 | Overweight | FAERS: 1 | US FAERS | |
| 1770 | Pacemaker complication | FAERS: 1 | US FAERS | |
| 1771 | Palatal operation | FAERS: 1 | US FAERS | |
| 1772 | Palmar erythema | FAERS: 1 | US FAERS | |
| 1773 | Pancreas divisum | FAERS: 1 | US FAERS | |
| 1774 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 1775 | Pancreatic enlargement | FAERS: 1 | US FAERS | |
| 1776 | Panic disorder without agoraphobia | FAERS: 1 | US FAERS | |
| 1777 | Papillophlebitis | FAERS: 1 | US FAERS | |
| 1778 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 1779 | Parapsoriasis | FAERS: 1 | US FAERS | |
| 1780 | Parasite blood test positive | FAERS: 1 | US FAERS | |
| 1781 | Parotid abscess | FAERS: 1 | US FAERS | |
| 1782 | Parotitis | FAERS: 1 | US FAERS | |
| 1783 | Pathological fracture | FAERS: 1 | US FAERS | |
| 1784 | Patient-device incompatibility | FAERS: 1 | US FAERS | |
| 1785 | Pelvic fluid collection | FAERS: 1 | US FAERS | |
| 1786 | Pemphigus | FAERS: 1 | US FAERS | |
| 1787 | Penicilliosis | FAERS: 1 | US FAERS | |
| 1788 | Penile erythema | FAERS: 1 | US FAERS | |
| 1789 | Perianal fungal infection | FAERS: 1 | US FAERS | |
| 1790 | Perineal pain | FAERS: 1 | US FAERS | |
| 1791 | Periodontitis | FAERS: 1 | US FAERS | |
| 1792 | Perioral Dermatitis | FAERS: 1 | US FAERS | |
| 1793 | Periostitis | FAERS: 1 | US FAERS | |
| 1794 | Peripheral artery thrombosis | FAERS: 1 | US FAERS | |
| 1795 | Peritoneal Infection | FAERS: 1 | US FAERS | |
| 1796 | Pertussis | FAERS: 1 | US FAERS | |
| 1797 | Pharyngolaryngeal abscess | FAERS: 1 | US FAERS | |
| 1798 | Phenylalanine screen positive | FAERS: 1 | US FAERS | |
| 1799 | Physical product label issue | FAERS: 1 | US FAERS | |
| 1800 | Pityriasis Rubra Pilaris | FAERS: 1 | US FAERS | |
| 1801 | Plasmacytosis | FAERS: 1 | US FAERS | |
| 1802 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 1803 | Pleural Infection | FAERS: 1 | US FAERS | |
| 1804 | Pneumocephalus | FAERS: 1 | US FAERS | |
| 1805 | Poikilocytosis | FAERS: 1 | US FAERS | |
| 1806 | Polyarteritis Nodosa | FAERS: 1 | US FAERS | |
| 1807 | Polymyositis | FAERS: 1 | US FAERS | |
| 1808 | Poor personal hygiene | FAERS: 1 | US FAERS | |
| 1809 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 1810 | Poor sucking reflex | FAERS: 1 | US FAERS | |
| 1811 | Poor weight gain neonatal | FAERS: 1 | US FAERS | |
| 1812 | Porencephaly | FAERS: 1 | US FAERS | |
| 1813 | Porphyria non-acute | FAERS: 1 | US FAERS | |
| 1814 | Portal hypertensive gastropathy | FAERS: 1 | US FAERS | |
| 1815 | Post procedural urine leak | FAERS: 1 | US FAERS | |
| 1816 | Post-Traumatic Headache | FAERS: 1 | US FAERS | |
| 1817 | Post-traumatic neck syndrome | FAERS: 1 | US FAERS | |
| 1818 | Postoperative stitch sinus | FAERS: 1 | US FAERS | |
| 1819 | Postural Orthostatic Tachycardia Syndrome | FAERS: 1 | US FAERS | |
| 1820 | Pregnancy after post coital contraception | FAERS: 1 | US FAERS | |
| 1821 | Pregnancy with implant contraceptive | FAERS: 1 | US FAERS | |
| 1822 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 1823 | Procedural vomiting | FAERS: 1 | US FAERS | |
