Alendronate
(OGSPWJRAVKPPFI-UHFFFAOYSA-N)
Structure
- SMILES
- NCCCC(P(=O)(O)O)(P(=O)(O)O)O
- Type(s)
- Approved
- ATC code(s)
- M05BA04; M05BB03; M05BB05; M05BB06
- Molecular Formula:
- C4H13NO7P2
- Molecular Weight:
- 249.096
- Log P:
- -0.5729
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 6
- TPSA:
- 180.93
- CAS Number(s):
- 66376-36-1
Synonym(s)
1.
Alendronate
2.
4-Amino-1-Hydroxybutylidene 1,1-Biphosphonate
3.
Alendronate Monosodium Salt, Trihydrate
4.
Alendronate Sodium
5.
Aminohydroxybutane Bisphosphonate
6.
Fosamax
7.
MK-217
8.
MK 217
9.
MK217
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Low turnover osteopathy | FAERS: 1751 | OFFSIDES US FAERS | |
| 2 | Osteonecrosis of Jaw | FAERS: 1203 Canada Vigilance: 14 | Canada Vigilance SIDER US FAERS | |
| 3 | Osteoporosis | FAERS: 1138 Canada Vigilance: 3 | CTD OFFSIDES Canada Vigilance US FAERS | |
| 4 | Osteomyelitis | FAERS: 1134 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 5 | Anxiety | FAERS: 1035 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 6 | Arthralgia | FAERS: 990 Canada Vigilance: 18 | Canada Vigilance US FAERS | |
| 7 | Dental caries | FAERS: 913 | OFFSIDES US FAERS | |
| 8 | Back Pain | FAERS: 749 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 9 | Adverse event | FAERS: 698 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 10 | Pain | FAERS: 696 Canada Vigilance: 16 | 10791010 18095072 20927253 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 11 | Arthropathy | FAERS: 680 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 12 | Oral infection | FAERS: 661 | OFFSIDES US FAERS | |
| 13 | Blood cholesterol increased | FAERS: 581 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Abscess | FAERS: 511 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 15 | Chest Pain | FAERS: 509 Canada Vigilance: 11 | 12730757 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 16 | Bone density decreased | FAERS: 507 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 17 | Nausea | FAERS: 506 Canada Vigilance: 33 | 12730757 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 18 | Headache | FAERS: 464 Canada Vigilance: 15 | 12730757 | CTD SIDER Canada Vigilance US FAERS |
| 19 | Urinary tract infection | FAERS: 457 | US FAERS | |
| 20 | Fatigue | FAERS: 449 Canada Vigilance: 1 | 12730757 | CTD OFFSIDES Canada Vigilance US FAERS |
| 21 | Drug ineffective | FAERS: 422 Canada Vigilance: 36 | Canada Vigilance US FAERS | |
| 22 | Tooth Loss | FAERS: 411 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 23 | Pneumonia | FAERS: 398 | US FAERS | |
| 24 | Osteopenia | FAERS: 397 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 25 | Arthritis | FAERS: 386 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 26 | Weight decreased | FAERS: 376 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Dizziness | FAERS: 374 Canada Vigilance: 14 | 12730757 | CTD SIDER Canada Vigilance US FAERS |
| 28 | Myalgia | FAERS: 372 Canada Vigilance: 21 | Canada Vigilance SIDER US FAERS | |
| 29 | Cataract | FAERS: 368 | OFFSIDES US FAERS | |
| 30 | Infection | FAERS: 366 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 31 | Bronchitis | FAERS: 359 | OFFSIDES US FAERS | |
| 32 | Constipation | FAERS: 359 Canada Vigilance: 5 | 12730757 | CTD SIDER Canada Vigilance US FAERS |
| 33 | Hypothyroidism | FAERS: 336 | US FAERS | |
| 34 | Cellulitis | FAERS: 313 | OFFSIDES US FAERS | |
| 35 | Intervertebral Disc Degeneration | FAERS: 310 | OFFSIDES US FAERS | |
| 36 | Sinusitis | FAERS: 303 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 37 | Dyspepsia | FAERS: 299 Canada Vigilance: 29 | 12730757 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 38 | Bursitis | FAERS: 298 | OFFSIDES US FAERS | |
| 39 | Fracture | FAERS: 297 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 40 | Bone pain | FAERS: 295 Canada Vigilance: 18 | Canada Vigilance OFFSIDES US FAERS | |
| 41 | Asthma | FAERS: 287 | SIDER US FAERS | |
| 42 | Abdominal Pain | FAERS: 277 Canada Vigilance: 18 | 12730757 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 43 | Periodontitis | FAERS: 262 | OFFSIDES US FAERS | |
| 44 | Coronary Artery Disease | FAERS: 257 | US FAERS | |
| 45 | Asthenia | FAERS: 255 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 46 | Oral torus | FAERS: 254 | OFFSIDES US FAERS | |
| 47 | Stomatitis | FAERS: 253 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 48 | Tooth Infection | FAERS: 251 | OFFSIDES US FAERS | |
| 49 | Rotator cuff syndrome | FAERS: 250 | US FAERS | |
| 50 | Vitamin D Deficiency | FAERS: 248 | US FAERS | |
| 51 | Atrial Fibrillation | FAERS: 245 | 17476024 18443257 19266096 | CTD US FAERS |
| 52 | Diverticulum | FAERS: 241 | US FAERS | |
| 53 | Musculoskeletal Pain | FAERS: 236 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 54 | Toothache | FAERS: 228 | US FAERS | |
| 55 | Gastritis | FAERS: 226 Canada Vigilance: 7 | 12730757 | CTD SIDER Canada Vigilance US FAERS |
| 56 | Rheumatoid Arthritis | FAERS: 225 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Loose tooth | FAERS: 218 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 58 | Ankle Fracture | FAERS: 214 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 59 | Hypersensitivity | FAERS: 214 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 60 | Vomiting | FAERS: 213 Canada Vigilance: 19 | 12730757 | CTD SIDER Canada Vigilance US FAERS |
| 61 | Malaise | FAERS: 210 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 62 | Spinal column stenosis | FAERS: 208 | OFFSIDES US FAERS | |
| 63 | Palpitations | FAERS: 205 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 64 | Device Failure | FAERS: 203 | OFFSIDES US FAERS | |
| 65 | Neck Pain | FAERS: 203 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 66 | Overdose | FAERS: 198 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Intramedullary rod insertion | FAERS: 194 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 68 | Abdominal discomfort | FAERS: 192 Canada Vigilance: 11 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 69 | Gingivitis | FAERS: 189 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 70 | Back disorder | FAERS: 188 | US FAERS | |
| 71 | Cerebrovascular accident | FAERS: 187 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 72 | Oral pain | FAERS: 186 | US FAERS | |
| 73 | Trismus | FAERS: 180 | US FAERS | |
| 74 | Inappropriate schedule of drug administration | FAERS: 179 | US FAERS | |
| 75 | Swelling | FAERS: 179 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 76 | Spondylolisthesis | FAERS: 176 | OFFSIDES US FAERS | |
| 77 | Dehydration | FAERS: 172 | OFFSIDES US FAERS | |
| 78 | Atypical femur fracture | FAERS: 171 Canada Vigilance: 33 | Canada Vigilance US FAERS | |
| 79 | Carpal Tunnel Syndrome | FAERS: 171 | US FAERS | |
| 80 | Limb injury | FAERS: 169 | US FAERS | |
| 81 | Syncope | FAERS: 168 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 82 | Joint injury | FAERS: 163 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Diabetes Mellitus | FAERS: 162 | US FAERS | |
| 84 | Tooth Extraction | FAERS: 162 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 85 | Myocardial Infarction | FAERS: 155 Canada Vigilance: 2 | 19680161 | CTD Canada Vigilance US FAERS |
| 86 | Muscle strain | FAERS: 150 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 87 | Pathological fracture | FAERS: 149 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 88 | Hypotension | FAERS: 144 | US FAERS | |
| 89 | Fistula discharge | FAERS: 136 | US FAERS | |
| 90 | Cholelithiasis | FAERS: 133 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 91 | Vertigo | FAERS: 132 | SIDER US FAERS | |
| 92 | Drug dose omission | FAERS: 131 | US FAERS | |
| 93 | Nephrolithiasis | FAERS: 130 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 94 | Pruritus | FAERS: 130 Canada Vigilance: 11 | Canada Vigilance SIDER US FAERS | |
| 95 | Skin lesion | FAERS: 126 | OFFSIDES US FAERS | |
| 96 | Sciatica | FAERS: 122 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 97 | Fibromyalgia | FAERS: 119 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 98 | Synovial Cyst | FAERS: 119 | OFFSIDES US FAERS | |
| 99 | Joint swelling | FAERS: 116 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 100 | Irritable Bowel Syndrome | FAERS: 115 | US FAERS | |
| 101 | Restless Legs Syndrome | FAERS: 115 | US FAERS | |
| 102 | Open reduction of fracture | FAERS: 114 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 103 | Basal cell carcinoma | FAERS: 111 | OFFSIDES US FAERS | |
| 104 | Respiratory Failure | FAERS: 108 | US FAERS | |
| 105 | Cyst | FAERS: 107 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 106 | Lymphadenopathy | FAERS: 106 | US FAERS | |
| 107 | Stress | FAERS: 106 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 108 | Tremor | FAERS: 102 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 109 | Urinary Incontinence | FAERS: 102 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 110 | Nocturia | FAERS: 101 | US FAERS | |
| 111 | Diverticulitis | FAERS: 99 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 112 | Tinnitus | FAERS: 99 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 113 | Deafness | FAERS: 98 | OFFSIDES US FAERS | |
| 114 | Deep Vein Thrombosis | FAERS: 98 | US FAERS | |
| 115 | Epistaxis | FAERS: 97 | US FAERS | |
| 116 | Mastication disorder | FAERS: 95 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 117 | Renal cyst | FAERS: 95 | OFFSIDES US FAERS | |
| 118 | Alopecia | FAERS: 93 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 119 | Emotional distress | FAERS: 93 | US FAERS | |
| 120 | Osteitis | FAERS: 93 | US FAERS | |
| 121 | Skin Ulcer | FAERS: 93 | US FAERS | |
| 122 | Oral candidiasis | FAERS: 90 | US FAERS | |
| 123 | Bruxism | FAERS: 89 | OFFSIDES US FAERS | |
| 124 | Glaucoma | FAERS: 89 | US FAERS | |
| 125 | Increased tendency to bruise | FAERS: 89 | US FAERS | |
| 126 | Pharyngitis | FAERS: 87 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Drug administration error | FAERS: 86 | US FAERS | |
| 128 | Dysuria | FAERS: 86 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 129 | Oropharyngeal pain | FAERS: 86 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 130 | Influenza | FAERS: 84 | US FAERS | |
| 131 | No adverse event | FAERS: 84 | US FAERS | |
| 132 | Chest discomfort | FAERS: 82 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 133 | Gastroenteritis | FAERS: 82 | US FAERS | |
| 134 | Lumbar radiculopathy | FAERS: 82 | OFFSIDES US FAERS | |
| 135 | Pancreatitis | FAERS: 82 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 136 | Acute sinusitis | FAERS: 80 | OFFSIDES US FAERS | |
| 137 | Laceration | FAERS: 80 | US FAERS | |
| 138 | Tachycardia | FAERS: 80 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 139 | Trigeminal Neuralgia | FAERS: 80 | US FAERS | |
| 140 | kyphosis | FAERS: 79 | OFFSIDES US FAERS | |
| 141 | Compression fracture | FAERS: 78 | OFFSIDES US FAERS | |
| 142 | Musculoskeletal chest pain | FAERS: 78 | OFFSIDES US FAERS | |
| 143 | Nerve injury | FAERS: 78 | US FAERS | |
| 144 | Squamous cell carcinoma | FAERS: 78 | US FAERS | |
| 145 | Dysphonia | FAERS: 77 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 146 | Essential Hypertension | FAERS: 77 | US FAERS | |
| 147 | Hypoxia | FAERS: 77 | US FAERS | |
| 148 | Neuralgia | FAERS: 76 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 149 | Sepsis | FAERS: 76 | US FAERS | |
| 150 | Gastric ulcer | FAERS: 75 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 151 | Hernia | FAERS: 75 | US FAERS | |
| 152 | Radiculopathy | FAERS: 75 | US FAERS | |
| 153 | Ulcer | FAERS: 75 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 154 | Musculoskeletal discomfort | FAERS: 74 | SIDER US FAERS | |
| 155 | Inflammation | FAERS: 73 | 17375077 18391837 | CTD US FAERS |
| 156 | Actinic keratosis | FAERS: 72 | OFFSIDES US FAERS | |
| 157 | Carotid bruit | FAERS: 72 | OFFSIDES US FAERS | |
| 158 | Peptic Ulcer | FAERS: 72 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 159 | Urticaria | FAERS: 72 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 160 | Bone lesion | FAERS: 71 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 161 | Joint sprain | FAERS: 71 | OFFSIDES US FAERS | |
| 162 | Left Ventricular Hypertrophy | FAERS: 71 | US FAERS | |
| 163 | Memory impairment | FAERS: 71 | US FAERS | |
| 164 | Arteriosclerosis | FAERS: 70 | OFFSIDES US FAERS | |
| 165 | Bipolar Disorder | FAERS: 70 | US FAERS | |
| 166 | Supraventricular tachycardia | FAERS: 70 | US FAERS | |
| 167 | Nasopharyngitis | FAERS: 67 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 168 | Atrophic vulvovaginitis | FAERS: 66 | OFFSIDES US FAERS | |
| 169 | Subcutaneous Abscess | FAERS: 66 | US FAERS | |
| 170 | Abasia | FAERS: 65 | US FAERS | |
| 171 | Atelectasis | FAERS: 65 | OFFSIDES US FAERS | |
| 172 | Calcium deficiency | FAERS: 65 | US FAERS | |
| 173 | Chronic sinusitis | FAERS: 65 | OFFSIDES US FAERS | |
| 174 | Dermatitis | FAERS: 65 | SIDER US FAERS | |
| 175 | Erythema | FAERS: 65 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 176 | Obesity | FAERS: 65 | US FAERS | |
