Prednisone
(XOFYZVNMUHMLCC-ZPOLXVRWSA-N)
Structure
- SMILES
- OCC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)CC(=O)[C@H]1[C@H]2CCC2=CC(=O)C=C[C@]12C
- Type(s)
- Approved; Vet_approved
- ATC code(s)
- A07EA03; H02AB07
- Molecular Formula:
- C21H26O5
- Molecular Weight:
- 358.428
- Log P:
- 1.7658
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 91.67
- CAS Number(s):
- 53-03-2; 19420
Synonym(s)
1.
Prednisone
2.
Dehydrocortisone
3.
delta-Cortisone
4.
Apo-Prednisone
5.
Cortan
6.
Cortancyl
7.
Cutason
8.
Dacortin
9.
Decortin
10.
Decortisyl
11.
Deltasone
12.
Encorton
13.
Encortone
14.
Enkortolon
15.
Kortancyl
16.
Liquid Pred
17.
Meticorten
18.
Orasone
19.
Panafcort
20.
Panasol
21.
Predni Tablinen
22.
Prednidib
23.
Predniment
24.
Prednison Acsis
25.
Prednison Galen
26.
Prednison Hexal
27.
Pronisone
28.
Rectodelt
29.
Sone
30.
Sterapred
31.
Ultracorten
32.
Winpred
33.
Acsis, Prednison
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 218 Canada Vigilance: 108 | Canada Vigilance US FAERS | |
| 2 | Diabetes Mellitus | FAERS: 81 Canada Vigilance: 12 | CTD SIDER Canada Vigilance US FAERS | |
| 3 | Blood glucose increased | FAERS: 78 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 4 | Headache | FAERS: 71 Canada Vigilance: 12 | 11565520 | CTD SIDER Canada Vigilance US FAERS |
| 5 | Pain | FAERS: 65 Canada Vigilance: 5 | CTD OFFSIDES Canada Vigilance US FAERS | |
| 6 | Fatigue | FAERS: 64 Canada Vigilance: 7 | 8759893 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 7 | Nausea | FAERS: 63 Canada Vigilance: 7 | 5031606 6614043 8759893 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 8 | Osteoporosis | FAERS: 60 Canada Vigilance: 16 | 8176015 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 9 | Anxiety | FAERS: 57 Canada Vigilance: 11 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 10 | Dizziness | FAERS: 57 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 11 | Asthenia | FAERS: 56 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 12 | Vomiting | FAERS: 50 Canada Vigilance: 9 | 5031606 8759893 | CTD SIDER Canada Vigilance US FAERS |
| 13 | Arthralgia | FAERS: 48 Canada Vigilance: 3 | CTD SIDER Canada Vigilance US FAERS | |
| 14 | Chest Pain | FAERS: 45 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 15 | Strongyloidiasis | FAERS: 45 | US FAERS | |
| 16 | Pneumonia | FAERS: 44 Canada Vigilance: 6 | 4850720 | CTD Canada Vigilance US FAERS |
| 17 | Respiratory Failure | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 18 | Weight decreased | FAERS: 40 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 19 | Product quality issue | FAERS: 39 | US FAERS | |
| 20 | Swelling | FAERS: 38 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 21 | Agitation | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 22 | Back Pain | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 23 | Product use in unapproved indication | FAERS: 34 | US FAERS | |
| 24 | Feeling abnormal | FAERS: 33 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 25 | Malaise | FAERS: 33 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 26 | Palpitations | FAERS: 33 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 27 | Sepsis | FAERS: 32 | 3597002 | CTD SIDER US FAERS |
| 28 | Hypersensitivity | FAERS: 30 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 29 | Erythema | FAERS: 29 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 30 | Septic Shock | FAERS: 29 | OFFSIDES US FAERS | |
| 31 | Abdominal Pain | FAERS: 27 Canada Vigilance: 8 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 32 | Alopecia | FAERS: 27 | 5031606 5254045 | CTD SIDER US FAERS |
| 33 | Asthma | FAERS: 26 | CTD OFFSIDES US FAERS | |
| 34 | Mental status changes | FAERS: 26 | OFFSIDES US FAERS | |
| 35 | Memory impairment | FAERS: 25 | SIDER US FAERS | |
| 36 | Tremor | FAERS: 25 Canada Vigilance: 2 | 3544376 8176015 | CTD Canada Vigilance US FAERS |
| 37 | Cataract | FAERS: 24 Canada Vigilance: 4 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 38 | Infection | FAERS: 24 Canada Vigilance: 2 | 3544376 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 39 | Abdominal discomfort | FAERS: 23 Canada Vigilance: 6 | Canada Vigilance OFFSIDES US FAERS | |
| 40 | Urticaria | FAERS: 23 Canada Vigilance: 4 | 15628056 16422373 | CTD SIDER Canada Vigilance US FAERS |
| 41 | Disease recurrence | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 42 | Visual Impairment | FAERS: 22 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 43 | Anger | FAERS: 20 | US FAERS | |
| 44 | Blindness | FAERS: 20 | US FAERS | |
| 45 | Drug Dependence | FAERS: 20 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 46 | Epidural lipomatosis | FAERS: 20 | US FAERS | |
| 47 | Myalgia | FAERS: 20 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 48 | Pruritus | FAERS: 20 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 49 | Tachycardia | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 50 | Hypotension | FAERS: 19 Canada Vigilance: 4 | 3703509 | CTD Canada Vigilance US FAERS |
| 51 | Maternal exposure during pregnancy | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Mood swings | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 53 | Urinary tract infection | FAERS: 18 | US FAERS | |
| 54 | Acne | FAERS: 17 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 55 | Cardiac Arrest | FAERS: 16 | SIDER US FAERS | |
| 56 | Chills | FAERS: 16 | 8759893 | CTD US FAERS |
| 57 | Delirium | FAERS: 16 | 8739013 | CTD SIDER US FAERS |
| 58 | Disease Progression | FAERS: 16 | 1669052 | CTD US FAERS |
| 59 | Dyspepsia | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 60 | Nervousness | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Disorientation | FAERS: 15 | US FAERS | |
| 62 | Osteopenia | FAERS: 15 | OFFSIDES US FAERS | |
| 63 | Peripheral swelling | FAERS: 15 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 64 | treatment failure | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Abasia | FAERS: 14 | OFFSIDES US FAERS | |
| 66 | Myopathy | FAERS: 14 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 67 | Product substitution issue | FAERS: 14 | US FAERS | |
| 68 | Somnolence | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Unevaluable event | FAERS: 14 | US FAERS | |
| 70 | Atrial Fibrillation | FAERS: 13 | US FAERS | |
| 71 | Dysgeusia | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 72 | Encephalitis | FAERS: 13 | US FAERS | |
| 73 | Facial paralysis | FAERS: 13 | US FAERS | |
| 74 | Incorrect dose administered | FAERS: 13 | OFFSIDES US FAERS | |
| 75 | Leukocytosis | FAERS: 13 | SIDER US FAERS | |
| 76 | Mucormycosis | FAERS: 13 | US FAERS | |
| 77 | Musculoskeletal Pain | FAERS: 13 | OFFSIDES US FAERS | |
| 78 | Respiratory distress | FAERS: 13 | US FAERS | |
| 79 | Drug dispensing error | FAERS: 12 | US FAERS | |
| 80 | Drug dose omission | FAERS: 12 | US FAERS | |
| 81 | Guillain-Barre Syndrome | FAERS: 12 | US FAERS | |
| 82 | Hepatitis B | FAERS: 12 | 19575458 | CTD US FAERS |
| 83 | Medication Error | FAERS: 12 | US FAERS | |
| 84 | Sinusitis | FAERS: 12 Canada Vigilance: 1 | 9812131 | CTD OFFSIDES Canada Vigilance US FAERS |
| 85 | Amnesia | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 86 | Arthritis | FAERS: 11 | US FAERS | |
| 87 | Bronchopulmonary Aspergillosis | FAERS: 11 | US FAERS | |
| 88 | Deep Vein Thrombosis | FAERS: 11 | US FAERS | |
| 89 | General physical health deterioration | FAERS: 11 | US FAERS | |
| 90 | Immunosuppression | FAERS: 11 | US FAERS | |
| 91 | Myocardial Infarction | FAERS: 11 | 3597002 | CTD SIDER US FAERS |
| 92 | Skin lesion | FAERS: 11 | OFFSIDES US FAERS | |
| 93 | Activities of daily living impaired | FAERS: 10 | US FAERS | |
| 94 | Acute kidney injury | FAERS: 10 | CTD US FAERS | |
| 95 | Adverse event | FAERS: 10 | US FAERS | |
| 96 | Dementia | FAERS: 10 Canada Vigilance: 1 | 6703100 15728296 | CTD SIDER Canada Vigilance US FAERS |
| 97 | Lethargy | FAERS: 10 | 6937637 | CTD OFFSIDES SIDER US FAERS |
| 98 | Pneumatosis intestinalis | FAERS: 10 | US FAERS | |
| 99 | Pulmonary Embolism | FAERS: 10 | 4746085 19663116 | CTD US FAERS |
| 100 | Rebound effect | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 101 | Suicide attempt | FAERS: 10 | US FAERS | |
| 102 | Arthropathy | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 103 | Dysphonia | FAERS: 9 | OFFSIDES US FAERS | |
| 104 | Flushing | FAERS: 9 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 105 | Hypoxia | FAERS: 9 | US FAERS | |
| 106 | Low birth weight baby | FAERS: 9 | US FAERS | |
| 107 | Musculoskeletal stiffness | FAERS: 9 | OFFSIDES US FAERS | |
| 108 | Shock | FAERS: 9 | SIDER US FAERS | |
| 109 | Syncope | FAERS: 9 | SIDER US FAERS | |
| 110 | Wrong technique in product usage process | FAERS: 9 | US FAERS | |
| 111 | Cellulitis | FAERS: 8 | OFFSIDES US FAERS | |
| 112 | Coccidioidomycosis | FAERS: 8 | US FAERS | |
| 113 | Diplopia | FAERS: 8 | US FAERS | |
