Tacrolimus
(QJJXYPPXXYFBGM-LFZNUXCKSA-N)
Structure
- SMILES
- C=CC[C@@H]1/C=C(\C)/C[C@H](C)C[C@H](OC)[C@H]2O[C@](O)([C@@H](C[C@@H]2OC)C)C(=O)C(=O)N2[C@H](C(=O)O[C@@H]([C@@H]([C@H](CC1=O)O)C)/C(=C/[C@@H]1CC[C@H]([C@@H](C1)OC)O)/C)CCCC2
- Type(s)
- Approved; Investigational
- ATC code(s)
- D11AH01; L04AD02
- Molecular Formula:
- C44H69NO12
- Molecular Weight:
- 804.018
- Log P:
- 4.5769
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 3
- TPSA:
- 178.36
- CAS Number(s):
- 104987-11-3
Synonym(s)
1.
Tacrolimus
2.
Anhydrous Tacrolimus
3.
FK-506
4.
FK506
5.
FR-900506
6.
Prograf
7.
Prograft
8.
Tacrolimus Anhydrous
9.
Anhydrous, Tacrolimus
10.
FK 506
11.
FR 900506
12.
FR900506
13.
Tacrolimus, Anhydrous
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 256 Canada Vigilance: 40 | Canada Vigilance SIDER US FAERS | |
| 2 | Tremor | FAERS: 204 Canada Vigilance: 4 | CTD SIDER Canada Vigilance US FAERS | |
| 3 | Malaise | FAERS: 203 Canada Vigilance: 17 | Canada Vigilance SIDER US FAERS | |
| 4 | Vomiting | FAERS: 197 Canada Vigilance: 6 | 7581086 8605372 | CTD SIDER Canada Vigilance US FAERS |
| 5 | Nausea | FAERS: 192 Canada Vigilance: 5 | 7581086 8605372 | CTD SIDER Canada Vigilance US FAERS |
| 6 | Pneumonia | FAERS: 181 Canada Vigilance: 17 | Canada Vigilance SIDER US FAERS | |
| 7 | Toxicity to various agents | FAERS: 167 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 8 | Blood creatinine increased | FAERS: 135 Canada Vigilance: 13 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 9 | Sepsis | FAERS: 135 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 10 | Headache | FAERS: 132 Canada Vigilance: 6 | CTD SIDER Canada Vigilance US FAERS | |
| 11 | Immunosuppressant drug level increased | FAERS: 129 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 12 | Diabetes Mellitus | FAERS: 124 Canada Vigilance: 11 | CTD SIDER Canada Vigilance US FAERS | |
| 13 | Product use issue | FAERS: 120 | US FAERS | |
| 14 | Posterior reversible encephalopathy syndrome | FAERS: 119 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 15 | Infection | FAERS: 109 Canada Vigilance: 11 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 16 | Liver transplant rejection | FAERS: 106 Canada Vigilance: 11 | Canada Vigilance OFFSIDES US FAERS | |
| 17 | Fatigue | FAERS: 102 Canada Vigilance: 8 | 9361932 | CTD SIDER Canada Vigilance US FAERS |
| 18 | Product use in unapproved indication | FAERS: 99 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 19 | Pruritus | FAERS: 99 Canada Vigilance: 5 | 10743694 | CTD SIDER Canada Vigilance US FAERS |
| 20 | Abdominal Pain | FAERS: 96 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 21 | Drug exposure during pregnancy | FAERS: 95 | US FAERS | |
| 22 | Asthenia | FAERS: 92 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 23 | Cerebrovascular accident | FAERS: 91 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 24 | Immunosuppressant drug level decreased | FAERS: 91 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 25 | Drug level increased | FAERS: 90 | SIDER US FAERS | |
| 26 | Urinary tract infection | FAERS: 90 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 27 | Lymphadenopathy | FAERS: 88 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 28 | Myocardial Infarction | FAERS: 83 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 29 | Pain | FAERS: 81 Canada Vigilance: 8 | 10577370 11263551 15257699 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 30 | Food Allergy | FAERS: 80 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 31 | Skin Papilloma | FAERS: 78 | SIDER US FAERS | |
| 32 | Chills | FAERS: 75 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 33 | No adverse event | FAERS: 74 | US FAERS | |
| 34 | Acute kidney injury | FAERS: 70 Canada Vigilance: 5 | CTD Canada Vigilance US FAERS | |
| 35 | Respiratory Failure | FAERS: 66 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 36 | Cardiac Arrest | FAERS: 63 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 37 | Incorrect product storage | FAERS: 62 | US FAERS | |
| 38 | Pregnancy | FAERS: 62 | US FAERS | |
| 39 | Maternal exposure during pregnancy | FAERS: 61 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 40 | Dehydration | FAERS: 59 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 41 | Lymphoma | FAERS: 59 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 42 | Hypersensitivity | FAERS: 58 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 43 | Alopecia | FAERS: 56 Canada Vigilance: 3 | 9636504 | CTD SIDER Canada Vigilance US FAERS |
| 44 | Dizziness | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 45 | Drug dose omission | FAERS: 53 | US FAERS | |
| 46 | Transplantation associated food allergy | FAERS: 53 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 47 | General physical health deterioration | FAERS: 52 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Low birth weight baby | FAERS: 52 | US FAERS | |
| 49 | Arthralgia | FAERS: 50 Canada Vigilance: 3 | CTD SIDER Canada Vigilance US FAERS | |
| 50 | Septic Shock | FAERS: 50 | OFFSIDES US FAERS | |
| 51 | Urticaria | FAERS: 50 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 52 | Weight decreased | FAERS: 50 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 53 | Blindness | FAERS: 48 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 54 | Nasopharyngitis | FAERS: 48 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 55 | Squamous cell carcinoma | FAERS: 47 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 56 | Post transplant distal limb syndrome | FAERS: 46 | US FAERS | |
| 57 | Hypotension | FAERS: 45 Canada Vigilance: 1 | 10385251 11041285 19332869 | CTD SIDER Canada Vigilance US FAERS |
| 58 | Overdose | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Adverse event | FAERS: 43 | OFFSIDES US FAERS | |
| 60 | Asthma | FAERS: 43 | SIDER US FAERS | |
| 61 | Influenza | FAERS: 43 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 62 | Burning sensation | FAERS: 42 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 63 | Hepatitis C | FAERS: 42 Canada Vigilance: 2 | 9636597 | CTD OFFSIDES Canada Vigilance US FAERS |
| 64 | Medication Error | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Product substitution issue | FAERS: 42 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 66 | Incorrect dose administered | FAERS: 41 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 67 | Product quality issue | FAERS: 40 | US FAERS | |
| 68 | Abdominal discomfort | FAERS: 39 | US FAERS | |
| 69 | Drug dispensing error | FAERS: 39 | US FAERS | |
| 70 | Thrombocytopenia | FAERS: 38 | 12753543 | CTD SIDER US FAERS |
| 71 | Wrong technique in drug usage process | FAERS: 38 | US FAERS | |
| 72 | Application site pain | FAERS: 37 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 73 | Drug level decreased | FAERS: 37 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 74 | Erythema | FAERS: 37 | SIDER US FAERS | |
| 75 | Inappropriate schedule of drug administration | FAERS: 37 | US FAERS | |
| 76 | Mental status changes | FAERS: 36 | SIDER US FAERS | |
| 77 | Renal transplant failure | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Ascites | FAERS: 35 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 79 | Drug level fluctuating | FAERS: 35 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 80 | Thrombosis | FAERS: 35 | CTD SIDER US FAERS | |
| 81 | Amnesia | FAERS: 34 | SIDER US FAERS | |
| 82 | Anxiety | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 83 | Disease recurrence | FAERS: 34 | OFFSIDES US FAERS | |
| 84 | Drug level below therapeutic | FAERS: 34 | US FAERS | |
| 85 | Metabolic acidosis | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 86 | Osmotic demyelination syndrome | FAERS: 34 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 87 | Angioedema | FAERS: 33 Canada Vigilance: 2 | 17377381 | CTD Canada Vigilance US FAERS |
| 88 | Basal cell carcinoma | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 89 | Post procedural complication | FAERS: 33 | OFFSIDES US FAERS | |
| 90 | Visual Impairment | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 91 | Eczema | FAERS: 32 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 92 | Memory impairment | FAERS: 32 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 93 | Drug prescribing error | FAERS: 31 | US FAERS | |
| 94 | Impetigo | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 95 | Fracture | FAERS: 30 | US FAERS | |
| 96 | Inflammation | FAERS: 30 | SIDER US FAERS | |
| 97 | Blood glucose increased | FAERS: 29 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 98 | Intentional product use issue | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 99 | Back Pain | FAERS: 28 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 100 | Nephrotic Syndrome | FAERS: 28 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 101 | Pancytopenia | FAERS: 28 | SIDER US FAERS | |
| 102 | Transplant | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 103 | Aphasia | FAERS: 27 Canada Vigilance: 1 | 7511197 | CTD SIDER Canada Vigilance US FAERS |
| 104 | Proteinuria | FAERS: 27 Canada Vigilance: 3 | 1375300 7514309 17283585 | CTD SIDER Canada Vigilance US FAERS |
| 105 | Somnolence | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 106 | Constipation | FAERS: 26 | SIDER US FAERS | |
| 107 | Drug ineffective for unapproved indication | FAERS: 26 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 108 | Dysarthria | FAERS: 26 Canada Vigilance: 2 | 8820772 12699871 12819864 | CTD SIDER Canada Vigilance US FAERS |
| 109 | Lung transplant rejection | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 110 | Respiratory distress | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 111 | Accidental overdose | FAERS: 25 | US FAERS | |
| 112 | Chest Pain | FAERS: 25 Canada Vigilance: 2 | 11296433 12975596 | CTD SIDER Canada Vigilance US FAERS |
| 113 | Feeling abnormal | FAERS: 25 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 114 | Intentional product misuse | FAERS: 25 | US FAERS | |
| 115 | Myalgia | FAERS: 25 | SIDER US FAERS | |
| 116 | Product storage error | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 117 | Circumstance or information capable of leading to medication error | FAERS: 24 | US FAERS | |
| 118 | Peripheral swelling | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 119 | Unevaluable event | FAERS: 24 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 120 | Wrong technique in product usage process | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 121 | Atrial Fibrillation | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 122 | Delayed Graft Function | FAERS: 23 | US FAERS | |
| 123 | Hypoxia | FAERS: 23 | US FAERS | |
| 124 | Neutropenia | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 125 | Pancreatitis | FAERS: 23 Canada Vigilance: 3 | 16753888 | CTD SIDER Canada Vigilance US FAERS |
| 126 | Renal tubular necrosis | FAERS: 23 | SIDER US FAERS | |
| 127 | Acne | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 128 | Blood creatinine abnormal | FAERS: 22 | US FAERS | |
| 129 | Cerebral Infarction | FAERS: 22 | 12072309 | CTD SIDER US FAERS |
| 130 | Cholangitis | FAERS: 22 | SIDER US FAERS | |
| 131 | Cholelithiasis | FAERS: 22 | 19541577 | CTD US FAERS |
| 132 | Immune thrombocytopenic purpura | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 133 | Pericardial effusion | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 134 | Sinusitis | FAERS: 22 | SIDER US FAERS | |
| 135 | Cataract | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 136 | Depressed Level of Consciousness | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 137 | Incorrect route of drug administration | FAERS: 21 | US FAERS | |
| 138 | Pulmonary Embolism | FAERS: 21 | US FAERS | |
| 139 | Pyelonephritis | FAERS: 21 | US FAERS | |
| 140 | Respiratory arrest | FAERS: 21 | US FAERS | |
| 141 | nervous system disorder | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 142 | Agitation | FAERS: 20 | SIDER US FAERS | |
| 143 | Bile Duct Stenosis | FAERS: 20 | SIDER US FAERS | |
| 144 | Nephrolithiasis | FAERS: 20 | OFFSIDES US FAERS | |
| 145 | Application site pruritus | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 146 | Cholestasis | FAERS: 19 Canada Vigilance: 1 | 12826230 16573611 19405263 | CTD SIDER Canada Vigilance US FAERS |
| 147 | Drug toxicity | FAERS: 19 | OFFSIDES US FAERS | |
| 148 | Enterococcal infection | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 149 | Histiocytosis haematophagic | FAERS: 19 | OFFSIDES US FAERS | |
| 150 | Intestinal Obstruction | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 151 | Product used for unknown indication | FAERS: 19 | US FAERS | |
| 152 | Stillbirth | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 153 | Blood urea increased | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 154 | Delirium | FAERS: 18 | SIDER US FAERS | |
| 155 | Disability | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 156 | Disease Progression | FAERS: 18 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 157 | Hypertrophic Cardiomyopathy | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 158 | Squamous cell carcinoma of skin | FAERS: 18 | US FAERS | |
| 159 | Diabetic Ketoacidosis | FAERS: 17 | US FAERS | |
| 160 | Eye irritation | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 161 | Leukoencephalopathy | FAERS: 17 | SIDER US FAERS | |
| 162 | Optic Neuropathy | FAERS: 17 | US FAERS | |
| 163 | Pulmonary Hypertension | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 164 | Swelling | FAERS: 17 | US FAERS | |
| 165 | Tachycardia | FAERS: 17 | 11296433 | CTD SIDER US FAERS |
| 166 | Alanine Aminotransferase Increased | FAERS: 16 | US FAERS | |
| 167 | Arthritis | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 168 | BK virus infection | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 169 | Disorientation | FAERS: 16 | SIDER US FAERS | |
| 170 | Dry skin | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 171 | Epilepsy | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 172 | Hypophagia | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 173 | Immunosuppression | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 174 | Incorrect storage of drug | FAERS: 16 | US FAERS | |