| 177 | Amnesia | FAERS: 64 | US FAERS | |
| 178 | Candidiasis | FAERS: 62 | US FAERS | |
| 179 | Cystitis | FAERS: 62 | US FAERS | |
| 180 | Deafness Neurosensory | FAERS: 62 | US FAERS | |
| 181 | Oral Cavity Fistula | FAERS: 62 | US FAERS | |
| 182 | Conjunctivitis | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 183 | Dementia | FAERS: 61 | US FAERS | |
| 184 | Medical device removal | FAERS: 61 | US FAERS | |
| 185 | Rhinitis | FAERS: 61 | OFFSIDES US FAERS | |
| 186 | Skeletal injury | FAERS: 61 | US FAERS | |
| 187 | Patellofemoral Pain Syndrome | FAERS: 60 | OFFSIDES US FAERS | |
| 188 | Pulmonary Embolism | FAERS: 60 | US FAERS | |
| 189 | Synovitis | FAERS: 60 | 15637369 | CTD US FAERS |
| 190 | Nodule | FAERS: 58 | US FAERS | |
| 191 | Electrocardiogram abnormal | FAERS: 57 | US FAERS | |
| 192 | Leukocytosis | FAERS: 57 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 193 | Musculoskeletal stiffness | FAERS: 57 | US FAERS | |
| 194 | Onychomycosis | FAERS: 57 | US FAERS | |
| 195 | Osteoradionecrosis | FAERS: 57 | OFFSIDES US FAERS | |
| 196 | Aphthous Stomatitis | FAERS: 56 | OFFSIDES US FAERS | |
| 197 | Cystocele | FAERS: 55 | OFFSIDES US FAERS | |
| 198 | Fibrosis | FAERS: 55 | 17375077 | CTD US FAERS |
| 199 | Angina Pectoris | FAERS: 54 | US FAERS | |
| 200 | Hormone level abnormal | FAERS: 54 | OFFSIDES US FAERS | |
| 201 | Hyperkeratosis | FAERS: 54 | OFFSIDES US FAERS | |
| 202 | Hysterectomy | FAERS: 54 | US FAERS | |
| 203 | Intermittent Claudication | FAERS: 54 | OFFSIDES US FAERS | |
| 204 | Mental status changes | FAERS: 54 | US FAERS | |
| 205 | Actinomycosis | FAERS: 53 | OFFSIDES US FAERS | |
| 206 | Breast Cyst | FAERS: 53 | US FAERS | |
| 207 | Cardiomegaly | FAERS: 53 | US FAERS | |
| 208 | Dental Fistula | FAERS: 53 | OFFSIDES US FAERS | |
| 209 | Intervertebral disc disorder | FAERS: 53 | OFFSIDES US FAERS | |
| 210 | Joint Range of Motion Decreased | FAERS: 53 | OFFSIDES US FAERS | |
| 211 | Thermal burn | FAERS: 52 | US FAERS | |
| 212 | Throat irritation | FAERS: 52 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 213 | Bradycardia | FAERS: 51 | US FAERS | |
| 214 | Facial Pain | FAERS: 51 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 215 | Colon adenoma | FAERS: 50 | US FAERS | |
| 216 | Osteosclerosis | FAERS: 50 | US FAERS | |
| 217 | Visual Impairment | FAERS: 50 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 218 | Macular degeneration | FAERS: 49 | US FAERS | |
| 219 | Otitis Media | FAERS: 49 | US FAERS | |
| 220 | Flatulence | FAERS: 48 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 221 | Pyelonephritis | FAERS: 48 | US FAERS | |
| 222 | Wound dehiscence | FAERS: 48 | US FAERS | |
| 223 | treatment failure | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 224 | Feeling abnormal | FAERS: 46 | SIDER US FAERS | |
| 225 | Night sweats | FAERS: 46 | US FAERS | |
| 226 | Periarthritis | FAERS: 46 | OFFSIDES US FAERS | |
| 227 | Venous Insufficiency | FAERS: 46 | OFFSIDES US FAERS | |
| 228 | Clostridium difficile colitis | FAERS: 45 | US FAERS | |
| 229 | Dysgeusia | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 230 | Flank Pain | FAERS: 45 | US FAERS | |
| 231 | Granuloma | FAERS: 45 | OFFSIDES US FAERS | |
| 232 | Limb discomfort | FAERS: 45 | US FAERS | |
| 233 | Nervousness | FAERS: 45 | US FAERS | |
| 234 | Thrombosis | FAERS: 45 | US FAERS | |
| 235 | Polymyalgia Rheumatica | FAERS: 44 | OFFSIDES US FAERS | |
| 236 | Rectocele | FAERS: 44 | US FAERS | |
| 237 | Eczema | FAERS: 43 | OFFSIDES US FAERS | |
| 238 | Gingival Recession | FAERS: 43 | US FAERS | |
| 239 | Malnutrition | FAERS: 43 | US FAERS | |
| 240 | Thyroid Neoplasm | FAERS: 43 | US FAERS | |
| 241 | Eye pain | FAERS: 42 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 242 | Lip swelling | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 243 | Poor quality sleep | FAERS: 42 | US FAERS | |
| 244 | Bunion | FAERS: 41 | OFFSIDES US FAERS | |
| 245 | Colitis | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 246 | Device breakage | FAERS: 41 | US FAERS | |
| 247 | Diastolic dysfunction | FAERS: 41 | US FAERS | |
| 248 | Incorrect dose administered | FAERS: 41 | US FAERS | |
| 249 | Somnolence | FAERS: 41 | US FAERS | |
| 250 | Upper-airway cough syndrome | FAERS: 41 | US FAERS | |
| 251 | Cheilitis | FAERS: 40 | US FAERS | |
| 252 | Endodontic procedure | FAERS: 40 | US FAERS | |
| 253 | Epicondylitis | FAERS: 40 | OFFSIDES US FAERS | |
| 254 | Hyperthyroidism | FAERS: 40 | US FAERS | |
| 255 | Open wound | FAERS: 40 | US FAERS | |
| 256 | Atrial tachycardia | FAERS: 39 | US FAERS | |
| 257 | Hydronephrosis | FAERS: 39 | US FAERS | |
| 258 | Limb asymmetry | FAERS: 39 | US FAERS | |
| 259 | Productive Cough | FAERS: 39 | OFFSIDES US FAERS | |
| 260 | Psoriasis | FAERS: 39 | US FAERS | |
| 261 | Burning sensation | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 262 | Labyrinthitis | FAERS: 38 | US FAERS | |
| 263 | Necrosis | FAERS: 38 | 17375077 | CTD US FAERS |
| 264 | Activities of daily living impaired | FAERS: 37 | US FAERS | |
| 265 | Postoperative fever | FAERS: 37 | US FAERS | |
| 266 | Pulmonary Hypertension | FAERS: 37 | OFFSIDES US FAERS | |
| 267 | Cerebral atrophy | FAERS: 36 | US FAERS | |
| 268 | Lichen Planus | FAERS: 36 | OFFSIDES US FAERS | |
| 269 | Medication Error | FAERS: 36 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 270 | Menopause | FAERS: 36 | SIDER US FAERS | |
| 271 | Myositis | FAERS: 36 | US FAERS | |
| 272 | Primary sequestrum | FAERS: 36 | US FAERS | |
| 273 | Drug Dependence | FAERS: 35 | US FAERS | |
| 274 | Laryngitis | FAERS: 35 | US FAERS | |
| 275 | Leukoplakia | FAERS: 35 | US FAERS | |
| 276 | Presyncope | FAERS: 35 | US FAERS | |
| 277 | Wheezing | FAERS: 35 | US FAERS | |
| 278 | Post procedural complication | FAERS: 34 | OFFSIDES US FAERS | |
| 279 | Delirium | FAERS: 33 | US FAERS | |
| 280 | Disability | FAERS: 33 | US FAERS | |
| 281 | Failure of implant | FAERS: 33 | US FAERS | |
| 282 | Hypertensive heart disease | FAERS: 33 | US FAERS | |
| 283 | Peripheral arterial occlusive disease | FAERS: 33 | OFFSIDES US FAERS | |
| 284 | Sinus bradycardia | FAERS: 33 | US FAERS | |
| 285 | Anorexia | FAERS: 31 | OFFSIDES US FAERS | |
| 286 | Cartilage injury | FAERS: 31 | US FAERS | |
| 287 | Obsessive-Compulsive Disorder | FAERS: 31 | US FAERS | |
| 288 | Adenoidal disorder | FAERS: 30 | US FAERS | |
| 289 | Cervicobrachial syndrome | FAERS: 30 | US FAERS | |
| 290 | Hyperparathyroidism | FAERS: 30 | OFFSIDES US FAERS | |
| 291 | Impaired gastric emptying | FAERS: 30 | US FAERS | |
| 292 | Joint stiffness | FAERS: 30 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 293 | Medical device complication | FAERS: 30 | US FAERS | |
| 294 | Sjogren's Syndrome | FAERS: 30 | OFFSIDES US FAERS | |
| 295 | Uterine Prolapse | FAERS: 30 | US FAERS | |
| 296 | Agitation | FAERS: 29 | US FAERS | |
| 297 | Bronchospasm | FAERS: 29 | US FAERS | |
| 298 | Neutropenia | FAERS: 29 | US FAERS | |
| 299 | jaundice | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 300 | Blood potassium decreased | FAERS: 28 | US FAERS | |
| 301 | Device related infection | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 302 | Erectile dysfunction | FAERS: 28 | US FAERS | |
| 303 | Glossitis | FAERS: 28 | US FAERS | |
| 304 | Periostitis | FAERS: 28 | US FAERS | |
| 305 | Aortic Aneurysm | FAERS: 27 | US FAERS | |
| 306 | Arthropod bite | FAERS: 27 | OFFSIDES US FAERS | |
| 307 | Bladder prolapse | FAERS: 27 | US FAERS | |
| 308 | Blindness | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 309 | Bronchiectasis | FAERS: 27 | US FAERS | |
| 310 | Choking | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 311 | Osteomalacia | FAERS: 27 | US FAERS | |
| 312 | Otitis Externa | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 313 | Pancytopenia | FAERS: 27 | US FAERS | |
| 314 | Pelvic Pain | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 315 | Spondylitis | FAERS: 27 | OFFSIDES US FAERS | |
| 316 | Thrombocytopenia | FAERS: 27 | US FAERS | |
| 317 | Benign Prostatic Hyperplasia | FAERS: 26 | US FAERS | |
| 318 | Bone formation decreased | FAERS: 26 | US FAERS | |
| 319 | Cholecystitis | FAERS: 26 | OFFSIDES US FAERS | |
| 320 | Discomfort | FAERS: 26 | SIDER US FAERS | |
| 321 | Exposed bone in jaw | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 322 | Pulmonary Fibrosis | FAERS: 26 | US FAERS | |
| 323 | Sinus Tachycardia | FAERS: 26 | US FAERS | |
| 324 | Tracheobronchitis | FAERS: 26 | US FAERS | |
| 325 | Acute myocardial infarction | FAERS: 25 | US FAERS | |
| 326 | Bone fragmentation | FAERS: 25 | US FAERS | |
| 327 | Cataract operation | FAERS: 25 | US FAERS | |
| 328 | Debridement | FAERS: 25 | US FAERS | |
| 329 | Excoriation | FAERS: 25 | US FAERS | |
| 330 | Gout | FAERS: 25 | OFFSIDES US FAERS | |
| 331 | Lobar Pneumonia | FAERS: 25 | US FAERS | |
| 332 | Sinus headache | FAERS: 25 | US FAERS | |
| 333 | Urinary Retention | FAERS: 25 | US FAERS | |
| 334 | Benign Neoplasm | FAERS: 24 | US FAERS | |
| 335 | Blood triglycerides increased | FAERS: 24 | US FAERS | |
| 336 | Chills | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 337 | Enthesopathy | FAERS: 24 | US FAERS | |
| 338 | Iliotibial Band Syndrome | FAERS: 24 | US FAERS | |
| 339 | Infected cyst | FAERS: 24 | US FAERS | |
| 340 | Multiple Myeloma | FAERS: 24 | OFFSIDES US FAERS | |
| 341 | Nasal Polyps | FAERS: 24 | US FAERS | |
| 342 | Post-Traumatic Stress Disorder | FAERS: 24 | US FAERS | |
| 343 | Product substitution issue | FAERS: 24 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 344 | Tenosynovitis | FAERS: 24 | OFFSIDES US FAERS | |
| 345 | Transaminases increased | FAERS: 24 | SIDER US FAERS | |
| 346 | Tympanic Membrane Perforation | FAERS: 24 | OFFSIDES US FAERS | |
| 347 | fibroma | FAERS: 24 | US FAERS | |
| 348 | Carotid artery occlusion | FAERS: 23 | US FAERS | |
| 349 | Oropharyngeal candidiasis | FAERS: 23 | US FAERS | |
| 350 | Skin laceration | FAERS: 23 | US FAERS | |
| 351 | Submandibular mass | FAERS: 23 | OFFSIDES US FAERS | |
| 352 | Viral upper respiratory tract infection | FAERS: 23 | US FAERS | |
| 353 | Benign neoplasm of spinal cord | FAERS: 22 | OFFSIDES US FAERS | |
| 354 | Blood urea increased | FAERS: 22 | US FAERS | |
| 355 | Ecchymosis | FAERS: 22 | US FAERS | |
| 356 | Hepatitis C | FAERS: 22 | US FAERS | |
| 357 | Lactose Intolerance | FAERS: 22 | US FAERS | |
| 358 | Peripheral swelling | FAERS: 22 | US FAERS | |
| 359 | Pulmonary vascular disorder | FAERS: 22 | US FAERS | |
| 360 | Rectal spasm | FAERS: 22 | US FAERS | |
| 361 | Rosacea | FAERS: 22 | US FAERS | |
| 362 | Sinus Arrhythmia | FAERS: 22 | US FAERS | |
| 363 | Tonsillectomy | FAERS: 22 | US FAERS | |
| 364 | Wrong technique in drug usage process | FAERS: 22 | US FAERS | |
| 365 | Accidental overdose | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 366 | Blood alkaline phosphatase increased | FAERS: 21 | OFFSIDES US FAERS | |
| 367 | Foreign body trauma | FAERS: 21 | OFFSIDES US FAERS | |
| 368 | Latex allergy | FAERS: 21 | US FAERS | |
| 369 | Polyarthritis | FAERS: 21 | US FAERS | |
| 370 | Retinal Detachment | FAERS: 21 | US FAERS | |
| 371 | Wrong technique in product usage process | FAERS: 21 | US FAERS | |
| 372 | nervous system disorder | FAERS: 21 | US FAERS | |
| 373 | Acute respiratory failure | FAERS: 20 | OFFSIDES US FAERS | |
| 374 | Appendicitis | FAERS: 20 | US FAERS | |
| 375 | Bone density abnormal | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 376 | Diplopia | FAERS: 20 | US FAERS | |
| 377 | Eructation | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 378 | Intestinal Obstruction | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 379 | Oral fibroma | FAERS: 20 | US FAERS | |
| 380 | Rash erythematous | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 381 | Snoring | FAERS: 20 | US FAERS | |
| 382 | Tooth Resorption | FAERS: 20 | US FAERS | |
| 383 | Vascular calcification | FAERS: 20 | US FAERS | |
| 384 | Venous thrombosis limb | FAERS: 20 | US FAERS | |
| 385 | Vitreous floaters | FAERS: 20 | US FAERS | |
| 386 | Wound Infection | FAERS: 20 | US FAERS | |
| 387 | Blepharitis | FAERS: 19 | US FAERS | |
| 388 | Blood glucose abnormal | FAERS: 19 | US FAERS | |
| 389 | Drug toxicity | FAERS: 19 | US FAERS | |
| 390 | Eye Infection | FAERS: 19 | OFFSIDES US FAERS | |
| 391 | Failure to Thrive | FAERS: 19 | US FAERS | |
| 392 | Gastrointestinal Pain | FAERS: 19 | SIDER US FAERS | |
| 393 | Hordeolum | FAERS: 19 | US FAERS | |
| 394 | Intracranial Aneurysm | FAERS: 19 | OFFSIDES US FAERS | |
| 395 | Meningioma | FAERS: 19 | US FAERS | |
| 396 | Purulence | FAERS: 19 | US FAERS | |
| 397 | Rectal polyp | FAERS: 19 | OFFSIDES US FAERS | |
| 398 | Respiratory distress | FAERS: 19 | US FAERS | |
| 399 | Temporal Arteritis | FAERS: 19 | US FAERS | |
| 400 | Umbilical hernia | FAERS: 19 | US FAERS | |
| 401 | Atrial Flutter | FAERS: 18 | US FAERS | |
| 402 | Blood potassium increased | FAERS: 18 | US FAERS | |
| 403 | Diabetes mellitus inadequate control | FAERS: 18 | US FAERS | |
| 404 | Feeling jittery | FAERS: 18 | US FAERS | |
