Lenalidomide
(GOTYRUGSSMKFNF-UHFFFAOYSA-N)
Structure
- SMILES
- O=C1CCC(C(=O)N1)N1Cc2c(C1=O)cccc2N
- Type(s)
- Approved
- ATC code(s)
- L04AX04
- Molecular Formula:
- C13H13N3O3
- Molecular Weight:
- 259.261
- Log P:
- 0.8777
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 2
- TPSA:
- 92.5
- CAS Number(s):
- 191732-72-6; 443912-14-9
Synonym(s)
1.
Lenalidomide
2.
2,6-Piperidinedione, 3-(4-amino-1,3-dihydro-1-oxo-2H- isoindol-2-yl)-
3.
3-(4-Amino-1-oxoisoindolin-2-yl)piperidine-2,6-dione
4.
CC 5013
5.
CC-5013
6.
CC5013
7.
IMiD3 Cpd
8.
Revimid
9.
Revlimid
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pneumonia | FAERS: 5028 Canada Vigilance: 208 | Canada Vigilance SIDER US FAERS | |
| 2 | Fatigue | FAERS: 3397 Canada Vigilance: 45 | 20385792 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 3 | Full blood count decreased | FAERS: 2392 Canada Vigilance: 14 | Canada Vigilance OFFSIDES US FAERS | |
| 4 | Thrombosis | FAERS: 2278 Canada Vigilance: 34 | CTD SIDER Canada Vigilance US FAERS | |
| 5 | White blood cell count decreased | FAERS: 2255 Canada Vigilance: 38 | Canada Vigilance US FAERS | |
| 6 | Multiple Myeloma | FAERS: 1981 |
12384400
16118317 16433596 16506632 16696148 16790586 16840727 17218586 17723971 17898564 18278812 19018868 19101782 19112817 20351701 20367570 20385792 20423566 20979938 23318440 23892921 25043012 26186254 29177954 | CTD OFFSIDES US FAERS |
| 7 | Asthenia | FAERS: 1834 Canada Vigilance: 30 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 8 | Nausea | FAERS: 1320 Canada Vigilance: 12 | Canada Vigilance SIDER US FAERS | |
| 9 | Drug ineffective | FAERS: 1309 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 10 | Disease Progression | FAERS: 1231 Canada Vigilance: 93 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 11 | Malaise | FAERS: 1165 Canada Vigilance: 32 | Canada Vigilance SIDER US FAERS | |
| 12 | Neutropenia | FAERS: 1165 Canada Vigilance: 19 | CTD SIDER Canada Vigilance US FAERS | |
| 13 | Dizziness | FAERS: 1148 Canada Vigilance: 21 | Canada Vigilance SIDER US FAERS | |
| 14 | Constipation | FAERS: 1114 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 15 | Unevaluable event | FAERS: 1044 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 16 | Dehydration | FAERS: 1023 Canada Vigilance: 19 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 17 | Infection | FAERS: 1013 Canada Vigilance: 22 | Canada Vigilance SIDER US FAERS | |
| 18 | Pruritus | FAERS: 1009 Canada Vigilance: 14 | Canada Vigilance SIDER US FAERS | |
| 19 | Sepsis | FAERS: 996 Canada Vigilance: 11 | Canada Vigilance SIDER US FAERS | |
| 20 | Pancytopenia | FAERS: 985 Canada Vigilance: 13 | Canada Vigilance SIDER US FAERS | |
| 21 | MYELODYSPLASTIC SYNDROME | FAERS: 958 Canada Vigilance: 17 | Canada Vigilance SIDER US FAERS | |
| 22 | Thrombocytopenia | FAERS: 883 Canada Vigilance: 15 | 17723971 19720904 20385792 | CTD SIDER Canada Vigilance US FAERS |
| 23 | Pain | FAERS: 852 Canada Vigilance: 18 | Canada Vigilance SIDER US FAERS | |
| 24 | Deep Vein Thrombosis | FAERS: 815 Canada Vigilance: 19 | Canada Vigilance SIDER US FAERS | |
| 25 | Cerebrovascular accident | FAERS: 777 Canada Vigilance: 22 | Canada Vigilance SIDER US FAERS | |
| 26 | Pulmonary Embolism | FAERS: 765 Canada Vigilance: 24 | 20052472 | CTD SIDER Canada Vigilance US FAERS |
| 27 | Peripheral swelling | FAERS: 741 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 28 | Vomiting | FAERS: 739 Canada Vigilance: 12 | Canada Vigilance SIDER US FAERS | |
| 29 | Weight decreased | FAERS: 737 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 30 | Urinary tract infection | FAERS: 721 Canada Vigilance: 18 | Canada Vigilance SIDER US FAERS | |
| 31 | Influenza | FAERS: 711 Canada Vigilance: 17 | Canada Vigilance SIDER US FAERS | |
| 32 | Myocardial Infarction | FAERS: 689 Canada Vigilance: 22 | Canada Vigilance SIDER US FAERS | |
| 33 | Back Pain | FAERS: 677 Canada Vigilance: 13 | Canada Vigilance SIDER US FAERS | |
| 34 | Drug dose omission | FAERS: 628 | US FAERS | |
| 35 | Nasopharyngitis | FAERS: 624 Canada Vigilance: 9 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 36 | Hypersensitivity | FAERS: 607 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 37 | Toxicity to various agents | FAERS: 587 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Hypotension | FAERS: 554 Canada Vigilance: 16 | Canada Vigilance SIDER US FAERS | |
| 39 | Atrial Fibrillation | FAERS: 540 Canada Vigilance: 14 | Canada Vigilance SIDER US FAERS | |
| 40 | Bronchitis | FAERS: 535 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 41 | Blood count abnormal | FAERS: 477 Canada Vigilance: 12 | Canada Vigilance OFFSIDES US FAERS | |
| 42 | Feeling abnormal | FAERS: 460 | SIDER US FAERS | |
| 43 | Headache | FAERS: 459 Canada Vigilance: 12 | Canada Vigilance SIDER US FAERS | |
| 44 | Chest Pain | FAERS: 441 Canada Vigilance: 7 | 20052472 | CTD SIDER Canada Vigilance US FAERS |
| 45 | Neutrophil count decreased | FAERS: 413 Canada Vigilance: 17 | Canada Vigilance OFFSIDES US FAERS | |
| 46 | Arthralgia | FAERS: 409 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 47 | Joint swelling | FAERS: 391 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 48 | Cataract | FAERS: 374 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 49 | Malignant neoplasm progression | FAERS: 374 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 50 | Arthropathy | FAERS: 364 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Memory impairment | FAERS: 361 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 52 | Urticaria | FAERS: 356 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 53 | Tremor | FAERS: 354 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 54 | Blood potassium decreased | FAERS: 334 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 55 | Dry skin | FAERS: 330 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 56 | Respiratory Failure | FAERS: 330 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 57 | Adverse event | FAERS: 321 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Abdominal Pain | FAERS: 319 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 59 | Cellulitis | FAERS: 304 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 60 | Sinusitis | FAERS: 301 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 61 | Syncope | FAERS: 294 Canada Vigilance: 13 | Canada Vigilance SIDER US FAERS | |
| 62 | Stomatitis | FAERS: 285 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 63 | Lymphoma | FAERS: 283 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 64 | Pulmonary thrombosis | FAERS: 277 Canada Vigilance: 6 | Canada Vigilance OFFSIDES US FAERS | |
| 65 | General physical health deterioration | FAERS: 274 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 66 | Dysgeusia | FAERS: 273 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 67 | Abdominal discomfort | FAERS: 258 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 68 | Cardiac Arrest | FAERS: 254 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 69 | Febrile Neutropenia | FAERS: 241 Canada Vigilance: 10 | Canada Vigilance SIDER US FAERS | |
| 70 | Somnolence | FAERS: 238 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 71 | Swelling | FAERS: 236 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Human chorionic gonadotropin increased | FAERS: 233 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 73 | Dementia | FAERS: 222 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 74 | Amnesia | FAERS: 221 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 75 | Epistaxis | FAERS: 220 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 76 | Alopecia | FAERS: 217 | SIDER US FAERS | |
| 77 | Bone pain | FAERS: 213 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 78 | Anxiety | FAERS: 208 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 79 | Diffuse Large B-Cell Lymphoma | FAERS: 208 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 80 | Back disorder | FAERS: 207 | US FAERS | |
| 81 | Blood human chorionic gonadotropin increased | FAERS: 206 | OFFSIDES US FAERS | |
| 82 | Oropharyngeal pain | FAERS: 206 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 83 | Septic Shock | FAERS: 204 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 84 | Blood creatinine increased | FAERS: 201 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 85 | Product dose omission | FAERS: 200 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 86 | Acute kidney injury | FAERS: 198 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 87 | Cytopenia | FAERS: 198 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 88 | Plasma cell myeloma recurrent | FAERS: 194 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 89 | Ageusia | FAERS: 192 | OFFSIDES SIDER US FAERS | |
| 90 | Chills | FAERS: 180 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 91 | Erythema | FAERS: 180 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 92 | Visual Impairment | FAERS: 179 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 93 | Dysphonia | FAERS: 177 | OFFSIDES SIDER US FAERS | |
| 94 | Intestinal Obstruction | FAERS: 176 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 95 | Myalgia | FAERS: 175 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 96 | Clostridium difficile infection | FAERS: 174 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 97 | Diabetes Mellitus | FAERS: 171 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 98 | Diverticulitis | FAERS: 169 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 99 | Colitis | FAERS: 152 | SIDER US FAERS | |
| 100 | Gout | FAERS: 149 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 101 | Blood glucose increased | FAERS: 148 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 102 | Fracture | FAERS: 146 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 103 | Abasia | FAERS: 145 | US FAERS | |
| 104 | Plasmacytoma | FAERS: 145 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 105 | Leukopenia | FAERS: 142 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 106 | Musculoskeletal stiffness | FAERS: 142 | SIDER US FAERS | |
| 107 | Hernia | FAERS: 141 | OFFSIDES US FAERS | |
| 108 | Deafness | FAERS: 139 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 109 | Mantle cell lymphoma | FAERS: 139 | US FAERS | |
| 110 | Asthma | FAERS: 138 | SIDER US FAERS | |
| 111 | Dyspepsia | FAERS: 133 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 112 | Nephrolithiasis | FAERS: 132 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 113 | Cystitis | FAERS: 131 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 114 | Full blood count increased | FAERS: 124 | US FAERS | |
| 115 | Squamous cell carcinoma of skin | FAERS: 122 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 116 | Night sweats | FAERS: 121 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 117 | Therapy non-responder | FAERS: 118 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 118 | Chest discomfort | FAERS: 117 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 119 | Cholelithiasis | FAERS: 116 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 120 | Lethargy | FAERS: 116 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 121 | Myelodysplastic syndrome transformation | FAERS: 116 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 122 | Flatulence | FAERS: 115 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 123 | Protein total increased | FAERS: 114 | US FAERS | |
| 124 | Musculoskeletal Pain | FAERS: 113 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 125 | Amyloidosis | FAERS: 106 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 126 | Basal cell carcinoma | FAERS: 101 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 127 | Burning sensation | FAERS: 101 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 128 | Nervousness | FAERS: 101 | SIDER US FAERS | |
| 129 | Multiple allergies | FAERS: 100 | US FAERS | |
| 130 | treatment failure | FAERS: 97 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 131 | Neck Pain | FAERS: 96 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 132 | Pericardial effusion | FAERS: 96 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 133 | Skin Ulcer | FAERS: 96 | US FAERS | |
| 134 | Rash erythematous | FAERS: 94 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 135 | Clostridium difficile colitis | FAERS: 92 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 136 | Limb injury | FAERS: 92 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 137 | Mental status changes | FAERS: 91 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 138 | Palpitations | FAERS: 90 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 139 | Lymphadenopathy | FAERS: 89 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 140 | Tinnitus | FAERS: 88 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 141 | Acute myocardial infarction | FAERS: 85 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 142 | Disorientation | FAERS: 85 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 143 | Failure to Thrive | FAERS: 85 | OFFSIDES US FAERS | |
| 144 | Skin lesion | FAERS: 83 | SIDER US FAERS | |
| 145 | Hypersomnia | FAERS: 82 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 146 | Arthritis | FAERS: 79 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 147 | Coronary Artery Disease | FAERS: 79 | US FAERS | |
| 148 | Limb discomfort | FAERS: 78 | US FAERS | |
| 149 | Dysuria | FAERS: 77 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 150 | Musculoskeletal chest pain | FAERS: 77 | US FAERS | |
| 151 | Osteomyelitis | FAERS: 77 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 152 | Therapy cessation | FAERS: 76 | US FAERS | |
| 153 | Increased tendency to bruise | FAERS: 75 | US FAERS | |
| 154 | Blood magnesium decreased | FAERS: 74 | US FAERS | |
| 155 | Productive Cough | FAERS: 74 | SIDER US FAERS | |
| 156 | Blindness | FAERS: 73 | SIDER US FAERS | |
| 157 | Monoclonal immunoglobulin present | FAERS: 73 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 158 | Pathological fracture | FAERS: 72 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 159 | Tachycardia | FAERS: 70 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 160 | Hypophagia | FAERS: 69 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 161 | Neuralgia | FAERS: 69 | 20385792 | CTD US FAERS |
| 162 | Hypoxia | FAERS: 68 | SIDER US FAERS | |
| 163 | Oral pain | FAERS: 67 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 164 | Pancreatitis | FAERS: 66 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 165 | Blood glucose decreased | FAERS: 64 | US FAERS | |
| 166 | Full blood count abnormal | FAERS: 64 | US FAERS | |
| 167 | Vertigo | FAERS: 63 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 168 | Compression fracture | FAERS: 62 | US FAERS | |
| 169 | jaundice | FAERS: 62 Canada Vigilance: 1 | 20011646 | CTD Canada Vigilance US FAERS |
| 170 | Flushing | FAERS: 61 | SIDER US FAERS | |
| 171 | Respiratory tract congestion | FAERS: 61 | US FAERS | |
| 172 | Immunosuppression | FAERS: 60 | US FAERS | |
| 173 | Respiratory distress | FAERS: 60 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 174 | Urinary Retention | FAERS: 60 | SIDER US FAERS | |
| 175 | Stevens-Johnson Syndrome | FAERS: 59 Canada Vigilance: 1 | 25811541 | CTD SIDER Canada Vigilance US FAERS |
| 176 | Toothache | FAERS: 59 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 177 | Joint injury | FAERS: 58 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 178 | Performance status decreased | FAERS: 58 | US FAERS | |