| 175 | Lentigo | FAERS: 16 | US FAERS | |
| 176 | jaundice | FAERS: 16 | SIDER US FAERS | |
| 177 | Aspartate Aminotransferase Increased | FAERS: 15 | US FAERS | |
| 178 | Coronary Artery Disease | FAERS: 15 | US FAERS | |
| 179 | Demyelination | FAERS: 15 | OFFSIDES US FAERS | |
| 180 | Gout | FAERS: 15 | SIDER US FAERS | |
| 181 | Ileus | FAERS: 15 | SIDER US FAERS | |
| 182 | Malnutrition | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 183 | Rhabdomyolysis | FAERS: 15 | 19376416 | CTD SIDER US FAERS |
| 184 | White blood cell count decreased | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 185 | Application site erythema | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 186 | Blood potassium increased | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 187 | Dementia | FAERS: 14 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 188 | Device related infection | FAERS: 14 | US FAERS | |
| 189 | Drug level above therapeutic | FAERS: 14 | US FAERS | |
| 190 | Evans syndrome | FAERS: 14 | US FAERS | |
| 191 | Expired product administered | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 192 | Eye pain | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 193 | Lethargy | FAERS: 14 | 12823354 | CTD US FAERS |
| 194 | Osteomyelitis | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 195 | Product physical issue | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 196 | Product supply issue | FAERS: 14 | US FAERS | |
| 197 | treatment failure | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 198 | Abasia | FAERS: 13 | OFFSIDES US FAERS | |
| 199 | Bronchitis | FAERS: 13 | SIDER US FAERS | |
| 200 | Deafness | FAERS: 13 | SIDER US FAERS | |
| 201 | Drug level changed | FAERS: 13 | US FAERS | |
| 202 | Escherichia infection | FAERS: 13 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 203 | Folliculitis | FAERS: 13 | SIDER US FAERS | |
| 204 | Glaucoma | FAERS: 13 | OFFSIDES US FAERS | |
| 205 | Leukopenia | FAERS: 13 | 10385251 | CTD SIDER US FAERS |
| 206 | Night sweats | FAERS: 13 | US FAERS | |
| 207 | Polyomavirus-associated nephropathy | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 208 | Post procedural bile leak | FAERS: 13 | OFFSIDES US FAERS | |
| 209 | Pre-Eclampsia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 210 | Renal graft loss | FAERS: 13 | US FAERS | |
| 211 | Renal tubular atrophy | FAERS: 13 | US FAERS | |
| 212 | Syncope | FAERS: 13 | SIDER US FAERS | |
| 213 | Tonsillitis | FAERS: 13 | US FAERS | |
| 214 | Autoimmune hepatitis | FAERS: 12 | OFFSIDES US FAERS | |
| 215 | Blood lactate dehydrogenase increased | FAERS: 12 | SIDER US FAERS | |
| 216 | Bone pain | FAERS: 12 | OFFSIDES US FAERS | |
| 217 | Colitis | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 218 | Cystitis | FAERS: 12 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 219 | Diverticulitis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 220 | Endocarditis | FAERS: 12 | US FAERS | |
| 221 | Fluid overload | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 222 | Reversible cerebral vasoconstriction syndrome | FAERS: 12 | US FAERS | |
| 223 | Shock | FAERS: 12 | 10385251 | CTD SIDER US FAERS |
| 224 | Skin lesion | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 225 | Altered state of consciousness | FAERS: 11 | SIDER US FAERS | |
| 226 | Anuria | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 227 | Clostridium difficile colitis | FAERS: 11 | US FAERS | |
| 228 | Complications of transplant surgery | FAERS: 11 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 229 | Dysuria | FAERS: 11 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 230 | Failure to Thrive | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 231 | Gastroenteritis | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 232 | Hydronephrosis | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 233 | Intentional drug misuse | FAERS: 11 | US FAERS | |
| 234 | Locked-In Syndrome | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 235 | Lymphocele | FAERS: 11 | US FAERS | |
| 236 | Oral allergy syndrome | FAERS: 11 | US FAERS | |
| 237 | Pancreatic carcinoma | FAERS: 11 | US FAERS | |
| 238 | Peritonitis | FAERS: 11 | SIDER US FAERS | |
| 239 | Tinnitus | FAERS: 11 | 10417040 16764642 | CTD SIDER US FAERS |
| 240 | Aspergillosis | FAERS: 10 | OFFSIDES US FAERS | |
| 241 | Deep Vein Thrombosis | FAERS: 10 | SIDER US FAERS | |
| 242 | Dermatitis | FAERS: 10 Canada Vigilance: 2 | 11407316 | CTD SIDER Canada Vigilance US FAERS |
| 243 | Epstein-Barr virus associated lymphoproliferative disorder | FAERS: 10 | OFFSIDES US FAERS | |
| 244 | Hepatic artery thrombosis | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 245 | Hernia | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 246 | Intestinal Perforation | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 247 | Joint swelling | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 248 | Mental impairment | FAERS: 10 | US FAERS | |
| 249 | Mycosis Fungoides | FAERS: 10 | SIDER US FAERS | |
| 250 | Nervousness | FAERS: 10 | SIDER US FAERS | |
| 251 | Nodular vasculitis | FAERS: 10 | US FAERS | |
| 252 | Skin Ulcer | FAERS: 10 | SIDER US FAERS | |
| 253 | Splenomegaly | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 254 | Stem cell transplant | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 255 | Suicide attempt | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 256 | T-Cell Lymphoma | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 257 | Tonsillectomy | FAERS: 10 | US FAERS | |
| 258 | Acidosis | FAERS: 9 | SIDER US FAERS | |
| 259 | Aneurysm | FAERS: 9 | US FAERS | |
| 260 | Ankle Fracture | FAERS: 9 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 261 | Back disorder | FAERS: 9 | US FAERS | |
| 262 | Basilar artery occlusion | FAERS: 9 | US FAERS | |
| 263 | Cardiomegaly | FAERS: 9 Canada Vigilance: 1 | CTD Canada Vigilance US FAERS | |
| 264 | Cellulitis | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 265 | Cerebral disorder | FAERS: 9 | US FAERS | |
| 266 | Clostridium difficile infection | FAERS: 9 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 267 | Depressed mood | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 268 | Diffuse Large B-Cell Lymphoma | FAERS: 9 | OFFSIDES US FAERS | |
| 269 | Discomfort | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 270 | Disseminated Intravascular Coagulation | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 271 | Electrolyte imbalance | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 272 | Epistaxis | FAERS: 9 | SIDER US FAERS | |
| 273 | Exposure during breast feeding | FAERS: 9 | US FAERS | |
| 274 | Guillain-Barre Syndrome | FAERS: 9 | US FAERS | |
| 275 | Hepatic Encephalopathy | FAERS: 9 | US FAERS | |
| 276 | Hepatic necrosis | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 277 | Leukocytosis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 278 | Limb injury | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 279 | Meningitis | FAERS: 9 | US FAERS | |
| 280 | Necrosis | FAERS: 9 | CTD US FAERS | |
| 281 | Palpitations | FAERS: 9 | SIDER US FAERS | |
| 282 | Pneumothorax | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 283 | Portal Vein Thrombosis | FAERS: 9 | US FAERS | |
| 284 | Prescribed underdose | FAERS: 9 | US FAERS | |
| 285 | Product packaging quantity issue | FAERS: 9 | US FAERS | |
| 286 | Right ventricular failure | FAERS: 9 | US FAERS | |
| 287 | Vasculitis | FAERS: 9 Canada Vigilance: 1 | 9566415 20443058 | CTD Canada Vigilance US FAERS |
| 288 | Abscess | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 289 | Acute graft versus host disease in skin | FAERS: 8 | US FAERS | |
| 290 | Arteriosclerosis | FAERS: 8 | US FAERS | |
| 291 | Ataxia | FAERS: 8 | 8820772 12699871 12819864 | CTD US FAERS |
| 292 | B-lymphocyte count decreased | FAERS: 8 | US FAERS | |
| 293 | Blood alkaline phosphatase increased | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 294 | Bronchopulmonary Aspergillosis | FAERS: 8 | US FAERS | |
| 295 | Candidiasis | FAERS: 8 | US FAERS | |
| 296 | Catatonia | FAERS: 8 | 17484951 | CTD US FAERS |
| 297 | Chronic graft versus host disease in skin | FAERS: 8 | US FAERS | |
| 298 | Cytomegalovirus chorioretinitis | FAERS: 8 | OFFSIDES US FAERS | |
| 299 | Drug effect incomplete | FAERS: 8 | US FAERS | |
| 300 | Eosinophilic colitis | FAERS: 8 | US FAERS | |
| 301 | Gait inability | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 302 | Gangrene | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 303 | Graft versus host disease in gastrointestinal tract | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 304 | Graft versus host disease in skin | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 305 | Hepatitis | FAERS: 8 | SIDER US FAERS | |
| 306 | Hepatomegaly | FAERS: 8 | US FAERS | |
| 307 | Infarction | FAERS: 8 | SIDER US FAERS | |
| 308 | Macular degeneration | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 309 | Musculoskeletal Pain | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 310 | Myelofibrosis | FAERS: 8 | US FAERS | |
| 311 | Optic Atrophy | FAERS: 8 | SIDER US FAERS | |
| 312 | Oropharyngeal pain | FAERS: 8 | US FAERS | |
| 313 | Portal Hypertension | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 314 | Procedural complication | FAERS: 8 | SIDER US FAERS | |
| 315 | Product dispensing error | FAERS: 8 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 316 | Product dose omission | FAERS: 8 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 317 | Renal cyst | FAERS: 8 | US FAERS | |
| 318 | Renal pain | FAERS: 8 | US FAERS | |
| 319 | Status Epilepticus | FAERS: 8 | CTD SIDER US FAERS | |
| 320 | Stomatitis | FAERS: 8 | 9209738 | CTD SIDER US FAERS |
| 321 | Therapy change | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 322 | Transaminases increased | FAERS: 8 | OFFSIDES US FAERS | |
| 323 | Vertigo | FAERS: 8 | SIDER US FAERS | |
| 324 | Viral upper respiratory tract infection | FAERS: 8 | US FAERS | |
| 325 | Wheezing | FAERS: 8 | US FAERS | |
| 326 | prostatitis | FAERS: 8 | US FAERS | |
| 327 | Alcohol Intolerance | FAERS: 7 | SIDER US FAERS | |
| 328 | Anorexia | FAERS: 7 | 12709079 | CTD SIDER US FAERS |
| 329 | Application site reaction | FAERS: 7 | US FAERS | |
| 330 | Arteriopathic disease | FAERS: 7 | US FAERS | |
| 331 | Arteritis | FAERS: 7 | 9311719 | CTD US FAERS |
| 332 | Bradycardia | FAERS: 7 | 9399620 | CTD SIDER US FAERS |
| 333 | Cell Death | FAERS: 7 | US FAERS | |
| 334 | Chest discomfort | FAERS: 7 | SIDER US FAERS | |
| 335 | Dental caries | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 336 | Disease complication | FAERS: 7 | US FAERS | |
| 337 | Drug exposure before pregnancy | FAERS: 7 | US FAERS | |
| 338 | Eosinophilia | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 339 | Escherichia urinary tract infection | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 340 | Feeling Cold | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 341 | Gastric ulcer | FAERS: 7 | SIDER US FAERS | |
| 342 | Gestational Diabetes | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 343 | Graft loss | FAERS: 7 | SIDER US FAERS | |
| 344 | Graft thrombosis | FAERS: 7 | US FAERS | |
| 345 | Hepatorenal Syndrome | FAERS: 7 | US FAERS | |
| 346 | Intracranial Aneurysm | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 347 | Lip swelling | FAERS: 7 | US FAERS | |
| 348 | Malabsorption | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 349 | Malignant melanoma stage I | FAERS: 7 | US FAERS | |
| 350 | Molluscum Contagiosum | FAERS: 7 | US FAERS | |
| 351 | Mutism | FAERS: 7 Canada Vigilance: 1 | 8820772 11014653 | CTD SIDER Canada Vigilance US FAERS |
| 352 | Product container issue | FAERS: 7 | US FAERS | |
| 353 | Pulmonary Fibrosis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 354 | Renal tubular acidosis | FAERS: 7 | US FAERS | |
| 355 | Sarcoma | FAERS: 7 | US FAERS | |
| 356 | Stupor | FAERS: 7 | SIDER US FAERS | |
| 357 | Transplantation complication | FAERS: 7 | US FAERS | |
| 358 | Vitiligo | FAERS: 7 | 19547993 | CTD US FAERS |
| 359 | Wound infection staphylococcal | FAERS: 7 | US FAERS | |
| 360 | Amyloidosis | FAERS: 6 | US FAERS | |
| 361 | Application site folliculitis | FAERS: 6 | US FAERS | |
| 362 | Bacterial sepsis | FAERS: 6 | OFFSIDES US FAERS | |
| 363 | Biliary anastomosis complication | FAERS: 6 | US FAERS | |
| 364 | Biliary dilatation | FAERS: 6 | OFFSIDES US FAERS | |
| 365 | Bowen's Disease | FAERS: 6 | US FAERS | |
| 366 | Brain Death | FAERS: 6 | US FAERS | |
| 367 | Central nervous system lesion | FAERS: 6 | US FAERS | |
| 368 | Cerebral artery stenosis | FAERS: 6 | US FAERS | |
| 369 | Cerebral atrophy | FAERS: 6 | US FAERS | |
| 370 | Congenital cystic kidney disease | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 371 | Diplopia | FAERS: 6 | 10954277 | CTD US FAERS |
| 372 | Dyspepsia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 373 | Escherichia sepsis | FAERS: 6 | US FAERS | |
| 374 | Flushing | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 375 | Gastritis | FAERS: 6 | SIDER US FAERS | |
| 376 | Glomerulonephritis | FAERS: 6 | SIDER US FAERS | |
| 377 | Graft dysfunction | FAERS: 6 | SIDER US FAERS | |
| 378 | Granuloma | FAERS: 6 | US FAERS | |
| 379 | Growth retardation | FAERS: 6 | US FAERS | |
| 380 | Hemiparesis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 381 | Hydrocephalus | FAERS: 6 | OFFSIDES US FAERS | |
| 382 | Hyperparathyroidism | FAERS: 6 | US FAERS | |
| 383 | Hypertensive Encephalopathy | FAERS: 6 | US FAERS | |
| 384 | Hyperthyroidism | FAERS: 6 | US FAERS | |
| 385 | Hypothyroidism | FAERS: 6 | SIDER US FAERS | |
| 386 | Hysterectomy | FAERS: 6 | US FAERS | |
| 387 | Immunosuppressant drug level | FAERS: 6 | OFFSIDES US FAERS | |
| 388 | Malignant neoplasm progression | FAERS: 6 | US FAERS | |
| 389 | Milk Allergy | FAERS: 6 | US FAERS | |
| 390 | Multifocal motor neuropathy | FAERS: 6 | US FAERS | |
| 391 | Nephrosclerosis | FAERS: 6 | SIDER US FAERS | |
| 392 | Oliguria | FAERS: 6 | 15840666 | CTD OFFSIDES SIDER US FAERS |
| 393 | Pleurisy | FAERS: 6 | OFFSIDES US FAERS | |
| 394 | Porokeratosis | FAERS: 6 | US FAERS | |
| 395 | Renal graft infection | FAERS: 6 | US FAERS | |