| 405 | Lethargy | FAERS: 18 | US FAERS | |
| 406 | Low density lipoprotein increased | FAERS: 18 | US FAERS | |
| 407 | Melanosis coli | FAERS: 18 | US FAERS | |
| 408 | Mouth cyst | FAERS: 18 | OFFSIDES US FAERS | |
| 409 | Optic Neuritis | FAERS: 18 | OFFSIDES US FAERS | |
| 410 | Oropharyngeal blistering | FAERS: 18 | US FAERS | |
| 411 | Phlebitis | FAERS: 18 | US FAERS | |
| 412 | Pleurisy | FAERS: 18 | US FAERS | |
| 413 | Pneumothorax | FAERS: 18 | US FAERS | |
| 414 | Post procedural infection | FAERS: 18 | US FAERS | |
| 415 | Proteinuria | FAERS: 18 | 18754075 | CTD US FAERS |
| 416 | Pyogenic granuloma | FAERS: 18 | US FAERS | |
| 417 | Sexual Dysfunction | FAERS: 18 | US FAERS | |
| 418 | Tooth Erosion | FAERS: 18 | US FAERS | |
| 419 | Angle Closure Glaucoma | FAERS: 17 | US FAERS | |
| 420 | Atypical fracture | FAERS: 17 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 421 | Dental Restoration Failure | FAERS: 17 | US FAERS | |
| 422 | Device intolerance | FAERS: 17 | US FAERS | |
| 423 | Electrolyte imbalance | FAERS: 17 | US FAERS | |
| 424 | Epilepsy | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 425 | Hepatitis B | FAERS: 17 | US FAERS | |
| 426 | Lipoma | FAERS: 17 | US FAERS | |
| 427 | Meniscus injury | FAERS: 17 | US FAERS | |
| 428 | Neuroma | FAERS: 17 | US FAERS | |
| 429 | Procedural complication | FAERS: 17 | US FAERS | |
| 430 | Quality of life decreased | FAERS: 17 | US FAERS | |
| 431 | Rhabdomyolysis | FAERS: 17 | US FAERS | |
| 432 | Skin Papilloma | FAERS: 17 | US FAERS | |
| 433 | Thoracic vertebral fracture | FAERS: 17 | OFFSIDES US FAERS | |
| 434 | Urine calcium increased | FAERS: 17 | US FAERS | |
| 435 | Vertebral foraminal stenosis | FAERS: 17 | US FAERS | |
| 436 | Animal bite | FAERS: 16 | US FAERS | |
| 437 | Blood parathyroid hormone increased | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 438 | Dysarthria | FAERS: 16 | US FAERS | |
| 439 | Dysplasia | FAERS: 16 | US FAERS | |
| 440 | Electrocardiogram ST-T change | FAERS: 16 | US FAERS | |
| 441 | Emotional disorder | FAERS: 16 | US FAERS | |
| 442 | Malignant Hypertension | FAERS: 16 | US FAERS | |
| 443 | Menorrhagia | FAERS: 16 | US FAERS | |
| 444 | Multiple Sclerosis | FAERS: 16 | US FAERS | |
| 445 | Overweight | FAERS: 16 | OFFSIDES US FAERS | |
| 446 | Paranasal sinus hypersecretion | FAERS: 16 | US FAERS | |
| 447 | Pharyngolaryngeal Pain | FAERS: 16 | OFFSIDES US FAERS | |
| 448 | Pulmonary granuloma | FAERS: 16 | US FAERS | |
| 449 | Purulent discharge | FAERS: 16 | US FAERS | |
| 450 | Respiratory Depression | FAERS: 16 | US FAERS | |
| 451 | Sarcoidosis | FAERS: 16 | US FAERS | |
| 452 | Alveolitis | FAERS: 15 | US FAERS | |
| 453 | Anosmia | FAERS: 15 | US FAERS | |
| 454 | Aspartate Aminotransferase Increased | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 455 | Cervical dysplasia | FAERS: 15 | US FAERS | |
| 456 | Drug abuse | FAERS: 15 | US FAERS | |
| 457 | Food Allergy | FAERS: 15 | US FAERS | |
| 458 | Genital Herpes | FAERS: 15 | US FAERS | |
| 459 | Hepatitis | FAERS: 15 | OFFSIDES US FAERS | |
| 460 | Incision site complication | FAERS: 15 | US FAERS | |
| 461 | Incontinence | FAERS: 15 | OFFSIDES US FAERS | |
| 462 | Intertrigo | FAERS: 15 | US FAERS | |
| 463 | Lymphoma | FAERS: 15 | US FAERS | |
| 464 | MYELODYSPLASTIC SYNDROME | FAERS: 15 | US FAERS | |
| 465 | Metatarsalgia | FAERS: 15 | US FAERS | |
| 466 | Multiple allergies | FAERS: 15 | US FAERS | |
| 467 | Muscle Spasticity | FAERS: 15 | US FAERS | |
| 468 | Neurodermatitis | FAERS: 15 | US FAERS | |
| 469 | Pemphigus | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 470 | Pneumonitis | FAERS: 15 | US FAERS | |
| 471 | Product quality issue | FAERS: 15 | US FAERS | |
| 472 | Seroma | FAERS: 15 | US FAERS | |
| 473 | Temperature intolerance | FAERS: 15 | US FAERS | |
| 474 | Urge Incontinence | FAERS: 15 | OFFSIDES US FAERS | |
| 475 | furuncle | FAERS: 15 | US FAERS | |
| 476 | Abdominal adhesions | FAERS: 14 | US FAERS | |
| 477 | Aphonia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 478 | Arthroscopy | FAERS: 14 | US FAERS | |
| 479 | Blood pressure fluctuation | FAERS: 14 | US FAERS | |
| 480 | Bone erosion | FAERS: 14 | US FAERS | |
| 481 | Cervical polyp | FAERS: 14 | US FAERS | |
| 482 | Cheilosis | FAERS: 14 | US FAERS | |
| 483 | Contrast media allergy | FAERS: 14 | OFFSIDES US FAERS | |
| 484 | Dental discomfort | FAERS: 14 | US FAERS | |
| 485 | Dental prosthesis user | FAERS: 14 | OFFSIDES US FAERS | |
| 486 | Depressed mood | FAERS: 14 | US FAERS | |
| 487 | Drooling | FAERS: 14 | US FAERS | |
| 488 | Ear discomfort | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 489 | Empyema | FAERS: 14 | US FAERS | |
| 490 | Eye irritation | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 491 | Hemiparesis | FAERS: 14 | US FAERS | |
| 492 | Hormone Therapy | FAERS: 14 | OFFSIDES US FAERS | |
| 493 | Hypercalciuria | FAERS: 14 | 19185560 | CTD SIDER US FAERS |
| 494 | Hypoaesthesia facial | FAERS: 14 | OFFSIDES US FAERS | |
| 495 | Injection site pain | FAERS: 14 | US FAERS | |
| 496 | Lip neoplasm malignant stage unspecified | FAERS: 14 | US FAERS | |
| 497 | Lymphopenia | FAERS: 14 | SIDER US FAERS | |
| 498 | Ocular Hypertension | FAERS: 14 | US FAERS | |
| 499 | Osteogenesis Imperfecta | FAERS: 14 | SIDER US FAERS | |
| 500 | Poor personal hygiene | FAERS: 14 | US FAERS | |
| 501 | Pressure of speech | FAERS: 14 | US FAERS | |
| 502 | Product use issue | FAERS: 14 | US FAERS | |
| 503 | Sebaceous hyperplasia | FAERS: 14 | OFFSIDES US FAERS | |
| 504 | Squamous cell carcinoma of skin | FAERS: 14 | OFFSIDES US FAERS | |
| 505 | Venous Thrombosis | FAERS: 14 | US FAERS | |
| 506 | neurofibroma | FAERS: 14 | US FAERS | |
| 507 | Ataxia | FAERS: 13 | US FAERS | |
| 508 | Benign neoplasm of skin | FAERS: 13 | US FAERS | |
| 509 | Blood creatinine increased | FAERS: 13 | US FAERS | |
| 510 | Bone callus excessive | FAERS: 13 | US FAERS | |
| 511 | Cerebral ventricle dilatation | FAERS: 13 | US FAERS | |
| 512 | Chondromalacia | FAERS: 13 | US FAERS | |
| 513 | Crying | FAERS: 13 | US FAERS | |
| 514 | Duodenitis | FAERS: 13 | 12730757 | CTD OFFSIDES US FAERS |
| 515 | Electrocardiogram ST segment abnormal | FAERS: 13 | US FAERS | |
| 516 | Hepatitis A | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 517 | Ileus | FAERS: 13 | US FAERS | |
| 518 | Iodine allergy | FAERS: 13 | US FAERS | |
| 519 | Leukopenia | FAERS: 13 | US FAERS | |
| 520 | Lymphangitis | FAERS: 13 | US FAERS | |
| 521 | Meniscal degeneration | FAERS: 13 | US FAERS | |
| 522 | Nasal discomfort | FAERS: 13 | US FAERS | |
| 523 | Nerve Root Compression | FAERS: 13 | US FAERS | |
| 524 | Neuritis | FAERS: 13 | US FAERS | |
| 525 | Occult blood positive | FAERS: 13 | US FAERS | |
| 526 | Polyneuropathy | FAERS: 13 | US FAERS | |
| 527 | Presbyopia | FAERS: 13 | US FAERS | |
| 528 | Restrictive pulmonary disease | FAERS: 13 | US FAERS | |
| 529 | Seasonal Affective Disorder | FAERS: 13 | US FAERS | |
| 530 | Steroid therapy | FAERS: 13 | US FAERS | |
| 531 | Thirst | FAERS: 13 | US FAERS | |
| 532 | Traumatic fracture | FAERS: 13 | US FAERS | |
| 533 | Vitreous Detachment | FAERS: 13 | US FAERS | |
| 534 | Ageusia | FAERS: 12 | US FAERS | |
| 535 | Alcohol abuse | FAERS: 12 | US FAERS | |
| 536 | Astigmatism | FAERS: 12 | OFFSIDES US FAERS | |
| 537 | Blood count abnormal | FAERS: 12 | US FAERS | |
| 538 | Blood glucose increased | FAERS: 12 | US FAERS | |
| 539 | Bone abscess | FAERS: 12 | US FAERS | |
| 540 | Breast cancer recurrent | FAERS: 12 | US FAERS | |
| 541 | Cerebral disorder | FAERS: 12 | US FAERS | |
| 542 | Cervical cord compression | FAERS: 12 | US FAERS | |
| 543 | Cyst removal | FAERS: 12 | US FAERS | |
| 544 | Dental Plaque | FAERS: 12 | US FAERS | |
| 545 | Diabetic Retinopathy | FAERS: 12 | US FAERS | |
| 546 | Fasciitis | FAERS: 12 | US FAERS | |
| 547 | Gastrointestinal ulcer | FAERS: 12 | US FAERS | |
| 548 | Gingival erythema | FAERS: 12 | OFFSIDES US FAERS | |
| 549 | Hypersomnia | FAERS: 12 | US FAERS | |
| 550 | Hypertensive crisis | FAERS: 12 | US FAERS | |
| 551 | Left atrial dilatation | FAERS: 12 | US FAERS | |
| 552 | Lip and/or oral cavity cancer | FAERS: 12 | US FAERS | |
| 553 | Metabolic acidosis | FAERS: 12 | US FAERS | |
| 554 | Non-cardiac chest pain | FAERS: 12 | US FAERS | |
| 555 | Numb chin syndrome | FAERS: 12 | US FAERS | |
| 556 | Pelvic prolapse | FAERS: 12 | OFFSIDES US FAERS | |
| 557 | Procedural hypotension | FAERS: 12 | US FAERS | |
| 558 | Strabismus | FAERS: 12 | US FAERS | |
| 559 | Tension Headache | FAERS: 12 | US FAERS | |
| 560 | Tinea Pedis | FAERS: 12 | US FAERS | |
| 561 | Ventricular Dysfunction | FAERS: 12 | US FAERS | |
| 562 | Vulvovaginal dryness | FAERS: 12 | US FAERS | |
| 563 | Acarodermatitis | FAERS: 11 | US FAERS | |
| 564 | Anaphylactic shock | FAERS: 11 | US FAERS | |
| 565 | Autonomic Dysreflexia | FAERS: 11 | US FAERS | |
| 566 | Autonomic nervous system imbalance | FAERS: 11 | US FAERS | |
| 567 | Bacterial disease carrier | FAERS: 11 | US FAERS | |
| 568 | Blood glucose decreased | FAERS: 11 | US FAERS | |
| 569 | Borderline glaucoma | FAERS: 11 | US FAERS | |
| 570 | Breast discomfort | FAERS: 11 | US FAERS | |
| 571 | Bronchial Hyperreactivity | FAERS: 11 | US FAERS | |
| 572 | Central nervous system lesion | FAERS: 11 | US FAERS | |
| 573 | Cerebral Arteriosclerosis | FAERS: 11 | US FAERS | |
| 574 | Cor pulmonale | FAERS: 11 | OFFSIDES US FAERS | |
| 575 | Denture wearer | FAERS: 11 | US FAERS | |
| 576 | Drug exposure during pregnancy | FAERS: 11 | US FAERS | |
| 577 | Fibroadenoma of breast | FAERS: 11 | US FAERS | |
| 578 | Gene Mutation | FAERS: 11 | US FAERS | |
| 579 | Hirsutism | FAERS: 11 | US FAERS | |
| 580 | Intestinal gangrene | FAERS: 11 | US FAERS | |
| 581 | Myelitis | FAERS: 11 | US FAERS | |
| 582 | Osteodystrophy | FAERS: 11 | US FAERS | |
| 583 | Pseudarthrosis | FAERS: 11 | US FAERS | |
| 584 | Radicular Cyst | FAERS: 11 | US FAERS | |
| 585 | Radicular pain | FAERS: 11 | US FAERS | |
| 586 | Sick Sinus Syndrome | FAERS: 11 | US FAERS | |
| 587 | Soft Tissue Infection | FAERS: 11 | US FAERS | |
| 588 | Spinal fusion surgery | FAERS: 11 | OFFSIDES US FAERS | |
| 589 | Thoracic Outlet Syndrome | FAERS: 11 | OFFSIDES US FAERS | |
| 590 | Vascular insufficiency | FAERS: 11 | OFFSIDES US FAERS | |
| 591 | Vascular stenosis | FAERS: 11 | US FAERS | |
| 592 | effusion | FAERS: 11 | OFFSIDES US FAERS | |
| 593 | Agoraphobia | FAERS: 10 | US FAERS | |
| 594 | Anorectal discomfort | FAERS: 10 | US FAERS | |
| 595 | Anorgasmia | FAERS: 10 | US FAERS | |
| 596 | Aphasia | FAERS: 10 | US FAERS | |
| 597 | Bedridden | FAERS: 10 | US FAERS | |
| 598 | Blood iron decreased | FAERS: 10 | US FAERS | |
| 599 | Blood thyroid stimulating hormone increased | FAERS: 10 | US FAERS | |
| 600 | Cardiac Flutter | FAERS: 10 | OFFSIDES US FAERS | |
| 601 | Dental alveolar anomaly | FAERS: 10 | US FAERS | |
| 602 | Drug resistance | FAERS: 10 | US FAERS | |
| 603 | Dry skin | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 604 | General physical health deterioration | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 605 | Giardiasis | FAERS: 10 | US FAERS | |
| 606 | Hip surgery | FAERS: 10 | US FAERS | |
| 607 | Hypokinesia | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 608 | Implant site swelling | FAERS: 10 | US FAERS | |
| 609 | Limb operation | FAERS: 10 | US FAERS | |
| 610 | Lordosis | FAERS: 10 | OFFSIDES US FAERS | |
| 611 | Lyme Disease | FAERS: 10 | US FAERS | |
| 612 | Malocclusion | FAERS: 10 | OFFSIDES US FAERS | |
| 613 | Meningeal disorder | FAERS: 10 | US FAERS | |
| 614 | Metabolic alkalosis | FAERS: 10 | US FAERS | |
| 615 | Metastasis | FAERS: 10 | US FAERS | |
| 616 | Nutritional condition abnormal | FAERS: 10 | US FAERS | |
| 617 | Osteolysis | FAERS: 10 | OFFSIDES US FAERS | |
| 618 | Pleocytosis | FAERS: 10 | US FAERS | |
| 619 | Post procedural pneumonia | FAERS: 10 | US FAERS | |
| 620 | Post-traumatic neck syndrome | FAERS: 10 | US FAERS | |
| 621 | Postmenopause | FAERS: 10 | US FAERS | |
| 622 | Pulmonary Eosinophilia | FAERS: 10 | US FAERS | |
| 623 | Radiculitis | FAERS: 10 | US FAERS | |
| 624 | Renal tubular necrosis | FAERS: 10 | US FAERS | |
| 625 | Sequestrectomy | FAERS: 10 | US FAERS | |
| 626 | Shock | FAERS: 10 | US FAERS | |
| 627 | Uterine Cancer | FAERS: 10 | US FAERS | |
| 628 | Uveitis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 629 | Vaginal Prolapse | FAERS: 10 | US FAERS | |
| 630 | Vulvovaginal pruritus | FAERS: 10 | US FAERS | |
| 631 | Wound infection staphylococcal | FAERS: 10 | OFFSIDES US FAERS | |
| 632 | Acanthosis | FAERS: 9 | US FAERS | |
| 633 | Alanine Aminotransferase Increased | FAERS: 9 | US FAERS | |
| 634 | Anhedonia | FAERS: 9 | OFFSIDES US FAERS | |
| 635 | Avulsion fracture | FAERS: 9 | US FAERS | |
| 636 | Balanitis | FAERS: 9 | US FAERS | |
| 637 | Blood blister | FAERS: 9 | US FAERS | |
| 638 | Blood lactate dehydrogenase increased | FAERS: 9 | US FAERS | |
| 639 | Bone infarction | FAERS: 9 | US FAERS | |
| 640 | Calcinosis | FAERS: 9 | US FAERS | |
| 641 | Cardiac Arrest | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 642 | Cerebral Infarction | FAERS: 9 | US FAERS | |
