Teriparatide
(OGBMKVWORPGQRR-UMXFMPSGSA-N)
Structure
- SMILES
- NCCCC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)Cc1ccccc1)CC(=O)N)Cc1nc[nH]c1)C(C)C)CC(=O)O)CCC(=O)N)CC(C)C)CCCCN)CCCCN)CCCNC(=N)N)CC(C)C)Cc1c[nH]c2c1cccc2)CCC(=O)O)C(C)C)CCCNC(=N)N)CCC(=O)O)CCSC)CO)CC(=O)N)CC(C)C)Cc1nc[nH]c1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H]([C@H](CC)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)[C@H](CO)N)CO)CCC(=O)O)CCC(=O)N)CC(C)C)CCSC)Cc1nc[nH]c1)CC(=O)N)CC(C)C
- Molecular Formula:
- C181H291N55O51S2
- Molecular Weight:
- 4117.720
- Log P:
- 6.3440
- Hydrogen Bond Acceptor:
- 104
- Hydrogen Bond Donor:
- 60
- TPSA:
- 1803.25
- CAS Number(s):
- 52232-67-4
Synonym(s)
1.
Teriparatide
2.
Human Parathyroid Hormone (1-34)
3.
hPTH (1-34)
4.
Forteo
5.
Parathar
6.
Teriparatide Acetate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Arthralgia | FAERS: 5342 Canada Vigilance: 10 | Canada Vigilance SIDER US FAERS | |
| 2 | Nausea | FAERS: 5327 Canada Vigilance: 20 | Canada Vigilance SIDER US FAERS | |
| 3 | Dizziness | FAERS: 4839 Canada Vigilance: 18 | Canada Vigilance SIDER US FAERS | |
| 4 | Pain | FAERS: 4539 Canada Vigilance: 13 | Canada Vigilance SIDER US FAERS | |
| 5 | Fatigue | FAERS: 4182 Canada Vigilance: 14 | Canada Vigilance SIDER US FAERS | |
| 6 | Malaise | FAERS: 3881 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 7 | Injection site erythema | FAERS: 3543 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 8 | Back Pain | FAERS: 3519 Canada Vigilance: 11 | Canada Vigilance SIDER US FAERS | |
| 9 | Injection site bruising | FAERS: 3362 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 10 | Injection site pain | FAERS: 3239 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 11 | Headache | FAERS: 3190 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 12 | Asthenia | FAERS: 2914 Canada Vigilance: 20 | Canada Vigilance SIDER US FAERS | |
| 13 | Bone pain | FAERS: 2619 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 14 | Feeling abnormal | FAERS: 2428 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 15 | Drug dose omission | FAERS: 2405 | US FAERS | |
| 16 | Myalgia | FAERS: 1594 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 17 | Constipation | FAERS: 1322 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 18 | Intentional product misuse | FAERS: 1267 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Vomiting | FAERS: 1256 Canada Vigilance: 18 | Canada Vigilance SIDER US FAERS | |
| 20 | Anxiety | FAERS: 1255 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 21 | Weight decreased | FAERS: 1141 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 22 | Pneumonia | FAERS: 1099 Canada Vigilance: 24 | Canada Vigilance SIDER US FAERS | |
| 23 | Abdominal discomfort | FAERS: 1079 | US FAERS | |
| 24 | Nasopharyngitis | FAERS: 1078 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 25 | Pruritus | FAERS: 1060 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 26 | Pharmaceutical product complaint | FAERS: 1003 | US FAERS | |
| 27 | Medication Error | FAERS: 966 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 28 | Bone density decreased | FAERS: 872 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Arthritis | FAERS: 868 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Palpitations | FAERS: 849 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 31 | Musculoskeletal Pain | FAERS: 809 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Nervousness | FAERS: 791 | US FAERS | |
| 33 | Tremor | FAERS: 757 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 34 | Alopecia | FAERS: 720 | US FAERS | |
| 35 | Peripheral swelling | FAERS: 691 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 36 | Fracture | FAERS: 681 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 37 | Neck Pain | FAERS: 670 | SIDER US FAERS | |
| 38 | Memory impairment | FAERS: 634 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Somnolence | FAERS: 626 | US FAERS | |
| 40 | Influenza | FAERS: 623 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 41 | Chest Pain | FAERS: 605 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 42 | Erythema | FAERS: 598 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 43 | Cerebrovascular accident | FAERS: 595 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 44 | Musculoskeletal stiffness | FAERS: 582 | US FAERS | |
| 45 | Joint swelling | FAERS: 568 | US FAERS | |
| 46 | Limb discomfort | FAERS: 542 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Abdominal Pain | FAERS: 524 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 48 | Discomfort | FAERS: 514 | US FAERS | |
| 49 | Musculoskeletal discomfort | FAERS: 504 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 50 | Urinary tract infection | FAERS: 490 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 51 | Hypersensitivity | FAERS: 483 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 52 | Visual Impairment | FAERS: 479 | US FAERS | |
| 53 | Arthropathy | FAERS: 476 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Nephrolithiasis | FAERS: 474 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 55 | Incorrect product storage | FAERS: 473 | US FAERS | |
| 56 | Drug ineffective | FAERS: 459 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 57 | Injection Site Reaction | FAERS: 454 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 58 | Bronchitis | FAERS: 451 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Adverse event | FAERS: 450 | US FAERS | |
| 60 | Dysgeusia | FAERS: 423 | US FAERS | |
| 61 | Overdose | FAERS: 411 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 62 | Sleep disorder due to a general medical condition | FAERS: 407 | US FAERS | |
| 63 | Accidental overdose | FAERS: 405 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Myocardial Infarction | FAERS: 401 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 65 | Dyspepsia | FAERS: 399 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 66 | Incorrect dose administered | FAERS: 393 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Burning sensation | FAERS: 385 | US FAERS | |
| 68 | Urticaria | FAERS: 384 | SIDER US FAERS | |
| 69 | Injection site mass | FAERS: 363 | US FAERS | |
| 70 | Dehydration | FAERS: 360 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 71 | Chills | FAERS: 351 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 72 | Sinusitis | FAERS: 343 | US FAERS | |
| 73 | Therapy cessation | FAERS: 324 | US FAERS | |
| 74 | Blood alkaline phosphatase increased | FAERS: 323 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 75 | Vertigo | FAERS: 317 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 76 | Dysphonia | FAERS: 315 | US FAERS | |
| 77 | Hypotension | FAERS: 311 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 78 | Injection site pruritus | FAERS: 309 | US FAERS | |
| 79 | Cataract | FAERS: 304 | US FAERS | |
| 80 | Oropharyngeal pain | FAERS: 304 | US FAERS | |
| 81 | Infection | FAERS: 295 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 82 | Chest discomfort | FAERS: 294 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 83 | Back disorder | FAERS: 293 | US FAERS | |
| 84 | Flatulence | FAERS: 286 | US FAERS | |
| 85 | Joint injury | FAERS: 262 | US FAERS | |
| 86 | Limb injury | FAERS: 257 | US FAERS | |
| 87 | General physical health deterioration | FAERS: 253 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 88 | Compression fracture | FAERS: 245 | US FAERS | |
| 89 | Wrong technique in product usage process | FAERS: 244 | US FAERS | |
| 90 | Stress | FAERS: 242 | US FAERS | |
| 91 | Inappropriate schedule of drug administration | FAERS: 240 | US FAERS | |
| 92 | Cystitis | FAERS: 239 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 93 | Middle insomnia | FAERS: 239 | US FAERS | |
| 94 | Lethargy | FAERS: 230 | US FAERS | |
| 95 | Amnesia | FAERS: 228 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Feeling Cold | FAERS: 225 | US FAERS | |
| 97 | Swelling | FAERS: 220 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 98 | Atrial Fibrillation | FAERS: 214 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 99 | Asthma | FAERS: 213 | US FAERS | |
| 100 | Syncope | FAERS: 211 Canada Vigilance: 12 | Canada Vigilance SIDER US FAERS | |
| 101 | Muscle Cramp | FAERS: 209 | US FAERS | |
| 102 | Thrombosis | FAERS: 208 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 103 | Toothache | FAERS: 207 | US FAERS | |
| 104 | Incorrect drug administration duration | FAERS: 200 | US FAERS | |
| 105 | Injection site urticaria | FAERS: 194 | US FAERS | |
| 106 | Injury associated with device | FAERS: 191 | US FAERS | |
| 107 | Osteoporosis | FAERS: 186 | 17317460 17609307 | CTD US FAERS |
| 108 | Blood glucose increased | FAERS: 183 | US FAERS | |
| 109 | Joint stiffness | FAERS: 182 | US FAERS | |
| 110 | Ankle Fracture | FAERS: 178 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 111 | Head discomfort | FAERS: 176 | US FAERS | |
| 112 | Dry skin | FAERS: 174 | US FAERS | |
| 113 | Injection site discomfort | FAERS: 173 | US FAERS | |
| 114 | Abasia | FAERS: 171 | US FAERS | |
| 115 | Intestinal Obstruction | FAERS: 171 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 116 | Musculoskeletal chest pain | FAERS: 170 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 117 | Rheumatoid Arthritis | FAERS: 169 | US FAERS | |
| 118 | Product storage error | FAERS: 165 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 119 | Depressed mood | FAERS: 164 | US FAERS | |
| 120 | Sepsis | FAERS: 157 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 121 | Frustration | FAERS: 151 | US FAERS | |
| 122 | Flushing | FAERS: 147 | US FAERS | |
| 123 | Injection site irritation | FAERS: 145 | US FAERS | |
| 124 | No adverse event | FAERS: 144 | US FAERS | |
| 125 | Tachycardia | FAERS: 143 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 126 | Tinnitus | FAERS: 141 | US FAERS | |
| 127 | Laryngitis | FAERS: 139 | US FAERS | |
| 128 | Respiratory Failure | FAERS: 138 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 129 | Disorientation | FAERS: 134 | US FAERS | |
| 130 | Intentional drug misuse | FAERS: 134 | US FAERS | |
| 131 | Night sweats | FAERS: 131 | US FAERS | |
| 132 | Crying | FAERS: 130 | US FAERS | |
| 133 | Dementia | FAERS: 128 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 134 | Presyncope | FAERS: 127 | US FAERS | |
| 135 | Product dose omission | FAERS: 127 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 136 | Cardiac Arrest | FAERS: 125 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 137 | Fibromyalgia | FAERS: 125 | US FAERS | |
| 138 | Muscle tightness | FAERS: 123 | US FAERS | |
| 139 | Hypokinesia | FAERS: 121 | US FAERS | |
| 140 | Injection site injury | FAERS: 121 | US FAERS | |
| 141 | Macular degeneration | FAERS: 121 | US FAERS | |
| 142 | Hypersomnia | FAERS: 120 | US FAERS | |
| 143 | Anger | FAERS: 118 | US FAERS | |
| 144 | Cholelithiasis | FAERS: 115 | US FAERS | |
| 145 | Sciatica | FAERS: 115 | SIDER US FAERS | |
| 146 | Eye pain | FAERS: 114 | US FAERS | |
| 147 | Cellulitis | FAERS: 110 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 148 | Epistaxis | FAERS: 110 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 149 | Injection site nodule | FAERS: 110 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 150 | Pulmonary Embolism | FAERS: 110 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Retching | FAERS: 108 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 152 | Diverticulitis | FAERS: 106 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 153 | Multiple Myeloma | FAERS: 105 | US FAERS | |
| 154 | Restless Legs Syndrome | FAERS: 105 | US FAERS | |
| 155 | Expired product administered | FAERS: 103 | US FAERS | |
| 156 | Hip surgery | FAERS: 103 | US FAERS | |
| 157 | Inflammation | FAERS: 103 | US FAERS | |
| 158 | Sneezing | FAERS: 103 | US FAERS | |
| 159 | Throat irritation | FAERS: 103 | US FAERS | |
| 160 | Dysuria | FAERS: 101 | US FAERS | |
| 161 | Neuralgia | FAERS: 101 | US FAERS | |
| 162 | Spinal column stenosis | FAERS: 101 | US FAERS | |
| 163 | Bone density abnormal | FAERS: 100 | US FAERS | |
| 164 | Drug prescribing error | FAERS: 100 | US FAERS | |
| 165 | Post procedural complication | FAERS: 97 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 166 | Pancreatitis | FAERS: 96 | US FAERS | |
| 167 | Thirst | FAERS: 96 | US FAERS | |
| 168 | Blood cholesterol increased | FAERS: 95 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 169 | Diabetes Mellitus | FAERS: 95 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 170 | Blood parathyroid hormone increased | FAERS: 94 | US FAERS | |
| 171 | Injection site burning | FAERS: 94 | US FAERS | |
| 172 | Intentional product use issue | FAERS: 94 | US FAERS | |
| 173 | Productive Cough | FAERS: 94 | US FAERS | |
| 174 | Cataract operation | FAERS: 93 | US FAERS | |
| 175 | Mental impairment | FAERS: 93 | US FAERS | |
| 176 | Hernia | FAERS: 91 | US FAERS | |
| 177 | Agitation | FAERS: 90 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 178 | Cerebral Infarction | FAERS: 90 | US FAERS | |
| 179 | Eructation | FAERS: 90 | US FAERS | |
| 180 | Feeling jittery | FAERS: 90 | US FAERS | |
| 181 | Intentional device misuse | FAERS: 90 | US FAERS | |
| 182 | Poor quality sleep | FAERS: 90 | US FAERS | |
| 183 | Oral pain | FAERS: 89 | US FAERS | |
| 184 | Onychoclasis | FAERS: 86 | US FAERS | |
| 185 | Vertebroplasty | FAERS: 86 | US FAERS | |
| 186 | Injection site extravasation | FAERS: 85 | US FAERS | |
| 187 | Pelvic Pain | FAERS: 85 | US FAERS | |
| 188 | Device Failure | FAERS: 83 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 189 | Anorexia | FAERS: 82 | US FAERS | |
| 190 | Flank Pain | FAERS: 82 | US FAERS | |
| 191 | Aphonia | FAERS: 81 | US FAERS | |
| 192 | Blood potassium increased | FAERS: 80 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 193 | Emotional distress | FAERS: 80 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 194 | Gastritis | FAERS: 79 | SIDER US FAERS | |
| 195 | Nodule | FAERS: 79 | US FAERS | |
| 196 | Sluggishness | FAERS: 78 | US FAERS | |
| 197 | Nerve injury | FAERS: 77 | US FAERS | |
| 198 | Blood sodium decreased | FAERS: 76 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 199 | Medical device complication | FAERS: 76 | US FAERS | |
| 200 | Rotator cuff syndrome | FAERS: 76 | US FAERS | |
| 201 | Blood pressure fluctuation | FAERS: 75 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 202 | Hypophagia | FAERS: 75 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 203 | Blindness | FAERS: 74 | US FAERS | |
| 204 | Blood potassium decreased | FAERS: 74 | US FAERS | |
| 205 | Muscle strain | FAERS: 74 | US FAERS | |
| 206 | Accidental underdose | FAERS: 73 | US FAERS | |
| 207 | Angina Pectoris | FAERS: 73 | SIDER US FAERS | |
| 208 | Chromaturia | FAERS: 73 | US FAERS | |
| 209 | Colitis | FAERS: 73 | US FAERS | |
| 210 | Incorrect storage of drug | FAERS: 73 | US FAERS | |
| 211 | Rash erythematous | FAERS: 73 | US FAERS | |
| 212 | Blood parathyroid hormone decreased | FAERS: 72 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 213 | Blood urine present | FAERS: 71 | US FAERS | |
| 214 | Restlessness | FAERS: 71 | US FAERS | |
| 215 | Irritable Bowel Syndrome | FAERS: 70 | US FAERS | |
| 216 | Activities of daily living impaired | FAERS: 69 | US FAERS | |
| 217 | Dental caries | FAERS: 69 | US FAERS | |
| 218 | Glaucoma | FAERS: 69 | US FAERS | |
| 219 | Unevaluable event | FAERS: 68 | US FAERS | |
| 220 | Cold sweat | FAERS: 67 | US FAERS | |
| 221 | Drug administered at inappropriate site | FAERS: 67 | US FAERS | |
| 222 | Increased tendency to bruise | FAERS: 67 | US FAERS | |
| 223 | Spinal fusion surgery | FAERS: 67 | US FAERS | |
| 224 | nervous system disorder | FAERS: 67 | SIDER US FAERS | |
| 225 | Tooth Loss | FAERS: 66 | US FAERS | |
| 226 | Aphasia | FAERS: 65 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 227 | Blood creatinine increased | FAERS: 65 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 228 | Bursitis | FAERS: 65 | US FAERS | |
| 229 | Calcinosis | FAERS: 65 | US FAERS | |
| 230 | Ear discomfort | FAERS: 65 | US FAERS | |
| 231 | Gastric ulcer | FAERS: 65 | US FAERS | |