| 396 | Rheumatoid Arthritis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 397 | Skin irritation | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 398 | Subcutaneous Abscess | FAERS: 6 | US FAERS | |
| 399 | Sudden death | FAERS: 6 | US FAERS | |
| 400 | Urinary Retention | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 401 | Wound Infection | FAERS: 6 | OFFSIDES US FAERS | |
| 402 | Accidental exposure to product | FAERS: 5 | US FAERS | |
| 403 | Actinic keratosis | FAERS: 5 | OFFSIDES US FAERS | |
| 404 | Acute graft versus host disease in liver | FAERS: 5 | OFFSIDES US FAERS | |
| 405 | Acute myocardial infarction | FAERS: 5 | OFFSIDES US FAERS | |
| 406 | Anaphylactic shock | FAERS: 5 | SIDER US FAERS | |
| 407 | Aortic Aneurysm | FAERS: 5 | US FAERS | |
| 408 | Appendicitis | FAERS: 5 | US FAERS | |
| 409 | Atelectasis | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 410 | Autoimmune thrombocytopenia | FAERS: 5 | US FAERS | |
| 411 | Bedridden | FAERS: 5 | US FAERS | |
| 412 | Blood albumin decreased | FAERS: 5 | OFFSIDES US FAERS | |
| 413 | Blood creatine phosphokinase increased | FAERS: 5 | US FAERS | |
| 414 | Blood immunoglobulin E increased | FAERS: 5 | US FAERS | |
| 415 | Blood magnesium decreased | FAERS: 5 | US FAERS | |
| 416 | Bradyphrenia | FAERS: 5 | US FAERS | |
| 417 | Cerebral Palsy | FAERS: 5 | US FAERS | |
| 418 | Cholecystitis | FAERS: 5 | US FAERS | |
| 419 | Diabetes Insipidus | FAERS: 5 | US FAERS | |
| 420 | Diabetic Foot | FAERS: 5 | US FAERS | |
| 421 | Diastolic dysfunction | FAERS: 5 | US FAERS | |
| 422 | Donor specific antibody present | FAERS: 5 | US FAERS | |
| 423 | Drug administration error | FAERS: 5 | US FAERS | |
| 424 | Economic problem | FAERS: 5 | US FAERS | |
| 425 | Eczema Herpeticum | FAERS: 5 | SIDER US FAERS | |
| 426 | Emotional disorder | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 427 | Encephalitis | FAERS: 5 | 15221068 | CTD OFFSIDES US FAERS |
| 428 | Expired drug administered | FAERS: 5 | US FAERS | |
| 429 | Eye Infection | FAERS: 5 | US FAERS | |
| 430 | Feeling jittery | FAERS: 5 | SIDER US FAERS | |
| 431 | Graft versus host disease in lung | FAERS: 5 | US FAERS | |
| 432 | Hepatic cancer metastatic | FAERS: 5 | US FAERS | |
| 433 | Hepatitis B | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 434 | Hypertensive crisis | FAERS: 5 | US FAERS | |
| 435 | Immune Reconstitution Inflammatory Syndrome | FAERS: 5 | US FAERS | |
| 436 | Impaired gastric emptying | FAERS: 5 | SIDER US FAERS | |
| 437 | Impaired work ability | FAERS: 5 | US FAERS | |
| 438 | Incisional hernia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 439 | Incorrect drug administration duration | FAERS: 5 | US FAERS | |
| 440 | Interferon gamma decreased | FAERS: 5 | US FAERS | |
| 441 | Large intestine perforation | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 442 | Metastatic Neoplasm | FAERS: 5 | OFFSIDES US FAERS | |
| 443 | Multiple Myeloma | FAERS: 5 | US FAERS | |
| 444 | Mydriasis | FAERS: 5 | US FAERS | |
| 445 | Neck Pain | FAERS: 5 | SIDER US FAERS | |
| 446 | Neonatal disorder | FAERS: 5 | US FAERS | |
| 447 | Nephrocalcinosis | FAERS: 5 | 8887267 | CTD US FAERS |
| 448 | Oral candidiasis | FAERS: 5 | SIDER US FAERS | |
| 449 | Pain of skin | FAERS: 5 | US FAERS | |
| 450 | Peripheral arterial occlusive disease | FAERS: 5 | US FAERS | |
| 451 | Pneumocystis jiroveci pneumonia | FAERS: 5 | OFFSIDES US FAERS | |
| 452 | Pneumonitis | FAERS: 5 | US FAERS | |
| 453 | Polymyositis | FAERS: 5 | US FAERS | |
| 454 | Poor peripheral circulation | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 455 | Post procedural infection | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 456 | Pseudomonal sepsis | FAERS: 5 | US FAERS | |
| 457 | Psoriasis | FAERS: 5 | 15948985 | CTD US FAERS |
| 458 | Rash erythematous | FAERS: 5 | US FAERS | |
| 459 | Rehabilitation therapy | FAERS: 5 | US FAERS | |
| 460 | Renal Artery Stenosis | FAERS: 5 | US FAERS | |
| 461 | Restlessness | FAERS: 5 | US FAERS | |
| 462 | Rhinitis | FAERS: 5 | SIDER US FAERS | |
| 463 | Spinal column stenosis | FAERS: 5 | US FAERS | |
| 464 | Strabismus | FAERS: 5 | US FAERS | |
| 465 | Superinfection | FAERS: 5 | US FAERS | |
| 466 | Temperature intolerance | FAERS: 5 | SIDER US FAERS | |
| 467 | Therapeutic response unexpected | FAERS: 5 | US FAERS | |
| 468 | Therapy cessation | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 469 | Tooth Loss | FAERS: 5 | US FAERS | |
| 470 | Umbilical hernia | FAERS: 5 | US FAERS | |
| 471 | Acquired macroglossia | FAERS: 4 | US FAERS | |
| 472 | Adenoidectomy | FAERS: 4 | US FAERS | |
| 473 | Ageusia | FAERS: 4 | US FAERS | |
| 474 | Angina Pectoris | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 475 | Application site irritation | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 476 | Application site swelling | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 477 | Arterial thrombosis | FAERS: 4 | US FAERS | |
| 478 | Asphyxia | FAERS: 4 | US FAERS | |
| 479 | Atrial Flutter | FAERS: 4 | SIDER US FAERS | |
| 480 | B-cell lymphoma stage III | FAERS: 4 | US FAERS | |
| 481 | B-cell lymphoma stage I | FAERS: 4 | US FAERS | |
| 482 | Biliary Fistula | FAERS: 4 | US FAERS | |
| 483 | Blood glucose decreased | FAERS: 4 | US FAERS | |
| 484 | Bone marrow depression | FAERS: 4 | US FAERS | |
| 485 | Brain Abscess | FAERS: 4 | OFFSIDES US FAERS | |
| 486 | Cachexia | FAERS: 4 | US FAERS | |
| 487 | Coma scale abnormal | FAERS: 4 | US FAERS | |
| 488 | Complications of bone marrow transplant | FAERS: 4 | OFFSIDES US FAERS | |
| 489 | Concomitant disease aggravated | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 490 | Cyst | FAERS: 4 | SIDER US FAERS | |
| 491 | Cytomegalovirus enterocolitis | FAERS: 4 | OFFSIDES US FAERS | |
| 492 | Cytopenia | FAERS: 4 | US FAERS | |
| 493 | Depression suicidal | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 494 | Diaphragmatic Hernia | FAERS: 4 | US FAERS | |
| 495 | Diffuse alveolar damage | FAERS: 4 | US FAERS | |
| 496 | Diverticular perforation | FAERS: 4 | OFFSIDES US FAERS | |
| 497 | Drug effective for unapproved indication | FAERS: 4 | US FAERS | |
| 498 | Drug withdrawal syndrome | FAERS: 4 | US FAERS | |
| 499 | Electroencephalogram abnormal | FAERS: 4 | US FAERS | |
| 500 | Electromechanical dissociation | FAERS: 4 | US FAERS | |
| 501 | Encapsulating Peritoneal Sclerosis | FAERS: 4 | US FAERS | |
| 502 | Exposure via breast milk | FAERS: 4 | US FAERS | |
| 503 | Exposure via father | FAERS: 4 | US FAERS | |
| 504 | Febrile Neutropenia | FAERS: 4 | US FAERS | |
| 505 | Fibromyalgia | FAERS: 4 | US FAERS | |
| 506 | Formication | FAERS: 4 | US FAERS | |
| 507 | Gastrointestinal infection | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 508 | Gingival Hyperplasia | FAERS: 4 | US FAERS | |
| 509 | Gingivitis | FAERS: 4 | US FAERS | |
| 510 | Hemiplegia | FAERS: 4 | 21321342 | CTD OFFSIDES SIDER US FAERS |
| 511 | Hepatitis E | FAERS: 4 | US FAERS | |
| 512 | Hip surgery | FAERS: 4 | US FAERS | |
| 513 | Hordeolum | FAERS: 4 | US FAERS | |
| 514 | Hyperreflexia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 515 | Hypertrichosis | FAERS: 4 | US FAERS | |
| 516 | Inappropriate schedule of product administration | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 517 | Incoherent | FAERS: 4 | US FAERS | |
| 518 | Intra-abdominal fluid collection | FAERS: 4 | US FAERS | |
| 519 | Intussusception | FAERS: 4 | OFFSIDES US FAERS | |
| 520 | Joint injury | FAERS: 4 | US FAERS | |
| 521 | Left Ventricular Hypertrophy | FAERS: 4 | US FAERS | |
| 522 | Limb discomfort | FAERS: 4 | US FAERS | |
| 523 | Lip neoplasm malignant stage unspecified | FAERS: 4 | US FAERS | |
| 524 | Liver Abscess | FAERS: 4 | OFFSIDES US FAERS | |
| 525 | Lung carcinoma cell type unspecified stage I | FAERS: 4 | US FAERS | |
| 526 | Lung consolidation | FAERS: 4 | US FAERS | |
| 527 | Lymphadenitis | FAERS: 4 | US FAERS | |
| 528 | Megacolon | FAERS: 4 | US FAERS | |
| 529 | Mental disorder due to a general medical condition | FAERS: 4 | US FAERS | |
| 530 | Mood swings | FAERS: 4 | SIDER US FAERS | |
| 531 | Mucormycosis | FAERS: 4 | OFFSIDES US FAERS | |
| 532 | Muscle Rigidity | FAERS: 4 | US FAERS | |
| 533 | Muscle Spasticity | FAERS: 4 | US FAERS | |
| 534 | Musculoskeletal stiffness | FAERS: 4 | OFFSIDES US FAERS | |
| 535 | Myasthenia Gravis | FAERS: 4 | 15883336 | CTD US FAERS |
| 536 | Myoclonus | FAERS: 4 | 17564783 | CTD SIDER US FAERS |
| 537 | Neurodermatitis | FAERS: 4 | US FAERS | |
| 538 | Neutrophil count decreased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 539 | Ocular icterus | FAERS: 4 | US FAERS | |
| 540 | Osteoporosis | FAERS: 4 | SIDER US FAERS | |
| 541 | Papule | FAERS: 4 | US FAERS | |
| 542 | Pericarditis | FAERS: 4 | US FAERS | |
| 543 | Personality Change | FAERS: 4 | US FAERS | |
| 544 | Pharyngitis | FAERS: 4 | SIDER US FAERS | |
| 545 | Photophobia | FAERS: 4 | SIDER US FAERS | |
| 546 | Polyneuropathy | FAERS: 4 | US FAERS | |
| 547 | Poor quality drug administered | FAERS: 4 | US FAERS | |
| 548 | Prescribed overdose | FAERS: 4 | US FAERS | |
| 549 | Product packaging issue | FAERS: 4 | US FAERS | |
| 550 | Product taste abnormal | FAERS: 4 | US FAERS | |
| 551 | Pyelocaliectasis | FAERS: 4 | US FAERS | |
| 552 | Pyloric Stenosis | FAERS: 4 | US FAERS | |
| 553 | Quadriplegia | FAERS: 4 | SIDER US FAERS | |
| 554 | Retching | FAERS: 4 | US FAERS | |
| 555 | Retinal Detachment | FAERS: 4 | US FAERS | |
| 556 | Rosacea | FAERS: 4 | 15096374 | CTD SIDER US FAERS |
| 557 | Stevens-Johnson Syndrome | FAERS: 4 | 18698687 25811541 | CTD SIDER US FAERS |
| 558 | Stress | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 559 | Symmetrical drug-related intertriginous and flexural exanthema | FAERS: 4 | US FAERS | |
| 560 | Synovial Cyst | FAERS: 4 | US FAERS | |
| 561 | Systemic mycosis | FAERS: 4 | US FAERS | |
| 562 | Thirst | FAERS: 4 | SIDER US FAERS | |
| 563 | Tongue cancer recurrent | FAERS: 4 | US FAERS | |
| 564 | Toothache | FAERS: 4 | US FAERS | |
| 565 | Underweight | FAERS: 4 | US FAERS | |
| 566 | Unresponsive to stimuli | FAERS: 4 | US FAERS | |
| 567 | Vitamin D Deficiency | FAERS: 4 | US FAERS | |
| 568 | pseudomembranous colitis | FAERS: 4 | US FAERS | |
| 569 | Abdominal adhesions | FAERS: 3 | US FAERS | |
| 570 | Acanthamoeba Infection | FAERS: 3 | US FAERS | |
| 571 | Accidental exposure | FAERS: 3 | US FAERS | |
| 572 | Acute graft versus host disease in intestine | FAERS: 3 | OFFSIDES US FAERS | |
| 573 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 574 | Adenocarcinoma | FAERS: 3 | OFFSIDES US FAERS | |
| 575 | Amputation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 576 | Antibody test abnormal | FAERS: 3 | US FAERS | |
| 577 | Antiphospholipid Syndrome | FAERS: 3 | US FAERS | |
| 578 | Apallic syndrome | FAERS: 3 | US FAERS | |
| 579 | Aphagia | FAERS: 3 | US FAERS | |
| 580 | Apparent death | FAERS: 3 | US FAERS | |
| 581 | Application site inflammation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 582 | Application site warmth | FAERS: 3 | SIDER US FAERS | |
| 583 | Bacterial test positive | FAERS: 3 | US FAERS | |
| 584 | Bacteriuria | FAERS: 3 | US FAERS | |
| 585 | Biopsy | FAERS: 3 | US FAERS | |
| 586 | Bipolar Disorder | FAERS: 3 | US FAERS | |
| 587 | Blood amylase increased | FAERS: 3 | SIDER US FAERS | |
| 588 | Blood cholesterol increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 589 | Blood creatine increased | FAERS: 3 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 590 | Blood creatinine decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 591 | Blood potassium decreased | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 592 | Blood product transfusion dependent | FAERS: 3 | US FAERS | |
| 593 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 594 | Bone marrow transplant rejection | FAERS: 3 | US FAERS | |
| 595 | Brain scan abnormal | FAERS: 3 | US FAERS | |
| 596 | Bronchopneumonia | FAERS: 3 | US FAERS | |
| 597 | Carcinoma in Situ | FAERS: 3 | US FAERS | |
| 598 | Cavernous Sinus Thrombosis | FAERS: 3 | US FAERS | |
| 599 | Central Nervous System Infection | FAERS: 3 | US FAERS | |
| 600 | Chromaturia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 601 | Chronic sinusitis | FAERS: 3 | US FAERS | |
| 602 | Clostridium test positive | FAERS: 3 | US FAERS | |
| 603 | Colectomy | FAERS: 3 | US FAERS | |
| 604 | Convulsion in childhood | FAERS: 3 | US FAERS | |
| 605 | Cord blood transplant therapy | FAERS: 3 | US FAERS | |
| 606 | Cystic Fibrosis | FAERS: 3 | US FAERS | |
| 607 | Cytomegalovirus test positive | FAERS: 3 | OFFSIDES US FAERS | |
| 608 | Deafness Neurosensory | FAERS: 3 | SIDER US FAERS | |
| 609 | Decreased immune responsiveness | FAERS: 3 | US FAERS | |
| 610 | Dermatitis acneiform | FAERS: 3 | US FAERS | |
| 611 | Device occlusion | FAERS: 3 | US FAERS | |
| 612 | Diabetes mellitus inadequate control | FAERS: 3 | US FAERS | |
| 613 | Diabetic Nephropathy | FAERS: 3 | SIDER US FAERS | |
| 614 | Drug abuse | FAERS: 3 | US FAERS | |
| 615 | Drug exposure via breast milk | FAERS: 3 | US FAERS | |
| 616 | Dysgeusia | FAERS: 3 | SIDER US FAERS | |
| 617 | Ear tube insertion | FAERS: 3 | US FAERS | |
| 618 | Ecchymosis | FAERS: 3 | SIDER US FAERS | |
| 619 | Echolalia | FAERS: 3 | US FAERS | |
| 620 | Encephalomalacia | FAERS: 3 | US FAERS | |
| 621 | Erythema Infectiosum | FAERS: 3 | US FAERS | |
| 622 | Eyelid irritation | FAERS: 3 | US FAERS | |
| 623 | Facial paralysis | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 624 | Flatulence | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 625 | Gamma-Glutamyltransferase Increased | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 626 | Gastrointestinal obstruction | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 627 | Gaze palsy | FAERS: 3 | US FAERS | |
| 628 | Genital Herpes | FAERS: 3 | US FAERS | |
| 629 | Hepatic Infarction | FAERS: 3 | US FAERS | |
| 630 | Hepatic vein occlusion | FAERS: 3 | US FAERS | |
| 631 | Hepatitis B Virus | FAERS: 3 | US FAERS | |
| 632 | Hypermetabolism | FAERS: 3 | US FAERS | |
| 633 | Idiosyncratic drug reaction | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 634 | Immobile | FAERS: 3 | US FAERS | |
