Carbamazepine
(FFGPTBGBLSHEPO-UHFFFAOYSA-N)
Structure
- SMILES
- NC(=O)N1c2ccccc2C=Cc2c1cccc2
- Type(s)
- Approved; Investigational
- ATC code(s)
- N03AF01
- Molecular Formula:
- C15H12N2O
- Molecular Weight:
- 236.269
- Log P:
- 4.1525
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 1
- TPSA:
- 46.33
- CAS Number(s):
- 298-46-4
Synonym(s)
1.
Carbamazepine
2.
Amizepine
3.
Carbamazepine Acetate
4.
Carbamazepine Anhydrous
5.
Carbamazepine Dihydrate
6.
Carbamazepine Hydrochloride
7.
Carbamazepine L-Tartrate (4:1)
8.
Carbamazepine Phosphate
9.
Carbamazepine Sulfate (2:1)
10.
Carbazepin
11.
Epitol
12.
Finlepsin
13.
Neurotol
14.
Tegretol
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dizziness | FAERS: 304 Canada Vigilance: 16 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 2 | Stevens-Johnson Syndrome | FAERS: 273 Canada Vigilance: 21 |
1603193
10331832 11837721 15057820 16415921 16538176 18855540 19304774 19694795 19915237 20485159 21428768 21428769 25811541 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 3 | Toxicity to various agents | FAERS: 260 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 4 | Drug ineffective | FAERS: 259 Canada Vigilance: 73 | Canada Vigilance US FAERS | |
| 5 | Maternal exposure during pregnancy | FAERS: 245 | US FAERS | |
| 6 | Overdose | FAERS: 244 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 7 | Somnolence | FAERS: 238 Canada Vigilance: 25 | Canada Vigilance SIDER US FAERS | |
| 8 | Vomiting | FAERS: 233 Canada Vigilance: 20 | CTD SIDER Canada Vigilance US FAERS | |
| 9 | Epilepsy | FAERS: 228 Canada Vigilance: 7 |
821787
1456863 1464298 1471883 1486836 1644161 1893664 2036618 2039260 2289480 2998143 3142761 3395254 3452233 3751517 3977647 6122135 6288881 6415512 6502170 6588711 6811702 7229772 7425577 7715759 7813412 7831181 7881227 7988514 8067500 8162374 8191881 8221706 8398372 8444328 8848816 9003978 9014606 9153479 9160401 9626375 9627208 9650679 9804087 9827229 10371552 10383724 10467277 10669712 10691121 11020128 11507366 11879339 11918515 12352223 14642999 15491979 16103386 16283138 16315636 16675199 17128563 17178248 17465707 17565596 17636003 18182329 18234410 18319016 19369666 19439326 19620853 20417680 22790970 25231249 25745819 28562019 | CTD OFFSIDES Canada Vigilance US FAERS |
| 10 | Drug exposure during pregnancy | FAERS: 216 | US FAERS | |
| 11 | Pruritus | FAERS: 214 Canada Vigilance: 22 | 10369620 | CTD SIDER Canada Vigilance US FAERS |
| 12 | Toxic Epidermal Necrolysis | FAERS: 205 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 13 | Malaise | FAERS: 201 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 14 | Headache | FAERS: 189 Canada Vigilance: 15 | 2362393 7806846 19080105 | CTD SIDER Canada Vigilance US FAERS |
| 15 | Hypersensitivity | FAERS: 185 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 16 | Nausea | FAERS: 179 Canada Vigilance: 20 | 405624 3085769 3691421 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 17 | Pain | FAERS: 169 Canada Vigilance: 7 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 18 | Alanine Aminotransferase Increased | FAERS: 160 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 19 | Erythema | FAERS: 153 Canada Vigilance: 5 | 2362393 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 20 | Suicide attempt | FAERS: 151 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 21 | Aspartate Aminotransferase Increased | FAERS: 143 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 22 | Lymphadenopathy | FAERS: 143 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 23 | Asthenia | FAERS: 139 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 24 | Urticaria | FAERS: 137 Canada Vigilance: 9 | 3824622 8610843 | CTD SIDER Canada Vigilance US FAERS |
| 25 | Fatigue | FAERS: 136 Canada Vigilance: 16 | 3225612 3691421 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 26 | Drug level increased | FAERS: 126 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 27 | Pharmaceutical product complaint | FAERS: 116 | US FAERS | |
| 28 | Anxiety | FAERS: 114 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 29 | Feeling abnormal | FAERS: 109 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 30 | Product substitution issue | FAERS: 108 Canada Vigilance: 33 | Canada Vigilance US FAERS | |
| 31 | Alopecia | FAERS: 102 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 32 | Gamma-Glutamyltransferase Increased | FAERS: 101 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 33 | Skin lesion | FAERS: 89 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 34 | Drug toxicity | FAERS: 87 | OFFSIDES US FAERS | |
| 35 | Eosinophilia | FAERS: 85 Canada Vigilance: 8 | CTD SIDER Canada Vigilance US FAERS | |
| 36 | Swelling | FAERS: 83 | SIDER US FAERS | |
| 37 | Depressed Level of Consciousness | FAERS: 80 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 38 | Tremor | FAERS: 78 Canada Vigilance: 2 | CTD SIDER Canada Vigilance US FAERS | |
| 39 | Memory impairment | FAERS: 77 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 40 | Status Epilepticus | FAERS: 77 Canada Vigilance: 2 | CTD OFFSIDES Canada Vigilance US FAERS | |
| 41 | Thrombocytopenia | FAERS: 77 Canada Vigilance: 16 | CTD SIDER Canada Vigilance US FAERS | |
| 42 | Pneumonia | FAERS: 73 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 43 | Blindness | FAERS: 72 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Blood alkaline phosphatase increased | FAERS: 72 Canada Vigilance: 7 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 45 | Abdominal Pain | FAERS: 71 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 46 | Agitation | FAERS: 68 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 47 | Diplopia | FAERS: 68 Canada Vigilance: 2 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 48 | Anticonvulsant drug level increased | FAERS: 67 | OFFSIDES US FAERS | |
| 49 | Cerebrovascular accident | FAERS: 65 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Hypotension | FAERS: 65 Canada Vigilance: 1 | 7741340 12897634 | CTD SIDER Canada Vigilance US FAERS |
| 51 | White blood cell count decreased | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Altered state of consciousness | FAERS: 63 | OFFSIDES US FAERS | |
| 53 | Syncope | FAERS: 63 Canada Vigilance: 1 | 1148068 3806129 | CTD SIDER Canada Vigilance US FAERS |
| 54 | Therapeutic response unexpected with drug substitution | FAERS: 63 | US FAERS | |
| 55 | Arthralgia | FAERS: 61 Canada Vigilance: 4 | 6462508 | CTD SIDER Canada Vigilance US FAERS |
| 56 | Amnesia | FAERS: 60 | OFFSIDES SIDER US FAERS | |
| 57 | Electroencephalogram abnormal | FAERS: 60 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 58 | Deformity | FAERS: 59 | US FAERS | |
| 59 | Ataxia | FAERS: 57 Canada Vigilance: 5 | CTD SIDER Canada Vigilance US FAERS | |
| 60 | Disability | FAERS: 57 | US FAERS | |
| 61 | Incorrect dose administered | FAERS: 57 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Erythema Multiforme | FAERS: 56 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 63 | Visual Impairment | FAERS: 56 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 64 | Respiratory Failure | FAERS: 55 | OFFSIDES US FAERS | |
| 65 | Blood lactate dehydrogenase increased | FAERS: 54 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 66 | Drug abuse | FAERS: 54 | US FAERS | |
| 67 | Rash erythematous | FAERS: 54 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 68 | Leukopenia | FAERS: 53 Canada Vigilance: 12 | CTD SIDER Canada Vigilance US FAERS | |
| 69 | Neutropenia | FAERS: 53 Canada Vigilance: 5 | 9855327 | CTD Canada Vigilance US FAERS |
| 70 | Sepsis | FAERS: 53 | US FAERS | |
| 71 | Vertigo | FAERS: 53 Canada Vigilance: 5 | 10907977 11197575 12897634 | CTD SIDER Canada Vigilance US FAERS |
| 72 | Anhedonia | FAERS: 52 | OFFSIDES US FAERS | |
| 73 | Human herpes virus 6 serology positive | FAERS: 50 | OFFSIDES US FAERS | |
| 74 | Lip swelling | FAERS: 50 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 75 | Bradycardia | FAERS: 49 | CTD OFFSIDES SIDER US FAERS | |
| 76 | Completed Suicide | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 77 | Dysarthria | FAERS: 49 Canada Vigilance: 2 | 11360270 12897634 | CTD SIDER Canada Vigilance US FAERS |
| 78 | Tachycardia | FAERS: 49 Canada Vigilance: 4 | 11990208 | CTD SIDER Canada Vigilance US FAERS |
| 79 | Accidental overdose | FAERS: 48 Canada Vigilance: 6 | Canada Vigilance OFFSIDES US FAERS | |
| 80 | Drug dispensing error | FAERS: 48 | US FAERS | |
| 81 | Weight decreased | FAERS: 48 | US FAERS | |
| 82 | Chest Pain | FAERS: 47 | 16283138 | CTD SIDER US FAERS |
| 83 | Medication Error | FAERS: 46 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Aphasia | FAERS: 45 Canada Vigilance: 1 | 16116141 | CTD Canada Vigilance US FAERS |
| 85 | Oropharyngeal pain | FAERS: 45 | US FAERS | |
| 86 | Stillbirth | FAERS: 44 | US FAERS | |
| 87 | Chills | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 88 | Drug level decreased | FAERS: 43 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 89 | Trigeminal Neuralgia | FAERS: 41 Canada Vigilance: 2 |
77392
78131 288398 1464298 2027499 3668581 4653892 5552123 6462508 6502170 7055454 8067500 8729227 9810297 16116141 18694452 19224505 19462818 19708228 | CTD Canada Vigilance US FAERS |
| 90 | Lethargy | FAERS: 40 Canada Vigilance: 4 | 7055454 14978727 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 91 | General physical health deterioration | FAERS: 39 | US FAERS | |
| 92 | Hepatitis | FAERS: 39 Canada Vigilance: 9 | 3161347 11431905 22790970 | CTD SIDER Canada Vigilance US FAERS |
| 93 | Internal injury | FAERS: 39 | US FAERS | |
| 94 | nervous system disorder | FAERS: 39 | SIDER US FAERS | |
| 95 | Nystagmus | FAERS: 38 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 96 | Restlessness | FAERS: 38 | US FAERS | |
| 97 | Infection | FAERS: 37 | SIDER US FAERS | |
| 98 | Blood glucose increased | FAERS: 36 | US FAERS | |
| 99 | Angioedema | FAERS: 35 Canada Vigilance: 1 | 11507366 16641839 | CTD SIDER Canada Vigilance US FAERS |
| 100 | Blood sodium decreased | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 101 | Cardiac Arrest | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 102 | Pancytopenia | FAERS: 35 Canada Vigilance: 3 | 2042043 5804525 12897634 | CTD SIDER Canada Vigilance US FAERS |
| 103 | Unresponsive to stimuli | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 104 | Blood creatine phosphokinase increased | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 105 | Leukocytosis | FAERS: 34 Canada Vigilance: 1 | 2327680 | CTD SIDER Canada Vigilance US FAERS |
| 106 | Osteoporosis | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 107 | Product quality issue | FAERS: 34 | US FAERS | |
| 108 | Central nervous system lesion | FAERS: 33 | US FAERS | |
| 109 | Disorientation | FAERS: 32 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 110 | Drug Dependence | FAERS: 32 | US FAERS | |
| 111 | Myoclonus | FAERS: 32 Canada Vigilance: 2 | CTD SIDER Canada Vigilance US FAERS | |
| 112 | Abasia | FAERS: 31 | US FAERS | |
| 113 | Dehydration | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 114 | Hepatomegaly | FAERS: 31 Canada Vigilance: 1 | CTD Canada Vigilance US FAERS | |
| 115 | Nasopharyngitis | FAERS: 31 | US FAERS | |
| 116 | Transaminases increased | FAERS: 31 | OFFSIDES SIDER US FAERS | |
| 117 | Mental status changes | FAERS: 30 | US FAERS | |
| 118 | Diabetes Mellitus | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 119 | Disease recurrence | FAERS: 29 | OFFSIDES US FAERS | |
| 120 | Nervousness | FAERS: 29 | SIDER US FAERS | |
| 121 | Gastric Lavage | FAERS: 28 | OFFSIDES US FAERS | |
| 122 | Inflammation | FAERS: 28 | US FAERS | |
| 123 | Myalgia | FAERS: 28 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 124 | Anticonvulsant drug level decreased | FAERS: 27 | OFFSIDES US FAERS | |
| 125 | Blood creatinine increased | FAERS: 27 | OFFSIDES US FAERS | |
| 126 | Lymphopenia | FAERS: 27 | US FAERS | |
| 127 | Sopor | FAERS: 27 | US FAERS | |
| 128 | Thermal burn | FAERS: 27 | US FAERS | |
| 129 | Blood immunoglobulin G decreased | FAERS: 26 | US FAERS | |
| 130 | Chromaturia | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 131 | Conjunctivitis | FAERS: 26 | 9072691 | CTD SIDER US FAERS |
| 132 | Constipation | FAERS: 26 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 133 | Mental impairment | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 134 | Myocardial Infarction | FAERS: 26 | 12184016 12693787 | CTD US FAERS |
| 135 | Poisoning | FAERS: 26 | 22634333 28728110 | CTD SIDER US FAERS |
| 136 | Respiratory distress | FAERS: 26 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 137 | jaundice | FAERS: 26 Canada Vigilance: 3 | CTD SIDER Canada Vigilance US FAERS | |
| 138 | Delirium | FAERS: 25 | 4003613 6147104 | CTD US FAERS |
| 139 | Flushing | FAERS: 25 | SIDER US FAERS | |
| 140 | Lymphocyte stimulation test positive | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 141 | Mydriasis | FAERS: 25 | SIDER US FAERS | |
| 142 | Purpura | FAERS: 25 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 143 | Abdominal discomfort | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 144 | Anorexia | FAERS: 24 | OFFSIDES SIDER US FAERS | |
| 145 | Emotional distress | FAERS: 24 | OFFSIDES SIDER US FAERS | |
| 146 | Hyporeflexia | FAERS: 24 | US FAERS | |
| 147 | Photophobia | FAERS: 24 | US FAERS | |
| 148 | Skin test positive | FAERS: 24 | OFFSIDES US FAERS | |
| 149 | Urinary tract infection | FAERS: 24 | SIDER US FAERS | |
| 150 | Dysmorphism | FAERS: 23 | US FAERS | |
| 151 | Facial Pain | FAERS: 23 | US FAERS | |
| 152 | Hypersomnia | FAERS: 23 | US FAERS | |
| 153 | Petechiae | FAERS: 23 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 154 | Rhabdomyolysis | FAERS: 23 | US FAERS | |
| 155 | Metabolic acidosis | FAERS: 22 | SIDER US FAERS | |
| 156 | Respiratory Depression | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 157 | Shock | FAERS: 22 | SIDER US FAERS | |
| 158 | Splenomegaly | FAERS: 22 | 1644161 | CTD US FAERS |
| 159 | Stomatitis | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 160 | Thrombosis | FAERS: 22 | 8146837 | CTD US FAERS |
| 161 | Atrial Fibrillation | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 162 | Blood immunoglobulin M decreased | FAERS: 21 | US FAERS | |