| 114 | Eye pain | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 115 | Gait inability | FAERS: 8 | US FAERS | |
| 116 | Glaucoma | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 117 | Inflammation | FAERS: 8 | 7617187 16111148 29408570 | CTD US FAERS |
| 118 | Joint swelling | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 119 | Laceration | FAERS: 8 | US FAERS | |
| 120 | Lipomatosis | FAERS: 8 | US FAERS | |
| 121 | Neck Pain | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 122 | Pancreatitis | FAERS: 8 Canada Vigilance: 1 | 3544376 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 123 | Pneumocystis jiroveci pneumonia | FAERS: 8 | US FAERS | |
| 124 | Posterior reversible encephalopathy syndrome | FAERS: 8 | US FAERS | |
| 125 | Productive Cough | FAERS: 8 | OFFSIDES US FAERS | |
| 126 | Rash erythematous | FAERS: 8 | US FAERS | |
| 127 | Retinal Detachment | FAERS: 8 | US FAERS | |
| 128 | Symptom masked | FAERS: 8 | US FAERS | |
| 129 | Therapy cessation | FAERS: 8 | US FAERS | |
| 130 | Tinnitus | FAERS: 8 Canada Vigilance: 1 | 19415035 | CTD Canada Vigilance US FAERS |
| 131 | Acute respiratory failure | FAERS: 7 | US FAERS | |
| 132 | Blastomycosis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 133 | Blood glucose abnormal | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 134 | Blood glucose decreased | FAERS: 7 | US FAERS | |
| 135 | Blood glucose fluctuation | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 136 | Brain Abscess | FAERS: 7 | 4711275 | CTD US FAERS |
| 137 | Cerebral Infarction | FAERS: 7 | US FAERS | |
| 138 | Chest discomfort | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 139 | Diabetic Ketoacidosis | FAERS: 7 | US FAERS | |
| 140 | Drug withdrawal syndrome | FAERS: 7 | SIDER US FAERS | |
| 141 | Electrolyte imbalance | FAERS: 7 | US FAERS | |
| 142 | Enterococcal infection | FAERS: 7 | US FAERS | |
| 143 | Febrile Neutropenia | FAERS: 7 | SIDER US FAERS | |
| 144 | Human herpesvirus 8 infection | FAERS: 7 | US FAERS | |
| 145 | Lupus Nephritis | FAERS: 7 | 455820 4695164 6508447 | CTD US FAERS |
| 146 | Night sweats | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 147 | Paranoia | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 148 | Pharmaceutical product complaint | FAERS: 7 | US FAERS | |
| 149 | Pneumothorax | FAERS: 7 Canada Vigilance: 1 | 4758799 | CTD Canada Vigilance US FAERS |
| 150 | Skin Ulcer | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Uveitis | FAERS: 7 | US FAERS | |
| 152 | Wheezing | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 153 | jaundice | FAERS: 7 | US FAERS | |
| 154 | Abscess | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 155 | Bone pain | FAERS: 6 | OFFSIDES US FAERS | |
| 156 | Bronchitis | FAERS: 6 | OFFSIDES US FAERS | |
| 157 | Burkholderia cepacia complex infection | FAERS: 6 | US FAERS | |
| 158 | Burning sensation | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 159 | Cerebrovascular accident | FAERS: 6 | US FAERS | |
| 160 | Congenital cytomegalovirus infection | FAERS: 6 | US FAERS | |
| 161 | Constipation | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 162 | Crying | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 163 | Depressed mood | FAERS: 6 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 164 | Dysarthria | FAERS: 6 | US FAERS | |
| 165 | Dyschromatopsia | FAERS: 6 | US FAERS | |
| 166 | Euphoric mood | FAERS: 6 | SIDER US FAERS | |
| 167 | Feeling jittery | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 168 | Flatulence | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 169 | Gastritis | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 170 | Hepatic Encephalopathy | FAERS: 6 | US FAERS | |
| 171 | Impaired work ability | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 172 | Lung hernia | FAERS: 6 | US FAERS | |
| 173 | Metamorphopsia | FAERS: 6 | US FAERS | |
| 174 | Osteomyelitis | FAERS: 6 | OFFSIDES US FAERS | |
| 175 | Peritonitis | FAERS: 6 | US FAERS | |
| 176 | Pleurisy | FAERS: 6 | US FAERS | |
| 177 | Psoriasis | FAERS: 6 | US FAERS | |
| 178 | Rheumatoid Arthritis | FAERS: 6 | US FAERS | |
| 179 | Scleritis | FAERS: 6 | 12427239 | CTD US FAERS |
| 180 | Scleroderma renal crisis | FAERS: 6 | US FAERS | |
| 181 | Steroid withdrawal syndrome | FAERS: 6 | SIDER US FAERS | |
| 182 | Therapeutic response unexpected | FAERS: 6 | US FAERS | |
| 183 | Throat irritation | FAERS: 6 | US FAERS | |
| 184 | Transaminases increased | FAERS: 6 | US FAERS | |
| 185 | Acidosis | FAERS: 5 | OFFSIDES US FAERS | |
| 186 | Angioedema | FAERS: 5 Canada Vigilance: 1 | 18281733 20689124 | CTD SIDER Canada Vigilance US FAERS |
| 187 | Ascites | FAERS: 5 | 6937637 | CTD US FAERS |
| 188 | Back disorder | FAERS: 5 | US FAERS | |
| 189 | Birdshot Chorioretinopathy | FAERS: 5 | US FAERS | |
| 190 | Blood creatinine increased | FAERS: 5 | OFFSIDES US FAERS | |
| 191 | Bone density decreased | FAERS: 5 | OFFSIDES US FAERS | |
| 192 | Chorioretinitis | FAERS: 5 | US FAERS | |
| 193 | Coronary Artery Disease | FAERS: 5 | 10452346 | CTD US FAERS |
| 194 | Cytomegalovirus chorioretinitis | FAERS: 5 | US FAERS | |
| 195 | Discomfort | FAERS: 5 | SIDER US FAERS | |
| 196 | Drug effect incomplete | FAERS: 5 | US FAERS | |
| 197 | Epistaxis | FAERS: 5 | US FAERS | |
| 198 | Escherichia infection | FAERS: 5 | US FAERS | |
| 199 | Folliculitis | FAERS: 5 | US FAERS | |
| 200 | Gastric ulcer | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 201 | Intentional product misuse | FAERS: 5 | US FAERS | |
| 202 | Listeriosis | FAERS: 5 | US FAERS | |
| 203 | Lymphadenopathy | FAERS: 5 | US FAERS | |
| 204 | Lymphopenia | FAERS: 5 | 7240601 | CTD SIDER US FAERS |
| 205 | Necrosis | FAERS: 5 | 782401 | CTD SIDER US FAERS |
| 206 | Obesity | FAERS: 5 Canada Vigilance: 1 | 782401 | CTD SIDER Canada Vigilance US FAERS |
| 207 | Oropharyngeal pain | FAERS: 5 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 208 | Overdose | FAERS: 5 | US FAERS | |
| 209 | Pleuritic pain | FAERS: 5 | US FAERS | |
| 210 | Pneumonitis | FAERS: 5 | US FAERS | |
| 211 | Polymyalgia Rheumatica | FAERS: 5 | US FAERS | |
| 212 | Porokeratosis | FAERS: 5 | US FAERS | |
| 213 | Product dispensing error | FAERS: 5 | US FAERS | |
| 214 | Sinus bradycardia | FAERS: 5 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 215 | Skin necrosis | FAERS: 5 | OFFSIDES US FAERS | |
| 216 | Steatohepatitis | FAERS: 5 | US FAERS | |
| 217 | Stress | FAERS: 5 | OFFSIDES US FAERS | |
| 218 | Therapy non-responder | FAERS: 5 | US FAERS | |
| 219 | Thirst | FAERS: 5 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 220 | Toxic Epidermal Necrolysis | FAERS: 5 | US FAERS | |
| 221 | Transcription medication error | FAERS: 5 | US FAERS | |
| 222 | Ulcer | FAERS: 5 | SIDER US FAERS | |
| 223 | Varicella Zoster Virus Infection | FAERS: 5 | US FAERS | |
| 224 | Ageusia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 225 | Angle Closure Glaucoma | FAERS: 4 | US FAERS | |
| 226 | Ataxia | FAERS: 4 Canada Vigilance: 1 | 5031606 | CTD Canada Vigilance US FAERS |
| 227 | Blood cholesterol increased | FAERS: 4 | US FAERS | |
| 228 | Blood potassium increased | FAERS: 4 | SIDER US FAERS | |
| 229 | Dehydration | FAERS: 4 | OFFSIDES US FAERS | |
| 230 | Depressed Level of Consciousness | FAERS: 4 | US FAERS | |
| 231 | Diffuse vasculitis | FAERS: 4 | US FAERS | |
| 232 | Disseminated Intravascular Coagulation | FAERS: 4 | US FAERS | |
| 233 | Diverticulitis | FAERS: 4 | OFFSIDES US FAERS | |
| 234 | Drug abuse | FAERS: 4 | US FAERS | |
| 235 | Drug ineffective for unapproved indication | FAERS: 4 | US FAERS | |
| 236 | Emotional disorder | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 237 | Exophthalmos | FAERS: 4 | SIDER US FAERS | |
| 238 | Gestational Diabetes | FAERS: 4 | OFFSIDES US FAERS | |
| 239 | Gluten sensitivity | FAERS: 4 | US FAERS | |
| 240 | Gout | FAERS: 4 | 3544376 | CTD US FAERS |
| 241 | Granulomatosis with polyangiitis | FAERS: 4 | US FAERS | |
| 242 | Growth retardation | FAERS: 4 | SIDER US FAERS | |
| 243 | Hemiparesis | FAERS: 4 | US FAERS | |
| 244 | Histoplasmosis | FAERS: 4 | US FAERS | |
| 245 | Hunger | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 246 | Hypomania | FAERS: 4 | US FAERS | |
| 247 | Lip swelling | FAERS: 4 | US FAERS | |
| 248 | Lipohypertrophy | FAERS: 4 | SIDER US FAERS | |
| 249 | Lung Abscess | FAERS: 4 | US FAERS | |
| 250 | Macular degeneration | FAERS: 4 | US FAERS | |
| 251 | Meningitis | FAERS: 4 | 16248868 | CTD SIDER US FAERS |
| 252 | Mental impairment | FAERS: 4 | US FAERS | |
| 253 | Middle insomnia | FAERS: 4 | US FAERS | |
| 254 | Muscle tightness | FAERS: 4 | US FAERS | |
| 255 | Nerve injury | FAERS: 4 | SIDER US FAERS | |
| 256 | Optic Neuropathy | FAERS: 4 | US FAERS | |
| 257 | Pain of skin | FAERS: 4 | US FAERS | |
| 258 | Pancytopenia | FAERS: 4 | 4117807 12577674 | CTD US FAERS |
| 259 | Photophobia | FAERS: 4 | US FAERS | |