| 643 | Chorioretinitis | FAERS: 9 | US FAERS | |
| 644 | Cubital Tunnel Syndrome | FAERS: 9 | US FAERS | |
| 645 | Device component issue | FAERS: 9 | US FAERS | |
| 646 | Enterocele | FAERS: 9 | US FAERS | |
| 647 | Eye inflammation | FAERS: 9 | US FAERS | |
| 648 | Fibromatosis | FAERS: 9 | US FAERS | |
| 649 | Gastric infection | FAERS: 9 | US FAERS | |
| 650 | Gastrointestinal inflammation | FAERS: 9 | US FAERS | |
| 651 | Gastrointestinal motility disorder | FAERS: 9 | US FAERS | |
| 652 | Head discomfort | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 653 | Hypertrophic Cardiomyopathy | FAERS: 9 | US FAERS | |
| 654 | Hypoparathyroidism | FAERS: 9 | US FAERS | |
| 655 | Hypoventilation | FAERS: 9 | US FAERS | |
| 656 | Incision site erythema | FAERS: 9 | US FAERS | |
| 657 | Incision site infection | FAERS: 9 | US FAERS | |
| 658 | Ligament rupture | FAERS: 9 | US FAERS | |
| 659 | Malabsorption | FAERS: 9 | US FAERS | |
| 660 | Nodal osteoarthritis | FAERS: 9 | OFFSIDES US FAERS | |
| 661 | Ovarian failure | FAERS: 9 | US FAERS | |
| 662 | Parophthalmia | FAERS: 9 | US FAERS | |
| 663 | Perivascular dermatitis | FAERS: 9 | US FAERS | |
| 664 | Phimosis | FAERS: 9 | US FAERS | |
| 665 | Product dose omission | FAERS: 9 | US FAERS | |
| 666 | Secretion discharge | FAERS: 9 | US FAERS | |
| 667 | Septic Shock | FAERS: 9 | US FAERS | |
| 668 | Trigeminal Nerve Disorder | FAERS: 9 | US FAERS | |
| 669 | Unevaluable event | FAERS: 9 | US FAERS | |
| 670 | Vasculitis | FAERS: 9 | US FAERS | |
| 671 | Vulvovaginitis | FAERS: 9 | US FAERS | |
| 672 | Abdominal Abscess | FAERS: 8 | US FAERS | |
| 673 | Abdominal tenderness | FAERS: 8 | US FAERS | |
| 674 | Acute Coronary Syndrome | FAERS: 8 | US FAERS | |
| 675 | Allergy to vaccine | FAERS: 8 | US FAERS | |
| 676 | Altered state of consciousness | FAERS: 8 | US FAERS | |
| 677 | Anal cancer stage III | FAERS: 8 | US FAERS | |
| 678 | Anger | FAERS: 8 | US FAERS | |
| 679 | Animal scratch | FAERS: 8 | US FAERS | |
| 680 | Atlantoaxial instability | FAERS: 8 | US FAERS | |
| 681 | Biliary dilatation | FAERS: 8 | US FAERS | |
| 682 | Blood albumin decreased | FAERS: 8 | US FAERS | |
| 683 | Blood homocysteine increased | FAERS: 8 | US FAERS | |
| 684 | Blood urine present | FAERS: 8 | US FAERS | |
| 685 | Brain Abscess | FAERS: 8 | US FAERS | |
| 686 | Cachexia | FAERS: 8 | US FAERS | |
| 687 | Chronic respiratory failure | FAERS: 8 | OFFSIDES US FAERS | |
| 688 | Deformity | FAERS: 8 | US FAERS | |
| 689 | Disorientation | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 690 | Dysthymic Disorder | FAERS: 8 | US FAERS | |
| 691 | Erysipelas | FAERS: 8 | US FAERS | |
| 692 | Escherichia urinary tract infection | FAERS: 8 | US FAERS | |
| 693 | Exostosis of jaw | FAERS: 8 | US FAERS | |
| 694 | Focal Nodular Hyperplasia | FAERS: 8 | US FAERS | |
| 695 | Foreign body aspiration | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 696 | Genital rash | FAERS: 8 | US FAERS | |
| 697 | Hormone replacement therapy | FAERS: 8 | US FAERS | |
| 698 | Hydrocephalus | FAERS: 8 | US FAERS | |
| 699 | Impaired work ability | FAERS: 8 | US FAERS | |
| 700 | Implant site inflammation | FAERS: 8 | OFFSIDES US FAERS | |
| 701 | Incisional hernia | FAERS: 8 | US FAERS | |
| 702 | Induration | FAERS: 8 | US FAERS | |
| 703 | Infective exacerbation of chronic obstructive airways disease | FAERS: 8 | US FAERS | |
| 704 | Intraductal papilloma of breast | FAERS: 8 | US FAERS | |
| 705 | Joint dislocation postoperative | FAERS: 8 | US FAERS | |
| 706 | Lipoma of breast | FAERS: 8 | US FAERS | |
| 707 | Lymphocyte morphology | FAERS: 8 | US FAERS | |
| 708 | Magnesium Deficiency | FAERS: 8 | US FAERS | |
| 709 | Mastitis | FAERS: 8 | US FAERS | |
| 710 | Meniscus removal | FAERS: 8 | US FAERS | |
| 711 | Myasthenia Gravis | FAERS: 8 | US FAERS | |
| 712 | Osteitis Deformans | FAERS: 8 | US FAERS | |
| 713 | Osteoma | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 714 | Osteopetrosis | FAERS: 8 | US FAERS | |
| 715 | Pharmaceutical product complaint | FAERS: 8 | US FAERS | |
| 716 | Polyuria | FAERS: 8 | US FAERS | |
| 717 | Protein total abnormal | FAERS: 8 | US FAERS | |
| 718 | Protein total decreased | FAERS: 8 | US FAERS | |
| 719 | Respiratory arrest | FAERS: 8 | US FAERS | |
| 720 | Sacroiliitis | FAERS: 8 | OFFSIDES US FAERS | |
| 721 | Transfusion Reaction | FAERS: 8 | US FAERS | |
| 722 | skin abrasion | FAERS: 8 | US FAERS | |
| 723 | Abdominal rigidity | FAERS: 7 | US FAERS | |
| 724 | Ankle deformity | FAERS: 7 | US FAERS | |
| 725 | Bacterial sepsis | FAERS: 7 | OFFSIDES US FAERS | |
| 726 | Bladder Neoplasm | FAERS: 7 | US FAERS | |
| 727 | Blood magnesium decreased | FAERS: 7 | US FAERS | |
| 728 | Blood osmolarity abnormal | FAERS: 7 | US FAERS | |
| 729 | Blood potassium abnormal | FAERS: 7 | US FAERS | |
| 730 | Bone density increased | FAERS: 7 | US FAERS | |
| 731 | Bronchopneumonia | FAERS: 7 | US FAERS | |
| 732 | Clumsiness | FAERS: 7 | US FAERS | |
| 733 | Duodenal Ulcer | FAERS: 7 | SIDER US FAERS | |
| 734 | Dystrophic calcification | FAERS: 7 | US FAERS | |
| 735 | Economic problem | FAERS: 7 | US FAERS | |
| 736 | Enchondroma | FAERS: 7 | US FAERS | |
| 737 | Endometrial disorder | FAERS: 7 | US FAERS | |
| 738 | Endometriosis | FAERS: 7 | US FAERS | |
| 739 | Epigastric discomfort | FAERS: 7 | US FAERS | |
| 740 | Flushing | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 741 | Food Poisoning | FAERS: 7 | US FAERS | |
| 742 | Gastrointestinal angiodysplasia | FAERS: 7 | US FAERS | |
| 743 | Gingival Atrophy | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 744 | Helicobacter test positive | FAERS: 7 | US FAERS | |
| 745 | Hepatomegaly | FAERS: 7 | US FAERS | |
| 746 | Human papilloma virus test positive | FAERS: 7 | US FAERS | |
| 747 | Hypertensive emergency | FAERS: 7 | US FAERS | |
| 748 | Infarction | FAERS: 7 | US FAERS | |
| 749 | Infected neoplasm | FAERS: 7 | US FAERS | |
| 750 | Jaw fistula | FAERS: 7 | US FAERS | |
| 751 | Keratitis | FAERS: 7 | US FAERS | |
| 752 | Labile blood pressure | FAERS: 7 | US FAERS | |
| 753 | Lacrimation decreased | FAERS: 7 | US FAERS | |
| 754 | Lentigo | FAERS: 7 | US FAERS | |
| 755 | Leriche Syndrome | FAERS: 7 | US FAERS | |
| 756 | Lichenification | FAERS: 7 | OFFSIDES US FAERS | |
| 757 | Lupus Nephritis | FAERS: 7 | US FAERS | |
| 758 | Lymphadenitis | FAERS: 7 | US FAERS | |
| 759 | Meningitis | FAERS: 7 | US FAERS | |
| 760 | Neurilemmoma | FAERS: 7 | US FAERS | |
| 761 | Obstruction | FAERS: 7 | US FAERS | |
| 762 | Oropharyngeal cancer stage unspecified | FAERS: 7 | OFFSIDES US FAERS | |
| 763 | Osteochondrosis | FAERS: 7 | US FAERS | |
| 764 | Pericoronitis | FAERS: 7 | US FAERS | |
| 765 | Periodontal infection | FAERS: 7 | OFFSIDES US FAERS | |
| 766 | Pleuritic pain | FAERS: 7 | US FAERS | |
| 767 | Post procedural constipation | FAERS: 7 | US FAERS | |
| 768 | Post-traumatic pain | FAERS: 7 | US FAERS | |
| 769 | Product use in unapproved indication | FAERS: 7 | US FAERS | |
| 770 | Pyuria | FAERS: 7 | US FAERS | |
| 771 | Reflux gastritis | FAERS: 7 | US FAERS | |
| 772 | Retching | FAERS: 7 | US FAERS | |
| 773 | Schizoid Personality Disorder | FAERS: 7 | US FAERS | |
| 774 | Sicca Syndrome | FAERS: 7 | US FAERS | |
| 775 | Soft tissue inflammation | FAERS: 7 | OFFSIDES US FAERS | |
| 776 | Spondylolysis | FAERS: 7 | OFFSIDES US FAERS | |
| 777 | Staphylococcal abscess | FAERS: 7 | US FAERS | |
| 778 | Status Asthmaticus | FAERS: 7 | US FAERS | |
| 779 | Suture related complication | FAERS: 7 | OFFSIDES US FAERS | |
| 780 | Toxicity to various agents | FAERS: 7 | US FAERS | |
| 781 | Uterine cervix stenosis | FAERS: 7 | US FAERS | |
| 782 | Visual disturbance | FAERS: 7 | US FAERS | |
| 783 | Vitreous degeneration | FAERS: 7 | US FAERS | |
| 784 | Vulvitis | FAERS: 7 | US FAERS | |
| 785 | Walking aid user | FAERS: 7 | US FAERS | |
| 786 | Acne | FAERS: 6 | US FAERS | |
| 787 | Adenocarcinoma | FAERS: 6 | US FAERS | |
| 788 | Adenoidectomy | FAERS: 6 | US FAERS | |
| 789 | Adjustment disorder with depressed mood | FAERS: 6 | US FAERS | |
| 790 | Allergic sinusitis | FAERS: 6 | US FAERS | |
| 791 | Allergy to arthropod sting | FAERS: 6 | OFFSIDES US FAERS | |
| 792 | Aortic valve calcification | FAERS: 6 | US FAERS | |
| 793 | Aortic valve sclerosis | FAERS: 6 | US FAERS | |
| 794 | Arcus lipoides | FAERS: 6 | US FAERS | |
| 795 | Artificial crown procedure | FAERS: 6 | US FAERS | |
| 796 | Bacterial test | FAERS: 6 | US FAERS | |
| 797 | Blood sodium decreased | FAERS: 6 | US FAERS | |
| 798 | Blood thyroid stimulating hormone decreased | FAERS: 6 | US FAERS | |
| 799 | Bone atrophy | FAERS: 6 | US FAERS | |
| 800 | Breast hyperplasia | FAERS: 6 | US FAERS | |
| 801 | Buccal polyp | FAERS: 6 | US FAERS | |
| 802 | Burning Mouth Syndrome | FAERS: 6 | OFFSIDES US FAERS | |
| 803 | C-telopeptide increased | FAERS: 6 | US FAERS | |
| 804 | Cauda Equina Syndrome | FAERS: 6 | US FAERS | |
| 805 | Cervical myelopathy | FAERS: 6 | US FAERS | |
| 806 | Depressed Level of Consciousness | FAERS: 6 | US FAERS | |
| 807 | Dermatomyositis | FAERS: 6 | OFFSIDES US FAERS | |
| 808 | Device deployment issue | FAERS: 6 | US FAERS | |
| 809 | Device dislocation | FAERS: 6 | US FAERS | |
| 810 | Device extrusion | FAERS: 6 | US FAERS | |
| 811 | Embolism | FAERS: 6 | US FAERS | |
| 812 | Enterococcal infection | FAERS: 6 | US FAERS | |
| 813 | Enzyme level increased | FAERS: 6 | US FAERS | |
| 814 | Erythroplasia | FAERS: 6 | US FAERS | |
| 815 | Essential Tremor | FAERS: 6 | US FAERS | |
| 816 | Frustration | FAERS: 6 | US FAERS | |
| 817 | Gas Gangrene | FAERS: 6 | US FAERS | |
| 818 | Hip swelling | FAERS: 6 | US FAERS | |
| 819 | Hypophagia | FAERS: 6 | US FAERS | |
| 820 | Implant site reaction | FAERS: 6 | US FAERS | |
| 821 | Infectious Mononucleosis | FAERS: 6 | US FAERS | |
| 822 | Intercapillary glomerulosclerosis | FAERS: 6 | US FAERS | |
| 823 | Intervertebral disc injury | FAERS: 6 | US FAERS | |
| 824 | Intracranial Hypotension | FAERS: 6 | US FAERS | |
| 825 | Ligament injury | FAERS: 6 | US FAERS | |
| 826 | Liver Abscess | FAERS: 6 | US FAERS | |
| 827 | Mallory-Weiss Syndrome | FAERS: 6 | US FAERS | |
| 828 | Medical device pain | FAERS: 6 | US FAERS | |
| 829 | Melanosis | FAERS: 6 | US FAERS | |
| 830 | Metaplasia | FAERS: 6 | OFFSIDES US FAERS | |
| 831 | Myositis Ossificans | FAERS: 6 | US FAERS | |
| 832 | Narcolepsy | FAERS: 6 | US FAERS | |
| 833 | Oroantral Fistula | FAERS: 6 | US FAERS | |
| 834 | Personality Change | FAERS: 6 | US FAERS | |
| 835 | Poor peripheral circulation | FAERS: 6 | US FAERS | |
| 836 | Post procedural fistula | FAERS: 6 | US FAERS | |
| 837 | Rectal discharge | FAERS: 6 | US FAERS | |
| 838 | Retroperitoneal lymphadenopathy | FAERS: 6 | US FAERS | |
| 839 | Rheumatic Fever | FAERS: 6 | US FAERS | |
| 840 | Stevens-Johnson Syndrome | FAERS: 6 | 25811541 | CTD SIDER US FAERS |
| 841 | Subcutaneous nodule | FAERS: 6 | US FAERS | |
| 842 | Suicide attempt | FAERS: 6 | US FAERS | |
| 843 | Syringomyelia | FAERS: 6 | US FAERS | |
| 844 | Tachyarrhythmia | FAERS: 6 | US FAERS | |
| 845 | Thrombocytosis | FAERS: 6 | US FAERS | |
| 846 | Thrombotic stroke | FAERS: 6 | US FAERS | |
| 847 | Tongue eruption | FAERS: 6 | US FAERS | |
| 848 | Urethral caruncle | FAERS: 6 | US FAERS | |
| 849 | Vestibular Neuronitis | FAERS: 6 | US FAERS | |
| 850 | Vitiligo | FAERS: 6 | US FAERS | |
| 851 | Wound necrosis | FAERS: 6 | US FAERS | |
| 852 | hypertensive nephropathy | FAERS: 6 | US FAERS | |
| 853 | Allergy to animal | FAERS: 5 | US FAERS | |
| 854 | Anastomotic ulcer | FAERS: 5 | SIDER US FAERS | |
| 855 | Aneurysm | FAERS: 5 | US FAERS | |
| 856 | Aphagia | FAERS: 5 | US FAERS | |
| 857 | Arterial bruit | FAERS: 5 | US FAERS | |
| 858 | Barbiturates positive | FAERS: 5 | US FAERS | |
| 859 | Bipolar I disorder | FAERS: 5 | US FAERS | |
| 860 | Bladder spasm | FAERS: 5 | US FAERS | |
| 861 | Blood creatine increased | FAERS: 5 | US FAERS | |
| 862 | Bone fistula | FAERS: 5 | US FAERS | |
| 863 | CREST Syndrome | FAERS: 5 | US FAERS | |
| 864 | Cervix carcinoma | FAERS: 5 | US FAERS | |
| 865 | Citrobacter infection | FAERS: 5 | US FAERS | |
| 866 | Colectomy | FAERS: 5 | US FAERS | |
| 867 | Corneal erosion | FAERS: 5 | US FAERS | |
| 868 | Drug dispensing error | FAERS: 5 | US FAERS | |
| 869 | Enuresis | FAERS: 5 | US FAERS | |
| 870 | Episcleritis | FAERS: 5 | SIDER US FAERS | |
| 871 | Factor V Leiden mutation | FAERS: 5 | US FAERS | |
| 872 | Febrile Neutropenia | FAERS: 5 | US FAERS | |
| 873 | Gangrene | FAERS: 5 | US FAERS | |
| 874 | Gastrostomy | FAERS: 5 | US FAERS | |
| 875 | Gingival Hyperplasia | FAERS: 5 | US FAERS | |
| 876 | Hepatic Encephalopathy | FAERS: 5 | US FAERS | |
| 877 | Hilar lymphadenopathy | FAERS: 5 | US FAERS | |
| 878 | Hoarseness | FAERS: 5 | US FAERS | |
| 879 | Hyperaldosteronism | FAERS: 5 | US FAERS | |
| 880 | Hyperchlorhydria | FAERS: 5 | US FAERS | |
| 881 | Hypophosphatasia | FAERS: 5 | US FAERS | |
| 882 | Iliac artery stenosis | FAERS: 5 | US FAERS | |
| 883 | Incorrect drug administration duration | FAERS: 5 | US FAERS | |