| 163 | Hepatosplenomegaly | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 164 | Lymphocytosis | FAERS: 21 | OFFSIDES US FAERS | |
| 165 | Product use in unapproved indication | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 166 | Back Pain | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 167 | Crying | FAERS: 20 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 168 | Depressed mood | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 169 | Glaucoma | FAERS: 20 | US FAERS | |
| 170 | Ileus | FAERS: 20 | US FAERS | |
| 171 | Pancreatitis | FAERS: 20 Canada Vigilance: 6 | 11837721 | CTD SIDER Canada Vigilance US FAERS |
| 172 | Product use issue | FAERS: 20 | US FAERS | |
| 173 | Agranulocytosis | FAERS: 19 Canada Vigilance: 2 | CTD SIDER Canada Vigilance US FAERS | |
| 174 | Blood urea increased | FAERS: 19 | SIDER US FAERS | |
| 175 | Cholestasis | FAERS: 19 Canada Vigilance: 1 | CTD Canada Vigilance US FAERS | |
| 176 | Influenza | FAERS: 19 | US FAERS | |
| 177 | Multi-organ disorder | FAERS: 19 | US FAERS | |
| 178 | Myocarditis | FAERS: 19 | 7739955 9072691 20129423 | CTD US FAERS |
| 179 | Anticonvulsant drug level above therapeutic | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 180 | Apathy | FAERS: 18 | OFFSIDES US FAERS | |
| 181 | Burning sensation | FAERS: 18 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 182 | Cholelithiasis | FAERS: 18 | US FAERS | |
| 183 | Disseminated Intravascular Coagulation | FAERS: 18 | 10464538 | CTD US FAERS |
| 184 | Eczema | FAERS: 18 Canada Vigilance: 2 | 2362393 | CTD OFFSIDES Canada Vigilance US FAERS |
| 185 | Glasgow coma scale abnormal | FAERS: 18 | US FAERS | |
| 186 | Hypoxia | FAERS: 18 | US FAERS | |
| 187 | Sinus Tachycardia | FAERS: 18 | US FAERS | |
| 188 | Bronchitis | FAERS: 17 | OFFSIDES SIDER US FAERS | |
| 189 | Dementia | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 190 | Dermatitis | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 191 | Drug withdrawal syndrome | FAERS: 17 | US FAERS | |
| 192 | Pleurisy | FAERS: 17 | OFFSIDES US FAERS | |
| 193 | Stress | FAERS: 17 | US FAERS | |
| 194 | Anticonvulsant drug level below therapeutic | FAERS: 16 | OFFSIDES US FAERS | |
| 195 | Blood albumin decreased | FAERS: 16 | OFFSIDES US FAERS | |
| 196 | Blood immunoglobulin A decreased | FAERS: 16 | US FAERS | |
| 197 | Drug prescribing error | FAERS: 16 | US FAERS | |
| 198 | Dyspepsia | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 199 | Eye pain | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 200 | Lymphocytic infiltration | FAERS: 16 | US FAERS | |
| 201 | Neuroleptic Malignant Syndrome | FAERS: 16 Canada Vigilance: 1 | 1948228 2904624 9807653 | CTD SIDER Canada Vigilance US FAERS |
| 202 | Neutrophil count decreased | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 203 | Pharyngitis | FAERS: 16 | SIDER US FAERS | |
| 204 | Urinary Retention | FAERS: 16 Canada Vigilance: 1 | 18078476 | CTD SIDER Canada Vigilance US FAERS |
| 205 | Wrong technique in drug usage process | FAERS: 16 | US FAERS | |
| 206 | Ascites | FAERS: 15 | US FAERS | |
| 207 | Aura | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 208 | Blood urine present | FAERS: 15 | US FAERS | |
| 209 | Dysuria | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 210 | Emotional disorder | FAERS: 15 | US FAERS | |
| 211 | Epistaxis | FAERS: 15 | US FAERS | |
| 212 | Hydrocephalus | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 213 | Neck Pain | FAERS: 15 | US FAERS | |
| 214 | Oral pain | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 215 | Pregnancy | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 216 | Pulmonary Embolism | FAERS: 15 | SIDER US FAERS | |
| 217 | Scab | FAERS: 15 | OFFSIDES US FAERS | |
| 218 | Thirst | FAERS: 15 | US FAERS | |
| 219 | Tonsillitis | FAERS: 15 | US FAERS | |
| 220 | Bone density decreased | FAERS: 14 | SIDER US FAERS | |
| 221 | Cardiomegaly | FAERS: 14 | 8315822 | CTD US FAERS |
| 222 | Cataract | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 223 | Colitis | FAERS: 14 | SIDER US FAERS | |
| 224 | Cyanosis | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 225 | Deep Vein Thrombosis | FAERS: 14 | US FAERS | |
| 226 | Dysphonia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 227 | Dystonia | FAERS: 14 Canada Vigilance: 1 | CTD Canada Vigilance US FAERS | |
| 228 | Electrolyte imbalance | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 229 | Hypothyroidism | FAERS: 14 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 230 | Lymphocyte count increased | FAERS: 14 | US FAERS | |
| 231 | Mucosal erosion | FAERS: 14 | OFFSIDES US FAERS | |
| 232 | Oculomucocutaneous syndrome | FAERS: 14 | OFFSIDES US FAERS | |
| 233 | Osteopenia | FAERS: 14 | SIDER US FAERS | |
| 234 | Ulcer | FAERS: 14 | US FAERS | |
| 235 | Asthma | FAERS: 13 | OFFSIDES US FAERS | |
| 236 | Atelectasis | FAERS: 13 | US FAERS | |
| 237 | Blood potassium decreased | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 238 | Cheilitis | FAERS: 13 | US FAERS | |
| 239 | Drug level above therapeutic | FAERS: 13 | US FAERS | |
| 240 | Enterocolitis | FAERS: 13 | US FAERS | |
| 241 | Inappropriate schedule of drug administration | FAERS: 13 | US FAERS | |
| 242 | Lymphocyte count decreased | FAERS: 13 | US FAERS | |
| 243 | Medication residue present | FAERS: 13 | US FAERS | |
| 244 | Myoclonic Epilepsy | FAERS: 13 | US FAERS | |
| 245 | No adverse event | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 246 | Osteomalacia | FAERS: 13 | 17016548 | CTD SIDER US FAERS |
| 247 | Polyuria | FAERS: 13 | 7370697 | CTD SIDER US FAERS |
| 248 | Product physical issue | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 249 | Rales | FAERS: 13 | US FAERS | |
| 250 | Sick Sinus Syndrome | FAERS: 13 | CTD US FAERS | |
| 251 | Urinary Incontinence | FAERS: 13 | 4032590 | CTD US FAERS |
| 252 | Accidental exposure | FAERS: 12 | US FAERS | |
| 253 | Blood cholesterol increased | FAERS: 12 | SIDER US FAERS | |
| 254 | Cerebral disorder | FAERS: 12 | US FAERS | |
| 255 | Hypokinesia | FAERS: 12 | 16116141 | CTD OFFSIDES US FAERS |
| 256 | Respiratory arrest | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 257 | Skin Erosion | FAERS: 12 | US FAERS | |
| 258 | Thrombocytosis | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 259 | Tinnitus | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 260 | Trisomy 21 | FAERS: 12 | US FAERS | |
| 261 | Deafness | FAERS: 11 | SIDER US FAERS | |
| 262 | Discomfort | FAERS: 11 | US FAERS | |
| 263 | Drug exposure via breast milk | FAERS: 11 | US FAERS | |
| 264 | Dry skin | FAERS: 11 | US FAERS | |
| 265 | Hepatitis C | FAERS: 11 | OFFSIDES US FAERS | |
| 266 | Hepatotoxicity | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 267 | Hypophagia | FAERS: 11 | US FAERS | |
| 268 | Lupus-like syndrome | FAERS: 11 | US FAERS | |
| 269 | Lymphadenitis | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 270 | Multiple Sclerosis | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 271 | Myasthenia Gravis | FAERS: 11 | US FAERS | |
| 272 | Ocular icterus | FAERS: 11 | US FAERS | |
| 273 | Papule | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 274 | Skin Ulcer | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 275 | Spina Bifida | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 276 | Therapy non-responder | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 277 | Unevaluable event | FAERS: 11 | US FAERS | |
| 278 | Wrong technique in product usage process | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 279 | Anaphylactic shock | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 280 | Anger | FAERS: 10 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 281 | Angina Pectoris | FAERS: 10 | US FAERS | |
| 282 | Atrioventricular Block | FAERS: 10 Canada Vigilance: 3 |
731879
1148068 1554049 1728915 2124090 3662457 3806129 4051836 6613526 6756049 8215250 8451916 9810297 12184016 15915744 17473503 | CTD SIDER Canada Vigilance US FAERS |
| 283 | Bipolar Disorder | FAERS: 10 |
1487473
1562312 1590497 1603193 2293776 2327680 2775969 2919698 3182607 3341477 3795291 3968046 4003613 6725221 7962691 8067500 8328579 8564338 8610843 10200867 11394195 11511412 15206449 15289703 15504660 15514420 15766298 15999955 17260335 17594078 19304774 19573494 20046352 25231249 | CTD OFFSIDES SIDER US FAERS |
| 284 | Blepharospasm | FAERS: 10 | US FAERS | |
| 285 | Blood potassium increased | FAERS: 10 | US FAERS | |
| 286 | Coma scale abnormal | FAERS: 10 | US FAERS | |
| 287 | Cytomegalovirus test positive | FAERS: 10 | US FAERS | |
| 288 | Diabetes Insipidus | FAERS: 10 | US FAERS | |
| 289 | Dysgeusia | FAERS: 10 | SIDER US FAERS | |
| 290 | Epidermal necrosis | FAERS: 10 | US FAERS | |
| 291 | Fracture | FAERS: 10 | SIDER US FAERS | |
| 292 | Intubation | FAERS: 10 | OFFSIDES US FAERS | |
| 293 | Joint swelling | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 294 | Keratitis | FAERS: 10 | US FAERS | |
| 295 | Limb discomfort | FAERS: 10 | US FAERS | |
| 296 | Nephrolithiasis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 297 | Neuralgia | FAERS: 10 Canada Vigilance: 2 | CTD SIDER Canada Vigilance US FAERS | |
| 298 | Night sweats | FAERS: 10 | US FAERS | |
| 299 | Paranoia | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 300 | Pericardial effusion | FAERS: 10 | 16283138 | CTD US FAERS |
| 301 | Proteinuria | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 302 | Pulmonary Fibrosis | FAERS: 10 | US FAERS | |
| 303 | Pulmonary Hypertension | FAERS: 10 | US FAERS | |
| 304 | Screaming | FAERS: 10 | US FAERS | |
| 305 | Talipes | FAERS: 10 | US FAERS | |
| 306 | Thyroiditis | FAERS: 10 | US FAERS | |
| 307 | Visual disturbance | FAERS: 10 | OFFSIDES US FAERS | |
| 308 | Activities of daily living impaired | FAERS: 9 | US FAERS | |
| 309 | Acute respiratory failure | FAERS: 9 | US FAERS | |
| 310 | Ageusia | FAERS: 9 | OFFSIDES US FAERS | |
| 311 | Cerebral Palsy | FAERS: 9 | US FAERS | |
| 312 | Cerebral atrophy | FAERS: 9 | OFFSIDES US FAERS | |
| 313 | Cholecystitis | FAERS: 9 | US FAERS | |
| 314 | Concomitant disease aggravated | FAERS: 9 | US FAERS | |
| 315 | Cytomegalovirus antibody positive | FAERS: 9 | US FAERS | |
| 316 | Drowning | FAERS: 9 | US FAERS | |
| 317 | Drug administration error | FAERS: 9 | OFFSIDES US FAERS | |
| 318 | Encephalitis | FAERS: 9 | OFFSIDES US FAERS | |
| 319 | Epidermolysis Bullosa | FAERS: 9 | US FAERS | |
| 320 | Gastrointestinal sounds abnormal | FAERS: 9 | OFFSIDES US FAERS | |
| 321 | Intentional misuse | FAERS: 9 | US FAERS | |
| 322 | Joint injury | FAERS: 9 | US FAERS | |
| 323 | Low birth weight baby | FAERS: 9 | US FAERS | |
| 324 | Mood swings | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 325 | Muscle Rigidity | FAERS: 9 | US FAERS | |
| 326 | Musculoskeletal stiffness | FAERS: 9 | OFFSIDES US FAERS | |
| 327 | Obesity | FAERS: 9 | US FAERS | |
| 328 | Palpitations | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 329 | Pneumonitis | FAERS: 9 | US FAERS | |
| 330 | Product taste abnormal | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 331 | Retching | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 332 | Roseolovirus test positive | FAERS: 9 | US FAERS | |
| 333 | Skin reaction | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 334 | Thrombocytopenic purpura | FAERS: 9 | SIDER US FAERS | |
| 335 | Trismus | FAERS: 9 | US FAERS | |
| 336 | VIIth nerve paralysis | FAERS: 9 | US FAERS | |
| 337 | Acne | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 338 | Ankle Fracture | FAERS: 8 | US FAERS | |
| 339 | Anuria | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 340 | Arthritis | FAERS: 8 Canada Vigilance: 1 | 6462508 | CTD Canada Vigilance US FAERS |
| 341 | Azoospermia | FAERS: 8 | US FAERS | |
| 342 | B-lymphocyte count decreased | FAERS: 8 | US FAERS | |
| 343 | Bilirubin conjugated increased | FAERS: 8 | US FAERS | |
| 344 | Cerebral Infarction | FAERS: 8 | US FAERS | |
| 345 | Corneal Opacity | FAERS: 8 | US FAERS | |
| 346 | Deafness Neurosensory | FAERS: 8 | US FAERS | |
| 347 | Diabetic Ketoacidosis | FAERS: 8 | US FAERS | |
| 348 | Drug dose omission | FAERS: 8 | US FAERS | |
| 349 | Drug level below therapeutic | FAERS: 8 | OFFSIDES US FAERS | |
| 350 | Gastritis | FAERS: 8 | US FAERS | |
| 351 | HLA marker study positive | FAERS: 8 | US FAERS | |
| 352 | Head discomfort | FAERS: 8 | US FAERS | |
| 353 | Histiocytosis | FAERS: 8 | US FAERS | |
| 354 | Laceration | FAERS: 8 | OFFSIDES US FAERS | |
| 355 | PO2 decreased | FAERS: 8 | US FAERS | |
| 356 | Paresis | FAERS: 8 | SIDER US FAERS | |
| 357 | Pulmonary congestion | FAERS: 8 | OFFSIDES US FAERS | |
| 358 | Schizophrenia | FAERS: 8 | 10464538 | CTD US FAERS |
| 359 | Symblepharon | FAERS: 8 | US FAERS | |
| 360 | Throat irritation | FAERS: 8 | US FAERS | |
| 361 | Tooth Loss | FAERS: 8 | US FAERS | |
| 362 | Vasculitis | FAERS: 8 | SIDER US FAERS | |
| 363 | Wrong drug administered | FAERS: 8 | US FAERS | |
| 364 | Ammonia increased | FAERS: 7 | OFFSIDES US FAERS | |
| 365 | Aphagia | FAERS: 7 | US FAERS | |
| 366 | Asphyxia | FAERS: 7 | US FAERS | |
| 367 | Cellulitis | FAERS: 7 | US FAERS | |
| 368 | Chest discomfort | FAERS: 7 | US FAERS | |
| 369 | Clonus | FAERS: 7 | US FAERS | |
| 370 | Complex partial seizures | FAERS: 7 | OFFSIDES US FAERS | |
| 371 | Congenital cystic kidney disease | FAERS: 7 | US FAERS | |
| 372 | Cytomegalovirus enterocolitis | FAERS: 7 | US FAERS | |
| 373 | Euphoric mood | FAERS: 7 | US FAERS | |
| 374 | Eyelid Function Disorder | FAERS: 7 | US FAERS | |
| 375 | Febrile Neutropenia | FAERS: 7 | US FAERS | |
| 376 | Feeling Cold | FAERS: 7 | US FAERS | |
| 377 | Gait inability | FAERS: 7 | US FAERS | |
| 378 | Gastrointestinal infection | FAERS: 7 | US FAERS | |
| 379 | Gestational Diabetes | FAERS: 7 | US FAERS | |
| 380 | Heat illness | FAERS: 7 | US FAERS | |
| 381 | Hepatic necrosis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 382 | Hyperpyrexia | FAERS: 7 | US FAERS | |
| 383 | Hyperreflexia | FAERS: 7 | OFFSIDES US FAERS | |
| 384 | Intentional self-injury | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 385 | Lip erosion | FAERS: 7 | OFFSIDES US FAERS | |
| 386 | Measles | FAERS: 7 | US FAERS | |
| 387 | Meningomyelocele | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 388 | Mental Retardation | FAERS: 7 | US FAERS | |