| 232 | Wrong technique in drug usage process | FAERS: 65 | US FAERS | |
| 233 | Injection site stinging | FAERS: 64 | US FAERS | |
| 234 | Laceration | FAERS: 64 | US FAERS | |
| 235 | Lymphoma | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 236 | Renal pain | FAERS: 64 | US FAERS | |
| 237 | Tooth Extraction | FAERS: 64 | US FAERS | |
| 238 | Carpal Tunnel Syndrome | FAERS: 63 | US FAERS | |
| 239 | Poor quality drug administered | FAERS: 63 | US FAERS | |
| 240 | Gout | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 241 | Urinary Incontinence | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 242 | Pancreatic carcinoma | FAERS: 59 | US FAERS | |
| 243 | Pathological fracture | FAERS: 59 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 244 | Cardiac Flutter | FAERS: 57 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 245 | Sleep disorder due to general medical condition, insomnia type | FAERS: 57 | US FAERS | |
| 246 | Blood calcium abnormal | FAERS: 56 | US FAERS | |
| 247 | Blood glucose decreased | FAERS: 56 | US FAERS | |
| 248 | Deafness | FAERS: 56 | US FAERS | |
| 249 | Emotional disorder | FAERS: 55 | US FAERS | |
| 250 | Pulmonary Fibrosis | FAERS: 55 | US FAERS | |
| 251 | Acne | FAERS: 54 | US FAERS | |
| 252 | Hunger | FAERS: 54 | US FAERS | |
| 253 | Thoracic vertebral fracture | FAERS: 54 | US FAERS | |
| 254 | Skin reaction | FAERS: 53 | US FAERS | |
| 255 | Bedridden | FAERS: 52 | US FAERS | |
| 256 | Eczema | FAERS: 52 | US FAERS | |
| 257 | Lip swelling | FAERS: 52 | US FAERS | |
| 258 | Waist circumference increased | FAERS: 52 | US FAERS | |
| 259 | Injection site warmth | FAERS: 51 | US FAERS | |
| 260 | Limb operation | FAERS: 51 | US FAERS | |
| 261 | Lymphadenopathy | FAERS: 51 | US FAERS | |
| 262 | Multiple Sclerosis | FAERS: 51 | US FAERS | |
| 263 | Skin Ulcer | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 264 | Tooth Infection | FAERS: 51 | US FAERS | |
| 265 | Facial Pain | FAERS: 50 | US FAERS | |
| 266 | Growing pains | FAERS: 49 | US FAERS | |
| 267 | Walking aid user | FAERS: 49 | US FAERS | |
| 268 | Bowel movement irregularity | FAERS: 48 | US FAERS | |
| 269 | Gastrointestinal infection | FAERS: 48 | US FAERS | |
| 270 | Intervertebral Disc Degeneration | FAERS: 48 | US FAERS | |
| 271 | Osteomyelitis | FAERS: 48 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 272 | Tension | FAERS: 48 | US FAERS | |
| 273 | White blood cell count decreased | FAERS: 48 | US FAERS | |
| 274 | Device breakage | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 275 | Pain of skin | FAERS: 47 | US FAERS | |
| 276 | Deep Vein Thrombosis | FAERS: 46 | US FAERS | |
| 277 | Diplopia | FAERS: 46 | US FAERS | |
| 278 | Pallor | FAERS: 46 | US FAERS | |
| 279 | Gastroenteritis | FAERS: 45 | US FAERS | |
| 280 | Rehabilitation therapy | FAERS: 45 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 281 | Ulcer | FAERS: 45 | US FAERS | |
| 282 | Visual disturbance | FAERS: 44 | US FAERS | |
| 283 | Breast tenderness | FAERS: 43 | US FAERS | |
| 284 | Incorrect route of drug administration | FAERS: 43 | US FAERS | |
| 285 | Loose tooth | FAERS: 43 | US FAERS | |
| 286 | Lower respiratory tract infection | FAERS: 43 | US FAERS | |
| 287 | Skin irritation | FAERS: 43 | US FAERS | |
| 288 | Stomatitis | FAERS: 43 | US FAERS | |
| 289 | Cyst | FAERS: 42 | US FAERS | |
| 290 | Spinal column injury | FAERS: 42 | US FAERS | |
| 291 | Wheezing | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 292 | Feeling of body temperature change | FAERS: 41 | US FAERS | |
| 293 | Incontinence | FAERS: 41 | US FAERS | |
| 294 | Injection site vesicles | FAERS: 41 | US FAERS | |
| 295 | Blood magnesium decreased | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 296 | Device dislocation | FAERS: 40 | US FAERS | |
| 297 | Coronary Artery Disease | FAERS: 39 | US FAERS | |
| 298 | Eye irritation | FAERS: 39 | US FAERS | |
| 299 | Fear of falling | FAERS: 39 | US FAERS | |
| 300 | Sinus headache | FAERS: 39 | US FAERS | |
| 301 | Skin lesion | FAERS: 39 | US FAERS | |
| 302 | Apathy | FAERS: 38 | US FAERS | |
| 303 | Aortic Aneurysm | FAERS: 37 | US FAERS | |
| 304 | Osteopenia | FAERS: 37 | US FAERS | |
| 305 | Paranasal sinus hypersecretion | FAERS: 37 | US FAERS | |
| 306 | Scab | FAERS: 37 | US FAERS | |
| 307 | Abdominal rigidity | FAERS: 36 | US FAERS | |
| 308 | Bladder prolapse | FAERS: 36 | US FAERS | |
| 309 | Initial insomnia | FAERS: 36 | US FAERS | |
| 310 | Injection site inflammation | FAERS: 36 | US FAERS | |
| 311 | Intervertebral disc disorder | FAERS: 36 | US FAERS | |
| 312 | Urine calcium increased | FAERS: 36 | US FAERS | |
| 313 | Choking | FAERS: 35 | US FAERS | |
| 314 | Incorrect product administration duration | FAERS: 35 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 315 | Muscle Fatigue | FAERS: 35 | US FAERS | |
| 316 | Vitamin D Deficiency | FAERS: 35 | US FAERS | |
| 317 | Accidental needle stick | FAERS: 34 | US FAERS | |
| 318 | Ageusia | FAERS: 34 | US FAERS | |
| 319 | Aneurysm | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 320 | Expired drug administered | FAERS: 34 | US FAERS | |
| 321 | Gastrointestinal motility disorder | FAERS: 34 | US FAERS | |
| 322 | Aspartate Aminotransferase Increased | FAERS: 33 | US FAERS | |
| 323 | Basal cell carcinoma | FAERS: 33 | US FAERS | |
| 324 | Endodontic procedure | FAERS: 33 | US FAERS | |
| 325 | Food Poisoning | FAERS: 33 | US FAERS | |
| 326 | Hypothyroidism | FAERS: 33 | US FAERS | |
| 327 | Injection site streaking | FAERS: 33 | US FAERS | |
| 328 | Living in residential institution | FAERS: 33 | US FAERS | |
| 329 | Mood swings | FAERS: 33 | US FAERS | |
| 330 | Skin laceration | FAERS: 33 | US FAERS | |
| 331 | Device malfunction | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 332 | Drug administration error | FAERS: 32 | US FAERS | |
| 333 | Gastrointestinal Pain | FAERS: 32 | US FAERS | |
| 334 | Urinary Retention | FAERS: 32 | US FAERS | |
| 335 | Osteitis Deformans | FAERS: 31 | US FAERS | |
| 336 | Psoriasis | FAERS: 31 | US FAERS | |
| 337 | Skeletal injury | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 338 | Acute myocardial infarction | FAERS: 30 | US FAERS | |
| 339 | Alanine Aminotransferase Increased | FAERS: 30 | US FAERS | |
| 340 | Dysarthria | FAERS: 30 | US FAERS | |
| 341 | Grip strength decreased | FAERS: 30 | US FAERS | |
| 342 | Infarction | FAERS: 30 | US FAERS | |
| 343 | Mental status changes | FAERS: 30 | US FAERS | |
| 344 | Pulmonary congestion | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 345 | Respiratory tract congestion | FAERS: 30 | US FAERS | |
| 346 | Thyroid Neoplasm | FAERS: 30 | US FAERS | |
| 347 | colonoscopy | FAERS: 30 | US FAERS | |
| 348 | Device related infection | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 349 | Gait inability | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 350 | Multiple allergies | FAERS: 29 | US FAERS | |
| 351 | Pharyngolaryngeal Pain | FAERS: 29 | US FAERS | |
| 352 | Pyelonephritis | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 353 | muscle injury | FAERS: 28 | US FAERS | |
| 354 | Arthropod bite | FAERS: 27 | US FAERS | |
| 355 | Blood glucose abnormal | FAERS: 27 | US FAERS | |
| 356 | Blood iron decreased | FAERS: 27 | US FAERS | |
| 357 | Bone fissure | FAERS: 27 | US FAERS | |
| 358 | Eye Infection | FAERS: 27 | US FAERS | |
| 359 | Gastric Dilatation | FAERS: 27 | US FAERS | |
| 360 | Hyperparathyroidism | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 361 | Malnutrition | FAERS: 27 | SIDER US FAERS | |
| 362 | Post procedural infection | FAERS: 27 | US FAERS | |
| 363 | Product use issue | FAERS: 27 | US FAERS | |
| 364 | Therapeutic procedure | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 365 | Depressed Level of Consciousness | FAERS: 26 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 366 | General physical condition abnormal | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 367 | Incorrect dose administered by device | FAERS: 26 | US FAERS | |
| 368 | Joint Range of Motion Decreased | FAERS: 26 | US FAERS | |
| 369 | Ligament rupture | FAERS: 26 | US FAERS | |
| 370 | Medial Tibial Stress Syndrome | FAERS: 26 | US FAERS | |
| 371 | Medical device removal | FAERS: 26 | US FAERS | |
| 372 | Metastatic Neoplasm | FAERS: 26 | US FAERS | |
| 373 | Nocturia | FAERS: 26 | US FAERS | |
| 374 | Paranoia | FAERS: 26 | US FAERS | |
| 375 | Pulmonary Hypertension | FAERS: 26 | US FAERS | |
| 376 | Renal cyst | FAERS: 26 | US FAERS | |
| 377 | Cholecystitis | FAERS: 25 | US FAERS | |
| 378 | Delirium | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 379 | Oropharyngeal discomfort | FAERS: 25 | US FAERS | |
| 380 | Pericardial effusion | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 381 | Polyuria | FAERS: 25 | SIDER US FAERS | |
| 382 | Procedural complication | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 383 | Rhinitis | FAERS: 25 | SIDER US FAERS | |
| 384 | Throat cancer | FAERS: 25 | US FAERS | |
| 385 | Thrombophlebitis | FAERS: 25 | US FAERS | |
| 386 | kyphosis | FAERS: 25 | US FAERS | |
| 387 | Bone lesion | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 388 | Formication | FAERS: 24 | US FAERS | |
| 389 | Hysterectomy | FAERS: 24 | US FAERS | |
| 390 | Intracranial Aneurysm | FAERS: 24 | US FAERS | |
| 391 | Nasal discomfort | FAERS: 24 | US FAERS | |
| 392 | Sarcoma | FAERS: 24 | US FAERS | |
| 393 | Skin Wrinkling | FAERS: 24 | US FAERS | |
| 394 | Bed rest | FAERS: 23 | US FAERS | |
| 395 | Blood blister | FAERS: 23 | US FAERS | |
| 396 | Blood count abnormal | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 397 | Hemiparesis | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 398 | Pleurisy | FAERS: 23 | US FAERS | |
| 399 | Respiratory arrest | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 400 | Wheelchair user | FAERS: 23 | US FAERS | |
| 401 | Gastrointestinal carcinoma | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 402 | Hemiplegia | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 403 | Joint sprain | FAERS: 22 | US FAERS | |
| 404 | Limb crushing injury | FAERS: 22 | US FAERS | |
| 405 | Pharyngitis | FAERS: 22 | SIDER US FAERS | |
| 406 | Respiratory distress | FAERS: 22 | US FAERS | |
| 407 | Secretion discharge | FAERS: 22 | US FAERS | |
| 408 | jaundice | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 409 | Asthenopia | FAERS: 21 | US FAERS | |
| 410 | Blood urea increased | FAERS: 21 | US FAERS | |
| 411 | Gingival Recession | FAERS: 21 | US FAERS | |
| 412 | MYELODYSPLASTIC SYNDROME | FAERS: 21 | US FAERS | |
| 413 | Nonspecific reaction | FAERS: 21 | US FAERS | |
| 414 | Osteonecrosis of Jaw | FAERS: 21 | US FAERS | |
| 415 | Phlebitis | FAERS: 21 | US FAERS | |
| 416 | Retinal Detachment | FAERS: 21 | US FAERS | |
| 417 | Septic Shock | FAERS: 21 | US FAERS | |
| 418 | Terminal state | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 419 | Vitreous floaters | FAERS: 21 | US FAERS | |
| 420 | Arteriosclerosis | FAERS: 20 | US FAERS | |
| 421 | Bone scan abnormal | FAERS: 20 | US FAERS | |
| 422 | Bronchopneumonia | FAERS: 20 | US FAERS | |
| 423 | Drug dispensing error | FAERS: 20 | US FAERS | |
| 424 | Epilepsy | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 425 | Hyperthyroidism | FAERS: 20 | US FAERS | |
| 426 | Injection site hypersensitivity | FAERS: 20 | US FAERS | |
| 427 | Injection site scar | FAERS: 20 | US FAERS | |
| 428 | Monoplegia | FAERS: 20 | US FAERS | |
| 429 | Poor peripheral circulation | FAERS: 20 | US FAERS | |
| 430 | Product taste abnormal | FAERS: 20 | US FAERS | |
| 431 | Prosthesis Implantation | FAERS: 20 | US FAERS | |
| 432 | Rectal Prolapse | FAERS: 20 | US FAERS | |
| 433 | Sjogren's Syndrome | FAERS: 20 | US FAERS | |
| 434 | Unresponsive to stimuli | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 435 | Venous Injury | FAERS: 20 | US FAERS | |
| 436 | Bradycardia | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 437 | Bruxism | FAERS: 19 | US FAERS | |
| 438 | Carotid artery occlusion | FAERS: 19 | US FAERS | |
| 439 | Clostridium difficile infection | FAERS: 19 | US FAERS | |
| 440 | Hospice Care | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 441 | Immobile | FAERS: 19 | US FAERS | |
| 442 | Increased upper airway secretion | FAERS: 19 | US FAERS | |
| 443 | Intestinal Perforation | FAERS: 19 | US FAERS | |
| 444 | Medical device implantation | FAERS: 19 | US FAERS | |
| 445 | Ocular discomfort | FAERS: 19 | US FAERS | |
| 446 | Scleroderma | FAERS: 19 | US FAERS | |
| 447 | Screaming | FAERS: 19 | US FAERS | |
| 448 | Trismus | FAERS: 19 | US FAERS | |
| 449 | Wound Infection | FAERS: 19 | US FAERS | |
| 450 | Abscess | FAERS: 18 | US FAERS | |
| 451 | Acute respiratory failure | FAERS: 18 | US FAERS | |
| 452 | Bladder discomfort | FAERS: 18 | US FAERS | |
| 453 | Excoriation | FAERS: 18 | US FAERS | |
| 454 | General symptom | FAERS: 18 | US FAERS | |
| 455 | Infrequent bowel movements | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 456 | Metastasis | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 457 | Pneumothorax | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 458 | Temporal Arteritis | FAERS: 18 | US FAERS | |
| 459 | Thrombocytopenia | FAERS: 18 | US FAERS | |
| 460 | Bone erosion | FAERS: 17 | US FAERS | |
| 461 | Bradyphrenia | FAERS: 17 | US FAERS | |
| 462 | Cardiomegaly | FAERS: 17 | US FAERS | |
| 463 | Chest wall pain | FAERS: 17 | US FAERS | |
| 464 | Dermatitis | FAERS: 17 | SIDER US FAERS | |
| 465 | Disability | FAERS: 17 | US FAERS | |
| 466 | Diverticulum | FAERS: 17 | US FAERS | |
| 467 | Dysgraphia | FAERS: 17 | US FAERS | |
| 468 | Electrolyte imbalance | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 469 | Fracture pain | FAERS: 17 | US FAERS | |
| 470 | Hepatitis | FAERS: 17 | US FAERS | |
| 471 | Impaired driving ability | FAERS: 17 | US FAERS | |
| 472 | Meniscus injury | FAERS: 17 | US FAERS | |
| 473 | Osteitis | FAERS: 17 | US FAERS | |
| 474 | Peritonitis | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 475 | Pulmonary thrombosis | FAERS: 17 | US FAERS | |
| 476 | Sudden death | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 477 | Temperature intolerance | FAERS: 17 | US FAERS | |
| 478 | Trichorrhexis | FAERS: 17 | US FAERS | |
| 479 | Vaginal Discharge | FAERS: 17 | US FAERS | |
| 480 | Wrong technique in device usage process | FAERS: 17 | US FAERS | |
| 481 | Abdominal mass | FAERS: 16 | US FAERS | |
| 482 | Accidental exposure to product | FAERS: 16 | US FAERS | |
| 483 | Altered state of consciousness | FAERS: 16 | US FAERS | |
| 484 | Bladder pain | FAERS: 16 | US FAERS | |
| 485 | Disease recurrence | FAERS: 16 | US FAERS | |
| 486 | Electrocardiogram abnormal | FAERS: 16 | US FAERS | |
| 487 | Gastric infection | FAERS: 16 | US FAERS | |
| 488 | Hepatitis C | FAERS: 16 | US FAERS | |
| 489 | Injection site scab | FAERS: 16 | US FAERS | |
| 490 | Mechanical ventilation | FAERS: 16 | US FAERS | |
| 491 | Needle issue | FAERS: 16 | US FAERS | |
| 492 | Prescribed overdose | FAERS: 16 | US FAERS | |
| 493 | Quality of life decreased | FAERS: 16 | US FAERS | |
| 494 | Thermal burn | FAERS: 16 | US FAERS | |
| 495 | Upper-airway cough syndrome | FAERS: 16 | US FAERS | |
| 496 | Viral upper respiratory tract infection | FAERS: 16 | US FAERS | |
| 497 | Blood creatine phosphokinase increased | FAERS: 15 | US FAERS | |
| 498 | Blood thyroid stimulating hormone increased | FAERS: 15 | US FAERS | |
| 499 | Escherichia infection | FAERS: 15 | US FAERS | |
| 500 | Exostosis of jaw | FAERS: 15 | US FAERS | |
| 501 | Failure to Thrive | FAERS: 15 | US FAERS | |
| 502 | Hyperkeratosis | FAERS: 15 | US FAERS | |
| 503 | Hypoxia | FAERS: 15 | US FAERS | |
| 504 | Laziness | FAERS: 15 | US FAERS | |
| 505 | Mastication disorder | FAERS: 15 | US FAERS | |
| 506 | Mouth swelling | FAERS: 15 | US FAERS | |
| 507 | N-telopeptide urine increased | FAERS: 15 | US FAERS | |
| 508 | Necrosis | FAERS: 15 | US FAERS | |
| 509 | Nipple pain | FAERS: 15 | US FAERS | |
| 510 | Peripheral arterial occlusive disease | FAERS: 15 | US FAERS | |
| 511 | Polymyalgia Rheumatica | FAERS: 15 | US FAERS | |
| 512 | Squamous cell carcinoma | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 513 | Synovial Cyst | FAERS: 15 | US FAERS | |