| 260 | Polyuria | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 261 | Poor quality sleep | FAERS: 4 | OFFSIDES US FAERS | |
| 262 | Product solubility abnormal | FAERS: 4 | US FAERS | |
| 263 | Proteinuria | FAERS: 4 | CTD US FAERS | |
| 264 | Pyomyositis | FAERS: 4 | US FAERS | |
| 265 | Splenomegaly | FAERS: 4 | 6937637 | CTD US FAERS |
| 266 | Temporal Arteritis | FAERS: 4 | OFFSIDES US FAERS | |
| 267 | Thrombocytopenia | FAERS: 4 | CTD US FAERS | |
| 268 | Thrombosis | FAERS: 4 | 2946315 3875694 10452346 | CTD US FAERS |
| 269 | Tongue discomfort | FAERS: 4 | US FAERS | |
| 270 | nervous system disorder | FAERS: 4 | SIDER US FAERS | |
| 271 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 272 | Aphasia | FAERS: 3 | US FAERS | |
| 273 | Bacterial sepsis | FAERS: 3 | OFFSIDES US FAERS | |
| 274 | Bedridden | FAERS: 3 | US FAERS | |
| 275 | Blood creatine phosphokinase increased | FAERS: 3 | OFFSIDES US FAERS | |
| 276 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 277 | Carpal Tunnel Syndrome | FAERS: 3 | US FAERS | |
| 278 | Cauda Equina Syndrome | FAERS: 3 | US FAERS | |
| 279 | Central nervous system lesion | FAERS: 3 | US FAERS | |
| 280 | Cerebral atrophy | FAERS: 3 | US FAERS | |
| 281 | Cholecystitis | FAERS: 3 | OFFSIDES US FAERS | |
| 282 | Clostridium difficile infection | FAERS: 3 | US FAERS | |
| 283 | Colitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 284 | Deformity | FAERS: 3 | US FAERS | |
| 285 | Diabetic metabolic decompensation | FAERS: 3 | US FAERS | |
| 286 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 287 | Drug resistance | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 288 | Dry gangrene | FAERS: 3 | US FAERS | |
| 289 | Duodenitis | FAERS: 3 | US FAERS | |
| 290 | Dysuria | FAERS: 3 | OFFSIDES US FAERS | |
| 291 | Ecchymosis | FAERS: 3 | SIDER US FAERS | |
| 292 | Ejection Fraction Decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 293 | Endocarditis | FAERS: 3 | US FAERS | |
| 294 | Epstein Barr virus positive mucocutaneous ulcer | FAERS: 3 | US FAERS | |
| 295 | Eructation | FAERS: 3 | US FAERS | |
| 296 | Food Allergy | FAERS: 3 | US FAERS | |
| 297 | Food Poisoning | FAERS: 3 | US FAERS | |
| 298 | Gastrointestinal Pain | FAERS: 3 | SIDER US FAERS | |
| 299 | Gene Mutation | FAERS: 3 | US FAERS | |
| 300 | Hepatitis | FAERS: 3 | 3769709 5110408 12003401 | CTD US FAERS |
| 301 | Hernia | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 302 | Human Ehrlichiosis | FAERS: 3 | US FAERS | |
| 303 | Hypersomnia | FAERS: 3 | US FAERS | |
| 304 | Immune thrombocytopenic purpura | FAERS: 3 | US FAERS | |
| 305 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 306 | Incorrect drug administration duration | FAERS: 3 | US FAERS | |
| 307 | Increased tendency to bruise | FAERS: 3 | US FAERS | |
| 308 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 309 | JC virus infection | FAERS: 3 | US FAERS | |
| 310 | Jealous delusion | FAERS: 3 | US FAERS | |
| 311 | Limb injury | FAERS: 3 | US FAERS | |
| 312 | Loss of personal independence in daily activities | FAERS: 3 | US FAERS | |
| 313 | Lymphoma | FAERS: 3 | OFFSIDES US FAERS | |
| 314 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 315 | Metrorrhagia | FAERS: 3 | US FAERS | |
| 316 | Musculoskeletal discomfort | FAERS: 3 | SIDER US FAERS | |
| 317 | Mycobacterium chelonae infection | FAERS: 3 | US FAERS | |
| 318 | Myositis | FAERS: 3 | 16307543 | CTD US FAERS |
| 319 | Nasopharyngitis | FAERS: 3 | OFFSIDES US FAERS | |
| 320 | No adverse event | FAERS: 3 | US FAERS | |
| 321 | Optic Neuritis | FAERS: 3 | 2618584 | CTD SIDER US FAERS |
| 322 | Orbital Myositis | FAERS: 3 | US FAERS | |
| 323 | Osteitis | FAERS: 3 | US FAERS | |
| 324 | Pallor | FAERS: 3 | US FAERS | |
| 325 | Panic disorder without agoraphobia | FAERS: 3 | US FAERS | |
| 326 | Personality Change | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 327 | Polydipsia | FAERS: 3 | US FAERS | |
| 328 | Polymyositis | FAERS: 3 | 3288755 9268244 24593216 | CTD US FAERS |
| 329 | Post procedural complication | FAERS: 3 | US FAERS | |
| 330 | Pre-Eclampsia | FAERS: 3 | US FAERS | |
| 331 | Pressure of speech | FAERS: 3 | US FAERS | |
| 332 | Product label issue | FAERS: 3 | US FAERS | |
| 333 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 334 | Quadriplegia | FAERS: 3 | US FAERS | |
| 335 | Quality of life decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 336 | Retinal pigment epithelial tear | FAERS: 3 | US FAERS | |
| 337 | Ross syndrome | FAERS: 3 | US FAERS | |
| 338 | Sexual Dysfunction | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 339 | Synovitis | FAERS: 3 | US FAERS | |
| 340 | Tenosynovitis | FAERS: 3 | US FAERS | |
| 341 | Tooth Loss | FAERS: 3 | US FAERS | |
| 342 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 343 | Tuberculosis | FAERS: 3 | SIDER US FAERS | |
| 344 | Unresponsive to stimuli | FAERS: 3 | OFFSIDES US FAERS | |
| 345 | Vasculitis | FAERS: 3 | 1392448 8350220 | CTD SIDER US FAERS |
| 346 | Vertigo | FAERS: 3 | SIDER US FAERS | |
| 347 | Walking aid user | FAERS: 3 | OFFSIDES US FAERS | |
| 348 | Wheelchair user | FAERS: 3 | US FAERS | |
| 349 | Abdominal adhesions | FAERS: 2 | US FAERS | |
| 350 | Abdominal rigidity | FAERS: 2 | US FAERS | |
| 351 | Abdominal tenderness | FAERS: 2 | OFFSIDES US FAERS | |
| 352 | Acanthamoeba Infection | FAERS: 2 | US FAERS | |
| 353 | Acute myocardial infarction | FAERS: 2 | OFFSIDES US FAERS | |
| 354 | Acute psychosis | FAERS: 2 | US FAERS | |
| 355 | Alcohol abuse | FAERS: 2 | US FAERS | |
| 356 | Allergic reaction to excipient | FAERS: 2 | US FAERS | |
| 357 | Alternaria infection | FAERS: 2 | US FAERS | |
| 358 | Amnestic Disorder | FAERS: 2 | US FAERS | |
| 359 | Aneurysm | FAERS: 2 | US FAERS | |
| 360 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 361 | Anosmia | FAERS: 2 | US FAERS | |
| 362 | Anuria | FAERS: 2 | US FAERS | |
| 363 | Apathy | FAERS: 2 | OFFSIDES US FAERS | |
| 364 | Aphagia | FAERS: 2 | US FAERS | |
| 365 | Arterial thrombosis | FAERS: 2 | US FAERS | |
| 366 | Aspergillosis | FAERS: 2 | 4711275 | CTD US FAERS |
| 367 | Blood corticotrophin increased | FAERS: 2 | US FAERS | |
| 368 | Blood pH increased | FAERS: 2 | US FAERS | |
| 369 | Blood potassium decreased | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 370 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 371 | Blood thyroid stimulating hormone decreased | FAERS: 2 | US FAERS | |
| 372 | Blood triglycerides increased | FAERS: 2 | SIDER US FAERS | |
| 373 | Body fat disorder | FAERS: 2 | US FAERS | |
| 374 | Body temperature fluctuation | FAERS: 2 | US FAERS | |
| 375 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 376 | Brain Death | FAERS: 2 | US FAERS | |
| 377 | Bronchiolitis | FAERS: 2 | US FAERS | |
| 378 | Carbon Monoxide Poisoning | FAERS: 2 | US FAERS | |
| 379 | Cardiac Hypertrophy | FAERS: 2 | US FAERS | |
| 380 | Cardiac valve vegetation | FAERS: 2 | OFFSIDES US FAERS | |
| 381 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 382 | Cervical dysplasia | FAERS: 2 | US FAERS | |
| 383 | Choking | FAERS: 2 | US FAERS | |
| 384 | Cholangiocarcinoma | FAERS: 2 | US FAERS | |
| 385 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 386 | Clostridium test positive | FAERS: 2 | US FAERS | |
| 387 | Cold sweat | FAERS: 2 | US FAERS | |
| 388 | Colectomy | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 389 | Completed Suicide | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 390 | Compression fracture | FAERS: 2 | OFFSIDES US FAERS | |
| 391 | Concomitant disease aggravated | FAERS: 2 | US FAERS | |
| 392 | Cutis Laxa | FAERS: 2 | US FAERS | |
| 393 | Cyanosis | FAERS: 2 | US FAERS | |
| 394 | Cytomegalovirus hepatitis | FAERS: 2 | US FAERS | |
| 395 | Cytopenia | FAERS: 2 | US FAERS | |
| 396 | Deafness | FAERS: 2 | OFFSIDES US FAERS | |
| 397 | Dental caries | FAERS: 2 | US FAERS | |
| 398 | Diffuse Large B-Cell Lymphoma | FAERS: 2 | US FAERS | |
| 399 | Drug administration error | FAERS: 2 | US FAERS | |
| 400 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 401 | Ecthyma | FAERS: 2 | US FAERS | |
| 402 | Ectropion | FAERS: 2 | US FAERS | |
| 403 | Eczema | FAERS: 2 | US FAERS | |
| 404 | Emotional distress | FAERS: 2 | OFFSIDES US FAERS | |
| 405 | Empyema | FAERS: 2 | US FAERS | |
| 406 | Enteritis | FAERS: 2 | US FAERS | |
| 407 | Enthesopathy | FAERS: 2 | US FAERS | |
| 408 | Enuresis | FAERS: 2 | US FAERS | |
| 409 | Eosinophilia | FAERS: 2 | 16111148 19509026 | CTD US FAERS |
| 410 | Erysipelothrix infection | FAERS: 2 | US FAERS | |
| 411 | Extremity necrosis | FAERS: 2 | OFFSIDES US FAERS | |
| 412 | Facial Pain | FAERS: 2 | US FAERS | |
| 413 | Factor V Leiden mutation | FAERS: 2 | US FAERS | |
| 414 | False positive investigation result | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 415 | Fasciotomy | FAERS: 2 | US FAERS | |
| 416 | Feeling Cold | FAERS: 2 | US FAERS | |
| 417 | Food craving | FAERS: 2 | US FAERS | |
| 418 | Formication | FAERS: 2 | OFFSIDES US FAERS | |