| 389 | No adverse effect | FAERS: 7 | US FAERS | |
| 390 | Optic Neuritis | FAERS: 7 | US FAERS | |
| 391 | Pallor | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 392 | Peripheral swelling | FAERS: 7 | US FAERS | |
| 393 | Pharyngolaryngeal Pain | FAERS: 7 | US FAERS | |
| 394 | Polydipsia | FAERS: 7 | US FAERS | |
| 395 | Polymyositis | FAERS: 7 | US FAERS | |
| 396 | Prescribed overdose | FAERS: 7 | US FAERS | |
| 397 | Psoriasis | FAERS: 7 | OFFSIDES US FAERS | |
| 398 | Regurgitation | FAERS: 7 | US FAERS | |
| 399 | Septic Shock | FAERS: 7 | US FAERS | |
| 400 | Sinusitis | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 401 | Spermatozoa progressive motility decreased | FAERS: 7 | US FAERS | |
| 402 | Wheelchair user | FAERS: 7 | OFFSIDES US FAERS | |
| 403 | Wheezing | FAERS: 7 | US FAERS | |
| 404 | Accidental drug intake by child | FAERS: 6 | US FAERS | |
| 405 | Accidental exposure to product | FAERS: 6 | US FAERS | |
| 406 | Akathisia | FAERS: 6 | US FAERS | |
| 407 | Amblyopia | FAERS: 6 | SIDER US FAERS | |
| 408 | Aneurysm | FAERS: 6 | US FAERS | |
| 409 | Biopsy skin abnormal | FAERS: 6 | US FAERS | |
| 410 | Blepharitis | FAERS: 6 | OFFSIDES US FAERS | |
| 411 | Blood sodium abnormal | FAERS: 6 | US FAERS | |
| 412 | Blood triglycerides increased | FAERS: 6 | SIDER US FAERS | |
| 413 | Cardiovascular insufficiency | FAERS: 6 | US FAERS | |
| 414 | Cholangitis | FAERS: 6 | CTD US FAERS | |
| 415 | Cold sweat | FAERS: 6 | US FAERS | |
| 416 | Concomitant disease progression | FAERS: 6 | US FAERS | |
| 417 | Cytomegalovirus gastroenteritis | FAERS: 6 | US FAERS | |
| 418 | Cytomegalovirus mucocutaneous ulcer | FAERS: 6 | US FAERS | |
| 419 | Drooling | FAERS: 6 | US FAERS | |
| 420 | Drug level changed | FAERS: 6 | US FAERS | |
| 421 | Drug screen positive | FAERS: 6 | US FAERS | |
| 422 | Electrocardiogram abnormal | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 423 | Enuresis | FAERS: 6 | OFFSIDES US FAERS | |
| 424 | Exposure during breast feeding | FAERS: 6 | US FAERS | |
| 425 | Gastric ulcer | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 426 | Gastrointestinal erosion | FAERS: 6 | US FAERS | |
| 427 | Hemiparesis | FAERS: 6 | OFFSIDES US FAERS | |
| 428 | Hemiplegia | FAERS: 6 | US FAERS | |
| 429 | Hepatic Encephalopathy | FAERS: 6 | 8398372 | CTD US FAERS |
| 430 | Histiocytosis haematophagic | FAERS: 6 | US FAERS | |
| 431 | Hypoaldosteronism | FAERS: 6 | US FAERS | |
| 432 | Incoherent | FAERS: 6 | US FAERS | |
| 433 | Infectious Mononucleosis | FAERS: 6 | US FAERS | |
| 434 | Infertility | FAERS: 6 | US FAERS | |
| 435 | Intellectual Disability | FAERS: 6 | 2039260 9014606 | CTD US FAERS |
| 436 | Lower respiratory tract infection | FAERS: 6 | US FAERS | |
| 437 | Lupus Nephritis | FAERS: 6 | US FAERS | |
| 438 | Monocyte count increased | FAERS: 6 | US FAERS | |
| 439 | Mumps | FAERS: 6 | US FAERS | |
| 440 | Nerve injury | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 441 | Neurological decompensation | FAERS: 6 | US FAERS | |
| 442 | Optic Neuropathy | FAERS: 6 | US FAERS | |
| 443 | Porphyria non-acute | FAERS: 6 | SIDER US FAERS | |
| 444 | Productive Cough | FAERS: 6 | US FAERS | |
| 445 | Protein total decreased | FAERS: 6 | US FAERS | |
| 446 | Secretion discharge | FAERS: 6 | US FAERS | |
| 447 | Tracheitis | FAERS: 6 | US FAERS | |
| 448 | Ventricular Fibrillation | FAERS: 6 | US FAERS | |
| 449 | Ventricular hypertrophy | FAERS: 6 | US FAERS | |
| 450 | Vitamin D Deficiency | FAERS: 6 | US FAERS | |
| 451 | Acanthosis | FAERS: 5 | US FAERS | |
| 452 | Adverse event | FAERS: 5 | OFFSIDES US FAERS | |
| 453 | Alcohol poisoning | FAERS: 5 | US FAERS | |
| 454 | Anosmia | FAERS: 5 | US FAERS | |
| 455 | Aphthous Stomatitis | FAERS: 5 | OFFSIDES US FAERS | |
| 456 | Blood immunoglobulin E increased | FAERS: 5 | US FAERS | |
| 457 | Blood phosphorus decreased | FAERS: 5 | US FAERS | |
| 458 | Blood pressure fluctuation | FAERS: 5 | US FAERS | |
| 459 | Bone pain | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 460 | Brain Death | FAERS: 5 | US FAERS | |
| 461 | Bronchopneumonia | FAERS: 5 | US FAERS | |
| 462 | Conversion disorder | FAERS: 5 | OFFSIDES US FAERS | |
| 463 | Craniotomy | FAERS: 5 | US FAERS | |
| 464 | Cytolytic hepatitis | FAERS: 5 | OFFSIDES US FAERS | |
| 465 | Dental caries | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 466 | Drug effect incomplete | FAERS: 5 | US FAERS | |
| 467 | Drug level fluctuating | FAERS: 5 | US FAERS | |
| 468 | Drug withdrawal convulsions | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 469 | Epididymitis | FAERS: 5 | US FAERS | |
| 470 | Epiglottitis | FAERS: 5 | US FAERS | |
| 471 | Exfoliative rash | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 472 | Exposure via breast milk | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 473 | Eye irritation | FAERS: 5 | US FAERS | |
| 474 | Eyelid pain | FAERS: 5 | US FAERS | |
| 475 | Gangrene | FAERS: 5 | US FAERS | |
| 476 | Genital burning sensation | FAERS: 5 | US FAERS | |
| 477 | Glomerulonephritis | FAERS: 5 | US FAERS | |
| 478 | Granuloma | FAERS: 5 | 3628894 7247130 | CTD US FAERS |
| 479 | Growth retardation | FAERS: 5 | US FAERS | |
| 480 | Hepatic congestion | FAERS: 5 | US FAERS | |
| 481 | Hypospadias | FAERS: 5 | US FAERS | |
| 482 | Implantable defibrillator insertion | FAERS: 5 | US FAERS | |
| 483 | Incontinence | FAERS: 5 | OFFSIDES US FAERS | |
| 484 | Intentional drug misuse | FAERS: 5 | US FAERS | |
| 485 | Long QT Syndrome | FAERS: 5 | 8726546 | CTD US FAERS |
| 486 | Meningitis | FAERS: 5 | SIDER US FAERS | |
| 487 | Muscle tightness | FAERS: 5 | US FAERS | |
| 488 | Myelitis | FAERS: 5 | US FAERS | |
| 489 | Necrosis | FAERS: 5 | US FAERS | |
| 490 | Nephrotic Syndrome | FAERS: 5 | US FAERS | |
| 491 | Neutrophil percentage increased | FAERS: 5 | US FAERS | |
| 492 | Oliguria | FAERS: 5 | SIDER US FAERS | |
| 493 | Oral mucosal exfoliation | FAERS: 5 | US FAERS | |
| 494 | Orchitis | FAERS: 5 | US FAERS | |
| 495 | Patent ductus arteriosus | FAERS: 5 | US FAERS | |
| 496 | Phimosis | FAERS: 5 | US FAERS | |
| 497 | Post procedural complication | FAERS: 5 | US FAERS | |
| 498 | Premature Ejaculation | FAERS: 5 | US FAERS | |
| 499 | Product formulation issue | FAERS: 5 | US FAERS | |
| 500 | Pseudomonal sepsis | FAERS: 5 | US FAERS | |
| 501 | Psychomotor skills impaired | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 502 | Pyelonephritis | FAERS: 5 | US FAERS | |
| 503 | Quadriplegia | FAERS: 5 | US FAERS | |
| 504 | Sexual Dysfunction | FAERS: 5 | SIDER US FAERS | |
| 505 | Skin necrosis | FAERS: 5 | US FAERS | |
| 506 | Spondylitis | FAERS: 5 | US FAERS | |
| 507 | Staring | FAERS: 5 | US FAERS | |
| 508 | Strabismus | FAERS: 5 | US FAERS | |
| 509 | Stupor | FAERS: 5 Canada Vigilance: 1 | 1173095 10466905 | CTD Canada Vigilance US FAERS |
| 510 | Supraventricular tachycardia | FAERS: 5 | US FAERS | |
| 511 | Tachyarrhythmia | FAERS: 5 | US FAERS | |
| 512 | Terminal state | FAERS: 5 | US FAERS | |
| 513 | Urine ketone body present | FAERS: 5 | OFFSIDES US FAERS | |
| 514 | Acidosis | FAERS: 4 | US FAERS | |
| 515 | Apparent death | FAERS: 4 | US FAERS | |
| 516 | Appendicitis | FAERS: 4 | US FAERS | |
| 517 | Arthropathy | FAERS: 4 | US FAERS | |
| 518 | Arthropod bite | FAERS: 4 | US FAERS | |
| 519 | Asterixis | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 520 | Auricular swelling | FAERS: 4 | US FAERS | |
| 521 | Bacteria stool identified | FAERS: 4 | US FAERS | |
| 522 | Bedridden | FAERS: 4 | US FAERS | |
| 523 | Biopsy liver abnormal | FAERS: 4 | US FAERS | |
| 524 | Blood count abnormal | FAERS: 4 | US FAERS | |
| 525 | Blood pH increased | FAERS: 4 | US FAERS | |
| 526 | Blood prolactin increased | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 527 | Bradyphrenia | FAERS: 4 | US FAERS | |
| 528 | Breech Presentation | FAERS: 4 | US FAERS | |
| 529 | Cerebellar Ataxia | FAERS: 4 | 9008782 | CTD OFFSIDES US FAERS |
| 530 | Choking | FAERS: 4 | US FAERS | |
| 531 | Cholelithotomy | FAERS: 4 | US FAERS | |
| 532 | Clumsiness | FAERS: 4 | US FAERS | |
| 533 | Complications of maternal exposure to therapeutic drugs | FAERS: 4 | US FAERS | |
| 534 | Congenital hydronephrosis | FAERS: 4 | US FAERS | |
| 535 | Dissociation | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 536 | Distichiasis | FAERS: 4 | US FAERS | |
| 537 | Drug ineffective for unapproved indication | FAERS: 4 | US FAERS | |
| 538 | Dysphemia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 539 | Eosinophilic Pneumonia | FAERS: 4 | US FAERS | |
| 540 | Epstein-Barr virus antibody positive | FAERS: 4 | OFFSIDES US FAERS | |
| 541 | Erectile dysfunction | FAERS: 4 Canada Vigilance: 1 | 16004674 | CTD SIDER Canada Vigilance US FAERS |
| 542 | Excessive eye blinking | FAERS: 4 | US FAERS | |
| 543 | Expired product administered | FAERS: 4 | US FAERS | |
| 544 | Fibrin D dimer increased | FAERS: 4 | US FAERS | |
| 545 | Fibromyalgia | FAERS: 4 | OFFSIDES US FAERS | |
| 546 | Flatulence | FAERS: 4 | US FAERS | |
| 547 | Gastric Bypass | FAERS: 4 | US FAERS | |
| 548 | Gastroenteritis | FAERS: 4 | US FAERS | |
| 549 | Gaze palsy | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 550 | General physical condition abnormal | FAERS: 4 | US FAERS | |
| 551 | Grip strength decreased | FAERS: 4 | US FAERS | |
| 552 | Hirsutism | FAERS: 4 | SIDER US FAERS | |
| 553 | Hormone level abnormal | FAERS: 4 | US FAERS | |
| 554 | Hyperacusis | FAERS: 4 | SIDER US FAERS | |
| 555 | Hyperkeratosis | FAERS: 4 | US FAERS | |
| 556 | Hyperthyroidism | FAERS: 4 | 28267586 | CTD US FAERS |
| 557 | Hyperventilation | FAERS: 4 | 2362393 | CTD US FAERS |
| 558 | Idiosyncratic drug reaction | FAERS: 4 | US FAERS | |
| 559 | Impaired driving ability | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 560 | Impaired work ability | FAERS: 4 | US FAERS | |
| 561 | Incorrect route of drug administration | FAERS: 4 | US FAERS | |
| 562 | Infantile apnoeic attack | FAERS: 4 | US FAERS | |
| 563 | Intestinal Obstruction | FAERS: 4 | 15123016 | CTD US FAERS |
| 564 | Joint Range of Motion Decreased | FAERS: 4 | US FAERS | |
| 565 | Joint stiffness | FAERS: 4 | OFFSIDES US FAERS | |
| 566 | Lennox-Gastaut syndrome | FAERS: 4 | US FAERS | |
| 567 | Low set ears | FAERS: 4 | US FAERS | |
| 568 | Lung consolidation | FAERS: 4 | US FAERS | |
| 569 | Lymphocyte percentage decreased | FAERS: 4 | US FAERS | |
| 570 | Lymphoma | FAERS: 4 | 10369620 | CTD OFFSIDES SIDER US FAERS |
| 571 | Malignant neoplasm progression | FAERS: 4 | OFFSIDES US FAERS | |
| 572 | Malnutrition | FAERS: 4 | SIDER US FAERS | |
| 573 | Mastication disorder | FAERS: 4 | US FAERS | |
| 574 | Meningism | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 575 | Menorrhagia | FAERS: 4 | US FAERS | |
| 576 | Microcephaly | FAERS: 4 | 10540608 15123016 | CTD US FAERS |
| 577 | Monocyte percentage increased | FAERS: 4 | US FAERS | |
| 578 | Monoplegia | FAERS: 4 | US FAERS | |
| 579 | Musculoskeletal Pain | FAERS: 4 | OFFSIDES US FAERS | |
| 580 | Myocardial fibrosis | FAERS: 4 | US FAERS | |
| 581 | Oropharyngeal blistering | FAERS: 4 | US FAERS | |
| 582 | Overlap syndrome | FAERS: 4 | US FAERS | |
| 583 | Overweight | FAERS: 4 | US FAERS | |
| 584 | Pain of skin | FAERS: 4 | OFFSIDES US FAERS | |
| 585 | Personality Change | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 586 | Pneumothorax | FAERS: 4 | US FAERS | |
| 587 | Polyarthritis | FAERS: 4 | US FAERS | |
| 588 | Poor sucking reflex | FAERS: 4 | US FAERS | |
| 589 | Porphyrins urine increased | FAERS: 4 | US FAERS | |
| 590 | Product availability issue | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 591 | Purulent discharge | FAERS: 4 | US FAERS | |
| 592 | Renal tubular necrosis | FAERS: 4 | US FAERS | |
| 593 | Reticulocyte count increased | FAERS: 4 | US FAERS | |
| 594 | Retinal Vein Occlusion | FAERS: 4 | US FAERS | |
| 595 | Rheumatoid Arthritis | FAERS: 4 | US FAERS | |
| 596 | Schizoaffective Disorder | FAERS: 4 | OFFSIDES US FAERS | |
| 597 | Sluggishness | FAERS: 4 | US FAERS | |
| 598 | Sudden death | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 599 | Tachyphrenia | FAERS: 4 | US FAERS | |
| 600 | Toothache | FAERS: 4 | US FAERS | |
| 601 | Traumatic Brain Injury | FAERS: 4 | US FAERS | |
| 602 | Vanishing bile duct syndrome | FAERS: 4 | SIDER US FAERS | |
| 603 | Varicocele | FAERS: 4 | US FAERS | |
| 604 | Ventricular arrhythmia | FAERS: 4 | US FAERS | |
| 605 | furuncle | FAERS: 4 | US FAERS | |
| 606 | Accidental exposure to product by child | FAERS: 3 | US FAERS | |
| 607 | Acute kidney injury | FAERS: 3 Canada Vigilance: 2 | CTD Canada Vigilance US FAERS | |
| 608 | Adactyly | FAERS: 3 | US FAERS | |
| 609 | Akinesia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 610 | Amylase increased | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 611 | Angiotensin converting enzyme increased | FAERS: 3 | US FAERS | |
| 612 | Angle Closure Glaucoma | FAERS: 3 | US FAERS | |
| 613 | Arteriosclerosis | FAERS: 3 | US FAERS | |
| 614 | Astigmatism | FAERS: 3 | US FAERS | |
| 615 | Back disorder | FAERS: 3 | US FAERS | |
| 616 | Biopsy adrenal gland abnormal | FAERS: 3 | US FAERS | |
| 617 | Biopsy kidney abnormal | FAERS: 3 | US FAERS | |
| 618 | Biopsy pancreas abnormal | FAERS: 3 | US FAERS | |
| 619 | Biopsy spleen abnormal | FAERS: 3 | US FAERS | |
| 620 | Bipolar I disorder | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 621 | Blood albumin increased | FAERS: 3 | US FAERS | |
| 622 | Blood amylase increased | FAERS: 3 | OFFSIDES US FAERS | |
| 623 | Blood cortisol increased | FAERS: 3 | OFFSIDES US FAERS | |
| 624 | Blood creatine increased | FAERS: 3 | OFFSIDES US FAERS | |
| 625 | Blood fibrinogen decreased | FAERS: 3 | US FAERS | |
| 626 | Blood pH decreased | FAERS: 3 | US FAERS | |
| 627 | Blood parathyroid hormone increased | FAERS: 3 | OFFSIDES US FAERS | |
| 628 | Bone marrow depression | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 629 | Bone scan abnormal | FAERS: 3 | OFFSIDES US FAERS | |
| 630 | Bradykinesia | FAERS: 3 | US FAERS | |
| 631 | Candida pneumonia | FAERS: 3 | US FAERS | |
| 632 | Carcinoembryonic antigen increased | FAERS: 3 | US FAERS | |
| 633 | Cell Death | FAERS: 3 | US FAERS | |
| 634 | Cerebellar infarction | FAERS: 3 | US FAERS | |