| 635 | Incontinence | FAERS: 3 | US FAERS | |
| 636 | Infected epidermal cyst | FAERS: 3 | US FAERS | |
| 637 | Infectious Mononucleosis | FAERS: 3 | US FAERS | |
| 638 | Infectious colitis | FAERS: 3 | US FAERS | |
| 639 | Intentional dose omission | FAERS: 3 | US FAERS | |
| 640 | Intestinal resection | FAERS: 3 | US FAERS | |
| 641 | Intracranial Hypotension | FAERS: 3 | US FAERS | |
| 642 | Intracranial mass | FAERS: 3 | US FAERS | |
| 643 | Ketoacidosis | FAERS: 3 | US FAERS | |
| 644 | Laryngitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 645 | Lichen Planus | FAERS: 3 | 15284791 21951348 | CTD US FAERS |
| 646 | Lip and/or oral cavity cancer | FAERS: 3 | US FAERS | |
| 647 | Liver graft loss | FAERS: 3 | US FAERS | |
| 648 | Loss of personal independence in daily activities | FAERS: 3 | US FAERS | |
| 649 | Lower respiratory tract infection | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 650 | Lupus Nephritis | FAERS: 3 Canada Vigilance: 1 | 17283585 | CTD Canada Vigilance US FAERS |
| 651 | Mediastinitis | FAERS: 3 | US FAERS | |
| 652 | Medical device complication | FAERS: 3 | US FAERS | |
| 653 | Megakaryocytes increased | FAERS: 3 | US FAERS | |
| 654 | Meniscus injury | FAERS: 3 | US FAERS | |
| 655 | Menorrhagia | FAERS: 3 | US FAERS | |
| 656 | Metastasis | FAERS: 3 | US FAERS | |
| 657 | Myocarditis | FAERS: 3 | US FAERS | |
| 658 | Myopathy | FAERS: 3 | US FAERS | |
| 659 | Nephritis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 660 | Neuroblastoma | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 661 | Neuropsychological test abnormal | FAERS: 3 | US FAERS | |
| 662 | Neutrophil Pelger-Huet anomaly present | FAERS: 3 | US FAERS | |
| 663 | Nonspecific reaction | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 664 | Nystagmus | FAERS: 3 | SIDER US FAERS | |
| 665 | Obesity | FAERS: 3 | US FAERS | |
| 666 | Onychomycosis | FAERS: 3 | US FAERS | |
| 667 | Oral pain | FAERS: 3 | US FAERS | |
| 668 | Otitis Media | FAERS: 3 | SIDER US FAERS | |
| 669 | Palpable purpura | FAERS: 3 | US FAERS | |
| 670 | Peripheral artery thrombosis | FAERS: 3 | US FAERS | |
| 671 | Peripheral embolism | FAERS: 3 | US FAERS | |
| 672 | Petechiae | FAERS: 3 | US FAERS | |
| 673 | Pharmaceutical product complaint | FAERS: 3 | US FAERS | |
| 674 | Phlebitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 675 | Pneumococcal sepsis | FAERS: 3 | US FAERS | |
| 676 | Poisoning | FAERS: 3 | US FAERS | |
| 677 | Polyserositis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 678 | Post procedural urine leak | FAERS: 3 | US FAERS | |
| 679 | Post-Traumatic Stress Disorder | FAERS: 3 | US FAERS | |
| 680 | Product container seal issue | FAERS: 3 | US FAERS | |
| 681 | Product label confusion | FAERS: 3 | US FAERS | |
| 682 | Productive Cough | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 683 | Prurigo | FAERS: 3 | US FAERS | |
| 684 | Removal of transplanted organ | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 685 | Renal Cell Carcinoma | FAERS: 3 | US FAERS | |
| 686 | Renal abscess | FAERS: 3 | US FAERS | |
| 687 | Renal artery occlusion | FAERS: 3 | US FAERS | |
| 688 | Renal tubular disorder | FAERS: 3 | OFFSIDES US FAERS | |
| 689 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 690 | Retinal Vein Occlusion | FAERS: 3 | US FAERS | |
| 691 | Rotator cuff syndrome | FAERS: 3 | US FAERS | |
| 692 | Single functional kidney | FAERS: 3 | US FAERS | |
| 693 | Skin Erosion | FAERS: 3 | US FAERS | |
| 694 | Skin necrosis | FAERS: 3 | US FAERS | |
| 695 | Soft tissue swelling | FAERS: 3 | US FAERS | |
| 696 | Stenotrophomonas infection | FAERS: 3 | OFFSIDES US FAERS | |
| 697 | Subcutaneous nodule | FAERS: 3 | OFFSIDES US FAERS | |
| 698 | Supraventricular tachycardia | FAERS: 3 | SIDER US FAERS | |
| 699 | Suture rupture | FAERS: 3 | US FAERS | |
| 700 | Therapeutic procedure | FAERS: 3 | US FAERS | |
| 701 | Therapeutic product ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 702 | Thermal burn | FAERS: 3 | US FAERS | |
| 703 | Thrombosis in device | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 704 | Thyroidectomy | FAERS: 3 | US FAERS | |
| 705 | Tinea Pedis | FAERS: 3 | US FAERS | |
| 706 | Tooth Extraction | FAERS: 3 | US FAERS | |
| 707 | Tuberculosis | FAERS: 3 | US FAERS | |
| 708 | Ulcer | FAERS: 3 | SIDER US FAERS | |
| 709 | Upper respiratory tract inflammation | FAERS: 3 | US FAERS | |
| 710 | Urinary tract infection fungal | FAERS: 3 | OFFSIDES US FAERS | |
| 711 | Urinary tract obstruction | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 712 | VIIth nerve paralysis | FAERS: 3 | US FAERS | |
| 713 | Wrong drug administered | FAERS: 3 | US FAERS | |
| 714 | skin abrasion | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 715 | Abdominal mass | FAERS: 2 | US FAERS | |
| 716 | Abdominal symptom | FAERS: 2 | US FAERS | |
| 717 | Abscess soft tissue | FAERS: 2 | US FAERS | |
| 718 | Acanthosis | FAERS: 2 | US FAERS | |
| 719 | Acute right ventricular failure | FAERS: 2 | US FAERS | |
| 720 | Aeromonas test positive | FAERS: 2 | US FAERS | |
| 721 | Alcaligenes infection | FAERS: 2 | US FAERS | |
| 722 | Alcohol poisoning | FAERS: 2 | US FAERS | |
| 723 | Anastomotic complication | FAERS: 2 | US FAERS | |
| 724 | Anastomotic stenosis | FAERS: 2 | US FAERS | |
| 725 | Animal bite | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 726 | Anosmia | FAERS: 2 | US FAERS | |
| 727 | Aortic Rupture | FAERS: 2 | US FAERS | |
| 728 | Aortic Valve Stenosis | FAERS: 2 | US FAERS | |
| 729 | Application site burn | FAERS: 2 | SIDER US FAERS | |
| 730 | Application site rash | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 731 | Arterial Injury | FAERS: 2 | US FAERS | |
| 732 | Arteriovenous fistula thrombosis | FAERS: 2 | US FAERS | |
| 733 | Arthropathy | FAERS: 2 | SIDER US FAERS | |
| 734 | Asterixis | FAERS: 2 | US FAERS | |
| 735 | Asthenopia | FAERS: 2 | US FAERS | |
| 736 | Autoimmune Lymphoproliferative Syndrome | FAERS: 2 | US FAERS | |
| 737 | Axonal neuropathy | FAERS: 2 | US FAERS | |
| 738 | Bacillus infection | FAERS: 2 | US FAERS | |
| 739 | Bacterial disease carrier | FAERS: 2 | US FAERS | |
| 740 | Benign Prostatic Hyperplasia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 741 | Bicytopenia | FAERS: 2 | US FAERS | |
| 742 | Biliary tract infection | FAERS: 2 | US FAERS | |
| 743 | Biloma | FAERS: 2 | US FAERS | |
| 744 | Biopsy kidney abnormal | FAERS: 2 | US FAERS | |
| 745 | Biopsy liver abnormal | FAERS: 2 | US FAERS | |
| 746 | Blepharospasm | FAERS: 2 | US FAERS | |
| 747 | Blood albumin increased | FAERS: 2 | US FAERS | |
| 748 | Blood creatine abnormal | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 749 | Blood creatine phosphokinase MB increased | FAERS: 2 | US FAERS | |
| 750 | Blood electrolytes abnormal | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 751 | Blood glucose abnormal | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 752 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 753 | Blood triglycerides increased | FAERS: 2 | SIDER US FAERS | |
| 754 | Bone marrow reticulin fibrosis | FAERS: 2 | US FAERS | |
| 755 | Bradykinesia | FAERS: 2 | US FAERS | |
| 756 | Breech Presentation | FAERS: 2 | US FAERS | |
| 757 | Bronchospasm | FAERS: 2 | US FAERS | |
| 758 | Budd-Chiari Syndrome | FAERS: 2 | US FAERS | |
| 759 | Calcinosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 760 | Carotid artery occlusion | FAERS: 2 | US FAERS | |
| 761 | Cataract operation | FAERS: 2 | US FAERS | |
| 762 | Cerebral ventricle dilatation | FAERS: 2 | US FAERS | |
| 763 | Cervical dysplasia | FAERS: 2 | US FAERS | |
| 764 | Chronic graft versus host disease in intestine | FAERS: 2 | US FAERS | |
| 765 | Chronic graft versus host disease in liver | FAERS: 2 | US FAERS | |
| 766 | Chronic tonsillitis | FAERS: 2 | US FAERS | |
| 767 | Complication associated with device | FAERS: 2 | US FAERS | |
| 768 | Complications of maternal exposure to therapeutic drugs | FAERS: 2 | US FAERS | |
| 769 | Congenital hydronephrosis | FAERS: 2 | US FAERS | |
| 770 | Conjunctivitis | FAERS: 2 | SIDER US FAERS | |
| 771 | Counterfeit product administered | FAERS: 2 | US FAERS | |
| 772 | Croup infectious | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 773 | Cytomegalovirus antigen positive | FAERS: 2 | US FAERS | |
| 774 | Cytomegalovirus gastrointestinal infection | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 775 | Dactylitis | FAERS: 2 | US FAERS | |
| 776 | Demodicidosis | FAERS: 2 | US FAERS | |
| 777 | Dermatophytosis | FAERS: 2 | US FAERS | |
| 778 | Diabetic Retinopathy | FAERS: 2 | US FAERS | |
| 779 | Diabetic blindness | FAERS: 2 | US FAERS | |
| 780 | Diplegia | FAERS: 2 | US FAERS | |
| 781 | Diverticulum | FAERS: 2 | OFFSIDES US FAERS | |
| 782 | Drug administered at inappropriate site | FAERS: 2 | US FAERS | |
| 783 | Drug administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 784 | Duodenal Ulcer | FAERS: 2 | 17202747 | CTD US FAERS |
| 785 | Dural abscess | FAERS: 2 | US FAERS | |
| 786 | Dysgraphia | FAERS: 2 | SIDER US FAERS | |
| 787 | Dysmorphism | FAERS: 2 | US FAERS | |
| 788 | Dysphasia | FAERS: 2 | US FAERS | |
| 789 | Dysphemia | FAERS: 2 | US FAERS | |
| 790 | Dystrophic calcification | FAERS: 2 | US FAERS | |
| 791 | Ear discomfort | FAERS: 2 | US FAERS | |
| 792 | Eczema impetiginous | FAERS: 2 | US FAERS | |
| 793 | Embolism | FAERS: 2 | US FAERS | |
| 794 | Emergency Care | FAERS: 2 | US FAERS | |
| 795 | Engraftment syndrome | FAERS: 2 | OFFSIDES US FAERS | |
| 796 | Enteritis | FAERS: 2 | US FAERS | |
| 797 | Enterocutaneous Fistula | FAERS: 2 | US FAERS | |
| 798 | Epstein-Barr virus test positive | FAERS: 2 | US FAERS | |
| 799 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 800 | Erysipelas | FAERS: 2 | US FAERS | |
| 801 | Erythema Nodosum | FAERS: 2 | US FAERS | |
| 802 | Exophthalmos | FAERS: 2 | US FAERS | |
| 803 | Extranodal marginal zone B-cell lymphoma (MALT type) | FAERS: 2 | US FAERS | |
| 804 | Eye inflammation | FAERS: 2 | US FAERS | |
| 805 | Eyelid pain | FAERS: 2 | US FAERS | |
| 806 | Facial Pain | FAERS: 2 | US FAERS | |
| 807 | Factor V Leiden mutation | FAERS: 2 | US FAERS | |
| 808 | Feeding disorder of infancy OR early childhood | FAERS: 2 | US FAERS | |
| 809 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 810 | Fibrin D dimer increased | FAERS: 2 | US FAERS | |
| 811 | Fibrosis | FAERS: 2 | 14620542 | CTD US FAERS |
| 812 | Flank Pain | FAERS: 2 | US FAERS | |
| 813 | Freezing phenomenon | FAERS: 2 | US FAERS | |
| 814 | Full blood count abnormal | FAERS: 2 | US FAERS | |
| 815 | Gamma-glutamyltransferase abnormal | FAERS: 2 | US FAERS | |
| 816 | Gastric Dilatation | FAERS: 2 | US FAERS | |
| 817 | Gastroenteritis norovirus | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 818 | Gastrointestinal carcinoma | FAERS: 2 | US FAERS | |
| 819 | Gastrostomy | FAERS: 2 | US FAERS | |
| 820 | Gingival Hypertrophy | FAERS: 2 | US FAERS | |
| 821 | Graft infection | FAERS: 2 | US FAERS | |
| 822 | Graft versus host disease in intestine | FAERS: 2 | US FAERS | |
| 823 | Granulomatous liver disease | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 824 | Hallucinations, mixed | FAERS: 2 | US FAERS | |
| 825 | Hepatic Infection | FAERS: 2 | US FAERS | |
| 826 | Hepatic artery occlusion | FAERS: 2 | US FAERS | |
| 827 | Hepatic artery stenosis | FAERS: 2 | OFFSIDES US FAERS | |
| 828 | Hepatic congestion | FAERS: 2 | US FAERS | |
| 829 | Hepatic vein stenosis | FAERS: 2 | US FAERS | |
| 830 | Hepatitis C virus | FAERS: 2 | US FAERS | |
| 831 | Hospice Care | FAERS: 2 | US FAERS | |
| 832 | Human polyomavirus infection | FAERS: 2 | US FAERS | |
| 833 | Hunger | FAERS: 2 | US FAERS | |
| 834 | Hypercapnia | FAERS: 2 | OFFSIDES US FAERS | |
| 835 | Hyperkeratosis | FAERS: 2 | OFFSIDES US FAERS | |
| 836 | Hypersomnia | FAERS: 2 | US FAERS | |
| 837 | Hypersplenism | FAERS: 2 | US FAERS | |
| 838 | Hyperventilation | FAERS: 2 | OFFSIDES US FAERS | |
| 839 | Hypoperfusion | FAERS: 2 | US FAERS | |
| 840 | Incorrect drug dosage form administered | FAERS: 2 | US FAERS | |
| 841 | Incorrect product formulation administered | FAERS: 2 | US FAERS | |
| 842 | Increased viscosity of bronchial secretion | FAERS: 2 | US FAERS | |
| 843 | Infected fistula | FAERS: 2 | US FAERS | |
| 844 | Infection in an immunocompromised host | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 845 | Inferior vena cava dilatation | FAERS: 2 | US FAERS | |
| 846 | Initial insomnia | FAERS: 2 | US FAERS | |
| 847 | Insurance issue | FAERS: 2 | US FAERS | |
| 848 | Intercapillary glomerulosclerosis | FAERS: 2 | US FAERS | |
| 849 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 850 | Intercepted drug prescribing error | FAERS: 2 | US FAERS | |
| 851 | Intestinal adenocarcinoma | FAERS: 2 | OFFSIDES US FAERS | |
| 852 | Intestinal transplant | FAERS: 2 | US FAERS | |
| 853 | Keratoconus | FAERS: 2 | US FAERS | |
| 854 | Laceration | FAERS: 2 | OFFSIDES US FAERS | |
| 855 | Laparotomy | FAERS: 2 | US FAERS | |
| 856 | Limb operation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 857 | Lipase increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 858 | Livedo Reticularis | FAERS: 2 | US FAERS | |
| 859 | Localised intraabdominal fluid collection | FAERS: 2 | US FAERS | |
| 860 | Lower respiratory tract infection bacterial | FAERS: 2 | US FAERS | |
| 861 | Lymphocyte count decreased | FAERS: 2 | US FAERS | |
| 862 | Lymphohistiocytosis | FAERS: 2 | US FAERS | |
| 863 | Lymphoid tissue hyperplasia | FAERS: 2 | US FAERS | |
| 864 | Malignant melanoma in situ | FAERS: 2 | US FAERS | |
| 865 | Maternal exposure during breast feeding | FAERS: 2 | US FAERS | |
| 866 | Maxillofacial operation | FAERS: 2 | US FAERS | |
| 867 | Meconium Aspiration Syndrome | FAERS: 2 | US FAERS | |
| 868 | Meningomyelocele | FAERS: 2 | US FAERS | |
| 869 | Mesothelioma | FAERS: 2 | US FAERS | |
| 870 | Metaplasia | FAERS: 2 | US FAERS | |
| 871 | Middle insomnia | FAERS: 2 | US FAERS | |
| 872 | Mole excision | FAERS: 2 | US FAERS | |
| 873 | Mononucleosis syndrome | FAERS: 2 | US FAERS | |
| 874 | Monoplegia | FAERS: 2 | US FAERS | |
| 875 | Muscle strain | FAERS: 2 | US FAERS | |
| 876 | Neonatal aspiration | FAERS: 2 | US FAERS | |
| 877 | Neonatal respiratory distress | FAERS: 2 | US FAERS | |