| 884 | Inspiratory capacity decreased | FAERS: 5 | US FAERS | |
| 885 | Insulin-requiring type 2 diabetes mellitus | FAERS: 5 | US FAERS | |
| 886 | Intestinal Perforation | FAERS: 5 | US FAERS | |
| 887 | Leukocytoclastic vasculitis | FAERS: 5 | US FAERS | |
| 888 | Lymph node palpable | FAERS: 5 | US FAERS | |
| 889 | Malignant melanoma in situ | FAERS: 5 | US FAERS | |
| 890 | Mastectomy | FAERS: 5 | US FAERS | |
| 891 | Medical device implantation | FAERS: 5 | US FAERS | |
| 892 | Megacolon | FAERS: 5 | US FAERS | |
| 893 | Motion Sickness | FAERS: 5 | US FAERS | |
| 894 | Muscle tightness | FAERS: 5 | US FAERS | |
| 895 | Mycotic allergy | FAERS: 5 | US FAERS | |
| 896 | Nicotine Dependence | FAERS: 5 | US FAERS | |
| 897 | Onychoclasis | FAERS: 5 | US FAERS | |
| 898 | Oral fungal infection | FAERS: 5 | OFFSIDES US FAERS | |
| 899 | Oxygen consumption decreased | FAERS: 5 | US FAERS | |
| 900 | Pancreatic carcinoma | FAERS: 5 | US FAERS | |
| 901 | Parotid abscess | FAERS: 5 | US FAERS | |
| 902 | Parotitis | FAERS: 5 | OFFSIDES US FAERS | |
| 903 | Pericardial effusion | FAERS: 5 | US FAERS | |
| 904 | Periodontal operation | FAERS: 5 | US FAERS | |
| 905 | Peripheral nerve lesion | FAERS: 5 | US FAERS | |
| 906 | Portal hypertensive gastropathy | FAERS: 5 | US FAERS | |
| 907 | Pregnancy | FAERS: 5 | US FAERS | |
| 908 | Prescribed overdose | FAERS: 5 | US FAERS | |
| 909 | Procedural nausea | FAERS: 5 | US FAERS | |
| 910 | Pseudocyst | FAERS: 5 | US FAERS | |
| 911 | Rectal fissure | FAERS: 5 | OFFSIDES US FAERS | |
| 912 | Renal Artery Stenosis | FAERS: 5 | US FAERS | |
| 913 | Renal mass | FAERS: 5 | US FAERS | |
| 914 | Retinal Artery Occlusion | FAERS: 5 | US FAERS | |
| 915 | Schizoaffective Disorder | FAERS: 5 | US FAERS | |
| 916 | Shoulder deformity | FAERS: 5 | US FAERS | |
| 917 | Skin irritation | FAERS: 5 | US FAERS | |
| 918 | Soft tissue necrosis | FAERS: 5 | US FAERS | |
| 919 | Spinal column injury | FAERS: 5 | US FAERS | |
| 920 | Stasis dermatitis | FAERS: 5 | US FAERS | |
| 921 | Therapeutic response unexpected | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 922 | Tooth Crowding | FAERS: 5 | US FAERS | |
| 923 | Underweight | FAERS: 5 | US FAERS | |
| 924 | VIIth nerve paralysis | FAERS: 5 | US FAERS | |
| 925 | Vaginal erosion | FAERS: 5 | US FAERS | |
| 926 | Vaginal lesion | FAERS: 5 | US FAERS | |
| 927 | Ventricular hypokinesia | FAERS: 5 | US FAERS | |
| 928 | Vertebroplasty | FAERS: 5 | US FAERS | |
| 929 | Wheelchair user | FAERS: 5 | US FAERS | |
| 930 | White blood cell count decreased | FAERS: 5 | US FAERS | |
| 931 | liposarcoma | FAERS: 5 | US FAERS | |
| 932 | muscle injury | FAERS: 5 | US FAERS | |
| 933 | prostatitis | FAERS: 5 | US FAERS | |
| 934 | Abdominal mass | FAERS: 4 | US FAERS | |
| 935 | Acquired diaphragmatic eventration | FAERS: 4 | US FAERS | |
| 936 | Actinomyces test positive | FAERS: 4 | US FAERS | |
| 937 | Acute kidney injury | FAERS: 4 | 9430905 18754075 | CTD US FAERS |
| 938 | Amaurosis Fugax | FAERS: 4 | US FAERS | |
| 939 | Aortic occlusion | FAERS: 4 | US FAERS | |
| 940 | Arterial Injury | FAERS: 4 | US FAERS | |
| 941 | Arthrodesis | FAERS: 4 | US FAERS | |
| 942 | Biopsy liver abnormal | FAERS: 4 | OFFSIDES US FAERS | |
| 943 | Blood Pressure | FAERS: 4 | US FAERS | |
| 944 | Blood cholesterol abnormal | FAERS: 4 | US FAERS | |
| 945 | Blood creatine phosphokinase increased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 946 | Blood parathyroid hormone decreased | FAERS: 4 | OFFSIDES US FAERS | |
| 947 | Blood pressure inadequately controlled | FAERS: 4 | US FAERS | |
| 948 | Bone scan abnormal | FAERS: 4 | US FAERS | |
| 949 | Breathing-related sleep disorder | FAERS: 4 | US FAERS | |
| 950 | Candida test positive | FAERS: 4 | US FAERS | |
| 951 | Chronic papillomatous dermatitis | FAERS: 4 | US FAERS | |
| 952 | Complication associated with device | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 953 | Coronary angioplasty | FAERS: 4 | US FAERS | |
| 954 | Craniotabes | FAERS: 4 | US FAERS | |
| 955 | Cyanosis | FAERS: 4 | US FAERS | |
| 956 | Cystopexy | FAERS: 4 | US FAERS | |
| 957 | Device defective | FAERS: 4 | US FAERS | |
| 958 | Device malfunction | FAERS: 4 | US FAERS | |
| 959 | Device material issue | FAERS: 4 | US FAERS | |
| 960 | Diaphragmatic Hernia | FAERS: 4 | US FAERS | |
| 961 | Diffuse Large B-Cell Lymphoma | FAERS: 4 | US FAERS | |
| 962 | Dilatation intrahepatic duct acquired | FAERS: 4 | US FAERS | |
| 963 | Disease complication | FAERS: 4 | US FAERS | |
| 964 | Disease recurrence | FAERS: 4 | US FAERS | |
| 965 | Disuse syndrome | FAERS: 4 | US FAERS | |
| 966 | Drug prescribing error | FAERS: 4 | US FAERS | |
| 967 | Duodenal ulcer perforation | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 968 | Dysphasia | FAERS: 4 | US FAERS | |
| 969 | Enterocutaneous Fistula | FAERS: 4 | US FAERS | |
| 970 | Erythema Multiforme | FAERS: 4 | 12730757 | CTD SIDER US FAERS |
| 971 | Expired product administered | FAERS: 4 | US FAERS | |
| 972 | Folliculitis | FAERS: 4 | US FAERS | |
| 973 | Gait Apraxia | FAERS: 4 | US FAERS | |
| 974 | Gastrointestinal carcinoma | FAERS: 4 | US FAERS | |
| 975 | Gastrointestinal sounds abnormal | FAERS: 4 | US FAERS | |
| 976 | Gingivectomy | FAERS: 4 | US FAERS | |
| 977 | Heat Stroke | FAERS: 4 | US FAERS | |
| 978 | Histrionic Personality Disorder | FAERS: 4 | US FAERS | |
| 979 | Hypercementosis | FAERS: 4 | US FAERS | |
| 980 | Hyperosmolar state | FAERS: 4 | US FAERS | |
| 981 | Hypochondriasis | FAERS: 4 | US FAERS | |
| 982 | Immobile | FAERS: 4 | US FAERS | |
| 983 | Implant site pain | FAERS: 4 | OFFSIDES US FAERS | |
| 984 | Incorrect route of drug administration | FAERS: 4 | US FAERS | |
| 985 | Intestinal adenocarcinoma | FAERS: 4 | US FAERS | |
| 986 | Intestinal infarction | FAERS: 4 | US FAERS | |
| 987 | Intraocular pressure test abnormal | FAERS: 4 | US FAERS | |
| 988 | Joint Instability | FAERS: 4 | US FAERS | |
| 989 | Large intestine perforation | FAERS: 4 | US FAERS | |
| 990 | Lower respiratory tract infection fungal | FAERS: 4 | US FAERS | |
| 991 | Lower respiratory tract infection | FAERS: 4 | US FAERS | |
| 992 | Mastoiditis | FAERS: 4 | US FAERS | |
| 993 | Microalbuminuria | FAERS: 4 | US FAERS | |
| 994 | Mood disorder due to a general medical condition | FAERS: 4 | US FAERS | |
| 995 | Mucosal erosion | FAERS: 4 | OFFSIDES US FAERS | |
| 996 | Myopathy | FAERS: 4 | US FAERS | |
| 997 | Nephrosclerosis | FAERS: 4 | US FAERS | |
| 998 | Neurogenic Bowel | FAERS: 4 | US FAERS | |
| 999 | Nutritional Support | FAERS: 4 | US FAERS | |
| 1000 | Oropharyngeal discomfort | FAERS: 4 | US FAERS | |
| 1001 | Orthodontic appliance complication | FAERS: 4 | US FAERS | |
| 1002 | Osteorrhagia | FAERS: 4 | US FAERS | |
| 1003 | Pain management | FAERS: 4 | US FAERS | |
| 1004 | Pain of skin | FAERS: 4 | US FAERS | |
| 1005 | Pallor | FAERS: 4 | US FAERS | |
| 1006 | Pancreatic duct dilatation | FAERS: 4 | US FAERS | |
| 1007 | Panic Disorder | FAERS: 4 | OFFSIDES US FAERS | |
| 1008 | Paradoxical drug reaction | FAERS: 4 | US FAERS | |
| 1009 | Paranasal cyst | FAERS: 4 | US FAERS | |
| 1010 | Paranoia | FAERS: 4 | US FAERS | |
| 1011 | Paraplegia | FAERS: 4 | US FAERS | |
| 1012 | Pedal pulse decreased | FAERS: 4 | US FAERS | |
| 1013 | Pericarditis | FAERS: 4 | US FAERS | |
| 1014 | Peripheral embolism | FAERS: 4 | US FAERS | |
| 1015 | Peripheral paralysis | FAERS: 4 | US FAERS | |
| 1016 | Pityriasis Lichenoides et Varioliformis Acuta | FAERS: 4 | US FAERS | |
| 1017 | Pneumoconiosis | FAERS: 4 | US FAERS | |
| 1018 | Premature Menopause | FAERS: 4 | US FAERS | |
| 1019 | Prostatic cyst | FAERS: 4 | US FAERS | |
| 1020 | Psychiatric symptom | FAERS: 4 | US FAERS | |
| 1021 | Pulmonary arterial pressure increased | FAERS: 4 | US FAERS | |
| 1022 | Pulmonary congestion | FAERS: 4 | US FAERS | |
| 1023 | Pulmonary interstitial emphysema syndrome | FAERS: 4 | US FAERS | |
| 1024 | Reaction to food additive | FAERS: 4 | US FAERS | |
| 1025 | Residual urine volume increased | FAERS: 4 | US FAERS | |
| 1026 | Rheumatic Heart Disease | FAERS: 4 | US FAERS | |
| 1027 | Ruptured cerebral aneurysm | FAERS: 4 | OFFSIDES US FAERS | |
| 1028 | Schizophrenia | FAERS: 4 | US FAERS | |
| 1029 | Sickle Cell Trait | FAERS: 4 | US FAERS | |
| 1030 | Skin Induration | FAERS: 4 | OFFSIDES US FAERS | |
| 1031 | Smallpox | FAERS: 4 | US FAERS | |
| 1032 | Splenic granuloma | FAERS: 4 | US FAERS | |
| 1033 | Superficial spreading melanoma stage III | FAERS: 4 | US FAERS | |
| 1034 | Surgical failure | FAERS: 4 | US FAERS | |
| 1035 | Symblepharon | FAERS: 4 | US FAERS | |
| 1036 | Systemic Inflammatory Response Syndrome | FAERS: 4 | US FAERS | |
| 1037 | Toe operation | FAERS: 4 | US FAERS | |
| 1038 | Torticollis | FAERS: 4 | US FAERS | |
| 1039 | Tracheal pain | FAERS: 4 | US FAERS | |
| 1040 | Tracheostomy infection | FAERS: 4 | US FAERS | |
| 1041 | Tuberculosis | FAERS: 4 | US FAERS | |
| 1042 | Upper airway obstruction | FAERS: 4 | US FAERS | |
| 1043 | Varicophlebitis | FAERS: 4 | US FAERS | |
| 1044 | Wolff-Parkinson-White Syndrome | FAERS: 4 | US FAERS | |
| 1045 | Wrong drug administered | FAERS: 4 | US FAERS | |
| 1046 | cancer surgery | FAERS: 4 | US FAERS | |
| 1047 | Abdominal Compartment Syndrome | FAERS: 3 | US FAERS | |
| 1048 | Abscess of eyelid | FAERS: 3 | US FAERS | |
| 1049 | Adnexa uteri mass | FAERS: 3 | US FAERS | |
| 1050 | Amalgam tattoo | FAERS: 3 | US FAERS | |
| 1051 | Anal polyp | FAERS: 3 | US FAERS | |
| 1052 | Androgenetic Alopecia | FAERS: 3 | US FAERS | |
| 1053 | Angioedema | FAERS: 3 Canada Vigilance: 1 | 12730757 | CTD SIDER Canada Vigilance US FAERS |
| 1054 | Angiomyolipoma | FAERS: 3 | US FAERS | |
| 1055 | Angioplasty | FAERS: 3 | US FAERS | |
| 1056 | Aortic bruit | FAERS: 3 | US FAERS | |
| 1057 | Arthrotomy | FAERS: 3 | US FAERS | |
| 1058 | Autonomic neuropathy | FAERS: 3 | US FAERS | |
| 1059 | Basal ganglia stroke | FAERS: 3 | US FAERS | |
| 1060 | Benign neoplasm of adrenal gland | FAERS: 3 | US FAERS | |
| 1061 | Bladder pain | FAERS: 3 | US FAERS | |
| 1062 | Blue Toe Syndrome | FAERS: 3 | US FAERS | |
| 1063 | Breast necrosis | FAERS: 3 | OFFSIDES US FAERS | |
| 1064 | Cardiac monitoring abnormal | FAERS: 3 | US FAERS | |
| 1065 | Carotid artery aneurysm | FAERS: 3 | US FAERS | |
| 1066 | Catheter related complication | FAERS: 3 | US FAERS | |
| 1067 | Cerebrovascular Insufficiency | FAERS: 3 | US FAERS | |
| 1068 | Chemotherapy | FAERS: 3 | US FAERS | |
| 1069 | Choking sensation | FAERS: 3 | US FAERS | |
| 1070 | Chondrosarcoma | FAERS: 3 | US FAERS | |
| 1071 | Device occlusion | FAERS: 3 | US FAERS | |
| 1072 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 1073 | Early satiety | FAERS: 3 | US FAERS | |
| 1074 | Electrolyte substitution therapy | FAERS: 3 | US FAERS | |
| 1075 | Escherichia infection | FAERS: 3 | US FAERS | |
| 1076 | Fat necrosis | FAERS: 3 | US FAERS | |
| 1077 | Full blood count abnormal | FAERS: 3 | US FAERS | |
| 1078 | Granulomatous liver disease | FAERS: 3 | US FAERS | |
| 1079 | Grief reaction | FAERS: 3 | US FAERS | |
| 1080 | Guillain-Barre Syndrome | FAERS: 3 | US FAERS | |
| 1081 | High turnover osteopathy | FAERS: 3 | US FAERS | |
| 1082 | Hyperplasia | FAERS: 3 | US FAERS | |
| 1083 | Hypertrophy of tongue papillae | FAERS: 3 | US FAERS | |
| 1084 | Hyperventilation | FAERS: 3 | US FAERS | |
| 1085 | Idiopathic urticaria | FAERS: 3 | US FAERS | |
| 1086 | Ileitis | FAERS: 3 | US FAERS | |
| 1087 | Implant site infection | FAERS: 3 | US FAERS | |
| 1088 | Inappropriate schedule of product administration | FAERS: 3 | US FAERS | |
| 1089 | Intentional self-injury | FAERS: 3 | US FAERS | |
| 1090 | Intervertebral disc compression | FAERS: 3 | US FAERS | |
| 1091 | Iritis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1092 | Juvenile arthritis | FAERS: 3 | US FAERS | |
| 1093 | Labile hypertension | FAERS: 3 | US FAERS | |
| 1094 | Lacrimal duct procedure | FAERS: 3 | US FAERS | |
| 1095 | Limb crushing injury | FAERS: 3 | US FAERS | |
| 1096 | Lung Abscess | FAERS: 3 | OFFSIDES US FAERS | |
| 1097 | Lung hyperinflation | FAERS: 3 | US FAERS | |
| 1098 | Mechanical complication of implant | FAERS: 3 | US FAERS | |
| 1099 | Mediastinal shift | FAERS: 3 | US FAERS | |
| 1100 | Mental impairment | FAERS: 3 | US FAERS | |
| 1101 | Metastatic Neoplasm | FAERS: 3 | US FAERS | |
| 1102 | Metrorrhagia | FAERS: 3 | US FAERS | |
| 1103 | Middle insomnia | FAERS: 3 | US FAERS | |
| 1104 | No adverse effect | FAERS: 3 | US FAERS | |
| 1105 | Ophthalmoplegia | FAERS: 3 | US FAERS | |
| 1106 | Osteochondritis | FAERS: 3 | US FAERS | |
| 1107 | Pancreatic Cyst | FAERS: 3 | OFFSIDES US FAERS | |
| 1108 | Papilloma | FAERS: 3 | US FAERS | |
| 1109 | Parakeratosis | FAERS: 3 | US FAERS | |
| 1110 | Pelvic Inflammatory Disease | FAERS: 3 | US FAERS | |
| 1111 | Peripheral venous disease | FAERS: 3 | US FAERS | |
| 1112 | Physical disability | FAERS: 3 | US FAERS | |
| 1113 | Poliomyelitis | FAERS: 3 | US FAERS | |
| 1114 | Postoperative wound complication | FAERS: 3 | US FAERS | |
| 1115 | Procedural headache | FAERS: 3 | US FAERS | |
| 1116 | Procedural vomiting | FAERS: 3 | US FAERS | |