| 514 | Urine output increased | FAERS: 15 | SIDER US FAERS | |
| 515 | VIIth nerve paralysis | FAERS: 15 | US FAERS | |
| 516 | Vascular occlusion | FAERS: 15 | US FAERS | |
| 517 | Vasculitis | FAERS: 15 | US FAERS | |
| 518 | Angioplasty | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 519 | Blood triglycerides increased | FAERS: 14 | US FAERS | |
| 520 | Breast cancer recurrent | FAERS: 14 | US FAERS | |
| 521 | Bronchiectasis | FAERS: 14 | US FAERS | |
| 522 | Cerebral disorder | FAERS: 14 | US FAERS | |
| 523 | Chemotherapy | FAERS: 14 | US FAERS | |
| 524 | Dental discomfort | FAERS: 14 | US FAERS | |
| 525 | Device use error | FAERS: 14 | US FAERS | |
| 526 | Ecchymosis | FAERS: 14 | US FAERS | |
| 527 | Gamma-Glutamyltransferase Increased | FAERS: 14 | US FAERS | |
| 528 | Inappropriate schedule of product administration | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 529 | Incision site complication | FAERS: 14 | US FAERS | |
| 530 | Incoherent | FAERS: 14 | US FAERS | |
| 531 | Joint Instability | FAERS: 14 | US FAERS | |
| 532 | Ligament injury | FAERS: 14 | US FAERS | |
| 533 | Muscle Rigidity | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 534 | Shock | FAERS: 14 | SIDER US FAERS | |
| 535 | Squamous cell carcinoma of skin | FAERS: 14 | US FAERS | |
| 536 | Uterine Cancer | FAERS: 14 | US FAERS | |
| 537 | Vascular calcification | FAERS: 14 | US FAERS | |
| 538 | skin abrasion | FAERS: 14 | US FAERS | |
| 539 | Cholecystitis infective | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 540 | Embolism | FAERS: 13 | US FAERS | |
| 541 | Extra dose administered | FAERS: 13 | US FAERS | |
| 542 | Gastrointestinal sounds abnormal | FAERS: 13 | US FAERS | |
| 543 | Ileus | FAERS: 13 | US FAERS | |
| 544 | Injection site dermatitis | FAERS: 13 | US FAERS | |
| 545 | Large intestine perforation | FAERS: 13 | US FAERS | |
| 546 | Lipoma | FAERS: 13 | US FAERS | |
| 547 | Renal mass | FAERS: 13 | US FAERS | |
| 548 | Skin hypertrophy | FAERS: 13 | US FAERS | |
| 549 | Spondylitis | FAERS: 13 | US FAERS | |
| 550 | Tension Headache | FAERS: 13 | US FAERS | |
| 551 | Thyroidectomy | FAERS: 13 | US FAERS | |
| 552 | Urinary bladder polyp | FAERS: 13 | US FAERS | |
| 553 | Vitamin D abnormal | FAERS: 13 | US FAERS | |
| 554 | Bladder Neoplasm | FAERS: 12 | US FAERS | |
| 555 | Blood iron increased | FAERS: 12 | US FAERS | |
| 556 | Cementoplasty | FAERS: 12 | US FAERS | |
| 557 | Clumsiness | FAERS: 12 | US FAERS | |
| 558 | Colectomy | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 559 | Economic problem | FAERS: 12 | US FAERS | |
| 560 | Food craving | FAERS: 12 | US FAERS | |
| 561 | Heat illness | FAERS: 12 | US FAERS | |
| 562 | Incision site pain | FAERS: 12 | US FAERS | |
| 563 | Injection site coldness | FAERS: 12 | US FAERS | |
| 564 | Oral fungal infection | FAERS: 12 | US FAERS | |
| 565 | Personality Change | FAERS: 12 | US FAERS | |
| 566 | Product quality issue | FAERS: 12 | US FAERS | |
| 567 | Renal Colic | FAERS: 12 | US FAERS | |
| 568 | Vascular pain | FAERS: 12 | US FAERS | |
| 569 | furuncle | FAERS: 12 | US FAERS | |
| 570 | Appendicitis | FAERS: 11 | US FAERS | |
| 571 | Ascites | FAERS: 11 | US FAERS | |
| 572 | Blood glucose fluctuation | FAERS: 11 | US FAERS | |
| 573 | Blood parathyroid hormone abnormal | FAERS: 11 | US FAERS | |
| 574 | Blood testosterone decreased | FAERS: 11 | US FAERS | |
| 575 | Breast Cyst | FAERS: 11 | US FAERS | |
| 576 | Calcium deficiency | FAERS: 11 | US FAERS | |
| 577 | Cardiac discomfort | FAERS: 11 | US FAERS | |
| 578 | Cheilitis | FAERS: 11 | US FAERS | |
| 579 | Impaired gastric emptying | FAERS: 11 | US FAERS | |
| 580 | Injection site papule | FAERS: 11 | US FAERS | |
| 581 | Lyme Disease | FAERS: 11 | US FAERS | |
| 582 | Miliaria | FAERS: 11 | US FAERS | |
| 583 | Motion Sickness | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 584 | Osteocalcin increased | FAERS: 11 | US FAERS | |
| 585 | Osteosarcoma | FAERS: 11 | SIDER US FAERS | |
| 586 | Product distribution issue | FAERS: 11 | US FAERS | |
| 587 | Rosacea | FAERS: 11 | US FAERS | |
| 588 | Therapy non-responder | FAERS: 11 | US FAERS | |
| 589 | Thyroid hormones increased | FAERS: 11 | US FAERS | |
| 590 | Tooth Resorption | FAERS: 11 | US FAERS | |
| 591 | Tooth repair | FAERS: 11 | US FAERS | |
| 592 | Underweight | FAERS: 11 | US FAERS | |
| 593 | Angioedema | FAERS: 10 | SIDER US FAERS | |
| 594 | Blood phosphorus increased | FAERS: 10 | US FAERS | |
| 595 | Blood sodium increased | FAERS: 10 | US FAERS | |
| 596 | Diplegia | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 597 | Ear congestion | FAERS: 10 | US FAERS | |
| 598 | Erysipelas | FAERS: 10 | US FAERS | |
| 599 | Fibrosis | FAERS: 10 | US FAERS | |
| 600 | Gingivitis | FAERS: 10 | US FAERS | |
| 601 | Hydrocephalus | FAERS: 10 | US FAERS | |
| 602 | Hyperchlorhydria | FAERS: 10 | US FAERS | |
| 603 | Hyperphagia | FAERS: 10 | US FAERS | |
| 604 | Hypertrichosis | FAERS: 10 | US FAERS | |
| 605 | Hyperventilation | FAERS: 10 | US FAERS | |
| 606 | Injection site macule | FAERS: 10 | US FAERS | |
| 607 | Intervertebral disc compression | FAERS: 10 | US FAERS | |
| 608 | Intestinal resection | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 609 | Lactose Intolerance | FAERS: 10 | US FAERS | |
| 610 | Low density lipoprotein increased | FAERS: 10 | US FAERS | |
| 611 | Migraine with Aura | FAERS: 10 | US FAERS | |
| 612 | Myasthenia Gravis | FAERS: 10 | US FAERS | |
| 613 | Open wound | FAERS: 10 | US FAERS | |
| 614 | Optic Neuritis | FAERS: 10 | US FAERS | |
| 615 | Pelvic mass | FAERS: 10 | US FAERS | |
| 616 | Pneumonitis | FAERS: 10 | US FAERS | |
| 617 | Protein total increased | FAERS: 10 | US FAERS | |
| 618 | Regurgitation | FAERS: 10 | US FAERS | |
| 619 | Skin Papilloma | FAERS: 10 | US FAERS | |
| 620 | Spondylolisthesis | FAERS: 10 | US FAERS | |
| 621 | Sunburn | FAERS: 10 | US FAERS | |
| 622 | Umbilical hernia | FAERS: 10 | US FAERS | |
| 623 | Uterine Polyp | FAERS: 10 | US FAERS | |
| 624 | Vessel perforation | FAERS: 10 | US FAERS | |
| 625 | Abdominal adhesions | FAERS: 9 | US FAERS | |
| 626 | Abdominal tenderness | FAERS: 9 | US FAERS | |
| 627 | Anaphylactic shock | FAERS: 9 | SIDER US FAERS | |
| 628 | Animal scratch | FAERS: 9 | US FAERS | |
| 629 | Artificial crown procedure | FAERS: 9 | US FAERS | |
| 630 | Blood phosphorus decreased | FAERS: 9 | US FAERS | |
| 631 | Bone swelling | FAERS: 9 | US FAERS | |
| 632 | Bronchospasm | FAERS: 9 | US FAERS | |
| 633 | Cartilage injury | FAERS: 9 | US FAERS | |
| 634 | Cervix carcinoma | FAERS: 9 | US FAERS | |
| 635 | Disease Progression | FAERS: 9 | US FAERS | |
| 636 | Food aversion | FAERS: 9 | US FAERS | |
| 637 | Gangrene | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 638 | Hypercalciuria | FAERS: 9 | 17609307 | CTD SIDER US FAERS |
| 639 | Hypertensive crisis | FAERS: 9 | US FAERS | |
| 640 | Incisional hernia | FAERS: 9 | US FAERS | |
| 641 | Injection site laceration | FAERS: 9 | US FAERS | |
| 642 | Labyrinthitis | FAERS: 9 | US FAERS | |
| 643 | Leukopenia | FAERS: 9 | US FAERS | |
| 644 | Menopause | FAERS: 9 | US FAERS | |
| 645 | Multiple sclerosis relapse | FAERS: 9 | US FAERS | |
| 646 | Obstruction | FAERS: 9 | US FAERS | |
| 647 | Paranasal sinus discomfort | FAERS: 9 | US FAERS | |
| 648 | Photophobia | FAERS: 9 | US FAERS | |
| 649 | Rheumatic disorder | FAERS: 9 | US FAERS | |
| 650 | Skin discomfort | FAERS: 9 | US FAERS | |
| 651 | Splenomegaly | FAERS: 9 | US FAERS | |
| 652 | Supraventricular tachycardia | FAERS: 9 | US FAERS | |
| 653 | Vulvovaginal pruritus | FAERS: 9 | US FAERS | |
| 654 | Acute kidney injury | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 655 | Adenocarcinoma | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 656 | Amyotrophic Lateral Sclerosis | FAERS: 8 | US FAERS | |
| 657 | Atrioventricular Block | FAERS: 8 | US FAERS | |
| 658 | Biopsy | FAERS: 8 | US FAERS | |
| 659 | Blood creatinine abnormal | FAERS: 8 | US FAERS | |
| 660 | Blood creatinine decreased | FAERS: 8 | US FAERS | |
| 661 | Blood potassium abnormal | FAERS: 8 | US FAERS | |
| 662 | Bone fragmentation | FAERS: 8 | US FAERS | |
| 663 | Breast discomfort | FAERS: 8 | US FAERS | |
| 664 | Bunion operation | FAERS: 8 | US FAERS | |
| 665 | Bunion | FAERS: 8 | US FAERS | |
| 666 | C-telopeptide increased | FAERS: 8 | US FAERS | |
| 667 | Completed Suicide | FAERS: 8 | US FAERS | |
| 668 | Dacryostenosis acquired | FAERS: 8 | US FAERS | |
| 669 | Drooling | FAERS: 8 | US FAERS | |
| 670 | Enchondroma | FAERS: 8 | US FAERS | |
| 671 | Epigastric discomfort | FAERS: 8 | US FAERS | |
| 672 | Eye inflammation | FAERS: 8 | US FAERS | |
| 673 | Food Allergy | FAERS: 8 | US FAERS | |
| 674 | Full blood count decreased | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 675 | Gastrointestinal inflammation | FAERS: 8 | US FAERS | |
| 676 | Hepatomegaly | FAERS: 8 | US FAERS | |
| 677 | Hernial eventration | FAERS: 8 | US FAERS | |
| 678 | Hormone level abnormal | FAERS: 8 | US FAERS | |
| 679 | Incorrect drug administration rate | FAERS: 8 | US FAERS | |
| 680 | Injection site discharge | FAERS: 8 | US FAERS | |
| 681 | Injection | FAERS: 8 | US FAERS | |
| 682 | Laryngeal discomfort | FAERS: 8 | US FAERS | |
| 683 | Malabsorption | FAERS: 8 | US FAERS | |
| 684 | Meningioma | FAERS: 8 | US FAERS | |
| 685 | Mydriasis | FAERS: 8 | US FAERS | |
| 686 | No adverse effect | FAERS: 8 | US FAERS | |
| 687 | Onychomycosis | FAERS: 8 | US FAERS | |
| 688 | Pelvic discomfort | FAERS: 8 | US FAERS | |
| 689 | Pericarditis | FAERS: 8 | US FAERS | |
| 690 | Plasmacytoma | FAERS: 8 | US FAERS | |
| 691 | Purulence | FAERS: 8 | US FAERS | |
| 692 | Pyoderma Gangrenosum | FAERS: 8 | US FAERS | |
| 693 | Renal Cell Carcinoma | FAERS: 8 | US FAERS | |
| 694 | Sarcoidosis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 695 | Scotoma | FAERS: 8 | US FAERS | |
| 696 | Sick Sinus Syndrome | FAERS: 8 | US FAERS | |
| 697 | Subcutaneous nodule | FAERS: 8 | US FAERS | |
| 698 | Superficial vein prominence | FAERS: 8 | US FAERS | |
| 699 | Supportive care | FAERS: 8 | US FAERS | |
| 700 | Tooth Erosion | FAERS: 8 | US FAERS | |
| 701 | Tuberculosis | FAERS: 8 | US FAERS | |
| 702 | Uterine Prolapse | FAERS: 8 | US FAERS | |
| 703 | Vulvovaginal pain | FAERS: 8 | US FAERS | |
| 704 | White blood cell count abnormal | FAERS: 8 | US FAERS | |
| 705 | Wound infection staphylococcal | FAERS: 8 | US FAERS | |
| 706 | Wrong drug administered | FAERS: 8 | US FAERS | |
| 707 | Abdominal symptom | FAERS: 7 | US FAERS | |
| 708 | Ankylosing spondylitis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 709 | Aortic valve calcification | FAERS: 7 | US FAERS | |
| 710 | Asphyxia | FAERS: 7 | US FAERS | |
| 711 | Atrial Flutter | FAERS: 7 | US FAERS | |
| 712 | Benign Neoplasm | FAERS: 7 | US FAERS | |
| 713 | Blood creatine increased | FAERS: 7 | US FAERS | |
| 714 | Blood pressure inadequately controlled | FAERS: 7 | US FAERS | |
| 715 | Body fat disorder | FAERS: 7 | US FAERS | |
| 716 | Calcification of muscle | FAERS: 7 | US FAERS | |
| 717 | Cardiovascular insufficiency | FAERS: 7 | US FAERS | |
| 718 | Cerebral Palsy | FAERS: 7 | US FAERS | |
| 719 | Corrective lens user | FAERS: 7 | US FAERS | |
| 720 | Creatinine renal clearance decreased | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 721 | Cystocele | FAERS: 7 | US FAERS | |
| 722 | Cystopexy | FAERS: 7 | US FAERS | |
| 723 | Deformity | FAERS: 7 | US FAERS | |
| 724 | Device occlusion | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 725 | Diverticular perforation | FAERS: 7 | US FAERS | |
| 726 | Duodenal Ulcer | FAERS: 7 | US FAERS | |
| 727 | Epicondylitis | FAERS: 7 | US FAERS | |
| 728 | Exposure to toxic agent | FAERS: 7 | US FAERS | |
| 729 | Eye laser surgery | FAERS: 7 | US FAERS | |
| 730 | Gastrointestinal obstruction | FAERS: 7 | US FAERS | |
| 731 | Gingival blister | FAERS: 7 | US FAERS | |
| 732 | Granuloma Annulare | FAERS: 7 | US FAERS | |
| 733 | Heat Stroke | FAERS: 7 | US FAERS | |
| 734 | Immunosuppression | FAERS: 7 | US FAERS | |
| 735 | Infectious peritonitis | FAERS: 7 | US FAERS | |
| 736 | Intentional dose omission | FAERS: 7 | US FAERS | |
| 737 | Intestinal infarction | FAERS: 7 | US FAERS | |
| 738 | Joint warmth | FAERS: 7 | US FAERS | |
| 739 | Keratoconjunctivitis Sicca | FAERS: 7 | US FAERS | |
| 740 | Lip and/or oral cavity cancer | FAERS: 7 | US FAERS | |
| 741 | Lip exfoliation | FAERS: 7 | US FAERS | |
| 742 | Monoparesis | FAERS: 7 | US FAERS | |
| 743 | Nerve Root Compression | FAERS: 7 | US FAERS | |
| 744 | Nerve root injury | FAERS: 7 | US FAERS | |
| 745 | Neutropenia | FAERS: 7 | US FAERS | |
| 746 | Non-cardiac chest pain | FAERS: 7 | US FAERS | |
| 747 | Overweight | FAERS: 7 | US FAERS | |
| 748 | Periarthritis | FAERS: 7 | US FAERS | |
| 749 | Pulmonary function test decreased | FAERS: 7 | US FAERS | |
| 750 | Rales | FAERS: 7 | US FAERS | |
| 751 | Rectal discharge | FAERS: 7 | US FAERS | |
| 752 | Skin tightness | FAERS: 7 | US FAERS | |
| 753 | Somnambulism | FAERS: 7 | US FAERS | |
| 754 | Therapeutic response unexpected | FAERS: 7 | US FAERS | |
| 755 | Therapy change | FAERS: 7 | US FAERS | |
| 756 | Toxicity to various agents | FAERS: 7 | US FAERS | |
| 757 | Urinary tract obstruction | FAERS: 7 | US FAERS | |
| 758 | Venous occlusion | FAERS: 7 | US FAERS | |
| 759 | Ventricular Fibrillation | FAERS: 7 | US FAERS | |
| 760 | Vulvovaginal burning sensation | FAERS: 7 | US FAERS | |
| 761 | Vulvovaginal discomfort | FAERS: 7 | US FAERS | |
| 762 | Abdominal strangulated hernia | FAERS: 6 | US FAERS | |
| 763 | Anosmia | FAERS: 6 | US FAERS | |
| 764 | Aphagia | FAERS: 6 | US FAERS | |
| 765 | Arteritis | FAERS: 6 | US FAERS | |
| 766 | Atypical femur fracture | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 767 | Benign bone neoplasm | FAERS: 6 | US FAERS | |
| 768 | Biliary Colic | FAERS: 6 | US FAERS | |
| 769 | Bipolar Disorder | FAERS: 6 | US FAERS | |
| 770 | Bladder spasm | FAERS: 6 | US FAERS | |
| 771 | Body temperature fluctuation | FAERS: 6 | US FAERS | |
| 772 | Catheter related infection | FAERS: 6 | US FAERS | |
| 773 | Central nervous system lesion | FAERS: 6 | US FAERS | |
| 774 | Cerebral Thrombosis | FAERS: 6 | US FAERS | |
| 775 | Cholangitis | FAERS: 6 | US FAERS | |
| 776 | Clostridium difficile colitis | FAERS: 6 | US FAERS | |
| 777 | Cluster Headache | FAERS: 6 | US FAERS | |
| 778 | Crystal urine present | FAERS: 6 | US FAERS | |
| 779 | Device use issue | FAERS: 6 | US FAERS | |
| 780 | Emergency Care | FAERS: 6 | US FAERS | |
| 781 | Essential Tremor | FAERS: 6 | US FAERS | |
| 782 | Gallbladder pain | FAERS: 6 | US FAERS | |
| 783 | Gastrointestinal ulcer | FAERS: 6 | US FAERS | |
| 784 | Gastrointestinal viral infection | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 785 | Glossitis | FAERS: 6 | US FAERS | |
| 786 | Guillain-Barre Syndrome | FAERS: 6 | US FAERS | |
| 787 | Hepatic Encephalopathy | FAERS: 6 | US FAERS | |
| 788 | Hernia pain | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 789 | Hypogeusia | FAERS: 6 | US FAERS | |
| 790 | Hypotrichosis | FAERS: 6 | US FAERS | |
| 791 | Iliac artery occlusion | FAERS: 6 | US FAERS | |
| 792 | Impaired work ability | FAERS: 6 | US FAERS | |
| 793 | Injection site infection | FAERS: 6 | US FAERS | |
| 794 | Iron deficiency | FAERS: 6 | US FAERS | |
| 795 | Malignant neoplasm progression | FAERS: 6 | US FAERS | |
| 796 | Meningitis | FAERS: 6 | US FAERS | |
| 797 | Metastases to stomach | FAERS: 6 | US FAERS | |
| 798 | Moaning | FAERS: 6 | US FAERS | |
| 799 | Multimorbidity | FAERS: 6 | US FAERS | |
| 800 | Myositis | FAERS: 6 | US FAERS | |
| 801 | Nail Infection | FAERS: 6 | US FAERS | |
| 802 | Nerve Block | FAERS: 6 | US FAERS | |
| 803 | Neuritis | FAERS: 6 | US FAERS | |
| 804 | Neuropathy | FAERS: 6 | US FAERS | |
| 805 | Neutrophil count decreased | FAERS: 6 | US FAERS | |
| 806 | Oncologic complication | FAERS: 6 | US FAERS | |
| 807 | Onychalgia | FAERS: 6 | US FAERS | |
| 808 | Oral pruritus | FAERS: 6 | US FAERS | |
| 809 | Osteogenesis Imperfecta | FAERS: 6 | US FAERS | |
| 810 | Pancreatic Neoplasm | FAERS: 6 | US FAERS | |
| 811 | Pancreatic enzymes increased | FAERS: 6 | US FAERS | |