| 635 | Choking sensation | FAERS: 3 | OFFSIDES US FAERS | |
| 636 | Cleft Palate | FAERS: 3 Canada Vigilance: 1 | 2492459 | CTD Canada Vigilance US FAERS |
| 637 | Compression fracture | FAERS: 3 | US FAERS | |
| 638 | Confabulation | FAERS: 3 | OFFSIDES US FAERS | |
| 639 | Congenital choroid plexus cyst | FAERS: 3 | US FAERS | |
| 640 | Congenital diaphragmatic hernia | FAERS: 3 | US FAERS | |
| 641 | Corneal Scar | FAERS: 3 | US FAERS | |
| 642 | Corneal epithelium defect | FAERS: 3 | US FAERS | |
| 643 | Creutzfeldt-Jakob disease | FAERS: 3 | US FAERS | |
| 644 | Dengue Fever | FAERS: 3 | US FAERS | |
| 645 | Diabetes mellitus inadequate control | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 646 | Dissociative disorder | FAERS: 3 | US FAERS | |
| 647 | Drug effect variable | FAERS: 3 | US FAERS | |
| 648 | Dysacusis | FAERS: 3 | US FAERS | |
| 649 | Dysentery | FAERS: 3 | US FAERS | |
| 650 | Dyslexia | FAERS: 3 | US FAERS | |
| 651 | Dysphasia | FAERS: 3 | US FAERS | |
| 652 | Dyspnoea exacerbated | FAERS: 3 | US FAERS | |
| 653 | Ecchymosis | FAERS: 3 | US FAERS | |
| 654 | Educational problem | FAERS: 3 | US FAERS | |
| 655 | Electromyogram abnormal | FAERS: 3 | US FAERS | |
| 656 | Embolism | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 657 | Emotional poverty | FAERS: 3 | US FAERS | |
| 658 | Epidermolysis | FAERS: 3 | US FAERS | |
| 659 | Epigastric discomfort | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 660 | Epileptic aura | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 661 | Escherichia infection | FAERS: 3 | US FAERS | |
| 662 | Expired drug administered | FAERS: 3 | US FAERS | |
| 663 | Extra dose administered | FAERS: 3 | US FAERS | |
| 664 | Eye symptom | FAERS: 3 | US FAERS | |
| 665 | Fat necrosis | FAERS: 3 | US FAERS | |
| 666 | Fibrosis | FAERS: 3 | US FAERS | |
| 667 | Fixed eruption | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 668 | Fulminant type 1 diabetes mellitus | FAERS: 3 | US FAERS | |
| 669 | Gammopathy | FAERS: 3 | US FAERS | |
| 670 | Gastrectomy | FAERS: 3 | US FAERS | |
| 671 | Gastric Dilatation | FAERS: 3 | US FAERS | |
| 672 | Gastrointestinal Pain | FAERS: 3 | SIDER US FAERS | |
| 673 | Genital Herpes | FAERS: 3 | US FAERS | |
| 674 | Genital pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 675 | Gout | FAERS: 3 | US FAERS | |
| 676 | Haematotoxicity | FAERS: 3 | US FAERS | |
| 677 | Head deformity | FAERS: 3 | US FAERS | |
| 678 | Hyperkinesia | FAERS: 3 | SIDER US FAERS | |
| 679 | Hyperplasia | FAERS: 3 | 18773962 | CTD US FAERS |
| 680 | Hypertrophic Cardiomyopathy | FAERS: 3 | US FAERS | |
| 681 | Hypoplastic Left Heart Syndrome | FAERS: 3 | OFFSIDES US FAERS | |
| 682 | Hypotrichosis | FAERS: 3 | US FAERS | |
| 683 | Hypoventilation | FAERS: 3 | US FAERS | |
| 684 | Immune thrombocytopenic purpura | FAERS: 3 | US FAERS | |
| 685 | Increased upper airway secretion | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 686 | Intentional product misuse | FAERS: 3 | US FAERS | |
| 687 | Labyrinthitis | FAERS: 3 | US FAERS | |
| 688 | Laryngospasm | FAERS: 3 | US FAERS | |
| 689 | Leukocytoclastic vasculitis | FAERS: 3 | US FAERS | |
| 690 | Limb injury | FAERS: 3 | US FAERS | |
| 691 | Limbic Encephalitis | FAERS: 3 | US FAERS | |
| 692 | Lymphocyte transformation test positive | FAERS: 3 | OFFSIDES US FAERS | |
| 693 | Maternal exposure timing unspecified | FAERS: 3 | US FAERS | |
| 694 | Mechanical ventilation | FAERS: 3 | US FAERS | |
| 695 | Medication residue | FAERS: 3 | US FAERS | |
| 696 | Megacolon | FAERS: 3 | US FAERS | |
| 697 | Meningioma | FAERS: 3 | US FAERS | |
| 698 | Metaplasia | FAERS: 3 | US FAERS | |
| 699 | Mitochondrial enzyme deficiency | FAERS: 3 | US FAERS | |
| 700 | Monocytosis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 701 | Mycosis Fungoides | FAERS: 3 | US FAERS | |
| 702 | Myopia | FAERS: 3 | US FAERS | |
| 703 | Nasal mucosal disorder | FAERS: 3 | US FAERS | |
| 704 | Nephritis | FAERS: 3 | US FAERS | |
| 705 | Nephrosclerosis | FAERS: 3 | US FAERS | |
| 706 | Neuritis | FAERS: 3 | SIDER US FAERS | |
| 707 | Neuromyelitis Optica | FAERS: 3 | US FAERS | |
| 708 | Neutrophil percentage decreased | FAERS: 3 | US FAERS | |
| 709 | Oral administration complication | FAERS: 3 | US FAERS | |
| 710 | Oral mucosal eruption | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 711 | Oropharyngeal spasm | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 712 | Osteomyelitis | FAERS: 3 | OFFSIDES US FAERS | |
| 713 | PCO2 increased | FAERS: 3 | US FAERS | |
| 714 | Pancreatic carcinoma | FAERS: 3 | US FAERS | |
| 715 | Pancreatic enlargement | FAERS: 3 | US FAERS | |
| 716 | Parakeratosis | FAERS: 3 | US FAERS | |
| 717 | Pemphigus | FAERS: 3 | US FAERS | |
| 718 | Pericarditis | FAERS: 3 | US FAERS | |
| 719 | Periodontitis | FAERS: 3 | US FAERS | |
| 720 | Phlebitis | FAERS: 3 | US FAERS | |
| 721 | Pityriasis Rubra Pilaris | FAERS: 3 | US FAERS | |
| 722 | Pre-Eclampsia | FAERS: 3 | US FAERS | |
| 723 | Pregnancy on contraceptive | FAERS: 3 | US FAERS | |
| 724 | Presyncope | FAERS: 3 | US FAERS | |
| 725 | Primary hypoparathyroidism | FAERS: 3 | US FAERS | |
| 726 | Product storage error | FAERS: 3 | US FAERS | |
| 727 | Protein total increased | FAERS: 3 | US FAERS | |
| 728 | Protein urine present | FAERS: 3 | US FAERS | |
| 729 | Protein-losing gastroenteropathy | FAERS: 3 | US FAERS | |
| 730 | Pseudolymphoma | FAERS: 3 Canada Vigilance: 1 | 9591791 12752131 | CTD SIDER Canada Vigilance US FAERS |
| 731 | Psychogenic seizure | FAERS: 3 | US FAERS | |
| 732 | Pupillary light reflex tests abnormal | FAERS: 3 | US FAERS | |
| 733 | Renal Cell Carcinoma | FAERS: 3 | US FAERS | |
| 734 | Renal cyst | FAERS: 3 | US FAERS | |
| 735 | Renal pain | FAERS: 3 | US FAERS | |
| 736 | Rickets | FAERS: 3 | US FAERS | |
| 737 | Sinoatrial Block | FAERS: 3 | CTD US FAERS | |
| 738 | Sinus bradycardia | FAERS: 3 | OFFSIDES US FAERS | |
| 739 | Sjogren's Syndrome | FAERS: 3 | US FAERS | |
| 740 | Slow response to stimuli | FAERS: 3 | US FAERS | |
| 741 | Sneezing | FAERS: 3 | US FAERS | |
| 742 | Subcutaneous Abscess | FAERS: 3 | US FAERS | |
| 743 | Sudden onset of sleep | FAERS: 3 | US FAERS | |
| 744 | Suppressed lactation | FAERS: 3 | US FAERS | |
| 745 | Systemic Inflammatory Response Syndrome | FAERS: 3 | US FAERS | |
| 746 | Temperature intolerance | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 747 | Temporal Arteritis | FAERS: 3 | US FAERS | |
| 748 | Tensilon test abnormal | FAERS: 3 | US FAERS | |
| 749 | Therapeutic response changed | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 750 | Thoracic Outlet Syndrome | FAERS: 3 | US FAERS | |
| 751 | Thoracic vertebral fracture | FAERS: 3 | OFFSIDES US FAERS | |
| 752 | Thymectomy | FAERS: 3 | US FAERS | |
| 753 | Thymoma | FAERS: 3 | US FAERS | |
| 754 | Tongue biting | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 755 | Tonic clonic movements | FAERS: 3 | US FAERS | |
| 756 | Tracheobronchitis | FAERS: 3 | US FAERS | |
| 757 | Unresponsive to pain stimuli | FAERS: 3 | US FAERS | |
| 758 | Urinary hesitation | FAERS: 3 | US FAERS | |
| 759 | Urine calcium increased | FAERS: 3 | US FAERS | |
| 760 | Urine output increased | FAERS: 3 | US FAERS | |
| 761 | Vaginal Discharge | FAERS: 3 | US FAERS | |
| 762 | Visceral congestion | FAERS: 3 | US FAERS | |
| 763 | Vitreous floaters | FAERS: 3 | US FAERS | |
| 764 | Water Intoxication | FAERS: 3 | 288398 6877534 | CTD SIDER US FAERS |
| 765 | Wound Infection | FAERS: 3 | US FAERS | |
| 766 | kyphosis | FAERS: 3 | OFFSIDES US FAERS | |
| 767 | oligodendroglioma | FAERS: 3 | US FAERS | |
| 768 | treatment failure | FAERS: 3 | US FAERS | |
| 769 | 17 ketosteroids urine decreased | FAERS: 2 | US FAERS | |
| 770 | Abdominal tenderness | FAERS: 2 | US FAERS | |
| 771 | Abscess | FAERS: 2 | OFFSIDES US FAERS | |
| 772 | Abulia | FAERS: 2 | US FAERS | |
| 773 | Acute Coronary Syndrome | FAERS: 2 | US FAERS | |
| 774 | Acute psychosis | FAERS: 2 | US FAERS | |
| 775 | Adrenocortical carcinoma | FAERS: 2 | US FAERS | |
| 776 | Albinism | FAERS: 2 | US FAERS | |
| 777 | Altered pitch perception | FAERS: 2 | US FAERS | |
| 778 | Altered visual depth perception | FAERS: 2 | US FAERS | |
| 779 | Amniotic Band Syndrome | FAERS: 2 | US FAERS | |
| 780 | Antiacetylcholine receptor antibody positive | FAERS: 2 | US FAERS | |
| 781 | Anticonvulsant drug level abnormal | FAERS: 2 | US FAERS | |
| 782 | Aplasia Cutis Congenita | FAERS: 2 | US FAERS | |
| 783 | Autoantibody positive | FAERS: 2 | US FAERS | |
| 784 | Automatism | FAERS: 2 | OFFSIDES US FAERS | |
| 785 | Bacterial sepsis | FAERS: 2 | OFFSIDES US FAERS | |
| 786 | Bicytopenia | FAERS: 2 | US FAERS | |
| 787 | Biopsy bone marrow abnormal | FAERS: 2 | US FAERS | |
| 788 | Blood Corticotrophin Decreased | FAERS: 2 | US FAERS | |
| 789 | Blood bilirubin unconjugated increased | FAERS: 2 | US FAERS | |
| 790 | Blood chloride abnormal | FAERS: 2 | US FAERS | |
| 791 | Blood chloride increased | FAERS: 2 | US FAERS | |
| 792 | Blood corticotrophin abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 793 | Blood cortisol abnormal | FAERS: 2 | US FAERS | |
| 794 | Blood creatinine decreased | FAERS: 2 | US FAERS | |
| 795 | Blood ethanol increased | FAERS: 2 | OFFSIDES US FAERS | |
| 796 | Blood fibrinogen increased | FAERS: 2 | US FAERS | |
| 797 | Blood folate decreased | FAERS: 2 | US FAERS | |
| 798 | Blood immunoglobulin A increased | FAERS: 2 | US FAERS | |
| 799 | Blood immunoglobulin M increased | FAERS: 2 | US FAERS | |
| 800 | Blood insulin decreased | FAERS: 2 | US FAERS | |
| 801 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 802 | Blood osmolarity increased | FAERS: 2 | US FAERS | |
| 803 | Blood thyroid stimulating hormone increased | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 804 | Bone fissure | FAERS: 2 | US FAERS | |
| 805 | Bone marrow toxicity | FAERS: 2 | US FAERS | |
| 806 | Brain scan abnormal | FAERS: 2 | US FAERS | |
| 807 | Brain stem syndrome | FAERS: 2 | US FAERS | |
| 808 | Bronchial secretion retention | FAERS: 2 | US FAERS | |
| 809 | Cardiac ablation | FAERS: 2 | US FAERS | |
| 810 | Cardiac enzymes increased | FAERS: 2 | US FAERS | |
| 811 | Cardiotoxicity | FAERS: 2 | US FAERS | |
| 812 | Catatonia | FAERS: 2 | 20159196 | CTD US FAERS |
| 813 | Cerebral Arteriosclerosis | FAERS: 2 | US FAERS | |
| 814 | Cerebrovascular operation | FAERS: 2 | US FAERS | |
| 815 | Chemical injury | FAERS: 2 | US FAERS | |
| 816 | Cholangiocarcinoma | FAERS: 2 | US FAERS | |
| 817 | Chronic gastritis | FAERS: 2 | US FAERS | |
| 818 | Cleft uvula | FAERS: 2 | US FAERS | |
| 819 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 820 | Cognitive deterioration | FAERS: 2 | US FAERS | |
| 821 | Cogwheel Rigidity | FAERS: 2 | US FAERS | |
| 822 | Complement factor decreased | FAERS: 2 | US FAERS | |
| 823 | Conduct Disorder | FAERS: 2 | US FAERS | |
| 824 | Congenital Hypothyroidism | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 825 | Congenital facial nerve hypoplasia | FAERS: 2 | US FAERS | |
| 826 | Congenital neurological disorder | FAERS: 2 | US FAERS | |
| 827 | Congenital pyelocaliectasis | FAERS: 2 | US FAERS | |
| 828 | Coproporphyrinogen increased | FAERS: 2 | US FAERS | |
| 829 | Corneal erosion | FAERS: 2 | OFFSIDES US FAERS | |
| 830 | Corneal exfoliation | FAERS: 2 | US FAERS | |
| 831 | Corneal light reflex test abnormal | FAERS: 2 | US FAERS | |
| 832 | Cortisol free urine increased | FAERS: 2 | US FAERS | |
| 833 | Culture wound positive | FAERS: 2 | US FAERS | |
| 834 | Cutis Laxa | FAERS: 2 | US FAERS | |
| 835 | Dehydroepiandrosterone decreased | FAERS: 2 | US FAERS | |
| 836 | Delayed Puberty | FAERS: 2 | US FAERS | |
| 837 | Demyelination | FAERS: 2 | OFFSIDES US FAERS | |
| 838 | Dependent Personality Disorder | FAERS: 2 | US FAERS | |
| 839 | Dermatomyositis | FAERS: 2 | US FAERS | |
| 840 | Device dislocation | FAERS: 2 | US FAERS | |
| 841 | Device related infection | FAERS: 2 | US FAERS | |
| 842 | Device use issue | FAERS: 2 | US FAERS | |
| 843 | Dexamethasone suppression test positive | FAERS: 2 | US FAERS | |
| 844 | Diplegia | FAERS: 2 | US FAERS | |
| 845 | Disease Progression | FAERS: 2 | US FAERS | |
| 846 | Diverticulum | FAERS: 2 | US FAERS | |
| 847 | Dyslalia | FAERS: 2 | US FAERS | |
| 848 | Echocardiogram abnormal | FAERS: 2 | US FAERS | |
| 849 | Economic problem | FAERS: 2 | US FAERS | |
| 850 | Electrocardiogram change | FAERS: 2 | US FAERS | |
| 851 | Enteritis | FAERS: 2 | US FAERS | |
| 852 | Enzyme Induction | FAERS: 2 | SIDER US FAERS | |
| 853 | Eosinophilic myocarditis | FAERS: 2 | US FAERS | |
| 854 | Erythrosis | FAERS: 2 | US FAERS | |
| 855 | Eschar | FAERS: 2 | US FAERS | |
| 856 | Eye Infection | FAERS: 2 | US FAERS | |
| 857 | False positive investigation result | FAERS: 2 | US FAERS | |
| 858 | False positive laboratory result | FAERS: 2 | US FAERS | |
| 859 | Feeling jittery | FAERS: 2 | US FAERS | |
| 860 | Fibromatosis | FAERS: 2 | US FAERS | |
| 861 | Flight of ideas | FAERS: 2 | US FAERS | |
| 862 | Foaming at mouth | FAERS: 2 | US FAERS | |
| 863 | Food Poisoning | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 864 | Foreign body aspiration | FAERS: 2 | US FAERS | |
| 865 | Frustration tolerance decreased | FAERS: 2 | US FAERS | |
| 866 | Full blood count decreased | FAERS: 2 | US FAERS | |
| 867 | Gastric pH decreased | FAERS: 2 | US FAERS | |
| 868 | Gastrointestinal hypomotility | FAERS: 2 | US FAERS | |
| 869 | Gastrointestinal motility disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 870 | Gastrointestinal perforation | FAERS: 2 | US FAERS | |
| 871 | Genital erosion | FAERS: 2 | OFFSIDES US FAERS | |
| 872 | Gingival Hyperplasia | FAERS: 2 | OFFSIDES US FAERS | |
| 873 | Glioma | FAERS: 2 | US FAERS | |
| 874 | Glossitis | FAERS: 2 | SIDER US FAERS | |
| 875 | Glutathione decreased | FAERS: 2 | US FAERS | |
| 876 | Glycosuria | FAERS: 2 | SIDER US FAERS | |
| 877 | Granulomatous liver disease | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 878 | HELLP Syndrome | FAERS: 2 | US FAERS | |
| 879 | Heart sounds abnormal | FAERS: 2 | US FAERS | |
| 880 | Heat Stroke | FAERS: 2 | US FAERS | |
| 881 | Heparin-induced thrombocytopenia | FAERS: 2 | US FAERS | |
| 882 | Hepatitis B | FAERS: 2 | US FAERS | |
| 883 | Herpes simplex serology positive | FAERS: 2 | US FAERS | |
| 884 | Hidradenitis | FAERS: 2 | US FAERS | |