| 179 | Bradycardia | FAERS: 57 | SIDER US FAERS | |
| 180 | Platelet count abnormal | FAERS: 57 | US FAERS | |
| 181 | Anorexia | FAERS: 56 | SIDER US FAERS | |
| 182 | Gastrointestinal infection | FAERS: 55 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 183 | Pneumonitis | FAERS: 55 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 184 | Light chain analysis increased | FAERS: 54 | US FAERS | |
| 185 | Myelofibrosis | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 186 | Tooth Infection | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 187 | White blood cell count abnormal | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 188 | Angioedema | FAERS: 52 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 189 | Blood sodium decreased | FAERS: 52 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 190 | Bone lesion | FAERS: 52 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 191 | Wheezing | FAERS: 52 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 192 | Blood urine present | FAERS: 51 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 193 | Eye Infection | FAERS: 51 | US FAERS | |
| 194 | Feeling Cold | FAERS: 51 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 195 | Ankle Fracture | FAERS: 50 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 196 | Inflammation | FAERS: 49 | SIDER US FAERS | |
| 197 | Laceration | FAERS: 49 | SIDER US FAERS | |
| 198 | Embolism | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 199 | nervous system disorder | FAERS: 48 | SIDER US FAERS | |
| 200 | Respiratory arrest | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 201 | Splenomegaly | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 202 | Gait inability | FAERS: 46 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 203 | Haematotoxicity | FAERS: 46 | US FAERS | |
| 204 | Intestinal Perforation | FAERS: 46 | SIDER US FAERS | |
| 205 | Throat irritation | FAERS: 46 | US FAERS | |
| 206 | Disease complication | FAERS: 45 | US FAERS | |
| 207 | Electrolyte imbalance | FAERS: 45 | US FAERS | |
| 208 | Mental impairment | FAERS: 45 | US FAERS | |
| 209 | Protein total abnormal | FAERS: 45 | US FAERS | |
| 210 | Acute respiratory failure | FAERS: 44 | US FAERS | |
| 211 | Blood potassium increased | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 212 | Feeling jittery | FAERS: 44 | US FAERS | |
| 213 | Papule | FAERS: 44 | US FAERS | |
| 214 | Ulcer | FAERS: 44 | US FAERS | |
| 215 | Device related infection | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 216 | Osteonecrosis of Jaw | FAERS: 43 | US FAERS | |
| 217 | Skin reaction | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 218 | Sudden death | FAERS: 43 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 219 | Cyst | FAERS: 42 | SIDER US FAERS | |
| 220 | Discomfort | FAERS: 42 | SIDER US FAERS | |
| 221 | Glaucoma | FAERS: 42 | US FAERS | |
| 222 | Muscle strain | FAERS: 42 | OFFSIDES US FAERS | |
| 223 | Nerve injury | FAERS: 41 | US FAERS | |
| 224 | Unresponsive to stimuli | FAERS: 41 | US FAERS | |
| 225 | Viral upper respiratory tract infection | FAERS: 41 | OFFSIDES US FAERS | |
| 226 | Blood iron decreased | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 227 | Hepatotoxicity | FAERS: 40 | SIDER US FAERS | |
| 228 | Meningitis | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 229 | Aphonia | FAERS: 39 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 230 | Gastric ulcer | FAERS: 39 | US FAERS | |
| 231 | Urinary Incontinence | FAERS: 39 | SIDER US FAERS | |
| 232 | Acne | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 233 | Fluid overload | FAERS: 38 | US FAERS | |
| 234 | Lower respiratory tract infection | FAERS: 38 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 235 | Squamous cell carcinoma | FAERS: 38 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 236 | Atrial Flutter | FAERS: 37 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 237 | Lip swelling | FAERS: 37 | US FAERS | |
| 238 | Macular degeneration | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 239 | Osteolysis | FAERS: 37 | US FAERS | |
| 240 | Chromaturia | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 241 | Ileus | FAERS: 35 | US FAERS | |
| 242 | Malnutrition | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 243 | Osteoporosis | FAERS: 35 | SIDER US FAERS | |
| 244 | Ascites | FAERS: 34 | US FAERS | |
| 245 | Delirium | FAERS: 34 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 246 | Protein total decreased | FAERS: 34 | US FAERS | |
| 247 | Rotator cuff syndrome | FAERS: 34 | US FAERS | |
| 248 | Hypothyroidism | FAERS: 33 | SIDER US FAERS | |
| 249 | Pulmonary Fibrosis | FAERS: 33 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 250 | Abscess | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 251 | Disease recurrence | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 252 | Erectile dysfunction | FAERS: 32 | OFFSIDES SIDER US FAERS | |
| 253 | Lactose Intolerance | FAERS: 32 | US FAERS | |
| 254 | Muscle tightness | FAERS: 32 | US FAERS | |
| 255 | Petechiae | FAERS: 32 | SIDER US FAERS | |
| 256 | Presyncope | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 257 | Restlessness | FAERS: 32 | US FAERS | |
| 258 | Sluggishness | FAERS: 32 | US FAERS | |
| 259 | Agitation | FAERS: 31 | SIDER US FAERS | |
| 260 | Anosmia | FAERS: 31 | US FAERS | |
| 261 | Ear discomfort | FAERS: 31 | OFFSIDES SIDER US FAERS | |
| 262 | Eye pain | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 263 | Neutropenic sepsis | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 264 | Stress | FAERS: 31 | US FAERS | |
| 265 | Aphasia | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 266 | Hepatitis | FAERS: 30 | SIDER US FAERS | |
| 267 | Restless Legs Syndrome | FAERS: 30 | US FAERS | |
| 268 | Spinal column stenosis | FAERS: 30 | OFFSIDES US FAERS | |
| 269 | Angina Pectoris | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 270 | Diplopia | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 271 | Gastritis | FAERS: 29 | SIDER US FAERS | |
| 272 | Hyperthyroidism | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 273 | Inappropriate schedule of drug administration | FAERS: 29 | US FAERS | |
| 274 | Joint stiffness | FAERS: 29 | SIDER US FAERS | |
| 275 | furuncle | FAERS: 29 | SIDER US FAERS | |
| 276 | Blood potassium abnormal | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 277 | Cerebral disorder | FAERS: 28 | OFFSIDES US FAERS | |
| 278 | Depressed mood | FAERS: 28 | OFFSIDES US FAERS | |
| 279 | Eye irritation | FAERS: 28 | SIDER US FAERS | |
| 280 | Onychoclasis | FAERS: 28 | US FAERS | |
| 281 | Pancreatic carcinoma | FAERS: 28 | US FAERS | |
| 282 | Pericarditis | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 283 | Alanine Aminotransferase Increased | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 284 | Blood glucose abnormal | FAERS: 27 | US FAERS | |
| 285 | Drug toxicity | FAERS: 27 | US FAERS | |
| 286 | Exfoliative rash | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 287 | Incontinence | FAERS: 27 | SIDER US FAERS | |
| 288 | Lobar Pneumonia | FAERS: 27 | SIDER US FAERS | |
| 289 | Oral infection | FAERS: 27 | SIDER US FAERS | |
| 290 | Sciatica | FAERS: 27 | SIDER US FAERS | |
| 291 | Blood urea increased | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 292 | Cholecystitis infective | FAERS: 26 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 293 | Pregnancy of partner | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 294 | Renal pain | FAERS: 26 | US FAERS | |
| 295 | Appendicitis | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 296 | Carpal Tunnel Syndrome | FAERS: 25 | US FAERS | |
| 297 | Cold sweat | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 298 | Conjunctivitis | FAERS: 25 | SIDER US FAERS | |
| 299 | Hepatitis C | FAERS: 25 | US FAERS | |
| 300 | Large intestine perforation | FAERS: 25 | US FAERS | |
| 301 | Therapy change | FAERS: 25 | US FAERS | |
| 302 | Venous Thrombosis | FAERS: 25 | CTD US FAERS | |
| 303 | Blood immunoglobulin G increased | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 304 | Dysarthria | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 305 | Gastric infection | FAERS: 24 | OFFSIDES US FAERS | |
| 306 | Laryngitis | FAERS: 24 | US FAERS | |
| 307 | No adverse event | FAERS: 24 | US FAERS | |
| 308 | Activities of daily living impaired | FAERS: 23 | US FAERS | |
| 309 | Aortic Aneurysm | FAERS: 23 | US FAERS | |
| 310 | Atelectasis | FAERS: 23 | US FAERS | |
| 311 | Atrioventricular Block | FAERS: 23 | US FAERS | |
| 312 | Blood human chorionic gonadotropin abnormal | FAERS: 23 | US FAERS | |
| 313 | Completed Suicide | FAERS: 23 | US FAERS | |
| 314 | Incoherent | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 315 | Irritable Bowel Syndrome | FAERS: 23 | SIDER US FAERS | |
| 316 | Psoriasis | FAERS: 23 | US FAERS | |
| 317 | Pulmonary Hypertension | FAERS: 23 | SIDER US FAERS | |
| 318 | Quality of life decreased | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 319 | Skin irritation | FAERS: 23 | SIDER US FAERS | |
| 320 | Vasculitis | FAERS: 23 | US FAERS | |
| 321 | Vitreous floaters | FAERS: 23 | US FAERS | |
| 322 | Wound Infection | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 323 | Bedridden | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 324 | Blood creatinine abnormal | FAERS: 22 | US FAERS | |
| 325 | Bronchopneumonia | FAERS: 22 | US FAERS | |
| 326 | Cholecystitis | FAERS: 22 | SIDER US FAERS | |
| 327 | Dental caries | FAERS: 22 | US FAERS | |
| 328 | Depressed Level of Consciousness | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 329 | Gastrointestinal motility disorder | FAERS: 22 | US FAERS | |
| 330 | Pulmonary congestion | FAERS: 22 | US FAERS | |
| 331 | Aphagia | FAERS: 21 | US FAERS | |
| 332 | Aspartate Aminotransferase Increased | FAERS: 21 | SIDER US FAERS | |
| 333 | Blood alkaline phosphatase increased | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 334 | Blood electrolytes decreased | FAERS: 21 | US FAERS | |
| 335 | Blood pressure fluctuation | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 336 | Blood testosterone decreased | FAERS: 21 | US FAERS | |
| 337 | Dermatitis | FAERS: 21 | SIDER US FAERS | |
| 338 | Escherichia infection | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 339 | Food Poisoning | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 340 | Gastrointestinal Pain | FAERS: 21 | SIDER US FAERS | |
| 341 | Neutrophil count abnormal | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 342 | Overdose | FAERS: 21 | US FAERS | |
| 343 | Pneumothorax | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 344 | Post procedural complication | FAERS: 21 | US FAERS | |
| 345 | Pregnancy test false positive | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 346 | Pregnancy | FAERS: 21 | US FAERS | |
| 347 | Renal Cell Carcinoma | FAERS: 21 | US FAERS | |
| 348 | Blast cell count increased | FAERS: 20 | US FAERS | |
| 349 | Cardiac Flutter | FAERS: 20 | US FAERS | |
| 350 | Drug administration error | FAERS: 20 | US FAERS | |
| 351 | Hepatomegaly | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 352 | Incorrect dose administered | FAERS: 20 | US FAERS | |
| 353 | Mood swings | FAERS: 20 | SIDER US FAERS | |
| 354 | Sneezing | FAERS: 20 | US FAERS | |
| 355 | Upper-airway cough syndrome | FAERS: 20 | US FAERS | |
| 356 | VIIth nerve paralysis | FAERS: 20 | US FAERS | |
| 357 | Blood calcium abnormal | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 358 | Bowel movement irregularity | FAERS: 19 | US FAERS | |
| 359 | Cachexia | FAERS: 19 | US FAERS | |
| 360 | Cerebral Infarction | FAERS: 19 | SIDER US FAERS | |
| 361 | Emotional disorder | FAERS: 19 | US FAERS | |
| 362 | Gastroenteritis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 363 | Iron deficiency | FAERS: 19 | US FAERS | |
| 364 | Light chain analysis abnormal | FAERS: 19 | OFFSIDES US FAERS | |
| 365 | Myeloma recurrence | FAERS: 19 | US FAERS | |
| 366 | Polyneuropathy | FAERS: 19 | SIDER US FAERS | |
| 367 | Poor quality sleep | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 368 | Purpura | FAERS: 19 | US FAERS | |
| 369 | Tooth Loss | FAERS: 19 | US FAERS | |
| 370 | Aneurysm | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 371 | Arthropod bite | FAERS: 18 | US FAERS | |
| 372 | Blood cholesterol increased | FAERS: 18 | US FAERS | |
| 373 | Decreased immune responsiveness | FAERS: 18 | US FAERS | |
| 374 | Diverticulum | FAERS: 18 | OFFSIDES SIDER US FAERS | |
| 375 | Gangrene | FAERS: 18 | US FAERS | |
| 376 | Hemiparesis | FAERS: 18 | US FAERS | |
| 377 | Leukocytosis | FAERS: 18 | US FAERS | |
| 378 | No adverse effect | FAERS: 18 | US FAERS | |
| 379 | Nodule | FAERS: 18 | SIDER US FAERS | |
| 380 | Pain of skin | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 381 | Agranulocytosis | FAERS: 17 | SIDER US FAERS | |
| 382 | Bone marrow toxicity | FAERS: 17 | OFFSIDES US FAERS | |
| 383 | Creatinine renal clearance decreased | FAERS: 17 | US FAERS | |
| 384 | Disseminated Intravascular Coagulation | FAERS: 17 | US FAERS | |
| 385 | Eczema | FAERS: 17 | SIDER US FAERS | |
| 386 | Hip surgery | FAERS: 17 | US FAERS | |
| 387 | Immobile | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 388 | Musculoskeletal discomfort | FAERS: 17 | OFFSIDES SIDER US FAERS | |
| 389 | Peritonitis | FAERS: 17 | US FAERS | |
| 390 | Phlebitis | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 391 | Poor peripheral circulation | FAERS: 17 | US FAERS | |
| 392 | Pulmonary toxicity | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 393 | Rhinitis | FAERS: 17 | SIDER US FAERS | |
| 394 | Temperature intolerance | FAERS: 17 | US FAERS | |
| 395 | Ataxia | FAERS: 16 | OFFSIDES SIDER US FAERS | |
| 396 | Blood lactate dehydrogenase increased | FAERS: 16 | US FAERS | |
| 397 | Ejection Fraction Decreased | FAERS: 16 | US FAERS | |
| 398 | Hordeolum | FAERS: 16 | SIDER US FAERS | |
| 399 | Hypogeusia | FAERS: 16 | US FAERS | |
| 400 | Nasal discomfort | FAERS: 16 | US FAERS | |
| 401 | Pharyngitis | FAERS: 16 | SIDER US FAERS | |
| 402 | Procedural complication | FAERS: 16 | US FAERS | |
| 403 | Secretion discharge | FAERS: 16 | US FAERS | |
| 404 | Shock | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 405 | Terminal state | FAERS: 16 | US FAERS | |
| 406 | Toxic Epidermal Necrolysis | FAERS: 16 | SIDER US FAERS | |
| 407 | Tympanic Membrane Perforation | FAERS: 16 | US FAERS | |
| 408 | Blood blister | FAERS: 15 | US FAERS | |
| 409 | Candidiasis | FAERS: 15 | US FAERS | |
| 410 | Cardiac Death | FAERS: 15 | OFFSIDES US FAERS | |
| 411 | Diverticular perforation | FAERS: 15 | US FAERS | |
| 412 | Head discomfort | FAERS: 15 | US FAERS | |
| 413 | Invasive Ductal Breast Carcinoma | FAERS: 15 | US FAERS | |
| 414 | Metabolic acidosis | FAERS: 15 | US FAERS | |
| 415 | Mouth swelling | FAERS: 15 | US FAERS | |
| 416 | Myopathy | FAERS: 15 | US FAERS | |
| 417 | Nocturia | FAERS: 15 | OFFSIDES US FAERS | |
| 418 | Product physical issue | FAERS: 15 | US FAERS | |
| 419 | Rhabdomyolysis | FAERS: 15 | SIDER US FAERS | |
| 420 | Scab | FAERS: 15 | US FAERS | |
| 421 | Blood creatine increased | FAERS: 14 | US FAERS | |
| 422 | Cancer Pain | FAERS: 14 | OFFSIDES US FAERS | |
| 423 | Cardiomegaly | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 424 | Drug resistance | FAERS: 14 | US FAERS | |
| 425 | Ecchymosis | FAERS: 14 | SIDER US FAERS | |