| 419 | Gastrointestinal inflammation | FAERS: 2 | US FAERS | |
| 420 | Hallucinations, mixed | FAERS: 2 | US FAERS | |
| 421 | Head discomfort | FAERS: 2 | US FAERS | |
| 422 | Hemiplegia | FAERS: 2 | US FAERS | |
| 423 | Hepatic necrosis | FAERS: 2 | US FAERS | |
| 424 | Hepatosplenomegaly | FAERS: 2 | US FAERS | |
| 425 | Histiocytosis haematophagic | FAERS: 2 | US FAERS | |
| 426 | Histiocytosis | FAERS: 2 | US FAERS | |
| 427 | Hypereosinophilic syndrome | FAERS: 2 | 20169542 28347583 | CTD US FAERS |
| 428 | Hyperphagia | FAERS: 2 | US FAERS | |
| 429 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 430 | Hypertrichosis | FAERS: 2 | 3544376 8176015 | CTD SIDER US FAERS |
| 431 | Hypophagia | FAERS: 2 | US FAERS | |
| 432 | Incontinence | FAERS: 2 | OFFSIDES US FAERS | |
| 433 | Infarction | FAERS: 2 | US FAERS | |
| 434 | Infectious pleural effusion | FAERS: 2 | US FAERS | |
| 435 | Infective tenosynovitis | FAERS: 2 | US FAERS | |
| 436 | Influenza | FAERS: 2 | US FAERS | |
| 437 | Injection site bruising | FAERS: 2 | US FAERS | |
| 438 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 439 | Keratitis | FAERS: 2 | US FAERS | |
| 440 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 441 | Laziness | FAERS: 2 | US FAERS | |
| 442 | Limb discomfort | FAERS: 2 | US FAERS | |
| 443 | Lipomatous hypertrophy of the interatrial septum | FAERS: 2 | US FAERS | |
| 444 | Live Birth | FAERS: 2 | US FAERS | |
| 445 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 446 | Lymphocyte count increased | FAERS: 2 | US FAERS | |
| 447 | Macular detachment | FAERS: 2 | US FAERS | |
| 448 | Malabsorption | FAERS: 2 | US FAERS | |
| 449 | Malacoplakia | FAERS: 2 | US FAERS | |
| 450 | Malignant neoplasm of spinal cord | FAERS: 2 | US FAERS | |
| 451 | Malnutrition | FAERS: 2 | SIDER US FAERS | |
| 452 | Multi-organ disorder | FAERS: 2 | US FAERS | |
| 453 | Myocarditis | FAERS: 2 | 2707913 11435335 | CTD US FAERS |
| 454 | Nephrotic Syndrome | FAERS: 2 |
71603
455820 758027 2465858 2815747 3132281 3796774 3944744 4698337 5764773 6508447 6878266 8350220 9647514 10444806 11304663 11793099 12577674 15334202 17877123 18324419 | CTD US FAERS |
| 455 | Neurological decompensation | FAERS: 2 | US FAERS | |
| 456 | Neutrophil morphology abnormal | FAERS: 2 | US FAERS | |
| 457 | Nodule | FAERS: 2 | US FAERS | |
| 458 | Optic Atrophy | FAERS: 2 | US FAERS | |
| 459 | Otitis Media | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 460 | Papule | FAERS: 2 | US FAERS | |
| 461 | Pemphigus | FAERS: 2 | CTD US FAERS | |
| 462 | Peripheral artery thrombosis | FAERS: 2 | US FAERS | |
| 463 | Postoperative ileus | FAERS: 2 | US FAERS | |
| 464 | Proctitis | FAERS: 2 | US FAERS | |
| 465 | Product administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 466 | Product blister packaging issue | FAERS: 2 | US FAERS | |
| 467 | Product label confusion | FAERS: 2 | US FAERS | |
| 468 | Product package associated injury | FAERS: 2 | US FAERS | |
| 469 | Product packaging issue | FAERS: 2 | US FAERS | |
| 470 | Product physical issue | FAERS: 2 | US FAERS | |
| 471 | Psychiatric symptom | FAERS: 2 | SIDER US FAERS | |
| 472 | Pulmonary granuloma | FAERS: 2 | US FAERS | |
| 473 | Pulmonary thrombosis | FAERS: 2 | US FAERS | |
| 474 | Reaction to excipient | FAERS: 2 | US FAERS | |
| 475 | Regurgitation | FAERS: 2 | US FAERS | |
| 476 | Renal Cell Carcinoma | FAERS: 2 | US FAERS | |
| 477 | Renal pain | FAERS: 2 | US FAERS | |
| 478 | Restlessness | FAERS: 2 | US FAERS | |
| 479 | Retching | FAERS: 2 | US FAERS | |
| 480 | Retinitis | FAERS: 2 | US FAERS | |
| 481 | Rhinitis | FAERS: 2 | US FAERS | |
| 482 | Rhinovirus infection | FAERS: 2 | US FAERS | |
| 483 | Scab | FAERS: 2 | US FAERS | |
| 484 | Screaming | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 485 | Secretion discharge | FAERS: 2 | US FAERS | |
| 486 | Septic embolus | FAERS: 2 | US FAERS | |
| 487 | Serotonin Syndrome | FAERS: 2 | US FAERS | |
| 488 | Similar reaction on previous exposure to drug | FAERS: 2 | US FAERS | |
| 489 | Skin reaction | FAERS: 2 | US FAERS | |
| 490 | Sluggishness | FAERS: 2 | US FAERS | |
| 491 | Squamous cell carcinoma | FAERS: 2 | US FAERS | |
| 492 | Staring | FAERS: 2 | US FAERS | |
| 493 | Stenotrophomonas infection | FAERS: 2 | US FAERS | |
| 494 | Subcutaneous Abscess | FAERS: 2 | US FAERS | |
| 495 | Subcutaneous Emphysema | FAERS: 2 | US FAERS | |
| 496 | Sunburn | FAERS: 2 | US FAERS | |
| 497 | Superinfection viral | FAERS: 2 | US FAERS | |
| 498 | Systemic Inflammatory Response Syndrome | FAERS: 2 | US FAERS | |
| 499 | Systemic Scleroderma | FAERS: 2 | US FAERS | |
| 500 | Systemic bacterial infection | FAERS: 2 | US FAERS | |
| 501 | Tachyphrenia | FAERS: 2 | US FAERS | |
| 502 | Therapeutic response unexpected with drug substitution | FAERS: 2 | US FAERS | |
| 503 | Thyroiditis | FAERS: 2 | US FAERS | |
| 504 | Trichophytosis | FAERS: 2 | US FAERS | |
| 505 | Varicella virus test positive | FAERS: 2 | US FAERS | |
| 506 | Venous Thrombosis | FAERS: 2 | 19663116 | CTD US FAERS |
| 507 | Violence-related symptom | FAERS: 2 | US FAERS | |
| 508 | Wound dehiscence | FAERS: 2 | US FAERS | |
| 509 | Writer's Cramp | FAERS: 2 | US FAERS | |
| 510 | muscle injury | FAERS: 2 | US FAERS | |
| 511 | Abnormal weight gain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 512 | Abortion late | FAERS: 1 | US FAERS | |
| 513 | Accidental underdose | FAERS: 1 | US FAERS | |
| 514 | Actinomycosis | FAERS: 1 | US FAERS | |
| 515 | Acute Chest Syndrome | FAERS: 1 | US FAERS | |
| 516 | Acute graft versus host disease in intestine | FAERS: 1 | OFFSIDES US FAERS | |
| 517 | Acute graft versus host disease in skin | FAERS: 1 | US FAERS | |
| 518 | Acute sinusitis | FAERS: 1 | US FAERS | |
| 519 | Alanine Aminotransferase Increased | FAERS: 1 | SIDER US FAERS | |
| 520 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 521 | Aldolase increased | FAERS: 1 | US FAERS | |
| 522 | Allergy test positive | FAERS: 1 | US FAERS | |
| 523 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 524 | Amblyopia | FAERS: 1 | US FAERS | |
| 525 | Anal Ulcer | FAERS: 1 | US FAERS | |
| 526 | Anaphylactic shock | FAERS: 1 | SIDER US FAERS | |
| 527 | Anhedonia | FAERS: 1 | OFFSIDES US FAERS | |
| 528 | Anion Gap | FAERS: 1 | US FAERS | |
| 529 | Anorexia | FAERS: 1 | 6614043 8759893 | CTD OFFSIDES SIDER US FAERS |
| 530 | Aphonia | FAERS: 1 | US FAERS | |
| 531 | Apparent death | FAERS: 1 | US FAERS | |
| 532 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 533 | Arachnoiditis | FAERS: 1 | SIDER US FAERS | |
| 534 | Arteriovenous fistula | FAERS: 1 | US FAERS | |
| 535 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 536 | Asphyxia | FAERS: 1 | US FAERS | |
| 537 | Auricular swelling | FAERS: 1 | US FAERS | |
| 538 | Autoimmune hepatitis | FAERS: 1 | OFFSIDES US FAERS | |
| 539 | Bipolar Disorder | FAERS: 1 | CTD US FAERS | |
| 540 | Blood Pressure | FAERS: 1 | US FAERS | |
| 541 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 542 | Blood blister | FAERS: 1 | OFFSIDES US FAERS | |
| 543 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 544 | Blood cortisol increased | FAERS: 1 | US FAERS | |
| 545 | Blood immunoglobulin A decreased | FAERS: 1 | US FAERS | |
| 546 | Blood immunoglobulin G decreased | FAERS: 1 | US FAERS | |
| 547 | Blood immunoglobulin G increased | FAERS: 1 | US FAERS | |
| 548 | Blood immunoglobulin M decreased | FAERS: 1 | US FAERS | |
| 549 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 550 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 551 | Blood urea increased | FAERS: 1 | OFFSIDES US FAERS | |
| 552 | Blood urea nitrogen/creatinine ratio decreased | FAERS: 1 | US FAERS | |
| 553 | Bone abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 554 | Bone density abnormal | FAERS: 1 | US FAERS | |
| 555 | Bone erosion | FAERS: 1 | US FAERS | |
| 556 | Bone lesion | FAERS: 1 | OFFSIDES US FAERS | |
| 557 | Bradycardia | FAERS: 1 | SIDER US FAERS | |
| 558 | Bronchial Fistula | FAERS: 1 | US FAERS | |
| 559 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 560 | Bronchoalveolar Lavage | FAERS: 1 | OFFSIDES US FAERS | |
| 561 | Bronchopleural Fistula | FAERS: 1 | US FAERS | |
| 562 | Candidiasis | FAERS: 1 | US FAERS | |
| 563 | Cardiac valve abscess | FAERS: 1 | US FAERS | |
| 564 | Cartilage injury | FAERS: 1 | US FAERS | |
| 565 | Cataplexy | FAERS: 1 | US FAERS | |
| 566 | Catatonia | FAERS: 1 Canada Vigilance: 1 | 440886 2742733 | CTD Canada Vigilance US FAERS |
| 567 | Chimerism | FAERS: 1 | US FAERS | |
| 568 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 569 | Cholestasis | FAERS: 1 | CTD US FAERS | |
| 570 | Choroidal Detachment | FAERS: 1 | US FAERS | |
| 571 | Chromaturia | FAERS: 1 | US FAERS | |
| 572 | Chronic pulmonary histoplasmosis | FAERS: 1 | US FAERS | |
| 573 | Cleft Palate | FAERS: 1 | 19479239 | CTD US FAERS |
| 574 | Clostridium colitis | FAERS: 1 | US FAERS | |
| 575 | Clostridium difficile colitis | FAERS: 1 | OFFSIDES US FAERS | |