| 885 | Hippocampal sclerosis | FAERS: 2 | US FAERS | |
| 886 | Hordeolum | FAERS: 2 | US FAERS | |
| 887 | Hostility | FAERS: 2 | US FAERS | |
| 888 | Hydronephrosis | FAERS: 2 | OFFSIDES US FAERS | |
| 889 | Hyperleukocytosis | FAERS: 2 | US FAERS | |
| 890 | Hypermetabolism | FAERS: 2 | US FAERS | |
| 891 | Hypermobility syndrome | FAERS: 2 | US FAERS | |
| 892 | Hyperphagia | FAERS: 2 | US FAERS | |
| 893 | Hypoaesthesia facial | FAERS: 2 | OFFSIDES US FAERS | |
| 894 | Hypomania | FAERS: 2 | OFFSIDES US FAERS | |
| 895 | Hypoosmolar state | FAERS: 2 | US FAERS | |
| 896 | Hypoperfusion | FAERS: 2 | US FAERS | |
| 897 | Hypothalamo-pituitary disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 898 | Hysterectomy | FAERS: 2 | US FAERS | |
| 899 | Immunology test abnormal | FAERS: 2 | US FAERS | |
| 900 | Impaired gastric emptying | FAERS: 2 | SIDER US FAERS | |
| 901 | Impaired insulin secretion | FAERS: 2 | US FAERS | |
| 902 | Impaired self-care | FAERS: 2 | US FAERS | |
| 903 | Inappropriate affect | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 904 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 905 | Incorrect drug dosage form administered | FAERS: 2 | US FAERS | |
| 906 | Incorrect product formulation administered | FAERS: 2 | US FAERS | |
| 907 | Increased bronchial secretion | FAERS: 2 | US FAERS | |
| 908 | Infarction | FAERS: 2 | US FAERS | |
| 909 | Infectious peritonitis | FAERS: 2 | US FAERS | |
| 910 | Intermittent Claudication | FAERS: 2 | US FAERS | |
| 911 | Interstitial granulomatous dermatitis | FAERS: 2 | US FAERS | |
| 912 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 913 | Intracranial Hypotension | FAERS: 2 | US FAERS | |
| 914 | Irregular breathing | FAERS: 2 | US FAERS | |
| 915 | Juvenile arthritis | FAERS: 2 | US FAERS | |
| 916 | Laboratory test interference | FAERS: 2 | US FAERS | |
| 917 | Lactobacillus infection | FAERS: 2 | US FAERS | |
| 918 | Laziness | FAERS: 2 | US FAERS | |
| 919 | Leukoaraiosis | FAERS: 2 | US FAERS | |
| 920 | Lichen Planus | FAERS: 2 | US FAERS | |
| 921 | Limb crushing injury | FAERS: 2 | US FAERS | |
| 922 | Limbal stem cell deficiency | FAERS: 2 | US FAERS | |
| 923 | Lipase increased | FAERS: 2 | US FAERS | |
| 924 | Lipoma | FAERS: 2 | US FAERS | |
| 925 | Lividity | FAERS: 2 | US FAERS | |
| 926 | Lobar Pneumonia | FAERS: 2 | US FAERS | |
| 927 | Loose tooth | FAERS: 2 | US FAERS | |
| 928 | Lymphocyte stimulation test | FAERS: 2 | US FAERS | |
| 929 | MELAS Syndrome | FAERS: 2 | US FAERS | |
| 930 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 931 | Macular degeneration | FAERS: 2 | US FAERS | |
| 932 | Malabsorption | FAERS: 2 | US FAERS | |
| 933 | Malignant dysphagia | FAERS: 2 | US FAERS | |
| 934 | Medical device implantation | FAERS: 2 | US FAERS | |
| 935 | Metrorrhagia | FAERS: 2 | US FAERS | |
| 936 | Mitochondrial cytopathy | FAERS: 2 | US FAERS | |
| 937 | Mouth swelling | FAERS: 2 | US FAERS | |
| 938 | Muscle Cramp | FAERS: 2 | US FAERS | |
| 939 | Muscular Dystrophy | FAERS: 2 | US FAERS | |
| 940 | Musculoskeletal chest pain | FAERS: 2 | OFFSIDES US FAERS | |
| 941 | Myasthenic Syndrome | FAERS: 2 | US FAERS | |
| 942 | Mycoplasma serology positive | FAERS: 2 | US FAERS | |
| 943 | Mycoplasma test positive | FAERS: 2 | US FAERS | |
| 944 | Neonatal aspiration | FAERS: 2 | US FAERS | |
| 945 | Neonatal disorder | FAERS: 2 | US FAERS | |
| 946 | Neonatal respiratory alkalosis | FAERS: 2 | US FAERS | |
| 947 | Nerve Block | FAERS: 2 | US FAERS | |
| 948 | Neurological examination abnormal | FAERS: 2 | US FAERS | |
| 949 | Ocular discomfort | FAERS: 2 | US FAERS | |
| 950 | Oligohydramnios | FAERS: 2 | US FAERS | |
| 951 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 952 | Oral mucosal erythema | FAERS: 2 | US FAERS | |
| 953 | Oropharyngeal discomfort | FAERS: 2 | US FAERS | |
| 954 | Osteitis Deformans | FAERS: 2 | US FAERS | |
| 955 | PCO2 decreased | FAERS: 2 | US FAERS | |
| 956 | Pancreatic enzymes increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 957 | Panic Disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 958 | Pathological fracture | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 959 | Penile size reduced | FAERS: 2 | US FAERS | |
| 960 | Performance status decreased | FAERS: 2 | US FAERS | |
| 961 | Periarthritis | FAERS: 2 | OFFSIDES US FAERS | |
| 962 | Peritoneal lavage | FAERS: 2 | US FAERS | |
| 963 | Perseveration | FAERS: 2 | US FAERS | |
| 964 | Pharyngeal erosion | FAERS: 2 | US FAERS | |
| 965 | Physical abuse | FAERS: 2 | US FAERS | |
| 966 | Placental Insufficiency | FAERS: 2 | US FAERS | |
| 967 | Polydactyly | FAERS: 2 | US FAERS | |
| 968 | Polyneuropathy | FAERS: 2 | OFFSIDES US FAERS | |
| 969 | Polyserositis | FAERS: 2 | US FAERS | |
| 970 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 971 | Poor weight gain neonatal | FAERS: 2 | US FAERS | |
| 972 | Portal Hypertension | FAERS: 2 | US FAERS | |
| 973 | Post inflammatory pigmentation change | FAERS: 2 | US FAERS | |
| 974 | Post procedural bile leak | FAERS: 2 | US FAERS | |
| 975 | Pregnancy test positive | FAERS: 2 | US FAERS | |
| 976 | Premenstrual syndrome | FAERS: 2 | US FAERS | |
| 977 | Prescription drug used without a prescription | FAERS: 2 | US FAERS | |
| 978 | Product lot number issue | FAERS: 2 | US FAERS | |
| 979 | Product measured potency issue | FAERS: 2 | US FAERS | |
| 980 | Product residue present | FAERS: 2 | US FAERS | |
| 981 | Product solubility abnormal | FAERS: 2 | US FAERS | |
| 982 | Product supply issue | FAERS: 2 | US FAERS | |
| 983 | Prothrombin time abnormal | FAERS: 2 | US FAERS | |
| 984 | Pseudomonas test positive | FAERS: 2 | US FAERS | |
| 985 | Psychiatric symptom | FAERS: 2 | US FAERS | |
| 986 | Pyelocaliectasis | FAERS: 2 | US FAERS | |
| 987 | Pyogenic granuloma | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 988 | Pyuria | FAERS: 2 | OFFSIDES US FAERS | |
| 989 | Rash maculovesicular | FAERS: 2 | US FAERS | |
| 990 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 991 | Respiratory tract infection bacterial | FAERS: 2 | US FAERS | |
| 992 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 993 | Rheumatoid factor increased | FAERS: 2 | US FAERS | |
| 994 | Sarcoidosis | FAERS: 2 | OFFSIDES US FAERS | |
| 995 | Seizure like phenomena | FAERS: 2 | US FAERS | |
| 996 | Self Mutilation | FAERS: 2 | US FAERS | |
| 997 | Sensory level abnormal | FAERS: 2 | US FAERS | |
| 998 | Single functional kidney | FAERS: 2 | US FAERS | |
| 999 | Single umbilical artery | FAERS: 2 | US FAERS | |
| 1000 | Skeletal dysplasia | FAERS: 2 | US FAERS | |
| 1001 | Slow speech | FAERS: 2 | US FAERS | |
| 1002 | Snoring | FAERS: 2 | OFFSIDES US FAERS | |
| 1003 | Specific gravity urine decreased | FAERS: 2 | US FAERS | |
| 1004 | Sperm count decreased | FAERS: 2 | SIDER US FAERS | |
| 1005 | Splenic Infarction | FAERS: 2 | US FAERS | |
| 1006 | Staphylococcal impetigo | FAERS: 2 | US FAERS | |
| 1007 | Staphylococcus test positive | FAERS: 2 | US FAERS | |
| 1008 | Stenotrophomonas infection | FAERS: 2 | US FAERS | |
| 1009 | Syndactyly | FAERS: 2 | US FAERS | |
| 1010 | Syphilis | FAERS: 2 | US FAERS | |
| 1011 | Tardive Dyskinesia | FAERS: 2 | US FAERS | |
| 1012 | Tension | FAERS: 2 | SIDER US FAERS | |
| 1013 | Therapeutic product ineffective | FAERS: 2 | US FAERS | |
| 1014 | Therapy cessation | FAERS: 2 | US FAERS | |
| 1015 | Therapy change | FAERS: 2 | US FAERS | |
| 1016 | Thyroid Neoplasm | FAERS: 2 | US FAERS | |
| 1017 | Tooth Extraction | FAERS: 2 | OFFSIDES US FAERS | |
| 1018 | Trendelenburg's symptom | FAERS: 2 | US FAERS | |
| 1019 | Trigeminal Nerve Disorder | FAERS: 2 | US FAERS | |
| 1020 | Tuberculosis | FAERS: 2 | US FAERS | |
| 1021 | Unexpected therapeutic drug effect | FAERS: 2 | US FAERS | |
| 1022 | Urinary occult blood positive | FAERS: 2 | US FAERS | |
| 1023 | Urine amylase increased | FAERS: 2 | US FAERS | |
| 1024 | Urine calcium decreased | FAERS: 2 | US FAERS | |
| 1025 | Urine flow decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 1026 | Urobilin urine present | FAERS: 2 | US FAERS | |
| 1027 | Vein pain | FAERS: 2 | US FAERS | |
| 1028 | Venous Thrombosis | FAERS: 2 | 11086405 | CTD US FAERS |
| 1029 | Venous occlusion | FAERS: 2 | US FAERS | |
| 1030 | Ventricular Flutter | FAERS: 2 | US FAERS | |
| 1031 | Viral upper respiratory tract infection | FAERS: 2 | US FAERS | |
| 1032 | Vitreous opacities | FAERS: 2 | US FAERS | |
| 1033 | Vocal Cord Paralysis | FAERS: 2 | US FAERS | |
| 1034 | Vulvovaginal discomfort | FAERS: 2 | US FAERS | |
| 1035 | Wound infection staphylococcal | FAERS: 2 | OFFSIDES US FAERS | |
| 1036 | pseudomembranous colitis | FAERS: 2 | US FAERS | |
| 1037 | Acantholysis | FAERS: 1 | US FAERS | |
| 1038 | Acanthosis Nigricans | FAERS: 1 | US FAERS | |
| 1039 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 1040 | Accessory kidney | FAERS: 1 | US FAERS | |
| 1041 | Accidental death | FAERS: 1 | US FAERS | |
| 1042 | Acquired night blindness | FAERS: 1 | US FAERS | |
| 1043 | Acromegaly | FAERS: 1 | US FAERS | |
| 1044 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 1045 | Acute prerenal failure | FAERS: 1 | US FAERS | |
| 1046 | Acute sinusitis | FAERS: 1 | US FAERS | |
| 1047 | Adenoviral upper respiratory infection | FAERS: 1 | US FAERS | |
| 1048 | Adiposis Dolorosa | FAERS: 1 | US FAERS | |
| 1049 | Administration site discomfort | FAERS: 1 | US FAERS | |
| 1050 | Agnosia | FAERS: 1 | US FAERS | |
| 1051 | Agonal rhythm | FAERS: 1 | US FAERS | |
| 1052 | Albuminuria | FAERS: 1 | SIDER US FAERS | |
| 1053 | Alexia | FAERS: 1 | US FAERS | |
| 1054 | Allergic bronchitis | FAERS: 1 | US FAERS | |
| 1055 | Allergy test positive | FAERS: 1 | US FAERS | |
| 1056 | Allodynia | FAERS: 1 | US FAERS | |
| 1057 | Alopecia effluvium | FAERS: 1 | US FAERS | |
| 1058 | Alopecia totalis | FAERS: 1 | US FAERS | |
| 1059 | Ammonia abnormal | FAERS: 1 | US FAERS | |
| 1060 | Amniotic fluid volume decreased | FAERS: 1 | US FAERS | |
| 1061 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 1062 | Amputation | FAERS: 1 | US FAERS | |
| 1063 | Anal Fissure | FAERS: 1 | US FAERS | |
| 1064 | Anal erosion | FAERS: 1 | US FAERS | |
| 1065 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 1066 | Anaplastic large cell lymphoma T- and null-cell types | FAERS: 1 | US FAERS | |
| 1067 | Anencephaly | FAERS: 1 | US FAERS | |
| 1068 | Angiomyolipoma | FAERS: 1 | US FAERS | |
| 1069 | Angular cheilitis | FAERS: 1 | US FAERS | |
| 1070 | Anorexia Nervosa | FAERS: 1 | US FAERS | |
| 1071 | Anoxic Encephalopathy | FAERS: 1 | US FAERS | |
| 1072 | Anti-aquaporin-4 antibody positive | FAERS: 1 | US FAERS | |
| 1073 | Antibody test abnormal | FAERS: 1 | US FAERS | |
| 1074 | Anticonvulsant drug level | FAERS: 1 | US FAERS | |
| 1075 | Anticonvulsant toxicity | FAERS: 1 | US FAERS | |
| 1076 | Antidepressant drug level increased | FAERS: 1 | US FAERS | |
| 1077 | Antiphospholipid antibodies positive | FAERS: 1 | OFFSIDES US FAERS | |
| 1078 | Antithrombin III increased | FAERS: 1 | US FAERS | |
| 1079 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 1080 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 1081 | Arteritis | FAERS: 1 | US FAERS | |
| 1082 | Aspergillosis | FAERS: 1 | US FAERS | |
| 1083 | Atherosclerosis | FAERS: 1 | US FAERS | |
| 1084 | Atrioventricular Septal Defect | FAERS: 1 | US FAERS | |
| 1085 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 1086 | Bacterial test | FAERS: 1 | US FAERS | |
| 1087 | Balanitis | FAERS: 1 | US FAERS | |
| 1088 | Ballismus | FAERS: 1 | US FAERS | |
| 1089 | Basophilia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1090 | Beta 2 microglobulin increased | FAERS: 1 | US FAERS | |
| 1091 | Bicuspid aortic valve | FAERS: 1 | US FAERS | |
| 1092 | Biliary tract infection | FAERS: 1 | US FAERS | |
| 1093 | Biopsy bronchus abnormal | FAERS: 1 | US FAERS | |
| 1094 | Biopsy colon abnormal | FAERS: 1 | US FAERS | |
| 1095 | Biopsy heart abnormal | FAERS: 1 | US FAERS | |
| 1096 | Biopsy larynx abnormal | FAERS: 1 | US FAERS | |
| 1097 | Biopsy lung abnormal | FAERS: 1 | US FAERS | |
| 1098 | Biopsy lymph gland abnormal | FAERS: 1 | US FAERS | |
| 1099 | Biopsy pleura abnormal | FAERS: 1 | US FAERS | |
| 1100 | Biopsy trachea abnormal | FAERS: 1 | US FAERS | |
| 1101 | Biopsy | FAERS: 1 | US FAERS | |
| 1102 | Biotin deficiency | FAERS: 1 | US FAERS | |
| 1103 | Blighted ovum | FAERS: 1 | US FAERS | |
| 1104 | Blood 25-hydroxycholecalciferol decreased | FAERS: 1 | US FAERS | |
| 1105 | Blood amino acid level increased | FAERS: 1 | US FAERS | |
| 1106 | Blood amylase decreased | FAERS: 1 | US FAERS | |
| 1107 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 1108 | Blood catecholamines increased | FAERS: 1 | US FAERS | |
| 1109 | Blood chloride decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 1110 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 1111 | Blood cholinesterase decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 1112 | Blood corticotrophin increased | FAERS: 1 | US FAERS | |
| 1113 | Blood creatine phosphokinase | FAERS: 1 | US FAERS | |
| 1114 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 1115 | Blood folate increased | FAERS: 1 | US FAERS | |
| 1116 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 1117 | Blood glucose decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 1118 | Blood iron abnormal | FAERS: 1 | US FAERS | |
| 1119 | Blood iron increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1120 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 1121 | Blood osmolarity abnormal | FAERS: 1 | US FAERS | |
| 1122 | Blood osmolarity decreased | FAERS: 1 | SIDER US FAERS | |
| 1123 | Blood parathyroid hormone decreased | FAERS: 1 | US FAERS | |
| 1124 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 1125 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 1126 | Blood sodium increased | FAERS: 1 | OFFSIDES US FAERS | |
| 1127 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 1128 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 1129 | Blood triglycerides abnormal | FAERS: 1 | US FAERS | |
| 1130 | Bone formation decreased | FAERS: 1 | US FAERS | |
| 1131 | Bone fragmentation | FAERS: 1 | US FAERS | |
| 1132 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 1133 | Brachydactyly | FAERS: 1 | US FAERS | |