| 812 | Paraparesis | FAERS: 6 | US FAERS | |
| 813 | Parathyroidectomy | FAERS: 6 | US FAERS | |
| 814 | Performance status decreased | FAERS: 6 | US FAERS | |
| 815 | Polyarthritis | FAERS: 6 | US FAERS | |
| 816 | Polydipsia | FAERS: 6 | US FAERS | |
| 817 | Post-traumatic neck syndrome | FAERS: 6 | US FAERS | |
| 818 | Product use in unapproved indication | FAERS: 6 | US FAERS | |
| 819 | Protein total abnormal | FAERS: 6 | US FAERS | |
| 820 | Protein urine present | FAERS: 6 | US FAERS | |
| 821 | Proteinuria | FAERS: 6 | US FAERS | |
| 822 | Purpura | FAERS: 6 | US FAERS | |
| 823 | Sinus operation | FAERS: 6 | US FAERS | |
| 824 | Small cell lung cancer metastatic | FAERS: 6 | US FAERS | |
| 825 | Suture insertion | FAERS: 6 | US FAERS | |
| 826 | Teeth brittle | FAERS: 6 | US FAERS | |
| 827 | Tongue biting | FAERS: 6 | US FAERS | |
| 828 | Tongue blistering | FAERS: 6 | US FAERS | |
| 829 | Transaminases increased | FAERS: 6 | US FAERS | |
| 830 | Trigeminal Neuralgia | FAERS: 6 | US FAERS | |
| 831 | Upper respiratory tract congestion | FAERS: 6 | US FAERS | |
| 832 | Vascular rupture | FAERS: 6 | US FAERS | |
| 833 | Venous Thrombosis | FAERS: 6 | US FAERS | |
| 834 | X-ray abnormal | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 835 | Acidosis | FAERS: 5 | US FAERS | |
| 836 | Acute Coronary Syndrome | FAERS: 5 | US FAERS | |
| 837 | Adnexa uteri pain | FAERS: 5 | US FAERS | |
| 838 | Allergy to chemicals | FAERS: 5 | US FAERS | |
| 839 | Ammonia | FAERS: 5 | US FAERS | |
| 840 | Animal bite | FAERS: 5 | US FAERS | |
| 841 | Aphthous Stomatitis | FAERS: 5 | US FAERS | |
| 842 | Arthropod sting | FAERS: 5 | US FAERS | |
| 843 | Atypical pneumonia | FAERS: 5 | US FAERS | |
| 844 | Benign Prostatic Hyperplasia | FAERS: 5 | US FAERS | |
| 845 | Blepharitis | FAERS: 5 | US FAERS | |
| 846 | Blepharospasm | FAERS: 5 | US FAERS | |
| 847 | Blood amylase increased | FAERS: 5 | US FAERS | |
| 848 | Blood magnesium increased | FAERS: 5 | US FAERS | |
| 849 | Blood pressure difference of extremities | FAERS: 5 | US FAERS | |
| 850 | Blood thyroid stimulating hormone decreased | FAERS: 5 | US FAERS | |
| 851 | Breast Microcalcification | FAERS: 5 | US FAERS | |
| 852 | Bronchial secretion retention | FAERS: 5 | US FAERS | |
| 853 | Carcinoembryonic antigen increased | FAERS: 5 | US FAERS | |
| 854 | Choking sensation | FAERS: 5 | US FAERS | |
| 855 | Complicated fracture | FAERS: 5 | US FAERS | |
| 856 | Conjunctivitis | FAERS: 5 | US FAERS | |
| 857 | Corneal dystrophy | FAERS: 5 | US FAERS | |
| 858 | Cyanosis | FAERS: 5 | US FAERS | |
| 859 | Depression suicidal | FAERS: 5 | US FAERS | |
| 860 | Device migration | FAERS: 5 | US FAERS | |
| 861 | Diabetes mellitus inadequate control | FAERS: 5 | US FAERS | |
| 862 | Diabetic ulcer | FAERS: 5 | US FAERS | |
| 863 | Disease complication | FAERS: 5 | US FAERS | |
| 864 | Drug withdrawal syndrome | FAERS: 5 | US FAERS | |
| 865 | Dry age-related macular degeneration | FAERS: 5 | US FAERS | |
| 866 | Duodenitis | FAERS: 5 | US FAERS | |
| 867 | Dysentery | FAERS: 5 | US FAERS | |
| 868 | Enamel anomaly | FAERS: 5 | US FAERS | |
| 869 | Enterocolitis | FAERS: 5 | US FAERS | |
| 870 | Erythema Nodosum | FAERS: 5 | US FAERS | |
| 871 | Escherichia urinary tract infection | FAERS: 5 | US FAERS | |
| 872 | Facial Paresis | FAERS: 5 | US FAERS | |
| 873 | Failure of implant | FAERS: 5 | US FAERS | |
| 874 | Fat redistribution | FAERS: 5 | US FAERS | |
| 875 | Femoral artery occlusion | FAERS: 5 | US FAERS | |
| 876 | Fluid overload | FAERS: 5 | US FAERS | |
| 877 | Gastrointestinal hypomotility | FAERS: 5 | US FAERS | |
| 878 | Genital rash | FAERS: 5 | US FAERS | |
| 879 | Hordeolum | FAERS: 5 | US FAERS | |
| 880 | Hypoparathyroidism | FAERS: 5 | US FAERS | |
| 881 | Induration | FAERS: 5 | US FAERS | |
| 882 | Limb asymmetry | FAERS: 5 | US FAERS | |
| 883 | Lung Injury | FAERS: 5 | US FAERS | |
| 884 | Metamorphopsia | FAERS: 5 | US FAERS | |
| 885 | Micturition frequency decreased | FAERS: 5 | US FAERS | |
| 886 | Negative thoughts | FAERS: 5 | US FAERS | |
| 887 | No adverse drug reaction | FAERS: 5 | US FAERS | |
| 888 | Oral candidiasis | FAERS: 5 | US FAERS | |
| 889 | Orthostatic hypertension | FAERS: 5 | US FAERS | |
| 890 | Osteolysis | FAERS: 5 | US FAERS | |
| 891 | Oxygen consumption decreased | FAERS: 5 | US FAERS | |
| 892 | Pancreatic Cyst | FAERS: 5 | US FAERS | |
| 893 | Panic Disorder | FAERS: 5 | US FAERS | |
| 894 | Peripheral nerve lesion | FAERS: 5 | US FAERS | |
| 895 | Petechiae | FAERS: 5 | US FAERS | |
| 896 | Pneumonectomy | FAERS: 5 | US FAERS | |
| 897 | Polymyositis | FAERS: 5 | US FAERS | |
| 898 | Post-traumatic pain | FAERS: 5 | US FAERS | |
| 899 | Postoperative adhesion | FAERS: 5 | US FAERS | |
| 900 | Procedural site reaction | FAERS: 5 | US FAERS | |
| 901 | Product administered at inappropriate site | FAERS: 5 | US FAERS | |
| 902 | Psychiatric symptom | FAERS: 5 | US FAERS | |
| 903 | Purulent discharge | FAERS: 5 | US FAERS | |
| 904 | Rash scaly | FAERS: 5 | US FAERS | |
| 905 | Renal Artery Stenosis | FAERS: 5 | US FAERS | |
| 906 | Renal artery occlusion | FAERS: 5 | US FAERS | |
| 907 | Respiratory tract infection viral | FAERS: 5 | US FAERS | |
| 908 | Shoulder Pain | FAERS: 5 | US FAERS | |
| 909 | Sinus Tachycardia | FAERS: 5 | US FAERS | |
| 910 | Skin nodule | FAERS: 5 | US FAERS | |
| 911 | Solar lentigo | FAERS: 5 | US FAERS | |
| 912 | Temperature regulation disorder | FAERS: 5 | US FAERS | |
| 913 | Therapeutic product ineffective | FAERS: 5 | US FAERS | |
| 914 | Toe operation | FAERS: 5 | US FAERS | |
| 915 | Traumatic fracture | FAERS: 5 | US FAERS | |
| 916 | Vaginal Prolapse | FAERS: 5 | US FAERS | |
| 917 | Varicophlebitis | FAERS: 5 | US FAERS | |
| 918 | Vein pain | FAERS: 5 | US FAERS | |
| 919 | Venous Insufficiency | FAERS: 5 | US FAERS | |
| 920 | Vitreous Detachment | FAERS: 5 | US FAERS | |
| 921 | Wound Complication | FAERS: 5 | US FAERS | |
| 922 | Wound closure | FAERS: 5 | US FAERS | |
| 923 | Wrong patient received medication | FAERS: 5 | US FAERS | |
| 924 | Yawning | FAERS: 5 | US FAERS | |
| 925 | Alcohol abuse | FAERS: 4 | US FAERS | |
| 926 | Ammonia increased | FAERS: 4 | US FAERS | |
| 927 | Amputation | FAERS: 4 | US FAERS | |
| 928 | Amyloidosis | FAERS: 4 | US FAERS | |
| 929 | Antibiotic therapy | FAERS: 4 | US FAERS | |
| 930 | Anuria | FAERS: 4 | US FAERS | |
| 931 | Aortic Valve Stenosis | FAERS: 4 | US FAERS | |
| 932 | Arterial graft | FAERS: 4 | US FAERS | |
| 933 | Arthrodesis | FAERS: 4 | US FAERS | |
| 934 | Atypical fracture | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 935 | Aura | FAERS: 4 | US FAERS | |
| 936 | Autoimmune thyroiditis | FAERS: 4 | US FAERS | |
| 937 | Blood albumin decreased | FAERS: 4 | US FAERS | |
| 938 | Blood alkaline phosphatase | FAERS: 4 | US FAERS | |
| 939 | Blood folate decreased | FAERS: 4 | US FAERS | |
| 940 | Blood urea abnormal | FAERS: 4 | US FAERS | |
| 941 | Boredom | FAERS: 4 | US FAERS | |
| 942 | Breast cancer stage II | FAERS: 4 | US FAERS | |
| 943 | Candidiasis | FAERS: 4 | US FAERS | |
| 944 | Capillary Fragility | FAERS: 4 | US FAERS | |
| 945 | Cardiac ablation | FAERS: 4 | US FAERS | |
| 946 | Chondroma | FAERS: 4 | US FAERS | |
| 947 | Chondrosarcoma | FAERS: 4 | US FAERS | |
| 948 | Chronic respiratory failure | FAERS: 4 | US FAERS | |
| 949 | Conversion disorder | FAERS: 4 | US FAERS | |
| 950 | Creatinine renal clearance increased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 951 | Cystic Fibrosis | FAERS: 4 | US FAERS | |
| 952 | Dark circles under eyes | FAERS: 4 | US FAERS | |
| 953 | Deafness Neurosensory | FAERS: 4 | US FAERS | |
| 954 | Device component issue | FAERS: 4 | US FAERS | |
| 955 | Device difficult to use | FAERS: 4 | US FAERS | |
| 956 | Dialysis device insertion | FAERS: 4 | US FAERS | |
| 957 | Drowning | FAERS: 4 | US FAERS | |
| 958 | Enchondromatosis | FAERS: 4 | US FAERS | |
| 959 | Enterococcal infection | FAERS: 4 | US FAERS | |
| 960 | Enuresis | FAERS: 4 | US FAERS | |
| 961 | Enzyme abnormality | FAERS: 4 | US FAERS | |
| 962 | Enzyme level increased | FAERS: 4 | US FAERS | |
| 963 | Eosinophilia | FAERS: 4 | US FAERS | |
| 964 | Euphoric mood | FAERS: 4 | US FAERS | |
| 965 | Excitability | FAERS: 4 | US FAERS | |
| 966 | Faecaluria | FAERS: 4 | US FAERS | |
| 967 | Feelings of worthlessness | FAERS: 4 | US FAERS | |
| 968 | Foreign body trauma | FAERS: 4 | US FAERS | |
| 969 | Gastrectomy | FAERS: 4 | US FAERS | |
| 970 | Gastric pH decreased | FAERS: 4 | US FAERS | |
| 971 | Gastrointestinal arteriovenous malformation | FAERS: 4 | US FAERS | |
| 972 | Genital discharge | FAERS: 4 | US FAERS | |
| 973 | Heart valve calcification | FAERS: 4 | US FAERS | |
| 974 | Hydronephrosis | FAERS: 4 | US FAERS | |
| 975 | Idiopathic Pulmonary Fibrosis | FAERS: 4 | US FAERS | |
| 976 | Impaired self-care | FAERS: 4 | US FAERS | |
| 977 | Impatience | FAERS: 4 | US FAERS | |
| 978 | Impetigo | FAERS: 4 | US FAERS | |
| 979 | Inability to afford medication | FAERS: 4 | US FAERS | |
| 980 | Injection related reaction | FAERS: 4 | US FAERS | |
| 981 | Injection site dryness | FAERS: 4 | US FAERS | |
| 982 | Injection site hypertrophy | FAERS: 4 | US FAERS | |
| 983 | Injection site joint redness | FAERS: 4 | US FAERS | |
| 984 | Injection site pustule | FAERS: 4 | US FAERS | |
| 985 | Injection site ulcer | FAERS: 4 | US FAERS | |
| 986 | Insurance issue | FAERS: 4 | US FAERS | |
| 987 | Intestinal Fistula | FAERS: 4 | US FAERS | |
| 988 | Invasive Ductal Breast Carcinoma | FAERS: 4 | US FAERS | |
| 989 | Joint destruction | FAERS: 4 | US FAERS | |
| 990 | Joint fluid drainage | FAERS: 4 | US FAERS | |
| 991 | Lipoatrophy | FAERS: 4 | US FAERS | |
| 992 | Liquid product physical issue | FAERS: 4 | US FAERS | |
| 993 | Lymphadenitis | FAERS: 4 | US FAERS | |
| 994 | Lymphocyte count abnormal | FAERS: 4 | US FAERS | |
| 995 | Lymphocyte count increased | FAERS: 4 | US FAERS | |
| 996 | Malabsorption from injection site | FAERS: 4 | US FAERS | |
| 997 | Marasmus | FAERS: 4 | US FAERS | |
| 998 | Mastectomy | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 999 | Medical device change | FAERS: 4 | US FAERS | |
| 1000 | Menorrhagia | FAERS: 4 | US FAERS | |
| 1001 | Metrorrhagia | FAERS: 4 | US FAERS | |
| 1002 | Mineral deficiency | FAERS: 4 | US FAERS | |
| 1003 | Nail pigmentation | FAERS: 4 | US FAERS | |
| 1004 | Nephrectomy | FAERS: 4 | US FAERS | |
| 1005 | Nephritis | FAERS: 4 | US FAERS | |
| 1006 | Nodule on extremity | FAERS: 4 | US FAERS | |
| 1007 | Noninfective gingivitis | FAERS: 4 | US FAERS | |
| 1008 | Paraplegia | FAERS: 4 | US FAERS | |
| 1009 | Paresis | FAERS: 4 | US FAERS | |
| 1010 | Pertussis | FAERS: 4 | US FAERS | |
| 1011 | Polyneuropathy | FAERS: 4 | US FAERS | |
| 1012 | Post-Traumatic Stress Disorder | FAERS: 4 | US FAERS | |
| 1013 | Postoperative fever | FAERS: 4 | US FAERS | |
| 1014 | Postoperative infection | FAERS: 4 | US FAERS | |
| 1015 | Precancerous cells present | FAERS: 4 | US FAERS | |
| 1016 | Product packaging quantity issue | FAERS: 4 | US FAERS | |
| 1017 | Radiculopathy | FAERS: 4 | US FAERS | |
| 1018 | Rectocele | FAERS: 4 | US FAERS | |
| 1019 | Reflux gastritis | FAERS: 4 | US FAERS | |
| 1020 | Retinal Vein Occlusion | FAERS: 4 | US FAERS | |
| 1021 | Rhinalgia | FAERS: 4 | US FAERS | |
| 1022 | Saliva altered | FAERS: 4 | US FAERS | |
| 1023 | Seroma | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1024 | Serum procollagen type I N-terminal propeptide increased | FAERS: 4 | US FAERS | |
| 1025 | Sexual Dysfunction | FAERS: 4 | US FAERS | |
| 1026 | Skin Induration | FAERS: 4 | US FAERS | |
| 1027 | Soft Tissue Infection | FAERS: 4 | US FAERS | |
| 1028 | Splinter | FAERS: 4 | US FAERS | |
| 1029 | Sputum retention | FAERS: 4 | US FAERS | |
| 1030 | Stevens-Johnson Syndrome | FAERS: 4 | US FAERS | |
| 1031 | Subcutaneous Abscess | FAERS: 4 | US FAERS | |
| 1032 | Sudden onset of sleep | FAERS: 4 | US FAERS | |
| 1033 | Suicide attempt | FAERS: 4 | US FAERS | |
| 1034 | Tonsillitis | FAERS: 4 | US FAERS | |
| 1035 | Traumatic Brain Injury | FAERS: 4 | US FAERS | |
| 1036 | Tympanic Membrane Perforation | FAERS: 4 | US FAERS | |
| 1037 | Urinary sediment present | FAERS: 4 | US FAERS | |
| 1038 | Urine flow decreased | FAERS: 4 | US FAERS | |
| 1039 | Vascular bypass graft | FAERS: 4 | US FAERS | |
| 1040 | Ventricular Dysfunction | FAERS: 4 | US FAERS | |
| 1041 | Wound dehiscence | FAERS: 4 | US FAERS | |
| 1042 | treatment failure | FAERS: 4 | US FAERS | |
| 1043 | Abnormal sleep-related event | FAERS: 3 | US FAERS | |
| 1044 | Abulia | FAERS: 3 | US FAERS | |
| 1045 | Acute sinusitis | FAERS: 3 | US FAERS | |
| 1046 | Allergic sinusitis | FAERS: 3 | US FAERS | |
| 1047 | Anal Fissure | FAERS: 3 | US FAERS | |
| 1048 | Anorectal discomfort | FAERS: 3 | US FAERS | |
| 1049 | Aortic surgery | FAERS: 3 | US FAERS | |
| 1050 | Apparent death | FAERS: 3 | US FAERS | |
| 1051 | Application site pain | FAERS: 3 | US FAERS | |
| 1052 | Arterial therapeutic procedure | FAERS: 3 | US FAERS | |
| 1053 | Atelectasis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1054 | Autoimmune hepatitis | FAERS: 3 | US FAERS | |
| 1055 | Bacterial sepsis | FAERS: 3 | US FAERS | |
| 1056 | Biliary dilatation | FAERS: 3 | US FAERS | |
| 1057 | Blood alkaline phosphatase abnormal | FAERS: 3 | US FAERS | |
| 1058 | Blood alkaline phosphatase decreased | FAERS: 3 | US FAERS | |
| 1059 | Blood calcitonin increased | FAERS: 3 | US FAERS | |
| 1060 | Blood chloride decreased | FAERS: 3 | US FAERS | |
| 1061 | Blood cholesterol abnormal | FAERS: 3 | US FAERS | |
| 1062 | Blood electrolytes abnormal | FAERS: 3 | US FAERS | |
| 1063 | Blood iron abnormal | FAERS: 3 | US FAERS | |
| 1064 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 1065 | Blood pressure orthostatic abnormal | FAERS: 3 | US FAERS | |
| 1066 | Bone Sarcoma | FAERS: 3 | US FAERS | |
| 1067 | Bone Tuberculosis | FAERS: 3 | US FAERS | |
| 1068 | Bradykinesia | FAERS: 3 | US FAERS | |
| 1069 | Calciphylaxis | FAERS: 3 | US FAERS | |
| 1070 | Callus formation delayed | FAERS: 3 | US FAERS | |
| 1071 | Cardiac stress test abnormal | FAERS: 3 | US FAERS | |
| 1072 | Catheter placement | FAERS: 3 | US FAERS | |
| 1073 | Cholecystostomy | FAERS: 3 | US FAERS | |
| 1074 | Chondromalacia | FAERS: 3 | US FAERS | |
| 1075 | Chordoma | FAERS: 3 | US FAERS | |
| 1076 | Chronic Fatigue Syndrome | FAERS: 3 | US FAERS | |
| 1077 | Circumstance or information capable of leading to medication error | FAERS: 3 | US FAERS | |
| 1078 | Device deployment issue | FAERS: 3 | US FAERS | |
| 1079 | Device dispensing error | FAERS: 3 | US FAERS | |
| 1080 | Device lead damage | FAERS: 3 | US FAERS | |
| 1081 | Diabetic Retinopathy | FAERS: 3 | US FAERS | |
| 1082 | Dropped head syndrome | FAERS: 3 | US FAERS | |
| 1083 | Drug abuse | FAERS: 3 | US FAERS | |
| 1084 | Dysphemia | FAERS: 3 | US FAERS | |
| 1085 | Dystonia | FAERS: 3 | US FAERS | |
| 1086 | Eating disorder symptom | FAERS: 3 | US FAERS | |
| 1087 | Elbow operation | FAERS: 3 | US FAERS | |
| 1088 | Encephalomalacia | FAERS: 3 | US FAERS | |
| 1089 | Endocarditis | FAERS: 3 | US FAERS | |
| 1090 | Endometrial Hyperplasia | FAERS: 3 | US FAERS | |
| 1091 | Erectile dysfunction | FAERS: 3 | US FAERS | |
| 1092 | Escherichia sepsis | FAERS: 3 | US FAERS | |
| 1093 | Eustachian tube disorder | FAERS: 3 | US FAERS | |
| 1094 | Eyelids pruritus | FAERS: 3 | US FAERS | |
| 1095 | Fluid imbalance | FAERS: 3 | US FAERS | |
| 1096 | Foraminotomy | FAERS: 3 | US FAERS | |
| 1097 | Full blood count increased | FAERS: 3 | US FAERS | |
| 1098 | Gastric Bypass | FAERS: 3 | US FAERS | |
| 1099 | Gastroenteritis norovirus | FAERS: 3 | US FAERS | |
| 1100 | Granuloma | FAERS: 3 | US FAERS | |
| 1101 | Head titubation | FAERS: 3 | US FAERS | |
| 1102 | Heat Exhaustion | FAERS: 3 | US FAERS | |
| 1103 | Hidradenitis | FAERS: 3 | US FAERS | |
| 1104 | High density lipoprotein increased | FAERS: 3 | US FAERS | |
| 1105 | Hirsutism | FAERS: 3 | US FAERS | |
| 1106 | Hoarseness | FAERS: 3 | US FAERS | |
| 1107 | Hypervigilance | FAERS: 3 | US FAERS | |
| 1108 | Hyporeflexia | FAERS: 3 | US FAERS | |
| 1109 | Implant site reaction | FAERS: 3 | US FAERS | |
| 1110 | Incision site cellulitis | FAERS: 3 | US FAERS | |