| 576 | Clumsiness | FAERS: 1 | US FAERS | |
| 577 | Coagulation factor VIII level decreased | FAERS: 1 | US FAERS | |
| 578 | Cognitive deterioration | FAERS: 1 | US FAERS | |
| 579 | Complex partial seizures | FAERS: 1 | US FAERS | |
| 580 | Complications of transplant surgery | FAERS: 1 | US FAERS | |
| 581 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 582 | Contraindicated product administered | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 583 | Conus Medullaris Syndrome | FAERS: 1 | US FAERS | |
| 584 | Cortisol decreased | FAERS: 1 | US FAERS | |
| 585 | Cryptococcal cutaneous infection | FAERS: 1 | US FAERS | |
| 586 | Cutaneous coccidioidomycosis | FAERS: 1 | US FAERS | |
| 587 | Cutaneous sarcoidosis | FAERS: 1 | US FAERS | |
| 588 | Cystitis | FAERS: 1 | 448907 1844164 | CTD US FAERS |
| 589 | Cyst | FAERS: 1 | US FAERS | |
| 590 | Cytomegalovirus test positive | FAERS: 1 | US FAERS | |
| 591 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 592 | Dermatomyositis | FAERS: 1 | 2707077 | CTD US FAERS |
| 593 | Dermatophytosis | FAERS: 1 | US FAERS | |
| 594 | Detachment of retinal pigment epithelium | FAERS: 1 | US FAERS | |
| 595 | Diabetes mellitus inadequate control | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 596 | Diverticulum | FAERS: 1 | US FAERS | |
| 597 | Drooling | FAERS: 1 | US FAERS | |
| 598 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 599 | Drug screen positive | FAERS: 1 | US FAERS | |
| 600 | Dry skin | FAERS: 1 | SIDER US FAERS | |
| 601 | Duodenal Ulcer | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 602 | Duodenal perforation | FAERS: 1 | US FAERS | |
| 603 | Dystonia | FAERS: 1 | US FAERS | |
| 604 | Ear congestion | FAERS: 1 | US FAERS | |
| 605 | Ectropion of cervix | FAERS: 1 | US FAERS | |
| 606 | Electroencephalogram abnormal | FAERS: 1 | SIDER US FAERS | |
| 607 | Elevated mood | FAERS: 1 | US FAERS | |
| 608 | Embolism | FAERS: 1 | SIDER US FAERS | |
| 609 | Emergency Care | FAERS: 1 | US FAERS | |
| 610 | Endocarditis enterococcal | FAERS: 1 | US FAERS | |
| 611 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 612 | Endometriosis | FAERS: 1 | US FAERS | |
| 613 | Enterobacter pneumonia | FAERS: 1 | US FAERS | |
| 614 | Enterocolitis | FAERS: 1 | US FAERS | |
| 615 | Eosinophilic granulomatosis with polyangiitis | FAERS: 1 | US FAERS | |
| 616 | Epilepsy | FAERS: 1 | SIDER US FAERS | |
| 617 | Episcleritis | FAERS: 1 | US FAERS | |
| 618 | Epstein-Barr virus associated lymphoproliferative disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 619 | Epstein-Barr virus test positive | FAERS: 1 | US FAERS | |
| 620 | Erectile dysfunction | FAERS: 1 | SIDER US FAERS | |
| 621 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 622 | Eschar | FAERS: 1 | US FAERS | |
| 623 | Excitability | FAERS: 1 | US FAERS | |
| 624 | Expired product administered | FAERS: 1 | US FAERS | |
| 625 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 626 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 627 | Eye infection intraocular | FAERS: 1 | US FAERS | |
| 628 | Eye irritation | FAERS: 1 | US FAERS | |
| 629 | Facial Neuralgia | FAERS: 1 | US FAERS | |
| 630 | False negative investigation result | FAERS: 1 | US FAERS | |
| 631 | Fat redistribution | FAERS: 1 | US FAERS | |
| 632 | Fibromuscular Dysplasia | FAERS: 1 | US FAERS | |
| 633 | Fibrosis | FAERS: 1 | US FAERS | |
| 634 | Fistula repair | FAERS: 1 | US FAERS | |
| 635 | Flank Pain | FAERS: 1 | US FAERS | |
| 636 | Fracture | FAERS: 1 | SIDER US FAERS | |
| 637 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 638 | Fungal tracheitis | FAERS: 1 | US FAERS | |
| 639 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 640 | Gastrointestinal mucosal disorder | FAERS: 1 | US FAERS | |
| 641 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 642 | Gastropleural fistula | FAERS: 1 | US FAERS | |
| 643 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 644 | Giant Cell Epulis | FAERS: 1 | US FAERS | |
| 645 | Glomerulonephritis | FAERS: 1 Canada Vigilance: 1 | CTD Canada Vigilance US FAERS | |
| 646 | Graft versus host disease in lung | FAERS: 1 | US FAERS | |
| 647 | Granulocytes abnormal | FAERS: 1 | US FAERS | |
| 648 | Granuloma | FAERS: 1 | US FAERS | |
| 649 | Head titubation | FAERS: 1 | US FAERS | |
| 650 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 651 | Heparin-induced thrombocytopenia | FAERS: 1 | US FAERS | |
| 652 | Hepatitis C RNA positive | FAERS: 1 | US FAERS | |
| 653 | Hip surgery | FAERS: 1 | US FAERS | |
| 654 | Hirsutism | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 655 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 656 | Humidity intolerance | FAERS: 1 | US FAERS | |
| 657 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 658 | Hyperferritinaemia | FAERS: 1 | US FAERS | |
| 659 | Hypertrophic obstructive cardiomyopathy | FAERS: 1 | US FAERS | |
| 660 | Hypoaesthesia facial | FAERS: 1 | OFFSIDES US FAERS | |
| 661 | Hypokinesia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 662 | Hypotrichosis | FAERS: 1 | US FAERS | |
| 663 | Idiopathic Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 664 | Iliac artery stenosis | FAERS: 1 | US FAERS | |
| 665 | Immobile | FAERS: 1 | US FAERS | |
| 666 | Impaired self-care | FAERS: 1 | US FAERS | |
| 667 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 668 | Inadequate aseptic technique in use of product | FAERS: 1 | US FAERS | |
| 669 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 670 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 671 | Incoherent | FAERS: 1 | US FAERS | |
| 672 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 673 | Infection reactivation | FAERS: 1 | US FAERS | |
| 674 | Infectious peritonitis | FAERS: 1 | US FAERS | |
| 675 | Injection site cellulitis | FAERS: 1 | US FAERS | |
| 676 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 677 | Intentional misuse | FAERS: 1 | US FAERS | |
| 678 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 679 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 680 | Intertrigo | FAERS: 1 | US FAERS | |
| 681 | Intervertebral Disc Degeneration | FAERS: 1 | OFFSIDES US FAERS | |
| 682 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 683 | Intestinal Perforation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 684 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 685 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 686 | Jejunal ulcer | FAERS: 1 | US FAERS | |
| 687 | Joint Instability | FAERS: 1 | US FAERS | |
| 688 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 689 | Joint fluid drainage | FAERS: 1 | US FAERS | |
| 690 | Joint stiffness | FAERS: 1 | US FAERS | |
| 691 | Klebsiella test positive | FAERS: 1 | US FAERS | |
| 692 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 693 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 694 | Leukopenia | FAERS: 1 | CTD US FAERS | |
| 695 | Lichen Planus | FAERS: 1 | US FAERS | |
| 696 | Ligament injury | FAERS: 1 | US FAERS | |
| 697 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 698 | Listeria encephalitis | FAERS: 1 | US FAERS | |
| 699 | Liver graft loss | FAERS: 1 | US FAERS | |
| 700 | Loose tooth | FAERS: 1 | US FAERS | |
| 701 | Lyme Disease | FAERS: 1 | US FAERS | |
| 702 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 703 | Male sexual dysfunction | FAERS: 1 | US FAERS | |
| 704 | Mantle cell lymphoma | FAERS: 1 | US FAERS | |
| 705 | Mastication disorder | FAERS: 1 | US FAERS | |
| 706 | Measles | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 707 | Meningism | FAERS: 1 | US FAERS | |
| 708 | Meningitis enterococcal | FAERS: 1 | US FAERS | |
| 709 | Meningoradiculitis | FAERS: 1 | US FAERS | |
| 710 | Meniscus injury | FAERS: 1 | US FAERS | |
| 711 | Mental disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 712 | Mesenteric artery stenosis | FAERS: 1 | US FAERS | |
| 713 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 714 | Mineral deficiency | FAERS: 1 | US FAERS | |
| 715 | Monocyte morphology abnormal | FAERS: 1 | US FAERS | |
| 716 | Mononucleosis syndrome | FAERS: 1 | US FAERS | |
| 717 | Mucocutaneous candidiasis | FAERS: 1 | US FAERS | |
| 718 | Multiple allergies | FAERS: 1 | OFFSIDES US FAERS | |
| 719 | Multiple sclerosis relapse | FAERS: 1 | US FAERS | |
| 720 | Muscle Fatigue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 721 | Muscle abscess | FAERS: 1 | US FAERS | |
| 722 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 723 | Myasthenia Gravis | FAERS: 1 | 8463474 17074487 | CTD US FAERS |
| 724 | Mycobacterium marinum Infection | FAERS: 1 | US FAERS | |
| 725 | Mydriasis | FAERS: 1 | US FAERS | |
| 726 | Myelitis | FAERS: 1 | US FAERS | |
| 727 | Myocardial fibrosis | FAERS: 1 | US FAERS | |
| 728 | Myocardial necrosis marker increased | FAERS: 1 | US FAERS | |
| 729 | Narcolepsy | FAERS: 1 | US FAERS | |
| 730 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 731 | Nasopharyngeal reflux | FAERS: 1 | US FAERS | |