| 1117 | Proctitis | FAERS: 3 | US FAERS | |
| 1118 | Product availability issue | FAERS: 3 | US FAERS | |
| 1119 | Product size issue | FAERS: 3 | US FAERS | |
| 1120 | Pseudodementia | FAERS: 3 | US FAERS | |
| 1121 | Reflux laryngitis | FAERS: 3 | US FAERS | |
| 1122 | Retinal Degeneration | FAERS: 3 | US FAERS | |
| 1123 | Rhonchi | FAERS: 3 | US FAERS | |
| 1124 | Seronegative arthritis | FAERS: 3 | US FAERS | |
| 1125 | Sinus operation | FAERS: 3 | US FAERS | |
| 1126 | Skeletal traction | FAERS: 3 | US FAERS | |
| 1127 | Skin reaction | FAERS: 3 | US FAERS | |
| 1128 | Small Intestinal Stenosis | FAERS: 3 | US FAERS | |
| 1129 | Sneezing | FAERS: 3 | US FAERS | |
| 1130 | Soft tissue mass | FAERS: 3 | US FAERS | |
| 1131 | Spigelian hernia | FAERS: 3 | US FAERS | |
| 1132 | Splenomegaly | FAERS: 3 | US FAERS | |
| 1133 | Syphilis | FAERS: 3 | US FAERS | |
| 1134 | Teeth brittle | FAERS: 3 | US FAERS | |
| 1135 | Therapy non-responder | FAERS: 3 | US FAERS | |
| 1136 | Throat cancer | FAERS: 3 | US FAERS | |
| 1137 | Tobacco user | FAERS: 3 | US FAERS | |
| 1138 | Tooth Ankylosis | FAERS: 3 | US FAERS | |
| 1139 | Traumatic occlusion | FAERS: 3 | US FAERS | |
| 1140 | Urethral intrinsic sphincter deficiency | FAERS: 3 | US FAERS | |
| 1141 | Urinary tract obstruction | FAERS: 3 | US FAERS | |
| 1142 | Uterine Polyp | FAERS: 3 | OFFSIDES US FAERS | |
| 1143 | Uterovaginal prolapse | FAERS: 3 | OFFSIDES US FAERS | |
| 1144 | Venous stasis | FAERS: 3 | US FAERS | |
| 1145 | Xerosis | FAERS: 3 | US FAERS | |
| 1146 | heart rate | FAERS: 3 | US FAERS | |
| 1147 | Accessory navicular syndrome | FAERS: 2 | US FAERS | |
| 1148 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 1149 | Acrodermatitis | FAERS: 2 | US FAERS | |
| 1150 | Agranulocytosis | FAERS: 2 | US FAERS | |
| 1151 | Allergy to chemicals | FAERS: 2 | US FAERS | |
| 1152 | Alopecia totalis | FAERS: 2 | US FAERS | |
| 1153 | Amblyopia | FAERS: 2 | US FAERS | |
| 1154 | Anal Fissure | FAERS: 2 | US FAERS | |
| 1155 | Antimicrobial susceptibility test resistant | FAERS: 2 | US FAERS | |
| 1156 | Arteriosclerotic retinopathy | FAERS: 2 | US FAERS | |
| 1157 | Ascites | FAERS: 2 | US FAERS | |
| 1158 | Aspergillosis | FAERS: 2 | US FAERS | |
| 1159 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 1160 | Autoimmune hepatitis | FAERS: 2 | OFFSIDES US FAERS | |
| 1161 | Bacterial test positive | FAERS: 2 | US FAERS | |
| 1162 | Benign breast lump removal | FAERS: 2 | US FAERS | |
| 1163 | Biopsy | FAERS: 2 | US FAERS | |
| 1164 | Birth mark | FAERS: 2 | US FAERS | |
| 1165 | Blood 25-hydroxycholecalciferol decreased | FAERS: 2 | US FAERS | |
| 1166 | Blood calcitonin increased | FAERS: 2 | US FAERS | |
| 1167 | Blood electrolytes abnormal | FAERS: 2 | US FAERS | |
| 1168 | Blood parathyroid hormone abnormal | FAERS: 2 | US FAERS | |
| 1169 | Blood urea abnormal | FAERS: 2 | US FAERS | |
| 1170 | Bone Sarcoma | FAERS: 2 | US FAERS | |
| 1171 | Bone resorption test abnormal | FAERS: 2 | US FAERS | |
| 1172 | Bowen's Disease | FAERS: 2 | US FAERS | |
| 1173 | Bunion operation | FAERS: 2 | US FAERS | |
| 1174 | Callus formation delayed | FAERS: 2 | US FAERS | |
| 1175 | Carcinoembryonic antigen increased | FAERS: 2 | US FAERS | |
| 1176 | Cardiac enzymes increased | FAERS: 2 | US FAERS | |
| 1177 | Cerebral artery stenosis | FAERS: 2 | US FAERS | |
| 1178 | Chemical injury | FAERS: 2 | US FAERS | |
| 1179 | Cholangitis | FAERS: 2 | US FAERS | |
| 1180 | Cholesteatoma | FAERS: 2 | US FAERS | |
| 1181 | Chromaturia | FAERS: 2 | OFFSIDES US FAERS | |
| 1182 | Chronic Fatigue Syndrome | FAERS: 2 | US FAERS | |
| 1183 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 1184 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 1185 | Constipation prophylaxis | FAERS: 2 | US FAERS | |
| 1186 | Culture urine positive | FAERS: 2 | US FAERS | |
| 1187 | Cutis Laxa | FAERS: 2 | OFFSIDES US FAERS | |
| 1188 | Cytolytic hepatitis | FAERS: 2 | US FAERS | |
| 1189 | Dermal Sinus | FAERS: 2 | US FAERS | |
| 1190 | Device connection issue | FAERS: 2 | US FAERS | |
| 1191 | Disease Progression | FAERS: 2 | US FAERS | |
| 1192 | Dissociation | FAERS: 2 | US FAERS | |
| 1193 | Dwarfism | FAERS: 2 | US FAERS | |
| 1194 | Dyspareunia | FAERS: 2 | OFFSIDES US FAERS | |
| 1195 | Ear congestion | FAERS: 2 | US FAERS | |
| 1196 | Elbow operation | FAERS: 2 | US FAERS | |
| 1197 | Electrocardiogram QT interval abnormal | FAERS: 2 | US FAERS | |
| 1198 | Electrocardiogram ST-T segment abnormal | FAERS: 2 | US FAERS | |
| 1199 | Electrocardiogram change | FAERS: 2 | US FAERS | |
| 1200 | Enteritis | FAERS: 2 | US FAERS | |
| 1201 | Enterococcus test positive | FAERS: 2 | US FAERS | |
| 1202 | Eustachian tube disorder | FAERS: 2 | US FAERS | |
| 1203 | Extra dose administered | FAERS: 2 | US FAERS | |
| 1204 | Eye allergy | FAERS: 2 | US FAERS | |
| 1205 | False positive investigation result | FAERS: 2 | US FAERS | |
| 1206 | Fascial hernia | FAERS: 2 | US FAERS | |
| 1207 | Fear of falling | FAERS: 2 | US FAERS | |
| 1208 | Feeding tube complication | FAERS: 2 | US FAERS | |
| 1209 | Foreign body in respiratory tract | FAERS: 2 | US FAERS | |
| 1210 | Full blood count decreased | FAERS: 2 | US FAERS | |
| 1211 | Gastrectomy | FAERS: 2 | US FAERS | |
| 1212 | Gastric Bypass | FAERS: 2 | US FAERS | |
| 1213 | Gastric mucosal lesion | FAERS: 2 | US FAERS | |
| 1214 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 1215 | Gastrointestinal tract adenoma | FAERS: 2 | US FAERS | |
| 1216 | Glomerulonephritis | FAERS: 2 | US FAERS | |
| 1217 | Graft dysfunction | FAERS: 2 | US FAERS | |
| 1218 | Grip strength decreased | FAERS: 2 | US FAERS | |
| 1219 | Hernia obstructive | FAERS: 2 | US FAERS | |
| 1220 | Hip Dysplasia | FAERS: 2 | US FAERS | |
| 1221 | Hypercapnia | FAERS: 2 | US FAERS | |
| 1222 | Hypersplenism | FAERS: 2 | US FAERS | |
| 1223 | Hypogeusia | FAERS: 2 | US FAERS | |
| 1224 | Hypogonadism | FAERS: 2 | US FAERS | |
| 1225 | Hysterosalpingo-oophorectomy | FAERS: 2 | US FAERS | |
| 1226 | Iliac artery occlusion | FAERS: 2 | US FAERS | |
| 1227 | Iliac bruit | FAERS: 2 | US FAERS | |
| 1228 | Impaired driving ability | FAERS: 2 | OFFSIDES US FAERS | |
| 1229 | Implant site discharge | FAERS: 2 | US FAERS | |
| 1230 | Incision site abscess | FAERS: 2 | US FAERS | |
| 1231 | Incision site cellulitis | FAERS: 2 | US FAERS | |
| 1232 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 1233 | Infected dermal cyst | FAERS: 2 | US FAERS | |
| 1234 | Initial insomnia | FAERS: 2 | US FAERS | |
| 1235 | Intentional drug misuse | FAERS: 2 | OFFSIDES US FAERS | |
| 1236 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 1237 | Intercostal neuralgia | FAERS: 2 | US FAERS | |
| 1238 | Intestinal polypectomy | FAERS: 2 | US FAERS | |
| 1239 | Intestinal villi atrophy | FAERS: 2 | US FAERS | |
| 1240 | Iridectomy | FAERS: 2 | US FAERS | |
| 1241 | Klebsiella test positive | FAERS: 2 | US FAERS | |
| 1242 | Macrocytosis | FAERS: 2 | US FAERS | |
| 1243 | Macrognathia | FAERS: 2 | US FAERS | |
| 1244 | Macular pigmentation | FAERS: 2 | US FAERS | |
| 1245 | Malignant breast lump removal | FAERS: 2 | US FAERS | |
| 1246 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 1247 | Mass excision | FAERS: 2 | US FAERS | |
| 1248 | Medical device discomfort | FAERS: 2 | US FAERS | |
| 1249 | Mitral valve sclerosis | FAERS: 2 | US FAERS | |
| 1250 | Mixed salivary tumour | FAERS: 2 | US FAERS | |
| 1251 | Mouth swelling | FAERS: 2 | US FAERS | |
| 1252 | Muscle Cramp | FAERS: 2 | US FAERS | |
| 1253 | Nephritis | FAERS: 2 | US FAERS | |
| 1254 | Nephrotic Syndrome | FAERS: 2 | OFFSIDES US FAERS | |
| 1255 | Neurectomy | FAERS: 2 | US FAERS | |
| 1256 | Nystagmus | FAERS: 2 | US FAERS | |
| 1257 | Ocular discomfort | FAERS: 2 | US FAERS | |
| 1258 | Onycholysis | FAERS: 2 | US FAERS | |
| 1259 | Oral discharge | FAERS: 2 | US FAERS | |
| 1260 | Oral mucosal erythema | FAERS: 2 | US FAERS | |
| 1261 | Osteoma cutis | FAERS: 2 | US FAERS | |
| 1262 | Osteonecrosis of external auditory canal | FAERS: 2 | US FAERS | |
| 1263 | Otosclerosis | FAERS: 2 | US FAERS | |
| 1264 | Ovarian germ cell teratoma benign | FAERS: 2 | US FAERS | |
| 1265 | Pelvic adhesions | FAERS: 2 | US FAERS | |
| 1266 | Pelvic fluid collection | FAERS: 2 | US FAERS | |
| 1267 | Perforated ulcer | FAERS: 2 | US FAERS | |
| 1268 | Perineal pain | FAERS: 2 | US FAERS | |
| 1269 | Peripheral nerve paresis | FAERS: 2 | US FAERS | |
| 1270 | Peroneal nerve injury | FAERS: 2 | US FAERS | |
| 1271 | Pharyngeal pouch | FAERS: 2 | US FAERS | |
| 1272 | Photophobia | FAERS: 2 | US FAERS | |
| 1273 | Plastic surgery to the face | FAERS: 2 | US FAERS | |
| 1274 | Poisoning | FAERS: 2 | US FAERS | |
| 1275 | Porokeratosis | FAERS: 2 | US FAERS | |
| 1276 | Portal Hypertension | FAERS: 2 | US FAERS | |
| 1277 | Post procedural stroke | FAERS: 2 | US FAERS | |
| 1278 | Posterior capsule opacification | FAERS: 2 | US FAERS | |
| 1279 | Postoperative infection | FAERS: 2 | US FAERS | |
| 1280 | Procedural hypertension | FAERS: 2 | US FAERS | |
| 1281 | Procedural site reaction | FAERS: 2 | US FAERS | |
| 1282 | Product administration error | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1283 | Product difficult to swallow | FAERS: 2 | US FAERS | |
| 1284 | Product label issue | FAERS: 2 | US FAERS | |
| 1285 | Product packaging issue | FAERS: 2 | US FAERS | |
| 1286 | Product physical issue | FAERS: 2 | US FAERS | |
| 1287 | Product use complaint | FAERS: 2 | US FAERS | |
| 1288 | Pseudomonas test positive | FAERS: 2 | US FAERS | |
| 1289 | Radiation injury | FAERS: 2 | US FAERS | |
| 1290 | Regurgitation | FAERS: 2 | SIDER US FAERS | |
| 1291 | Renal Colic | FAERS: 2 | US FAERS | |
| 1292 | Resorption bone decreased | FAERS: 2 | US FAERS | |
| 1293 | Respiratory tract congestion | FAERS: 2 | US FAERS | |
| 1294 | Rhinalgia | FAERS: 2 | US FAERS | |
| 1295 | Rhinitis perennial | FAERS: 2 | US FAERS | |
| 1296 | Right ventricular systolic pressure increased | FAERS: 2 | US FAERS | |
| 1297 | Salivary gland operation | FAERS: 2 | US FAERS | |
| 1298 | Scleritis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 1299 | Secondary hypertension | FAERS: 2 | US FAERS | |
| 1300 | Septic embolus | FAERS: 2 | US FAERS | |
| 1301 | Shoulder Pain | FAERS: 2 | US FAERS | |
| 1302 | Sinus perforation | FAERS: 2 | US FAERS | |
| 1303 | Skin Erosion | FAERS: 2 | US FAERS | |
| 1304 | Sleep disorder due to general medical condition, insomnia type | FAERS: 2 | US FAERS | |
| 1305 | Spinal claudication | FAERS: 2 | US FAERS | |
| 1306 | Streptococcus test positive | FAERS: 2 | US FAERS | |
| 1307 | Therapeutic response unexpected with drug substitution | FAERS: 2 | US FAERS | |
| 1308 | Thyroidectomy | FAERS: 2 | US FAERS | |
| 1309 | Thyroiditis | FAERS: 2 | US FAERS | |
| 1310 | Tongue blistering | FAERS: 2 | US FAERS | |
| 1311 | Tonsillitis | FAERS: 2 | US FAERS | |
| 1312 | Trichorrhexis | FAERS: 2 | US FAERS | |
| 1313 | Urinary anastomotic leak | FAERS: 2 | US FAERS | |
| 1314 | Urinary tract infection pseudomonal | FAERS: 2 | US FAERS | |
| 1315 | Varicose vein operation | FAERS: 2 | US FAERS | |
| 1316 | Vena cava filter insertion | FAERS: 2 | US FAERS | |
| 1317 | Vertebral wedging | FAERS: 2 | US FAERS | |
| 1318 | Viral labyrinthitis | FAERS: 2 | US FAERS | |
| 1319 | Vitreous opacities | FAERS: 2 | US FAERS | |
| 1320 | Vocal Cord Paralysis | FAERS: 2 | US FAERS | |
| 1321 | Vulvovaginal mycotic infection | FAERS: 2 | OFFSIDES US FAERS | |
| 1322 | Wound Complication | FAERS: 2 | US FAERS | |
| 1323 | ovarian neoplasm | FAERS: 2 | US FAERS | |
| 1324 | pseudomembranous colitis | FAERS: 2 | US FAERS | |
| 1325 | rhinoplasty | FAERS: 2 | US FAERS | |
| 1326 | Abdominal hernia obstructive | FAERS: 1 | US FAERS | |
| 1327 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 1328 | Acidosis | FAERS: 1 | US FAERS | |
| 1329 | Acrochordon excision | FAERS: 1 | US FAERS | |
| 1330 | Adjustment disorder with mixed anxiety and depressed mood | FAERS: 1 | US FAERS | |
| 1331 | Adnexa uteri cyst | FAERS: 1 | US FAERS | |
| 1332 | Allergic respiratory symptom | FAERS: 1 | US FAERS | |
| 1333 | Allergy to arthropod bite | FAERS: 1 | US FAERS | |
| 1334 | Amaurosis | FAERS: 1 | US FAERS | |
| 1335 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 1336 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 1337 | Anastomotic Leak | FAERS: 1 | US FAERS | |
| 1338 | Angiodysplasia | FAERS: 1 | US FAERS | |
| 1339 | Anisocytosis | FAERS: 1 | US FAERS | |
| 1340 | Anorexia Nervosa | FAERS: 1 | US FAERS | |
| 1341 | Anticoagulation drug level below therapeutic | FAERS: 1 | US FAERS | |
| 1342 | Antiphospholipid Syndrome | FAERS: 1 | US FAERS | |
| 1343 | Apparent death | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1344 | Application site erythema | FAERS: 1 | US FAERS | |
| 1345 | Arteriovenous fistula | FAERS: 1 | US FAERS | |
| 1346 | Atrial thrombosis | FAERS: 1 | US FAERS | |
| 1347 | Auricular swelling | FAERS: 1 | US FAERS | |
| 1348 | Autoimmune thyroiditis | FAERS: 1 | OFFSIDES US FAERS | |
| 1349 | Aversion | FAERS: 1 | US FAERS | |
| 1350 | Axonal neuropathy | FAERS: 1 | US FAERS | |