| 1824 | Proctocolectomy | FAERS: 1 | US FAERS | |
| 1825 | Product administration interrupted | FAERS: 1 | US FAERS | |
| 1826 | Product availability issue | FAERS: 1 | US FAERS | |
| 1827 | Product commingling | FAERS: 1 | US FAERS | |
| 1828 | Product counterfeit | FAERS: 1 | US FAERS | |
| 1829 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 1830 | Product intolerance | FAERS: 1 | US FAERS | |
| 1831 | Product leakage | FAERS: 1 | US FAERS | |
| 1832 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 1833 | Prostatic specific antigen decreased | FAERS: 1 | US FAERS | |
| 1834 | Protein C increased | FAERS: 1 | US FAERS | |
| 1835 | Protein S Deficiency | FAERS: 1 | US FAERS | |
| 1836 | Proteus test positive | FAERS: 1 | US FAERS | |
| 1837 | Prothrombin time abnormal | FAERS: 1 | US FAERS | |
| 1838 | Pseudolymphoma | FAERS: 1 | US FAERS | |
| 1839 | Pseudomonas test positive | FAERS: 1 | US FAERS | |
| 1840 | Pseudomyopia | FAERS: 1 | US FAERS | |
| 1841 | Psoas sign | FAERS: 1 | US FAERS | |
| 1842 | Psychiatric evaluation | FAERS: 1 | US FAERS | |
| 1843 | Psychological abuse | FAERS: 1 | US FAERS | |
| 1844 | Pubic pain | FAERS: 1 | US FAERS | |
| 1845 | Pulmonary granuloma | FAERS: 1 | US FAERS | |
| 1846 | Puncture site reaction | FAERS: 1 | US FAERS | |
| 1847 | Pus in stool | FAERS: 1 | US FAERS | |
| 1848 | Pyelocaliectasis | FAERS: 1 | US FAERS | |
| 1849 | Quadriparesis | FAERS: 1 | US FAERS | |
| 1850 | Rash scaly | FAERS: 1 | US FAERS | |
| 1851 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 1852 | Rebound effect | FAERS: 1 | US FAERS | |
| 1853 | Rectal cramps | FAERS: 1 | US FAERS | |
| 1854 | Rectovaginal septum abscess | FAERS: 1 | US FAERS | |
| 1855 | Red cell distribution width decreased | FAERS: 1 | US FAERS | |
| 1856 | Reflex Sympathetic Dystrophy | FAERS: 1 | US FAERS | |
| 1857 | Renal interstitial fibrosis | FAERS: 1 | US FAERS | |
| 1858 | Renal tubular atrophy | FAERS: 1 | US FAERS | |
| 1859 | Residual ovary syndrome | FAERS: 1 | US FAERS | |
| 1860 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 1861 | Respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 1862 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 1863 | Retinal Vasculitis | FAERS: 1 | US FAERS | |
| 1864 | Retinal migraine | FAERS: 1 | US FAERS | |
| 1865 | Retinitis Pigmentosa | FAERS: 1 | US FAERS | |
| 1866 | Rhabdomyosarcoma | FAERS: 1 | US FAERS | |
| 1867 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 1868 | Rocky Mountain Spotted Fever | FAERS: 1 | US FAERS | |
| 1869 | Sacral pain | FAERS: 1 | US FAERS | |
| 1870 | Sadism | FAERS: 1 | US FAERS | |
| 1871 | Salivary gland pain | FAERS: 1 | US FAERS | |
| 1872 | Salpingectomy | FAERS: 1 | US FAERS | |
| 1873 | Sarcoma | FAERS: 1 | US FAERS | |
| 1874 | Scarlet Fever | FAERS: 1 | US FAERS | |
| 1875 | Scrotal Infection | FAERS: 1 | US FAERS | |
| 1876 | Scrotal mass | FAERS: 1 | US FAERS | |
| 1877 | Seasonal Affective Disorder | FAERS: 1 | US FAERS | |
| 1878 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 1879 | Self-induced vomiting | FAERS: 1 | US FAERS | |