| 878 | Nephrectomy | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 879 | Nephroblastoma | FAERS: 2 | US FAERS | |
| 880 | Nephrogenic Diabetes Insipidus | FAERS: 2 | US FAERS | |
| 881 | Nerve injury | FAERS: 2 | SIDER US FAERS | |
| 882 | Neuralgia | FAERS: 2 Canada Vigilance: 2 | 16787880 18227327 18306017 | CTD SIDER Canada Vigilance US FAERS |
| 883 | Neurological decompensation | FAERS: 2 | US FAERS | |
| 884 | Nodule | FAERS: 2 | OFFSIDES US FAERS | |
| 885 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 886 | Oral mucosal erythema | FAERS: 2 | US FAERS | |
| 887 | Overweight | FAERS: 2 | US FAERS | |
| 888 | Pancreas islet cell transplant | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 889 | Pancreatic Insufficiency | FAERS: 2 | US FAERS | |
| 890 | Pancreatic enzymes increased | FAERS: 2 | US FAERS | |
| 891 | Paracentesis | FAERS: 2 | US FAERS | |
| 892 | Paraplegia | FAERS: 2 | OFFSIDES US FAERS | |
| 893 | Parathyroidectomy | FAERS: 2 | US FAERS | |
| 894 | Parotitis | FAERS: 2 | US FAERS | |
| 895 | Peliosis Hepatis | FAERS: 2 | US FAERS | |
| 896 | Pelvic cyst | FAERS: 2 | US FAERS | |
| 897 | Perinephric collection | FAERS: 2 | US FAERS | |
| 898 | Peripheral motor neuropathy | FAERS: 2 | US FAERS | |
| 899 | Pharyngotonsillitis | FAERS: 2 | US FAERS | |
| 900 | Plasmacytoma | FAERS: 2 | US FAERS | |
| 901 | Plasminogen activator inhibitor increased | FAERS: 2 | US FAERS | |
| 902 | Polyhydramnios | FAERS: 2 | US FAERS | |
| 903 | Polyuria | FAERS: 2 | US FAERS | |
| 904 | Poor quality product administered | FAERS: 2 | US FAERS | |
| 905 | Postoperative infection | FAERS: 2 | US FAERS | |
| 906 | Precancerous cells present | FAERS: 2 | US FAERS | |
| 907 | Product administered at inappropriate site | FAERS: 2 | US FAERS | |
| 908 | Product administration error | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 909 | Product dosage form issue | FAERS: 2 | US FAERS | |
| 910 | Product measured potency issue | FAERS: 2 | US FAERS | |
| 911 | Product preparation error | FAERS: 2 | US FAERS | |
| 912 | Product prescribing error | FAERS: 2 | US FAERS | |
| 913 | Product prescribing issue | FAERS: 2 | US FAERS | |
| 914 | Product solubility abnormal | FAERS: 2 | US FAERS | |
| 915 | Protein urine present | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 916 | Pseudobulbar Palsy | FAERS: 2 | US FAERS | |
| 917 | Psychiatric symptom | FAERS: 2 | US FAERS | |
| 918 | Pulmonary artery thrombosis | FAERS: 2 | US FAERS | |
| 919 | Pulmonary congestion | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 920 | Pulmonary function test decreased | FAERS: 2 | SIDER US FAERS | |
| 921 | Pulmonary granuloma | FAERS: 2 | US FAERS | |
| 922 | Purpura | FAERS: 2 | US FAERS | |
| 923 | Purulence | FAERS: 2 | US FAERS | |
| 924 | Pyonephrosis | FAERS: 2 | US FAERS | |
| 925 | Quadriparesis | FAERS: 2 | SIDER US FAERS | |
| 926 | Quality of life decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 927 | Radiation skin injury | FAERS: 2 | US FAERS | |
| 928 | Radiculopathy | FAERS: 2 | US FAERS | |
| 929 | Renal and pancreas transplant rejection | FAERS: 2 | US FAERS | |
| 930 | Renal aneurysm | FAERS: 2 | US FAERS | |
| 931 | Renal salt-wasting syndrome | FAERS: 2 | OFFSIDES US FAERS | |
| 932 | Rheumatic disorder | FAERS: 2 | US FAERS | |
| 933 | Right Ventricular Dysfunction | FAERS: 2 | US FAERS | |
| 934 | Sarcoidosis | FAERS: 2 | US FAERS | |
| 935 | Scleritis | FAERS: 2 | US FAERS | |
| 936 | Scleroderma renal crisis | FAERS: 2 | US FAERS | |
| 937 | Serratia sepsis | FAERS: 2 | US FAERS | |
| 938 | Silicon granuloma | FAERS: 2 | US FAERS | |
| 939 | Skin neoplasm excision | FAERS: 2 | US FAERS | |
| 940 | Slow speech | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 941 | Sluggishness | FAERS: 2 | US FAERS | |
| 942 | Small intestine carcinoma | FAERS: 2 | US FAERS | |
| 943 | Smooth muscle cell neoplasm | FAERS: 2 | US FAERS | |
| 944 | Soft Tissue Infection | FAERS: 2 | US FAERS | |
| 945 | Splenic vein thrombosis | FAERS: 2 | US FAERS | |
| 946 | Sunburn | FAERS: 2 | SIDER US FAERS | |
| 947 | Superficial siderosis of central nervous system | FAERS: 2 | US FAERS | |
| 948 | Syndactyly | FAERS: 2 | US FAERS | |
| 949 | Systemic bacterial infection | FAERS: 2 | US FAERS | |
| 950 | Systolic hypertension | FAERS: 2 | US FAERS | |
| 951 | Tardive Dyskinesia | FAERS: 2 | US FAERS | |
| 952 | Terminal state | FAERS: 2 | US FAERS | |
| 953 | Therapeutic product effect incomplete | FAERS: 2 | US FAERS | |
| 954 | Therapeutic response unexpected with drug substitution | FAERS: 2 | US FAERS | |
| 955 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 956 | Throat cancer | FAERS: 2 | US FAERS | |
| 957 | Toxic Epidermal Necrolysis | FAERS: 2 | SIDER US FAERS | |
| 958 | Toxic Optic Neuropathy | FAERS: 2 | US FAERS | |
| 959 | Toxoplasmosis | FAERS: 2 | US FAERS | |
| 960 | Transaminases abnormal | FAERS: 2 | US FAERS | |
| 961 | Urinary Incontinence | FAERS: 2 | SIDER US FAERS | |
| 962 | Urine osmolarity decreased | FAERS: 2 | US FAERS | |
| 963 | Uveitis | FAERS: 2 | US FAERS | |
| 964 | Vascular Hyalinosis | FAERS: 2 | US FAERS | |
| 965 | Vascular graft complication | FAERS: 2 | US FAERS | |
| 966 | Venoocclusive disease | FAERS: 2 | OFFSIDES US FAERS | |
| 967 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 968 | Venous occlusion | FAERS: 2 | US FAERS | |
| 969 | Viral DNA test positive | FAERS: 2 | US FAERS | |
| 970 | Viral mutation identified | FAERS: 2 | US FAERS | |
| 971 | Vulvovaginal burning sensation | FAERS: 2 | US FAERS | |
| 972 | West Nile viral infection | FAERS: 2 | US FAERS | |
| 973 | Wrong patient received medication | FAERS: 2 | US FAERS | |
| 974 | effusion | FAERS: 2 | US FAERS | |
| 975 | intensive care | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 976 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 977 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 978 | Abdominal tenderness | FAERS: 1 | OFFSIDES US FAERS | |
| 979 | Abdominal wall cyst | FAERS: 1 | US FAERS | |
| 980 | Abscess fungal | FAERS: 1 | US FAERS | |
| 981 | Abulia | FAERS: 1 | US FAERS | |
| 982 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 983 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 984 | Acute Coronary Syndrome | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 985 | Acute hepatitis C | FAERS: 1 | US FAERS | |
| 986 | Acute left ventricular failure | FAERS: 1 | US FAERS | |
| 987 | Acute tonsillitis | FAERS: 1 | US FAERS | |
| 988 | Adactyly | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 989 | Adenoiditis | FAERS: 1 | US FAERS | |
| 990 | Adrenal mass | FAERS: 1 | US FAERS | |
| 991 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 992 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 993 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 994 | Alopecia totalis | FAERS: 1 | US FAERS | |
| 995 | Alternaria infection | FAERS: 1 | US FAERS | |
| 996 | Amniotic Band Syndrome | FAERS: 1 | US FAERS | |
| 997 | Amniotic fluid volume decreased | FAERS: 1 | US FAERS | |
| 998 | Amylase increased | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 999 | Anal Fistula | FAERS: 1 | US FAERS | |
| 1000 | Anal abscess | FAERS: 1 | US FAERS | |
| 1001 | Anger | FAERS: 1 | US FAERS | |
| 1002 | Angiomyolipoma | FAERS: 1 | US FAERS | |
| 1003 | Angiotensin II increased | FAERS: 1 | US FAERS | |
| 1004 | Anogenital dysplasia | FAERS: 1 | US FAERS | |
| 1005 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 1006 | Anoxic Encephalopathy | FAERS: 1 | US FAERS | |
| 1007 | Anti factor V antibody positive | FAERS: 1 | US FAERS | |
| 1008 | Anti-neutrophil cytoplasmic antibody positive vasculitis | FAERS: 1 | US FAERS | |
| 1009 | Antibody test positive | FAERS: 1 | US FAERS | |
| 1010 | Antifungal treatment | FAERS: 1 | US FAERS | |
| 1011 | Antiphospholipid Antibodies | FAERS: 1 | US FAERS | |
| 1012 | Aphonia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1013 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 1014 | Application site discomfort | FAERS: 1 | US FAERS | |
| 1015 | Application site erosion | FAERS: 1 | US FAERS | |
| 1016 | Application site excoriation | FAERS: 1 | US FAERS | |
| 1017 | Application site fissure | FAERS: 1 | US FAERS | |
| 1018 | Application site scab | FAERS: 1 | US FAERS | |
| 1019 | Application site vesicles | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 1020 | Arteriovenous fistula aneurysm | FAERS: 1 | US FAERS | |
| 1021 | Arteriovenous fistula site complication | FAERS: 1 | OFFSIDES US FAERS | |
| 1022 | Arteriovenous fistula | FAERS: 1 | US FAERS | |
| 1023 | Arthrodesis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1024 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 1025 | Autoimmune neutropenia | FAERS: 1 | US FAERS | |
| 1026 | Autologous bone marrow transplantation therapy | FAERS: 1 | US FAERS | |
| 1027 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 1028 | Autosomal chromosome anomaly | FAERS: 1 | US FAERS | |
| 1029 | Axillary vein thrombosis | FAERS: 1 | US FAERS | |
| 1030 | Azoospermia | FAERS: 1 | US FAERS | |
| 1031 | Babesiosis | FAERS: 1 | US FAERS | |
| 1032 | Bacterial pyelonephritis | FAERS: 1 | US FAERS | |
| 1033 | Balanoposthitis | FAERS: 1 | US FAERS | |
| 1034 | Benign Neoplasm | FAERS: 1 | US FAERS | |
| 1035 | Benzodiazepine drug level | FAERS: 1 | US FAERS | |
| 1036 | Beta 2 microglobulin increased | FAERS: 1 | US FAERS | |
| 1037 | Bicuspid aortic valve | FAERS: 1 | US FAERS | |
| 1038 | Bile duct cancer recurrent | FAERS: 1 | US FAERS | |
| 1039 | Bile duct stent insertion | FAERS: 1 | US FAERS | |
| 1040 | Biliary sepsis | FAERS: 1 | US FAERS | |
| 1041 | Biopsy bone marrow abnormal | FAERS: 1 | US FAERS | |
| 1042 | Biopsy brain abnormal | FAERS: 1 | US FAERS | |
| 1043 | Biopsy cervix abnormal | FAERS: 1 | US FAERS | |
| 1044 | Biopsy heart abnormal | FAERS: 1 | US FAERS | |
| 1045 | Biopsy site unspecified abnormal | FAERS: 1 | US FAERS | |
| 1046 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 1047 | Blepharitis | FAERS: 1 | SIDER US FAERS | |
| 1048 | Blood Pressure | FAERS: 1 | US FAERS | |
| 1049 | Blood aldosterone decreased | FAERS: 1 | US FAERS | |
| 1050 | Blood blister | FAERS: 1 | US FAERS | |
| 1051 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 1052 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 1053 | Blood count abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1054 | Blood fibrinogen increased | FAERS: 1 | US FAERS | |
| 1055 | Blood folate decreased | FAERS: 1 | US FAERS | |
| 1056 | Blood immunoglobulin G | FAERS: 1 | US FAERS | |
| 1057 | Blood immunoglobulin G abnormal | FAERS: 1 | US FAERS | |
| 1058 | Blood immunoglobulin G decreased | FAERS: 1 | US FAERS | |
| 1059 | Blood immunoglobulin G increased | FAERS: 1 | US FAERS | |
| 1060 | Blood iron decreased | FAERS: 1 | SIDER US FAERS | |
| 1061 | Blood magnesium abnormal | FAERS: 1 | US FAERS | |
| 1062 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 1063 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 1064 | Blood sodium increased | FAERS: 1 | OFFSIDES US FAERS | |
| 1065 | Blood stem cell transplant failure | FAERS: 1 | US FAERS | |
| 1066 | Blood testosterone increased | FAERS: 1 | US FAERS | |
| 1067 | Blood urine present | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1068 | Bone lesion | FAERS: 1 | US FAERS | |
| 1069 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 1070 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 1071 | Breast Cyst | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1072 | Breast hyperplasia | FAERS: 1 | US FAERS | |
| 1073 | Breathing-related sleep disorder | FAERS: 1 | US FAERS | |
| 1074 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 1075 | Bronchial anastomosis complication | FAERS: 1 | US FAERS | |
| 1076 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 1077 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 1078 | Brucellosis | FAERS: 1 | US FAERS | |
| 1079 | Bruxism | FAERS: 1 | US FAERS | |
| 1080 | Bullous impetigo | FAERS: 1 | SIDER US FAERS | |
| 1081 | Bullous lung disease | FAERS: 1 | US FAERS | |
| 1082 | Bursitis | FAERS: 1 | SIDER US FAERS | |
| 1083 | CD4 Lymphocytes Decreased | FAERS: 1 | US FAERS | |
| 1084 | Calciphylaxis | FAERS: 1 | US FAERS | |
| 1085 | Calcium deficiency | FAERS: 1 | US FAERS | |
| 1086 | Capsule physical issue | FAERS: 1 | US FAERS | |
| 1087 | Carbon Monoxide Poisoning | FAERS: 1 | US FAERS | |
| 1088 | Carbon dioxide abnormal | FAERS: 1 | US FAERS | |
| 1089 | Carcinoma | FAERS: 1 | US FAERS | |
| 1090 | Cardiac Death | FAERS: 1 | US FAERS | |
| 1091 | Cardiac Hypertrophy | FAERS: 1 | SIDER US FAERS | |
| 1092 | Cardiac function disturbance postoperative | FAERS: 1 | US FAERS | |
| 1093 | Cardiac granuloma | FAERS: 1 | US FAERS | |
| 1094 | Cardiac procedure complication | FAERS: 1 | US FAERS | |
| 1095 | Cardiac pseudoaneurysm | FAERS: 1 | US FAERS | |
| 1096 | Carditis | FAERS: 1 | US FAERS | |
| 1097 | Catheter placement | FAERS: 1 | OFFSIDES US FAERS | |
| 1098 | Catheter related complication | FAERS: 1 | US FAERS | |
| 1099 | Catheter site related reaction | FAERS: 1 | US FAERS | |
| 1100 | Cellulitis of male external genital organ | FAERS: 1 | US FAERS | |
| 1101 | Central line infection | FAERS: 1 | US FAERS | |
| 1102 | Cerebellar Ataxia | FAERS: 1 | 16530436 | CTD OFFSIDES US FAERS |
| 1103 | Cerebellar infarction | FAERS: 1 | OFFSIDES US FAERS | |
| 1104 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 1105 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 1106 | Cerebral aspergillosis | FAERS: 1 | US FAERS | |
| 1107 | Cerebral calcification | FAERS: 1 | US FAERS | |
| 1108 | Cerebral vasoconstriction | FAERS: 1 | US FAERS | |
| 1109 | Cerebrovascular stenosis | FAERS: 1 | US FAERS | |
| 1110 | Cheilitis | FAERS: 1 | US FAERS | |
| 1111 | Chemical burns of eye | FAERS: 1 | US FAERS | |
| 1112 | Chemotherapeutic drug level increased | FAERS: 1 | OFFSIDES US FAERS | |
| 1113 | Chemotherapy | FAERS: 1 | US FAERS | |
| 1114 | Chimerism | FAERS: 1 | US FAERS | |
| 1115 | Choking sensation | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 1116 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 1117 | Chromatopsia | FAERS: 1 | US FAERS | |
| 1118 | Chronic respiratory failure | FAERS: 1 | US FAERS | |