| 1111 | Infusion site erythema | FAERS: 3 | US FAERS | |
| 1112 | Injection site abscess | FAERS: 3 | US FAERS | |
| 1113 | Injection site atrophy | FAERS: 3 | US FAERS | |
| 1114 | Injection site joint pain | FAERS: 3 | US FAERS | |
| 1115 | Injection site joint swelling | FAERS: 3 | US FAERS | |
| 1116 | Intentional self-injury | FAERS: 3 | US FAERS | |
| 1117 | Intercepted drug prescribing error | FAERS: 3 | US FAERS | |
| 1118 | Intervertebral disc injury | FAERS: 3 | US FAERS | |
| 1119 | Intracranial Hypotension | FAERS: 3 | US FAERS | |
| 1120 | Itching scar | FAERS: 3 | US FAERS | |
| 1121 | Labile blood pressure | FAERS: 3 | US FAERS | |
| 1122 | Ligament pain | FAERS: 3 | US FAERS | |
| 1123 | Ligamentitis | FAERS: 3 | US FAERS | |
| 1124 | Limb mass | FAERS: 3 | US FAERS | |
| 1125 | Lipase increased | FAERS: 3 | US FAERS | |
| 1126 | Localised skin reaction | FAERS: 3 | US FAERS | |
| 1127 | Loss of personal independence in daily activities | FAERS: 3 | US FAERS | |
| 1128 | Lumbar radiculopathy | FAERS: 3 | US FAERS | |
| 1129 | Lung cyst removal | FAERS: 3 | US FAERS | |
| 1130 | Maternal exposure during pregnancy | FAERS: 3 | US FAERS | |
| 1131 | Medical device pain | FAERS: 3 | US FAERS | |
| 1132 | Muscle Spasticity | FAERS: 3 | US FAERS | |
| 1133 | Myocardial rupture | FAERS: 3 | US FAERS | |
| 1134 | Myopathy | FAERS: 3 | US FAERS | |
| 1135 | Nail bed disorder | FAERS: 3 | US FAERS | |
| 1136 | Narcolepsy | FAERS: 3 | US FAERS | |
| 1137 | Nephrotic Syndrome | FAERS: 3 | US FAERS | |
| 1138 | Obesity | FAERS: 3 | US FAERS | |
| 1139 | Oliguria | FAERS: 3 | US FAERS | |
| 1140 | Oral mucosal eruption | FAERS: 3 | US FAERS | |
| 1141 | Oral mucosal erythema | FAERS: 3 | US FAERS | |
| 1142 | Osteochondritis | FAERS: 3 | US FAERS | |
| 1143 | Osteoma cutis | FAERS: 3 | US FAERS | |
| 1144 | Osteotomy | FAERS: 3 | US FAERS | |
| 1145 | Otitis Externa | FAERS: 3 | US FAERS | |
| 1146 | Ovarian enlargement | FAERS: 3 | US FAERS | |
| 1147 | Oxygen supplementation | FAERS: 3 | US FAERS | |
| 1148 | Pacemaker complication | FAERS: 3 | US FAERS | |
| 1149 | Pain management | FAERS: 3 | US FAERS | |
| 1150 | Palliative Care | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1151 | Pancreatic calcification | FAERS: 3 | US FAERS | |
| 1152 | Pancytopenia | FAERS: 3 | US FAERS | |
| 1153 | Pemphigus | FAERS: 3 | US FAERS | |
| 1154 | Peptic Ulcer | FAERS: 3 | US FAERS | |
| 1155 | Periodontitis | FAERS: 3 | US FAERS | |
| 1156 | Physical disability | FAERS: 3 | US FAERS | |
| 1157 | Poliomyelitis | FAERS: 3 | US FAERS | |
| 1158 | Post procedural pain | FAERS: 3 | US FAERS | |
| 1159 | Postoperative thrombosis | FAERS: 3 | US FAERS | |
| 1160 | Potentiating drug interaction | FAERS: 3 | US FAERS | |
| 1161 | Procollagen type I C-terminal propeptide increased | FAERS: 3 | US FAERS | |
| 1162 | Protein total decreased | FAERS: 3 | US FAERS | |
| 1163 | Radial nerve palsy | FAERS: 3 | US FAERS | |
| 1164 | Radicular pain | FAERS: 3 | US FAERS | |
| 1165 | Renal aneurysm | FAERS: 3 | US FAERS | |
| 1166 | Retinal vascular thrombosis | FAERS: 3 | US FAERS | |
| 1167 | Rheumatoid Nodule | FAERS: 3 | US FAERS | |
| 1168 | Rheumatoid factor increased | FAERS: 3 | US FAERS | |
| 1169 | Senile dementia | FAERS: 3 | US FAERS | |
| 1170 | Sensation of blood flow | FAERS: 3 | US FAERS | |
| 1171 | Skin texture abnormal | FAERS: 3 | US FAERS | |
| 1172 | Spinal X-ray abnormal | FAERS: 3 | US FAERS | |
| 1173 | Starvation | FAERS: 3 | US FAERS | |
| 1174 | Stubbornness | FAERS: 3 | US FAERS | |
| 1175 | Surgical failure | FAERS: 3 | US FAERS | |
| 1176 | Suture related complication | FAERS: 3 | US FAERS | |
| 1177 | Syringe issue | FAERS: 3 | US FAERS | |
| 1178 | Tetany | FAERS: 3 | US FAERS | |
| 1179 | Thermoanaesthesia | FAERS: 3 | US FAERS | |
| 1180 | Thirst decreased | FAERS: 3 | US FAERS | |
| 1181 | Thrombotic stroke | FAERS: 3 | US FAERS | |
| 1182 | Thyroid gland scan abnormal | FAERS: 3 | US FAERS | |
| 1183 | Thyroiditis | FAERS: 3 | US FAERS | |
| 1184 | Tonsillectomy | FAERS: 3 | US FAERS | |
| 1185 | Transplant | FAERS: 3 | US FAERS | |
| 1186 | Ureterolithiasis | FAERS: 3 | US FAERS | |
| 1187 | Varicose vein operation | FAERS: 3 | US FAERS | |
| 1188 | Vascular insufficiency | FAERS: 3 | US FAERS | |
| 1189 | Venous thrombosis limb | FAERS: 3 | US FAERS | |
| 1190 | Vertebral column mass | FAERS: 3 | US FAERS | |
| 1191 | Vocal Cord Paralysis | FAERS: 3 | US FAERS | |
| 1192 | Wrong product stored | FAERS: 3 | US FAERS | |
| 1193 | X-ray limb abnormal | FAERS: 3 | US FAERS | |
| 1194 | X-ray of pelvis and hip abnormal | FAERS: 3 | US FAERS | |
| 1195 | ovarian neoplasm | FAERS: 3 | US FAERS | |
| 1196 | Abdominal Abscess | FAERS: 2 | US FAERS | |
| 1197 | Abdominal Infection | FAERS: 2 | US FAERS | |
| 1198 | Abdominal fat apron | FAERS: 2 | US FAERS | |
| 1199 | Abdominal hernia obstructive | FAERS: 2 | US FAERS | |
| 1200 | Accidental death | FAERS: 2 | US FAERS | |
| 1201 | Accidental exposure | FAERS: 2 | US FAERS | |
| 1202 | Adenoidectomy | FAERS: 2 | US FAERS | |
| 1203 | Adrenocortical insufficiency chronic | FAERS: 2 | US FAERS | |
| 1204 | Agnosia | FAERS: 2 | US FAERS | |
| 1205 | Allergic respiratory symptom | FAERS: 2 | US FAERS | |
| 1206 | Ammonia abnormal | FAERS: 2 | US FAERS | |
| 1207 | Amylase increased | FAERS: 2 | US FAERS | |
| 1208 | Anal polyp | FAERS: 2 | US FAERS | |
| 1209 | Anorgasmia | FAERS: 2 | US FAERS | |
| 1210 | Antinuclear antibody increased | FAERS: 2 | US FAERS | |
| 1211 | Aortic Rupture | FAERS: 2 | US FAERS | |
| 1212 | Aortic occlusion | FAERS: 2 | US FAERS | |
| 1213 | Aortitis | FAERS: 2 | US FAERS | |
| 1214 | Arterial Injury | FAERS: 2 | US FAERS | |
| 1215 | Arterial aneurysm repair | FAERS: 2 | US FAERS | |
| 1216 | Arterial stenosis limb | FAERS: 2 | US FAERS | |
| 1217 | Arterial thrombosis | FAERS: 2 | US FAERS | |
| 1218 | Arthrofibrosis | FAERS: 2 | US FAERS | |
| 1219 | Asbestosis | FAERS: 2 | US FAERS | |
| 1220 | Auricular swelling | FAERS: 2 | US FAERS | |
| 1221 | Autonomic neuropathy | FAERS: 2 | US FAERS | |
| 1222 | Axillary vein thrombosis | FAERS: 2 | US FAERS | |
| 1223 | Bacterial disease carrier | FAERS: 2 | US FAERS | |
| 1224 | Band neutrophil count increased | FAERS: 2 | US FAERS | |
| 1225 | Bence Jones protein urine present | FAERS: 2 | US FAERS | |
| 1226 | Benign neoplasm of thyroid gland | FAERS: 2 | US FAERS | |
| 1227 | Biliary Dyskinesia | FAERS: 2 | US FAERS | |
| 1228 | Bipolar I disorder | FAERS: 2 | US FAERS | |
| 1229 | Birth mark | FAERS: 2 | US FAERS | |
| 1230 | Bladder malposition acquired | FAERS: 2 | US FAERS | |
| 1231 | Blood albumin increased | FAERS: 2 | US FAERS | |
| 1232 | Blood cortisol increased | FAERS: 2 | US FAERS | |
| 1233 | Blood electrolytes decreased | FAERS: 2 | US FAERS | |
| 1234 | Blood growth hormone decreased | FAERS: 2 | US FAERS | |
| 1235 | Blood immunoglobulin E increased | FAERS: 2 | US FAERS | |
| 1236 | Blood immunoglobulin G increased | FAERS: 2 | US FAERS | |
| 1237 | Blood pressure immeasurable | FAERS: 2 | US FAERS | |
| 1238 | Blood sodium abnormal | FAERS: 2 | US FAERS | |
| 1239 | Blood testosterone increased | FAERS: 2 | US FAERS | |
| 1240 | Blood uric acid decreased | FAERS: 2 | US FAERS | |
| 1241 | Blue Toe Syndrome | FAERS: 2 | US FAERS | |
| 1242 | Bone contusion | FAERS: 2 | US FAERS | |
| 1243 | Bone density increased | FAERS: 2 | US FAERS | |
| 1244 | Bone formation decreased | FAERS: 2 | US FAERS | |
| 1245 | Brain natriuretic peptide increased | FAERS: 2 | US FAERS | |
| 1246 | Breast cancer stage III | FAERS: 2 | US FAERS | |
| 1247 | Breast engorgement | FAERS: 2 | US FAERS | |
| 1248 | Breathing-related sleep disorder | FAERS: 2 | US FAERS | |
| 1249 | Brucellosis | FAERS: 2 | US FAERS | |
| 1250 | C-telopeptide | FAERS: 2 | US FAERS | |
| 1251 | CREST Syndrome | FAERS: 2 | US FAERS | |
| 1252 | Cachexia | FAERS: 2 | US FAERS | |
| 1253 | Carbon dioxide increased | FAERS: 2 | US FAERS | |
| 1254 | Carcinoma in Situ | FAERS: 2 | US FAERS | |
| 1255 | Carcinoma in situ of eye | FAERS: 2 | US FAERS | |
| 1256 | Carcinoma | FAERS: 2 | US FAERS | |
| 1257 | Cardiac Death | FAERS: 2 | US FAERS | |
| 1258 | Cardiac enzymes increased | FAERS: 2 | US FAERS | |
| 1259 | Cardiac procedure complication | FAERS: 2 | US FAERS | |
| 1260 | Cardiac valve replacement complication | FAERS: 2 | US FAERS | |
| 1261 | Cardiac valve vegetation | FAERS: 2 | US FAERS | |
| 1262 | Cardio-respiratory distress | FAERS: 2 | US FAERS | |
| 1263 | Cardioactive drug level increased | FAERS: 2 | US FAERS | |
| 1264 | Carotid Artery Thrombosis | FAERS: 2 | US FAERS | |
| 1265 | Catheter sepsis | FAERS: 2 | US FAERS | |
| 1266 | Cervical cord compression | FAERS: 2 | US FAERS | |
| 1267 | Chronic sinusitis | FAERS: 2 | US FAERS | |
| 1268 | Citrobacter infection | FAERS: 2 | US FAERS | |
| 1269 | Clostridium colitis | FAERS: 2 | US FAERS | |
| 1270 | Coagulation test abnormal | FAERS: 2 | US FAERS | |
| 1271 | Colon adenoma | FAERS: 2 | US FAERS | |
| 1272 | Colon cancer recurrent | FAERS: 2 | US FAERS | |
| 1273 | Colonic Pseudo-Obstruction | FAERS: 2 | US FAERS | |
| 1274 | Colorectal cancer recurrent | FAERS: 2 | US FAERS | |
| 1275 | Complication of device insertion | FAERS: 2 | US FAERS | |
| 1276 | Contrast media allergy | FAERS: 2 | US FAERS | |
| 1277 | Corneal Infection | FAERS: 2 | US FAERS | |
| 1278 | Coronary artery insufficiency | FAERS: 2 | US FAERS | |
| 1279 | Cyst removal | FAERS: 2 | US FAERS | |
| 1280 | Cystitis escherichia | FAERS: 2 | US FAERS | |
| 1281 | Death of spouse | FAERS: 2 | US FAERS | |
| 1282 | Decreased immune responsiveness | FAERS: 2 | US FAERS | |
| 1283 | Dengue Fever | FAERS: 2 | US FAERS | |
| 1284 | Dental Plaque | FAERS: 2 | US FAERS | |
| 1285 | Dental Restoration Failure | FAERS: 2 | US FAERS | |
| 1286 | Dental prosthesis placement | FAERS: 2 | US FAERS | |
| 1287 | Dermatomyositis | FAERS: 2 | US FAERS | |
| 1288 | Device capturing issue | FAERS: 2 | US FAERS | |
| 1289 | Device damage | FAERS: 2 | US FAERS | |
| 1290 | Device defective | FAERS: 2 | US FAERS | |
| 1291 | Device extrusion | FAERS: 2 | US FAERS | |
| 1292 | Device loosening | FAERS: 2 | US FAERS | |
| 1293 | Device power source issue | FAERS: 2 | US FAERS | |
| 1294 | Diabetes Insipidus | FAERS: 2 | US FAERS | |
| 1295 | Dissociation | FAERS: 2 | US FAERS | |
| 1296 | Dreamy state | FAERS: 2 | US FAERS | |
| 1297 | Drug exposure before pregnancy | FAERS: 2 | US FAERS | |
| 1298 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 1299 | Duodenal Obstruction | FAERS: 2 | US FAERS | |
| 1300 | Dural tear | FAERS: 2 | US FAERS | |
| 1301 | Dysacusis | FAERS: 2 | US FAERS | |
| 1302 | Dyslexia | FAERS: 2 | US FAERS | |
| 1303 | Dysphasia | FAERS: 2 | US FAERS | |
| 1304 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 1305 | Electroencephalogram abnormal | FAERS: 2 | US FAERS | |
| 1306 | Electrolyte depletion | FAERS: 2 | US FAERS | |
| 1307 | Empyema | FAERS: 2 | US FAERS | |
| 1308 | Encephalitis | FAERS: 2 | US FAERS | |
| 1309 | Endometrial cancer stage II | FAERS: 2 | US FAERS | |
| 1310 | Endometriosis | FAERS: 2 | US FAERS | |
| 1311 | Endoscopic Retrograde Cholangiopancreatography | FAERS: 2 | US FAERS | |
| 1312 | Enteritis | FAERS: 2 | US FAERS | |
| 1313 | Enterocolitis bacterial | FAERS: 2 | US FAERS | |
| 1314 | Essential Hypertension | FAERS: 2 | US FAERS | |
| 1315 | Evans syndrome | FAERS: 2 | US FAERS | |
| 1316 | Excessive cerumen production | FAERS: 2 | US FAERS | |
| 1317 | Excessive eye blinking | FAERS: 2 | US FAERS | |
| 1318 | Exfoliative rash | FAERS: 2 | US FAERS | |
| 1319 | Exploratory operation | FAERS: 2 | US FAERS | |
| 1320 | External ear pain | FAERS: 2 | US FAERS | |
| 1321 | Eye Redness | FAERS: 2 | US FAERS | |
| 1322 | Eyeglasses therapy | FAERS: 2 | US FAERS | |
| 1323 | Eyelid Function Disorder | FAERS: 2 | US FAERS | |
| 1324 | Eyelid exfoliation | FAERS: 2 | US FAERS | |
| 1325 | Facetectomy | FAERS: 2 | US FAERS | |
| 1326 | Facial Neuralgia | FAERS: 2 | US FAERS | |
| 1327 | Facial paralysis | FAERS: 2 | US FAERS | |
| 1328 | Femoral arterial stenosis | FAERS: 2 | US FAERS | |
| 1329 | Fluid replacement | FAERS: 2 | US FAERS | |
| 1330 | Frustration tolerance decreased | FAERS: 2 | US FAERS | |
| 1331 | Gastric mucosal lesion | FAERS: 2 | US FAERS | |
| 1332 | Gastrointestinal bacterial infection | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1333 | Gastrointestinal hypermotility | FAERS: 2 | US FAERS | |
| 1334 | Glycosuria | FAERS: 2 | US FAERS | |
| 1335 | Grief reaction | FAERS: 2 | US FAERS | |
| 1336 | Head deformity | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1337 | Hearing aid user | FAERS: 2 | US FAERS | |
| 1338 | Hearing disability | FAERS: 2 | US FAERS | |
| 1339 | Heart valve stenosis | FAERS: 2 | US FAERS | |
| 1340 | Hepatic Infection | FAERS: 2 | US FAERS | |
| 1341 | Hepatic artery occlusion | FAERS: 2 | US FAERS | |
| 1342 | Hepatic vein occlusion | FAERS: 2 | US FAERS | |
| 1343 | Hyperacusis | FAERS: 2 | US FAERS | |
| 1344 | Hyperreflexia | FAERS: 2 | US FAERS | |
| 1345 | Hypertrophy | FAERS: 2 | US FAERS | |
| 1346 | Hypervitaminosis D | FAERS: 2 | US FAERS | |
| 1347 | Hypoaesthesia facial | FAERS: 2 | US FAERS | |
| 1348 | Hypothalamo-pituitary disorder | FAERS: 2 | US FAERS | |
| 1349 | Implantable defibrillator insertion | FAERS: 2 | US FAERS | |
| 1350 | Incision site infection | FAERS: 2 | US FAERS | |
| 1351 | Incorrect route of product administration | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1352 | Infected dermal cyst | FAERS: 2 | US FAERS | |
| 1353 | Inflammatory marker increased | FAERS: 2 | US FAERS | |
| 1354 | Injection site calcification | FAERS: 2 | US FAERS | |
| 1355 | Injection site cellulitis | FAERS: 2 | US FAERS | |
| 1356 | Injection site exfoliation | FAERS: 2 | US FAERS | |
| 1357 | Injection site joint erythema | FAERS: 2 | US FAERS | |
| 1358 | Injection site necrosis | FAERS: 2 | US FAERS | |
| 1359 | Insulin Resistance | FAERS: 2 | US FAERS | |
| 1360 | Intention tremor | FAERS: 2 | US FAERS | |
| 1361 | Intentional misuse | FAERS: 2 | US FAERS | |
| 1362 | Intercepted drug administration error | FAERS: 2 | US FAERS | |
| 1363 | Intraocular pressure test | FAERS: 2 | US FAERS | |
| 1364 | Iodine allergy | FAERS: 2 | US FAERS | |
| 1365 | Iritis | FAERS: 2 | US FAERS | |
| 1366 | Joint adhesion | FAERS: 2 | US FAERS | |
| 1367 | Joint dislocation postoperative | FAERS: 2 | US FAERS | |
| 1368 | Lactation Disorder | FAERS: 2 | US FAERS | |
| 1369 | Left Ventricular Hypertrophy | FAERS: 2 | US FAERS | |
| 1370 | Leukocytoclastic vasculitis | FAERS: 2 | US FAERS | |
| 1371 | Leukocytosis | FAERS: 2 | US FAERS | |
| 1372 | Lichen Planus | FAERS: 2 | US FAERS | |
| 1373 | Light chain analysis abnormal | FAERS: 2 | US FAERS | |
| 1374 | Lip neoplasm malignant stage unspecified | FAERS: 2 | US FAERS | |
| 1375 | Lipodystrophy acquired | FAERS: 2 | US FAERS | |
| 1376 | Livedo Reticularis | FAERS: 2 | US FAERS | |
| 1377 | Liver transplant rejection | FAERS: 2 | US FAERS | |
| 1378 | Lobar Pneumonia | FAERS: 2 | US FAERS | |
| 1379 | Local reaction | FAERS: 2 | US FAERS | |
| 1380 | Lordosis | FAERS: 2 | US FAERS | |
| 1381 | Lower respiratory tract infection fungal | FAERS: 2 | US FAERS | |
| 1382 | Lupus Nephritis | FAERS: 2 | US FAERS | |
| 1383 | Lupus-like syndrome | FAERS: 2 | US FAERS | |
| 1384 | Lymphocyte count decreased | FAERS: 2 | US FAERS | |
| 1385 | Macular fibrosis | FAERS: 2 | US FAERS | |
| 1386 | Malignant Fibrous Histiocytoma | FAERS: 2 | US FAERS | |
| 1387 | Malignant neoplasm of ampulla of Vater | FAERS: 2 | US FAERS | |
| 1388 | Malignant neoplasm of spinal cord | FAERS: 2 | US FAERS | |
| 1389 | Mantle cell lymphoma | FAERS: 2 | US FAERS | |
| 1390 | Manufacturing product shipping issue | FAERS: 2 | US FAERS | |
| 1391 | Markedly reduced dietary intake | FAERS: 2 | US FAERS | |
| 1392 | Mastocytosis | FAERS: 2 | US FAERS | |
| 1393 | Medical device discomfort | FAERS: 2 | US FAERS | |
| 1394 | Mental Fatigue | FAERS: 2 | US FAERS | |
| 1395 | Metastases to adrenals | FAERS: 2 | US FAERS | |
| 1396 | Mitral Valve Stenosis | FAERS: 2 | US FAERS | |
| 1397 | Monoclonal immunoglobulin present | FAERS: 2 | US FAERS | |
| 1398 | Mood disorder due to a general medical condition | FAERS: 2 | US FAERS | |