| 1351 | Bacterial Vaginosis | FAERS: 1 | US FAERS | |
| 1352 | Bacteriuria | FAERS: 1 | US FAERS | |
| 1353 | Barium swallow abnormal | FAERS: 1 | US FAERS | |
| 1354 | Benign bone neoplasm | FAERS: 1 | US FAERS | |
| 1355 | Bicuspid aortic valve | FAERS: 1 | US FAERS | |
| 1356 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 1357 | Blighted ovum | FAERS: 1 | US FAERS | |
| 1358 | Blood albumin abnormal | FAERS: 1 | US FAERS | |
| 1359 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 1360 | Blood cholesterol | FAERS: 1 | US FAERS | |
| 1361 | Blood cholinesterase decreased | FAERS: 1 | US FAERS | |
| 1362 | Blood creatine phosphokinase abnormal | FAERS: 1 | US FAERS | |
| 1363 | Blood immunoglobulin A decreased | FAERS: 1 | US FAERS | |
| 1364 | Blood immunoglobulin G decreased | FAERS: 1 | US FAERS | |
| 1365 | Blood osmolarity decreased | FAERS: 1 | US FAERS | |
| 1366 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 1367 | Blood pressure orthostatic decreased | FAERS: 1 | US FAERS | |
| 1368 | Blood sodium increased | FAERS: 1 | OFFSIDES US FAERS | |
| 1369 | Blood sodium | FAERS: 1 | OFFSIDES US FAERS | |
| 1370 | Blood triglycerides | FAERS: 1 | US FAERS | |
| 1371 | Blood uric acid decreased | FAERS: 1 | US FAERS | |
| 1372 | Body height abnormal | FAERS: 1 | US FAERS | |
| 1373 | Bone contusion | FAERS: 1 | US FAERS | |
| 1374 | Bone swelling | FAERS: 1 | OFFSIDES US FAERS | |
| 1375 | Bone trimming | FAERS: 1 | US FAERS | |
| 1376 | Brain Death | FAERS: 1 | US FAERS | |
| 1377 | Breakthrough Pain | FAERS: 1 | US FAERS | |
| 1378 | Breast cancer stage III | FAERS: 1 | US FAERS | |
| 1379 | Breast tenderness | FAERS: 1 | US FAERS | |
| 1380 | Bronchomalacia | FAERS: 1 | US FAERS | |
| 1381 | Bronchoscopy abnormal | FAERS: 1 | US FAERS | |
| 1382 | Bursa calcification | FAERS: 1 | US FAERS | |
| 1383 | Capsular contracture associated with breast implant | FAERS: 1 | US FAERS | |
| 1384 | Carbohydrate antigen 19-9 increased | FAERS: 1 | US FAERS | |
| 1385 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 1386 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 1387 | Cardiac function test abnormal | FAERS: 1 | US FAERS | |
| 1388 | Cardiac monitoring | FAERS: 1 | US FAERS | |
| 1389 | Cardiac ventricular disorder | FAERS: 1 | US FAERS | |
| 1390 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 1391 | Carotid Endarterectomy | FAERS: 1 | US FAERS | |
| 1392 | Caustic injury | FAERS: 1 | US FAERS | |
| 1393 | Cementoplasty | FAERS: 1 | US FAERS | |
| 1394 | Central Nervous System Infection | FAERS: 1 | US FAERS | |
| 1395 | Central pain syndrome | FAERS: 1 | US FAERS | |
| 1396 | Cerumen removal | FAERS: 1 | US FAERS | |
| 1397 | Cervicogenic Headache | FAERS: 1 | US FAERS | |
| 1398 | Chest wall pain | FAERS: 1 | OFFSIDES US FAERS | |
| 1399 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 1400 | Chondroma | FAERS: 1 | US FAERS | |
| 1401 | Chondroplasty | FAERS: 1 | US FAERS | |
| 1402 | Choroiditis | FAERS: 1 | US FAERS | |
| 1403 | Clinodactyly | FAERS: 1 | US FAERS | |
| 1404 | Cluster Headache | FAERS: 1 | US FAERS | |
| 1405 | Coagulation test abnormal | FAERS: 1 | US FAERS | |
| 1406 | Coccidioidomycosis | FAERS: 1 | US FAERS | |
| 1407 | Cold sweat | FAERS: 1 | US FAERS | |
| 1408 | Complex partial seizures | FAERS: 1 | US FAERS | |
| 1409 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 1410 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 1411 | Conjunctival degeneration | FAERS: 1 | US FAERS | |
| 1412 | Connective tissue inflammation | FAERS: 1 | US FAERS | |
| 1413 | Continuous Positive Airway Pressure | FAERS: 1 | US FAERS | |
| 1414 | Corneal decompensation | FAERS: 1 | US FAERS | |
| 1415 | Corneal lesion | FAERS: 1 | US FAERS | |
| 1416 | Coronary artery insufficiency | FAERS: 1 | US FAERS | |
| 1417 | Craniofacial deformity | FAERS: 1 | US FAERS | |
| 1418 | Culture positive | FAERS: 1 | US FAERS | |
| 1419 | Cystic Fibrosis | FAERS: 1 | US FAERS | |
| 1420 | Death of friend | FAERS: 1 | US FAERS | |
| 1421 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 1422 | Dental examination abnormal | FAERS: 1 | US FAERS | |
| 1423 | Dental prosthesis placement | FAERS: 1 | US FAERS | |
| 1424 | Dependence | FAERS: 1 | US FAERS | |
| 1425 | Deposit eye | FAERS: 1 | US FAERS | |
| 1426 | Device fastener issue | FAERS: 1 | US FAERS | |
| 1427 | Diffuse vasculitis | FAERS: 1 | US FAERS | |
| 1428 | Dissociative disorder | FAERS: 1 | US FAERS | |
| 1429 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 1430 | Duodenal perforation | FAERS: 1 | US FAERS | |
| 1431 | Dyslexia | FAERS: 1 | US FAERS | |
| 1432 | Dysmorphism | FAERS: 1 | US FAERS | |
| 1433 | Dystonia | FAERS: 1 | US FAERS | |
| 1434 | Ear tube insertion | FAERS: 1 | US FAERS | |
| 1435 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 1436 | Electrocardiogram poor R-wave progression | FAERS: 1 | US FAERS | |
| 1437 | Embolic stroke | FAERS: 1 | US FAERS | |
| 1438 | Enchondromatosis | FAERS: 1 | US FAERS | |
| 1439 | Endoscopy gastrointestinal abnormal | FAERS: 1 | US FAERS | |
| 1440 | Endotracheal intubation complication | FAERS: 1 | OFFSIDES US FAERS | |
| 1441 | Enterocolitis | FAERS: 1 | US FAERS | |
| 1442 | Eosinophilia | FAERS: 1 | US FAERS | |
| 1443 | Epiglottis ulcer | FAERS: 1 | US FAERS | |
| 1444 | Erosive Duodenitis | FAERS: 1 | US FAERS | |
| 1445 | Escherichia test positive | FAERS: 1 | US FAERS | |
| 1446 | Expired drug administered | FAERS: 1 | US FAERS | |
| 1447 | Exploratory operation | FAERS: 1 | US FAERS | |
| 1448 | Eye laser surgery | FAERS: 1 | US FAERS | |
| 1449 | Facial Neuralgia | FAERS: 1 | OFFSIDES US FAERS | |
| 1450 | Facial Paresis | FAERS: 1 | US FAERS | |
| 1451 | Facial asymmetry | FAERS: 1 | US FAERS | |
| 1452 | Fasciotomy | FAERS: 1 | US FAERS | |
| 1453 | Feeling Cold | FAERS: 1 | OFFSIDES US FAERS | |
| 1454 | Fluid overload | FAERS: 1 | US FAERS | |
| 1455 | Fracture pain | FAERS: 1 | US FAERS | |
| 1456 | Fracture treatment | FAERS: 1 | OFFSIDES US FAERS | |
| 1457 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 1458 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 1459 | Gastric adenoma | FAERS: 1 | US FAERS | |
| 1460 | Gastric mucosa erythema | FAERS: 1 | US FAERS | |
| 1461 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 1462 | Gastrointestinal arteriovenous malformation | FAERS: 1 | US FAERS | |
| 1463 | Gastrointestinal cancer metastatic | FAERS: 1 | US FAERS | |
| 1464 | Gastrointestinal erosion | FAERS: 1 | US FAERS | |
| 1465 | Gastrointestinal hypermotility | FAERS: 1 | US FAERS | |
| 1466 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 1467 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 1468 | Gastrointestinal stenosis | FAERS: 1 | US FAERS | |
| 1469 | Gastrointestinal viral infection | FAERS: 1 | US FAERS | |
| 1470 | Gastrooesophageal sphincter insufficiency | FAERS: 1 | US FAERS | |
| 1471 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 1472 | General physical condition decreased | FAERS: 1 | US FAERS | |
| 1473 | General symptom | FAERS: 1 | US FAERS | |
| 1474 | Genital labial operation | FAERS: 1 | US FAERS | |
| 1475 | Gingival Hypertrophy | FAERS: 1 | US FAERS | |
| 1476 | Gingival blister | FAERS: 1 | US FAERS | |
| 1477 | Gingival graft | FAERS: 1 | US FAERS | |
| 1478 | Globulin abnormal | FAERS: 1 | US FAERS | |
| 1479 | Gram stain positive | FAERS: 1 | US FAERS | |
| 1480 | Granuloma Annulare | FAERS: 1 | US FAERS | |
| 1481 | Head circumference abnormal | FAERS: 1 | US FAERS | |
| 1482 | Hearing aid user | FAERS: 1 | US FAERS | |
| 1483 | Hemicephalalgia | FAERS: 1 | US FAERS | |
| 1484 | Heparin-induced thrombocytopenia | FAERS: 1 | US FAERS | |
| 1485 | Hepatic calcification | FAERS: 1 | US FAERS | |
| 1486 | Hepatitis A antibody positive | FAERS: 1 | US FAERS | |
| 1487 | Hernia pain | FAERS: 1 | US FAERS | |
| 1488 | Herpes zoster infection neurological | FAERS: 1 | US FAERS | |
| 1489 | Hyperacusis | FAERS: 1 | US FAERS | |
| 1490 | Hypervitaminosis | FAERS: 1 | OFFSIDES US FAERS | |
| 1491 | Hypoglossal Nerve Disorder | FAERS: 1 | US FAERS | |
| 1492 | Hypopyon | FAERS: 1 | US FAERS | |
| 1493 | Hypospadias | FAERS: 1 | US FAERS | |
| 1494 | Hysteroscopy | FAERS: 1 | US FAERS | |
| 1495 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 1496 | Immune complex level increased | FAERS: 1 | US FAERS | |
| 1497 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 1498 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 1499 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 1500 | Infectious peritonitis | FAERS: 1 | US FAERS | |
| 1501 | Infusion site bruising | FAERS: 1 | US FAERS | |
| 1502 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 1503 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 1504 | Intestinal resection | FAERS: 1 | US FAERS | |
| 1505 | Intraneural cyst | FAERS: 1 | US FAERS | |
| 1506 | Invasive Ductal Breast Carcinoma | FAERS: 1 | US FAERS | |
| 1507 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 1508 | Jejunal ulcer | FAERS: 1 | US FAERS | |
| 1509 | Joint laxity | FAERS: 1 | US FAERS | |
| 1510 | Joint warmth | FAERS: 1 | US FAERS | |
| 1511 | Jugular vein distension | FAERS: 1 | US FAERS | |
| 1512 | Lactobacillus infection | FAERS: 1 | US FAERS | |
| 1513 | Laparoscopy | FAERS: 1 | US FAERS | |
| 1514 | Laziness | FAERS: 1 | US FAERS | |
| 1515 | Leprosy | FAERS: 1 | US FAERS | |
| 1516 | Levator syndrome | FAERS: 1 | US FAERS | |
| 1517 | Ligament pain | FAERS: 1 | US FAERS | |
| 1518 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 1519 | Lipohypertrophy | FAERS: 1 | US FAERS | |
| 1520 | Lipomatosis | FAERS: 1 | US FAERS | |
| 1521 | Listeriosis | FAERS: 1 | US FAERS | |
| 1522 | Lithotripsy | FAERS: 1 | US FAERS | |
| 1523 | Loss of anatomical alignment after fracture reduction | FAERS: 1 | US FAERS | |
| 1524 | Lower Urinary Tract Symptoms | FAERS: 1 | US FAERS | |
| 1525 | Lown-Ganong-Levine Syndrome | FAERS: 1 | US FAERS | |
| 1526 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 1527 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 1528 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 1529 | Malignant neoplasm of spinal cord | FAERS: 1 | US FAERS | |
| 1530 | Mandibular mass | FAERS: 1 | US FAERS | |
| 1531 | Mantle cell lymphoma | FAERS: 1 | US FAERS | |
| 1532 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 1533 | Mediastinitis | FAERS: 1 | US FAERS | |
| 1534 | Medical device site infection | FAERS: 1 | US FAERS | |
| 1535 | Medical device site inflammation | FAERS: 1 | US FAERS | |
| 1536 | Medication residue present | FAERS: 1 | US FAERS | |
| 1537 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 1538 | Metastases to pelvis | FAERS: 1 | US FAERS | |
| 1539 | Metastases to stomach | FAERS: 1 | US FAERS | |
| 1540 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 1541 | Modified radical mastectomy | FAERS: 1 | US FAERS | |
| 1542 | Monoplegia | FAERS: 1 | US FAERS | |
| 1543 | Mucosal atrophy | FAERS: 1 | US FAERS | |
| 1544 | Mucosal exfoliation | FAERS: 1 | US FAERS | |
| 1545 | Mucosal necrosis | FAERS: 1 | US FAERS | |
| 1546 | Muscle Rigidity | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1547 | Muscle flap operation | FAERS: 1 | US FAERS | |
| 1548 | Muscle tone disorder | FAERS: 1 | US FAERS | |
| 1549 | Myocardial necrosis marker | FAERS: 1 | US FAERS | |
| 1550 | Myoclonus | FAERS: 1 | US FAERS | |
| 1551 | Nephrectomy | FAERS: 1 | US FAERS | |
| 1552 | Nephrocalcinosis | FAERS: 1 | US FAERS | |
| 1553 | Nephroureterectomy | FAERS: 1 | US FAERS | |
| 1554 | Nerve Block | FAERS: 1 | US FAERS | |
| 1555 | Neurological examination abnormal | FAERS: 1 | US FAERS | |
| 1556 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 1557 | Nodule on extremity | FAERS: 1 | US FAERS | |
| 1558 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 1559 | Obesity surgery | FAERS: 1 | US FAERS | |
| 1560 | Occult blood negative | FAERS: 1 | US FAERS | |
| 1561 | Ocular icterus | FAERS: 1 | US FAERS | |
| 1562 | Oral pruritus | FAERS: 1 | US FAERS | |
| 1563 | Osteitis condensans | FAERS: 1 | US FAERS | |
| 1564 | Osteotomy | FAERS: 1 | US FAERS | |
| 1565 | Palatal dysplasia | FAERS: 1 | US FAERS | |
| 1566 | Palmar erythema | FAERS: 1 | US FAERS | |
| 1567 | Pancreatic Pseudocyst | FAERS: 1 | US FAERS | |
| 1568 | Papule | FAERS: 1 | US FAERS | |
| 1569 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 1570 | Parapharyngeal abscess | FAERS: 1 | US FAERS | |
| 1571 | Parathyroidectomy | FAERS: 1 | US FAERS | |
| 1572 | Paresis | FAERS: 1 | US FAERS | |
| 1573 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 1574 | Patient-device incompatibility | FAERS: 1 | US FAERS | |
| 1575 | Pelvic mass | FAERS: 1 | US FAERS | |
| 1576 | Peptostreptococcus infection | FAERS: 1 | US FAERS | |
| 1577 | Peripheral nerve palsy | FAERS: 1 | US FAERS | |
| 1578 | Peritonitis | FAERS: 1 | OFFSIDES US FAERS | |
| 1579 | Persistent corneal epithelial defect | FAERS: 1 | US FAERS | |
| 1580 | Petechiae | FAERS: 1 | US FAERS | |
| 1581 | Peutz-Jeghers Syndrome | FAERS: 1 | US FAERS | |
| 1582 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 1583 | Physical deconditioning | FAERS: 1 | US FAERS | |