| 1119 | Chylothorax | FAERS: 1 | US FAERS | |
| 1120 | Cleft Palate | FAERS: 1 | US FAERS | |
| 1121 | Clonus | FAERS: 1 | US FAERS | |
| 1122 | Cluster Headache | FAERS: 1 | US FAERS | |
| 1123 | Coccidioidomycosis | FAERS: 1 | OFFSIDES US FAERS | |
| 1124 | Colonic fistula | FAERS: 1 | US FAERS | |
| 1125 | Completed Suicide | FAERS: 1 | US FAERS | |
| 1126 | Concomitant disease progression | FAERS: 1 | US FAERS | |
| 1127 | Congenital diaphragmatic hernia | FAERS: 1 | US FAERS | |
| 1128 | Congenital renal cyst | FAERS: 1 | US FAERS | |
| 1129 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 1130 | Corneal erosion | FAERS: 1 | US FAERS | |
| 1131 | Corneal irritation | FAERS: 1 | US FAERS | |
| 1132 | Coronary angioplasty | FAERS: 1 | US FAERS | |
| 1133 | Craniofacial deformity | FAERS: 1 | US FAERS | |
| 1134 | Crying | FAERS: 1 | US FAERS | |
| 1135 | Cryptococcal cutaneous infection | FAERS: 1 | US FAERS | |
| 1136 | Culture positive | FAERS: 1 | OFFSIDES US FAERS | |
| 1137 | Cutaneous nocardiosis | FAERS: 1 | US FAERS | |
| 1138 | Cutaneous sarcoidosis | FAERS: 1 | US FAERS | |
| 1139 | Cyst removal | FAERS: 1 | US FAERS | |
| 1140 | Cytomegalovirus duodenitis | FAERS: 1 | US FAERS | |
| 1141 | Cytomegalovirus gastroenteritis | FAERS: 1 | OFFSIDES US FAERS | |
| 1142 | Dacryocystorhinostomy | FAERS: 1 | US FAERS | |
| 1143 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 1144 | Developmental Coordination Disorder | FAERS: 1 | US FAERS | |
| 1145 | Device malfunction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1146 | Device related sepsis | FAERS: 1 | US FAERS | |
| 1147 | Diabetic ulcer | FAERS: 1 | US FAERS | |
| 1148 | Dialysis disequilibrium syndrome | FAERS: 1 | US FAERS | |
| 1149 | Diffuse vasculitis | FAERS: 1 | US FAERS | |
| 1150 | Dose calculation error | FAERS: 1 | US FAERS | |
| 1151 | Drug Dependence | FAERS: 1 | US FAERS | |
| 1152 | Drug clearance decreased | FAERS: 1 | US FAERS | |
| 1153 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 1154 | Drug resistance | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1155 | Duodenitis | FAERS: 1 | SIDER US FAERS | |
| 1156 | Dyspareunia | FAERS: 1 | US FAERS | |
| 1157 | Dysphonia | FAERS: 1 | US FAERS | |
| 1158 | Dysplasia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1159 | Dystonia | FAERS: 1 | US FAERS | |
| 1160 | Early satiety | FAERS: 1 | US FAERS | |
| 1161 | Ectopic Pregnancy | FAERS: 1 | US FAERS | |
| 1162 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 1163 | Elbow operation | FAERS: 1 | US FAERS | |
| 1164 | Electrocardiogram ST segment abnormal | FAERS: 1 | SIDER US FAERS | |
| 1165 | Electrocardiogram abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 1166 | Emotional distress | FAERS: 1 | OFFSIDES US FAERS | |
| 1167 | Emphysematous pyelonephritis | FAERS: 1 | US FAERS | |
| 1168 | Encephalitis protozoal | FAERS: 1 | US FAERS | |
| 1169 | Encephalocele | FAERS: 1 | US FAERS | |
| 1170 | Engraft failure | FAERS: 1 | OFFSIDES US FAERS | |
| 1171 | Enterobacter test positive | FAERS: 1 | US FAERS | |
| 1172 | Enterococcus test positive | FAERS: 1 | US FAERS | |
| 1173 | Enterocolitis viral | FAERS: 1 | US FAERS | |
| 1174 | Enterocolitis | FAERS: 1 | SIDER US FAERS | |
| 1175 | Eosinophil cationic protein increased | FAERS: 1 | US FAERS | |
| 1176 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 1177 | Epidermodysplasia Verruciformis | FAERS: 1 | US FAERS | |
| 1178 | Episcleritis | FAERS: 1 | US FAERS | |
| 1179 | Epstein-Barr virus antibody positive | FAERS: 1 | US FAERS | |
| 1180 | Epstein-Barr virus associated lymphoma | FAERS: 1 | US FAERS | |
| 1181 | Erythema Multiforme | FAERS: 1 | SIDER US FAERS | |
| 1182 | Escherichia pyelonephritis | FAERS: 1 | US FAERS | |
| 1183 | Eustachian tube disorder | FAERS: 1 | US FAERS | |
| 1184 | Excoriation | FAERS: 1 | US FAERS | |
| 1185 | Exposure via direct contact | FAERS: 1 | US FAERS | |
| 1186 | Extravasation | FAERS: 1 | US FAERS | |
| 1187 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 1188 | Eyelids pruritus | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1189 | Facial Paresis | FAERS: 1 | US FAERS | |
| 1190 | Familial Mediterranean Fever | FAERS: 1 | US FAERS | |
| 1191 | Fasciitis | FAERS: 1 | US FAERS | |
| 1192 | Feeding tube complication | FAERS: 1 | US FAERS | |
| 1193 | Fibroadenoma of breast | FAERS: 1 | US FAERS | |
| 1194 | Fibrosarcoma | FAERS: 1 | US FAERS | |
| 1195 | Flavivirus test positive | FAERS: 1 | US FAERS | |
| 1196 | Food craving | FAERS: 1 | US FAERS | |
| 1197 | Frustration | FAERS: 1 | US FAERS | |
| 1198 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 1199 | Gastrectomy | FAERS: 1 | US FAERS | |
| 1200 | Gastric ulcer, obstructive | FAERS: 1 | US FAERS | |
| 1201 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 1202 | Gastrointestinal candidiasis | FAERS: 1 | US FAERS | |
| 1203 | Gastrointestinal dysplasia | FAERS: 1 | US FAERS | |
| 1204 | Gastrointestinal perforation | FAERS: 1 | SIDER US FAERS | |
| 1205 | Gastrointestinal stoma complication | FAERS: 1 | US FAERS | |
| 1206 | Gastrointestinal tract adenoma | FAERS: 1 | US FAERS | |
| 1207 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 1208 | General symptom | FAERS: 1 | US FAERS | |
| 1209 | Gliosis | FAERS: 1 | US FAERS | |
| 1210 | Glomerular Filtration Rate | FAERS: 1 | US FAERS | |
| 1211 | Graft versus host disease in liver | FAERS: 1 | US FAERS | |
| 1212 | Granulocyte count increased | FAERS: 1 | US FAERS | |
| 1213 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 1214 | Groin infection | FAERS: 1 | US FAERS | |
| 1215 | HELLP Syndrome | FAERS: 1 | US FAERS | |
| 1216 | Head deformity | FAERS: 1 | US FAERS | |
| 1217 | Hearing disability | FAERS: 1 | US FAERS | |
| 1218 | Heart valve stenosis | FAERS: 1 | US FAERS | |
| 1219 | Hepatic Vein Thrombosis | FAERS: 1 | US FAERS | |
| 1220 | Hepatic cyst ruptured | FAERS: 1 | US FAERS | |
| 1221 | Hepatic enzyme decreased | FAERS: 1 | US FAERS | |
| 1222 | Hepatic vascular thrombosis | FAERS: 1 | US FAERS | |
| 1223 | Hepatoblastoma | FAERS: 1 | US FAERS | |
| 1224 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 1225 | Hepatotoxicity | FAERS: 1 | SIDER US FAERS | |
| 1226 | Herpes simplex serology positive | FAERS: 1 | US FAERS | |
| 1227 | Herpes zoster infection neurological | FAERS: 1 | US FAERS | |
| 1228 | Heterophoria | FAERS: 1 | US FAERS | |
| 1229 | Histoplasmosis | FAERS: 1 | US FAERS | |
| 1230 | Hodgkin's disease mixed cellularity stage II supradiaphragmatic | FAERS: 1 | US FAERS | |
| 1231 | Holoprosencephaly | FAERS: 1 | US FAERS | |
| 1232 | Human herpes virus 6 serology positive | FAERS: 1 | US FAERS | |
| 1233 | Human rhinovirus test positive | FAERS: 1 | US FAERS | |
| 1234 | Hydrothorax | FAERS: 1 | US FAERS | |
| 1235 | Hyperdynamic left ventricle | FAERS: 1 | US FAERS | |
| 1236 | Hyperemesis Gravidarum | FAERS: 1 | US FAERS | |
| 1237 | Hypertrophic osteoarthropathy | FAERS: 1 | US FAERS | |
| 1238 | Hypertrophy | FAERS: 1 | US FAERS | |
| 1239 | Hypopharyngeal cancer stage IV | FAERS: 1 | US FAERS | |
| 1240 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 1241 | Iatrogenic infection | FAERS: 1 | US FAERS | |
| 1242 | Idiopathic Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 1243 | Ileal Stenosis | FAERS: 1 | US FAERS | |
| 1244 | Ileal ulcer | FAERS: 1 | US FAERS | |
| 1245 | Impaired insulin secretion | FAERS: 1 | US FAERS | |
| 1246 | Implant site thrombosis | FAERS: 1 | US FAERS | |
| 1247 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 1248 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 1249 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 1250 | Incision site infection | FAERS: 1 | US FAERS | |
| 1251 | Incision site pain | FAERS: 1 | US FAERS | |
| 1252 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 1253 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 1254 | Incorrect route of product administration | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1255 | Increased insulin requirement | FAERS: 1 | US FAERS | |
| 1256 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 1257 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 1258 | Incubator therapy | FAERS: 1 | US FAERS | |
| 1259 | Infection reactivation | FAERS: 1 | US FAERS | |
| 1260 | Infective glossitis | FAERS: 1 | US FAERS | |
| 1261 | Infertility | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1262 | Influenza A virus test positive | FAERS: 1 | US FAERS | |
| 1263 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 1264 | Iniencephaly | FAERS: 1 | US FAERS | |
| 1265 | Injection site abscess | FAERS: 1 | US FAERS | |
| 1266 | Injection site pain | FAERS: 1 | US FAERS | |
| 1267 | Insulin Resistance | FAERS: 1 | 24959755 | CTD US FAERS |
| 1268 | Insulin resistance syndrome | FAERS: 1 | US FAERS | |
| 1269 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 1270 | Intercepted product prescribing error | FAERS: 1 | US FAERS | |
| 1271 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 1272 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 1273 | Intestinal Fistula | FAERS: 1 | US FAERS | |
| 1274 | Intestinal congestion | FAERS: 1 | US FAERS | |
| 1275 | Intracardiac mass | FAERS: 1 | US FAERS | |
| 1276 | Iron deficiency | FAERS: 1 | US FAERS | |
| 1277 | JC virus infection | FAERS: 1 | US FAERS | |
| 1278 | Joint laxity | FAERS: 1 | US FAERS | |
| 1279 | Joint stiffness | FAERS: 1 | OFFSIDES US FAERS | |
| 1280 | Jugular vein occlusion | FAERS: 1 | US FAERS | |
| 1281 | Keratitis | FAERS: 1 | US FAERS | |
| 1282 | Ketonuria | FAERS: 1 | US FAERS | |
| 1283 | Ketosis | FAERS: 1 | US FAERS | |
| 1284 | Large intestinal stenosis | FAERS: 1 | US FAERS | |
| 1285 | Laryngeal cancer recurrent | FAERS: 1 | US FAERS | |
| 1286 | Left ventricle outflow tract obstruction | FAERS: 1 | US FAERS | |
| 1287 | Leukoaraiosis | FAERS: 1 | US FAERS | |
| 1288 | Leukoderma | FAERS: 1 | SIDER US FAERS | |
| 1289 | Light chain analysis increased | FAERS: 1 | US FAERS | |
| 1290 | Lipoma | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1291 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 1292 | Lower respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 1293 | Lumbar hernia | FAERS: 1 | US FAERS | |
| 1294 | Lung cyst | FAERS: 1 | US FAERS | |
| 1295 | Lung hyperinflation | FAERS: 1 | US FAERS | |
| 1296 | Lung infection pseudomonal | FAERS: 1 | US FAERS | |
| 1297 | Lung perforation | FAERS: 1 | US FAERS | |
| 1298 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 1299 | Lyme Disease | FAERS: 1 | US FAERS | |
| 1300 | Lymph node palpable | FAERS: 1 | US FAERS | |
| 1301 | Lymphangioma | FAERS: 1 | US FAERS | |
| 1302 | Lymphangiosis carcinomatosa | FAERS: 1 | US FAERS | |
| 1303 | Lymphocyte percentage increased | FAERS: 1 | US FAERS | |
| 1304 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 1305 | Lymphopenia | FAERS: 1 | US FAERS | |
| 1306 | Macule | FAERS: 1 | US FAERS | |
| 1307 | Magnesium Deficiency | FAERS: 1 | US FAERS | |
| 1308 | Malignant Hypertension | FAERS: 1 | OFFSIDES US FAERS | |
| 1309 | Malignant melanoma stage IV | FAERS: 1 | US FAERS | |
| 1310 | Malignant transformation | FAERS: 1 | US FAERS | |
| 1311 | Manufacturing materials issue | FAERS: 1 | US FAERS | |
| 1312 | Mastication disorder | FAERS: 1 | US FAERS | |
| 1313 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 1314 | Medication tampering | FAERS: 1 | US FAERS | |
| 1315 | Meningioma | FAERS: 1 | US FAERS | |
| 1316 | Meningorrhagia | FAERS: 1 | US FAERS | |
| 1317 | Menopause | FAERS: 1 | US FAERS | |
| 1318 | Mental Retardation | FAERS: 1 | US FAERS | |
| 1319 | Mental retardation severity unspecified | FAERS: 1 | US FAERS | |
| 1320 | Metapneumovirus infection | FAERS: 1 | US FAERS | |
| 1321 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 1322 | Migraine with Aura | FAERS: 1 | 15836601 | CTD US FAERS |
| 1323 | Miller Fisher Syndrome | FAERS: 1 | 15855240 | CTD US FAERS |
| 1324 | Mineral supplementation | FAERS: 1 | US FAERS | |
| 1325 | Mismatched donor bone marrow transplantation therapy | FAERS: 1 | US FAERS | |
| 1326 | Moaning | FAERS: 1 | US FAERS | |
| 1327 | Mononeuropathy Multiplex | FAERS: 1 | US FAERS | |
| 1328 | Mouth swelling | FAERS: 1 | US FAERS | |
| 1329 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 1330 | Multimorbidity | FAERS: 1 | US FAERS | |
| 1331 | Muscle abscess | FAERS: 1 | US FAERS | |
| 1332 | Muscle tightness | FAERS: 1 | US FAERS | |
| 1333 | Muscle tone disorder | FAERS: 1 | US FAERS | |
| 1334 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 1335 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 1336 | Mycobacterium tuberculosis complex test positive | FAERS: 1 | US FAERS | |
| 1337 | Myeloma recurrence | FAERS: 1 | US FAERS | |
| 1338 | Myocardial fibrosis | FAERS: 1 | US FAERS | |
| 1339 | Myocardial rupture | FAERS: 1 | US FAERS | |
| 1340 | Myofascitis | FAERS: 1 | US FAERS | |
| 1341 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 1342 | Myositis | FAERS: 1 | 15110639 | CTD US FAERS |
| 1343 | Nail Infection | FAERS: 1 | US FAERS | |
| 1344 | Nail bed disorder | FAERS: 1 | US FAERS | |
| 1345 | Neonatal cardiac failure | FAERS: 1 | US FAERS | |
| 1346 | Neurological infection | FAERS: 1 | US FAERS | |
| 1347 | Neurosarcoidosis | FAERS: 1 | US FAERS | |
| 1348 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 1349 | Neutrophil morphology abnormal | FAERS: 1 | US FAERS | |
| 1350 | Nocturia | FAERS: 1 | SIDER US FAERS | |
| 1351 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 1352 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 1353 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 1354 | Ocular vascular disorder | FAERS: 1 | US FAERS | |
| 1355 | Oculogyric crisis | FAERS: 1 | US FAERS | |
| 1356 | Ophthalmic vein thrombosis | FAERS: 1 | US FAERS | |
| 1357 | Oral infection | FAERS: 1 | US FAERS | |
| 1358 | Oral mucosal hypertrophy | FAERS: 1 | US FAERS | |
| 1359 | Osteogenesis Imperfecta | FAERS: 1 | US FAERS | |
| 1360 | Osteolysis | FAERS: 1 | US FAERS | |
| 1361 | Osteomyelitis fungal | FAERS: 1 | US FAERS | |
| 1362 | Osteopenia | FAERS: 1 | SIDER US FAERS | |
| 1363 | Osteotomy | FAERS: 1 | US FAERS | |
| 1364 | Otitis Externa | FAERS: 1 | SIDER US FAERS | |
| 1365 | Oxalosis | FAERS: 1 | US FAERS | |
| 1366 | PCO2 increased | FAERS: 1 | US FAERS | |