| 1880 | Semen abnormal | FAERS: 1 | US FAERS | |
| 1881 | Semen volume abnormal | FAERS: 1 | US FAERS | |
| 1882 | Semen volume decreased | FAERS: 1 | US FAERS | |
| 1883 | Semen volume increased | FAERS: 1 | US FAERS | |
| 1884 | Sensation of blood flow | FAERS: 1 | US FAERS | |
| 1885 | Septic arthritis staphylococcal | FAERS: 1 | US FAERS | |
| 1886 | Seronegative arthritis | FAERS: 1 | US FAERS | |
| 1887 | Shone complex | FAERS: 1 | US FAERS | |
| 1888 | Sicca Syndrome | FAERS: 1 | US FAERS | |
| 1889 | Sigmoidoscopy abnormal | FAERS: 1 | US FAERS | |
| 1890 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 1891 | Simple Partial Seizures | FAERS: 1 | US FAERS | |
| 1892 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 1893 | Sleep Talking | FAERS: 1 | US FAERS | |
| 1894 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 1895 | Small intestinal bacterial overgrowth | FAERS: 1 | US FAERS | |
| 1896 | Soft tissue inflammation | FAERS: 1 | US FAERS | |
| 1897 | Solar lentigo | FAERS: 1 | US FAERS | |
| 1898 | Somatoform disorder pregnancy | FAERS: 1 | US FAERS | |
| 1899 | Somnambulism | FAERS: 1 | US FAERS | |
| 1900 | Sperm concentration decreased | FAERS: 1 | US FAERS | |
| 1901 | Spermatozoa abnormal | FAERS: 1 | US FAERS | |
| 1902 | Spermatozoa morphology abnormal | FAERS: 1 | US FAERS | |
| 1903 | Sphincter of Oddi Dysfunction | FAERS: 1 | US FAERS | |
| 1904 | Splenectomy | FAERS: 1 | US FAERS | |
| 1905 | Splenitis | FAERS: 1 | US FAERS | |
| 1906 | Sputum retention | FAERS: 1 | US FAERS | |
| 1907 | Staphylococcal pharyngitis | FAERS: 1 | US FAERS | |
| 1908 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 1909 | Stenotrophomonas infection | FAERS: 1 | US FAERS | |
| 1910 | Stoma site abscess | FAERS: 1 | US FAERS | |
| 1911 | Streptococcal abscess | FAERS: 1 | US FAERS | |
| 1912 | Subcutaneous nodule | FAERS: 1 | US FAERS | |
| 1913 | Subileus | FAERS: 1 | US FAERS | |
| 1914 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 1915 | Superficial injury of eye | FAERS: 1 | US FAERS | |
| 1916 | Superficial vein prominence | FAERS: 1 | US FAERS | |
| 1917 | Superinfection | FAERS: 1 | US FAERS | |
| 1918 | Suture insertion | FAERS: 1 | US FAERS | |
| 1919 | T-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 1920 | Temperature regulation disorder | FAERS: 1 | US FAERS | |
| 1921 | Thalamic infarction | FAERS: 1 | US FAERS | |
| 1922 | Thelitis | FAERS: 1 | US FAERS | |
| 1923 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 1924 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 1925 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 1926 | Therapy change | FAERS: 1 | US FAERS | |
| 1927 | Therapy naive | FAERS: 1 | US FAERS | |
| 1928 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 1929 | Throat cancer | FAERS: 1 | US FAERS | |
| 1930 | Tongue blistering | FAERS: 1 | US FAERS | |
| 1931 | Tooth repair | FAERS: 1 | US FAERS | |
| 1932 | Total cholesterol/HDL ratio abnormal | FAERS: 1 | US FAERS | |
| 1933 | Toxic Shock Syndrome | FAERS: 1 | US FAERS | |