| 732 | Negative thoughts | FAERS: 1 | US FAERS | |
| 733 | Nephrectomy | FAERS: 1 | US FAERS | |
| 734 | Neuralgia | FAERS: 1 | 16519781 | CTD US FAERS |
| 735 | Neuropsychiatric syndrome | FAERS: 1 | US FAERS | |
| 736 | Neurosarcoidosis | FAERS: 1 | US FAERS | |
| 737 | Neutropenia | FAERS: 1 | 19720904 | CTD SIDER US FAERS |
| 738 | No adverse effect | FAERS: 1 | US FAERS | |
| 739 | Nocardia sepsis | FAERS: 1 | US FAERS | |
| 740 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 741 | Obsessive-Compulsive Disorder | FAERS: 1 Canada Vigilance: 1 | 15819475 | CTD Canada Vigilance US FAERS |
| 742 | Obstruction | FAERS: 1 | US FAERS | |
| 743 | Ocular icterus | FAERS: 1 | US FAERS | |
| 744 | Oral candidiasis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 745 | Oropharyngeal plaque | FAERS: 1 | US FAERS | |
| 746 | Orthosis user | FAERS: 1 | US FAERS | |
| 747 | Osteochondrosis | FAERS: 1 | US FAERS | |
| 748 | Osteomyelitis fungal | FAERS: 1 | US FAERS | |
| 749 | PCO2 increased | FAERS: 1 | US FAERS | |
| 750 | PO2 decreased | FAERS: 1 | US FAERS | |
| 751 | Pachymeningitis | FAERS: 1 | US FAERS | |
| 752 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 753 | Panic Disorder | FAERS: 1 | US FAERS | |
| 754 | Papillary muscle infarction | FAERS: 1 | US FAERS | |
| 755 | Paraplegia | FAERS: 1 | SIDER US FAERS | |
| 756 | Patient Isolation | FAERS: 1 | US FAERS | |
| 757 | Pelvic prolapse | FAERS: 1 | US FAERS | |
| 758 | Periarthritis calcarea | FAERS: 1 | US FAERS | |
| 759 | Periodontitis | FAERS: 1 | OFFSIDES US FAERS | |
| 760 | Periorbital fat herniation | FAERS: 1 | US FAERS | |
| 761 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 762 | Perivascular dermatitis | FAERS: 1 | US FAERS | |
| 763 | Perseveration | FAERS: 1 | US FAERS | |
| 764 | Petechiae | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 765 | Pharyngolaryngeal Pain | FAERS: 1 | OFFSIDES US FAERS | |
| 766 | Physical disability | FAERS: 1 | US FAERS | |
| 767 | Polyarteritis Nodosa | FAERS: 1 | CTD US FAERS | |
| 768 | Porphyria non-acute | FAERS: 1 | US FAERS | |
| 769 | Portal fibrosis | FAERS: 1 | US FAERS | |
| 770 | Portal tract inflammation | FAERS: 1 | US FAERS | |
| 771 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 772 | Pregnancy | FAERS: 1 | US FAERS | |
| 773 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 774 | Presyncope | FAERS: 1 | US FAERS | |
| 775 | Procedural complication | FAERS: 1 | US FAERS | |
| 776 | Product formulation issue | FAERS: 1 | US FAERS | |
| 777 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 778 | Product prescribing error | FAERS: 1 | US FAERS | |
| 779 | Product size issue | FAERS: 1 | US FAERS | |
| 780 | Product storage error | FAERS: 1 | US FAERS | |
| 781 | Product supply issue | FAERS: 1 | US FAERS | |
| 782 | Product use complaint | FAERS: 1 | US FAERS | |
| 783 | Product use issue | FAERS: 1 | US FAERS | |
| 784 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 785 | Protein total increased | FAERS: 1 | US FAERS | |
| 786 | Pulmonary Fibrosis | FAERS: 1 | 7213447 29408570 | CTD US FAERS |
| 787 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 788 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 789 | Purpura | FAERS: 1 Canada Vigilance: 1 | 3361544 | CTD SIDER Canada Vigilance US FAERS |
| 790 | Pustular psoriasis | FAERS: 1 | US FAERS | |
| 791 | Pyoderma Gangrenosum | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 792 | Radiation proctitis | FAERS: 1 | US FAERS | |
| 793 | Reaction to azo-dyes | FAERS: 1 | US FAERS | |
| 794 | Rectal discharge | FAERS: 1 | US FAERS | |
| 795 | Renal Artery Stenosis | FAERS: 1 | US FAERS | |
| 796 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 797 | Respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 798 | Retinal infarction | FAERS: 1 | US FAERS | |
| 799 | Retinal pigment epitheliopathy | FAERS: 1 | US FAERS | |
| 800 | Rheumatoid factor increased | FAERS: 1 | US FAERS | |
| 801 | Rhodococcus infection | FAERS: 1 | US FAERS | |
| 802 | Right Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 803 | Rubber sensitivity | FAERS: 1 | US FAERS | |
| 804 | Sarcoidosis | FAERS: 1 | 850496 1743505 18717146 | CTD OFFSIDES US FAERS |
| 805 | Sarcopenia | FAERS: 1 | US FAERS | |
| 806 | Sciatica | FAERS: 1 | US FAERS | |
| 807 | Sclerema | FAERS: 1 | US FAERS | |
| 808 | Sebaceous hyperplasia | FAERS: 1 | US FAERS | |
| 809 | Secondary hypertension | FAERS: 1 | US FAERS | |
| 810 | Serum Sickness | FAERS: 1 | US FAERS | |
| 811 | Sinus pain | FAERS: 1 | US FAERS | |
| 812 | Skin Erosion | FAERS: 1 | US FAERS | |
| 813 | Skin irritation | FAERS: 1 | US FAERS | |
| 814 | Skin laceration | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 815 | Skin test positive | FAERS: 1 | US FAERS | |
| 816 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 817 | Soft tissue swelling | FAERS: 1 | US FAERS | |
| 818 | Solar lentigo | FAERS: 1 | US FAERS | |
| 819 | Sphincter of Oddi Dysfunction | FAERS: 1 | US FAERS | |
| 820 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 821 | Sporotrichosis | FAERS: 1 | US FAERS | |
| 822 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 823 | Sternal injury | FAERS: 1 | US FAERS | |
| 824 | Stomatitis | FAERS: 1 | 5031606 | CTD US FAERS |
| 825 | Strabismus | FAERS: 1 | US FAERS | |
| 826 | Stridor | FAERS: 1 | US FAERS | |
| 827 | Suspected product contamination | FAERS: 1 | US FAERS | |
| 828 | Symblepharon | FAERS: 1 | US FAERS | |
| 829 | Symptom recurrence | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 830 | Syphilis | FAERS: 1 | US FAERS | |
| 831 | Systolic hypertension | FAERS: 1 | US FAERS | |
| 832 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 833 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 834 | Tension | FAERS: 1 | US FAERS | |
| 835 | Therapeutic agent-diagnostic test interaction | FAERS: 1 | US FAERS | |
| 836 | Therapeutic product effect decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 837 | Therapeutic product effect variable | FAERS: 1 | US FAERS | |
| 838 | Therapy change | FAERS: 1 | US FAERS | |
| 839 | Thymoma | FAERS: 1 | US FAERS | |
| 840 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 841 | Tobacco user | FAERS: 1 | US FAERS | |
| 842 | Tongue biting | FAERS: 1 | US FAERS | |
| 843 | Tooth Infection | FAERS: 1 | US FAERS | |
| 844 | Toothache | FAERS: 1 | US FAERS | |
| 845 | Torticollis | FAERS: 1 | US FAERS | |
| 846 | Tracheobronchitis | FAERS: 1 | US FAERS | |
| 847 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 848 | Tuberculoma of central nervous system | FAERS: 1 | US FAERS | |
| 849 | Tuberculous tenosynovitis | FAERS: 1 | US FAERS | |
| 850 | Unemployment | FAERS: 1 | US FAERS | |
| 851 | Ureterolithiasis | FAERS: 1 | US FAERS | |
| 852 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 853 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 854 | Uterine Prolapse | FAERS: 1 | US FAERS | |
| 855 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 856 | Vanishing bile duct syndrome | FAERS: 1 | US FAERS | |
| 857 | Viral myocarditis | FAERS: 1 | US FAERS | |
| 858 | Visual disturbance | FAERS: 1 | US FAERS | |
| 859 | Vitiligo | FAERS: 1 | US FAERS | |
| 860 | Vocal Cord Dysfunction | FAERS: 1 | US FAERS | |
| 861 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 862 | White blood cell morphology abnormal | FAERS: 1 | US FAERS | |
| 863 | Wound Complication | FAERS: 1 | US FAERS | |
| 864 | Wound Infection | FAERS: 1 | US FAERS | |
| 865 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 866 | X-ray abnormal | FAERS: 1 | US FAERS | |
| 867 | Zika Virus Infection | FAERS: 1 | US FAERS | |
| 868 | abdominal wall wound | FAERS: 1 | US FAERS | |
| 869 | Abdominal Abscess | Canada Vigilance: 1 | Canada Vigilance | |
| 870 | Abdominal Infection | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 871 | Abnormal cervical smear | OFFSIDES | ||
| 872 | Abnormal vision | OFFSIDES | ||
| 873 | Abnormalities, Drug-Induced | 19479239 | CTD | |
| 874 | Acid reflux | OFFSIDES | ||
| 875 | Acidosis, Lactic | 3703509 | CTD | |
| 876 | Actinomycetales Infections | 6350469 | CTD | |
| 877 | Acute Coronary Syndrome | SIDER | ||
| 878 | Acute bronchitis | OFFSIDES | ||
| 879 | Acute graft versus host disease in liver | OFFSIDES | ||
| 880 | Adenocarcinoma | 675898 | CTD | |
| 881 | Adrenal atrophy | SIDER | ||
| 882 | Adrenal cortex atrophy | SIDER | ||
| 883 | Affective Disorders, Psychotic | 9853693 | CTD | |
| 884 | Albumin globulin ratio decreased | OFFSIDES | ||
| 885 | Alkalosis | SIDER | ||
| 886 | Allergic colitis | OFFSIDES | ||
| 887 | Alopecia Areata | 4422330 | CTD | |
| 888 | Alveolitis | OFFSIDES | ||
| 889 | Alveoloplasty | OFFSIDES | ||
| 890 | Amphetamines | OFFSIDES | ||
| 891 | Amyopathic dermatomyositis | 7722021 | CTD | |
| 892 | Anal Fissure | OFFSIDES | ||
| 893 | Anaphylactoid Reaction | Canada Vigilance: 1 | Canada Vigilance | |