| 1399 | Mucosal pigmentation | FAERS: 2 | US FAERS | |
| 1400 | Muscle abscess | FAERS: 2 | US FAERS | |
| 1401 | Muscle contusion | FAERS: 2 | US FAERS | |
| 1402 | Muscle hypertrophy | FAERS: 2 | US FAERS | |
| 1403 | Muscle tension dysphonia | FAERS: 2 | US FAERS | |
| 1404 | Mycobacterium test positive | FAERS: 2 | US FAERS | |
| 1405 | Myocardial strain | FAERS: 2 | US FAERS | |
| 1406 | Myoclonic Epilepsy | FAERS: 2 | US FAERS | |
| 1407 | Myopia | FAERS: 2 | US FAERS | |
| 1408 | Myositis Ossificans | FAERS: 2 | US FAERS | |
| 1409 | Nasal Polyps | FAERS: 2 | US FAERS | |
| 1410 | Nasal mucosal disorder | FAERS: 2 | US FAERS | |
| 1411 | Nasal pruritus | FAERS: 2 | US FAERS | |
| 1412 | Nephrocalcinosis | FAERS: 2 | US FAERS | |
| 1413 | Nerve Degeneration | FAERS: 2 | US FAERS | |
| 1414 | Neuroma | FAERS: 2 | US FAERS | |
| 1415 | Nutritional Support | FAERS: 2 | US FAERS | |
| 1416 | Nutritional condition abnormal | FAERS: 2 | US FAERS | |
| 1417 | Nystagmus | FAERS: 2 | US FAERS | |
| 1418 | Obsessive-Compulsive Disorder | FAERS: 2 | US FAERS | |
| 1419 | Ocular icterus | FAERS: 2 | US FAERS | |
| 1420 | Ocular vascular disorder | FAERS: 2 | US FAERS | |
| 1421 | Oral mucosal exfoliation | FAERS: 2 | US FAERS | |
| 1422 | Oropharyngeal plaque | FAERS: 2 | US FAERS | |
| 1423 | Orthosis user | FAERS: 2 | US FAERS | |
| 1424 | Osteocalcin decreased | FAERS: 2 | US FAERS | |
| 1425 | Osteomalacia | FAERS: 2 | US FAERS | |
| 1426 | Osteosarcoma localised | FAERS: 2 | US FAERS | |
| 1427 | Otosclerosis | FAERS: 2 | US FAERS | |
| 1428 | PCO2 increased | FAERS: 2 | US FAERS | |
| 1429 | Pancreatic Duct Stenosis | FAERS: 2 | US FAERS | |
| 1430 | Papule | FAERS: 2 | US FAERS | |
| 1431 | Paracentesis | FAERS: 2 | US FAERS | |
| 1432 | Patella replacement | FAERS: 2 | US FAERS | |
| 1433 | Pelvic floor repair | FAERS: 2 | US FAERS | |
| 1434 | Perforated ulcer | FAERS: 2 | US FAERS | |
| 1435 | Periorbital disorder | FAERS: 2 | US FAERS | |
| 1436 | Peripheral embolism | FAERS: 2 | US FAERS | |
| 1437 | Peripheral venous disease | FAERS: 2 | US FAERS | |
| 1438 | Periphlebitis | FAERS: 2 | US FAERS | |
| 1439 | Persistent depressive disorder | FAERS: 2 | US FAERS | |
| 1440 | Phantom pain | FAERS: 2 | US FAERS | |
| 1441 | Phlebitis deep | FAERS: 2 | US FAERS | |
| 1442 | Piloerection | FAERS: 2 | US FAERS | |
| 1443 | Platelet count abnormal | FAERS: 2 | US FAERS | |
| 1444 | Pleuritic pain | FAERS: 2 | US FAERS | |
| 1445 | Poisoning | FAERS: 2 | US FAERS | |
| 1446 | Poor dental condition | FAERS: 2 | US FAERS | |
| 1447 | Post procedural fistula | FAERS: 2 | US FAERS | |
| 1448 | Post procedural swelling | FAERS: 2 | US FAERS | |
| 1449 | Precancerous skin lesion | FAERS: 2 | US FAERS | |
| 1450 | Procedural vomiting | FAERS: 2 | US FAERS | |
| 1451 | Product contamination | FAERS: 2 | US FAERS | |
| 1452 | Product physical issue | FAERS: 2 | US FAERS | |
| 1453 | Progressive multiple sclerosis | FAERS: 2 | US FAERS | |
| 1454 | Pseudarthrosis | FAERS: 2 | US FAERS | |
| 1455 | Psychomotor skills impaired | FAERS: 2 | US FAERS | |
| 1456 | Pulmonary interstitial emphysema syndrome | FAERS: 2 | US FAERS | |
| 1457 | Puncture site infection | FAERS: 2 | US FAERS | |
| 1458 | Puncture site reaction | FAERS: 2 | US FAERS | |
| 1459 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 1460 | Rectal polyp | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1461 | Reduced bladder capacity | FAERS: 2 | US FAERS | |
| 1462 | Refusal of treatment by relative | FAERS: 2 | US FAERS | |
| 1463 | Respiratory Therapy | FAERS: 2 | US FAERS | |
| 1464 | Respiratory tract irritation | FAERS: 2 | US FAERS | |
| 1465 | Retinal Artery Occlusion | FAERS: 2 | US FAERS | |
| 1466 | Retinal Degeneration | FAERS: 2 | US FAERS | |
| 1467 | Rhonchi | FAERS: 2 | US FAERS | |
| 1468 | Ruptured cerebral aneurysm | FAERS: 2 | US FAERS | |
| 1469 | Schistosomiasis | FAERS: 2 | US FAERS | |
| 1470 | Scoliosis surgery | FAERS: 2 | US FAERS | |
| 1471 | Sense of oppression | FAERS: 2 | US FAERS | |
| 1472 | Shoulder deformity | FAERS: 2 | US FAERS | |
| 1473 | Shunt malfunction | FAERS: 2 | US FAERS | |
| 1474 | Silicosis | FAERS: 2 | US FAERS | |
| 1475 | Single functional kidney | FAERS: 2 | US FAERS | |
| 1476 | Sinus bradycardia | FAERS: 2 | US FAERS | |
| 1477 | Sinus pain | FAERS: 2 | US FAERS | |
| 1478 | Sleep Talking | FAERS: 2 | US FAERS | |
| 1479 | Sleep disorder due to general medical condition, hypersomnia type | FAERS: 2 | US FAERS | |
| 1480 | Slow speech | FAERS: 2 | US FAERS | |
| 1481 | Spinal claudication | FAERS: 2 | US FAERS | |
| 1482 | Staring | FAERS: 2 | US FAERS | |
| 1483 | Stent occlusion | FAERS: 2 | US FAERS | |
| 1484 | Stent-graft malfunction | FAERS: 2 | US FAERS | |
| 1485 | Steroid withdrawal syndrome | FAERS: 2 | US FAERS | |
| 1486 | Stupor | FAERS: 2 | US FAERS | |
| 1487 | Sudden Cardiac Death | FAERS: 2 | US FAERS | |
| 1488 | Superficial injury of eye | FAERS: 2 | US FAERS | |
| 1489 | Superinfection lung | FAERS: 2 | US FAERS | |
| 1490 | Suture rupture | FAERS: 2 | US FAERS | |
| 1491 | Syringomyelia | FAERS: 2 | US FAERS | |
| 1492 | Systemic mycosis | FAERS: 2 | US FAERS | |
| 1493 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 1494 | Tendon discomfort | FAERS: 2 | US FAERS | |
| 1495 | Tenosynovitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1496 | Therapy regimen changed | FAERS: 2 | US FAERS | |
| 1497 | Tongue discomfort | FAERS: 2 | US FAERS | |
| 1498 | Tongue eruption | FAERS: 2 | US FAERS | |
| 1499 | Tongue movement disturbance | FAERS: 2 | US FAERS | |
| 1500 | Tongue spasm | FAERS: 2 | US FAERS | |
| 1501 | Total lung capacity abnormal | FAERS: 2 | US FAERS | |
| 1502 | Tracheal dilatation | FAERS: 2 | US FAERS | |
| 1503 | Tracheitis | FAERS: 2 | US FAERS | |
| 1504 | Tracheobronchitis | FAERS: 2 | US FAERS | |
| 1505 | Transmission of an infectious agent via a medicinal product | FAERS: 2 | US FAERS | |
| 1506 | Troponin increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1507 | Ultrasound scan abnormal | FAERS: 2 | US FAERS | |
| 1508 | Urethritis | FAERS: 2 | US FAERS | |
| 1509 | Urinary hesitation | FAERS: 2 | US FAERS | |
| 1510 | Urinary tract infection enterococcal | FAERS: 2 | US FAERS | |
| 1511 | Vagus Nerve Disorder | FAERS: 2 | US FAERS | |
| 1512 | Vascular fragility | FAERS: 2 | US FAERS | |
| 1513 | Vessel puncture site bruise | FAERS: 2 | US FAERS | |
| 1514 | Visual acuity reduced transiently | FAERS: 2 | US FAERS | |
| 1515 | Vulvovaginal mycotic infection | FAERS: 2 | US FAERS | |
| 1516 | White blood cell analysis abnormal | FAERS: 2 | US FAERS | |
| 1517 | Wrist deformity | FAERS: 2 | US FAERS | |
| 1518 | Wrong dose | FAERS: 2 | US FAERS | |
| 1519 | diagnostic procedure | FAERS: 2 | US FAERS | |
| 1520 | effusion | FAERS: 2 | US FAERS | |
| 1521 | leiomyosarcoma | FAERS: 2 | US FAERS | |
| 1522 | synovial sarcoma | FAERS: 2 | US FAERS | |
| 1523 | Abdominal sepsis | FAERS: 1 | US FAERS | |
| 1524 | Acantholysis | FAERS: 1 | US FAERS | |
| 1525 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 1526 | Accessory cardiac pathway | FAERS: 1 | US FAERS | |
| 1527 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 1528 | Acoustic Neuroma | FAERS: 1 | US FAERS | |
| 1529 | Actinic keratosis | FAERS: 1 | US FAERS | |
| 1530 | Adenosquamous cell lung cancer | FAERS: 1 | US FAERS | |
| 1531 | Administration site hypersensitivity | FAERS: 1 | US FAERS | |
| 1532 | Adnexa uteri cyst | FAERS: 1 | US FAERS | |
| 1533 | Adrenal mass | FAERS: 1 | US FAERS | |
| 1534 | Agraphia | FAERS: 1 | US FAERS | |
| 1535 | Akinesia | FAERS: 1 | US FAERS | |
| 1536 | Aldolase increased | FAERS: 1 | US FAERS | |
| 1537 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 1538 | Alveolar bone resorption | FAERS: 1 | US FAERS | |
| 1539 | Alveolitis | FAERS: 1 | US FAERS | |
| 1540 | Amnestic Disorder | FAERS: 1 | US FAERS | |
| 1541 | Anal Fistula | FAERS: 1 | US FAERS | |
| 1542 | Anal abscess | FAERS: 1 | US FAERS | |
| 1543 | Anal sphincter hypertonia | FAERS: 1 | US FAERS | |
| 1544 | Analgesic intervention supportive therapy | FAERS: 1 | US FAERS | |
| 1545 | Ankle reconstruction | FAERS: 1 | US FAERS | |
| 1546 | Anorectal operation | FAERS: 1 | US FAERS | |
| 1547 | Anorexia Nervosa | FAERS: 1 | US FAERS | |
| 1548 | Anoxic Encephalopathy | FAERS: 1 | US FAERS | |
| 1549 | Anticholinergic Syndrome | FAERS: 1 | US FAERS | |
| 1550 | Anticonvulsant drug level increased | FAERS: 1 | US FAERS | |
| 1551 | Antitussive therapy | FAERS: 1 | US FAERS | |
| 1552 | Aortic anastomosis | FAERS: 1 | US FAERS | |
| 1553 | Application site coldness | FAERS: 1 | US FAERS | |
| 1554 | Application site erythema | FAERS: 1 | US FAERS | |
| 1555 | Application site irritation | FAERS: 1 | US FAERS | |
| 1556 | Application site pruritus | FAERS: 1 | US FAERS | |
| 1557 | Application site reaction | FAERS: 1 | US FAERS | |
| 1558 | Application site warmth | FAERS: 1 | US FAERS | |
| 1559 | Arterial bypass operation | FAERS: 1 | US FAERS | |
| 1560 | Arteriogram | FAERS: 1 | US FAERS | |
| 1561 | Arthroscopy | FAERS: 1 | US FAERS | |
| 1562 | Aspergillosis | FAERS: 1 | US FAERS | |
| 1563 | Ataxia | FAERS: 1 | US FAERS | |
| 1564 | Atrial hypertrophy | FAERS: 1 | US FAERS | |
| 1565 | Atrial tachycardia | FAERS: 1 | US FAERS | |
| 1566 | Atrial thrombosis | FAERS: 1 | US FAERS | |
| 1567 | Atrophic vulvovaginitis | FAERS: 1 | US FAERS | |
| 1568 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 1569 | Aversion | FAERS: 1 | US FAERS | |
| 1570 | Avulsion fracture | FAERS: 1 | US FAERS | |
| 1571 | B-cell lymphoma recurrent | FAERS: 1 | US FAERS | |
| 1572 | B-cell lymphoma stage IV | FAERS: 1 | US FAERS | |
| 1573 | Bacteria sputum identified | FAERS: 1 | US FAERS | |
| 1574 | Bacterial pyelonephritis | FAERS: 1 | US FAERS | |
| 1575 | Bacteriuria | FAERS: 1 | US FAERS | |
| 1576 | Behavioural and psychiatric symptoms of dementia | FAERS: 1 | US FAERS | |
| 1577 | Benign anorectal neoplasm | FAERS: 1 | US FAERS | |
| 1578 | Benign neoplasm of bladder | FAERS: 1 | US FAERS | |
| 1579 | Benign neoplasm of skin | FAERS: 1 | US FAERS | |
| 1580 | Benign vascular neoplasm | FAERS: 1 | US FAERS | |
| 1581 | Bile Duct Stenosis | FAERS: 1 | US FAERS | |
| 1582 | Bile duct stent insertion | FAERS: 1 | US FAERS | |
| 1583 | Bile output | FAERS: 1 | US FAERS | |
| 1584 | Bile output decreased | FAERS: 1 | US FAERS | |
| 1585 | Biopsy bone abnormal | FAERS: 1 | US FAERS | |
| 1586 | Biopsy bone marrow abnormal | FAERS: 1 | US FAERS | |
| 1587 | Bladder calculus removal | FAERS: 1 | US FAERS | |
| 1588 | Bladder cancer recurrent | FAERS: 1 | US FAERS | |
| 1589 | Bladder cyst | FAERS: 1 | US FAERS | |
| 1590 | Bladder dysfunction | FAERS: 1 | US FAERS | |
| 1591 | Bladder neck suspension | FAERS: 1 | US FAERS | |
| 1592 | Bladder papilloma | FAERS: 1 | US FAERS | |
| 1593 | Bladder polypectomy | FAERS: 1 | US FAERS | |
| 1594 | Blood 1,25-dihydroxycholecalciferol increased | FAERS: 1 | US FAERS | |
| 1595 | Blood Pressure | FAERS: 1 | US FAERS | |
| 1596 | Blood acid phosphatase increased | FAERS: 1 | US FAERS | |
| 1597 | Blood aldosterone increased | FAERS: 1 | US FAERS | |
| 1598 | Blood antidiuretic hormone increased | FAERS: 1 | US FAERS | |
| 1599 | Blood chromogranin A increased | FAERS: 1 | US FAERS | |
| 1600 | Blood cortisol abnormal | FAERS: 1 | US FAERS | |
| 1601 | Blood creatine abnormal | FAERS: 1 | US FAERS | |
| 1602 | Blood creatine phosphokinase MB abnormal | FAERS: 1 | US FAERS | |
| 1603 | Blood creatine phosphokinase decreased | FAERS: 1 | US FAERS | |
| 1604 | Blood folate increased | FAERS: 1 | US FAERS | |
| 1605 | Blood follicle stimulating hormone abnormal | FAERS: 1 | US FAERS | |
| 1606 | Blood gases abnormal | FAERS: 1 | US FAERS | |
| 1607 | Blood growth hormone increased | FAERS: 1 | US FAERS | |
| 1608 | Blood homocysteine increased | FAERS: 1 | US FAERS | |
| 1609 | Blood human chorionic gonadotropin positive | FAERS: 1 | US FAERS | |
| 1610 | Blood immunoglobulin A increased | FAERS: 1 | US FAERS | |
| 1611 | Blood immunoglobulin E | FAERS: 1 | US FAERS | |
| 1612 | Blood immunoglobulin G decreased | FAERS: 1 | US FAERS | |
| 1613 | Blood lactate dehydrogenase | FAERS: 1 | US FAERS | |
| 1614 | Blood magnesium abnormal | FAERS: 1 | US FAERS | |
| 1615 | Blood mercury abnormal | FAERS: 1 | US FAERS | |
| 1616 | Blood pH abnormal | FAERS: 1 | US FAERS | |
| 1617 | Blood pH increased | FAERS: 1 | US FAERS | |
| 1618 | Blood parathyroid hormone | FAERS: 1 | US FAERS | |
| 1619 | Blood phosphorus | FAERS: 1 | US FAERS | |
| 1620 | Blood pressure ambulatory increased | FAERS: 1 | US FAERS | |
| 1621 | Blood pressure orthostatic decreased | FAERS: 1 | US FAERS | |
| 1622 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 1623 | Blood triglycerides decreased | FAERS: 1 | US FAERS | |
| 1624 | Blood urea nitrogen/creatinine ratio increased | FAERS: 1 | US FAERS | |
| 1625 | Blood uric acid abnormal | FAERS: 1 | US FAERS | |
| 1626 | Bloody airway discharge | FAERS: 1 | US FAERS | |
| 1627 | Body height abnormal | FAERS: 1 | US FAERS | |
| 1628 | Bone atrophy | FAERS: 1 | US FAERS | |
| 1629 | Bone callus excessive | FAERS: 1 | US FAERS | |
| 1630 | Bone decalcification | FAERS: 1 | US FAERS | |
| 1631 | Bone infarction | FAERS: 1 | US FAERS | |
| 1632 | Bone marrow depression | FAERS: 1 | US FAERS | |
| 1633 | Brain Abscess | FAERS: 1 | US FAERS | |
| 1634 | Brain Contusion | FAERS: 1 | US FAERS | |
| 1635 | Brain Hypoxia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1636 | Breakthrough Pain | FAERS: 1 | US FAERS | |
| 1637 | Breast complication associated with device | FAERS: 1 | US FAERS | |
| 1638 | Breast necrosis | FAERS: 1 | US FAERS | |
| 1639 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 1640 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 1641 | Buccal mucosal roughening | FAERS: 1 | US FAERS | |
| 1642 | Bulbar palsy | FAERS: 1 | US FAERS | |
| 1643 | Burning Mouth Syndrome | FAERS: 1 | US FAERS | |
| 1644 | Caffeine consumption | FAERS: 1 | US FAERS | |
| 1645 | Carbohydrate antigen 19-9 increased | FAERS: 1 | US FAERS | |
| 1646 | Carbohydrate antigen 27.29 increased | FAERS: 1 | US FAERS | |
| 1647 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 1648 | Cardiac infection | FAERS: 1 | US FAERS | |
| 1649 | Cardiac monitoring | FAERS: 1 | US FAERS | |
| 1650 | Carotidynia | FAERS: 1 | US FAERS | |
| 1651 | Cartilage atrophy | FAERS: 1 | US FAERS | |
| 1652 | Cataract operation complication | FAERS: 1 | US FAERS | |
| 1653 | Catheter related complication | FAERS: 1 | US FAERS | |
| 1654 | Caustic injury | FAERS: 1 | US FAERS | |
| 1655 | Cell Death | FAERS: 1 | US FAERS | |
| 1656 | Central Nervous System Infection | FAERS: 1 | US FAERS | |
| 1657 | Central line infection | FAERS: 1 | US FAERS | |
| 1658 | Cerebellar embolism | FAERS: 1 | US FAERS | |
| 1659 | Cerebellar infarction | FAERS: 1 | US FAERS | |
| 1660 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 1661 | Cerebral cyst | FAERS: 1 | US FAERS | |
| 1662 | Cervical dysplasia | FAERS: 1 | US FAERS | |
| 1663 | Cervix carcinoma stage IV | FAERS: 1 | US FAERS | |
| 1664 | Chloropsia | FAERS: 1 | US FAERS | |
| 1665 | Cholelithotomy | FAERS: 1 | US FAERS | |
| 1666 | Chondromatosis | FAERS: 1 | US FAERS | |
| 1667 | Chronic Spontaneous Urticaria | FAERS: 1 | US FAERS | |
| 1668 | Chronic pigmented purpura | FAERS: 1 | US FAERS | |
| 1669 | Clonus | FAERS: 1 | US FAERS | |
| 1670 | Clostridium difficile sepsis | FAERS: 1 | US FAERS | |
| 1671 | Clostridium test positive | FAERS: 1 | US FAERS | |
| 1672 | Colonic fistula | FAERS: 1 | US FAERS | |
| 1673 | Colonoscopy abnormal | FAERS: 1 | US FAERS | |
| 1674 | Complication associated with device | FAERS: 1 | US FAERS | |
| 1675 | Complications of transplant surgery | FAERS: 1 | US FAERS | |
| 1676 | Compulsive hoarding | FAERS: 1 | US FAERS | |
| 1677 | Conduct Disorder | FAERS: 1 | US FAERS | |
| 1678 | Congenital mitochondrial cytopathy | FAERS: 1 | US FAERS | |
| 1679 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 1680 | Convalescent | FAERS: 1 | US FAERS | |
| 1681 | Cor pulmonale | FAERS: 1 | US FAERS | |
| 1682 | Corneal Perforation | FAERS: 1 | US FAERS | |
| 1683 | Corneal Ulcer | FAERS: 1 | US FAERS | |