| 1367 | Pallor | FAERS: 1 | US FAERS | |
| 1368 | Palmar erythema | FAERS: 1 | US FAERS | |
| 1369 | Pancreatic Cyst | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1370 | Pancreatic Pseudocyst | FAERS: 1 | SIDER US FAERS | |
| 1371 | Pancreatic operation | FAERS: 1 | US FAERS | |
| 1372 | Panophthalmitis | FAERS: 1 | US FAERS | |
| 1373 | Papilloma | FAERS: 1 | US FAERS | |
| 1374 | Parakeratosis | FAERS: 1 | US FAERS | |
| 1375 | Paranoia | FAERS: 1 | US FAERS | |
| 1376 | Paraparesis | FAERS: 1 | US FAERS | |
| 1377 | Parapsoriasis | FAERS: 1 | US FAERS | |
| 1378 | Paresis | FAERS: 1 | 9606397 11740402 | CTD SIDER US FAERS |
| 1379 | Parotidectomy | FAERS: 1 | US FAERS | |
| 1380 | Patellofemoral Pain Syndrome | FAERS: 1 | US FAERS | |
| 1381 | Patent ductus arteriosus | FAERS: 1 | US FAERS | |
| 1382 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 1383 | Pathological fracture | FAERS: 1 | US FAERS | |
| 1384 | Pelvic Inflammatory Disease | FAERS: 1 | US FAERS | |
| 1385 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 1386 | Pelvic floor repair | FAERS: 1 | US FAERS | |
| 1387 | Pelvic venous thrombosis | FAERS: 1 | US FAERS | |
| 1388 | Penile operation | FAERS: 1 | US FAERS | |
| 1389 | Penis carcinoma | FAERS: 1 | US FAERS | |
| 1390 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 1391 | Periodontitis | FAERS: 1 | US FAERS | |
| 1392 | Peripheral artery dissection | FAERS: 1 | US FAERS | |
| 1393 | Peripheral artery stenosis | FAERS: 1 | US FAERS | |
| 1394 | Peritoneal lesion | FAERS: 1 | US FAERS | |
| 1395 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 1396 | Phimosis | FAERS: 1 | US FAERS | |
| 1397 | Phonophobia | FAERS: 1 | US FAERS | |
| 1398 | Photopheresis | FAERS: 1 | US FAERS | |
| 1399 | Physical deconditioning | FAERS: 1 | US FAERS | |
| 1400 | Physical product label issue | FAERS: 1 | US FAERS | |
| 1401 | Placenta Accreta | FAERS: 1 | US FAERS | |
| 1402 | Placental Insufficiency | FAERS: 1 | US FAERS | |
| 1403 | Plasma cells present | FAERS: 1 | US FAERS | |
| 1404 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 1405 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 1406 | Pneumonia herpes viral | FAERS: 1 | US FAERS | |
| 1407 | Pneumoperitoneum | FAERS: 1 | US FAERS | |
| 1408 | Podagra | FAERS: 1 | US FAERS | |
| 1409 | Polydactyly | FAERS: 1 | US FAERS | |
| 1410 | Polydipsia | FAERS: 1 | US FAERS | |
| 1411 | Poor feeding infant | FAERS: 1 | US FAERS | |
| 1412 | Poor personal hygiene | FAERS: 1 | US FAERS | |
| 1413 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 1414 | Portal hypertensive gastropathy | FAERS: 1 | US FAERS | |
| 1415 | Portal tract inflammation | FAERS: 1 | US FAERS | |
| 1416 | Portal triaditis | FAERS: 1 | US FAERS | |
| 1417 | Portal vein flow decreased | FAERS: 1 | US FAERS | |
| 1418 | Post infection glomerulonephritis | FAERS: 1 | US FAERS | |
| 1419 | Post procedural discharge | FAERS: 1 | US FAERS | |
| 1420 | Post procedural pain | FAERS: 1 | SIDER US FAERS | |
| 1421 | Post procedural pulmonary embolism | FAERS: 1 | US FAERS | |
| 1422 | Post procedural stroke | FAERS: 1 | US FAERS | |
| 1423 | Postoperative fever | FAERS: 1 | US FAERS | |
| 1424 | Postoperative renal failure | FAERS: 1 | US FAERS | |
| 1425 | Precancerous skin lesion | FAERS: 1 | US FAERS | |
| 1426 | Pregnancy of partner | FAERS: 1 | US FAERS | |
| 1427 | Prenatal screening test abnormal | FAERS: 1 | US FAERS | |
| 1428 | Presyncope | FAERS: 1 | US FAERS | |
| 1429 | Primary Ciliary Dyskinesia | FAERS: 1 | US FAERS | |
| 1430 | Primary Effusion Lymphoma | FAERS: 1 | US FAERS | |
| 1431 | Procalcitonin increased | FAERS: 1 | US FAERS | |
| 1432 | Procedural hypotension | FAERS: 1 | OFFSIDES US FAERS | |
| 1433 | Procedural intestinal perforation | FAERS: 1 | US FAERS | |
| 1434 | Proctocolectomy | FAERS: 1 | US FAERS | |
| 1435 | Product availability issue | FAERS: 1 | US FAERS | |
| 1436 | Product commingling | FAERS: 1 | US FAERS | |
| 1437 | Product compounding quality issue | FAERS: 1 | US FAERS | |
| 1438 | Product contamination | FAERS: 1 | US FAERS | |
| 1439 | Product contamination physical | FAERS: 1 | US FAERS | |
| 1440 | Product formulation issue | FAERS: 1 | US FAERS | |
| 1441 | Product label counterfeit | FAERS: 1 | US FAERS | |
| 1442 | Product label issue | FAERS: 1 | US FAERS | |
| 1443 | Product label on wrong product | FAERS: 1 | US FAERS | |
| 1444 | Product name confusion | FAERS: 1 | US FAERS | |
| 1445 | Product package associated injury | FAERS: 1 | US FAERS | |
| 1446 | Product quality control issue | FAERS: 1 | US FAERS | |
| 1447 | Product size issue | FAERS: 1 | US FAERS | |
| 1448 | Product use complaint | FAERS: 1 | US FAERS | |
| 1449 | Progressive cerebellar degeneration | FAERS: 1 | US FAERS | |
| 1450 | Prostatectomy | FAERS: 1 | US FAERS | |
| 1451 | Pseudomonas test positive | FAERS: 1 | US FAERS | |
| 1452 | Pulmonary Valve Stenosis | FAERS: 1 | US FAERS | |
| 1453 | Pulmonary arterial hypertension | FAERS: 1 | US FAERS | |
| 1454 | Pulmonary arterial pressure increased | FAERS: 1 | US FAERS | |
| 1455 | Pulmonary necrosis | FAERS: 1 | US FAERS | |
| 1456 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 1457 | Pulmonary toxicity | FAERS: 1 | OFFSIDES US FAERS | |
| 1458 | Purulent discharge | FAERS: 1 | US FAERS | |
| 1459 | Pustular psoriasis | FAERS: 1 | US FAERS | |
| 1460 | Pyoderma Gangrenosum | FAERS: 1 | 17076739 | CTD US FAERS |
| 1461 | Pyogenic granuloma | FAERS: 1 | US FAERS | |
| 1462 | Pyuria | FAERS: 1 | SIDER US FAERS | |
| 1463 | Reactive gastropathy | FAERS: 1 | US FAERS | |
| 1464 | Rebound effect | FAERS: 1 | US FAERS | |
| 1465 | Recall phenomenon | FAERS: 1 | US FAERS | |
| 1466 | Red blood cell morphology abnormal | FAERS: 1 | US FAERS | |
| 1467 | Red blood cell schistocytes present | FAERS: 1 | US FAERS | |
| 1468 | Regurgitation of food | FAERS: 1 | US FAERS | |
| 1469 | Regurgitation | FAERS: 1 | US FAERS | |
| 1470 | Renal embolism | FAERS: 1 | US FAERS | |
| 1471 | Renal hypertension | FAERS: 1 | US FAERS | |
| 1472 | Renal impairment neonatal | FAERS: 1 | US FAERS | |
| 1473 | Renal lymphocele | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1474 | Renal tubular injury | FAERS: 1 | US FAERS | |
| 1475 | Renin increased | FAERS: 1 | US FAERS | |
| 1476 | Reocclusion | FAERS: 1 | US FAERS | |
| 1477 | Respiratory muscle weakness | FAERS: 1 | US FAERS | |
| 1478 | Respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 1479 | Retinitis | FAERS: 1 | US FAERS | |
| 1480 | Retinopathy of Prematurity | FAERS: 1 | US FAERS | |
| 1481 | Retroperitoneal mass | FAERS: 1 | US FAERS | |
| 1482 | Rhinovirus infection | FAERS: 1 | US FAERS | |
| 1483 | Rhodococcus infection | FAERS: 1 | US FAERS | |
| 1484 | Rickets | FAERS: 1 | US FAERS | |
| 1485 | Right Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 1486 | Roseolovirus test positive | FAERS: 1 | US FAERS | |
| 1487 | Salmonella sepsis | FAERS: 1 | US FAERS | |
| 1488 | Schistosomiasis | FAERS: 1 | US FAERS | |
| 1489 | Scleroderma | FAERS: 1 | US FAERS | |
| 1490 | Scotoma | FAERS: 1 | US FAERS | |
| 1491 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 1492 | Septic embolus | FAERS: 1 | US FAERS | |
| 1493 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 1494 | Shunt aneurysm | FAERS: 1 | US FAERS | |
| 1495 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 1496 | Simple Partial Seizures | FAERS: 1 | US FAERS | |
| 1497 | Simplex virus test positive | FAERS: 1 | US FAERS | |
| 1498 | Sinus headache | FAERS: 1 | OFFSIDES US FAERS | |
| 1499 | Sinus operation | FAERS: 1 | US FAERS | |
| 1500 | Skeletal injury | FAERS: 1 | US FAERS | |
| 1501 | Skin Induration | FAERS: 1 | OFFSIDES US FAERS | |
| 1502 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 1503 | Skin graft rejection | FAERS: 1 | US FAERS | |
| 1504 | Skin reaction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1505 | Smallpox | FAERS: 1 | US FAERS | |
| 1506 | Sneezing | FAERS: 1 | US FAERS | |
| 1507 | Snoring | FAERS: 1 | US FAERS | |
| 1508 | Soft tissue mass | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1509 | Solar dermatitis | FAERS: 1 | US FAERS | |
| 1510 | Soliloquy | FAERS: 1 | US FAERS | |
| 1511 | Somnambulism | FAERS: 1 | US FAERS | |
| 1512 | Spermatozoa progressive motility decreased | FAERS: 1 | US FAERS | |
| 1513 | Spinal fusion surgery | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1514 | Splenectomy | FAERS: 1 | US FAERS | |
| 1515 | Splenic fibrosis | FAERS: 1 | US FAERS | |
| 1516 | Splenic granuloma | FAERS: 1 | US FAERS | |
| 1517 | Spondylitis | FAERS: 1 | OFFSIDES US FAERS | |
| 1518 | Spondylosis | FAERS: 1 | US FAERS | |
| 1519 | Staphylococcal abscess | FAERS: 1 | US FAERS | |
| 1520 | Staphylococcal impetigo | FAERS: 1 | US FAERS | |
| 1521 | Staring | FAERS: 1 | US FAERS | |
| 1522 | Status Asthmaticus | FAERS: 1 | US FAERS | |
| 1523 | Stent occlusion | FAERS: 1 | US FAERS | |
| 1524 | Stoma creation | FAERS: 1 | US FAERS | |
| 1525 | Stomatococcal infection | FAERS: 1 | US FAERS | |
| 1526 | Streptococcal impetigo | FAERS: 1 | US FAERS | |
| 1527 | Subacute combined cord degeneration | FAERS: 1 | US FAERS | |
| 1528 | Subileus | FAERS: 1 | SIDER US FAERS | |
| 1529 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 1530 | Sudden Visual Loss | FAERS: 1 | US FAERS | |
| 1531 | Sudden infant death syndrome | FAERS: 1 | US FAERS | |
| 1532 | Surgical vascular shunt | FAERS: 1 | US FAERS | |
| 1533 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 1534 | Suture related complication | FAERS: 1 | US FAERS | |
| 1535 | Sympathomimetic Effect | FAERS: 1 | US FAERS | |
| 1536 | Systemic lupus erythematosus rash | FAERS: 1 | US FAERS | |
| 1537 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 1538 | Tenosynovitis | FAERS: 1 | US FAERS | |
| 1539 | Tension Headache | FAERS: 1 | US FAERS | |
| 1540 | Testicular mass | FAERS: 1 | US FAERS | |
| 1541 | Tetany | FAERS: 1 | US FAERS | |
| 1542 | Thalamic infarction | FAERS: 1 | US FAERS | |
| 1543 | Therapeutic drug monitoring analysis incorrectly performed | FAERS: 1 | US FAERS | |
| 1544 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 1545 | Throat irritation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1546 | Thrombocytopenic purpura | FAERS: 1 | SIDER US FAERS | |
| 1547 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 1548 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 1549 | Thymectomy | FAERS: 1 | US FAERS | |
| 1550 | Thyroglossal Cyst | FAERS: 1 | US FAERS | |
| 1551 | Thyroiditis | FAERS: 1 | OFFSIDES US FAERS | |
| 1552 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 1553 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 1554 | Toxic leukoencephalopathy | FAERS: 1 | US FAERS | |
| 1555 | Tracheal Stenosis | FAERS: 1 | US FAERS | |
| 1556 | Tracheobronchitis | FAERS: 1 | US FAERS | |
| 1557 | Transcription medication error | FAERS: 1 | US FAERS | |
| 1558 | Transfusion-Related Acute Lung Injury | FAERS: 1 | US FAERS | |
| 1559 | Transplant abscess | FAERS: 1 | US FAERS | |
| 1560 | Traumatic arthropathy | FAERS: 1 | US FAERS | |
| 1561 | Trichomegaly | FAERS: 1 | US FAERS | |
| 1562 | Trichophyton infection | FAERS: 1 | US FAERS | |
| 1563 | Trichophytosis | FAERS: 1 | US FAERS | |
| 1564 | Trichosporon infection | FAERS: 1 | US FAERS | |
| 1565 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 1566 | Typhoid Fever | FAERS: 1 | US FAERS | |
| 1567 | Unresponsive to verbal stimuli | FAERS: 1 | US FAERS | |
| 1568 | Upper motor neurone lesion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1569 | Ureterolithiasis | FAERS: 1 | US FAERS | |
| 1570 | Urethral Obstruction | FAERS: 1 | US FAERS | |
| 1571 | Urethral Stenosis | FAERS: 1 | US FAERS | |
| 1572 | Urethrotomy | FAERS: 1 | US FAERS | |
| 1573 | Urinary anastomotic leak | FAERS: 1 | US FAERS | |
| 1574 | Urinary tract infection enterococcal | FAERS: 1 | US FAERS | |
| 1575 | Urinary tract infection pseudomonal | FAERS: 1 | US FAERS | |
| 1576 | Urinary tract infection viral | FAERS: 1 | US FAERS | |
| 1577 | Urinary tract stoma complication | FAERS: 1 | US FAERS | |
| 1578 | Uterine Prolapse | FAERS: 1 | US FAERS | |
| 1579 | Vaginal lesion | FAERS: 1 | US FAERS | |
| 1580 | Vascular insufficiency | FAERS: 1 | US FAERS | |
| 1581 | Vascular occlusion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1582 | Vascular procedure complication | FAERS: 1 | US FAERS | |
| 1583 | Vascular rupture | FAERS: 1 | US FAERS | |
| 1584 | Vascular stent stenosis | FAERS: 1 | US FAERS | |
| 1585 | Vasoplegia syndrome | FAERS: 1 | US FAERS | |
| 1586 | Venous aneurysm | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1587 | Venous stenosis | FAERS: 1 | US FAERS | |
| 1588 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 1589 | Ventricular Dysfunction | FAERS: 1 | SIDER US FAERS | |
| 1590 | Ventricular Fibrillation | FAERS: 1 | SIDER US FAERS | |
| 1591 | Ventricular Flutter | FAERS: 1 | US FAERS | |
| 1592 | Ventricular hypertrophy | FAERS: 1 | SIDER US FAERS | |
| 1593 | Ventricular wall thickening | FAERS: 1 | US FAERS | |
| 1594 | Victim of child abuse | FAERS: 1 | US FAERS | |
| 1595 | Victim of homicide | FAERS: 1 | US FAERS | |
| 1596 | Visual disturbance | FAERS: 1 | US FAERS | |
| 1597 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 1598 | Vitreous opacities | FAERS: 1 | US FAERS | |
| 1599 | Vulval cancer recurrent | FAERS: 1 | US FAERS | |
| 1600 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 1601 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 1602 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 1603 | Walking aid user | FAERS: 1 | US FAERS | |
| 1604 | West Nile virus test positive | FAERS: 1 | US FAERS | |
| 1605 | Wound Complication | FAERS: 1 | US FAERS | |
| 1606 | Wound abscess | FAERS: 1 | US FAERS | |
| 1607 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 1608 | Wound necrosis | FAERS: 1 | US FAERS | |
| 1609 | X-linked chromosomal disorder | FAERS: 1 | US FAERS | |
| 1610 | Zygomycosis | FAERS: 1 | US FAERS | |
| 1611 | diagnostic procedure | FAERS: 1 | US FAERS | |
| 1612 | fibroma | FAERS: 1 | US FAERS | |
| 1613 | furuncle | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 1614 | keratoacanthoma | FAERS: 1 | US FAERS | |
| 1615 | leiomyosarcoma | FAERS: 1 | US FAERS | |