| 1134 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 1135 | Breakthrough Pain | FAERS: 1 | US FAERS | |
| 1136 | Breast tenderness | FAERS: 1 | US FAERS | |
| 1137 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 1138 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 1139 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 1140 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 1141 | Bronchoalveolar lavage abnormal | FAERS: 1 | US FAERS | |
| 1142 | Bronchoscopy abnormal | FAERS: 1 | US FAERS | |
| 1143 | Bronchospasm | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1144 | Cachexia | FAERS: 1 | US FAERS | |
| 1145 | Calcium deficiency | FAERS: 1 | US FAERS | |
| 1146 | Candida sepsis | FAERS: 1 | US FAERS | |
| 1147 | Candida serology positive | FAERS: 1 | US FAERS | |
| 1148 | Candidiasis | FAERS: 1 | US FAERS | |
| 1149 | Cardiac Hypertrophy | FAERS: 1 | US FAERS | |
| 1150 | Cardiac Tamponade | FAERS: 1 | 10669712 | CTD US FAERS |
| 1151 | Cardiac function disturbance postoperative | FAERS: 1 | US FAERS | |
| 1152 | Cardiac function test abnormal | FAERS: 1 | US FAERS | |
| 1153 | Cardiac neoplasm unspecified | FAERS: 1 | US FAERS | |
| 1154 | Cardiac valve replacement complication | FAERS: 1 | US FAERS | |
| 1155 | Carnitine decreased | FAERS: 1 | US FAERS | |
| 1156 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 1157 | Cataplexy | FAERS: 1 | US FAERS | |
| 1158 | Catheter placement | FAERS: 1 | US FAERS | |
| 1159 | Caustic injury | FAERS: 1 | US FAERS | |
| 1160 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 1161 | Cerebral calcification | FAERS: 1 | US FAERS | |
| 1162 | Cerebral hypoperfusion | FAERS: 1 | US FAERS | |
| 1163 | Cerebral perfusion pressure decreased | FAERS: 1 | US FAERS | |
| 1164 | Cerebral salt-wasting syndrome | FAERS: 1 | US FAERS | |
| 1165 | Cerebral ventricle dilatation | FAERS: 1 | US FAERS | |
| 1166 | Cervical dysplasia | FAERS: 1 | US FAERS | |
| 1167 | Chemotherapy | FAERS: 1 | US FAERS | |
| 1168 | Choanal Atresia | FAERS: 1 | US FAERS | |
| 1169 | Cholecystitis infective | FAERS: 1 | OFFSIDES US FAERS | |
| 1170 | Chorea | FAERS: 1 | US FAERS | |
| 1171 | Choreoathetosis | FAERS: 1 | SIDER US FAERS | |
| 1172 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 1173 | Clinodactyly | FAERS: 1 | US FAERS | |
| 1174 | Coagulation test abnormal | FAERS: 1 | US FAERS | |
| 1175 | Coagulation time shortened | FAERS: 1 | OFFSIDES US FAERS | |
| 1176 | Complement factor C3 decreased | FAERS: 1 | US FAERS | |
| 1177 | Complement factor C4 decreased | FAERS: 1 | US FAERS | |
| 1178 | Compulsive cheek biting | FAERS: 1 | US FAERS | |
| 1179 | Compulsive lip biting | FAERS: 1 | US FAERS | |
| 1180 | Compulsive sexual behaviour | FAERS: 1 | US FAERS | |
| 1181 | Congenital Hydrocephalus | FAERS: 1 | US FAERS | |
| 1182 | Congenital brain damage | FAERS: 1 | US FAERS | |
| 1183 | Congenital cerebellar agenesis | FAERS: 1 | US FAERS | |
| 1184 | Congenital heart valve disorder | FAERS: 1 | US FAERS | |
| 1185 | Congenital intestinal malformation | FAERS: 1 | US FAERS | |
| 1186 | Congenital renal cyst | FAERS: 1 | US FAERS | |
| 1187 | Conjunctival degeneration | FAERS: 1 | US FAERS | |
| 1188 | Conjunctival erosion | FAERS: 1 | US FAERS | |
| 1189 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 1190 | Contracted bladder | FAERS: 1 | US FAERS | |
| 1191 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 1192 | Corneal defect | FAERS: 1 | US FAERS | |
| 1193 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 1194 | Coronary Artery Disease | FAERS: 1 | 12693787 | CTD SIDER US FAERS |
| 1195 | Cortical Dysplasia | FAERS: 1 | US FAERS | |
| 1196 | Craniofacial deformity | FAERS: 1 | US FAERS | |
| 1197 | Craniosynostosis | FAERS: 1 | US FAERS | |
| 1198 | Cubital Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 1199 | Culture urine positive | FAERS: 1 | US FAERS | |
| 1200 | Cystitis | FAERS: 1 | US FAERS | |
| 1201 | Cyst | FAERS: 1 | US FAERS | |
| 1202 | Cytokine storm | FAERS: 1 | US FAERS | |
| 1203 | Cytomegalovirus hepatitis | FAERS: 1 | US FAERS | |
| 1204 | Cytopenia | FAERS: 1 | US FAERS | |
| 1205 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 1206 | Deja Vu | FAERS: 1 | US FAERS | |
| 1207 | Delayed delivery | FAERS: 1 | US FAERS | |
| 1208 | Delusional disorder, persecutory type | FAERS: 1 | OFFSIDES US FAERS | |
| 1209 | Depression suicidal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1210 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 1211 | Dermoid Cyst | FAERS: 1 | US FAERS | |
| 1212 | Dermoid cyst of ovary | FAERS: 1 | US FAERS | |
| 1213 | Developmental Coordination Disorder | FAERS: 1 | US FAERS | |
| 1214 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 1215 | Diet refusal | FAERS: 1 | US FAERS | |
| 1216 | Diffuse panbronchiolitis | FAERS: 1 | US FAERS | |
| 1217 | Disease complication | FAERS: 1 | US FAERS | |
| 1218 | Disseminated intravascular coagulation in newborn | FAERS: 1 | US FAERS | |
| 1219 | Districhiasis | FAERS: 1 | US FAERS | |
| 1220 | Diverticulitis | FAERS: 1 | US FAERS | |
| 1221 | Double ureter | FAERS: 1 | US FAERS | |
| 1222 | Dreamy state | FAERS: 1 | US FAERS | |
| 1223 | Drug abuser | FAERS: 1 | US FAERS | |
| 1224 | Drug cross-reactivity | FAERS: 1 | US FAERS | |
| 1225 | Drug diversion | FAERS: 1 | US FAERS | |
| 1226 | Drug resistance | FAERS: 1 | US FAERS | |
| 1227 | Dry age-related macular degeneration | FAERS: 1 | US FAERS | |
| 1228 | Duodenal atresia | FAERS: 1 | US FAERS | |
| 1229 | Dwarfism | FAERS: 1 | US FAERS | |
| 1230 | Dyscalculia | FAERS: 1 | US FAERS | |
| 1231 | Dysgraphia | FAERS: 1 | US FAERS | |
| 1232 | Dysplasia | FAERS: 1 | US FAERS | |
| 1233 | Dysthymic Disorder | FAERS: 1 | US FAERS | |
| 1234 | Ear infection staphylococcal | FAERS: 1 | US FAERS | |
| 1235 | Echography abnormal | FAERS: 1 | US FAERS | |
| 1236 | Echopraxia | FAERS: 1 | US FAERS | |
| 1237 | Eclampsia | FAERS: 1 | US FAERS | |
| 1238 | Ectopic Pregnancy | FAERS: 1 | US FAERS | |
| 1239 | Ectropion | FAERS: 1 | US FAERS | |
| 1240 | Ejection Fraction Decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 1241 | Electrocardiogram ST segment abnormal | FAERS: 1 | US FAERS | |
| 1242 | Elevated mood | FAERS: 1 | US FAERS | |
| 1243 | Endocarditis | FAERS: 1 | US FAERS | |
| 1244 | Endometriosis | FAERS: 1 | US FAERS | |
| 1245 | Enterobacter test positive | FAERS: 1 | US FAERS | |
| 1246 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 1247 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 1248 | Eosinophil percentage increased | FAERS: 1 | US FAERS | |
| 1249 | Eosinophilic pustular folliculitis | FAERS: 1 | US FAERS | |
| 1250 | Episcleritis | FAERS: 1 | OFFSIDES US FAERS | |
| 1251 | Episiotomy | FAERS: 1 | US FAERS | |
| 1252 | Epstein-Barr virus antigen positive | FAERS: 1 | US FAERS | |
| 1253 | Epstein-Barr virus test positive | FAERS: 1 | US FAERS | |
| 1254 | Erysipelas | FAERS: 1 | US FAERS | |
| 1255 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 1256 | Escherichia test positive | FAERS: 1 | US FAERS | |
| 1257 | Essential Hypertension | FAERS: 1 | OFFSIDES US FAERS | |
| 1258 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 1259 | Eye Burns | FAERS: 1 | US FAERS | |
| 1260 | Eye Redness | FAERS: 1 | US FAERS | |
| 1261 | Eye inflammation | FAERS: 1 | US FAERS | |
| 1262 | Eyelid erosion | FAERS: 1 | US FAERS | |
| 1263 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 1264 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 1265 | Facial Paresis | FAERS: 1 | US FAERS | |
| 1266 | Facial asymmetry | FAERS: 1 | US FAERS | |
| 1267 | Facial paralysis | FAERS: 1 | US FAERS | |
| 1268 | Fear of falling | FAERS: 1 | US FAERS | |
| 1269 | Feeding disorder neonatal | FAERS: 1 | US FAERS | |
| 1270 | Feeding disorder of infancy OR early childhood | FAERS: 1 | US FAERS | |
| 1271 | Feeding tube complication | FAERS: 1 | US FAERS | |
| 1272 | Fluid overload | FAERS: 1 | OFFSIDES US FAERS | |
| 1273 | Fluid replacement | FAERS: 1 | US FAERS | |
| 1274 | Folliculitis | FAERS: 1 | OFFSIDES US FAERS | |
| 1275 | Fontanelle depressed | FAERS: 1 | US FAERS | |
| 1276 | Food Allergy | FAERS: 1 | US FAERS | |
| 1277 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 1278 | Formication | FAERS: 1 | OFFSIDES US FAERS | |
| 1279 | Frustration | FAERS: 1 | US FAERS | |
| 1280 | Gastric Fistula | FAERS: 1 | US FAERS | |
| 1281 | Gastric infection | FAERS: 1 | US FAERS | |
| 1282 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 1283 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 1284 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 1285 | Gastrointestinal wall thickening | FAERS: 1 | US FAERS | |
| 1286 | Genital discharge | FAERS: 1 | US FAERS | |
| 1287 | Giant Cell Epulis | FAERS: 1 | US FAERS | |
| 1288 | Gingival Hypertrophy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1289 | Gingival erythema | FAERS: 1 | US FAERS | |
| 1290 | Glossopharyngeal Neuralgia | FAERS: 1 | US FAERS | |
| 1291 | Glucose tolerance test | FAERS: 1 | US FAERS | |
| 1292 | Glutamate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 1293 | Granulocyte count decreased | FAERS: 1 | US FAERS | |
| 1294 | Granulocyte count increased | FAERS: 1 | US FAERS | |
| 1295 | Haemoconcentration | FAERS: 1 | US FAERS | |
| 1296 | Hallucinations, mixed | FAERS: 1 | OFFSIDES US FAERS | |
| 1297 | Haptoglobin Decreased | FAERS: 1 | US FAERS | |
| 1298 | Haptoglobin increased | FAERS: 1 | US FAERS | |
| 1299 | Head lag | FAERS: 1 | US FAERS | |
| 1300 | Hearing disability | FAERS: 1 | US FAERS | |
| 1301 | Hepatic infiltration eosinophilic | FAERS: 1 | US FAERS | |
| 1302 | Hepatitis A | FAERS: 1 | US FAERS | |
| 1303 | Hepatitis B antibody positive | FAERS: 1 | US FAERS | |
| 1304 | Hepatitis E | FAERS: 1 | US FAERS | |
| 1305 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 1306 | Herpes Zoster Oticus | FAERS: 1 | US FAERS | |
| 1307 | Herpes pharyngitis | FAERS: 1 | US FAERS | |
| 1308 | Herpes simplex DNA test positive | FAERS: 1 | US FAERS | |
| 1309 | High density lipoprotein increased | FAERS: 1 | SIDER US FAERS | |
| 1310 | Hydrothorax | FAERS: 1 | US FAERS | |
| 1311 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 1312 | Hypercreatinaemia | FAERS: 1 | US FAERS | |
| 1313 | Hypersplenism | FAERS: 1 | US FAERS | |
| 1314 | Hypertensive Encephalopathy | FAERS: 1 | 11836887 | CTD US FAERS |
| 1315 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 1316 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 1317 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 1318 | Hypertrophy | FAERS: 1 | US FAERS | |
| 1319 | Hyponatraemic seizure | FAERS: 1 | US FAERS | |
| 1320 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 1321 | Impatience | FAERS: 1 | US FAERS | |
| 1322 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 1323 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 1324 | Infantile spitting up | FAERS: 1 | US FAERS | |
| 1325 | Infant | FAERS: 1 | US FAERS | |
| 1326 | Infection reactivation | FAERS: 1 | US FAERS | |
| 1327 | Influenza serology positive | FAERS: 1 | US FAERS | |
| 1328 | Initial insomnia | FAERS: 1 | US FAERS | |
| 1329 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 1330 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 1331 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 1332 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 1333 | Intermittent Explosive Disorder | FAERS: 1 | US FAERS | |
| 1334 | Intervertebral disc disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 1335 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 1336 | Intussusception | FAERS: 1 | US FAERS | |
| 1337 | Iron Overload | FAERS: 1 | US FAERS | |
| 1338 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 1339 | Klippel-Feil Syndrome | FAERS: 1 | US FAERS | |
| 1340 | Kluver-Bucy Syndrome | FAERS: 1 | US FAERS | |
| 1341 | Laparotomy | FAERS: 1 | OFFSIDES US FAERS | |
| 1342 | Large intestine erosion | FAERS: 1 | US FAERS | |
| 1343 | Laryngitis | FAERS: 1 | US FAERS | |
| 1344 | Laryngomalacia | FAERS: 1 | US FAERS | |
| 1345 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 1346 | Lichenification | FAERS: 1 | US FAERS | |
| 1347 | Light chain analysis increased | FAERS: 1 | US FAERS | |
| 1348 | Lipomatosis | FAERS: 1 | US FAERS | |
| 1349 | Lipomeningocele | FAERS: 1 | US FAERS | |
| 1350 | Lipoprotein (a) increased | FAERS: 1 | US FAERS | |
| 1351 | Live Birth | FAERS: 1 | US FAERS | |
| 1352 | Loose associations | FAERS: 1 | US FAERS | |
| 1353 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 1354 | Lower respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 1355 | Lung Injury | FAERS: 1 | US FAERS | |
| 1356 | Lung infection pseudomonal | FAERS: 1 | US FAERS | |
| 1357 | Lymphadenitis bacterial | FAERS: 1 | US FAERS | |
| 1358 | Lymphocyte percentage increased | FAERS: 1 | US FAERS | |
| 1359 | Lymphoid tissue hyperplasia | FAERS: 1 | US FAERS | |
| 1360 | Macule | FAERS: 1 | US FAERS | |
| 1361 | Mastitis | FAERS: 1 | US FAERS | |
| 1362 | Maternal exposure during breast feeding | FAERS: 1 | US FAERS | |
| 1363 | Medical device site infection | FAERS: 1 | US FAERS | |
| 1364 | Medical device site joint pain | FAERS: 1 | US FAERS | |
| 1365 | Megakaryocytes decreased | FAERS: 1 | US FAERS | |
| 1366 | Meibomian gland dysfunction | FAERS: 1 | US FAERS | |
| 1367 | Metabolic alkalosis | FAERS: 1 | US FAERS | |
| 1368 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 1369 | Metastasis | FAERS: 1 | US FAERS | |
| 1370 | Mild Mental Retardation | FAERS: 1 | US FAERS | |
| 1371 | Mineral deficiency | FAERS: 1 | US FAERS | |
| 1372 | Mixed liver injury | FAERS: 1 | US FAERS | |
| 1373 | Monocyte count decreased | FAERS: 1 | US FAERS | |
| 1374 | Monocyte percentage decreased | FAERS: 1 | US FAERS | |
| 1375 | Monogenic diabetes | FAERS: 1 | US FAERS | |
| 1376 | Monoparesis | FAERS: 1 | US FAERS | |
| 1377 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 1378 | Motion Sickness | FAERS: 1 | US FAERS | |
| 1379 | Moyamoya Disease | FAERS: 1 | US FAERS | |
| 1380 | Mucocutaneous rash | FAERS: 1 | US FAERS | |
| 1381 | Mucosal necrosis | FAERS: 1 | US FAERS | |
| 1382 | Multiple Myeloma | FAERS: 1 | US FAERS | |
| 1383 | Multiple System Atrophy | FAERS: 1 | US FAERS | |
| 1384 | Multiple drug overdose | FAERS: 1 | OFFSIDES US FAERS | |