| 426 | Loss of personal independence in daily activities | FAERS: 14 | US FAERS | |
| 427 | Neuropathy | FAERS: 14 | SIDER US FAERS | |
| 428 | Pallor | FAERS: 14 | US FAERS | |
| 429 | Peripheral arterial occlusive disease | FAERS: 14 | OFFSIDES US FAERS | |
| 430 | Pleurisy | FAERS: 14 | US FAERS | |
| 431 | Pseudomonal sepsis | FAERS: 14 | US FAERS | |
| 432 | Retinal Detachment | FAERS: 14 | US FAERS | |
| 433 | Skeletal injury | FAERS: 14 | US FAERS | |
| 434 | Skin toxicity | FAERS: 14 | US FAERS | |
| 435 | Thermal burn | FAERS: 14 | US FAERS | |
| 436 | Transaminases increased | FAERS: 14 | US FAERS | |
| 437 | Accidental overdose | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 438 | Acute Coronary Syndrome | FAERS: 13 | SIDER US FAERS | |
| 439 | Blood creatinine decreased | FAERS: 13 | US FAERS | |
| 440 | Blood immunoglobulin A increased | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 441 | Blood iron increased | FAERS: 13 | US FAERS | |
| 442 | Eructation | FAERS: 13 | US FAERS | |
| 443 | Gastrointestinal toxicity | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 444 | Intracranial Aneurysm | FAERS: 13 | US FAERS | |
| 445 | Lyme Disease | FAERS: 13 | US FAERS | |
| 446 | Thirst | FAERS: 13 | US FAERS | |
| 447 | Thrombophlebitis | FAERS: 13 | SIDER US FAERS | |
| 448 | Tooth Extraction | FAERS: 13 | US FAERS | |
| 449 | Vital functions abnormal | FAERS: 13 | US FAERS | |
| 450 | Bacterial sepsis | FAERS: 12 | US FAERS | |
| 451 | Blood phosphorus decreased | FAERS: 12 | OFFSIDES US FAERS | |
| 452 | Bronchopulmonary Aspergillosis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 453 | Catheter site infection | FAERS: 12 | US FAERS | |
| 454 | Cerebral Thrombosis | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 455 | Endocarditis | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 456 | Feeling of body temperature change | FAERS: 12 | US FAERS | |
| 457 | Gingivitis | FAERS: 12 | US FAERS | |
| 458 | Retching | FAERS: 12 | US FAERS | |
| 459 | Rheumatoid Arthritis | FAERS: 12 | US FAERS | |
| 460 | Subcutaneous Abscess | FAERS: 12 | US FAERS | |
| 461 | Uterine Cancer | FAERS: 12 | US FAERS | |
| 462 | Ventricular Fibrillation | FAERS: 12 | US FAERS | |
| 463 | Aphthous Stomatitis | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 464 | Asthenopia | FAERS: 11 | OFFSIDES US FAERS | |
| 465 | Atypical pneumonia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 466 | Colon adenoma | FAERS: 11 | US FAERS | |
| 467 | Escherichia sepsis | FAERS: 11 | US FAERS | |
| 468 | Febrile bone marrow aplasia | FAERS: 11 | US FAERS | |
| 469 | General physical condition abnormal | FAERS: 11 | US FAERS | |
| 470 | Graft versus host disease in skin | FAERS: 11 | US FAERS | |
| 471 | Hepatitis B | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 472 | Intervertebral disc disorder | FAERS: 11 | US FAERS | |
| 473 | Marasmus | FAERS: 11 | US FAERS | |
| 474 | Medication Error | FAERS: 11 | US FAERS | |
| 475 | Obstruction | FAERS: 11 | US FAERS | |
| 476 | Osteopenia | FAERS: 11 | SIDER US FAERS | |
| 477 | Pharyngolaryngeal Pain | FAERS: 11 | US FAERS | |
| 478 | Post procedural infection | FAERS: 11 | US FAERS | |
| 479 | Precancerous skin lesion | FAERS: 11 | US FAERS | |
| 480 | Protein urine present | FAERS: 11 | US FAERS | |
| 481 | Spinal column injury | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 482 | Sunburn | FAERS: 11 | US FAERS | |
| 483 | Tongue discomfort | FAERS: 11 | US FAERS | |
| 484 | Transfusion Reaction | FAERS: 11 | SIDER US FAERS | |
| 485 | Tuberculosis | FAERS: 11 | US FAERS | |
| 486 | skin abrasion | FAERS: 11 | US FAERS | |
| 487 | Arterial thrombosis | FAERS: 10 | US FAERS | |
| 488 | Arteriosclerosis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 489 | Benign Prostatic Hyperplasia | FAERS: 10 | OFFSIDES US FAERS | |
| 490 | Biopsy bone marrow abnormal | FAERS: 10 | OFFSIDES US FAERS | |
| 491 | Bronchiectasis | FAERS: 10 | US FAERS | |
| 492 | Bursitis | FAERS: 10 | US FAERS | |
| 493 | Cheilitis | FAERS: 10 | US FAERS | |
| 494 | Cholestasis | FAERS: 10 | SIDER US FAERS | |
| 495 | Eosinophilia | FAERS: 10 | US FAERS | |
| 496 | Erythema Multiforme | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 497 | Facial paralysis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 498 | Increased upper airway secretion | FAERS: 10 | US FAERS | |
| 499 | Iron Overload | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 500 | Neutropenic infection | FAERS: 10 | US FAERS | |
| 501 | Non-cardiac chest pain | FAERS: 10 | US FAERS | |
| 502 | Proteinuria | FAERS: 10 | US FAERS | |
| 503 | Renal mass | FAERS: 10 | SIDER US FAERS | |
| 504 | Sexual Dysfunction | FAERS: 10 | US FAERS | |
| 505 | Sudden Cardiac Death | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 506 | Urine human chorionic gonadotropin positive | FAERS: 10 | OFFSIDES US FAERS | |
| 507 | Accidental exposure to product | FAERS: 9 | US FAERS | |
| 508 | Anger | FAERS: 9 | US FAERS | |
| 509 | Animal bite | FAERS: 9 | US FAERS | |
| 510 | Anorectal discomfort | FAERS: 9 | US FAERS | |
| 511 | Bladder prolapse | FAERS: 9 | OFFSIDES US FAERS | |
| 512 | Blepharospasm | FAERS: 9 | US FAERS | |
| 513 | Blood glucose fluctuation | FAERS: 9 | OFFSIDES US FAERS | |
| 514 | Blood phosphorus increased | FAERS: 9 | US FAERS | |
| 515 | Blood sodium abnormal | FAERS: 9 | US FAERS | |
| 516 | Crying | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 517 | Dermatitis acneiform | FAERS: 9 | US FAERS | |
| 518 | Diffuse large B-cell lymphoma refractory | FAERS: 9 | US FAERS | |
| 519 | Gamma-Glutamyltransferase Increased | FAERS: 9 | US FAERS | |
| 520 | Gingival Recession | FAERS: 9 | US FAERS | |
| 521 | Hyperkeratosis | FAERS: 9 | OFFSIDES US FAERS | |
| 522 | Hyperviscosity syndrome | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 523 | Immune thrombocytopenic purpura | FAERS: 9 | US FAERS | |
| 524 | Impaired gastric emptying | FAERS: 9 | US FAERS | |
| 525 | Intervertebral Disc Degeneration | FAERS: 9 | US FAERS | |
| 526 | Medical device complication | FAERS: 9 | US FAERS | |
| 527 | Metastatic Neoplasm | FAERS: 9 | US FAERS | |
| 528 | Nephrotic Syndrome | FAERS: 9 | US FAERS | |
| 529 | Oral mucosal eruption | FAERS: 9 | US FAERS | |
| 530 | Personality Change | FAERS: 9 | US FAERS | |
| 531 | Photophobia | FAERS: 9 | US FAERS | |
| 532 | Pleuritic pain | FAERS: 9 | US FAERS | |
| 533 | Pyoderma Gangrenosum | FAERS: 9 | OFFSIDES US FAERS | |
| 534 | Thrombocytosis | FAERS: 9 | US FAERS | |
| 535 | Urine human chorionic gonadotropin abnormal | FAERS: 9 | OFFSIDES US FAERS | |
| 536 | Venous thrombosis limb | FAERS: 9 | US FAERS | |
| 537 | Abdominal Infection | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 538 | Adenocarcinoma | FAERS: 8 | US FAERS | |
| 539 | Altered state of consciousness | FAERS: 8 | SIDER US FAERS | |
| 540 | Anal squamous cell carcinoma | FAERS: 8 | US FAERS | |
| 541 | Blood albumin decreased | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 542 | Blood human chorionic gonadotropin | FAERS: 8 | OFFSIDES US FAERS | |
| 543 | Blood stem cell transplant failure | FAERS: 8 | US FAERS | |
| 544 | Central nervous system lesion | FAERS: 8 | US FAERS | |
| 545 | Creatinine renal clearance increased | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 546 | Cytolytic hepatitis | FAERS: 8 | SIDER US FAERS | |
| 547 | Drug exposure during pregnancy | FAERS: 8 | US FAERS | |
| 548 | Ear congestion | FAERS: 8 | US FAERS | |
| 549 | Electrocardiogram abnormal | FAERS: 8 | US FAERS | |
| 550 | Exophthalmos | FAERS: 8 | US FAERS | |
| 551 | Febrile infection | FAERS: 8 | OFFSIDES US FAERS | |
| 552 | Formication | FAERS: 8 | US FAERS | |
| 553 | Gastrointestinal sounds abnormal | FAERS: 8 | US FAERS | |
| 554 | Guillain-Barre Syndrome | FAERS: 8 | US FAERS | |
| 555 | Lymphopenia | FAERS: 8 | 20385792 | CTD SIDER US FAERS |
| 556 | Meningioma | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 557 | Oral candidiasis | FAERS: 8 | SIDER US FAERS | |
| 558 | Paranasal sinus hypersecretion | FAERS: 8 | US FAERS | |
| 559 | Sinus headache | FAERS: 8 | OFFSIDES US FAERS | |
| 560 | Skin laceration | FAERS: 8 | US FAERS | |
| 561 | Splenic Infarction | FAERS: 8 | SIDER US FAERS | |
| 562 | Supraventricular tachycardia | FAERS: 8 | SIDER US FAERS | |
| 563 | Therapeutic response unexpected | FAERS: 8 | US FAERS | |
| 564 | Trismus | FAERS: 8 | US FAERS | |
| 565 | Troponin increased | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 566 | Wound infection staphylococcal | FAERS: 8 | US FAERS | |
| 567 | prostatitis | FAERS: 8 | US FAERS | |
| 568 | Abdominal mass | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 569 | Acute graft versus host disease in skin | FAERS: 7 | US FAERS | |
| 570 | Anuria | FAERS: 7 | US FAERS | |
| 571 | Blood immunoglobulin G decreased | FAERS: 7 | US FAERS | |
| 572 | Blood iron abnormal | FAERS: 7 | US FAERS | |
| 573 | Blood magnesium abnormal | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 574 | Blood pressure inadequately controlled | FAERS: 7 | US FAERS | |
| 575 | Brain Abscess | FAERS: 7 | OFFSIDES US FAERS | |
| 576 | Catatonia | FAERS: 7 | US FAERS | |
| 577 | Choking | FAERS: 7 | US FAERS | |
| 578 | Delusional disorder, unspecified type | FAERS: 7 | US FAERS | |
| 579 | Device malfunction | FAERS: 7 | US FAERS | |
| 580 | Drug dispensing error | FAERS: 7 | US FAERS | |
| 581 | Encephalitis | FAERS: 7 | US FAERS | |
| 582 | Enterococcal infection | FAERS: 7 | US FAERS | |
| 583 | Enterocolitis | FAERS: 7 | US FAERS | |
| 584 | Epigastric discomfort | FAERS: 7 | US FAERS | |
| 585 | Escherichia urinary tract infection | FAERS: 7 | US FAERS | |
| 586 | Eyelid margin crusting | FAERS: 7 | US FAERS | |
| 587 | Flank Pain | FAERS: 7 | US FAERS | |
| 588 | Gastrointestinal carcinoma | FAERS: 7 | US FAERS | |
| 589 | Gastrointestinal perforation | FAERS: 7 | US FAERS | |
| 590 | Gastrointestinal viral infection | FAERS: 7 | US FAERS | |
| 591 | General symptom | FAERS: 7 | US FAERS | |
| 592 | Glossitis | FAERS: 7 | US FAERS | |
| 593 | Granulocyte count decreased | FAERS: 7 | US FAERS | |
| 594 | Intestinal infarction | FAERS: 7 | US FAERS | |
| 595 | Limb mass | FAERS: 7 | US FAERS | |
| 596 | Multi-organ disorder | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 597 | Myelocytosis | FAERS: 7 | OFFSIDES US FAERS | |
| 598 | Myoclonus | FAERS: 7 | US FAERS | |
| 599 | Pneumocystis jiroveci pneumonia | FAERS: 7 | US FAERS | |
| 600 | Radiation injury | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 601 | Renal cyst | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 602 | Rosacea | FAERS: 7 | US FAERS | |
| 603 | Sarcoma | FAERS: 7 | US FAERS | |
| 604 | Skin tightness | FAERS: 7 | US FAERS | |
| 605 | Splenic Rupture | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 606 | Suicide attempt | FAERS: 7 | US FAERS | |
| 607 | Synovial Cyst | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 608 | Therapeutic product effect decreased | FAERS: 7 | US FAERS | |
| 609 | Thrombosis in device | FAERS: 7 | US FAERS | |
| 610 | Tongue blistering | FAERS: 7 | OFFSIDES US FAERS | |
| 611 | Upper respiratory tract congestion | FAERS: 7 | US FAERS | |
| 612 | Urinary tract obstruction | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 613 | Uterine Prolapse | FAERS: 7 | US FAERS | |
| 614 | Vertebral column mass | FAERS: 7 | US FAERS | |
| 615 | Vitamin D Deficiency | FAERS: 7 | US FAERS | |
| 616 | Abdominal Abscess | FAERS: 6 | US FAERS | |
| 617 | Accidental exposure | FAERS: 6 | US FAERS | |
| 618 | Aortic Valve Stenosis | FAERS: 6 | SIDER US FAERS | |
| 619 | Blood immunoglobulin M decreased | FAERS: 6 | US FAERS | |
| 620 | Blood immunoglobulin M increased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 621 | Bradyphrenia | FAERS: 6 | US FAERS | |
| 622 | Bronchospasm | FAERS: 6 | US FAERS | |
| 623 | Catheter related infection | FAERS: 6 | US FAERS | |
| 624 | Diabetic Foot | FAERS: 6 | US FAERS | |
| 625 | Eating disorder symptom | FAERS: 6 | US FAERS | |
| 626 | Embolic stroke | FAERS: 6 | US FAERS | |
| 627 | Emotional distress | FAERS: 6 | US FAERS | |
| 628 | Epilepsy | FAERS: 6 | US FAERS | |
| 629 | Eye inflammation | FAERS: 6 | US FAERS | |
| 630 | Fluid imbalance | FAERS: 6 | US FAERS | |
| 631 | Gastrointestinal inflammation | FAERS: 6 | US FAERS | |
| 632 | Glioblastoma Multiforme | FAERS: 6 | SIDER US FAERS | |
| 633 | Graft versus host disease in liver | FAERS: 6 | US FAERS | |
| 634 | Hemiplegia | FAERS: 6 | US FAERS | |
| 635 | Hepatic Infection | FAERS: 6 | US FAERS | |
| 636 | Hypokinesia | FAERS: 6 | US FAERS | |
| 637 | Immunoglobulins abnormal | FAERS: 6 | US FAERS | |
| 638 | Impaired driving ability | FAERS: 6 | US FAERS | |
| 639 | Infectious colitis | FAERS: 6 | US FAERS | |
| 640 | Ligament rupture | FAERS: 6 | OFFSIDES US FAERS | |
| 641 | Loose tooth | FAERS: 6 | OFFSIDES US FAERS | |
| 642 | Meniscus injury | FAERS: 6 | US FAERS | |
| 643 | Metastasis | FAERS: 6 | US FAERS | |
| 644 | Miliaria | FAERS: 6 | US FAERS | |
| 645 | Multiple Sclerosis | FAERS: 6 | US FAERS | |
| 646 | Muscle Fatigue | FAERS: 6 | US FAERS | |
| 647 | Muscle Rigidity | FAERS: 6 | US FAERS | |
| 648 | Mycosis Fungoides | FAERS: 6 | US FAERS | |
| 649 | Myocarditis | FAERS: 6 | US FAERS | |
| 650 | Myositis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 651 | No adverse drug reaction | FAERS: 6 | US FAERS | |
| 652 | Noninfective gingivitis | FAERS: 6 | US FAERS | |
| 653 | Osteitis | FAERS: 6 | US FAERS | |
| 654 | POEMS Syndrome | FAERS: 6 | US FAERS | |
| 655 | Paraplegia | FAERS: 6 | US FAERS | |
| 656 | Pelvic Pain | FAERS: 6 | SIDER US FAERS | |
| 657 | Peripheral artery thrombosis | FAERS: 6 | US FAERS | |
| 658 | Pregnancy test positive | FAERS: 6 | US FAERS | |
| 659 | Pulmonary sepsis | FAERS: 6 | US FAERS | |
| 660 | Quadriplegia | FAERS: 6 | US FAERS | |
| 661 | Respiratory tract infection viral | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 662 | Sick Sinus Syndrome | FAERS: 6 | US FAERS | |
| 663 | Sinus Tachycardia | FAERS: 6 | US FAERS | |
| 664 | Skin Wrinkling | FAERS: 6 | US FAERS | |
| 665 | Spondylitis | FAERS: 6 | US FAERS | |
| 666 | Thoracic vertebral fracture | FAERS: 6 | US FAERS | |
| 667 | Thyroiditis | FAERS: 6 | US FAERS | |
| 668 | Transplant | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 669 | Umbilical hernia | FAERS: 6 | OFFSIDES US FAERS | |
| 670 | Urine flow decreased | FAERS: 6 | OFFSIDES US FAERS | |
| 671 | Vascular occlusion | FAERS: 6 | US FAERS | |
| 672 | 5q-syndrome | FAERS: 5 | OFFSIDES US FAERS | |
| 673 | Acute graft versus host disease in intestine | FAERS: 5 | US FAERS | |
| 674 | Ammonia increased | FAERS: 5 | US FAERS | |
| 675 | Apathy | FAERS: 5 | US FAERS | |
| 676 | Arthropod sting | FAERS: 5 | US FAERS | |
| 677 | Auricular swelling | FAERS: 5 | OFFSIDES US FAERS | |
| 678 | Bladder Neoplasm | FAERS: 5 | US FAERS | |
| 679 | Blood immunoglobulin A decreased | FAERS: 5 | US FAERS | |
| 680 | Blood product transfusion dependent | FAERS: 5 | US FAERS | |
| 681 | Blood triglycerides increased | FAERS: 5 | US FAERS | |
| 682 | Bone density decreased | FAERS: 5 | US FAERS | |
| 683 | Bowen's Disease | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 684 | Bronchiolitis | FAERS: 5 | US FAERS | |
| 685 | Calcium deficiency | FAERS: 5 | US FAERS | |
| 686 | Candida sepsis | FAERS: 5 | US FAERS | |
| 687 | Concomitant disease progression | FAERS: 5 | US FAERS | |
| 688 | Diabetes mellitus inadequate control | FAERS: 5 | US FAERS | |
| 689 | Dialysis related complication | FAERS: 5 | US FAERS | |