| 1684 | Corneal graft rejection | FAERS: 1 | US FAERS | |
| 1685 | Coronary angioplasty | FAERS: 1 | US FAERS | |
| 1686 | Cranioplasty | FAERS: 1 | US FAERS | |
| 1687 | Croup infectious | FAERS: 1 | US FAERS | |
| 1688 | Cryotherapy | FAERS: 1 | US FAERS | |
| 1689 | Cutaneous lymphoma | FAERS: 1 | US FAERS | |
| 1690 | Cutis Laxa | FAERS: 1 | US FAERS | |
| 1691 | Cystine urine present | FAERS: 1 | US FAERS | |
| 1692 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 1693 | Cytomegalovirus enterocolitis | FAERS: 1 | US FAERS | |
| 1694 | Death of child | FAERS: 1 | US FAERS | |
| 1695 | Death of relative | FAERS: 1 | US FAERS | |
| 1696 | Dehydroepiandrosterone decreased | FAERS: 1 | US FAERS | |
| 1697 | Delayed delivery | FAERS: 1 | US FAERS | |
| 1698 | Delusional perception | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1699 | Dental alveolar anomaly | FAERS: 1 | US FAERS | |
| 1700 | Dental cleaning | FAERS: 1 | US FAERS | |
| 1701 | Dental examination abnormal | FAERS: 1 | US FAERS | |
| 1702 | Dental examination | FAERS: 1 | US FAERS | |
| 1703 | Dental prosthesis user | FAERS: 1 | US FAERS | |
| 1704 | Deoxypyridinoline urine increased | FAERS: 1 | US FAERS | |
| 1705 | Dependence | FAERS: 1 | US FAERS | |
| 1706 | Deposit eye | FAERS: 1 | US FAERS | |
| 1707 | Device allergy | FAERS: 1 | US FAERS | |
| 1708 | Device electrical finding | FAERS: 1 | US FAERS | |
| 1709 | Device expulsion | FAERS: 1 | US FAERS | |
| 1710 | Device fastener issue | FAERS: 1 | US FAERS | |
| 1711 | Device interaction | FAERS: 1 | US FAERS | |
| 1712 | Device material issue | FAERS: 1 | US FAERS | |
| 1713 | Device operational issue | FAERS: 1 | US FAERS | |
| 1714 | Device used for unapproved schedule | FAERS: 1 | US FAERS | |
| 1715 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 1716 | Diaphragmatic Hernia | FAERS: 1 | US FAERS | |
| 1717 | Diastolic hypertension | FAERS: 1 | US FAERS | |
| 1718 | Diffuse Large B-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 1719 | Disease prodromal stage | FAERS: 1 | US FAERS | |
| 1720 | Dissociative Identity Disorder | FAERS: 1 | US FAERS | |
| 1721 | Drooping shoulder syndrome | FAERS: 1 | US FAERS | |
| 1722 | Drug Dependence | FAERS: 1 | US FAERS | |
| 1723 | Drug dose omission by device | FAERS: 1 | US FAERS | |
| 1724 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 1725 | Drug level increased | FAERS: 1 | US FAERS | |
| 1726 | Drug monitoring procedure not performed | FAERS: 1 | US FAERS | |
| 1727 | Drug screen positive | FAERS: 1 | US FAERS | |
| 1728 | Drug specific antibody present | FAERS: 1 | US FAERS | |
| 1729 | Drug toxicity | FAERS: 1 | US FAERS | |
| 1730 | Dry gangrene | FAERS: 1 | US FAERS | |
| 1731 | Duodenal perforation | FAERS: 1 | US FAERS | |
| 1732 | Duodenal ulcer perforation | FAERS: 1 | US FAERS | |
| 1733 | Dyschezia | FAERS: 1 | US FAERS | |
| 1734 | Dysmorphism | FAERS: 1 | US FAERS | |
| 1735 | Dysplasia | FAERS: 1 | US FAERS | |
| 1736 | Dyspnoea exacerbated | FAERS: 1 | US FAERS | |
| 1737 | Ear tube insertion | FAERS: 1 | US FAERS | |
| 1738 | Echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 1739 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 1740 | Elevated mood | FAERS: 1 | US FAERS | |
| 1741 | Emotional poverty | FAERS: 1 | US FAERS | |
| 1742 | Endometrial disorder | FAERS: 1 | US FAERS | |
| 1743 | Endometrial thickening | FAERS: 1 | US FAERS | |
| 1744 | Endoscopy abnormal | FAERS: 1 | US FAERS | |
| 1745 | Enteral Nutrition | FAERS: 1 | US FAERS | |
| 1746 | Enteropathy-Associated T-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 1747 | Ependymoma | FAERS: 1 | US FAERS | |
| 1748 | Epinephrine increased | FAERS: 1 | US FAERS | |
| 1749 | Episcleritis | FAERS: 1 | US FAERS | |
| 1750 | Erosive Duodenitis | FAERS: 1 | US FAERS | |
| 1751 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 1752 | Erythromelalgia | FAERS: 1 | US FAERS | |
| 1753 | Exercise capacity decreased | FAERS: 1 | US FAERS | |
| 1754 | Exophthalmos | FAERS: 1 | US FAERS | |
| 1755 | Exposure to allergen | FAERS: 1 | US FAERS | |
| 1756 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 1757 | Extravasation | FAERS: 1 | US FAERS | |
| 1758 | Eye Burns | FAERS: 1 | US FAERS | |
| 1759 | Eye allergy | FAERS: 1 | US FAERS | |
| 1760 | Eye complication associated with device | FAERS: 1 | US FAERS | |
| 1761 | Eye excision | FAERS: 1 | US FAERS | |
| 1762 | Eye muscle operation | FAERS: 1 | US FAERS | |
| 1763 | Eye prosthesis insertion | FAERS: 1 | US FAERS | |
| 1764 | Eyelash thickening | FAERS: 1 | US FAERS | |
| 1765 | Eyelid infection | FAERS: 1 | US FAERS | |
| 1766 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 1767 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 1768 | Eyelid pain | FAERS: 1 | US FAERS | |
| 1769 | Face Lift | FAERS: 1 | US FAERS | |
| 1770 | Facial asymmetry | FAERS: 1 | US FAERS | |
| 1771 | Factor V Leiden mutation | FAERS: 1 | US FAERS | |
| 1772 | False positive laboratory result | FAERS: 1 | US FAERS | |
| 1773 | Familial Mediterranean Fever | FAERS: 1 | US FAERS | |
| 1774 | Familial Tremor | FAERS: 1 | US FAERS | |
| 1775 | Fasciitis | FAERS: 1 | US FAERS | |
| 1776 | Female Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 1777 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 1778 | Fibroadenoma of breast | FAERS: 1 | US FAERS | |
| 1779 | Fibromatosis | FAERS: 1 | US FAERS | |
| 1780 | Fistula repair | FAERS: 1 | US FAERS | |
| 1781 | Flat affect | FAERS: 1 | US FAERS | |
| 1782 | Flight of ideas | FAERS: 1 | US FAERS | |
| 1783 | Focal Nodular Hyperplasia | FAERS: 1 | US FAERS | |
| 1784 | Folliculitis | FAERS: 1 | US FAERS | |
| 1785 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 1786 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 1787 | Gastric dysplasia | FAERS: 1 | US FAERS | |
| 1788 | Gastric hypertonia | FAERS: 1 | US FAERS | |
| 1789 | Gastric outlet obstruction | FAERS: 1 | US FAERS | |
| 1790 | Gastric polypectomy | FAERS: 1 | US FAERS | |
| 1791 | Gastrointestinal cancer metastatic | FAERS: 1 | US FAERS | |
| 1792 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 1793 | Gastrointestinal stenosis | FAERS: 1 | US FAERS | |
| 1794 | Gastrointestinal stoma complication | FAERS: 1 | US FAERS | |
| 1795 | Gastrostomy | FAERS: 1 | US FAERS | |
| 1796 | General physical condition | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1797 | Genital pain | FAERS: 1 | US FAERS | |
| 1798 | Genitalia external painful | FAERS: 1 | US FAERS | |
| 1799 | Gingival Hypertrophy | FAERS: 1 | US FAERS | |
| 1800 | Gingival erythema | FAERS: 1 | US FAERS | |
| 1801 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 1802 | Global Amnesia | FAERS: 1 | US FAERS | |
| 1803 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 1804 | Graft infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1805 | Haematinuria | FAERS: 1 | US FAERS | |
| 1806 | Haematotoxicity | FAERS: 1 | US FAERS | |
| 1807 | Hair metal test | FAERS: 1 | US FAERS | |
| 1808 | Hair metal test abnormal | FAERS: 1 | US FAERS | |
| 1809 | Hamartoma | FAERS: 1 | US FAERS | |
| 1810 | Head Banging | FAERS: 1 | US FAERS | |
| 1811 | Head circumference abnormal | FAERS: 1 | US FAERS | |
| 1812 | Heart alternation | FAERS: 1 | US FAERS | |
| 1813 | Hemiplegic migraine | FAERS: 1 | US FAERS | |
| 1814 | Hepatic cancer stage IV | FAERS: 1 | US FAERS | |
| 1815 | Hepatic enzyme decreased | FAERS: 1 | US FAERS | |
| 1816 | Hepatic vein dilatation | FAERS: 1 | US FAERS | |
| 1817 | Hepatitis A | FAERS: 1 | US FAERS | |
| 1818 | Hepatitis C RNA increased | FAERS: 1 | US FAERS | |
| 1819 | Hepatitis C virus test positive | FAERS: 1 | US FAERS | |
| 1820 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 1821 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 1822 | Herpes dermatitis | FAERS: 1 | US FAERS | |
| 1823 | Hiatus hernia, obstructive | FAERS: 1 | US FAERS | |
| 1824 | High frequency ablation | FAERS: 1 | US FAERS | |
| 1825 | Hip swelling | FAERS: 1 | US FAERS | |
| 1826 | Histrionic Personality Disorder | FAERS: 1 | US FAERS | |
| 1827 | Human Ehrlichiosis | FAERS: 1 | US FAERS | |
| 1828 | Hypercapnia | FAERS: 1 | US FAERS | |
| 1829 | Hypercreatinaemia | FAERS: 1 | US FAERS | |
| 1830 | Hypercreatininaemia | FAERS: 1 | US FAERS | |
| 1831 | Hypermobility syndrome | FAERS: 1 | US FAERS | |
| 1832 | Hyperpituitarism | FAERS: 1 | US FAERS | |
| 1833 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 1834 | Hypertensive heart disease | FAERS: 1 | US FAERS | |
| 1835 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 1836 | Hyperviscosity syndrome | FAERS: 1 | US FAERS | |
| 1837 | Hypervitaminosis | FAERS: 1 | US FAERS | |
| 1838 | Hypomania | FAERS: 1 | US FAERS | |
| 1839 | Hypopharyngeal Cancer | FAERS: 1 | US FAERS | |
| 1840 | Hypoventilation | FAERS: 1 | US FAERS | |
| 1841 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 1842 | Idiosyncratic drug reaction | FAERS: 1 | US FAERS | |
| 1843 | Illness anxiety disorder | FAERS: 1 | US FAERS | |
| 1844 | Immediate post-injection reaction | FAERS: 1 | US FAERS | |
| 1845 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 1846 | Immunoglobulin Therapy | FAERS: 1 | US FAERS | |
| 1847 | Immunoglobulins abnormal | FAERS: 1 | US FAERS | |
| 1848 | Immunology test abnormal | FAERS: 1 | US FAERS | |
| 1849 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 1850 | Implant site cyst | FAERS: 1 | US FAERS | |
| 1851 | Implant site extravasation | FAERS: 1 | US FAERS | |
| 1852 | Implant site pain | FAERS: 1 | US FAERS | |
| 1853 | Implant site scar | FAERS: 1 | US FAERS | |
| 1854 | Implant site swelling | FAERS: 1 | US FAERS | |
| 1855 | Implantable cardiac monitor insertion | FAERS: 1 | US FAERS | |
| 1856 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 1857 | Incision site erythema | FAERS: 1 | US FAERS | |
| 1858 | Incision site vesicles | FAERS: 1 | US FAERS | |
| 1859 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 1860 | Infected bite | FAERS: 1 | US FAERS | |
| 1861 | Infected cyst | FAERS: 1 | US FAERS | |
| 1862 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 1863 | Infective glossitis | FAERS: 1 | US FAERS | |
| 1864 | Infestation | FAERS: 1 | US FAERS | |
| 1865 | Infusion site bruising | FAERS: 1 | US FAERS | |
| 1866 | Inguinal mass | FAERS: 1 | US FAERS | |
| 1867 | Inhibitory drug interaction | FAERS: 1 | US FAERS | |
| 1868 | Injection site cyst | FAERS: 1 | US FAERS | |
| 1869 | Injection site nerve damage | FAERS: 1 | US FAERS | |
| 1870 | Injection site pallor | FAERS: 1 | US FAERS | |
| 1871 | Injection site thrombosis | FAERS: 1 | US FAERS | |
| 1872 | Injury asphyxiation | FAERS: 1 | US FAERS | |
| 1873 | Instillation site coldness | FAERS: 1 | US FAERS | |
| 1874 | Insulin-like growth factor decreased | FAERS: 1 | US FAERS | |
| 1875 | Intentional device use issue | FAERS: 1 | US FAERS | |
| 1876 | Interleukin-2 receptor increased | FAERS: 1 | US FAERS | |
| 1877 | Internal injury | FAERS: 1 | US FAERS | |
| 1878 | Intestinal congestion | FAERS: 1 | US FAERS | |
| 1879 | Intestinal polypectomy | FAERS: 1 | US FAERS | |
| 1880 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 1881 | Intra-cerebral aneurysm operation | FAERS: 1 | US FAERS | |
| 1882 | Intraductal papillary-mucinous carcinoma of pancreas | FAERS: 1 | US FAERS | |
| 1883 | Intrathecal pump insertion | FAERS: 1 | US FAERS | |
| 1884 | Invasive Lobular Breast Carcinoma | FAERS: 1 | US FAERS | |
| 1885 | Iris vascular disorder | FAERS: 1 | US FAERS | |
| 1886 | Irregular breathing | FAERS: 1 | US FAERS | |
| 1887 | Irregular sleep phase | FAERS: 1 | US FAERS | |
| 1888 | Joint abscess | FAERS: 1 | US FAERS | |
| 1889 | Joint prosthesis user | FAERS: 1 | US FAERS | |
| 1890 | Koilonychia | FAERS: 1 | US FAERS | |
| 1891 | Lack of administration site rotation | FAERS: 1 | US FAERS | |
| 1892 | Lack of injection site rotation | FAERS: 1 | US FAERS | |
| 1893 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 1894 | Large cell carcinoma of the respiratory tract stage unspecified | FAERS: 1 | US FAERS | |
| 1895 | Laser Therapy | FAERS: 1 | US FAERS | |
| 1896 | Latent Tuberculosis | FAERS: 1 | US FAERS | |
| 1897 | Latex allergy | FAERS: 1 | US FAERS | |
| 1898 | Lemmel's syndrome | FAERS: 1 | US FAERS | |
| 1899 | Leukoplakia | FAERS: 1 | US FAERS | |
| 1900 | Light chain disease | FAERS: 1 | US FAERS | |
| 1901 | Lipomatosis | FAERS: 1 | US FAERS | |
| 1902 | Lithiasis | FAERS: 1 | US FAERS | |
| 1903 | Liver Abscess | FAERS: 1 | US FAERS | |
| 1904 | Loss of dreaming | FAERS: 1 | US FAERS | |
| 1905 | Low turnover osteopathy | FAERS: 1 | US FAERS | |
| 1906 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 1907 | Lower respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 1908 | Lumbar hernia | FAERS: 1 | US FAERS | |
| 1909 | Lung carcinoma cell type unspecified stage I | FAERS: 1 | US FAERS | |
| 1910 | Lung consolidation | FAERS: 1 | US FAERS | |
| 1911 | Lung infection pseudomonal | FAERS: 1 | US FAERS | |
| 1912 | Lung perforation | FAERS: 1 | US FAERS | |
| 1913 | Lung squamous cell carcinoma stage III | FAERS: 1 | US FAERS | |
| 1914 | Lung transplant rejection | FAERS: 1 | US FAERS | |
| 1915 | Lymph nodes scan abnormal | FAERS: 1 | US FAERS | |
| 1916 | Lymphangitis | FAERS: 1 | US FAERS | |
| 1917 | Lymphatic system neoplasm | FAERS: 1 | US FAERS | |
| 1918 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 1919 | Macrogenia | FAERS: 1 | US FAERS | |
| 1920 | Macule | FAERS: 1 | US FAERS | |
| 1921 | Magnesium Deficiency | FAERS: 1 | US FAERS | |
| 1922 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 1923 | Malignant ascites | FAERS: 1 | US FAERS | |
| 1924 | Malignant lymphoid neoplasm | FAERS: 1 | US FAERS | |
| 1925 | Malignant melanoma in situ | FAERS: 1 | US FAERS | |
| 1926 | Malignant melanoma of eyelid | FAERS: 1 | US FAERS | |
| 1927 | Malignant melanoma of sites other than skin | FAERS: 1 | US FAERS | |
| 1928 | Malignant neoplasm of thorax | FAERS: 1 | US FAERS | |
| 1929 | Manufacturing product storage issue | FAERS: 1 | US FAERS | |
| 1930 | Mastitis | FAERS: 1 | US FAERS | |
| 1931 | Mastocytic enterocolitis | FAERS: 1 | US FAERS | |
| 1932 | Mastoiditis | FAERS: 1 | US FAERS | |
| 1933 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 1934 | Measles | FAERS: 1 | US FAERS | |
| 1935 | Medical device site pain | FAERS: 1 | US FAERS | |
| 1936 | Medical device site reaction | FAERS: 1 | US FAERS | |
| 1937 | Medical diet | FAERS: 1 | US FAERS | |
| 1938 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 1939 | Meningioma surgery | FAERS: 1 | US FAERS | |
| 1940 | Meniscus operation | FAERS: 1 | US FAERS | |
| 1941 | Meniscus removal | FAERS: 1 | US FAERS | |
| 1942 | Mental Retardation | FAERS: 1 | US FAERS | |
| 1943 | Mesothelioma | FAERS: 1 | US FAERS | |
| 1944 | Microlithiasis | FAERS: 1 | US FAERS | |
| 1945 | Mixed Connective Tissue Disease | FAERS: 1 | US FAERS | |
| 1946 | Mouth Breathing | FAERS: 1 | US FAERS | |
| 1947 | Mouth cyst | FAERS: 1 | US FAERS | |
| 1948 | Mucosal atrophy | FAERS: 1 | US FAERS | |
| 1949 | Multiple Chemical Sensitivity | FAERS: 1 | US FAERS | |
| 1950 | Multiple use of single-use product | FAERS: 1 | US FAERS | |
| 1951 | Mumps | FAERS: 1 | US FAERS | |
| 1952 | Muscle enzyme | FAERS: 1 | US FAERS | |
| 1953 | Muscular Dystrophy | FAERS: 1 | US FAERS | |
| 1954 | Myasthenic Syndrome | FAERS: 1 | US FAERS | |
| 1955 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 1956 | Myelofibrosis | FAERS: 1 | US FAERS | |
| 1957 | Myeloid Metaplasia | FAERS: 1 | US FAERS | |
| 1958 | Myeloma recurrence | FAERS: 1 | US FAERS | |
| 1959 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 1960 | Myosclerosis | FAERS: 1 | US FAERS | |
| 1961 | Nail bed tenderness | FAERS: 1 | US FAERS | |
| 1962 | Nail discomfort | FAERS: 1 | US FAERS | |
| 1963 | Nail growth cessation | FAERS: 1 | US FAERS | |
| 1964 | Nasal Flaring | FAERS: 1 | US FAERS | |
| 1965 | Near Drowning | FAERS: 1 | US FAERS | |
| 1966 | Nephrogenic Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 1967 | Neurilemmoma | FAERS: 1 | US FAERS | |
| 1968 | Neuroblastoma | FAERS: 1 | US FAERS | |
| 1969 | Neurodermatitis | FAERS: 1 | US FAERS | |
| 1970 | Neurogenic Bowel | FAERS: 1 | US FAERS | |
| 1971 | Neuronal neuropathy | FAERS: 1 | US FAERS | |