| 1385 | Multiple sclerosis relapse | FAERS: 1 | OFFSIDES US FAERS | |
| 1386 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 1387 | Musculoskeletal Deformity | FAERS: 1 | US FAERS | |
| 1388 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 1389 | Mycosis fungoides stage IV | FAERS: 1 | US FAERS | |
| 1390 | Myelofibrosis | FAERS: 1 | US FAERS | |
| 1391 | Myocardial necrosis | FAERS: 1 | US FAERS | |
| 1392 | Myositis | FAERS: 1 | 8293614 | CTD US FAERS |
| 1393 | Nail bed injury | FAERS: 1 | US FAERS | |
| 1394 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 1395 | Neonatal respiratory acidosis | FAERS: 1 | US FAERS | |
| 1396 | Neonatal respiratory failure | FAERS: 1 | US FAERS | |
| 1397 | Nephrectomy | FAERS: 1 | US FAERS | |
| 1398 | Nephroptosis | FAERS: 1 | US FAERS | |
| 1399 | Neuralgic Amyotrophy | FAERS: 1 | US FAERS | |
| 1400 | Neuropathy | FAERS: 1 | US FAERS | |
| 1401 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 1402 | No adverse drug reaction | FAERS: 1 | US FAERS | |
| 1403 | Nodule | FAERS: 1 | OFFSIDES US FAERS | |
| 1404 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 1405 | Norepinephrine increased | FAERS: 1 | US FAERS | |
| 1406 | Normetanephrine urine increased | FAERS: 1 | US FAERS | |
| 1407 | Nuclear magnetic resonance imaging brain normal | FAERS: 1 | US FAERS | |
| 1408 | Nuclear magnetic resonance imaging thoracic abnormal | FAERS: 1 | US FAERS | |
| 1409 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 1410 | Oculogyric crisis | FAERS: 1 | US FAERS | |
| 1411 | Onychomycosis | FAERS: 1 | US FAERS | |
| 1412 | Opisthotonus | FAERS: 1 | US FAERS | |
| 1413 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 1414 | Opticokinetic nystagmus tests abnormal | FAERS: 1 | US FAERS | |
| 1415 | Oral pruritus | FAERS: 1 | US FAERS | |
| 1416 | Osteolysis | FAERS: 1 | OFFSIDES US FAERS | |
| 1417 | Otitis Media | FAERS: 1 | US FAERS | |
| 1418 | PO2 increased | FAERS: 1 | US FAERS | |
| 1419 | PROTHROMBIN TIME | FAERS: 1 | US FAERS | |
| 1420 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 1421 | Paraparesis | FAERS: 1 | US FAERS | |
| 1422 | Paroxysmal arrhythmia | FAERS: 1 | US FAERS | |
| 1423 | Patient uncooperative | FAERS: 1 | US FAERS | |
| 1424 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 1425 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 1426 | Peripheral paralysis | FAERS: 1 | US FAERS | |
| 1427 | Peritoneal Dialysis | FAERS: 1 | US FAERS | |
| 1428 | Pertussis | FAERS: 1 | US FAERS | |
| 1429 | Phalangeal agenesis | FAERS: 1 | US FAERS | |
| 1430 | Pharyngotonsillitis | FAERS: 1 | US FAERS | |
| 1431 | Photodermatosis | FAERS: 1 | US FAERS | |
| 1432 | Piloerection | FAERS: 1 | US FAERS | |
| 1433 | Placental hypertrophy | FAERS: 1 | US FAERS | |
| 1434 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 1435 | Polyglandular disorder | FAERS: 1 | US FAERS | |
| 1436 | Polyhydramnios | FAERS: 1 | US FAERS | |
| 1437 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 1438 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 1439 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 1440 | Poverty of speech | FAERS: 1 | US FAERS | |
| 1441 | Precocious Puberty | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1442 | Pregnancy with implant contraceptive | FAERS: 1 | US FAERS | |
| 1443 | Premature Menopause | FAERS: 1 | US FAERS | |
| 1444 | Prerenal failure | FAERS: 1 | US FAERS | |
| 1445 | Pressure of speech | FAERS: 1 | US FAERS | |
| 1446 | Priapism | FAERS: 1 | US FAERS | |
| 1447 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 1448 | Product appearance confusion | FAERS: 1 | US FAERS | |
| 1449 | Product counterfeit | FAERS: 1 | US FAERS | |
| 1450 | Product dose omission | FAERS: 1 | US FAERS | |
| 1451 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 1452 | Product intolerance | FAERS: 1 | US FAERS | |
| 1453 | Product packaging issue | FAERS: 1 | US FAERS | |
| 1454 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 1455 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 1456 | Product selection error | FAERS: 1 | US FAERS | |
| 1457 | Product shape issue | FAERS: 1 | US FAERS | |
| 1458 | Product tampering | FAERS: 1 | US FAERS | |
| 1459 | Product use complaint | FAERS: 1 | US FAERS | |
| 1460 | Prosopagnosia | FAERS: 1 | US FAERS | |
| 1461 | Prosthesis Implantation | FAERS: 1 | US FAERS | |
| 1462 | Protein S Deficiency | FAERS: 1 | US FAERS | |
| 1463 | Protein total abnormal | FAERS: 1 | US FAERS | |
| 1464 | Prothrombin time ratio decreased | FAERS: 1 | US FAERS | |
| 1465 | Prurigo | FAERS: 1 | US FAERS | |
| 1466 | Pseudocyst | FAERS: 1 | US FAERS | |
| 1467 | Pulmonary Eosinophilia | FAERS: 1 | 6462508 9923035 | CTD US FAERS |
| 1468 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 1469 | Pulmonary malformation | FAERS: 1 | US FAERS | |
| 1470 | Pulmonary sepsis | FAERS: 1 | US FAERS | |
| 1471 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 1472 | Purulence | FAERS: 1 | US FAERS | |
| 1473 | QRS axis abnormal | FAERS: 1 | US FAERS | |
| 1474 | Quadriparesis | FAERS: 1 | OFFSIDES US FAERS | |
| 1475 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 1476 | Radiotherapy to brain | FAERS: 1 | US FAERS | |
| 1477 | Radiotherapy to thyroid | FAERS: 1 | US FAERS | |
| 1478 | Rebound effect | FAERS: 1 | US FAERS | |
| 1479 | Rebound psychosis | FAERS: 1 | US FAERS | |
| 1480 | Rectal discharge | FAERS: 1 | US FAERS | |
| 1481 | Red man syndrome | FAERS: 1 | US FAERS | |
| 1482 | Reflux laryngitis | FAERS: 1 | US FAERS | |
| 1483 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 1484 | Renal dysplasia | FAERS: 1 | US FAERS | |
| 1485 | Renal tubular disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 1486 | Restrictive cardiomyopathy | FAERS: 1 | US FAERS | |
| 1487 | Restrictive pulmonary disease | FAERS: 1 | US FAERS | |
| 1488 | Reticulocyte count decreased | FAERS: 1 | US FAERS | |
| 1489 | Reticulocytosis | FAERS: 1 | SIDER US FAERS | |
| 1490 | Retinal Degeneration | FAERS: 1 | US FAERS | |
| 1491 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 1492 | Retinal Vascular Disorder | FAERS: 1 | US FAERS | |
| 1493 | Retinal exudates | FAERS: 1 | US FAERS | |
| 1494 | Retinal toxicity | FAERS: 1 | US FAERS | |
| 1495 | Retrognathia | FAERS: 1 | US FAERS | |
| 1496 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 1497 | Rhabdomyoma | FAERS: 1 | US FAERS | |
| 1498 | Rhinitis | FAERS: 1 | SIDER US FAERS | |
| 1499 | Right ventricular diastolic collapse | FAERS: 1 | US FAERS | |
| 1500 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 1501 | Rocky Mountain Spotted Fever | FAERS: 1 | US FAERS | |
| 1502 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 1503 | Salt intoxication | FAERS: 1 | US FAERS | |
| 1504 | Scarlet Fever | FAERS: 1 | US FAERS | |
| 1505 | School refusal | FAERS: 1 | US FAERS | |
| 1506 | Sclerema | FAERS: 1 | US FAERS | |
| 1507 | Scoliosis surgery | FAERS: 1 | US FAERS | |
| 1508 | Sedation complication | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1509 | Selenium deficiency | FAERS: 1 | US FAERS | |
| 1510 | Sensorimotor disorder | FAERS: 1 | US FAERS | |
| 1511 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 1512 | Serum Sickness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1513 | Shunt malfunction | FAERS: 1 | US FAERS | |
| 1514 | Sinobronchitis | FAERS: 1 | US FAERS | |
| 1515 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 1516 | Skin Induration | FAERS: 1 | US FAERS | |
| 1517 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 1518 | Skin toxicity | FAERS: 1 | US FAERS | |
| 1519 | Sleep Talking | FAERS: 1 | US FAERS | |
| 1520 | Sperm concentration decreased | FAERS: 1 | SIDER US FAERS | |
| 1521 | Sperm count abnormal | FAERS: 1 | US FAERS | |
| 1522 | Spermatozoa abnormal | FAERS: 1 | US FAERS | |
| 1523 | Spermatozoa progressive motility abnormal | FAERS: 1 | US FAERS | |
| 1524 | Spina Bifida Occulta | FAERS: 1 | US FAERS | |
| 1525 | Spondylolysis | FAERS: 1 | US FAERS | |
| 1526 | Staphylococcal Scalded Skin Syndrome | FAERS: 1 | US FAERS | |
| 1527 | Staphylococcal abscess | FAERS: 1 | US FAERS | |
| 1528 | Stool analysis abnormal | FAERS: 1 | US FAERS | |
| 1529 | Streptococcus test positive | FAERS: 1 | US FAERS | |
| 1530 | Stridor | FAERS: 1 | US FAERS | |
| 1531 | Struck by lightning | FAERS: 1 | US FAERS | |
| 1532 | Subileus | FAERS: 1 | US FAERS | |
| 1533 | Sudden infant death syndrome | FAERS: 1 | US FAERS | |
| 1534 | Sunburn | FAERS: 1 | US FAERS | |
| 1535 | Suspected suicide attempt | FAERS: 1 | US FAERS | |
| 1536 | Symmetrical drug-related intertriginous and flexural exanthema | FAERS: 1 | US FAERS | |
| 1537 | Synostosis | FAERS: 1 | US FAERS | |
| 1538 | Synovitis | FAERS: 1 | OFFSIDES US FAERS | |
| 1539 | Syringomyelia | FAERS: 1 | US FAERS | |
| 1540 | T-lymphocyte count increased | FAERS: 1 | US FAERS | |
| 1541 | Taciturnity | FAERS: 1 | US FAERS | |
| 1542 | Teeth brittle | FAERS: 1 | US FAERS | |
| 1543 | Teratoma | FAERS: 1 | US FAERS | |
| 1544 | Tetany | FAERS: 1 | US FAERS | |
| 1545 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 1546 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 1547 | Throat cancer | FAERS: 1 | US FAERS | |
| 1548 | Thyroidectomy | FAERS: 1 | US FAERS | |
| 1549 | Tinea Pedis | FAERS: 1 | US FAERS | |
| 1550 | Tongue eruption | FAERS: 1 | US FAERS | |
| 1551 | Torticollis | FAERS: 1 | US FAERS | |
| 1552 | Toxic Optic Neuropathy | FAERS: 1 | US FAERS | |
| 1553 | Toxic Shock Syndrome | FAERS: 1 | US FAERS | |
| 1554 | Toxoplasmosis | FAERS: 1 | US FAERS | |
| 1555 | Tracheal Stenosis | FAERS: 1 | US FAERS | |
| 1556 | Transaminases abnormal | FAERS: 1 | US FAERS | |
| 1557 | Trichotillomania | FAERS: 1 | US FAERS | |
| 1558 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 1559 | Typhoid Fever | FAERS: 1 | US FAERS | |
| 1560 | Ultrasound abdomen abnormal | FAERS: 1 | US FAERS | |
| 1561 | Ultrasound scan abnormal | FAERS: 1 | US FAERS | |
| 1562 | Unmasking of previously unidentified disease | FAERS: 1 | US FAERS | |
| 1563 | Unresponsive to verbal stimuli | FAERS: 1 | US FAERS | |
| 1564 | Upper respiratory fungal infection | FAERS: 1 | US FAERS | |
| 1565 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 1566 | Upper respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 1567 | Ureterocele | FAERS: 1 | US FAERS | |
| 1568 | Urethral Obstruction | FAERS: 1 | US FAERS | |
| 1569 | Urge Incontinence | FAERS: 1 | US FAERS | |
| 1570 | Urine leukocyte esterase positive | FAERS: 1 | US FAERS | |
| 1571 | Urine osmolarity decreased | FAERS: 1 | US FAERS | |
| 1572 | Urticaria Pigmentosa | FAERS: 1 | US FAERS | |
| 1573 | Uterine Cancer | FAERS: 1 | OFFSIDES US FAERS | |
| 1574 | Uveitis | FAERS: 1 | US FAERS | |
| 1575 | Varicella zoster virus serology positive | FAERS: 1 | US FAERS | |
| 1576 | Vascular encephalopathy | FAERS: 1 | US FAERS | |
| 1577 | Vascular parkinsonism | FAERS: 1 | US FAERS | |
| 1578 | Vasculitic rash | FAERS: 1 | US FAERS | |
| 1579 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 1580 | Ventriculoperitoneal shunt malfunction | FAERS: 1 | US FAERS | |
| 1581 | Vestibular Neuronitis | FAERS: 1 | OFFSIDES US FAERS | |
| 1582 | Victim of elder abuse | FAERS: 1 | US FAERS | |
| 1583 | Violence-related symptom | FAERS: 1 | US FAERS | |
| 1584 | Vitamin K Deficiency | FAERS: 1 | US FAERS | |
| 1585 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 1586 | Vocal cord cyst | FAERS: 1 | US FAERS | |
| 1587 | Vulvovaginal adhesion | FAERS: 1 | US FAERS | |
| 1588 | Vulvovaginal erythema | FAERS: 1 | US FAERS | |
| 1589 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 1590 | Walking aid user | FAERS: 1 | US FAERS | |
| 1591 | White matter lesion | FAERS: 1 | US FAERS | |
| 1592 | Wound Complication | FAERS: 1 | US FAERS | |
| 1593 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 1594 | X-ray abnormal | FAERS: 1 | US FAERS | |
| 1595 | Xerosis | FAERS: 1 | US FAERS | |
| 1596 | cold agglutinins | FAERS: 1 | US FAERS | |
| 1597 | effusion | FAERS: 1 | OFFSIDES US FAERS | |
| 1598 | insulinoma | FAERS: 1 | US FAERS | |
| 1599 | muscle injury | FAERS: 1 | US FAERS | |
| 1600 | Abdominal adhesions | OFFSIDES | ||
| 1601 | Abnormalities, Drug-Induced | CTD | ||
| 1602 | Acid reflux | OFFSIDES | ||
| 1603 | Actinic keratosis | OFFSIDES | ||
| 1604 | Actinomycosis | OFFSIDES | ||
| 1605 | Acute Disease | 15289703 | CTD | |
| 1606 | Acute Generalized Exanthematous Pustulosis | 12430739 15229826 | CTD | |
| 1607 | Acute bronchitis | OFFSIDES | ||
| 1608 | Acute retention of urine | SIDER | ||
| 1609 | Adams-Stokes Syndrome | 6613526 6756049 | CTD OFFSIDES SIDER | |
| 1610 | Adenitis | OFFSIDES | ||
| 1611 | Adenocarcinoma | OFFSIDES | ||
| 1612 | Adnexa uteri mass | OFFSIDES | ||
| 1613 | Affective Disorders, Psychotic | 8109663 | CTD | |
| 1614 | Albumin globulin ratio abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 1615 | Albumin globulin ratio decreased | OFFSIDES | ||
| 1616 | Alcohol withdrawal syndrome | OFFSIDES | ||
| 1617 | Altered bowel function | OFFSIDES | ||
| 1618 | Amaurosis Fugax | OFFSIDES | ||
| 1619 | Analgesia | OFFSIDES | ||
| 1620 | Analgesic drug level increased | OFFSIDES | ||
| 1621 | Anemia, Hemolytic | 6441416 9855327 18055338 | CTD | |
| 1622 | Anemia | 10369620 | CTD | |
| 1623 | Angiokeratoma | OFFSIDES | ||
| 1624 | Angiolipoma | OFFSIDES | ||
| 1625 | Anhidrosis | OFFSIDES | ||
| 1626 | Anticholinergic Syndrome | OFFSIDES | ||
| 1627 | Antiviral drug level above therapeutic | OFFSIDES | ||
| 1628 | Application site reaction | Canada Vigilance: 1 | Canada Vigilance | |
| 1629 | Apraxias | 16116141 | CTD | |
| 1630 | Arterial insufficiency | SIDER | ||
| 1631 | Arthrodesis | OFFSIDES | ||
| 1632 | Articulation Disorders | 16140591 | CTD | |
| 1633 | Aspiration Pneumonia | OFFSIDES | ||
| 1634 | Atrial Flutter | OFFSIDES | ||
| 1635 | Atrial tachycardia | OFFSIDES | ||
| 1636 | Auditory Perceptual Disorders | CTD | ||
| 1637 | Bacterial disease carrier | OFFSIDES | ||
| 1638 | Basal Ganglia Diseases | 20375657 | CTD | |
| 1639 | Basal cell carcinoma | OFFSIDES | ||
| 1640 | Belligerence | OFFSIDES | ||
| 1641 | Benign Prostatic Hyperplasia | OFFSIDES | ||
| 1642 | Bereavement | OFFSIDES | ||
| 1643 | Bile Duct Diseases | 12352223 | CTD | |
| 1644 | Bladder cancer recurrent | OFFSIDES | ||
| 1645 | Blood Coagulation Disorders | 17923349 | CTD | |