| 894 | Anemia, Hemolytic | 3944744 11364438 | CTD | |
| 895 | Anemia, Sickle Cell | 18717146 | CTD | |
| 896 | Anemia | 448907 19720904 | CTD | |
| 897 | Anoxic Encephalopathy | OFFSIDES | ||
| 898 | Anxiety Disorders | 4700331 10506276 11708428 | CTD | |
| 899 | Aortic Rupture | 105598 | CTD | |
| 900 | Appendicitis | OFFSIDES | ||
| 901 | Application site erythema | OFFSIDES | ||
| 902 | Application site vesicles | OFFSIDES | ||
| 903 | Arthropod bite | OFFSIDES | ||
| 904 | Aseptic necrosis | SIDER | ||
| 905 | Atelectasis | OFFSIDES | ||
| 906 | Atherosclerosis | 16550133 | CTD | |
| 907 | Atrial tachycardia | OFFSIDES | ||
| 908 | Atrial thrombosis | OFFSIDES | ||
| 909 | Azotemia | 4833837 6936839 | CTD | |
| 910 | Bacteria stool identified | OFFSIDES | ||
| 911 | Bacterial test positive | OFFSIDES | ||
| 912 | Basal Ganglia Diseases | 4144552 | CTD | |
| 913 | Basal cell carcinoma | OFFSIDES | ||
| 914 | Behcet Syndrome | 9775117 | CTD | |
| 915 | Berylliosis | 18757698 | CTD | |
| 916 | Bile Duct Stenosis | OFFSIDES | ||
| 917 | Biopsy bone abnormal | OFFSIDES | ||
| 918 | Bladder Diverticulum | OFFSIDES | ||
| 919 | Blood Glucose | OFFSIDES | ||
| 920 | Blood albumin decreased | OFFSIDES | ||
| 921 | Blood and lymphatic system disorders | SIDER | ||
| 922 | Blood bilirubin abnormal | OFFSIDES | ||
| 923 | Blood chloride decreased | OFFSIDES | ||
| 924 | Blood cholesterol | OFFSIDES | ||
| 925 | Blood immunoglobulin A increased | OFFSIDES | ||
| 926 | Blood iron decreased | OFFSIDES | ||
| 927 | Blood urine present | OFFSIDES | ||
| 928 | Blue Toe Syndrome | 2240906 | CTD | |
| 929 | Body Temperature | OFFSIDES | ||
| 930 | Bone Diseases | 8061360 | CTD | |
| 931 | Bone swelling | OFFSIDES | ||
| 932 | Breast tenderness | OFFSIDES | ||
| 933 | Bronchial irritation | OFFSIDES | ||
| 934 | Bronchopneumonia | OFFSIDES | ||
| 935 | Bronchospasm | Canada Vigilance: 1 | Canada Vigilance | |
| 936 | Buffalo hump | SIDER | ||
| 937 | Bunion operation | OFFSIDES | ||
| 938 | Bunion | OFFSIDES | ||
| 939 | Burkitt Lymphoma | 3965085 18782177 | CTD | |
| 940 | Bursitis | OFFSIDES | ||
| 941 | Calcinosis | 5474506 | CTD | |
| 942 | Capillary Leak Syndrome | OFFSIDES | ||
| 943 | Carbohydrate tolerance decreased | SIDER | ||
| 944 | Carcinoma, Transitional Cell | CTD | ||
| 945 | Carcinoma | 903024 3510835 7844616 | CTD | |
| 946 | Cardiac asthma | OFFSIDES | ||
| 947 | Cardiomegaly | 11937956 | CTD SIDER | |
| 948 | Cardiomyopathies | 5474506 6938188 | CTD | |
| 949 | Cardiomyopathy, Dilated | 11435335 | CTD | |
| 950 | Carotid Stenosis | 16550133 | CTD | |
| 951 | Cataract operation | OFFSIDES | ||
| 952 | Catheter related infection | OFFSIDES | ||
| 953 | Celiac Disease | 12950421 | CTD | |
| 954 | Central Nervous System Fungal Infections | 4711275 | CTD | |
| 955 | Cerebrovascular Disorders | 8971384 | CTD | |
| 956 | Cervicobrachial syndrome | OFFSIDES | ||
| 957 | Chemical and Drug Induced Liver Injury | CTD | ||
| 958 | Child Behavior Disorders | 1727206 10506276 12171842 | CTD | |
| 959 | Choking sensation | OFFSIDES | ||
| 960 | Cholangiolitis | OFFSIDES | ||
| 961 | Cholelithiasis | 3544376 | CTD | |
| 962 | Cholestatic liver injury | OFFSIDES | ||
| 963 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 964 | Chronic ulcerative colitis | OFFSIDES | ||
| 965 | Cognition Disorders | 12724501 | CTD | |
| 966 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 967 | Conjunctivitis | Canada Vigilance: 1 | Canada Vigilance | |
| 968 | Contusions | 5025095 | CTD | |
| 969 | Corneal Opacity | Canada Vigilance: 1 | Canada Vigilance | |
| 970 | Crohn Disease | CTD | ||
| 971 | Cushing Syndrome | 4700331 5764773 | CTD | |
| 972 | Demyelinating Diseases | 17661993 | CTD | |
| 973 | Demyelination | OFFSIDES | ||
| 974 | Depressive disorder | CTD | ||
| 975 | Dermatitis acneiform | SIDER | ||
| 976 | Dermatitis | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 977 | Device malfunction | OFFSIDES | ||
| 978 | Diabetes | OFFSIDES | ||
| 979 | Diarrhea | 5031606 | CTD OFFSIDES | |
| 980 | Diastolic dysfunction | OFFSIDES | ||
| 981 | Diplegia | SIDER | ||
| 982 | Disorders of Excessive Somnolence | 3544376 | CTD | |
| 983 | Distention | SIDER | ||
| 984 | Diverticular perforation | OFFSIDES | ||
| 985 | Drug Eruptions | 8698924 19509026 | CTD | |
| 986 | Drug administered at inappropriate site | OFFSIDES | ||
| 987 | Drug delivery system malfunction | OFFSIDES | ||
| 988 | Drug toxicity | OFFSIDES | ||
| 989 | Drug withdrawal headache | OFFSIDES | ||
| 990 | Dry scalp | SIDER | ||
| 991 | Duodenal ulcer perforation | Canada Vigilance: 1 | Canada Vigilance | |
| 992 | Dyspnea | 2707077 | CTD | |
| 993 | Edema | 4540388 5025095 6937637 | CTD | |
| 994 | Ejection fraction abnormal | OFFSIDES | ||
| 995 | Electrocardiogram ST segment abnormal | OFFSIDES | ||
| 996 | Endometrial Neoplasms | 903024 | CTD | |
| 997 | Endophthalmitis | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 998 | Endoscopy abnormal | OFFSIDES | ||
| 999 | Eosinopenia | SIDER | ||
| 1000 | Eosinophilia-Myalgia Syndrome | 12610828 | CTD | |
| 1001 | Epicondylitis | OFFSIDES | ||
| 1002 | Epigastric discomfort | SIDER | ||
| 1003 | Erosive gastritis | OFFSIDES | ||
| 1004 | Erythema Multiforme | Canada Vigilance: 1 | Canada Vigilance | |
| 1005 | Esophageal Neoplasms | 7844616 | CTD | |
| 1006 | Exanthema | 4211170 9017778 10894975 | CTD | |
| 1007 | Exploratory operation | OFFSIDES | ||
| 1008 | Facies | 1237376 | CTD | |
| 1009 | Fanconi Syndrome | 8352262 | CTD | |
| 1010 | Fatty Liver | 4166870 | CTD | |
| 1011 | Fear of falling | OFFSIDES | ||
| 1012 | Feeding disorder neonatal | OFFSIDES | ||
| 1013 | Feeling of body temperature change | Canada Vigilance: 1 | Canada Vigilance | |
| 1014 | Fever | 4211170 8759893 9017778 | CTD | |
| 1015 | Fibromyalgia | OFFSIDES | ||
| 1016 | Fixed eruption | Canada Vigilance: 1 | Canada Vigilance | |
| 1017 | Frustration | OFFSIDES | ||
| 1018 | Gammopathy | OFFSIDES | ||
| 1019 | Gastric irritation | SIDER | ||
| 1020 | Gastroenteritis | OFFSIDES | ||
| 1021 | Gastrointestinal Diseases | 5025095 5254045 6089632 | CTD | |
| 1022 | General symptom | Canada Vigilance: 1 | Canada Vigilance | |
| 1023 | Giant Cell Arteritis | CTD | ||
| 1024 | Gingival Hypertrophy | OFFSIDES | ||
| 1025 | Gingivitis | 8176015 | CTD | |
| 1026 | Glaucoma, Open-Angle | 2263031 12446362 | CTD | |
| 1027 | Glycosuria | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 1028 | Granulocytosis | OFFSIDES | ||
| 1029 | Graves Disease | 2263031 | CTD | |
| 1030 | Growth Disorders | 782401 | CTD | |
| 1031 | HIV Wasting Syndrome | 9268244 | CTD | |
| 1032 | Hallucinations | 440886 | CTD | |
| 1033 | Hearing Loss, Unilateral | 19029995 | CTD | |
| 1034 | Hearing Loss | 19415035 | CTD | |
| 1035 | Heart Diseases | 7915431 | CTD | |
| 1036 | Heart Rupture, Post-Infarction | 15219313 | CTD | |
| 1037 | Heart failure | 11435335 28347583 | CTD | |
| 1038 | Hemangioma, Cavernous | 3944744 | CTD | |
| 1039 | Hemangioma | 11937956 | CTD | |
| 1040 | Hematuria | 448907 6860382 12748258 | CTD | |
| 1041 | Hemoglobinuria, Paroxysmal | 48615 | CTD | |
| 1042 | Hemorrhage | 448907 | CTD | |
| 1043 | Hepatic Veno-Occlusive Disease | 18839274 | CTD | |
| 1044 | Hepatic congestion | OFFSIDES | ||
| 1045 | Hepatitis B, Chronic | CTD | ||
| 1046 | Hepatitis C | OFFSIDES | ||
| 1047 | Hepatitis, Chronic | 3371886 4123775 7433331 | CTD | |
| 1048 | Hepatomegaly | 3944744 4166870 6937637 | CTD SIDER | |
| 1049 | Hereditary Angioedema Types I and II | 4014294 | CTD | |
| 1050 | Hidradenitis | OFFSIDES | ||
| 1051 | Histiocytosis, Langerhans-Cell | 12571475 | CTD | |
| 1052 | Hodgkin Disease | CTD | ||
| 1053 | Human herpes virus 6 serology positive | OFFSIDES | ||
| 1054 | Hyperbilirubinemia | 6937637 | CTD | |
| 1055 | Hypercalcemia | 850496 4010837 9382671 | CTD | |
| 1056 | Hypercholesterolemia | 2665233 | CTD | |
| 1057 | Hyperglycemia | 3703509 | CTD | |
| 1058 | Hyperkalemia | 4833837 8606734 | CTD | |
| 1059 | Hyperkinesia | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 1060 | Hyperpigmentation | 5031606 | CTD | |
| 1061 | Hypertensive cardiomyopathy | OFFSIDES | ||
| 1062 | Hypertensive heart disease | OFFSIDES | ||
| 1063 | Hyperthyroidism | SIDER | ||
| 1064 | Hypertriglyceridemia | 2665233 | CTD | |
| 1065 | Hypertrophic Cardiomyopathy | SIDER | ||
| 1066 | Hyperuricemia | 3544376 | CTD | |
| 1067 | Hypocalcemia | 4833837 | CTD | |
| 1068 | Hypogeusia | Canada Vigilance: 1 | Canada Vigilance | |
| 1069 | Hypoglycemia | 19902248 | CTD | |
| 1070 | Hypospadias | 15371800 | CTD | |
| 1071 | Hypothermia neonatal | OFFSIDES | ||
| 1072 | Hypothyroidism | SIDER | ||
| 1073 | Ileus | 6937637 | CTD | |
| 1074 | Immune System Diseases | 6351368 16044099 | CTD | |
| 1075 | Implantable defibrillator insertion | OFFSIDES | ||
| 1076 | Increased bronchial secretion | OFFSIDES | ||
| 1077 | Increased insulin requirement | SIDER | ||
| 1078 | Inflammatory Bowel Diseases | 1301798 16145214 | CTD | |