| 1934 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 1935 | Toxoplasmosis | FAERS: 1 | US FAERS | |
| 1936 | Tracheobronchitis | FAERS: 1 | US FAERS | |
| 1937 | Transcription medication error | FAERS: 1 | US FAERS | |
| 1938 | Transferrin decreased | FAERS: 1 | US FAERS | |
| 1939 | Transgender operation | FAERS: 1 | US FAERS | |
| 1940 | Transplant | FAERS: 1 | US FAERS | |
| 1941 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 1942 | Typhoid Fever | FAERS: 1 | US FAERS | |
| 1943 | Ultrasound liver abnormal | FAERS: 1 | US FAERS | |
| 1944 | Umbilical malformation | FAERS: 1 | US FAERS | |
| 1945 | Unevaluable investigation | FAERS: 1 | US FAERS | |
| 1946 | Ureterolithiasis | FAERS: 1 | US FAERS | |
| 1947 | Urethral atrophy | FAERS: 1 | US FAERS | |
| 1948 | Urethral fistula | FAERS: 1 | US FAERS | |
| 1949 | Urge Incontinence | FAERS: 1 | US FAERS | |
| 1950 | Urinary casts present | FAERS: 1 | US FAERS | |
| 1951 | Urinary sediment present | FAERS: 1 | US FAERS | |
| 1952 | Urinary tract infection enterococcal | FAERS: 1 | US FAERS | |
| 1953 | Urine calcium increased | FAERS: 1 | US FAERS | |
| 1954 | Urine electrophoresis abnormal | FAERS: 1 | US FAERS | |
| 1955 | Uterine Prolapse | FAERS: 1 | US FAERS | |
| 1956 | Uterine cervix hypoplasia | FAERS: 1 | US FAERS | |
| 1957 | Uterine cervix ulcer | FAERS: 1 | US FAERS | |
| 1958 | Varicose vein operation | FAERS: 1 | US FAERS | |
| 1959 | Venous stasis | FAERS: 1 | US FAERS | |
| 1960 | Violent ideation | FAERS: 1 | US FAERS | |
| 1961 | Viral test positive | FAERS: 1 | US FAERS | |
| 1962 | Viral vasculitis | FAERS: 1 | US FAERS | |
| 1963 | Vital dye staining cornea present | FAERS: 1 | US FAERS | |
| 1964 | Vitamin A Deficiency | FAERS: 1 | US FAERS | |
| 1965 | Vitreous opacities | FAERS: 1 | US FAERS | |
| 1966 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 1967 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 1968 | Walking aid user | FAERS: 1 | US FAERS | |
| 1969 | Wart excision | FAERS: 1 | US FAERS | |
| 1970 | Weight | FAERS: 1 | US FAERS | |
| 1971 | Wound necrosis | FAERS: 1 | US FAERS | |
| 1972 | Wrong schedule | FAERS: 1 | US FAERS | |
| 1973 | effusion | FAERS: 1 | US FAERS | |
| 1974 | fibroma | FAERS: 1 | US FAERS | |
| 1975 | keratoacanthoma | FAERS: 1 | US FAERS | |
| 1976 | kyphosis | FAERS: 1 | US FAERS | |
| 1977 | ovarian neoplasm | FAERS: 1 | US FAERS | |
| 1978 | streptococcal serology | FAERS: 1 | US FAERS | |
| 1979 | Abnormalities, Drug-Induced | 8048045 12149069 18769834 | CTD | |
| 1980 | Accutane embryopathy | CTD | ||
| 1981 | Acne Vulgaris |
1831820
2039732 2933136 2938008 3157930 6225882 6238241 6591112 7769163 8347155 8655244 8746368 8961893 9330049 9784036 10831665 11464180 12207595 12587200 12622636 12653758 12963905 15204147 15826276 15897376 16185265 16232082 16405632 17062097 17166623 17277875 17286159 17305209 17472998 17501969 17556790 18363422 18769834 19382995 19783054 19950851 20059367 20236286 | CTD | |
| 1982 | Acneiform Eruptions | 16232082 | CTD | |
| 1983 | Anemia | 7707116 | CTD | |
| 1984 | Anti-Neutrophil Cytoplasmic Antibody-Associated Vasculitis | 9085448 | CTD | |