| 690 | Drug Tolerance | FAERS: 5 | US FAERS | |
| 691 | Enterovesical Fistula | FAERS: 5 | US FAERS | |
| 692 | Enzyme level increased | FAERS: 5 | US FAERS | |
| 693 | Extra dose administered | FAERS: 5 | US FAERS | |
| 694 | Fibromyalgia | FAERS: 5 | US FAERS | |
| 695 | Frustration tolerance decreased | FAERS: 5 | US FAERS | |
| 696 | Gastrointestinal obstruction | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 697 | Gastrointestinal stoma complication | FAERS: 5 | US FAERS | |
| 698 | Hepatic Encephalopathy | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 699 | Histiocytosis haematophagic | FAERS: 5 | US FAERS | |
| 700 | Hormone level abnormal | FAERS: 5 | US FAERS | |
| 701 | Hospice Care | FAERS: 5 | US FAERS | |
| 702 | Hunger | FAERS: 5 | US FAERS | |
| 703 | Hydrocephalus | FAERS: 5 | US FAERS | |
| 704 | Hydronephrosis | FAERS: 5 | OFFSIDES US FAERS | |
| 705 | Impaired work ability | FAERS: 5 | US FAERS | |
| 706 | Infarction | FAERS: 5 | US FAERS | |
| 707 | Laziness | FAERS: 5 | US FAERS | |
| 708 | Lymphadenitis | FAERS: 5 | US FAERS | |
| 709 | Lymphocyte count decreased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 710 | Mantle cell lymphoma recurrent | FAERS: 5 | US FAERS | |
| 711 | Mantle cell lymphoma refractory | FAERS: 5 | US FAERS | |
| 712 | Maternal exposure during pregnancy | FAERS: 5 | US FAERS | |
| 713 | Narcolepsy | FAERS: 5 | US FAERS | |
| 714 | Nerve Root Compression | FAERS: 5 | OFFSIDES US FAERS | |
| 715 | Obesity | FAERS: 5 | US FAERS | |
| 716 | Ocular discomfort | FAERS: 5 | US FAERS | |
| 717 | Onychomycosis | FAERS: 5 | US FAERS | |
| 718 | Oral mucosal erythema | FAERS: 5 | US FAERS | |
| 719 | Parotitis | FAERS: 5 | US FAERS | |
| 720 | Peripheral motor neuropathy | FAERS: 5 | SIDER US FAERS | |
| 721 | Pneumococcal sepsis | FAERS: 5 | OFFSIDES US FAERS | |
| 722 | Polyuria | FAERS: 5 | OFFSIDES US FAERS | |
| 723 | Pyelonephritis | FAERS: 5 | US FAERS | |
| 724 | Renal tubular necrosis | FAERS: 5 | SIDER US FAERS | |
| 725 | Rheumatic Fever | FAERS: 5 | OFFSIDES US FAERS | |
| 726 | Sickle Cell Trait | FAERS: 5 | US FAERS | |
| 727 | Sinus operation | FAERS: 5 | US FAERS | |
| 728 | Small intestine carcinoma | FAERS: 5 | US FAERS | |
| 729 | Squamous cell carcinoma of lung | FAERS: 5 | US FAERS | |
| 730 | Swelling of eyelid | FAERS: 5 | US FAERS | |
| 731 | Systemic Inflammatory Response Syndrome | FAERS: 5 | US FAERS | |
| 732 | T-Cell Lymphoma | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 733 | Tachyphrenia | FAERS: 5 | US FAERS | |
| 734 | Temporal Arteritis | FAERS: 5 | OFFSIDES US FAERS | |
| 735 | Therapeutic response changed | FAERS: 5 | US FAERS | |
| 736 | Transplantation complication | FAERS: 5 | US FAERS | |
| 737 | Urine output increased | FAERS: 5 | US FAERS | |
| 738 | Ventricular arrhythmia | FAERS: 5 | US FAERS | |
| 739 | Vulvovaginal pain | FAERS: 5 | US FAERS | |
| 740 | Abdominal hernia obstructive | FAERS: 4 | US FAERS | |
| 741 | Actinic keratosis | FAERS: 4 | US FAERS | |
| 742 | Ammonia abnormal | FAERS: 4 | US FAERS | |
| 743 | Anal Fistula | FAERS: 4 | OFFSIDES US FAERS | |
| 744 | Anaphylactic shock | FAERS: 4 | US FAERS | |
| 745 | Anaplastic large cell lymphoma T- and null-cell types | FAERS: 4 | US FAERS | |
| 746 | Arteriovenous fistula site infection | FAERS: 4 | OFFSIDES US FAERS | |
| 747 | Aspergillosis | FAERS: 4 | US FAERS | |
| 748 | Autoimmune thrombocytopenia | FAERS: 4 | OFFSIDES US FAERS | |
| 749 | Autoimmune thyroiditis | FAERS: 4 | OFFSIDES US FAERS | |
| 750 | Biopsy site unspecified abnormal | FAERS: 4 | US FAERS | |
| 751 | Bipolar Disorder | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 752 | Blepharitis | FAERS: 4 | US FAERS | |
| 753 | Blood bilirubin abnormal | FAERS: 4 | US FAERS | |
| 754 | Blood creatine decreased | FAERS: 4 | US FAERS | |
| 755 | Blood electrolytes abnormal | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 756 | Blood human chorionic gonadotropin positive | FAERS: 4 | US FAERS | |
| 757 | Breast Cyst | FAERS: 4 | US FAERS | |
| 758 | Breast cancer recurrent | FAERS: 4 | US FAERS | |
| 759 | Cardiac Tamponade | FAERS: 4 | US FAERS | |
| 760 | Cardiotoxicity | FAERS: 4 | US FAERS | |
| 761 | Cataract operation | FAERS: 4 | US FAERS | |
| 762 | Cerebellar infarction | FAERS: 4 | SIDER US FAERS | |
| 763 | Cholangitis | FAERS: 4 | US FAERS | |
| 764 | Culture urine positive | FAERS: 4 | US FAERS | |
| 765 | Cyanosis | FAERS: 4 | US FAERS | |
| 766 | Dacryostenosis acquired | FAERS: 4 | US FAERS | |
| 767 | Device related sepsis | FAERS: 4 | US FAERS | |
| 768 | Diabetic ulcer | FAERS: 4 | US FAERS | |
| 769 | Diffuse large B-cell lymphoma recurrent | FAERS: 4 | US FAERS | |
| 770 | Dysgraphia | FAERS: 4 | US FAERS | |
| 771 | Electrolyte depletion | FAERS: 4 | OFFSIDES US FAERS | |
| 772 | Empyema | FAERS: 4 | US FAERS | |
| 773 | Eosinophilic Pneumonia | FAERS: 4 | US FAERS | |
| 774 | Facial Pain | FAERS: 4 | US FAERS | |
| 775 | Food aversion | FAERS: 4 | OFFSIDES US FAERS | |
| 776 | Genital swelling | FAERS: 4 | US FAERS | |
| 777 | Glioblastoma | FAERS: 4 | US FAERS | |
| 778 | Hernia obstructive | FAERS: 4 | OFFSIDES US FAERS | |
| 779 | Histoplasmosis | FAERS: 4 | US FAERS | |
| 780 | Hyperventilation | FAERS: 4 | US FAERS | |
| 781 | Impaired quality of life | FAERS: 4 | US FAERS | |
| 782 | Incarcerated hernia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 783 | Infected bite | FAERS: 4 | US FAERS | |
| 784 | Infected cyst | FAERS: 4 | US FAERS | |
| 785 | Intervertebral disc compression | FAERS: 4 | OFFSIDES US FAERS | |
| 786 | Joint Instability | FAERS: 4 | US FAERS | |
| 787 | Joint sprain | FAERS: 4 | US FAERS | |
| 788 | Joint warmth | FAERS: 4 | US FAERS | |
| 789 | Leukocytoclastic vasculitis | FAERS: 4 | SIDER US FAERS | |
| 790 | Light chain analysis decreased | FAERS: 4 | US FAERS | |
| 791 | Lower respiratory tract infection fungal | FAERS: 4 | US FAERS | |
| 792 | Lung Abscess | FAERS: 4 | OFFSIDES US FAERS | |
| 793 | Malabsorption | FAERS: 4 | US FAERS | |
| 794 | Malignant melanoma stage I | FAERS: 4 | US FAERS | |
| 795 | Mesothelioma | FAERS: 4 | OFFSIDES US FAERS | |
| 796 | Middle insomnia | FAERS: 4 | US FAERS | |
| 797 | Migraine with Aura | FAERS: 4 | US FAERS | |
| 798 | Mucormycosis | FAERS: 4 | US FAERS | |
| 799 | Multimorbidity | FAERS: 4 | US FAERS | |
| 800 | Myocardial necrosis marker increased | FAERS: 4 | US FAERS | |
| 801 | Ocular icterus | FAERS: 4 | OFFSIDES US FAERS | |
| 802 | Orthostatic hypertension | FAERS: 4 | US FAERS | |
| 803 | Osteomalacia | FAERS: 4 | US FAERS | |
| 804 | Paranasal sinus discomfort | FAERS: 4 | US FAERS | |
| 805 | Pathogen resistance | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 806 | Physical examination abnormal | FAERS: 4 | US FAERS | |
| 807 | Plasmacytosis | FAERS: 4 | US FAERS | |
| 808 | Portal Hypertension | FAERS: 4 | US FAERS | |
| 809 | Portal Vein Thrombosis | FAERS: 4 | US FAERS | |
| 810 | Product difficult to swallow | FAERS: 4 | US FAERS | |
| 811 | Product quality issue | FAERS: 4 | US FAERS | |
| 812 | Pulmonary pain | FAERS: 4 | US FAERS | |
| 813 | Radiation skin injury | FAERS: 4 | US FAERS | |
| 814 | Rectal abscess | FAERS: 4 | US FAERS | |
| 815 | Regurgitation | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 816 | Retinal vascular thrombosis | FAERS: 4 | US FAERS | |
| 817 | Sinus bradycardia | FAERS: 4 | US FAERS | |
| 818 | Skin Papilloma | FAERS: 4 | US FAERS | |
| 819 | Small cell lung cancer metastatic | FAERS: 4 | US FAERS | |
| 820 | Snoring | FAERS: 4 | US FAERS | |
| 821 | Somnambulism | FAERS: 4 | US FAERS | |
| 822 | Starvation | FAERS: 4 | OFFSIDES US FAERS | |
| 823 | Stem cell transplant | FAERS: 4 | US FAERS | |
| 824 | Subileus | FAERS: 4 | US FAERS | |
| 825 | Tenosynovitis | FAERS: 4 | US FAERS | |
| 826 | Tension | FAERS: 4 | SIDER US FAERS | |
| 827 | Tonsillitis | FAERS: 4 | US FAERS | |
| 828 | Trigeminal Neuralgia | FAERS: 4 | US FAERS | |
| 829 | Tumour haemorrhage | FAERS: 4 | US FAERS | |
| 830 | Urinary tract infection enterococcal | FAERS: 4 | OFFSIDES US FAERS | |
| 831 | Vaginal Discharge | FAERS: 4 | US FAERS | |
| 832 | Vertebral lesion | FAERS: 4 | US FAERS | |
| 833 | Visual disturbance | FAERS: 4 | SIDER US FAERS | |
| 834 | Vulvovaginal dryness | FAERS: 4 | US FAERS | |
| 835 | liposarcoma | FAERS: 4 | US FAERS | |
| 836 | Accidental death | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 837 | Acoustic Neuroma | FAERS: 3 | US FAERS | |
| 838 | Acquired gene mutation | FAERS: 3 | US FAERS | |
| 839 | Acute graft versus host disease in liver | FAERS: 3 | OFFSIDES US FAERS | |
| 840 | Allergic sinusitis | FAERS: 3 | US FAERS | |
| 841 | Amaurosis Fugax | FAERS: 3 | US FAERS | |
| 842 | Amputation | FAERS: 3 | US FAERS | |
| 843 | Apparent death | FAERS: 3 | US FAERS | |
| 844 | Arteriovenous fistula thrombosis | FAERS: 3 | US FAERS | |
| 845 | Beta 2 microglobulin increased | FAERS: 3 | US FAERS | |
| 846 | Bifascicular block | FAERS: 3 | OFFSIDES US FAERS | |
| 847 | Bladder spasm | FAERS: 3 | US FAERS | |
| 848 | Blood creatine abnormal | FAERS: 3 | US FAERS | |
| 849 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 850 | Blood thyroid stimulating hormone increased | FAERS: 3 | US FAERS | |
| 851 | Body temperature fluctuation | FAERS: 3 | US FAERS | |
| 852 | Bone marrow myelogram abnormal | FAERS: 3 | US FAERS | |
| 853 | Brain natriuretic peptide increased | FAERS: 3 | US FAERS | |
| 854 | Breast tenderness | FAERS: 3 | US FAERS | |
| 855 | Bronchial Hyperreactivity | FAERS: 3 | SIDER US FAERS | |
| 856 | Calcinosis | FAERS: 3 | US FAERS | |
| 857 | Campylobacter infection | FAERS: 3 | US FAERS | |
| 858 | Cardiac enzymes increased | FAERS: 3 | US FAERS | |
| 859 | Cardiac function test abnormal | FAERS: 3 | US FAERS | |
| 860 | Carotid artery occlusion | FAERS: 3 | US FAERS | |
| 861 | Central Nervous System Infection | FAERS: 3 | US FAERS | |
| 862 | Cerebral atrophy | FAERS: 3 | US FAERS | |
| 863 | Choking sensation | FAERS: 3 | US FAERS | |
| 864 | Cholangiocarcinoma | FAERS: 3 | US FAERS | |
| 865 | Chronic sinusitis | FAERS: 3 | OFFSIDES US FAERS | |
| 866 | Clostridium test positive | FAERS: 3 | US FAERS | |
| 867 | Colectomy | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 868 | Complications of bone marrow transplant | FAERS: 3 | US FAERS | |
| 869 | Cytogenetic analysis abnormal | FAERS: 3 | US FAERS | |
| 870 | Deafness Neurosensory | FAERS: 3 | US FAERS | |
| 871 | Dental discomfort | FAERS: 3 | SIDER US FAERS | |
| 872 | Device Failure | FAERS: 3 | US FAERS | |
| 873 | Device occlusion | FAERS: 3 | US FAERS | |
| 874 | Disability | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 875 | Dissociation | FAERS: 3 | US FAERS | |
| 876 | Duodenal Ulcer | FAERS: 3 | US FAERS | |
| 877 | Dysentery | FAERS: 3 | US FAERS | |
| 878 | Dysplasia | FAERS: 3 | US FAERS | |
| 879 | Economic problem | FAERS: 3 | US FAERS | |
| 880 | Endometrial adenocarcinoma | FAERS: 3 | US FAERS | |
| 881 | Epididymitis | FAERS: 3 | US FAERS | |
| 882 | Erection increased | FAERS: 3 | US FAERS | |
| 883 | Erythema Nodosum | FAERS: 3 | OFFSIDES US FAERS | |
| 884 | Excessive cerumen production | FAERS: 3 | US FAERS | |
| 885 | Excoriation | FAERS: 3 | SIDER US FAERS | |
| 886 | Extranodal marginal zone B-cell lymphoma (MALT type) | FAERS: 3 | US FAERS | |
| 887 | Foaming at mouth | FAERS: 3 | US FAERS | |
| 888 | Food Allergy | FAERS: 3 | US FAERS | |
| 889 | Fracture pain | FAERS: 3 | US FAERS | |
| 890 | Gastric Dilatation | FAERS: 3 | US FAERS | |
| 891 | Gastroenteritis norovirus | FAERS: 3 | US FAERS | |
| 892 | Gastrointestinal bacterial infection | FAERS: 3 | US FAERS | |
| 893 | Graft versus host disease in gastrointestinal tract | FAERS: 3 | US FAERS | |
| 894 | Graft versus host disease in intestine | FAERS: 3 | US FAERS | |
| 895 | Granulocytosis | FAERS: 3 | US FAERS | |
| 896 | Groin infection | FAERS: 3 | US FAERS | |
| 897 | Hyperchlorhydria | FAERS: 3 | US FAERS | |
| 898 | Hyperplasia | FAERS: 3 | US FAERS | |
| 899 | Hyperpyrexia | FAERS: 3 | US FAERS | |
| 900 | Infection reactivation | FAERS: 3 | US FAERS | |
| 901 | Infectious peritonitis | FAERS: 3 | US FAERS | |
| 902 | Infrequent bowel movements | FAERS: 3 | US FAERS | |
| 903 | Initial insomnia | FAERS: 3 | US FAERS | |
| 904 | Injection related reaction | FAERS: 3 | US FAERS | |
| 905 | Injection site infection | FAERS: 3 | US FAERS | |
| 906 | Intracranial mass | FAERS: 3 | US FAERS | |
| 907 | Klebsiella test positive | FAERS: 3 | US FAERS | |
| 908 | Labyrinthitis | FAERS: 3 | US FAERS | |
| 909 | Limb operation | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 910 | Lip and/or oral cavity cancer | FAERS: 3 | US FAERS | |
| 911 | Liver Abscess | FAERS: 3 | US FAERS | |
| 912 | Lower respiratory tract congestion | FAERS: 3 | US FAERS | |
| 913 | Lung consolidation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 914 | Malignant lymphoid neoplasm | FAERS: 3 | OFFSIDES US FAERS | |
| 915 | Malignant melanoma in situ | FAERS: 3 | US FAERS | |
| 916 | Malignant transformation | FAERS: 3 | OFFSIDES US FAERS | |
| 917 | Mastication disorder | FAERS: 3 | US FAERS | |
| 918 | Mastoiditis | FAERS: 3 | US FAERS | |
| 919 | Menorrhagia | FAERS: 3 | US FAERS | |
| 920 | Metapneumovirus infection | FAERS: 3 | US FAERS | |
| 921 | Metastatic Renal Cell Carcinoma | FAERS: 3 | US FAERS | |
| 922 | Monoplegia | FAERS: 3 | US FAERS | |
| 923 | Motion Sickness | FAERS: 3 | US FAERS | |
| 924 | Multiple sclerosis relapse | FAERS: 3 | US FAERS | |
| 925 | Mydriasis | FAERS: 3 | US FAERS | |
| 926 | Nonspecific reaction | FAERS: 3 | US FAERS | |
| 927 | Optic Atrophy | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 928 | Oral fungal infection | FAERS: 3 | US FAERS | |
| 929 | Oropharyngeal cancer stage unspecified | FAERS: 3 | US FAERS | |
| 930 | Osteogenesis Imperfecta | FAERS: 3 | US FAERS | |
| 931 | Peripheral artery occlusion | FAERS: 3 | US FAERS | |
| 932 | Pertussis | FAERS: 3 | US FAERS | |
| 933 | Pharyngeal swelling | FAERS: 3 | US FAERS | |
| 934 | Physical deconditioning | FAERS: 3 | US FAERS | |
| 935 | Plasmablastic lymphoma | FAERS: 3 | US FAERS | |
| 936 | Polyarthritis | FAERS: 3 | US FAERS | |
| 937 | Positron emission tomogram abnormal | FAERS: 3 | US FAERS | |
| 938 | Posterior reversible encephalopathy syndrome | FAERS: 3 | US FAERS | |
| 939 | Product container issue | FAERS: 3 | US FAERS | |
| 940 | Prostatic Obstruction | FAERS: 3 | US FAERS | |
| 941 | Protein Deficiency | FAERS: 3 | US FAERS | |
| 942 | Pseudomonas bronchitis | FAERS: 3 | US FAERS | |
| 943 | Pulmonary Infarction | FAERS: 3 | US FAERS | |
| 944 | Purulent discharge | FAERS: 3 | US FAERS | |
| 945 | Radiation associated pain | FAERS: 3 | OFFSIDES US FAERS | |
| 946 | Rectal discharge | FAERS: 3 | US FAERS | |
| 947 | Refractory cytopenia with multilineage dysplasia | FAERS: 3 | US FAERS | |
| 948 | Respiratory Depression | FAERS: 3 | US FAERS | |
| 949 | Retinal Artery Occlusion | FAERS: 3 | US FAERS | |
| 950 | Retinal vascular occlusion | FAERS: 3 | US FAERS | |
| 951 | Rhinovirus infection | FAERS: 3 | US FAERS | |
| 952 | Scleritis | FAERS: 3 | US FAERS | |
| 953 | Seizure like phenomena | FAERS: 3 | US FAERS | |
| 954 | Sinus Arrhythmia | FAERS: 3 | US FAERS | |
| 955 | Sinus pain | FAERS: 3 | US FAERS | |
| 956 | Skin hypertrophy | FAERS: 3 | US FAERS | |
| 957 | Skin necrosis | FAERS: 3 | US FAERS | |
| 958 | Sperm concentration decreased | FAERS: 3 | US FAERS | |
| 959 | Spinal fusion surgery | FAERS: 3 | US FAERS | |
| 960 | Splenectomy | FAERS: 3 | US FAERS | |