| 1646 | Blood and lymphatic system disorders | SIDER | ||
| 1647 | Blood antidiuretic hormone increased | OFFSIDES | ||
| 1648 | Blood beta-D-glucan increased | OFFSIDES | ||
| 1649 | Blood corticotrophin | OFFSIDES | ||
| 1650 | Blood lactate dehydrogenase | OFFSIDES | ||
| 1651 | Blood sodium | OFFSIDES | ||
| 1652 | Blood testosterone increased | OFFSIDES | ||
| 1653 | Blood thyroid stimulating hormone | OFFSIDES | ||
| 1654 | Blurred vision | OFFSIDES | ||
| 1655 | Body Temperature | OFFSIDES | ||
| 1656 | Body Weight Changes | 28267586 | CTD | |
| 1657 | Bone Marrow Diseases | 10369620 12897634 | CTD | |
| 1658 | Bone lesion | OFFSIDES | ||
| 1659 | Borderline Personality Disorder | OFFSIDES | ||
| 1660 | Brain Concussion | OFFSIDES | ||
| 1661 | Brain Damage, Chronic | 17113938 | CTD | |
| 1662 | Brain Diseases | CTD | ||
| 1663 | Brain Injuries | 28267586 | CTD | |
| 1664 | Breast Cyst | OFFSIDES | ||
| 1665 | Breast Feeding | SIDER | ||
| 1666 | Breast cancer recurrent | OFFSIDES | ||
| 1667 | Bruxism | OFFSIDES | ||
| 1668 | Bundle-Branch Block | 11590881 12184016 15915744 | CTD | |
| 1669 | Cardioactive drug level | OFFSIDES | ||
| 1670 | Carotidynia | OFFSIDES | ||
| 1671 | Cerebellar Diseases | 7831181 | CTD | |
| 1672 | Cerebral artery stenosis | OFFSIDES | ||
| 1673 | Cervicobrachial syndrome | OFFSIDES | ||
| 1674 | Cervix carcinoma recurrent | OFFSIDES | ||
| 1675 | Chemical and Drug Induced Liver Injury |
908993
2074067 2144387 2279511 3143551 3161347 3568943 3628894 3821638 6462508 6698343 7247130 7315533 7806846 8067500 8398372 8600877 10022661 10383724 10599404 10907977 11143408 11431905 11837721 11918515 12005248 12352223 15229826 16204911 17465707 17724898 19995690 20305608 22331495 22790970 23397584 24085192 24752500 25111975 25231249 27485346 28138970 28437613 | CTD | |
| 1676 | Chemotherapeutic drug level increased | OFFSIDES | ||
| 1677 | Child Behavior Disorders | 1513924 2919698 19921623 | CTD | |
| 1678 | Chronic sinusitis | OFFSIDES | ||
| 1679 | Cocaine-Related Disorders | 12233988 | CTD | |
| 1680 | Cognition Disorders | CTD | ||
| 1681 | Confusion | CTD | ||
| 1682 | Connective Tissue Diseases | 8293614 | CTD | |
| 1683 | Coordination disturbance | SIDER | ||
| 1684 | Corneal lesion | Canada Vigilance: 1 | Canada Vigilance | |
| 1685 | Coronary artery disease aggravated | SIDER | ||
| 1686 | Coronary artery insufficiency | SIDER | ||
| 1687 | Cramps of lower extremities | SIDER | ||
| 1688 | Craniofacial Abnormalities | 9014606 15644835 17264463 | CTD | |
| 1689 | Decreased Libido | OFFSIDES | ||
| 1690 | Delayed gastric emptying | SIDER | ||
| 1691 | Dental abscess | OFFSIDES | ||
| 1692 | Dental prosthesis user | OFFSIDES | ||
| 1693 | Depressive disorder | CTD | ||
| 1694 | Diabetes | OFFSIDES | ||
| 1695 | Diabetic Retinopathy | OFFSIDES | ||
| 1696 | Diarrhea | OFFSIDES | ||
| 1697 | Disorders of Excessive Somnolence | CTD | ||
| 1698 | Distress | SIDER | ||
| 1699 | Diuresis | SIDER | ||
| 1700 | Drowsiness | OFFSIDES SIDER | ||
| 1701 | Drug Eruptions | CTD | ||
| 1702 | Drug Overdose | CTD | ||
| 1703 | Drug addict | OFFSIDES | ||
| 1704 | Drug withdrawal headache | OFFSIDES | ||
| 1705 | Duodenitis | OFFSIDES | ||
| 1706 | Dyskinesia, Drug-Induced | 1011032 2194703 6811702 | CTD | |
| 1707 | Dysmenorrhea | OFFSIDES | ||
| 1708 | Dyspnea | 16283138 | CTD | |
| 1709 | Ear and labyrinth disorders | SIDER | ||
| 1710 | Ear discomfort | OFFSIDES | ||
| 1711 | Edema | CTD | ||
| 1712 | Electrocardiogram QRS complex | SIDER | ||
| 1713 | Endodontic procedure | OFFSIDES | ||
| 1714 | Epilepsies, Partial |
405624
2870222 3653053 3691421 3925335 9109744 10331832 10513696 11720147 14518681 15008574 15229826 16275822 16628512 17116037 | CTD | |
| 1715 | Epilepsy, Complex Partial |
453362
2739918 3195683 3508708 3585400 3774685 3795291 7750514 8215250 8293614 8404753 8564338 10343150 12136070 12897634 14733874 15915744 17327289 | CTD | |
| 1716 | Epilepsy, Generalized | 405624 | CTD | |
| 1717 | Epilepsy, Rolandic | 17561952 19921623 | CTD | |
| 1718 | Epilepsy, Temporal Lobe | CTD | ||
| 1719 | Erythema Nodosum | SIDER | ||
| 1720 | Erythromelalgia | 19549232 19557861 | CTD | |
| 1721 | Esotropia | 9438588 | CTD | |
| 1722 | Essential Tremor | 19497322 | CTD | |
| 1723 | Exanthema | CTD | ||
| 1724 | Exophthalmos | OFFSIDES | ||
| 1725 | Facial Neuralgia | 16323733 | CTD OFFSIDES | |
| 1726 | Fanconi Syndrome | 10029255 11077456 | CTD OFFSIDES | |
| 1727 | Fatty Liver | OFFSIDES | ||
| 1728 | Febrile infection | OFFSIDES | ||
| 1729 | Fetal Diseases | 19496458 | CTD | |
| 1730 | Fetal Growth Retardation | 9535510 | CTD | |
| 1731 | Fever | CTD | ||
| 1732 | Focal dyscognitive seizures | Canada Vigilance: 1 | Canada Vigilance | |
| 1733 | Food craving | OFFSIDES | ||
| 1734 | Gait Ataxia | 405624 2027499 | CTD | |
| 1735 | Gait Disorders, Neurologic | 12897634 | CTD | |
| 1736 | Galactorrhea | OFFSIDES | ||
| 1737 | Gambling | OFFSIDES | ||
| 1738 | Gastrooesophageal reflux prophylaxis | OFFSIDES | ||
| 1739 | Genital erythema | Canada Vigilance: 1 | Canada Vigilance | |
| 1740 | Glasgow coma scale | OFFSIDES | ||
| 1741 | Gliosis | OFFSIDES | ||
| 1742 | Granulocytosis | OFFSIDES | ||
| 1743 | Hallucinations | 5552123 11118803 16944411 | CTD | |
| 1744 | Hay fever | OFFSIDES | ||
| 1745 | Heart Block | 78131 12897634 | CTD | |
| 1746 | Heart failure | 7425577 8726546 12897634 | CTD | |
| 1747 | Hemifacial Spasm | 9746297 | CTD | |
| 1748 | Hepatitis C antibody positive | OFFSIDES | ||
| 1749 | Hereditary Angioedema Types I and II | 1644161 | CTD | |
| 1750 | Hernia obstructive | OFFSIDES | ||
| 1751 | Hyperalgesia | 12787826 16777327 | CTD | |
| 1752 | Hyperammonemia | 3341477 | CTD | |
| 1753 | Hyperemia | 28267586 | CTD | |
| 1754 | Hypereosinophilic syndrome | OFFSIDES | ||
| 1755 | Hyperhomocysteinemia | 10459572 | CTD | |
| 1756 | Hyperpigmentation | OFFSIDES | ||
| 1757 | Hypesthesia | 2998143 | CTD | |
| 1758 | Hypocalcemia | 16136018 | CTD | |
| 1759 | Hyponatremia | CTD | ||
| 1760 | Hypopituitarism | OFFSIDES | ||
| 1761 | Immunosuppression | OFFSIDES | ||
| 1762 | Impetigo | OFFSIDES | ||
| 1763 | Infestation | SIDER | ||
| 1764 | Injection site nodule | OFFSIDES | ||
| 1765 | Intention tremor | OFFSIDES | ||
| 1766 | Intoxication | SIDER | ||
| 1767 | Isaacs syndrome | 11360270 | CTD | |
| 1768 | Joint sprain | OFFSIDES | ||
| 1769 | Keratitis sicca | OFFSIDES | ||
| 1770 | Ketonuria | SIDER | ||
| 1771 | Language Disorders | 16140591 | CTD | |
| 1772 | Leukemoid Reaction | 2522601 | CTD | |
| 1773 | Leukoencephalopathy | OFFSIDES | ||
| 1774 | Leukopenia neonatal | OFFSIDES | ||
| 1775 | Limb Deformities, Congenital | 2492459 15644835 | CTD | |
| 1776 | Lipase | OFFSIDES | ||
| 1777 | Liver Failure, Acute | CTD | ||
| 1778 | Liver Failure | 10331832 10369620 | CTD | |
| 1779 | Liver neoplasms | 25058030 28108177 | CTD | |
| 1780 | Lordosis | OFFSIDES | ||
| 1781 | Low Back Pain | SIDER | ||
| 1782 | Lupus Erythematosus, Systemic | CTD | ||
| 1783 | Lupus Erythematosus | SIDER | ||
| 1784 | Lymph node palpable | OFFSIDES | ||
| 1785 | Lymphangitis | OFFSIDES | ||
| 1786 | Lymphatic Diseases | 6462508 | CTD | |
| 1787 | Macrocytosis | Canada Vigilance: 1 | Canada Vigilance | |
| 1788 | Mallory-Weiss Syndrome | OFFSIDES | ||
| 1789 | Manic psychosis | SIDER | ||
| 1790 | Mass excision | OFFSIDES | ||
| 1791 | Mastectomy | OFFSIDES | ||
| 1792 | Memory Disorders | 3632397 16116141 | CTD | |
| 1793 | Meningorrhagia | OFFSIDES | ||
| 1794 | Mental disorders | 6408936 | CTD | |
| 1795 | Micrognathism | 2492459 | CTD | |
| 1796 | Middle insomnia | OFFSIDES | ||
| 1797 | Migraine Disorders | 19469263 | CTD | |
| 1798 | Miliaria | Canada Vigilance: 1 | Canada Vigilance | |
| 1799 | Modified radical mastectomy | OFFSIDES | ||
| 1800 | Mood Disorders | 4037133 10440025 15266186 | CTD | |
| 1801 | Mouth Abnormalities | 17328645 | CTD | |
| 1802 | Mouth cyst | OFFSIDES | ||
| 1803 | Movement Disorders | 10371552 22107891 | CTD | |
| 1804 | Mucocutaneous Lymph Node Syndrome | 3136432 | CTD | |
| 1805 | Multicystic Dysplastic Kidney | 17310358 | CTD | |
| 1806 | Muscle Spasticity | Canada Vigilance: 2 | 2027499 | CTD Canada Vigilance |
| 1807 | Muscle Weakness | 10775221 | CTD OFFSIDES | |
| 1808 | Myotonia Congenita | 20399394 | CTD | |
| 1809 | Myotonic Dystrophy | 4051836 | CTD | |
| 1810 | Neoplasm Metastasis | 24352538 | CTD | |
| 1811 | Nephritis, Interstitial | CTD | ||
| 1812 | Nerve Degeneration | 12192617 17636003 19371260 | CTD | |
| 1813 | Nervous tension | OFFSIDES | ||
| 1814 | Neural Tube Defects | 9535510 | CTD | |
| 1815 | Neurobehavioral Manifestations | 3182607 8150804 | CTD | |
| 1816 | Neurodermatitis | SIDER | ||
| 1817 | Neuropathic pain | OFFSIDES | ||
| 1818 | Neurotoxicity Syndromes | CTD | ||
| 1819 | Nocturia | OFFSIDES | ||
| 1820 | Nodule on extremity | OFFSIDES | ||
| 1821 | Non-cardiac chest pain | OFFSIDES | ||
| 1822 | Ocular Motility Disorders | CTD | ||
| 1823 | Oligospermia | Canada Vigilance: 1 | Canada Vigilance | |
| 1824 | Open wound | OFFSIDES | ||
| 1825 | Ophthalmoplegia | CTD | ||
| 1826 | Oral infection | OFFSIDES | ||
| 1827 | Pancreatic Insufficiency | OFFSIDES | ||
| 1828 | Paraplegia | OFFSIDES | ||
| 1829 | Parapsoriasis | 16538176 | CTD | |
| 1830 | Parathyroidectomy | OFFSIDES | ||
| 1831 | Paresthesia | 7561930 8451916 11360270 | CTD | |
| 1832 | Peripheral Nervous System Diseases | CTD | ||
| 1833 | Perirectal abscess | OFFSIDES | ||
| 1834 | Perivascular dermatitis | OFFSIDES | ||
| 1835 | Personality Disorders | 2362393 3182607 6711691 | CTD | |
| 1836 | Phonophobia | OFFSIDES | ||
| 1837 | Photosensitivity Disorders | 8610843 | CTD | |
| 1838 | Pituitary enlargement | OFFSIDES | ||
| 1839 | Plasma calcium decreased | SIDER | ||
| 1840 | Plasma osmolality decreased | SIDER | ||
| 1841 | Porphyria Cutanea Tarda | 8610843 | CTD SIDER | |
| 1842 | Posterior Leukoencephalopathy Syndrome | 19462818 | CTD | |
| 1843 | Postmenopausal bleeding | OFFSIDES | ||
| 1844 | Pregnancy Complications | 9014606 | CTD | |
| 1845 | Premature Birth | 10540608 | CTD | |
| 1846 | Prenatal Exposure Delayed Effects | CTD | ||
| 1847 | Prenatal Injuries | CTD | ||
| 1848 | Primary sequestrum | OFFSIDES | ||
| 1849 | Product complaint | Canada Vigilance: 2 | Canada Vigilance | |
| 1850 | Product dispensing error | Canada Vigilance: 1 | Canada Vigilance | |
| 1851 | Product prescribing error | Canada Vigilance: 1 | Canada Vigilance | |
| 1852 | Prothrombin level decreased | OFFSIDES | ||
| 1853 | Psychomotor Agitation | CTD | ||
| 1854 | Psychoses, Substance-Induced | 2362393 16944411 | CTD | |
| 1855 | Psychotic Disorders | CTD | ||
| 1856 | Pulmonary artery stenosis | OFFSIDES | ||
| 1857 | Pulmonary function test decreased | SIDER | ||
| 1858 | Pyroglutamate increased | OFFSIDES | ||
| 1859 | REM Sleep Behavior Disorder | 9186252 | CTD | |
| 1860 | Radial nerve palsy | Canada Vigilance: 1 | Canada Vigilance | |
| 1861 | Radiation Pneumonitis | OFFSIDES | ||
| 1862 | Radiculopathy | 8731607 | CTD | |
| 1863 | Rage | SIDER | ||
| 1864 | Reaction to preservatives | OFFSIDES | ||
| 1865 | Renal Insufficiency | 2522601 10331832 | CTD | |
| 1866 | Respiratory papilloma | OFFSIDES | ||
| 1867 | Respiratory tract congestion | OFFSIDES | ||
| 1868 | Retinal Diseases | 3751517 | CTD | |
| 1869 | Retinal vascular occlusion | OFFSIDES | ||
| 1870 | Sagittal Sinus Thrombosis | 11086405 | CTD | |
| 1871 | Scleroderma | OFFSIDES | ||
| 1872 | Scotoma | OFFSIDES | ||
| 1873 | Seizures |
405624
558553 743650 841172 1440123 1563341 1597341 1900790 2400545 2498296 2790457 2924746 2978064 3085769 3525615 3616367 3929090 6693586 6877534 7568372 7813146 8058587 8186424 8243363 8374915 8435746 8480078 8645877 8880893 9028861 9030893 9046859 9593229 9661830 9827229 9840351 9844417 9888492 9892448 10022661 10369620 10698845 10728915 11197575 11446366 11738929 11750573 11784375 11836887 11837721 12189261 12449849 12668379 14636342 14704468 14704477 15057820 15451008 15528922 15634624 15680200 15946322 16116122 16180713 16368452 16513683 16876388 16910300 16938433 17145735 17264463 18717705 19414003 19918026 21480876 22107891 26216692 | CTD | |
| 1874 | Shock, Cardiogenic | 20129423 | CTD | |
| 1875 | Sinus polyp | OFFSIDES | ||
| 1876 | Sleep Wake Disorders | 3659725 19414003 | CTD | |
| 1877 | Slurred speech | SIDER | ||
| 1878 | Speech Disorders | 2492459 7831181 | CTD | |
| 1879 | Spondylosis | OFFSIDES | ||
| 1880 | Substance Withdrawal Syndrome |
1686406
2498296 2898213 3170494 3195683 8109663 8232943 8564338 10702963 11128246 11801812 11952768 15514420 15804245 19934718 | CTD | |
| 1881 | Substance-Related Disorders | 3144406 | CTD | |
| 1882 | Surfactant protein increased | OFFSIDES | ||
| 1883 | Systemic lupus erythematosus rash | Canada Vigilance: 1 | Canada Vigilance | |
| 1884 | Tachycardia, Ventricular | 9072691 | CTD | |
| 1885 | Talkativeness | SIDER | ||
| 1886 | Taste Disorders | 623418 | CTD | |
| 1887 | Tension Headache | Canada Vigilance: 1 | Canada Vigilance | |
| 1888 | Therapeutic product effect decreased | Canada Vigilance: 4 | Canada Vigilance | |
| 1889 | Thromboembolism | SIDER | ||
| 1890 | Thrombophlebitis | Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER | |
| 1891 | Thrombosed varicose vein | OFFSIDES | ||
| 1892 | Tissue Adhesions | 9535510 | CTD | |
| 1893 | Tooth Infection | OFFSIDES | ||
| 1894 | Tooth repair | OFFSIDES | ||
| 1895 | Transposition of Great Vessels | 11805365 17785243 | CTD | |
| 1896 | Trembling | SIDER | ||
| 1897 | Tyrosinemias | 3313115 | CTD | |
| 1898 | Urine osmolarity increased | OFFSIDES | ||
| 1899 | Varicose vein operation | OFFSIDES | ||
| 1900 | Variegate Porphyria | SIDER | ||
| 1901 | Vascular Diseases | 10464538 | CTD | |
| 1902 | Vascular purpura | SIDER | ||
| 1903 | Vasculitis, Leukocytoclastic, Cutaneous | 3668581 | CTD | |
| 1904 | Venous Insufficiency | OFFSIDES | ||
| 1905 | Ventricular Dysfunction, Left | 8726546 10866337 | CTD | |
| 1906 | Ventricular Dysfunction | 9072691 | CTD | |
| 1907 | Viral pharyngitis | OFFSIDES | ||
| 1908 | Vision Disorders | 3395264 11984493 | CTD | |
| 1909 | Vitamin A Deficiency | OFFSIDES | ||
| 1910 | Weight Gain | 11879339 | CTD OFFSIDES | |
| 1911 | Wound dehiscence | OFFSIDES | ||
| 1912 | colonoscopy | OFFSIDES | ||
| 1913 | prostatitis | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.