| 1079 | Infusion site mobility decreased | OFFSIDES | ||
| 1080 | Injection site irritation | OFFSIDES | ||
| 1081 | Intestinal resection | OFFSIDES | ||
| 1082 | Intracranial Hypertension | 11565520 | CTD | |
| 1083 | Intracranial Thrombosis | 3111251 | CTD | |
| 1084 | Intravenous catheter management | OFFSIDES | ||
| 1085 | Iridocyclitis | 7196210 | CTD | |
| 1086 | Ischemia | 4061472 | CTD | |
| 1087 | Ketosis | Canada Vigilance: 1 | 3703509 | CTD Canada Vigilance |
| 1088 | Kidney Diseases | CTD | ||
| 1089 | Kidney Failure | OFFSIDES | ||
| 1090 | Kidney Papillary Necrosis | 12774222 | CTD | |
| 1091 | Klebsiella sepsis | OFFSIDES | ||
| 1092 | Left atrial dilatation | OFFSIDES | ||
| 1093 | Leishmaniasis | OFFSIDES | ||
| 1094 | Leprosy, Lepromatous | 19663116 | CTD | |
| 1095 | Leukoderma | SIDER | ||
| 1096 | Lipids abnormal | SIDER | ||
| 1097 | Lipoatrophy | SIDER | ||
| 1098 | Lipodystrophy | 17501951 | CTD | |
| 1099 | Lipoma | Canada Vigilance: 2 | Canada Vigilance | |
| 1100 | Liver Abscess, Amebic | 850496 | CTD | |
| 1101 | Liver Failure | 1669052 | CTD | |
| 1102 | Liver diseases | 1058041 8698924 | CTD | |
| 1103 | Liver neoplasms | 3465877 | CTD | |
| 1104 | Liver transplant rejection | OFFSIDES | ||
| 1105 | Lung Diseases, Obstructive | 11150940 | CTD | |
| 1106 | Lupus Erythematosus, Cutaneous | 9451224 | CTD | |
| 1107 | Lupus Erythematosus, Systemic | CTD | ||
| 1108 | Lymphoma, Extranodal NK-T-Cell | 20839428 | CTD | |
| 1109 | Lymphoma, Non-Hodgkin | CTD | ||
| 1110 | Mastoiditis | OFFSIDES | ||
| 1111 | Megacolon | OFFSIDES | ||
| 1112 | Memory Disorders | 12724501 17030063 | CTD | |
| 1113 | Memory Loss | SIDER | ||
| 1114 | Meningeal Neoplasms | 2428950 | CTD | |
| 1115 | Menstruation Disturbances | 17501951 | CTD | |
| 1116 | Mental disorders | 12428485 17501951 | CTD | |
| 1117 | Metatarsalgia | OFFSIDES | ||
| 1118 | Methemoglobinemia | 6703568 | CTD | |
| 1119 | Mitochondrial Myopathies | 6938188 | CTD | |
| 1120 | Mononeuropathies | 20944818 | CTD | |
| 1121 | Monoplegia | SIDER | ||
| 1122 | Multiple Myeloma | CTD OFFSIDES | ||
| 1123 | Multiple Pulmonary Nodules | 3310943 | CTD | |
| 1124 | Multiple Sclerosis | 1237376 2843795 | CTD | |
| 1125 | Muscle Cramp | 17501951 | CTD | |
| 1126 | Muscle Weakness | CTD OFFSIDES | ||
| 1127 | Muscular Atrophy | CTD | ||
| 1128 | Myelodysplasia | OFFSIDES | ||
| 1129 | Myocardial rupture | SIDER | ||
| 1130 | Myoglobinuria | 3288755 | CTD | |
| 1131 | Narcotic intoxication | OFFSIDES | ||
| 1132 | Nephritis, Interstitial | CTD | ||
| 1133 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 1134 | Nephrolithiasis | OFFSIDES | ||
| 1135 | Nephrosis, congenital | 1867984 | CTD | |
| 1136 | Nephrosis | 4961747 | CTD | |
| 1137 | Nervous tension | OFFSIDES | ||
| 1138 | Neuritis | SIDER | ||
| 1139 | Neurocysticercosis | 11565520 | CTD | |
| 1140 | Neurologic Manifestations | 9438656 17501951 | CTD | |
| 1141 | Neuromuscular Diseases | 5254045 | CTD | |
| 1142 | Neuropathy | SIDER | ||
| 1143 | Nitrogen balance negative | SIDER | ||
| 1144 | Nocardia Infections | 16248868 | CTD | |
| 1145 | Nodule on extremity | OFFSIDES | ||
| 1146 | Non-cardiac chest pain | OFFSIDES | ||
| 1147 | Ocular Hypertension | Canada Vigilance: 1 | 1301798 2263031 12689911 | CTD Canada Vigilance |
| 1148 | Oligohydramnios | OFFSIDES | ||
| 1149 | Oral Ulcer | 6937637 | CTD | |
| 1150 | Oral fungal infection | OFFSIDES | ||
| 1151 | Oral infection | OFFSIDES | ||
| 1152 | Oropharyngeal candidiasis | SIDER | ||
| 1153 | Orthopnea | OFFSIDES | ||
| 1154 | Osteitis Deformans | OFFSIDES | ||
| 1155 | Osteosclerosis | 3039073 | CTD | |
| 1156 | Overweight | OFFSIDES | ||
| 1157 | PROTHROMBIN TIME | OFFSIDES | ||
| 1158 | Panniculitis, Lupus Erythematosus | 2985516 | CTD | |
| 1159 | Panniculitis, Peritoneal | 18361473 | CTD | |
| 1160 | Panniculitis | OFFSIDES | ||
| 1161 | Panophthalmitis | SIDER | ||
| 1162 | Paraparesis | SIDER | ||
| 1163 | Paresthesia | 3544376 4608355 5356550 | CTD | |
| 1164 | Pathological fracture | Canada Vigilance: 2 | Canada Vigilance | |
| 1165 | Peptic Ulcer Perforation | Canada Vigilance: 1 | Canada Vigilance | |
| 1166 | Peptic Ulcer | SIDER | ||
| 1167 | Pericardial effusion | OFFSIDES | ||
| 1168 | Peripheral Nervous System Diseases | 6937637 20807892 20874823 | CTD | |
| 1169 | Plaque, Atherosclerotic | 16550133 | CTD | |
| 1170 | Platybasia | OFFSIDES | ||
| 1171 | Polyarthritis | Canada Vigilance: 1 | Canada Vigilance | |
| 1172 | Polyneuropathy | OFFSIDES | ||
| 1173 | Polyomavirus Infections | 19584685 | CTD | |
| 1174 | Postmenopausal bleeding | OFFSIDES | ||
| 1175 | Postoperative Complications | 4371370 6351368 7608474 | CTD | |
| 1176 | Potassium Deficiency | SIDER | ||
| 1177 | Potassium increased | SIDER | ||
| 1178 | Precursor B-Cell Lymphoblastic Leukemia-Lymphoma | 11070476 21064136 | CTD | |
| 1179 | Precursor T-Cell Lymphoblastic Leukemia-Lymphoma | 20167372 | CTD | |
| 1180 | Prenatal Exposure Delayed Effects | 15371800 19902248 | CTD | |
| 1181 | Primary Myelofibrosis | 19720904 | CTD | |
| 1182 | Primary sequestrum | OFFSIDES | ||
| 1183 | Procedural hypotension | Canada Vigilance: 2 | Canada Vigilance | |
| 1184 | Procedural site reaction | OFFSIDES | ||
| 1185 | Prostatic Neoplasms, Castration-Resistant | 18500220 | CTD | |
| 1186 | Prostatic Neoplasms | 16731754 16888761 | CTD | |
| 1187 | Protozoan Infections, Animal | 20698940 | CTD | |
| 1188 | Proximal myopathy | SIDER | ||
| 1189 | Pseudobulbar Palsy | OFFSIDES | ||
| 1190 | Pseudotumor Cerebri | 9974094 10369621 | CTD | |
| 1191 | Psychoses, Substance-Induced | CTD | ||
| 1192 | Pulmonary Hypertension | OFFSIDES | ||
| 1193 | Pyuria | OFFSIDES | ||
| 1194 | Rectal Neoplasms | 3510835 | CTD | |
| 1195 | Rectal polyp | OFFSIDES | ||
| 1196 | Reflex Sympathetic Dystrophy | 8156963 16986675 | CTD | |
| 1197 | Renal Insufficiency | CTD | ||
| 1198 | Renal mass | OFFSIDES | ||
| 1199 | Respiratory tract congestion | OFFSIDES | ||
| 1200 | Retinal Vein Occlusion | 8176015 | CTD | |
| 1201 | Rheumatic Fever | 3944744 | CTD | |
| 1202 | Risus sardonicus | OFFSIDES | ||
| 1203 | Rosacea | SIDER | ||
| 1204 | Schizophrenia | SIDER | ||
| 1205 | Scleral thinning | SIDER | ||
| 1206 | Scleroderma | OFFSIDES | ||
| 1207 | Scurvy | 4538611 | CTD | |
| 1208 | Seizures | CTD | ||
| 1209 | Sensory integrative dysfunction | OFFSIDES | ||
| 1210 | Sequestrectomy | OFFSIDES | ||
| 1211 | Skeletal survey abnormal | OFFSIDES | ||
| 1212 | Sleep Initiation and Maintenance Disorders | 1727206 11898253 | CTD | |
| 1213 | Spondylitis | OFFSIDES | ||
| 1214 | Spondylolisthesis | OFFSIDES | ||
| 1215 | Steroid acne | SIDER | ||
| 1216 | Steroid diabetes | Canada Vigilance: 3 | Canada Vigilance | |
| 1217 | Steroid psychosis | SIDER | ||
| 1218 | Stevens-Johnson Syndrome | 3944744 | CTD | |
| 1219 | Subcutaneous nodule | OFFSIDES | ||
| 1220 | Substance Withdrawal Syndrome | CTD | ||
| 1221 | Substance-Related Disorders | 4700331 8739013 9339886 | CTD | |
| 1222 | Supraventricular tachycardia | OFFSIDES | ||
| 1223 | Synovial Cyst | OFFSIDES | ||
| 1224 | Systemic mycosis | OFFSIDES | ||
| 1225 | Tendinitis | OFFSIDES | ||
| 1226 | Therapeutic product effect incomplete | Canada Vigilance: 2 | Canada Vigilance | |
| 1227 | Therapeutic product ineffective | Canada Vigilance: 2 | Canada Vigilance | |
| 1228 | Thermal burn | Canada Vigilance: 1 | Canada Vigilance | |
| 1229 | Thoracic vertebral fracture | Canada Vigilance: 1 | Canada Vigilance | |
| 1230 | Thromboembolism | 4746085 | CTD SIDER | |
| 1231 | Thrombophlebitis | OFFSIDES SIDER | ||
| 1232 | Thyroid Diseases | 4711275 | CTD | |
| 1233 | Thyrotoxic periodic paralysis | OFFSIDES | ||
| 1234 | Tooth Erosion | OFFSIDES | ||
| 1235 | Tooth Extraction | OFFSIDES | ||
| 1236 | Toxoplasmosis | 5120183 | CTD | |
| 1237 | Trauma | SIDER | ||
| 1238 | Urinary Retention | Canada Vigilance: 1 | Canada Vigilance | |
| 1239 | Urination Disorders | 9017778 | CTD | |
| 1240 | Urine output increased | Canada Vigilance: 1 | Canada Vigilance | |
| 1241 | Uveomeningoencephalitic Syndrome | 20177954 | CTD | |
| 1242 | Vascular purpura | SIDER | ||
| 1243 | Vasculitis, Leukocytoclastic, Cutaneous | 3091170 11069541 16422373 | CTD | |
| 1244 | Ventricular Dysfunction | 2707913 | CTD | |
| 1245 | Ventricular hypokinesia | OFFSIDES | ||
| 1246 | Vertebroplasty | OFFSIDES | ||
| 1247 | Vision Disorders | 443085 | CTD | |
| 1248 | Waldenstrom Macroglobulinemia | 16432856 | CTD | |
| 1249 | Water-Electrolyte Imbalance | 5025095 | CTD | |
| 1250 | Weight Gain | CTD OFFSIDES | ||
| 1251 | White blood cell count abnormal | OFFSIDES | ||
| 1252 | Whole blood transfusion | OFFSIDES | ||
| 1253 | Wrong technique in drug usage process | OFFSIDES | ||
| 1254 | anaphylaxis | 1147448 | CTD | |
| 1255 | effusion | OFFSIDES | ||
| 1256 | kyphosis | OFFSIDES | ||
| 1257 | leiomyosarcoma | 7844616 12748258 | CTD | |
| 1258 | leukemia | 3875694 4166870 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.