| 961 | Staphylococcus test | FAERS: 3 | US FAERS | |
| 962 | Staphylococcus test positive | FAERS: 3 | US FAERS | |
| 963 | Status Epilepticus | FAERS: 3 | US FAERS | |
| 964 | Stupor | FAERS: 3 | US FAERS | |
| 965 | Subacute endocarditis | FAERS: 3 | US FAERS | |
| 966 | Superficial injury of eye | FAERS: 3 | US FAERS | |
| 967 | Therapy responder | FAERS: 3 | US FAERS | |
| 968 | Thrombotic stroke | FAERS: 3 | OFFSIDES US FAERS | |
| 969 | Toxic Shock Syndrome | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 970 | Tracheomalacia | FAERS: 3 | US FAERS | |
| 971 | Trichorrhexis | FAERS: 3 | US FAERS | |
| 972 | Urethral Stenosis | FAERS: 3 | OFFSIDES US FAERS | |
| 973 | Uterine Polyp | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 974 | Vaginal mucosal blistering | FAERS: 3 | US FAERS | |
| 975 | Vascular calcification | FAERS: 3 | US FAERS | |
| 976 | Vascular pain | FAERS: 3 | US FAERS | |
| 977 | Venous stasis retinopathy | FAERS: 3 | US FAERS | |
| 978 | Vulvovaginal mycotic infection | FAERS: 3 | US FAERS | |
| 979 | Waist circumference increased | FAERS: 3 | US FAERS | |
| 980 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 981 | effusion | FAERS: 3 | OFFSIDES US FAERS | |
| 982 | leiomyosarcoma | FAERS: 3 | US FAERS | |
| 983 | Abdominal sepsis | FAERS: 2 | OFFSIDES US FAERS | |
| 984 | Abnormal sleep-related event | FAERS: 2 | US FAERS | |
| 985 | Acidosis | FAERS: 2 | US FAERS | |
| 986 | Acute prerenal failure | FAERS: 2 | US FAERS | |
| 987 | Acute psychosis | FAERS: 2 | US FAERS | |
| 988 | Alanine aminotransferase abnormal | FAERS: 2 | US FAERS | |
| 989 | Alveolitis | FAERS: 2 | US FAERS | |
| 990 | Amaurosis | FAERS: 2 | US FAERS | |
| 991 | Anal Fissure | FAERS: 2 | US FAERS | |
| 992 | Anaplastic astrocytoma | FAERS: 2 | US FAERS | |
| 993 | Angiodysplasia | FAERS: 2 | US FAERS | |
| 994 | Animal scratch | FAERS: 2 | US FAERS | |
| 995 | Anorectal infection | FAERS: 2 | US FAERS | |
| 996 | Arterial insufficiency | FAERS: 2 | US FAERS | |
| 997 | Aspergilloma | FAERS: 2 | OFFSIDES US FAERS | |
| 998 | Astigmatism | FAERS: 2 | US FAERS | |
| 999 | Autonomic neuropathy | FAERS: 2 | US FAERS | |
| 1000 | B-cell lymphoma recurrent | FAERS: 2 | US FAERS | |
| 1001 | Bacterial test positive | FAERS: 2 | US FAERS | |
| 1002 | Behavioural and psychiatric symptoms of dementia | FAERS: 2 | US FAERS | |
| 1003 | Benign Neoplasm | FAERS: 2 | US FAERS | |
| 1004 | Benign neoplasm of skin | FAERS: 2 | US FAERS | |
| 1005 | Bile acid malabsorption | FAERS: 2 | US FAERS | |
| 1006 | Biliary dilatation | FAERS: 2 | US FAERS | |
| 1007 | Biopsy bone abnormal | FAERS: 2 | US FAERS | |
| 1008 | Bladder cancer recurrent | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1009 | Blood amylase increased | FAERS: 2 | US FAERS | |
| 1010 | Blood bilirubin unconjugated increased | FAERS: 2 | US FAERS | |
| 1011 | Blood catecholamines decreased | FAERS: 2 | US FAERS | |
| 1012 | Blood cholesterol abnormal | FAERS: 2 | US FAERS | |
| 1013 | Blood folate decreased | FAERS: 2 | US FAERS | |
| 1014 | Blood growth hormone decreased | FAERS: 2 | US FAERS | |
| 1015 | Blood parathyroid hormone increased | FAERS: 2 | US FAERS | |
| 1016 | Blood stem cell harvest failure | FAERS: 2 | US FAERS | |
| 1017 | Blood viscosity decreased | FAERS: 2 | US FAERS | |
| 1018 | Bone erosion | FAERS: 2 | US FAERS | |
| 1019 | Bone scan abnormal | FAERS: 2 | US FAERS | |
| 1020 | Breast cancer stage II | FAERS: 2 | US FAERS | |
| 1021 | Breast discomfort | FAERS: 2 | US FAERS | |
| 1022 | Bronchial Obstruction | FAERS: 2 | US FAERS | |
| 1023 | Bronchial secretion retention | FAERS: 2 | US FAERS | |
| 1024 | CD4 Lymphocytes Decreased | FAERS: 2 | US FAERS | |
| 1025 | Cardiac Hypertrophy | FAERS: 2 | US FAERS | |
| 1026 | Cardiac dysfunction | FAERS: 2 | US FAERS | |
| 1027 | Cardiac infection | FAERS: 2 | US FAERS | |
| 1028 | Cardiac procedure complication | FAERS: 2 | US FAERS | |
| 1029 | Cardiac ventricular disorder | FAERS: 2 | US FAERS | |
| 1030 | Cardioactive drug level increased | FAERS: 2 | US FAERS | |
| 1031 | Cardiovascular function test | FAERS: 2 | US FAERS | |
| 1032 | Cardiovascular insufficiency | FAERS: 2 | US FAERS | |
| 1033 | Cartilage injury | FAERS: 2 | US FAERS | |
| 1034 | Catheter related complication | FAERS: 2 | US FAERS | |
| 1035 | Catheter site phlebitis | FAERS: 2 | US FAERS | |
| 1036 | Chronic respiratory failure | FAERS: 2 | US FAERS | |
| 1037 | Clonal Evolution | FAERS: 2 | US FAERS | |
| 1038 | Clostridium colitis | FAERS: 2 | US FAERS | |
| 1039 | Coating in mouth | FAERS: 2 | US FAERS | |
| 1040 | Colon cancer recurrent | FAERS: 2 | US FAERS | |
| 1041 | Complication associated with device | FAERS: 2 | US FAERS | |
| 1042 | Complications of transplant surgery | FAERS: 2 | US FAERS | |
| 1043 | Concomitant disease aggravated | FAERS: 2 | US FAERS | |
| 1044 | Consciousness fluctuating | FAERS: 2 | US FAERS | |
| 1045 | Cor pulmonale | FAERS: 2 | US FAERS | |
| 1046 | Creatinine urine abnormal | FAERS: 2 | US FAERS | |
| 1047 | Creutzfeldt-Jakob disease | FAERS: 2 | OFFSIDES US FAERS | |
| 1048 | Dark circles under eyes | FAERS: 2 | US FAERS | |
| 1049 | Demyelination | FAERS: 2 | US FAERS | |
| 1050 | Dependence | FAERS: 2 | US FAERS | |
| 1051 | Device related thrombosis | FAERS: 2 | US FAERS | |
| 1052 | Diabetic foot infection | FAERS: 2 | US FAERS | |
| 1053 | Diet refusal | FAERS: 2 | US FAERS | |
| 1054 | Dissociative disorder | FAERS: 2 | US FAERS | |
| 1055 | Disturbance in sexual arousal | FAERS: 2 | US FAERS | |
| 1056 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 1057 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 1058 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 1059 | Duodenitis | FAERS: 2 | US FAERS | |
| 1060 | Dyschezia | FAERS: 2 | US FAERS | |
| 1061 | Electrocardiogram change | FAERS: 2 | US FAERS | |
| 1062 | Electrocardiogram repolarisation abnormality | FAERS: 2 | US FAERS | |
| 1063 | Electromechanical dissociation | FAERS: 2 | US FAERS | |
| 1064 | Endophthalmitis | FAERS: 2 | US FAERS | |
| 1065 | Engraftment syndrome | FAERS: 2 | US FAERS | |
| 1066 | Enteritis | FAERS: 2 | US FAERS | |
| 1067 | Enterococcal sepsis | FAERS: 2 | US FAERS | |
| 1068 | Enterocolitis bacterial | FAERS: 2 | US FAERS | |
| 1069 | Enterocolitis viral | FAERS: 2 | US FAERS | |
| 1070 | Enzyme Inhibition | FAERS: 2 | US FAERS | |
| 1071 | Enzyme abnormality | FAERS: 2 | US FAERS | |
| 1072 | Epiglottitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 1073 | Epiploic appendagitis | FAERS: 2 | US FAERS | |
| 1074 | Erysipelas | FAERS: 2 | US FAERS | |
| 1075 | Escherichia test positive | FAERS: 2 | US FAERS | |
| 1076 | Essential Tremor | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1077 | Evans syndrome | FAERS: 2 | US FAERS | |
| 1078 | Exposure via partner | FAERS: 2 | US FAERS | |
| 1079 | Extremity contracture | FAERS: 2 | US FAERS | |
| 1080 | Eye ulcer | FAERS: 2 | US FAERS | |
| 1081 | Eyelid rash | FAERS: 2 | US FAERS | |
| 1082 | Fibrin D dimer increased | FAERS: 2 | US FAERS | |
| 1083 | Folliculitis | FAERS: 2 | OFFSIDES US FAERS | |
| 1084 | Foreign body in respiratory tract | FAERS: 2 | US FAERS | |
| 1085 | Gastrectomy | FAERS: 2 | OFFSIDES US FAERS | |
| 1086 | Gastric pH decreased | FAERS: 2 | US FAERS | |
| 1087 | Gastrointestinal amyloidosis | FAERS: 2 | US FAERS | |
| 1088 | Gastrointestinal hypomotility | FAERS: 2 | US FAERS | |
| 1089 | Gastrointestinal ulcer | FAERS: 2 | US FAERS | |
| 1090 | Genital discomfort | FAERS: 2 | US FAERS | |
| 1091 | Genital infection | FAERS: 2 | US FAERS | |
| 1092 | Genital rash | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1093 | Gingival erythema | FAERS: 2 | OFFSIDES US FAERS | |
| 1094 | Granuloma | FAERS: 2 | US FAERS | |
| 1095 | Head deformity | FAERS: 2 | US FAERS | |
| 1096 | Heart sounds abnormal | FAERS: 2 | US FAERS | |
| 1097 | Heat Exhaustion | FAERS: 2 | OFFSIDES US FAERS | |
| 1098 | Heat illness | FAERS: 2 | US FAERS | |
| 1099 | Heparin-induced thrombocytopenia | FAERS: 2 | US FAERS | |
| 1100 | Hepatic cancer metastatic | FAERS: 2 | US FAERS | |
| 1101 | Hepatic enzyme decreased | FAERS: 2 | US FAERS | |
| 1102 | Hernia pain | FAERS: 2 | US FAERS | |
| 1103 | Hypereosinophilic syndrome | FAERS: 2 | US FAERS | |
| 1104 | Hyperphagia | FAERS: 2 | US FAERS | |
| 1105 | Hypertensive Encephalopathy | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1106 | Hypertrichosis | FAERS: 2 | US FAERS | |
| 1107 | Hypertrophic Cardiomyopathy | FAERS: 2 | US FAERS | |
| 1108 | Hypocoagulable state | FAERS: 2 | US FAERS | |
| 1109 | Hypoventilation | FAERS: 2 | US FAERS | |
| 1110 | Hysterectomy | FAERS: 2 | US FAERS | |
| 1111 | Iatrogenic injury | FAERS: 2 | US FAERS | |
| 1112 | Impatience | FAERS: 2 | US FAERS | |
| 1113 | Implant site infection | FAERS: 2 | US FAERS | |
| 1114 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 1115 | Incision site infection | FAERS: 2 | OFFSIDES US FAERS | |
| 1116 | Incisional hernia | FAERS: 2 | US FAERS | |
| 1117 | Increased viscosity of upper respiratory secretion | FAERS: 2 | US FAERS | |
| 1118 | Induration | FAERS: 2 | US FAERS | |
| 1119 | Infection in an immunocompromised host | FAERS: 2 | US FAERS | |
| 1120 | Infectious Mononucleosis | FAERS: 2 | US FAERS | |
| 1121 | Infective exacerbation of chronic obstructive airways disease | FAERS: 2 | OFFSIDES US FAERS | |
| 1122 | Influenza A virus test positive | FAERS: 2 | US FAERS | |
| 1123 | Injection site erythema | FAERS: 2 | US FAERS | |
| 1124 | Intestinal adenocarcinoma | FAERS: 2 | US FAERS | |
| 1125 | Intestinal resection | FAERS: 2 | OFFSIDES US FAERS | |
| 1126 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 1127 | Leukostasis | FAERS: 2 | OFFSIDES US FAERS | |
| 1128 | Libido disorder | FAERS: 2 | US FAERS | |
| 1129 | Light chain analysis | FAERS: 2 | US FAERS | |
| 1130 | Lip exfoliation | FAERS: 2 | US FAERS | |
| 1131 | Lipase increased | FAERS: 2 | US FAERS | |
| 1132 | Listeria sepsis | FAERS: 2 | US FAERS | |
| 1133 | Low Cardiac Output Syndrome | FAERS: 2 | US FAERS | |
| 1134 | Lower respiratory tract inflammation | FAERS: 2 | US FAERS | |
| 1135 | Lung squamous cell carcinoma stage IV | FAERS: 2 | US FAERS | |
| 1136 | Lymphocyte count increased | FAERS: 2 | US FAERS | |
| 1137 | Lymphocyte percentage increased | FAERS: 2 | US FAERS | |
| 1138 | Lymphoma transformation | FAERS: 2 | US FAERS | |
| 1139 | Macule | FAERS: 2 | US FAERS | |
| 1140 | Malaria | FAERS: 2 | US FAERS | |
| 1141 | Mechanical ileus | FAERS: 2 | US FAERS | |
| 1142 | Medical device site abscess | FAERS: 2 | US FAERS | |
| 1143 | Medical device site thrombosis | FAERS: 2 | US FAERS | |
| 1144 | Medication residue present | FAERS: 2 | US FAERS | |
| 1145 | Megacolon | FAERS: 2 | US FAERS | |
| 1146 | Melanoma recurrent | FAERS: 2 | US FAERS | |
| 1147 | Meniscus operation | FAERS: 2 | US FAERS | |
| 1148 | Metaplasia | FAERS: 2 | US FAERS | |
| 1149 | Monocyte count increased | FAERS: 2 | US FAERS | |
| 1150 | Muscle Spasticity | FAERS: 2 | US FAERS | |
| 1151 | Nail Infection | FAERS: 2 | US FAERS | |
| 1152 | Nasal Flaring | FAERS: 2 | OFFSIDES US FAERS | |
| 1153 | Nasal inflammation | FAERS: 2 | US FAERS | |
| 1154 | Natural killer-cell lymphoblastic lymphoma | FAERS: 2 | US FAERS | |
| 1155 | Necrosis | FAERS: 2 | US FAERS | |
| 1156 | Negative thoughts | FAERS: 2 | US FAERS | |
| 1157 | Nephritis | FAERS: 2 | US FAERS | |
| 1158 | Nerve Block | FAERS: 2 | US FAERS | |
| 1159 | Nerve root injury | FAERS: 2 | US FAERS | |
| 1160 | Neuritis | FAERS: 2 | SIDER US FAERS | |
| 1161 | Neurodermatitis | FAERS: 2 | OFFSIDES US FAERS | |
| 1162 | Neuroma | FAERS: 2 | OFFSIDES US FAERS | |
| 1163 | Neutropenic colitis | FAERS: 2 | US FAERS | |
| 1164 | Neutrophil percentage decreased | FAERS: 2 | US FAERS | |
| 1165 | Nipple pain | FAERS: 2 | US FAERS | |
| 1166 | Non-Hodgkin's lymphoma refractory | FAERS: 2 | US FAERS | |
| 1167 | Obsessive-Compulsive Disorder | FAERS: 2 | US FAERS | |
| 1168 | Ocular Hypertension | FAERS: 2 | SIDER US FAERS | |
| 1169 | Oncologic complication | FAERS: 2 | US FAERS | |
| 1170 | Oral papule | FAERS: 2 | US FAERS | |
| 1171 | Oropharyngeal swelling | FAERS: 2 | US FAERS | |
| 1172 | Otitis Media | FAERS: 2 | US FAERS | |
| 1173 | Oxygen consumption decreased | FAERS: 2 | US FAERS | |
| 1174 | Palliative Care | FAERS: 2 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 1175 | Peptic Ulcer | FAERS: 2 | US FAERS | |
| 1176 | Peptic ulcer helicobacter | FAERS: 2 | US FAERS | |
| 1177 | Perforated ulcer | FAERS: 2 | US FAERS | |
| 1178 | Perineal ulceration | FAERS: 2 | US FAERS | |
| 1179 | Perinephric effusion | FAERS: 2 | US FAERS | |
| 1180 | Peripheral T-cell lymphoma unspecified refractory | FAERS: 2 | US FAERS | |
| 1181 | Peripheral embolism | FAERS: 2 | US FAERS | |
| 1182 | Peritoneal Infection | FAERS: 2 | US FAERS | |
| 1183 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 1184 | Physical disability | FAERS: 2 | US FAERS | |
| 1185 | Pilonidal Cyst | FAERS: 2 | US FAERS | |
| 1186 | Plasma cell myeloma in remission | FAERS: 2 | US FAERS | |
| 1187 | Plasma cells present | FAERS: 2 | US FAERS | |
| 1188 | Pneumonia moraxella | FAERS: 2 | OFFSIDES US FAERS | |
| 1189 | Polymyositis | FAERS: 2 | US FAERS | |
| 1190 | Post-traumatic neck syndrome | FAERS: 2 | US FAERS | |
| 1191 | Poverty of speech | FAERS: 2 | US FAERS | |
| 1192 | Proctocolitis | FAERS: 2 | US FAERS | |
| 1193 | Product prescribing issue | FAERS: 2 | US FAERS | |
| 1194 | Product storage error | FAERS: 2 | US FAERS | |
| 1195 | Product substitution issue | FAERS: 2 | US FAERS | |
| 1196 | Product use issue | FAERS: 2 | US FAERS | |
| 1197 | Prostatic specific antigen decreased | FAERS: 2 | US FAERS | |
| 1198 | Prostatism | FAERS: 2 | US FAERS | |
| 1199 | Prothrombin level abnormal | FAERS: 2 | US FAERS | |
| 1200 | Pruritus allergic | FAERS: 2 | US FAERS | |
| 1201 | Psychiatric symptom | FAERS: 2 | US FAERS | |
| 1202 | Pulmonary Eosinophilia | FAERS: 2 | US FAERS | |
| 1203 | Pulmonary artery thrombosis | FAERS: 2 | US FAERS | |
| 1204 | Pulmonary granuloma | FAERS: 2 | US FAERS | |
| 1205 | Radiation Pneumonitis | FAERS: 2 | US FAERS | |
| 1206 | Radiculopathy | FAERS: 2 | US FAERS | |
| 1207 | Rales | FAERS: 2 | SIDER US FAERS | |
| 1208 | Rash papulosquamous | FAERS: 2 | US FAERS | |
| 1209 | Rectal Prolapse | FAERS: 2 | OFFSIDES US FAERS | |
| 1210 | Rectal spasm | FAERS: 2 | US FAERS | |
| 1211 | Remission not achieved | FAERS: 2 | US FAERS | |
| 1212 | Renal cancer metastatic | FAERS: 2 | US FAERS | |
| 1213 | Renal tubular acidosis | FAERS: 2 | OFFSIDES US FAERS | |
| 1214 | Respiratory syncytial virus bronchitis | FAERS: 2 | US FAERS | |
| 1215 | Respiratory tract infection fungal | FAERS: 2 | US FAERS | |
| 1216 | Respiratory tract irritation | FAERS: 2 | US FAERS | |
| 1217 | Restrictive pulmonary disease | FAERS: 2 | US FAERS | |
| 1218 | Reticulocyte count decreased | FAERS: 2 | US FAERS | |
| 1219 | Retinal Degeneration | FAERS: 2 | US FAERS | |
| 1220 | Retinal Vein Occlusion | FAERS: 2 | US FAERS | |
| 1221 | Richter's syndrome | FAERS: 2 | US FAERS | |
| 1222 | Scan abnormal | FAERS: 2 | US FAERS | |
| 1223 | Scleroderma | FAERS: 2 | US FAERS | |
| 1224 | Sensitive skin | FAERS: 2 | US FAERS | |
| 1225 | Septic arthritis staphylococcal | FAERS: 2 | US FAERS | |
| 1226 | Severe Acute Respiratory Syndrome | FAERS: 2 | US FAERS | |
| 1227 | Shunt occlusion | FAERS: 2 | US FAERS | |
| 1228 | Sinus polyp | FAERS: 2 | US FAERS | |
| 1229 | Soft tissue mass | FAERS: 2 | US FAERS | |
| 1230 | Solar lentigo | FAERS: 2 | US FAERS | |