| 1972 | Neuroprosthesis implantation | FAERS: 1 | US FAERS | |
| 1973 | Neurostimulator removal | FAERS: 1 | US FAERS | |
| 1974 | No adverse reaction | FAERS: 1 | US FAERS | |
| 1975 | Non-small cell lung cancer recurrent | FAERS: 1 | US FAERS | |
| 1976 | Non-small cell lung cancer stage I | FAERS: 1 | US FAERS | |
| 1977 | Noninfective sialoadenitis | FAERS: 1 | US FAERS | |
| 1978 | Norovirus test positive | FAERS: 1 | US FAERS | |
| 1979 | Nuchal Rigidity | FAERS: 1 | US FAERS | |
| 1980 | Nuclear magnetic resonance imaging breast abnormal | FAERS: 1 | US FAERS | |
| 1981 | Obesity surgery | FAERS: 1 | US FAERS | |
| 1982 | Occult blood positive | FAERS: 1 | US FAERS | |
| 1983 | Omphalitis | FAERS: 1 | US FAERS | |
| 1984 | Open reduction of fracture | FAERS: 1 | US FAERS | |
| 1985 | Optic nerve infarction | FAERS: 1 | US FAERS | |
| 1986 | Oral discharge | FAERS: 1 | US FAERS | |
| 1987 | Oral infection | FAERS: 1 | US FAERS | |
| 1988 | Oral viral infection | FAERS: 1 | US FAERS | |
| 1989 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 1990 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 1991 | Orthostatic intolerance | FAERS: 1 | US FAERS | |
| 1992 | Osteitis condensans | FAERS: 1 | US FAERS | |
| 1993 | Osteocalcin | FAERS: 1 | US FAERS | |
| 1994 | Osteochondrosis | FAERS: 1 | US FAERS | |
| 1995 | Osteoma | FAERS: 1 | US FAERS | |
| 1996 | Osteopetrosis | FAERS: 1 | US FAERS | |
| 1997 | Ovarian cancer stage III | FAERS: 1 | US FAERS | |
| 1998 | Oxygen Consumption | FAERS: 1 | US FAERS | |
| 1999 | PO2 decreased | FAERS: 1 | US FAERS | |
| 2000 | Pacemaker generated arrhythmia | FAERS: 1 | US FAERS | |
| 2001 | Pain trauma activated | FAERS: 1 | US FAERS | |
| 2002 | Pancreatic Pseudocyst | FAERS: 1 | US FAERS | |
| 2003 | Pancreatic carcinoma recurrent | FAERS: 1 | US FAERS | |
| 2004 | Pancreatic duct obstruction | FAERS: 1 | US FAERS | |
| 2005 | Pancreatic operation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2006 | Pancreatitis viral | FAERS: 1 | US FAERS | |
| 2007 | Panniculitis | FAERS: 1 | US FAERS | |
| 2008 | Papillary serous endometrial carcinoma | FAERS: 1 | US FAERS | |
| 2009 | Parasitic gastroenteritis | FAERS: 1 | US FAERS | |
| 2010 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 2011 | Pelvic Floor Muscle Weakness | FAERS: 1 | US FAERS | |
| 2012 | Pelvic Inflammatory Disease | FAERS: 1 | US FAERS | |
| 2013 | Pelvic fluid collection | FAERS: 1 | US FAERS | |
| 2014 | Pelvic prolapse | FAERS: 1 | US FAERS | |
| 2015 | Pelvic venous thrombosis | FAERS: 1 | US FAERS | |
| 2016 | Pericoronitis | FAERS: 1 | US FAERS | |
| 2017 | Perineoplasty | FAERS: 1 | US FAERS | |
| 2018 | Periodontal operation | FAERS: 1 | US FAERS | |
| 2019 | Periorbital contusion | FAERS: 1 | US FAERS | |
| 2020 | Periostitis | FAERS: 1 | US FAERS | |
| 2021 | Peripheral occlusive disease | FAERS: 1 | US FAERS | |
| 2022 | Peritoneal cyst | FAERS: 1 | US FAERS | |
| 2023 | Peritoneal hernia | FAERS: 1 | US FAERS | |
| 2024 | Peritonsillar Abscess | FAERS: 1 | US FAERS | |
| 2025 | Personality change due to a general medical condition | FAERS: 1 | US FAERS | |
| 2026 | Physical deconditioning | FAERS: 1 | US FAERS | |
| 2027 | Pituitary cyst | FAERS: 1 | US FAERS | |
| 2028 | Plasma cell myeloma in remission | FAERS: 1 | US FAERS | |
| 2029 | Plasmapheresis | FAERS: 1 | US FAERS | |
| 2030 | Platelet Transfusion | FAERS: 1 | US FAERS | |
| 2031 | Polychondritis | FAERS: 1 | US FAERS | |
| 2032 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 2033 | Positron emission tomogram abnormal | FAERS: 1 | US FAERS | |
| 2034 | Post procedural bile leak | FAERS: 1 | US FAERS | |
| 2035 | Post procedural cellulitis | FAERS: 1 | US FAERS | |
| 2036 | Post procedural discharge | FAERS: 1 | US FAERS | |
| 2037 | Post procedural discomfort | FAERS: 1 | US FAERS | |
| 2038 | Post-traumatic amnestic disorder | FAERS: 1 | US FAERS | |
| 2039 | Post-tussive vomiting | FAERS: 1 | US FAERS | |
| 2040 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 2041 | Postoperative hypotension | FAERS: 1 | US FAERS | |
| 2042 | Postoperative wound complication | FAERS: 1 | US FAERS | |
| 2043 | Postural Orthostatic Tachycardia Syndrome | FAERS: 1 | US FAERS | |
| 2044 | Poverty of speech | FAERS: 1 | US FAERS | |
| 2045 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 2046 | Premenstrual syndrome | FAERS: 1 | US FAERS | |
| 2047 | Presbyopia | FAERS: 1 | US FAERS | |
| 2048 | Pressure of speech | FAERS: 1 | US FAERS | |
| 2049 | Procalcitonin increased | FAERS: 1 | US FAERS | |
| 2050 | Procedural hypotension | FAERS: 1 | US FAERS | |
| 2051 | Procedural nausea | FAERS: 1 | US FAERS | |
| 2052 | Proctitis | FAERS: 1 | US FAERS | |
| 2053 | Product administration error | FAERS: 1 | US FAERS | |
| 2054 | Product availability issue | FAERS: 1 | US FAERS | |
| 2055 | Product container issue | FAERS: 1 | US FAERS | |
| 2056 | Product contamination physical | FAERS: 1 | US FAERS | |
| 2057 | Product dispensing error | FAERS: 1 | US FAERS | |
| 2058 | Product lot number issue | FAERS: 1 | US FAERS | |
| 2059 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 2060 | Product residue present | FAERS: 1 | US FAERS | |
| 2061 | Product tampering | FAERS: 1 | US FAERS | |
| 2062 | Product use complaint | FAERS: 1 | US FAERS | |
| 2063 | Prolapse repair | FAERS: 1 | US FAERS | |
| 2064 | Prostate cancer recurrent | FAERS: 1 | US FAERS | |
| 2065 | Prostatectomy | FAERS: 1 | US FAERS | |
| 2066 | Prostatic Adenoma | FAERS: 1 | US FAERS | |
| 2067 | Pseudohyperkalaemia | FAERS: 1 | US FAERS | |
| 2068 | Psychological Trauma | FAERS: 1 | US FAERS | |
| 2069 | Psychotic symptom | FAERS: 1 | US FAERS | |
| 2070 | Pterygium | FAERS: 1 | US FAERS | |
| 2071 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 2072 | Pulmonary Valve Stenosis | FAERS: 1 | US FAERS | |
| 2073 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 2074 | Pulmonary granuloma | FAERS: 1 | US FAERS | |
| 2075 | Pulmonary radiation injury | FAERS: 1 | US FAERS | |
| 2076 | Pulmonary sepsis | FAERS: 1 | US FAERS | |
| 2077 | Pyloric Stenosis | FAERS: 1 | US FAERS | |
| 2078 | Pyoderma | FAERS: 1 | US FAERS | |
| 2079 | Quadriplegia | FAERS: 1 | US FAERS | |
| 2080 | Quadruple vessel bypass graft | FAERS: 1 | US FAERS | |
| 2081 | Radiation injury | FAERS: 1 | US FAERS | |
| 2082 | Radiation skin injury | FAERS: 1 | US FAERS | |
| 2083 | Reaction to food additive | FAERS: 1 | US FAERS | |
| 2084 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 2085 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 2086 | Reduced facial expression | FAERS: 1 | US FAERS | |
| 2087 | Reflux laryngitis | FAERS: 1 | US FAERS | |
| 2088 | Renal artery stent placement | FAERS: 1 | US FAERS | |
| 2089 | Renal cancer recurrent | FAERS: 1 | US FAERS | |
| 2090 | Renal hypertension | FAERS: 1 | US FAERS | |
| 2091 | Respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 2092 | Resting Tremor | FAERS: 1 | US FAERS | |
| 2093 | Restrictive pulmonary disease | FAERS: 1 | US FAERS | |
| 2094 | Retinal scar | FAERS: 1 | US FAERS | |
| 2095 | Retinal vascular occlusion | FAERS: 1 | US FAERS | |
| 2096 | Retinitis Pigmentosa | FAERS: 1 | US FAERS | |
| 2097 | Retinopexy | FAERS: 1 | US FAERS | |
| 2098 | Retrograde amnesia | FAERS: 1 | US FAERS | |
| 2099 | Retroperitoneal abscess | FAERS: 1 | US FAERS | |
| 2100 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 2101 | Rickets | FAERS: 1 | US FAERS | |
| 2102 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 2103 | Rocky Mountain Spotted Fever | FAERS: 1 | US FAERS | |
| 2104 | Root canal infection | FAERS: 1 | US FAERS | |
| 2105 | Rubber sensitivity | FAERS: 1 | US FAERS | |
| 2106 | Sacroiliac fracture | FAERS: 1 | US FAERS | |
| 2107 | Salivary gland pain | FAERS: 1 | US FAERS | |
| 2108 | Salmonella sepsis | FAERS: 1 | US FAERS | |
| 2109 | Salt craving | FAERS: 1 | US FAERS | |
| 2110 | Scan bone marrow abnormal | FAERS: 1 | US FAERS | |
| 2111 | Scan lymph nodes | FAERS: 1 | US FAERS | |
| 2112 | Scarlet Fever | FAERS: 1 | US FAERS | |
| 2113 | Sebaceous adenoma | FAERS: 1 | US FAERS | |
| 2114 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 2115 | Serum Sickness | FAERS: 1 | US FAERS | |
| 2116 | Serum serotonin decreased | FAERS: 1 | US FAERS | |
| 2117 | Shock symptom | FAERS: 1 | US FAERS | |
| 2118 | Shunt occlusion | FAERS: 1 | US FAERS | |
| 2119 | Sick relative | FAERS: 1 | US FAERS | |
| 2120 | Sight disability | FAERS: 1 | US FAERS | |
| 2121 | Silent myocardial infarction | FAERS: 1 | US FAERS | |
| 2122 | Simple Partial Seizures | FAERS: 1 | US FAERS | |
| 2123 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 2124 | Skin Erosion | FAERS: 1 | US FAERS | |
| 2125 | Skin graft failure | FAERS: 1 | US FAERS | |
| 2126 | Skin implant removal | FAERS: 1 | US FAERS | |
| 2127 | Skin necrosis | FAERS: 1 | US FAERS | |
| 2128 | Skinfold measurement | FAERS: 1 | US FAERS | |
| 2129 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 2130 | Small intestinal bacterial overgrowth | FAERS: 1 | US FAERS | |
| 2131 | Small intestine carcinoma | FAERS: 1 | US FAERS | |
| 2132 | Smear site unspecified abnormal | FAERS: 1 | US FAERS | |
| 2133 | Somatoform Disorder | FAERS: 1 | US FAERS | |
| 2134 | Spastic paralysis | FAERS: 1 | US FAERS | |
| 2135 | Spinal Stenosis | FAERS: 1 | US FAERS | |
| 2136 | Spinal cord infection | FAERS: 1 | US FAERS | |
| 2137 | Spinal corpectomy | FAERS: 1 | US FAERS | |
| 2138 | Spinal rod insertion | FAERS: 1 | US FAERS | |
| 2139 | Spinal shock | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2140 | Splenectomy | FAERS: 1 | US FAERS | |
| 2141 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 2142 | Splenic Rupture | FAERS: 1 | US FAERS | |
| 2143 | Splenic neoplasm malignancy unspecified | FAERS: 1 | US FAERS | |
| 2144 | Staphylococcal abscess | FAERS: 1 | US FAERS | |
| 2145 | Staphylococcal osteomyelitis | FAERS: 1 | US FAERS | |
| 2146 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 2147 | Stasis dermatitis | FAERS: 1 | US FAERS | |
| 2148 | Status Asthmaticus | FAERS: 1 | US FAERS | |
| 2149 | Stem cell therapy | FAERS: 1 | US FAERS | |
| 2150 | Sternal injury | FAERS: 1 | US FAERS | |
| 2151 | Steroid therapy | FAERS: 1 | US FAERS | |
| 2152 | Strabismus | FAERS: 1 | US FAERS | |
| 2153 | Stress at work | FAERS: 1 | US FAERS | |
| 2154 | Subacute endocarditis | FAERS: 1 | US FAERS | |
| 2155 | Superinfection | FAERS: 1 | US FAERS | |
| 2156 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 2157 | Suspected product tampering | FAERS: 1 | US FAERS | |
| 2158 | Suspected transmission of an infectious agent via product | FAERS: 1 | US FAERS | |
| 2159 | Synovitis | FAERS: 1 | US FAERS | |
| 2160 | T-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 2161 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 2162 | Temperature perception test abnormal | FAERS: 1 | US FAERS | |
| 2163 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 2164 | Thoracic Outlet Syndrome | FAERS: 1 | US FAERS | |
| 2165 | Thoracic cavity drainage | FAERS: 1 | US FAERS | |
| 2166 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 2167 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 2168 | Thrombosed varicose vein | FAERS: 1 | US FAERS | |
| 2169 | Thyroglobulin increased | FAERS: 1 | US FAERS | |
| 2170 | Thyroid calcification | FAERS: 1 | US FAERS | |
| 2171 | Thyroid hormones decreased | FAERS: 1 | US FAERS | |
| 2172 | Tinea cruris | FAERS: 1 | US FAERS | |
| 2173 | Tobacco user | FAERS: 1 | US FAERS | |
| 2174 | Tongue erythema | FAERS: 1 | US FAERS | |
| 2175 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 2176 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 2177 | Torticollis | FAERS: 1 | US FAERS | |
| 2178 | Total cholesterol/HDL ratio increased | FAERS: 1 | US FAERS | |
| 2179 | Toxic Shock Syndrome | FAERS: 1 | US FAERS | |
| 2180 | Trabeculectomy | FAERS: 1 | US FAERS | |
| 2181 | Tracheostomy infection | FAERS: 1 | US FAERS | |
| 2182 | Transfusion related complication | FAERS: 1 | US FAERS | |
| 2183 | Transitional cell cancer of renal pelvis and ureter metastatic | FAERS: 1 | US FAERS | |
| 2184 | Traumatic tooth displacement | FAERS: 1 | US FAERS | |
| 2185 | Triple vessel bypass graft | FAERS: 1 | US FAERS | |
| 2186 | Tryptase increased | FAERS: 1 | US FAERS | |
| 2187 | Tympanoplasty | FAERS: 1 | US FAERS | |
| 2188 | Tympanosclerosis | FAERS: 1 | US FAERS | |
| 2189 | Ultrasound breast abnormal | FAERS: 1 | US FAERS | |
| 2190 | Unexpected therapeutic drug effect | FAERS: 1 | US FAERS | |
| 2191 | Urethral Obstruction | FAERS: 1 | US FAERS | |
| 2192 | Urethral Stenosis | FAERS: 1 | US FAERS | |
| 2193 | Urethral discharge | FAERS: 1 | US FAERS | |
| 2194 | Urge Incontinence | FAERS: 1 | US FAERS | |
| 2195 | Urinary Tract Pain | FAERS: 1 | US FAERS | |
| 2196 | Urinary lipids present | FAERS: 1 | US FAERS | |
| 2197 | Urinary tract infection staphylococcal | FAERS: 1 | US FAERS | |
| 2198 | Urine alcohol test positive | FAERS: 1 | US FAERS | |
| 2199 | Urine bilirubin increased | FAERS: 1 | US FAERS | |
| 2200 | Urine electrophoresis abnormal | FAERS: 1 | US FAERS | |
| 2201 | Urine ketone body present | FAERS: 1 | US FAERS | |
| 2202 | Urine phosphorus increased | FAERS: 1 | US FAERS | |
| 2203 | Uterine spasm | FAERS: 1 | US FAERS | |
| 2204 | Vaccination site pain | FAERS: 1 | US FAERS | |
| 2205 | Vaginal lesion | FAERS: 1 | US FAERS | |
| 2206 | Vaginoplasty | FAERS: 1 | US FAERS | |
| 2207 | Vascular purpura | FAERS: 1 | US FAERS | |
| 2208 | Vascular stenosis | FAERS: 1 | US FAERS | |
| 2209 | Vasculitic rash | FAERS: 1 | US FAERS | |
| 2210 | Vasectomy | FAERS: 1 | US FAERS | |
| 2211 | Venous stasis | FAERS: 1 | US FAERS | |
| 2212 | Venous stent insertion | FAERS: 1 | US FAERS | |
| 2213 | Ventricle rupture | FAERS: 1 | US FAERS | |
| 2214 | Ventricular Flutter | FAERS: 1 | US FAERS | |
| 2215 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 2216 | Vertebral foraminal stenosis | FAERS: 1 | US FAERS | |
| 2217 | Vertebral wedging | FAERS: 1 | US FAERS | |
| 2218 | Very low density lipoprotein abnormal | FAERS: 1 | US FAERS | |
| 2219 | Vesicoureteral reflux surgery | FAERS: 1 | US FAERS | |
| 2220 | Vessel puncture site reaction | FAERS: 1 | US FAERS | |
| 2221 | Vestibular Neuronitis | FAERS: 1 | US FAERS | |
| 2222 | Vibration test abnormal | FAERS: 1 | US FAERS | |
| 2223 | Viral test positive | FAERS: 1 | US FAERS | |
| 2224 | Viral tonsillitis | FAERS: 1 | US FAERS | |
| 2225 | Visceral Pain | FAERS: 1 | US FAERS | |
| 2226 | Visual brightness | FAERS: 1 | US FAERS | |
| 2227 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 2228 | Vitamin B12 abnormal | FAERS: 1 | US FAERS | |
| 2229 | Vitamin B6 increased | FAERS: 1 | US FAERS | |
| 2230 | Vitreous adhesions | FAERS: 1 | US FAERS | |
| 2231 | Vulvovaginal adhesion | FAERS: 1 | US FAERS | |
| 2232 | Vulvovaginal rash | FAERS: 1 | US FAERS | |
| 2233 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 2234 | Water Intoxication | FAERS: 1 | US FAERS | |
| 2235 | West Nile viral infection | FAERS: 1 | US FAERS | |
| 2236 | Whole blood transfusion | FAERS: 1 | US FAERS | |
| 2237 | Wound abscess | FAERS: 1 | US FAERS | |
| 2238 | Wrong schedule | FAERS: 1 | US FAERS | |
| 2239 | angiogram | FAERS: 1 | US FAERS | |
| 2240 | cancer surgery | FAERS: 1 | US FAERS | |
| 2241 | carbuncle | FAERS: 1 | US FAERS | |
| 2242 | intensive care | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2243 | keratoacanthoma | FAERS: 1 | US FAERS | |
| 2244 | neurofibroma | FAERS: 1 | US FAERS | |
| 2245 | prostatitis | FAERS: 1 | US FAERS | |
| 2246 | Acute dyspnea | SIDER | ||
| 2247 | Blood and lymphatic system disorders | SIDER | ||
| 2248 | Cramps of lower extremities | SIDER | ||
| 2249 | Dermatofibrosarcoma Protuberans | Canada Vigilance: 1 | Canada Vigilance | |
| 2250 | Ear and labyrinth disorders | SIDER | ||
| 2251 | Ear, nose and throat examination abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 2252 | Generalized urticaria | SIDER | ||
| 2253 | Low Back Pain | SIDER | ||
| 2254 | Myoclonus | Canada Vigilance: 1 | Canada Vigilance | |
| 2255 | Orofacial oedema | SIDER | ||
| 2256 | Sweating | SIDER | ||
| 2257 | Urolithiasis | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.