| 1616 | liposarcoma | FAERS: 1 | US FAERS | |
| 1617 | Abdominal bloating | SIDER | ||
| 1618 | Abdominal sepsis | OFFSIDES | ||
| 1619 | Abnormal vision | OFFSIDES SIDER | ||
| 1620 | Acid reflux | OFFSIDES | ||
| 1621 | Acute glomerulonephritis | OFFSIDES | ||
| 1622 | Acute psychosis | Canada Vigilance: 1 | Canada Vigilance | |
| 1623 | Agranulocytosis | SIDER | ||
| 1624 | Akathisia, Drug-Induced | 1376291 8874843 | CTD | |
| 1625 | Akinetic Mutism | CTD | ||
| 1626 | Albuminuria | 16095517 | CTD SIDER | |
| 1627 | Alkalosis | SIDER | ||
| 1628 | Altered visual depth perception | OFFSIDES | ||
| 1629 | Amblyopia | SIDER | ||
| 1630 | Amenorrhea | 12709079 | CTD | |
| 1631 | Anaphylactoid Reaction | SIDER | ||
| 1632 | Anemia, Hemolytic | CTD | ||
| 1633 | Anemia | CTD | ||
| 1634 | Anti-erythropoietin antibody positive | OFFSIDES | ||
| 1635 | Anxiety Disorders | 1376291 8874843 | CTD | |
| 1636 | Aphthous Stomatitis | SIDER | ||
| 1637 | Application site cellulitis | OFFSIDES | ||
| 1638 | Application site urticaria | Canada Vigilance: 1 | Canada Vigilance | |
| 1639 | Apraxias | 7512320 8820772 | CTD | |
| 1640 | Ascites infection | OFFSIDES | ||
| 1641 | Asthenic conditions | SIDER | ||
| 1642 | Atypical pneumonia | Canada Vigilance: 1 | Canada Vigilance | |
| 1643 | Azotemia | 11485932 | CTD | |
| 1644 | Bacteria stool identified | OFFSIDES | ||
| 1645 | Behcet Syndrome | 7517134 | CTD | |
| 1646 | Bile Duct Diseases | 18698687 | CTD | |
| 1647 | Bladder and urethral symptoms | SIDER | ||
| 1648 | Bladder pain | SIDER | ||
| 1649 | Bladder spasm | SIDER | ||
| 1650 | Blindness, Cortical | 10338054 12879959 | CTD | |
| 1651 | Blood and lymphatic system disorders | SIDER | ||
| 1652 | Blood beta-D-glucan increased | OFFSIDES | ||
| 1653 | Blood uric acid | OFFSIDES | ||
| 1654 | Body Temperature | OFFSIDES | ||
| 1655 | Bone Diseases | 10577370 15257699 | CTD | |
| 1656 | Bone Marrow Diseases | 11263551 | CTD | |
| 1657 | Bone marrow toxicity | OFFSIDES | ||
| 1658 | Brachial Plexus Neuritis | 18503483 | CTD | |
| 1659 | Brain Damage, Chronic | 19779798 | CTD | |
| 1660 | Brain Diseases, Metabolic | 15919502 | CTD | |
| 1661 | Brain Diseases | 11100753 11465799 | CTD | |
| 1662 | Brain Edema | CTD | ||
| 1663 | Brain Injuries | 12942100 | CTD | |
| 1664 | Brain Ischemia | 17076660 | CTD | |
| 1665 | Bronchoalveolar Lavage | OFFSIDES | ||
| 1666 | CYTOMEGALOVIRUS ANTIGEN | OFFSIDES | ||
| 1667 | Candida sepsis | OFFSIDES | ||
| 1668 | Cardiomyopathies | 7535875 7543645 10743694 | CTD | |
| 1669 | Cardiovascular Diseases | 17703430 | CTD | |
| 1670 | Carpal Tunnel Syndrome | SIDER | ||
| 1671 | Catalepsy | 15332494 | CTD | |
| 1672 | Cerebral Hemorrhage | 11100753 15540907 16753888 | CTD | |
| 1673 | Cerebrovascular Disorders | 18852671 | CTD | |
| 1674 | Chemical and Drug Induced Liver Injury | 10743694 18648179 19405263 | CTD | |
| 1675 | Chest tightness | SIDER | ||
| 1676 | Cholangiolitis | OFFSIDES | ||
| 1677 | Cirrhosis | OFFSIDES | ||
| 1678 | Citrobacter infection | OFFSIDES | ||
| 1679 | Clostridium difficile toxin test positive | OFFSIDES | ||
| 1680 | Coagulation test abnormal | OFFSIDES | ||
| 1681 | Cognition Disorders | 9427854 12823354 19779798 | CTD | |
| 1682 | Confusion | CTD | ||
| 1683 | Consciousness Disorders | 1721398 11868353 | CTD | |
| 1684 | Cramps of lower extremities | SIDER | ||
| 1685 | Creatinine increased | SIDER | ||
| 1686 | Cystitis viral | OFFSIDES | ||
| 1687 | Deglutition Disorders | 12819864 17484951 | CTD | |
| 1688 | Demyelinating Diseases | CTD | ||
| 1689 | Dental Restoration Failure | Canada Vigilance: 1 | Canada Vigilance | |
| 1690 | Depressive disorder | 12709079 | CTD | |
| 1691 | Dermatitis, Allergic Contact | 11692113 19207676 | CTD | |
| 1692 | Dermatitis, Atopic | CTD | ||
| 1693 | Dermatomycoses | 15956404 | CTD | |
| 1694 | Diabetes | OFFSIDES | ||
| 1695 | Diabetes Mellitus, Experimental | 24959755 | CTD | |
| 1696 | Diarrhea | 8605372 8732602 | CTD OFFSIDES | |
| 1697 | Distal intestinal obstruction syndrome | OFFSIDES | ||
| 1698 | Drug Overdose | 11740402 | CTD | |
| 1699 | Dyskinesia, Drug-Induced | 14519411 | CTD | |
| 1700 | Dyslexia | Canada Vigilance: 1 | Canada Vigilance | |
| 1701 | Dyspeptic signs and symptoms | SIDER | ||
| 1702 | Ear and labyrinth disorders | SIDER | ||
| 1703 | Ear discharge | OFFSIDES | ||
| 1704 | Echocardiogram abnormal | SIDER | ||
| 1705 | Edema | 11263551 17785681 | CTD | |
| 1706 | Elevated mood | SIDER | ||
| 1707 | Endocardial disease | Canada Vigilance: 1 | Canada Vigilance | |
| 1708 | Enlargement abdomen | SIDER | ||
| 1709 | Epilepsy, Temporal Lobe | 16573841 | CTD | |
| 1710 | Extremity contracture | OFFSIDES | ||
| 1711 | Facial Dermatoses | 15096374 | CTD | |
| 1712 | Factor II deficiency | SIDER | ||
| 1713 | Fanconi Syndrome | 18186898 | CTD | |
| 1714 | Fasting | SIDER | ||
| 1715 | Fatty Liver | 17907528 | CTD | |
| 1716 | Fever | 8605372 | CTD | |
| 1717 | Furunculosis | SIDER | ||
| 1718 | Gait Disorders, Neurologic | 16573841 | CTD | |
| 1719 | Gastrointestinal Diseases | 9267719 10743694 | CTD | |
| 1720 | Gastrointestinal inflammatory conditions | SIDER | ||
| 1721 | Gastrointestinal ulcer perforation | SIDER | ||
| 1722 | Gingival Overgrowth | 18342291 | CTD | |
| 1723 | Glomerulonephritis, Membranoproliferative | 19406543 | CTD | |
| 1724 | Glycosuria | SIDER | ||
| 1725 | Growth Disorders | 11041285 | CTD | |
| 1726 | Hallucinations | 10954277 | CTD | |
| 1727 | Hearing Loss, Bilateral | 10417040 16764642 | CTD | |
| 1728 | Hearing Loss, Sudden | 16764642 | CTD | |
| 1729 | Heart failure | 7535875 | CTD | |
| 1730 | Heart-lung transplant rejection | OFFSIDES | ||
| 1731 | Hemolytic-Uremic Syndrome |
7679450
9811409 10328486 10561115 10616519 10831087 11100278 11140243 12644073 14696762 15219059 15388824 17123120 17951952 18534145 18689275 20009155 20813025 | CTD | |
| 1732 | Hemorrhage | 17785681 | CTD | |
| 1733 | Hepatic Veno-Occlusive Disease | 17697264 19135948 | CTD | |
| 1734 | Hepatitis B positive | OFFSIDES | ||
| 1735 | Hepatosplenic T-cell lymphoma | SIDER | ||
| 1736 | Herpes Labialis | SIDER | ||
| 1737 | Herpes dermatitis | SIDER | ||
| 1738 | Herpes simplex dermatitis | SIDER | ||
| 1739 | Hirsutism | SIDER | ||
| 1740 | Hypercalciuria | 14978156 | CTD | |
| 1741 | Hypercholesterolemia | 11443583 11583721 15982605 | CTD | |
| 1742 | Hyperglycemia | CTD | ||
| 1743 | Hyperkalemia | 7679825 8732602 9193849 | CTD | |
| 1744 | Hyperplasia | 1379756 | CTD | |
| 1745 | Hypertriglyceridemia | 11583721 | CTD | |
| 1746 | Hyperuricemia | 7532090 | CTD | |
| 1747 | Hypokinesia | 8820772 | CTD | |
| 1748 | Hypomagnesemia 2, renal | 7532090 | CTD | |
| 1749 | Hyponatremia | 14604289 20737184 | CTD | |
| 1750 | Hypotrichosis | SIDER | ||
| 1751 | Hypozincaemia | OFFSIDES | ||
| 1752 | Immunodeficiency congenital | OFFSIDES | ||
| 1753 | Incision site complication | SIDER | ||
| 1754 | Infective pulmonary exacerbation of cystic fibrosis | Canada Vigilance: 1 | Canada Vigilance | |
| 1755 | Infestation | SIDER | ||
| 1756 | Influenza-like symptoms | SIDER | ||
| 1757 | Infusion site mobility decreased | OFFSIDES | ||
| 1758 | Infusion site pain | OFFSIDES | ||
| 1759 | Infusion site swelling | OFFSIDES | ||
| 1760 | Instillation site pain | SIDER | ||
| 1761 | Intracranial Hypertension | 16048612 | CTD | |
| 1762 | Ischaemic coronary artery disorders | SIDER | ||
| 1763 | Ischemia | 9660400 12892836 | CTD | |
| 1764 | Jaundice, Obstructive | 18648179 | CTD | |
| 1765 | Joint Instability | OFFSIDES | ||
| 1766 | Joint Range of Motion Decreased | OFFSIDES | ||
| 1767 | Kidney Diseases |
1379756
7508536 7509514 7514309 7526278 7532089 7533848 7540737 7542793 7581086 8542679 8605372 8732602 8878382 8943876 9209738 9267719 9422427 9517403 9570331 9664955 10450987 10551656 10918426 11041285 11063349 11140242 11361051 11544444 11583940 11773892 12243498 12427154 12469222 12472797 12584269 12660339 12836095 12883183 12883193 14675044 15365603 15976495 16210976 16980036 17085464 17132217 17283585 17690032 18001539 18339148 18408564 18582803 18589147 18769365 19584685 20091056 20484890 20526235 21865292 29362864 | CTD | |
| 1768 | Kidney Failure, Chronic | 10831087 | CTD | |
| 1769 | Kidney Failure | OFFSIDES | ||
| 1770 | Klebsiella sepsis | OFFSIDES | ||
| 1771 | Leukopenia neonatal | OFFSIDES | ||
| 1772 | Low Cardiac Output Syndrome | OFFSIDES | ||
| 1773 | Lung Abscess | OFFSIDES | ||
| 1774 | Lupus Erythematosus, Systemic | 9462174 | CTD | |
| 1775 | Lymph Node Tuberculosis | OFFSIDES | ||
| 1776 | Lymphocyte count increased | Canada Vigilance: 1 | Canada Vigilance | |
| 1777 | Lymphocytic infiltration | OFFSIDES | ||
| 1778 | Lymphoproliferative Disorders | 10743694 | CTD | |
| 1779 | Metastases to larynx | Canada Vigilance: 1 | Canada Vigilance | |
| 1780 | Migraine Disorders | 17112920 | CTD | |
| 1781 | Monoparesis | SIDER | ||
| 1782 | Multiple Sclerosis, Chronic Progressive | 7539635 | CTD | |
| 1783 | Muscle Cramp | 12072309 | CTD | |
| 1784 | Muscle Weakness | 7511197 18089409 | CTD | |
| 1785 | Myelinolysis, Central Pontine | 12819864 15919502 | CTD | |
| 1786 | Myelitis | OFFSIDES | ||
| 1787 | Myocardial Ischemia | 12975596 | CTD | |
| 1788 | Myocardial hypertrophy | SIDER | ||
| 1789 | Myocardial necrosis marker increased | Canada Vigilance: 1 | Canada Vigilance | |
| 1790 | Neoplasms, Experimental | 25770929 | CTD | |
| 1791 | Nephritis, Interstitial | 14620542 | CTD | |
| 1792 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 1793 | Nephrosis | 1375300 | CTD | |
| 1794 | Nerve Degeneration | 9620083 17360923 20149694 | CTD | |
| 1795 | Neurobehavioral Manifestations | 15452321 21321342 | CTD | |
| 1796 | Neuroblastoma recurrent | OFFSIDES | ||
| 1797 | Neuropathy | SIDER | ||
| 1798 | Neurotoxicity Syndromes |
7512320
7517134 7518974 7541834 7549057 9361932 9606397 10653398 10743694 11071440 11271254 12352921 12780665 12823354 14703933 15485139 15919502 16549190 16573841 | CTD | |
| 1799 | Ocular Motility Disorders | 12699871 | CTD | |
| 1800 | Ophthalmoplegia | 10954277 15090580 | CTD | |
| 1801 | PCO2 decreased | OFFSIDES | ||
| 1802 | Pain, Intractable | 15619640 16787880 18306017 | CTD | |
| 1803 | Pancreatic Diseases | 24959755 | CTD | |
| 1804 | Paraesthesias and dysaesthesias | SIDER | ||
| 1805 | Peripheral Nervous System Diseases | 7511197 15919502 | CTD | |
| 1806 | Phototoxicity | SIDER | ||
| 1807 | Pigmentary retinopathy | OFFSIDES | ||
| 1808 | Pilonidal Cyst | OFFSIDES | ||
| 1809 | Polyarthritis | SIDER | ||
| 1810 | Polyomavirus Infections | 19584685 | CTD SIDER | |
| 1811 | Polyradiculoneuropathy, Chronic Inflammatory Demyelinating | 7512691 18297634 | CTD | |
| 1812 | Post transplant diabetes mellitus | SIDER | ||
| 1813 | Posterior Leukoencephalopathy Syndrome |
12173578
12823354 12876250 12879959 16530436 18024699 18155524 18483659 18790253 18840131 19712604 19715529 19781881 20171145 20933182 | CTD | |
| 1814 | Postoperative Complications | 18400815 | CTD | |
| 1815 | Primary Graft Dysfunction | SIDER | ||
| 1816 | Product lot number issue | Canada Vigilance: 1 | Canada Vigilance | |
| 1817 | Prothrombin level decreased | SIDER | ||
| 1818 | Psychomotor skills impaired | SIDER | ||
| 1819 | Psychoses, Substance-Induced | 7511197 | CTD | |
| 1820 | Purpura, Thrombotic Thrombocytopenic | 18580733 18689275 | CTD | |
| 1821 | Putaminal Hemorrhage | 12695819 | CTD | |
| 1822 | Recurrence | 9636597 | CTD | |
| 1823 | Renal Artery Obstruction | 15388824 | CTD | |
| 1824 | Renal Insufficiency | CTD | ||
| 1825 | Reperfusion Injury | 9655420 12892836 | CTD | |
| 1826 | Respiratory Depression | SIDER | ||
| 1827 | Reticulocyte count decreased | OFFSIDES | ||
| 1828 | Retinal Diseases | 9660400 | CTD | |
| 1829 | Retinal vascular occlusion | OFFSIDES | ||
| 1830 | Seizures |
1721271
7512320 9386723 9606397 10528682 10918426 11750573 11868353 12072309 12823354 12879959 15451009 15452321 15919502 16382468 17095192 17360923 18024699 18155524 18840131 19862562 24283660 | CTD | |
| 1831 | Sensation of warmth | SIDER | ||
| 1832 | Septicemia | SIDER | ||
| 1833 | Shunt occlusion | OFFSIDES | ||
| 1834 | Sinus bradycardia | OFFSIDES | ||
| 1835 | Sinus polyp | OFFSIDES | ||
| 1836 | Skin Neoplasms | 25770929 | CTD | |
| 1837 | Skin carcinoma | SIDER | ||
| 1838 | Skin hypertrophy | OFFSIDES SIDER | ||
| 1839 | Skin laceration | Canada Vigilance: 1 | Canada Vigilance | |
| 1840 | Skin tightness | OFFSIDES | ||
| 1841 | Sleep Initiation and Maintenance Disorders | 11271222 12709079 | CTD | |
| 1842 | Speech Disorders | 7512320 16573841 | CTD | |
| 1843 | Speech and language abnormalities | SIDER | ||
| 1844 | Spermatic Cord Torsion | 18766458 | CTD | |
| 1845 | Sputum culture positive | Canada Vigilance: 1 | Canada Vigilance | |
| 1846 | Sweating | SIDER | ||
| 1847 | Swelling of eyelid | Canada Vigilance: 1 | Canada Vigilance | |
| 1848 | T-lymphocyte count increased | Canada Vigilance: 1 | Canada Vigilance | |
| 1849 | Tension | SIDER | ||
| 1850 | Testicular Diseases | 17785681 | CTD | |
| 1851 | Therapeutic product effect prolonged | Canada Vigilance: 1 | Canada Vigilance | |
| 1852 | Thrombophlebitis | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 1853 | Thrombotic Microangiopathies | CTD | ||
| 1854 | Torsades de Pointes | 1373538 9734501 | CTD | |
| 1855 | Urge Incontinence | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 1856 | Urinary abnormalities | SIDER | ||
| 1857 | Vaginal Diseases | 15284791 | CTD | |
| 1858 | Varicella zoster | SIDER | ||
| 1859 | Vascular Diseases | 9664955 11092348 19135948 | CTD | |
| 1860 | Vascular hypotensive disorders | SIDER | ||
| 1861 | Vasculitis, Central Nervous System | 15221068 | CTD | |
| 1862 | Venous thrombosis deep limb | SIDER | ||
| 1863 | Ventricular arrhythmia | SIDER | ||
| 1864 | Vesiculobullous rash | SIDER | ||
| 1865 | Viral test negative | Canada Vigilance: 1 | Canada Vigilance | |
| 1866 | Vision Disorders | 9855339 12072309 20233105 | CTD | |
| 1867 | Vulvar Diseases | 15284791 | CTD | |
| 1868 | Vulvovaginal mycotic infection | SIDER | ||
| 1869 | Warts | SIDER | ||
| 1870 | Weight Gain | 11443583 | CTD | |
| 1871 | Wheelchair user | Canada Vigilance: 1 | Canada Vigilance | |
| 1872 | Xerophthalmia | 20233105 | CTD | |
| 1873 | hypertensive nephropathy | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.