| 1231 | Splenic thrombosis | FAERS: 2 | US FAERS | |
| 1232 | Squamous cell carcinoma of pharynx | FAERS: 2 | US FAERS | |
| 1233 | Staphylococcal Scalded Skin Syndrome | FAERS: 2 | US FAERS | |
| 1234 | Strangulated hernia | FAERS: 2 | US FAERS | |
| 1235 | Tachyarrhythmia | FAERS: 2 | SIDER US FAERS | |
| 1236 | Tardive Dyskinesia | FAERS: 2 | US FAERS | |
| 1237 | Teeth brittle | FAERS: 2 | US FAERS | |
| 1238 | Tension Headache | FAERS: 2 | US FAERS | |
| 1239 | Testis discomfort | FAERS: 2 | US FAERS | |
| 1240 | Thirst decreased | FAERS: 2 | US FAERS | |
| 1241 | Throat cancer | FAERS: 2 | US FAERS | |
| 1242 | Throat clearing | FAERS: 2 | US FAERS | |
| 1243 | Thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 1244 | Thromboembolic stroke | FAERS: 2 | OFFSIDES US FAERS | |
| 1245 | Thyroid Neoplasm | FAERS: 2 | US FAERS | |
| 1246 | Tinea Pedis | FAERS: 2 | US FAERS | |
| 1247 | Tongue amyloidosis | FAERS: 2 | US FAERS | |
| 1248 | Tracheal mass | FAERS: 2 | US FAERS | |
| 1249 | Tracheobronchitis | FAERS: 2 | OFFSIDES US FAERS | |
| 1250 | Transmission of drug via semen | FAERS: 2 | US FAERS | |
| 1251 | Traumatic fracture | FAERS: 2 | US FAERS | |
| 1252 | Underweight | FAERS: 2 | US FAERS | |
| 1253 | Upper respiratory tract infection bacterial | FAERS: 2 | US FAERS | |
| 1254 | Upper respiratory tract irritation | FAERS: 2 | US FAERS | |
| 1255 | Urine human chorionic gonadotropin | FAERS: 2 | US FAERS | |
| 1256 | Urine human chorionic gonadotropin increased | FAERS: 2 | OFFSIDES US FAERS | |
| 1257 | Varicella Zoster Virus Infection | FAERS: 2 | US FAERS | |
| 1258 | Vasospasm | FAERS: 2 | US FAERS | |
| 1259 | Vein collapse | FAERS: 2 | US FAERS | |
| 1260 | Venous occlusion | FAERS: 2 | US FAERS | |
| 1261 | Ventricular failure | FAERS: 2 | US FAERS | |
| 1262 | Visual brightness | FAERS: 2 | OFFSIDES US FAERS | |
| 1263 | Vitreous Detachment | FAERS: 2 | US FAERS | |
| 1264 | Vocal Cord Paralysis | FAERS: 2 | US FAERS | |
| 1265 | Vulvovaginal burning sensation | FAERS: 2 | US FAERS | |
| 1266 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 1267 | Vulvovaginal swelling | FAERS: 2 | US FAERS | |
| 1268 | Wound dehiscence | FAERS: 2 | US FAERS | |
| 1269 | Wound necrosis | FAERS: 2 | US FAERS | |
| 1270 | Wrong dose | FAERS: 2 | US FAERS | |
| 1271 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 1272 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 1273 | Xerosis | FAERS: 2 | US FAERS | |
| 1274 | muscle injury | FAERS: 2 | US FAERS | |
| 1275 | ovarian neoplasm | FAERS: 2 | US FAERS | |
| 1276 | synovial sarcoma | FAERS: 2 | US FAERS | |
| 1277 | Abdominal strangulated hernia | FAERS: 1 | US FAERS | |
| 1278 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 1279 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 1280 | Abscess of eyelid | FAERS: 1 | US FAERS | |
| 1281 | Abscess soft tissue | FAERS: 1 | US FAERS | |
| 1282 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 1283 | Accidental device ingestion | FAERS: 1 | US FAERS | |
| 1284 | Accidental underdose | FAERS: 1 | US FAERS | |
| 1285 | Achlorhydria | FAERS: 1 | US FAERS | |
| 1286 | Acquired Immunodeficiency Syndrome | FAERS: 1 | US FAERS | |
| 1287 | Actinomycosis | FAERS: 1 | US FAERS | |
| 1288 | Acute cardiac event | FAERS: 1 | US FAERS | |
| 1289 | Acute left ventricular failure | FAERS: 1 | US FAERS | |
| 1290 | Acute polyneuropathy | FAERS: 1 | US FAERS | |
| 1291 | Acute sinusitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 1292 | Adams-Stokes Syndrome | FAERS: 1 | US FAERS | |
| 1293 | Adrenal mass | FAERS: 1 | US FAERS | |
| 1294 | Agnosia | FAERS: 1 | US FAERS | |
| 1295 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 1296 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 1297 | Allergic bronchitis | FAERS: 1 | US FAERS | |
| 1298 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 1299 | Allergic respiratory symptom | FAERS: 1 | US FAERS | |
| 1300 | Ammonia | FAERS: 1 | US FAERS | |
| 1301 | Amputation stump pain | FAERS: 1 | US FAERS | |
| 1302 | Amylase increased | FAERS: 1 | US FAERS | |
| 1303 | Anal abscess | FAERS: 1 | US FAERS | |
| 1304 | Anal spasm | FAERS: 1 | US FAERS | |
| 1305 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 1306 | Anaplastic Oligodendroglioma | FAERS: 1 | US FAERS | |
| 1307 | Anaplastic large cell lymphoma T- and null-cell types recurrent | FAERS: 1 | US FAERS | |
| 1308 | Angiomyolipoma | FAERS: 1 | OFFSIDES US FAERS | |
| 1309 | Angioplasty | FAERS: 1 | US FAERS | |
| 1310 | Antibody test abnormal | FAERS: 1 | US FAERS | |
| 1311 | Anticoagulation drug level abnormal | FAERS: 1 | US FAERS | |
| 1312 | Antiphospholipid antibodies positive | FAERS: 1 | US FAERS | |
| 1313 | Aortic occlusion | FAERS: 1 | OFFSIDES US FAERS | |
| 1314 | Apoptosis | FAERS: 1 | US FAERS | |
| 1315 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 1316 | Arteriovenous fistula | FAERS: 1 | US FAERS | |
| 1317 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 1318 | Asphyxia | FAERS: 1 | OFFSIDES US FAERS | |
| 1319 | Atrial hypertrophy | FAERS: 1 | US FAERS | |
| 1320 | Atrial tachycardia | FAERS: 1 | US FAERS | |
| 1321 | Atrial thrombosis | FAERS: 1 | US FAERS | |
| 1322 | Axillary vein thrombosis | FAERS: 1 | US FAERS | |
| 1323 | Azoospermia | FAERS: 1 | US FAERS | |
| 1324 | B-cell lymphoma refractory | FAERS: 1 | US FAERS | |
| 1325 | B-cell small lymphocytic lymphoma stage IV | FAERS: 1 | US FAERS | |
| 1326 | Bacillus infection | FAERS: 1 | US FAERS | |
| 1327 | Bacterial abdominal infection | FAERS: 1 | US FAERS | |
| 1328 | Bacterial allergy | FAERS: 1 | US FAERS | |
| 1329 | Bacteriuria | FAERS: 1 | US FAERS | |
| 1330 | Band neutrophil count decreased | FAERS: 1 | US FAERS | |
| 1331 | Benign neoplasm of orbit | FAERS: 1 | US FAERS | |
| 1332 | Benign neoplasm of thyroid gland | FAERS: 1 | US FAERS | |
| 1333 | Biliary Colic | FAERS: 1 | US FAERS | |
| 1334 | Biliary Dyskinesia | FAERS: 1 | US FAERS | |
| 1335 | Biliary tract infection | FAERS: 1 | US FAERS | |
| 1336 | Biopsy | FAERS: 1 | US FAERS | |
| 1337 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 1338 | Bladder dysfunction | FAERS: 1 | US FAERS | |
| 1339 | Bladder neck obstruction | FAERS: 1 | OFFSIDES US FAERS | |
| 1340 | Bladder pain | FAERS: 1 | SIDER US FAERS | |
| 1341 | Bladder papilloma | FAERS: 1 | US FAERS | |
| 1342 | Bladder squamous cell carcinoma stage unspecified | FAERS: 1 | US FAERS | |
| 1343 | Bladder transitional cell carcinoma stage 0 | FAERS: 1 | US FAERS | |
| 1344 | Blast cells present | FAERS: 1 | US FAERS | |
| 1345 | Blastomycosis | FAERS: 1 | US FAERS | |
| 1346 | Blister rupture | FAERS: 1 | US FAERS | |
| 1347 | Blood Pressure | FAERS: 1 | US FAERS | |
| 1348 | Blood bicarbonate abnormal | FAERS: 1 | US FAERS | |
| 1349 | Blood cadmium decreased | FAERS: 1 | US FAERS | |
| 1350 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 1351 | Blood count normal | FAERS: 1 | OFFSIDES US FAERS | |
| 1352 | Blood creatine | FAERS: 1 | US FAERS | |
| 1353 | Blood electrolytes increased | FAERS: 1 | US FAERS | |
| 1354 | Blood follicle stimulating hormone increased | FAERS: 1 | US FAERS | |
| 1355 | Blood growth hormone increased | FAERS: 1 | US FAERS | |
| 1356 | Blood immunoglobulin E increased | FAERS: 1 | US FAERS | |
| 1357 | Blood insulin abnormal | FAERS: 1 | US FAERS | |
| 1358 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 1359 | Blood pH increased | FAERS: 1 | US FAERS | |
| 1360 | Blood pressure difference of extremities | FAERS: 1 | US FAERS | |
| 1361 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 1362 | Blood testosterone abnormal | FAERS: 1 | US FAERS | |
| 1363 | Blood thyroid stimulating hormone abnormal | FAERS: 1 | US FAERS | |
| 1364 | Blood urea nitrogen/creatinine ratio increased | FAERS: 1 | US FAERS | |
| 1365 | Blood uric acid decreased | FAERS: 1 | US FAERS | |
| 1366 | Body height abnormal | FAERS: 1 | US FAERS | |
| 1367 | Body height below normal | FAERS: 1 | US FAERS | |
| 1368 | Bone Sarcoma | FAERS: 1 | OFFSIDES US FAERS | |
| 1369 | Bone fragmentation | FAERS: 1 | OFFSIDES US FAERS | |
| 1370 | Bone marrow transplant rejection | FAERS: 1 | US FAERS | |
| 1371 | Bone swelling | FAERS: 1 | US FAERS | |
| 1372 | Bradykinesia | FAERS: 1 | US FAERS | |
| 1373 | Brain Death | FAERS: 1 | US FAERS | |
| 1374 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 1375 | Brain Stem Glioma | FAERS: 1 | US FAERS | |
| 1376 | Brain scan abnormal | FAERS: 1 | US FAERS | |
| 1377 | Breast infection | FAERS: 1 | US FAERS | |
| 1378 | Breast necrosis | FAERS: 1 | US FAERS | |
| 1379 | Bronchoscopy abnormal | FAERS: 1 | US FAERS | |
| 1380 | Bulbar palsy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1381 | Burning feet syndrome | FAERS: 1 | US FAERS | |
| 1382 | Candida pneumonia | FAERS: 1 | US FAERS | |
| 1383 | Capillaritis | FAERS: 1 | US FAERS | |
| 1384 | Capillary Fragility | FAERS: 1 | US FAERS | |
| 1385 | Capsule issue | FAERS: 1 | US FAERS | |
| 1386 | Carcinoma in situ of skin | FAERS: 1 | US FAERS | |
| 1387 | Cardiac ablation | FAERS: 1 | US FAERS | |
| 1388 | Cardiac valve vegetation | FAERS: 1 | US FAERS | |
| 1389 | Catheter placement | FAERS: 1 | US FAERS | |
| 1390 | Catheter sepsis | FAERS: 1 | US FAERS | |
| 1391 | Catheter site irritation | FAERS: 1 | US FAERS | |
| 1392 | Cauda Equina Syndrome | FAERS: 1 | US FAERS | |
| 1393 | Caustic injury | FAERS: 1 | US FAERS | |
| 1394 | Cell Death | FAERS: 1 | US FAERS | |
| 1395 | Central nervous system mass | FAERS: 1 | US FAERS | |
| 1396 | Cerebellar Ataxia | FAERS: 1 | US FAERS | |
| 1397 | Cerebral circulatory failure | FAERS: 1 | US FAERS | |
| 1398 | Cerebral salt-wasting syndrome | FAERS: 1 | US FAERS | |
| 1399 | Cerebrovascular stenosis | FAERS: 1 | US FAERS | |
| 1400 | Cervical cord compression | FAERS: 1 | US FAERS | |
| 1401 | Cervical dysplasia | FAERS: 1 | US FAERS | |
| 1402 | Cholera | FAERS: 1 | US FAERS | |
| 1403 | Chronic disease | FAERS: 1 | US FAERS | |
| 1404 | Chronic left ventricular failure | FAERS: 1 | US FAERS | |
| 1405 | Clitoris abscess | FAERS: 1 | US FAERS | |
| 1406 | Clostridium difficile sepsis | FAERS: 1 | US FAERS | |
| 1407 | Coagulation test abnormal | FAERS: 1 | US FAERS | |
| 1408 | Colonic Pseudo-Obstruction | FAERS: 1 | US FAERS | |
| 1409 | Colostomy infection | FAERS: 1 | US FAERS | |
| 1410 | Composite Lymphoma | FAERS: 1 | US FAERS | |
| 1411 | Connective tissue inflammation | FAERS: 1 | US FAERS | |
| 1412 | Contralateral breast cancer | FAERS: 1 | US FAERS | |
| 1413 | Coombs test positive | FAERS: 1 | US FAERS | |
| 1414 | Coronary artery embolism | FAERS: 1 | US FAERS | |
| 1415 | Coronary artery insufficiency | FAERS: 1 | US FAERS | |
| 1416 | Cortisol decreased | FAERS: 1 | US FAERS | |
| 1417 | Corynebacterium test positive | FAERS: 1 | US FAERS | |
| 1418 | Critical Illness | FAERS: 1 | US FAERS | |
| 1419 | Cyst removal | FAERS: 1 | US FAERS | |
| 1420 | Cystitis escherichia | FAERS: 1 | US FAERS | |
| 1421 | Cystitis viral | FAERS: 1 | US FAERS | |
| 1422 | Cytokine Release Syndrome | FAERS: 1 | US FAERS | |
| 1423 | Cytokine storm | FAERS: 1 | US FAERS | |
| 1424 | Cytomegalovirus test positive | FAERS: 1 | US FAERS | |
| 1425 | Deformity | FAERS: 1 | US FAERS | |
| 1426 | Dengue Fever | FAERS: 1 | OFFSIDES US FAERS | |
| 1427 | Dependence on oxygen therapy | FAERS: 1 | US FAERS | |
| 1428 | Depression suicidal | FAERS: 1 | US FAERS | |
| 1429 | Dermoid Cyst | FAERS: 1 | US FAERS | |
| 1430 | Device dislocation | FAERS: 1 | US FAERS | |
| 1431 | Device leakage | FAERS: 1 | US FAERS | |
| 1432 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 1433 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 1434 | Diabetic Retinopathy | FAERS: 1 | US FAERS | |
| 1435 | Diaphragmalgia | FAERS: 1 | US FAERS | |
| 1436 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 1437 | Diffuse alveolar damage | FAERS: 1 | US FAERS | |
| 1438 | Dilatation intrahepatic duct acquired | FAERS: 1 | US FAERS | |
| 1439 | Diplegia | FAERS: 1 | US FAERS | |
| 1440 | Disease susceptibility | FAERS: 1 | US FAERS | |
| 1441 | Drain site complication | FAERS: 1 | US FAERS | |
| 1442 | Drooling | FAERS: 1 | US FAERS | |
| 1443 | Drug Dependence | FAERS: 1 | US FAERS | |
| 1444 | Drug abuse | FAERS: 1 | US FAERS | |
| 1445 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 1446 | Drug effect variable | FAERS: 1 | US FAERS | |
| 1447 | Drug level increased | FAERS: 1 | US FAERS | |
| 1448 | Dry age-related macular degeneration | FAERS: 1 | US FAERS | |
| 1449 | Duodenal Obstruction | FAERS: 1 | US FAERS | |
| 1450 | Dysbacteriosis | FAERS: 1 | US FAERS | |
| 1451 | Dyslexia | FAERS: 1 | US FAERS | |
| 1452 | Dysphemia | FAERS: 1 | OFFSIDES US FAERS | |
| 1453 | EGFR gene mutation | FAERS: 1 | US FAERS | |
| 1454 | Ear infection staphylococcal | FAERS: 1 | US FAERS | |
| 1455 | Echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 1456 | Echolalia | FAERS: 1 | US FAERS | |
| 1457 | Ecthyma | FAERS: 1 | US FAERS | |
| 1458 | Electrocardiogram ST segment abnormal | FAERS: 1 | US FAERS | |
| 1459 | Electrocardiogram T wave peaked | FAERS: 1 | US FAERS | |
| 1460 | Electrocardiogram poor R-wave progression | FAERS: 1 | US FAERS | |
| 1461 | Electrolyte substitution therapy | FAERS: 1 | US FAERS | |
| 1462 | Elephantiasis Nostras Verrucosa | FAERS: 1 | US FAERS | |
| 1463 | Emotional poverty | FAERS: 1 | US FAERS | |
| 1464 | Endotracheal intubation complication | FAERS: 1 | US FAERS | |
| 1465 | Enterococcus test positive | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1466 | Entropion | FAERS: 1 | US FAERS | |
| 1467 | Enuresis | FAERS: 1 | US FAERS | |
| 1468 | Enzyme level abnormal | FAERS: 1 | US FAERS | |
| 1469 | Eosinophilic colitis | FAERS: 1 | US FAERS | |
| 1470 | Eosinophils urine present | FAERS: 1 | US FAERS | |
| 1471 | Epidermal growth factor receptor decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 1472 | Epidermolysis Bullosa | FAERS: 1 | US FAERS | |
| 1473 | Epstein-Barr virus associated lymphoproliferative disorder | FAERS: 1 | US FAERS | |
| 1474 | Erosive Duodenitis | FAERS: 1 | US FAERS | |
| 1475 | Erythroblast count increased | FAERS: 1 | US FAERS | |
| 1476 | Erythrosis | FAERS: 1 | US FAERS | |
| 1477 | Euphoric mood | FAERS: 1 | US FAERS | |
| 1478 | Euthanasia | FAERS: 1 | US FAERS | |
| 1479 | Excessive skin | FAERS: 1 | US FAERS | |
| 1480 | Exposure via body fluid | FAERS: 1 | US FAERS | |
| 1481 | Exposure via direct contact | FAERS: 1 | US FAERS | |
| 1482 | Exposure via father | FAERS: 1 | US FAERS | |
| 1483 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 1484 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 1485 | Eye allergy | FAERS: 1 | US FAERS | |
| 1486 | Eye operation complication | FAERS: 1 | US FAERS | |
| 1487 | Eyeball rupture | FAERS: 1 | US FAERS | |
| 1488 | Eyelid infection | FAERS: 1 | US FAERS | |
| 1489 | Factor VIII inhibition | FAERS: 1 | US FAERS | |
| 1490 | False positive investigation result | FAERS: 1 | US FAERS | |
| 1491 | Fanconi Syndrome | FAERS: 1 | US FAERS | |
| 1492 | Fasciitis | FAERS: 1 | US FAERS | |
| 1493 | Fat necrosis | FAERS: 1 | US FAERS | |
| 1494 | Fibrinolysis | FAERS: 1 | US FAERS | |
| 1495 | Food craving | FAERS: 1 | US FAERS | |
| 1496 | Frostbite | FAERS: 1 | US FAERS | |
| 1497 | Frustration | FAERS: 1 | US FAERS | |
| 1498 | Full blood count normal | FAERS: 1 | US FAERS | |
| 1499 | Fungal rhinitis | FAERS: 1 | US FAERS | |
| 1500 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 1501 | Gallstone ileus | FAERS: 1 | US FAERS | |
| 1502 | Gammopathy | FAERS: 1 | US FAERS | |