| 1584 | Plantar erythema | FAERS: 1 | US FAERS | |
| 1585 | Plasmacytoma | FAERS: 1 | US FAERS | |
| 1586 | Platybasia | FAERS: 1 | US FAERS | |
| 1587 | Pleural Infection | FAERS: 1 | US FAERS | |
| 1588 | Pleurodesis | FAERS: 1 | US FAERS | |
| 1589 | Poikilocytosis | FAERS: 1 | OFFSIDES US FAERS | |
| 1590 | Polymyositis | FAERS: 1 | OFFSIDES US FAERS | |
| 1591 | Poor quality drug administered | FAERS: 1 | OFFSIDES US FAERS | |
| 1592 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 1593 | Post procedural bile leak | FAERS: 1 | US FAERS | |
| 1594 | Post-Traumatic Headache | FAERS: 1 | US FAERS | |
| 1595 | Postcricoid cancer | FAERS: 1 | US FAERS | |
| 1596 | Postoperative adhesion | FAERS: 1 | US FAERS | |
| 1597 | Precancerous cells present | FAERS: 1 | US FAERS | |
| 1598 | Precancerous skin lesion | FAERS: 1 | US FAERS | |
| 1599 | Prerenal failure | FAERS: 1 | US FAERS | |
| 1600 | Primary Hypothyroidism | FAERS: 1 | US FAERS | |
| 1601 | Product blister packaging issue | FAERS: 1 | US FAERS | |
| 1602 | Product container issue | FAERS: 1 | US FAERS | |
| 1603 | Product label confusion | FAERS: 1 | US FAERS | |
| 1604 | Product supply issue | FAERS: 1 | US FAERS | |
| 1605 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 1606 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 1607 | Protein C Deficiency | FAERS: 1 | US FAERS | |
| 1608 | Pruritus allergic | FAERS: 1 | OFFSIDES US FAERS | |
| 1609 | Pseudomyxoma Peritonei | FAERS: 1 | US FAERS | |
| 1610 | Psychological Trauma | FAERS: 1 | US FAERS | |
| 1611 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 1612 | Pulmonary pneumatocele | FAERS: 1 | US FAERS | |
| 1613 | QRS axis abnormal | FAERS: 1 | US FAERS | |
| 1614 | Radial nerve palsy | FAERS: 1 | US FAERS | |
| 1615 | Radiotherapy to breast | FAERS: 1 | US FAERS | |
| 1616 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 1617 | Rectal polypectomy | FAERS: 1 | US FAERS | |
| 1618 | Removal of transplanted organ | FAERS: 1 | US FAERS | |
| 1619 | Renal artery occlusion | FAERS: 1 | US FAERS | |
| 1620 | Renal pain | FAERS: 1 | US FAERS | |
| 1621 | Renal tubular acidosis | FAERS: 1 | US FAERS | |
| 1622 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 1623 | Retinal artery embolism | FAERS: 1 | US FAERS | |
| 1624 | Retinal pallor | FAERS: 1 | US FAERS | |
| 1625 | Retinitis | FAERS: 1 | US FAERS | |
| 1626 | Retroperitoneal mass | FAERS: 1 | US FAERS | |
| 1627 | Right atrial dilatation | FAERS: 1 | US FAERS | |
| 1628 | Root canal infection | FAERS: 1 | US FAERS | |
| 1629 | Salpingo-oophorectomy unilateral | FAERS: 1 | US FAERS | |
| 1630 | Scab | FAERS: 1 | OFFSIDES US FAERS | |
| 1631 | Scoliosis surgery | FAERS: 1 | US FAERS | |
| 1632 | Scotoma | FAERS: 1 | US FAERS | |
| 1633 | Screaming | FAERS: 1 | US FAERS | |
| 1634 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 1635 | Senile dementia | FAERS: 1 | US FAERS | |
| 1636 | Single functional kidney | FAERS: 1 | US FAERS | |
| 1637 | Sinus antrostomy | FAERS: 1 | US FAERS | |
| 1638 | Sinus polyp | FAERS: 1 | US FAERS | |
| 1639 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 1640 | Skin flap necrosis | FAERS: 1 | US FAERS | |
| 1641 | Skin necrosis | FAERS: 1 | US FAERS | |
| 1642 | Skin neoplasm excision | FAERS: 1 | US FAERS | |
| 1643 | Skin texture abnormal | FAERS: 1 | US FAERS | |
| 1644 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 1645 | Sluggishness | FAERS: 1 | US FAERS | |
| 1646 | Small intestine carcinoma recurrent | FAERS: 1 | US FAERS | |
| 1647 | Soft tissue flap operation | FAERS: 1 | US FAERS | |
| 1648 | Solar dermatitis | FAERS: 1 | US FAERS | |
| 1649 | Solar elastosis | FAERS: 1 | US FAERS | |
| 1650 | Solar lentigo | FAERS: 1 | US FAERS | |
| 1651 | Solar urticaria | FAERS: 1 | US FAERS | |
| 1652 | Somatoform Disorder | FAERS: 1 | US FAERS | |
| 1653 | Spina Bifida | FAERS: 1 | US FAERS | |
| 1654 | Spinal X-ray abnormal | FAERS: 1 | US FAERS | |
| 1655 | Spinal rod insertion | FAERS: 1 | US FAERS | |
| 1656 | Splenectomy | FAERS: 1 | US FAERS | |
| 1657 | Staphylococcal osteomyelitis | FAERS: 1 | US FAERS | |
| 1658 | Starvation | FAERS: 1 | US FAERS | |
| 1659 | Stitch abscess | FAERS: 1 | US FAERS | |
| 1660 | Stomach scan abnormal | FAERS: 1 | US FAERS | |
| 1661 | Stress ulcer | FAERS: 1 | US FAERS | |
| 1662 | Subacute endocarditis | FAERS: 1 | US FAERS | |
| 1663 | Subclavian artery occlusion | FAERS: 1 | US FAERS | |
| 1664 | Subcutaneous Emphysema | FAERS: 1 | US FAERS | |
| 1665 | Sunburn | FAERS: 1 | US FAERS | |
| 1666 | Synovectomy | FAERS: 1 | US FAERS | |
| 1667 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 1668 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 1669 | Therapeutic procedure | FAERS: 1 | OFFSIDES US FAERS | |
| 1670 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 1671 | Thrombectomy | FAERS: 1 | US FAERS | |
| 1672 | Thromboembolectomy | FAERS: 1 | US FAERS | |
| 1673 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 1674 | Thyroglobulin decreased | FAERS: 1 | US FAERS | |
| 1675 | Thyroid hormones decreased | FAERS: 1 | US FAERS | |
| 1676 | Tongue biting | FAERS: 1 | US FAERS | |
| 1677 | Toxic Epidermal Necrolysis | FAERS: 1 | SIDER US FAERS | |
| 1678 | Tracheitis | FAERS: 1 | US FAERS | |
| 1679 | Transcription medication error | FAERS: 1 | US FAERS | |
| 1680 | Transmission of drug via semen | FAERS: 1 | US FAERS | |
| 1681 | Trendelenburg's symptom | FAERS: 1 | US FAERS | |
| 1682 | Umbilical malformation | FAERS: 1 | US FAERS | |
| 1683 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 1684 | Unresponsive to verbal stimuli | FAERS: 1 | US FAERS | |
| 1685 | Upper airway resistance syndrome | FAERS: 1 | US FAERS | |
| 1686 | Ureteral stent insertion | FAERS: 1 | US FAERS | |
| 1687 | Urethral Stenosis | FAERS: 1 | US FAERS | |
| 1688 | Urethral cancer metastatic | FAERS: 1 | US FAERS | |
| 1689 | Uterine Perforation | FAERS: 1 | US FAERS | |
| 1690 | Vaginal mucosal blistering | FAERS: 1 | US FAERS | |
| 1691 | Vascular pain | FAERS: 1 | US FAERS | |
| 1692 | Vasculitic rash | FAERS: 1 | US FAERS | |
| 1693 | Venous ligation | FAERS: 1 | US FAERS | |
| 1694 | Venous occlusion | FAERS: 1 | US FAERS | |
| 1695 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 1696 | Vitamin D abnormal | FAERS: 1 | US FAERS | |
| 1697 | Vocal cord cyst | FAERS: 1 | US FAERS | |
| 1698 | Wound decomposition | FAERS: 1 | US FAERS | |
| 1699 | Wrong dose | FAERS: 1 | US FAERS | |
| 1700 | Wrong product administered | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1701 | X-ray abnormal | FAERS: 1 | US FAERS | |
| 1702 | Zygomycosis | FAERS: 1 | US FAERS | |
| 1703 | colonoscopy | FAERS: 1 | US FAERS | |
| 1704 | organ donor | FAERS: 1 | US FAERS | |
| 1705 | Abdominal symptom | OFFSIDES | ||
| 1706 | Acid reflux | OFFSIDES | ||
| 1707 | Acute bronchitis | OFFSIDES | ||
| 1708 | Adenoma | OFFSIDES | ||
| 1709 | Alcohol interaction | Canada Vigilance: 1 | Canada Vigilance | |
| 1710 | Alcoholic Intoxication | OFFSIDES | ||
| 1711 | Amylase increased | Canada Vigilance: 1 | Canada Vigilance | |
| 1712 | Antiphospholipid antibodies positive | OFFSIDES | ||
| 1713 | Aortic Rupture | OFFSIDES | ||
| 1714 | Application site hypersensitivity | OFFSIDES | ||
| 1715 | Arachnoiditis | OFFSIDES | ||
| 1716 | Aseptic Meningitis | OFFSIDES | ||
| 1717 | Atherosclerosis obliterans | OFFSIDES | ||
| 1718 | Atypical stress fracture | SIDER | ||
| 1719 | Bacterial Infections | 12669766 | CTD | |
| 1720 | Bicytopenia | OFFSIDES | ||
| 1721 | Bile Duct Stenosis | OFFSIDES | ||
| 1722 | Blood sodium abnormal | OFFSIDES | ||
| 1723 | Bone Diseases | 16699055 | CTD | |
| 1724 | Bone Resorption | CTD | ||
| 1725 | Bone fissure | OFFSIDES | ||
| 1726 | Bone neoplasms | 10791010 | CTD | |
| 1727 | Cardiac Death | OFFSIDES | ||
| 1728 | Cardiovascular Diseases | 10447376 | CTD | |
| 1729 | Central line infection | OFFSIDES | ||
| 1730 | Cerebral cyst | OFFSIDES | ||
| 1731 | Chemical and Drug Induced Liver Injury | 9883006 11938071 | CTD | |
| 1732 | Cholangiolitis | OFFSIDES | ||
| 1733 | Cholestatic liver injury | OFFSIDES | ||
| 1734 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 1735 | Chronic active hepatitis | OFFSIDES | ||
| 1736 | Chronic ulcerative colitis | OFFSIDES | ||
| 1737 | Cirrhosis | OFFSIDES | ||
| 1738 | Coagulation factor VIII level increased | OFFSIDES | ||
| 1739 | Cognition Disorders | 30481507 | CTD | |
| 1740 | Concomitant disease progression | OFFSIDES | ||
| 1741 | Confabulation | OFFSIDES | ||
| 1742 | Corneal Opacity | Canada Vigilance: 1 | Canada Vigilance | |
| 1743 | Corneal dystrophy | OFFSIDES | ||
| 1744 | Creatinine renal clearance decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 1745 | Cytomegalovirus chorioretinitis | OFFSIDES | ||
| 1746 | Cytomegalovirus enterocolitis | OFFSIDES | ||
| 1747 | Dacryocanaliculitis | OFFSIDES | ||
| 1748 | Dacryostenosis acquired | OFFSIDES | ||
| 1749 | Decreased Libido | OFFSIDES | ||
| 1750 | Deglutition Disorders | 12730757 | CTD | |
| 1751 | Demyelination | OFFSIDES | ||
| 1752 | Dental abscess | OFFSIDES | ||
| 1753 | Diarrhea | 12730757 | CTD OFFSIDES | |
| 1754 | Diffuse alveolar damage | OFFSIDES | ||
| 1755 | Diverticular perforation | OFFSIDES | ||
| 1756 | Edema | 17375077 | CTD | |
| 1757 | Endophthalmitis | 10369603 | CTD | |
| 1758 | Escherichia sepsis | OFFSIDES | ||
| 1759 | Esophageal Stenosis | OFFSIDES | ||
| 1760 | Esophageal erosions | SIDER | ||
| 1761 | Esophagitis | 12730757 | CTD | |
| 1762 | Exacerbation of asthma | SIDER | ||
| 1763 | Exanthema | 12730757 | CTD | |
| 1764 | Eyelash thickening | OFFSIDES | ||
| 1765 | Facial paralysis | Canada Vigilance: 1 | Canada Vigilance | |
| 1766 | Fatty Liver | OFFSIDES | ||
| 1767 | Floppy iris syndrome | Canada Vigilance: 1 | Canada Vigilance | |
| 1768 | Formication | OFFSIDES | ||
| 1769 | Gait inability | Canada Vigilance: 1 | Canada Vigilance | |
| 1770 | Giant Cell Tumor of Bone | 15037971 | CTD | |
| 1771 | Globulinuria | OFFSIDES | ||
| 1772 | Granulocytosis | OFFSIDES | ||
| 1773 | Hallucinations | 15222671 | CTD | |
| 1774 | Heartburn | 12730757 | CTD SIDER | |
| 1775 | Hepatic congestion | OFFSIDES | ||
| 1776 | Hyperalgesia | 16769263 | CTD | |
| 1777 | Hypercalcemia | 12730757 17681097 | CTD | |
| 1778 | Hyperreflexia | OFFSIDES | ||
| 1779 | Hypocalcemia | 12730757 | CTD | |
| 1780 | Impetigo | OFFSIDES | ||
| 1781 | Influenza-like symptoms | SIDER | ||
| 1782 | Infusion site mobility decreased | OFFSIDES | ||
| 1783 | Injection site thrombosis | OFFSIDES | ||
| 1784 | Joint abscess | OFFSIDES | ||
| 1785 | Kidney Failure | OFFSIDES | ||
| 1786 | Loss of personal independence in daily activities | Canada Vigilance: 2 | Canada Vigilance | |
| 1787 | Lower respiratory tract infection viral | OFFSIDES | ||
| 1788 | Lupus vasculitis | OFFSIDES | ||
| 1789 | Memory Disorders | 30481507 | CTD | |
| 1790 | Monocytosis | OFFSIDES | ||
| 1791 | Mononeuritis | OFFSIDES | ||
| 1792 | Muscle Weakness | OFFSIDES | ||
| 1793 | Myofascitis | OFFSIDES | ||
| 1794 | Nephritis, Interstitial | 16060139 | CTD | |
| 1795 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 1796 | Ocular vasculitis | Canada Vigilance: 1 | Canada Vigilance | |
| 1797 | Optic Atrophy | OFFSIDES | ||
| 1798 | Oropharyngeal spasm | OFFSIDES | ||
| 1799 | Osteoporosis, Postmenopausal | 10447376 12730757 17439652 | CTD | |
| 1800 | Osteoporotic Fractures | 17439652 | CTD | |
| 1801 | Osteosarcoma | 15049011 | CTD | |
| 1802 | Pancreatic Duct Stenosis | OFFSIDES | ||
| 1803 | Paroxysmal arrhythmia | OFFSIDES | ||
| 1804 | Pelvic discomfort | OFFSIDES | ||
| 1805 | Peripheral occlusive disease | OFFSIDES | ||
| 1806 | Pharyngeal swelling | Canada Vigilance: 4 | Canada Vigilance | |
| 1807 | Post procedural pain | OFFSIDES | ||
| 1808 | Product dispensing error | Canada Vigilance: 1 | Canada Vigilance | |
| 1809 | Prothrombin time abnormal | OFFSIDES | ||
| 1810 | Pseudophaeochromocytoma | OFFSIDES | ||
| 1811 | Pulmonary function test decreased | OFFSIDES | ||
| 1812 | Rectal Prolapse | OFFSIDES | ||
| 1813 | Retinal Vasculitis | OFFSIDES | ||
| 1814 | Retrosternal pain | SIDER | ||
| 1815 | Risus sardonicus | OFFSIDES | ||
| 1816 | Scleroderma | OFFSIDES | ||
| 1817 | Seizures | 12461152 | CTD | |
| 1818 | Skin hypertrophy | OFFSIDES | ||
| 1819 | Skin tightness | OFFSIDES | ||
| 1820 | Sleep-related eating disorder | OFFSIDES | ||
| 1821 | Soft Tissue Injuries | OFFSIDES | ||
| 1822 | Sphincter of Oddi Dysfunction | OFFSIDES | ||
| 1823 | Spinal haemangioma | OFFSIDES | ||
| 1824 | Stem cell transplant | OFFSIDES | ||
| 1825 | Stridor | Canada Vigilance: 1 | Canada Vigilance | |
| 1826 | Sudden Cardiac Death | OFFSIDES | ||
| 1827 | Tendinitis | OFFSIDES | ||
| 1828 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 1829 | Unresponsive to pain stimuli | OFFSIDES | ||
| 1830 | Viral pharyngitis | OFFSIDES | ||
| 1831 | Vision Disorders | 15222671 | CTD | |
| 1832 | Vitamin B 12 Deficiency | OFFSIDES | ||
| 1833 | Weight Gain | OFFSIDES | ||
| 1834 | Whole blood transfusion | OFFSIDES | ||
| 1835 | Wound Debridement | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.