| 1985 | Brain Ischemia | 17472998 | CTD | |
| 1986 | Bundle-Branch Block | 12653758 | CTD | |
| 1987 | Cardiovascular Abnormalities | 2278026 12149069 | CTD | |
| 1988 | Cerebral Hemorrhage | 8571296 | CTD | |
| 1989 | Chemical and Drug Induced Liver Injury | 6591112 10642057 | CTD | |
| 1990 | Cicatrix | 9784036 | CTD | |
| 1991 | Congenital Microtia | 3162101 11105626 | CTD | |
| 1992 | Conjunctival Diseases | 19831559 | CTD | |
| 1993 | Craniofacial Abnormalities | CTD | ||
| 1994 | Depressive disorder | CTD | ||
| 1995 | Disorders of Excessive Somnolence | 15283020 | CTD | |
| 1996 | Dyspnea | 2938008 | CTD | |
| 1997 | Ear Diseases | 2278026 12149069 | CTD | |
| 1998 | Exanthema | 7707116 | CTD | |
| 1999 | Fatty Liver | 2039732 8347155 | CTD | |
| 2000 | Fetal Death | 3162101 | CTD | |
| 2001 | Fever | 2938008 | CTD | |
| 2002 | Hoarseness | 17062097 | CTD | |
| 2003 | Hypercalcemia | CTD | ||
| 2004 | Hyperhomocysteinemia | 20236286 | CTD | |
| 2005 | Hyperlipoproteinemias | 3721869 | CTD | |
| 2006 | Hypertriglyceridemia | 12622636 12643008 | CTD | |
| 2007 | Idiopathic intracranial hypertension with papilledema | 7769163 | CTD | |
| 2008 | Infant, Premature, Diseases | 6591112 | CTD | |
| 2009 | Intracranial Hypertension | 15177980 | CTD | |
| 2010 | Isotretinoin embryopathy like syndrome | 2278026 | CTD | |
| 2011 | Kidney Diseases | 9198075 | CTD | |
| 2012 | Kleine-Levin Syndrome | 20163374 | CTD | |
| 2013 | Lacrimal Apparatus Diseases | 12149069 | CTD | |
| 2014 | Liver neoplasms | 25058030 | CTD | |
| 2015 | Lung Neoplasms | 15899809 | CTD | |
| 2016 | Lung diseases | 2938008 | CTD | |
| 2017 | Macrostomia | 3465061 | CTD | |
| 2018 | Malformations of Cortical Development | 2278026 3465061 | CTD | |
| 2019 | Maxillofacial Abnormalities | 3465061 | CTD | |
| 2020 | Mental disorders | 16406201 | CTD | |
| 2021 | Micrognathism | 3465061 | CTD | |
| 2022 | Microstomia | 3465061 | CTD | |
| 2023 | Mood Disorders | 19783054 | CTD | |
| 2024 | Neoplasms, Experimental | 18380168 | CTD | |
| 2025 | Neoplasms | 8347155 | CTD | |
| 2026 | Neuromuscular Junction Diseases | 3091143 | CTD | |
| 2027 | Olfaction Disorders | 2149010 | CTD | |
| 2028 | Papilledema | 2931989 2973971 7634848 | CTD | |
| 2029 | Photosensitivity Disorders | 2931989 | CTD | |
| 2030 | Precancerous Conditions | 6211233 9093712 | CTD | |
| 2031 | Prenatal Exposure Delayed Effects | 3465061 6237184 18769834 | CTD | |
| 2032 | Product gel formation | Canada Vigilance: 1 | Canada Vigilance | |
| 2033 | Pseudotumor Cerebri | CTD | ||
| 2034 | Psychomotor Disorders | 18769834 | CTD | |
| 2035 | Scleromyxedema | 2050852 | CTD | |
| 2036 | Skin Abnormalities | 8003796 | CTD | |
| 2037 | Skin Neoplasms | 6211233 15225900 | CTD | |
| 2038 | Staphylococcus test positive | Canada Vigilance: 1 | Canada Vigilance | |
| 2039 | Stiff-Person Syndrome | 12398844 | CTD | |
| 2040 | Taste Disorders | 2149010 8746368 | CTD | |
| 2041 | Vision Disorders | 2931989 18528226 | CTD | |
| 2042 | Xerostomia | 17286159 | CTD | |
| 2043 | melanoma | 17237267 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.