| 1503 | Gastrointestinal adenocarcinoma | FAERS: 1 | US FAERS | |
| 1504 | Gastrointestinal bacterial overgrowth | FAERS: 1 | US FAERS | |
| 1505 | Gastrointestinal mucosal disorder | FAERS: 1 | US FAERS | |
| 1506 | Gastrointestinal stenosis | FAERS: 1 | OFFSIDES US FAERS | |
| 1507 | Gastrointestinal wall thickening | FAERS: 1 | US FAERS | |
| 1508 | Gastrooesophageal sphincter insufficiency | FAERS: 1 | US FAERS | |
| 1509 | General physical condition | FAERS: 1 | US FAERS | |
| 1510 | General physical condition decreased | FAERS: 1 | US FAERS | |
| 1511 | Genital Herpes | FAERS: 1 | US FAERS | |
| 1512 | Genital abscess | FAERS: 1 | US FAERS | |
| 1513 | Genital burning sensation | FAERS: 1 | US FAERS | |
| 1514 | Genital pain | FAERS: 1 | US FAERS | |
| 1515 | Giardiasis | FAERS: 1 | US FAERS | |
| 1516 | Gingival blister | FAERS: 1 | US FAERS | |
| 1517 | Gingival discomfort | FAERS: 1 | US FAERS | |
| 1518 | Glioma | FAERS: 1 | US FAERS | |
| 1519 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 1520 | Graft infection | FAERS: 1 | US FAERS | |
| 1521 | Graft versus host disease in eye | FAERS: 1 | US FAERS | |
| 1522 | Graft versus host disease in lung | FAERS: 1 | US FAERS | |
| 1523 | Granulomatous liver disease | FAERS: 1 | OFFSIDES US FAERS | |
| 1524 | Grief reaction | FAERS: 1 | US FAERS | |
| 1525 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 1526 | Grip strength | FAERS: 1 | US FAERS | |
| 1527 | Hand-eye coordination impaired | FAERS: 1 | US FAERS | |
| 1528 | Heart valve stenosis | FAERS: 1 | US FAERS | |
| 1529 | Heat Stroke | FAERS: 1 | US FAERS | |
| 1530 | Hepatic Vein Thrombosis | FAERS: 1 | US FAERS | |
| 1531 | Hepatic amyloidosis | FAERS: 1 | US FAERS | |
| 1532 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 1533 | Hepatitis B DNA increased | FAERS: 1 | US FAERS | |
| 1534 | Hepatitis B surface antigen positive | FAERS: 1 | US FAERS | |
| 1535 | Hepatitis C virus test positive | FAERS: 1 | US FAERS | |
| 1536 | Hepatoblastoma | FAERS: 1 | US FAERS | |
| 1537 | Hepatosplenomegaly | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1538 | Herpes Zoster Oticus | FAERS: 1 | US FAERS | |
| 1539 | Herpes sepsis | FAERS: 1 | US FAERS | |
| 1540 | Hirsutism | FAERS: 1 | SIDER US FAERS | |
| 1541 | Histiocytic sarcoma | FAERS: 1 | US FAERS | |
| 1542 | Human Chorionic Gonadotropin | FAERS: 1 | US FAERS | |
| 1543 | Human Ehrlichiosis | FAERS: 1 | US FAERS | |
| 1544 | Human chorionic gonadotropin positive | FAERS: 1 | US FAERS | |
| 1545 | Human metapneumovirus test positive | FAERS: 1 | US FAERS | |
| 1546 | Hyperacusis | FAERS: 1 | US FAERS | |
| 1547 | Hypercapnia | FAERS: 1 | US FAERS | |
| 1548 | Hyperdynamic left ventricle | FAERS: 1 | US FAERS | |
| 1549 | Hypermetabolism | FAERS: 1 | US FAERS | |
| 1550 | Hyperosmolar state | FAERS: 1 | US FAERS | |
| 1551 | Hyperparathyroidism | FAERS: 1 | US FAERS | |
| 1552 | Hypersplenism | FAERS: 1 | OFFSIDES US FAERS | |
| 1553 | Hypertensive cardiomyopathy | FAERS: 1 | US FAERS | |
| 1554 | Hypertensive heart disease | FAERS: 1 | OFFSIDES US FAERS | |
| 1555 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 1556 | Hypervigilance | FAERS: 1 | OFFSIDES US FAERS | |
| 1557 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 1558 | Hypochondriasis | FAERS: 1 | US FAERS | |
| 1559 | Hypomania | FAERS: 1 | US FAERS | |
| 1560 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 1561 | Hypothalamo-pituitary disorder | FAERS: 1 | US FAERS | |
| 1562 | Idiopathic pneumonia syndrome | FAERS: 1 | US FAERS | |
| 1563 | Ileitis | FAERS: 1 | US FAERS | |
| 1564 | Illiteracy | FAERS: 1 | US FAERS | |
| 1565 | Immune Reconstitution Inflammatory Syndrome | FAERS: 1 | US FAERS | |
| 1566 | Immune-mediated adverse reaction | FAERS: 1 | US FAERS | |
| 1567 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 1568 | Incision site impaired healing | FAERS: 1 | US FAERS | |
| 1569 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 1570 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 1571 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 1572 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 1573 | Infectious disease carrier | FAERS: 1 | US FAERS | |
| 1574 | Infectious pleural effusion | FAERS: 1 | US FAERS | |
| 1575 | Infertile partner | FAERS: 1 | US FAERS | |
| 1576 | Infertility | FAERS: 1 | US FAERS | |
| 1577 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 1578 | Infusion site infection | FAERS: 1 | US FAERS | |
| 1579 | Inguinal mass | FAERS: 1 | US FAERS | |
| 1580 | Injection site pain | FAERS: 1 | US FAERS | |
| 1581 | Injection site pruritus | FAERS: 1 | US FAERS | |
| 1582 | Injection site scar | FAERS: 1 | US FAERS | |
| 1583 | Injection | FAERS: 1 | US FAERS | |
| 1584 | Insulin-requiring type 2 diabetes mellitus | FAERS: 1 | US FAERS | |
| 1585 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 1586 | Internal injury | FAERS: 1 | US FAERS | |
| 1587 | Intervertebral disc injury | FAERS: 1 | US FAERS | |
| 1588 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 1589 | Intra-abdominal pressure increased | FAERS: 1 | US FAERS | |
| 1590 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 1591 | Intussusception | FAERS: 1 | US FAERS | |
| 1592 | Invasive Lobular Breast Carcinoma | FAERS: 1 | US FAERS | |
| 1593 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 1594 | Iritis | FAERS: 1 | US FAERS | |
| 1595 | Irregular breathing | FAERS: 1 | US FAERS | |
| 1596 | Itching scar | FAERS: 1 | US FAERS | |
| 1597 | Joint abscess | FAERS: 1 | US FAERS | |
| 1598 | Keratitis | FAERS: 1 | US FAERS | |
| 1599 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 1600 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 1601 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 1602 | Large intestinal stenosis | FAERS: 1 | US FAERS | |
| 1603 | Laryngospasm | FAERS: 1 | US FAERS | |
| 1604 | Left atrial dilatation | FAERS: 1 | OFFSIDES US FAERS | |
| 1605 | Lentigo | FAERS: 1 | US FAERS | |
| 1606 | Leukoencephalopathy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1607 | Lichenification | FAERS: 1 | US FAERS | |
| 1608 | Life expectancy shortened | FAERS: 1 | US FAERS | |
| 1609 | Ligament injury | FAERS: 1 | US FAERS | |
| 1610 | Ligament pain | FAERS: 1 | US FAERS | |
| 1611 | Limb asymmetry | FAERS: 1 | US FAERS | |
| 1612 | Limb crushing injury | FAERS: 1 | US FAERS | |
| 1613 | Lipoma | FAERS: 1 | US FAERS | |
| 1614 | Listeria encephalitis | FAERS: 1 | US FAERS | |
| 1615 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 1616 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 1617 | Lower respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 1618 | Lumbar radiculopathy | FAERS: 1 | US FAERS | |
| 1619 | Lung carcinoma cell type unspecified stage II | FAERS: 1 | US FAERS | |
| 1620 | Lung cyst | FAERS: 1 | US FAERS | |
| 1621 | Lung neoplasm surgery | FAERS: 1 | US FAERS | |
| 1622 | Lung squamous cell carcinoma stage III | FAERS: 1 | US FAERS | |
| 1623 | Lymphatic obstruction | FAERS: 1 | US FAERS | |
| 1624 | Lymphatic system neoplasm | FAERS: 1 | OFFSIDES US FAERS | |
| 1625 | Lymphocytosis | FAERS: 1 | OFFSIDES US FAERS | |
| 1626 | Macrocytosis | FAERS: 1 | US FAERS | |
| 1627 | Macular pigmentation | FAERS: 1 | US FAERS | |
| 1628 | Malignant Fibrous Histiocytoma | FAERS: 1 | US FAERS | |
| 1629 | Malignant anorectal neoplasm | FAERS: 1 | US FAERS | |
| 1630 | Malignant ascites | FAERS: 1 | US FAERS | |
| 1631 | Malignant fibrous histiocytoma metastatic | FAERS: 1 | US FAERS | |
| 1632 | Malignant melanoma stage III | FAERS: 1 | US FAERS | |
| 1633 | Malignant neoplasm of ampulla of Vater | FAERS: 1 | US FAERS | |
| 1634 | Mastitis | FAERS: 1 | US FAERS | |
| 1635 | Medial Tibial Stress Syndrome | FAERS: 1 | US FAERS | |
| 1636 | Medical device site infection | FAERS: 1 | US FAERS | |
| 1637 | Medulloblastoma | FAERS: 1 | US FAERS | |
| 1638 | Megakaryocytes increased | FAERS: 1 | US FAERS | |
| 1639 | Meibomian gland dysfunction | FAERS: 1 | US FAERS | |
| 1640 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 1641 | Meningorrhagia | FAERS: 1 | US FAERS | |
| 1642 | Menopause | FAERS: 1 | US FAERS | |
| 1643 | Mesenteric Panniculitis | FAERS: 1 | US FAERS | |
| 1644 | Mesenteric arterial occlusion | FAERS: 1 | US FAERS | |
| 1645 | Metabolic function test abnormal | FAERS: 1 | US FAERS | |
| 1646 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 1647 | Metastases to stomach | FAERS: 1 | US FAERS | |
| 1648 | Metrorrhagia | FAERS: 1 | SIDER US FAERS | |
| 1649 | Microcytosis | FAERS: 1 | US FAERS | |
| 1650 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 1651 | Mitral valve disease mixed | FAERS: 1 | US FAERS | |
| 1652 | Monocyte count decreased | FAERS: 1 | US FAERS | |
| 1653 | Monoparesis | FAERS: 1 | US FAERS | |
| 1654 | Morganella infection | FAERS: 1 | US FAERS | |
| 1655 | Mouth cyst | FAERS: 1 | US FAERS | |
| 1656 | Mucosal Infection | FAERS: 1 | US FAERS | |
| 1657 | Mumps | FAERS: 1 | US FAERS | |
| 1658 | Muscle tone disorder | FAERS: 1 | US FAERS | |
| 1659 | Mutism | FAERS: 1 | US FAERS | |
| 1660 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 1661 | Myeloid Metaplasia | FAERS: 1 | US FAERS | |
| 1662 | Myopericarditis | FAERS: 1 | US FAERS | |
| 1663 | Myopia | FAERS: 1 | US FAERS | |
| 1664 | Nail bed disorder | FAERS: 1 | US FAERS | |
| 1665 | Nail bed infection | FAERS: 1 | US FAERS | |
| 1666 | Nail pigmentation | FAERS: 1 | US FAERS | |
| 1667 | Nasal Polyps | FAERS: 1 | US FAERS | |
| 1668 | Nasal mucosal disorder | FAERS: 1 | US FAERS | |
| 1669 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 1670 | Nephrectomy | FAERS: 1 | US FAERS | |
| 1671 | Neuroblastoma | FAERS: 1 | US FAERS | |
| 1672 | No adverse reaction | FAERS: 1 | US FAERS | |
| 1673 | Nodular melanoma | FAERS: 1 | US FAERS | |
| 1674 | Nodular regenerative hyperplasia | FAERS: 1 | US FAERS | |
| 1675 | Non-small cell lung cancer recurrent | FAERS: 1 | US FAERS | |
| 1676 | Nutritional condition abnormal | FAERS: 1 | US FAERS | |
| 1677 | Nystagmus | FAERS: 1 | US FAERS | |
| 1678 | Ocular vascular disorder | FAERS: 1 | US FAERS | |
| 1679 | Oliguria | FAERS: 1 | US FAERS | |
| 1680 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 1681 | Optic disc vascular disorder | FAERS: 1 | US FAERS | |
| 1682 | Oral contusion | FAERS: 1 | US FAERS | |
| 1683 | Orchitis | FAERS: 1 | US FAERS | |
| 1684 | Oroantral Fistula | FAERS: 1 | US FAERS | |
| 1685 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 1686 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 1687 | Oropharyngeal plaque | FAERS: 1 | US FAERS | |
| 1688 | Oropharyngeal spasm | FAERS: 1 | US FAERS | |
| 1689 | Osteoma cutis | FAERS: 1 | US FAERS | |
| 1690 | Ovarian cancer stage IV | FAERS: 1 | US FAERS | |
| 1691 | Overlap syndrome | FAERS: 1 | US FAERS | |
| 1692 | PCO2 decreased | FAERS: 1 | US FAERS | |
| 1693 | PO2 decreased | FAERS: 1 | US FAERS | |
| 1694 | PO2 increased | FAERS: 1 | US FAERS | |
| 1695 | Pacemaker complication | FAERS: 1 | US FAERS | |
| 1696 | Pachymeningitis | FAERS: 1 | US FAERS | |
| 1697 | Pain management | FAERS: 1 | US FAERS | |
| 1698 | Palmar erythema | FAERS: 1 | US FAERS | |
| 1699 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 1700 | Pancreatic Pseudocyst | FAERS: 1 | US FAERS | |
| 1701 | Pancreatic carcinoma recurrent | FAERS: 1 | US FAERS | |
| 1702 | Pancreatic duct dilatation | FAERS: 1 | OFFSIDES US FAERS | |
| 1703 | Panic Disorder | FAERS: 1 | US FAERS | |
| 1704 | Parakeratosis | FAERS: 1 | US FAERS | |
| 1705 | Paranoia | FAERS: 1 | US FAERS | |
| 1706 | Paraparesis | FAERS: 1 | US FAERS | |
| 1707 | Parathyroid hormone-related protein increased | FAERS: 1 | US FAERS | |
| 1708 | Paresis | FAERS: 1 | US FAERS | |
| 1709 | Parkinsonian rest tremor | FAERS: 1 | US FAERS | |
| 1710 | Parophthalmia | FAERS: 1 | US FAERS | |
| 1711 | Pelvic discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 1712 | Peptic Ulcer Perforation | FAERS: 1 | US FAERS | |
| 1713 | Perineal infection | FAERS: 1 | US FAERS | |
| 1714 | Periodontal infection | FAERS: 1 | US FAERS | |
| 1715 | Periorbital contusion | FAERS: 1 | US FAERS | |
| 1716 | Periorbital disorder | FAERS: 1 | US FAERS | |
| 1717 | Periorbital swelling | FAERS: 1 | US FAERS | |
| 1718 | Peripancreatic fluid collection | FAERS: 1 | US FAERS | |
| 1719 | Peripheral arthritis | FAERS: 1 | US FAERS | |
| 1720 | Peripheral nerve lesion | FAERS: 1 | US FAERS | |
| 1721 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 1722 | Peritoneal Dialysis | FAERS: 1 | US FAERS | |
| 1723 | Peritoneal effluent abnormal | FAERS: 1 | US FAERS | |
| 1724 | Phantom pain | FAERS: 1 | US FAERS | |
| 1725 | Phrenic nerve paralysis | FAERS: 1 | US FAERS | |
| 1726 | Piloerection | FAERS: 1 | US FAERS | |
| 1727 | Plague | FAERS: 1 | US FAERS | |
| 1728 | Plasma cells decreased | FAERS: 1 | US FAERS | |
| 1729 | Plasmapheresis | FAERS: 1 | US FAERS | |
| 1730 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 1731 | Pneumonia Pseudomonas aeruginosa | FAERS: 1 | US FAERS | |
| 1732 | Pneumonia herpes viral | FAERS: 1 | US FAERS | |
| 1733 | Pneumovirus test positive | FAERS: 1 | US FAERS | |
| 1734 | Poisoning | FAERS: 1 | US FAERS | |
| 1735 | Polyarteritis Nodosa | FAERS: 1 | US FAERS | |
| 1736 | Polychondritis | FAERS: 1 | US FAERS | |
| 1737 | Polydipsia | FAERS: 1 | US FAERS | |
| 1738 | Polymyalgia Rheumatica | FAERS: 1 | OFFSIDES US FAERS | |
| 1739 | Portal venous gas | FAERS: 1 | US FAERS | |
| 1740 | Post procedural myocardial infarction | FAERS: 1 | US FAERS | |
| 1741 | Post procedural sepsis | FAERS: 1 | US FAERS | |
| 1742 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 1743 | Post-traumatic pain | FAERS: 1 | US FAERS | |
| 1744 | Posterior capsule opacification | FAERS: 1 | US FAERS | |
| 1745 | Postmenopause | FAERS: 1 | US FAERS | |
| 1746 | Postoperative adhesion | FAERS: 1 | US FAERS | |
| 1747 | Postoperative fever | FAERS: 1 | US FAERS | |
| 1748 | Postoperative thrombosis | FAERS: 1 | US FAERS | |
| 1749 | Postrenal failure | FAERS: 1 | US FAERS | |
| 1750 | Postural Orthostatic Tachycardia Syndrome | FAERS: 1 | US FAERS | |
| 1751 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 1752 | Primary Myelofibrosis | FAERS: 1 | 17870158 19720904 | CTD US FAERS |
| 1753 | Primary mediastinal large B-cell lymphoma recurrent | FAERS: 1 | US FAERS | |
| 1754 | Procedural nausea | FAERS: 1 | US FAERS | |
| 1755 | Procedural vomiting | FAERS: 1 | US FAERS | |
| 1756 | Product availability issue | FAERS: 1 | US FAERS | |
| 1757 | Product compounding quality issue | FAERS: 1 | US FAERS | |
| 1758 | Product dispensing issue | FAERS: 1 | US FAERS | |
| 1759 | Product formulation issue | FAERS: 1 | US FAERS | |
| 1760 | Product packaging issue | FAERS: 1 | US FAERS | |
| 1761 | Product tampering | FAERS: 1 | US FAERS | |
| 1762 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 1763 | Prostate cancer recurrent | FAERS: 1 | US FAERS | |
| 1764 | Prostatectomy | FAERS: 1 | OFFSIDES US FAERS | |
| 1765 | Prothrombin time abnormal | FAERS: 1 | US FAERS | |
| 1766 | Psychiatric decompensation | FAERS: 1 | OFFSIDES US FAERS | |
| 1767 | Psychogenic erectile dysfunction | FAERS: 1 | US FAERS | |
| 1768 | Pterygium | FAERS: 1 | OFFSIDES US FAERS | |
| 1769 | Pubic pain | FAERS: 1 | US FAERS | |
| 1770 | Pulmonary amyloidosis | FAERS: 1 | US FAERS | |
| 1771 | Pulmonary arterial hypertension | FAERS: 1 | US FAERS | |
| 1772 | Pulmonary function test decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 1773 | Purulence | FAERS: 1 | US FAERS | |
| 1774 | Radial nerve palsy | FAERS: 1 | US FAERS | |
| 1775 | Rash follicular | FAERS: 1 | US FAERS | |
| 1776 | Rectal fissure | FAERS: 1 | US FAERS | |
| 1777 | Rectal polyp | FAERS: 1 | US FAERS | |
| 1778 | Rectocele | FAERS: 1 | US FAERS | |
| 1779 | Rectosigmoid cancer stage III | FAERS: 1 | US FAERS | |
| 1780 | Red man syndrome | FAERS: 1 | US FAERS | |
| 1781 | Reflux gastritis | FAERS: 1 | US FAERS | |
| 1782 | Refractory cancer | FAERS: 1 | US FAERS | |
| 1783 | Refusal of treatment by relative | FAERS: 1 | US FAERS | |
| 1784 | Regurgitation of food | FAERS: 1 | SIDER US FAERS | |
| 1785 | Renal Artery Stenosis | FAERS: 1 | US FAERS | |
| 1786 | Renal Osteodystrophy | FAERS: 1 | US FAERS | |
| 1787 | Renal artery occlusion | FAERS: 1 | US FAERS | |
| 1788 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 1789 | Respiratory fatigue | FAERS: 1 | US FAERS | |
| 1790 | Respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 1791 | Respirovirus test positive | FAERS: 1 | US FAERS | |
| 1792 | Restrictive cardiomyopathy | FAERS: 1 | US FAERS | |
| 1793 | Retinal artery embolism | FAERS: 1 | US FAERS | |
| 1794 | Retroperitoneal abscess | FAERS: 1 | US FAERS | |
| 1795 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 1796 | Retroperitoneal lymphadenopathy | FAERS: 1 | OFFSIDES US FAERS | |
| 1797 | Retroperitoneal mass | FAERS: 1 | US FAERS | |
| 1798 | Rheumatic disorder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1799 | Rhinalgia | FAERS: 1 | US FAERS | |
| 1800 | Rhonchi | FAERS: 1 | US FAERS | |
| 1801 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 1802 | Rocky Mountain Spotted Fever | FAERS: 1 | US FAERS | |
| 1803 | Root canal infection | FAERS: 1 | US FAERS | |
| 1804 | Rubber sensitivity | FAERS: 1 | US FAERS | |
| 1805 | Saliva altered | FAERS: 1 | US FAERS | |
| 1806 | Salmonella test positive | FAERS: 1 | US FAERS | |
| 1807 | Sarcoma of skin | FAERS: 1 | US FAERS | |
| 1808 | Schizoaffective Disorder | FAERS: 1 | US FAERS | |
| 1809 | Scotoma | FAERS: 1 | US FAERS | |
| 1810 | Septic embolus | FAERS: 1 | US FAERS | |
| 1811 | Shunt malfunction | FAERS: 1 | US FAERS | |
| 1812 | Shunt thrombosis | FAERS: 1 | US FAERS | |
| 1813 | Sight disability | FAERS: 1 | US FAERS | |
| 1814 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 1815 | Skin Induration | FAERS: 1 | US FAERS | |
| 1816 | Skin texture abnormal | FAERS: 1 | US FAERS | |
| 1817 | Skull X-ray abnormal | FAERS: 1 | US FAERS | |
| 1818 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 1819 | Slow speech | FAERS: 1 | US FAERS | |
| 1820 | Small cell lung cancer extensive stage | FAERS: 1 | US FAERS | |
| 1821 | Sodium retention | FAERS: 1 | US FAERS | |
| 1822 | Soft Tissue Infection | FAERS: 1 | US FAERS | |
| 1823 | Somatic symptom disorder | FAERS: 1 | US FAERS | |
| 1824 | Sperm concentration zero | FAERS: 1 | US FAERS | |
| 1825 | Spinal synovial cyst | FAERS: 1 | US FAERS | |
| 1826 | Splenic vein thrombosis | FAERS: 1 | US FAERS | |
| 1827 | Staphylococcal pharyngitis | FAERS: 1 | US FAERS | |
| 1828 | Staring | FAERS: 1 | US FAERS | |
| 1829 | Stasis dermatitis | FAERS: 1 | OFFSIDES US FAERS | |
| 1830 | Stent malfunction | FAERS: 1 | US FAERS | |
| 1831 | Stridor | FAERS: 1 | US FAERS | |
| 1832 | Subclavian Steal Syndrome | FAERS: 1 | US FAERS | |
| 1833 | Submandibular mass | FAERS: 1 | US FAERS | |
| 1834 | Superficial spreading melanoma stage III | FAERS: 1 | US FAERS | |
| 1835 | Superficial vein prominence | FAERS: 1 | US FAERS | |
| 1836 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 1837 | Symptom masked | FAERS: 1 | US FAERS | |
| 1838 | Systemic lupus erythematosus rash | FAERS: 1 | US FAERS | |
| 1839 | Systemic viral infection | FAERS: 1 | US FAERS | |
| 1840 | T-cell lymphoma recurrent | FAERS: 1 | US FAERS | |
| 1841 | Thalamic infarction | FAERS: 1 | US FAERS | |
| 1842 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 1843 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 1844 | Therapy partial responder | FAERS: 1 | US FAERS | |
| 1845 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 1846 | Thought withdrawal | FAERS: 1 | US FAERS | |
| 1847 | Thrombosed varicose vein | FAERS: 1 | US FAERS | |
| 1848 | Thyroid hormones decreased | FAERS: 1 | US FAERS | |
| 1849 | Thyroid hormones increased | FAERS: 1 | US FAERS | |
| 1850 | Thyroidectomy | FAERS: 1 | OFFSIDES US FAERS | |
| 1851 | Tick-borne fever | FAERS: 1 | US FAERS | |
| 1852 | Tissue injury | FAERS: 1 | US FAERS | |
| 1853 | Tongue biting | FAERS: 1 | US FAERS | |
| 1854 | Tongue movement disturbance | FAERS: 1 | US FAERS | |
| 1855 | Tonsillectomy | FAERS: 1 | OFFSIDES US FAERS | |
| 1856 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 1857 | Toxoplasmosis | FAERS: 1 | US FAERS | |
| 1858 | Tracheitis | FAERS: 1 | OFFSIDES US FAERS | |
| 1859 | Transient lingual papillitis | FAERS: 1 | US FAERS | |
| 1860 | Transitional cell carcinoma metastatic | FAERS: 1 | US FAERS | |
| 1861 | Transitional cell carcinoma urethra | FAERS: 1 | US FAERS | |
| 1862 | Traumatic liver injury | FAERS: 1 | US FAERS | |
| 1863 | Treatment related secondary malignancy | FAERS: 1 | US FAERS | |
| 1864 | Troponin T increased | FAERS: 1 | US FAERS | |
| 1865 | Ultrasound liver abnormal | FAERS: 1 | US FAERS | |
| 1866 | Unevaluable investigation | FAERS: 1 | US FAERS | |
| 1867 | Unspecified agent exposure during pregnancy | FAERS: 1 | US FAERS | |
| 1868 | Upper respiratory fungal infection | FAERS: 1 | US FAERS | |
| 1869 | Upper respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 1870 | Ureterolithiasis | FAERS: 1 | US FAERS | |
| 1871 | Urethral discharge | FAERS: 1 | US FAERS | |
| 1872 | Urethritis noninfective | FAERS: 1 | US FAERS | |
| 1873 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 1874 | Urinary sediment abnormal | FAERS: 1 | US FAERS | |
| 1875 | Urinary sediment present | FAERS: 1 | US FAERS | |
| 1876 | Urinary straining | FAERS: 1 | US FAERS | |
| 1877 | Urinary tract infection fungal | FAERS: 1 | OFFSIDES US FAERS | |
| 1878 | Urinary tract infection pseudomonal | FAERS: 1 | US FAERS | |
| 1879 | Urine calcium increased | FAERS: 1 | US FAERS | |
| 1880 | Uveitis | FAERS: 1 | US FAERS | |
| 1881 | Vaginal abscess | FAERS: 1 | US FAERS | |
| 1882 | Vaginal lesion | FAERS: 1 | US FAERS | |
| 1883 | Vascular access malfunction | FAERS: 1 | US FAERS | |
| 1884 | Vascular encephalopathy | FAERS: 1 | US FAERS | |
| 1885 | Vascular purpura | FAERS: 1 | US FAERS | |
| 1886 | Vascular rupture | FAERS: 1 | US FAERS | |
| 1887 | Vascular stent thrombosis | FAERS: 1 | US FAERS | |
| 1888 | Vasculitic ulcer | FAERS: 1 | US FAERS | |
| 1889 | Vein pain | FAERS: 1 | US FAERS | |
| 1890 | Ventricular Flutter | FAERS: 1 | US FAERS | |
| 1891 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 1892 | Vestibular Neuronitis | FAERS: 1 | US FAERS | |
| 1893 | Visual acuity tests abnormal | FAERS: 1 | US FAERS | |
| 1894 | Vitamin B1 decreased | FAERS: 1 | US FAERS | |
| 1895 | Vitamin B12 abnormal | FAERS: 1 | US FAERS | |
| 1896 | Vitamin B6 increased | FAERS: 1 | US FAERS | |
| 1897 | Vitamin D abnormal | FAERS: 1 | US FAERS | |
| 1898 | Vitiligo | FAERS: 1 | US FAERS | |
| 1899 | Vitreous haze | FAERS: 1 | US FAERS | |
| 1900 | Walking aid user | FAERS: 1 | US FAERS | |
| 1901 | Weight | FAERS: 1 | US FAERS | |
| 1902 | West Nile viral infection | FAERS: 1 | US FAERS | |
| 1903 | Wound decomposition | FAERS: 1 | US FAERS | |
| 1904 | Wound infection pseudomonas | FAERS: 1 | OFFSIDES US FAERS | |
| 1905 | Wound sepsis | FAERS: 1 | US FAERS | |
| 1906 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 1907 | X-ray abnormal | FAERS: 1 | US FAERS | |
| 1908 | Xanthopsia | FAERS: 1 | US FAERS | |
| 1909 | Zinc deficiency | FAERS: 1 | US FAERS | |
| 1910 | colonoscopy | FAERS: 1 | US FAERS | |
| 1911 | gallbladder neoplasm | FAERS: 1 | US FAERS | |
| 1912 | insulinoma | FAERS: 1 | US FAERS | |
| 1913 | keratoacanthoma | FAERS: 1 | OFFSIDES US FAERS | |
| 1914 | pH urine decreased | FAERS: 1 | US FAERS | |
| 1915 | Abdominal tenderness | SIDER | ||
| 1916 | Abdominal wall infection | Canada Vigilance: 1 | Canada Vigilance | |
| 1917 | Abdominal wound dehiscence | OFFSIDES | ||
| 1918 | Abscess management | OFFSIDES | ||
| 1919 | Acid reflux | OFFSIDES | ||
| 1920 | Acquired porphyria | OFFSIDES | ||
| 1921 | Acute otitis media | OFFSIDES | ||
| 1922 | Adjustment disorder with depressed mood | Canada Vigilance: 1 | Canada Vigilance | |
| 1923 | Altered visual depth perception | Canada Vigilance: 1 | Canada Vigilance | |
| 1924 | Amino acid level increased | OFFSIDES | ||
| 1925 | Amyotrophic Lateral Sclerosis | 16510725 | CTD | |
| 1926 | Anemia | 19118065 19720904 | CTD | |
| 1927 | Anhidrosis | OFFSIDES | ||
| 1928 | Arterial aneurysm | SIDER | ||
| 1929 | Arterial therapeutic procedure | OFFSIDES | ||
| 1930 | Arthritis aggravated | SIDER | ||
| 1931 | Azotemia | 18452093 | CTD | |
| 1932 | Bilevel positive airway pressure | OFFSIDES | ||
| 1933 | Biloma | OFFSIDES | ||
| 1934 | Biopsy bone marrow normal | OFFSIDES | ||
| 1935 | Blood and lymphatic system disorders | SIDER | ||
| 1936 | Blood potassium | OFFSIDES | ||
| 1937 | Bone Marrow Diseases | 23892921 | CTD | |
| 1938 | Bone marrow depression | SIDER | ||
| 1939 | Bowel spasm | SIDER | ||
| 1940 | Brain stem thrombosis | OFFSIDES | ||
| 1941 | Bullous lung disease | OFFSIDES | ||
| 1942 | COPD exacerbation | SIDER | ||
| 1943 | Carcinoma | SIDER | ||
| 1944 | Cardiac autonomic neuropathy | OFFSIDES | ||
| 1945 | Cardiac valve sclerosis | OFFSIDES | ||
| 1946 | Central line infection | SIDER | ||
| 1947 | Central venous catheter removal | OFFSIDES | ||
| 1948 | Cerebral Arteriosclerosis | OFFSIDES | ||
| 1949 | Chemical and Drug Induced Liver Injury | 20011646 | CTD | |
| 1950 | Cholangiolitis | OFFSIDES | ||
| 1951 | Cholelithotomy | OFFSIDES | ||
| 1952 | Choroidal Detachment | OFFSIDES | ||
| 1953 | Corneal dystrophy | OFFSIDES | ||
| 1954 | Culture negative | SIDER | ||
| 1955 | Culture wound positive | OFFSIDES | ||
| 1956 | Cutaneous Candidiasis | OFFSIDES | ||
| 1957 | Denervation atrophy | OFFSIDES | ||
| 1958 | Dental prosthesis placement | OFFSIDES | ||
| 1959 | Dyspnoea exacerbated | SIDER | ||
| 1960 | Ear and labyrinth disorders | SIDER | ||
| 1961 | Ejection fraction abnormal | OFFSIDES | ||
| 1962 | Encephalomalacia | OFFSIDES | ||
| 1963 | Endometrial sarcoma | OFFSIDES | ||
| 1964 | Enterobacter sepsis | SIDER | ||
| 1965 | Esophageal Stenosis | OFFSIDES | ||
| 1966 | Eye laser surgery | OFFSIDES | ||
| 1967 | Fibrillation atrial aggravated | SIDER | ||
| 1968 | Fluid replacement | Canada Vigilance: 1 | Canada Vigilance | |
| 1969 | Focal glomerulosclerosis | OFFSIDES | ||
| 1970 | Foot pain | SIDER | ||
| 1971 | Fungal rash | OFFSIDES | ||
| 1972 | Gastric Stenosis | OFFSIDES | ||
| 1973 | Gastroduodenitis | OFFSIDES | ||
| 1974 | Gastrointestinal Diseases | 20052472 | CTD | |
| 1975 | Gingival graft | OFFSIDES | ||
| 1976 | Goiter | OFFSIDES | ||
| 1977 | Hepatic calcification | OFFSIDES | ||
| 1978 | Hepatitis A | OFFSIDES | ||
| 1979 | Hidradenitis | OFFSIDES | ||
| 1980 | Hoarseness | SIDER | ||
| 1981 | Hypogonadism | OFFSIDES | ||
| 1982 | Iliac artery stenosis | OFFSIDES | ||
| 1983 | Infective tenosynovitis | OFFSIDES | ||
| 1984 | Infestation | SIDER | ||
| 1985 | Injection site bruising | SIDER | ||
| 1986 | Intraductal papilloma of breast | OFFSIDES | ||
| 1987 | Kidney Failure | OFFSIDES | ||
| 1988 | Klebsiella sepsis | SIDER | ||
| 1989 | Leukopenia neonatal | OFFSIDES | ||
| 1990 | Leukoplakia | OFFSIDES | ||
| 1991 | Light chain disease | OFFSIDES | ||
| 1992 | Lithotripsy | OFFSIDES | ||
| 1993 | Liver Failure, Acute | 20011646 | CTD | |
| 1994 | Lower respiratory tract infection viral | OFFSIDES | ||
| 1995 | Lung hyperinflation | OFFSIDES | ||
| 1996 | Lymph nodes scan abnormal | OFFSIDES | ||
| 1997 | Lymphohistiocytosis | OFFSIDES | ||
| 1998 | Lymphoma, Non-Hodgkin | 18217897 | CTD | |
| 1999 | Malignant neoplasm of spinal cord | OFFSIDES | ||
| 2000 | Malignant tumour excision | OFFSIDES | ||
| 2001 | Mammary duct ectasia | OFFSIDES | ||
| 2002 | Mental Retardation | OFFSIDES | ||
| 2003 | Metastatic pain | OFFSIDES | ||
| 2004 | Muscle relaxant therapy | SIDER | ||
| 2005 | Myelodysplasia | OFFSIDES | ||
| 2006 | Myelosuppression | SIDER | ||
| 2007 | Myocardial fibrosis | Canada Vigilance: 1 | Canada Vigilance | |
| 2008 | Neutrophilic dermatosis | SIDER | ||
| 2009 | Nodule on extremity | OFFSIDES | ||
| 2010 | Obsessive thoughts | OFFSIDES | ||
| 2011 | Ocular vasculitis | OFFSIDES | ||
| 2012 | Onychalgia | OFFSIDES | ||
| 2013 | Oral Cavity Fistula | OFFSIDES | ||
| 2014 | Oral discharge | OFFSIDES | ||
| 2015 | Osteoradionecrosis | OFFSIDES | ||
| 2016 | Oxygen supplementation | OFFSIDES | ||
| 2017 | Pancreatic Cyst | OFFSIDES | ||
| 2018 | Pancreatitis due to biliary obstruction | SIDER | ||
| 2019 | Papilloma | OFFSIDES | ||
| 2020 | Paraproteinemias | 18452093 | CTD | |
| 2021 | Paroxysmal arrhythmia | OFFSIDES | ||
| 2022 | Patellofemoral Pain Syndrome | OFFSIDES | ||
| 2023 | Pelvic prolapse | OFFSIDES | ||
| 2024 | Penile Infection | Canada Vigilance: 1 | Canada Vigilance | |
| 2025 | Periarthritis | SIDER | ||
| 2026 | Peripheral Nervous System Diseases | 16840727 20385792 23892921 | CTD | |
| 2027 | Perirectal abscess | Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER | |
| 2028 | Pitting edema | SIDER | ||
| 2029 | Platelet Transfusion | Canada Vigilance: 5 | Canada Vigilance | |
| 2030 | Pneumoconiosis | OFFSIDES | ||
| 2031 | Poor dental condition | OFFSIDES | ||
| 2032 | Poor personal hygiene | OFFSIDES | ||
| 2033 | Postmenopausal bleeding | OFFSIDES | ||
| 2034 | Presbyopia | OFFSIDES | ||
| 2035 | Primary Hypothyroidism | SIDER | ||
| 2036 | Prostate examination abnormal | OFFSIDES | ||
| 2037 | Prostatic Neoplasms | 20052472 | CTD | |
| 2038 | Prurigo | SIDER | ||
| 2039 | Recurrence | 29177954 | CTD | |
| 2040 | Refractory cytopenia with unilineage dysplasia | SIDER | ||
| 2041 | Rehabilitation therapy | Canada Vigilance: 1 | Canada Vigilance | |
| 2042 | Residual urine | OFFSIDES | ||
| 2043 | Retro-orbital neoplasm | Canada Vigilance: 1 | Canada Vigilance | |
| 2044 | Retropharyngeal Abscess | OFFSIDES | ||
| 2045 | Right atrial dilatation | OFFSIDES | ||
| 2046 | Sacroiliitis | OFFSIDES | ||
| 2047 | Sarcopenia | OFFSIDES | ||
| 2048 | Scrotal cyst | OFFSIDES | ||
| 2049 | Skin Erosion | OFFSIDES | ||
| 2050 | Spondylitic myelopathy | OFFSIDES | ||
| 2051 | Spondylolisthesis | OFFSIDES | ||
| 2052 | Stiffness | SIDER | ||
| 2053 | Strabismus | Canada Vigilance: 1 | Canada Vigilance | |
| 2054 | Sweating | SIDER | ||
| 2055 | Tendinitis | OFFSIDES | ||
| 2056 | Teratogenesis | 25043012 | CTD | |
| 2057 | Thromboembolism | 17723971 20979938 | CTD | |
| 2058 | Troponin I increased | SIDER | ||
| 2059 | Tryptase increased | OFFSIDES | ||
| 2060 | Upper aerodigestive tract infection | OFFSIDES | ||
| 2061 | Upset stomach | SIDER | ||
| 2062 | Urate nephropathy | OFFSIDES | ||
| 2063 | Ureteral stent insertion | OFFSIDES | ||
| 2064 | Urge Incontinence | OFFSIDES | ||
| 2065 | Uterovaginal prolapse | OFFSIDES | ||
| 2066 | Vagotomy | OFFSIDES | ||
| 2067 | Vascular insufficiency | OFFSIDES | ||
| 2068 | Venous Thromboembolism | SIDER | ||
| 2069 | Venous stenosis | OFFSIDES | ||
| 2070 | Ventricular Dysfunction | SIDER | ||
| 2071 | Vertebral artery occlusion | OFFSIDES | ||
| 2072 | Vitamin A Deficiency | OFFSIDES | ||
| 2073 | bone marrow fibrosis | OFFSIDES | ||
| 2074 | fibroma | OFFSIDES | ||
| 2075 | kyphosis | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.