NuvaRing
(MXDOOIVQXATHKU-RYVPXURESA-N)
Structure
- SMILES
- C#C[C@]1(O)CC[C@@H]2[C@]1(CC)CC(=C)[C@H]1[C@H]2CCC2=CC(=O)CC[C@H]12.C#C[C@]1(O)CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCc2c1ccc(c2)O
- Molecular Formula:
- C42H52O4
- Molecular Weight:
- 620.860
- Log P:
- 7.6613
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 3
- TPSA:
- 77.76
- CAS Number(s):
- 131562-74-8
Synonym(s)
1.
NuvaRing
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pulmonary Embolism | FAERS: 4496 Canada Vigilance: 50 | Canada Vigilance US FAERS | |
| 2 | Deep Vein Thrombosis | FAERS: 2972 Canada Vigilance: 18 | Canada Vigilance US FAERS | |
| 3 | Inappropriate schedule of drug administration | FAERS: 2223 | US FAERS | |
| 4 | Device expulsion | FAERS: 1185 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 5 | No adverse event | FAERS: 991 | US FAERS | |
| 6 | Incorrect drug administration duration | FAERS: 965 | OFFSIDES US FAERS | |
| 7 | Headache | FAERS: 830 Canada Vigilance: 12 | Canada Vigilance SIDER US FAERS | |
| 8 | Metrorrhagia | FAERS: 797 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 9 | Anxiety | FAERS: 681 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 10 | Thrombosis | FAERS: 651 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 11 | Nausea | FAERS: 589 Canada Vigilance: 9 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 12 | Cerebrovascular accident | FAERS: 497 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 13 | Product quality issue | FAERS: 496 | US FAERS | |
| 14 | Menorrhagia | FAERS: 471 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 15 | Chest Pain | FAERS: 416 Canada Vigilance: 8 | Canada Vigilance OFFSIDES US FAERS | |
| 16 | Pain | FAERS: 410 Canada Vigilance: 7 | Canada Vigilance OFFSIDES US FAERS | |
| 17 | Maternal exposure before pregnancy | FAERS: 394 | US FAERS | |
| 18 | Urinary tract infection | FAERS: 377 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 19 | Pneumonia | FAERS: 370 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Back Pain | FAERS: 355 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 21 | Pulmonary Infarction | FAERS: 351 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 22 | Pregnancy with contraceptive device | FAERS: 347 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 23 | Abdominal Pain | FAERS: 343 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 24 | Fatigue | FAERS: 326 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 25 | Dizziness | FAERS: 303 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 26 | Vomiting | FAERS: 294 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 27 | Asthma | FAERS: 260 | OFFSIDES US FAERS | |
| 28 | Vaginal Discharge | FAERS: 249 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 29 | Device breakage | FAERS: 241 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 30 | Abnormal withdrawal bleeding | FAERS: 213 | US FAERS | |
| 31 | Arthralgia | FAERS: 213 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 32 | Cervical dysplasia | FAERS: 200 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 33 | Medical device discomfort | FAERS: 198 | OFFSIDES SIDER US FAERS | |
| 34 | Adverse event | FAERS: 192 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Bronchitis | FAERS: 192 | OFFSIDES SIDER US FAERS | |
| 36 | Palpitations | FAERS: 190 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 37 | Emotional disorder | FAERS: 181 | OFFSIDES US FAERS | |
| 38 | Constipation | FAERS: 173 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 39 | Atelectasis | FAERS: 166 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 40 | Incorrect product storage | FAERS: 155 | US FAERS | |
| 41 | Intentional medical device removal by patient | FAERS: 146 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Sinusitis | FAERS: 143 | OFFSIDES SIDER US FAERS | |
| 43 | Hypothyroidism | FAERS: 142 | US FAERS | |
| 44 | Vulvovaginal discomfort | FAERS: 140 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 45 | Syncope | FAERS: 138 | US FAERS | |
| 46 | Product use issue | FAERS: 137 | US FAERS | |
| 47 | Stress | FAERS: 137 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 48 | Malaise | FAERS: 128 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 49 | Drug exposure during pregnancy | FAERS: 125 | OFFSIDES US FAERS | |
| 50 | Swelling | FAERS: 120 | US FAERS | |
| 51 | Vena cava filter insertion | FAERS: 119 | US FAERS | |
| 52 | Mood swings | FAERS: 112 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 53 | Nephrolithiasis | FAERS: 112 | OFFSIDES US FAERS | |
| 54 | Asthenia | FAERS: 111 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 55 | Cholelithiasis | FAERS: 110 | US FAERS | |
| 56 | Pregnancy | FAERS: 110 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 57 | Drug dose omission | FAERS: 109 | OFFSIDES US FAERS | |
| 58 | Tachycardia | FAERS: 109 | US FAERS | |
| 59 | Drug administration error | FAERS: 108 | US FAERS | |
| 60 | Product use in unapproved indication | FAERS: 107 | US FAERS | |
| 61 | Pelvic Pain | FAERS: 102 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 62 | Leukocytosis | FAERS: 101 | US FAERS | |
| 63 | Infection | FAERS: 99 | OFFSIDES SIDER US FAERS | |
| 64 | Product storage error | FAERS: 98 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Neck Pain | FAERS: 96 | US FAERS | |
| 66 | Obesity | FAERS: 96 | US FAERS | |
| 67 | Sinus Tachycardia | FAERS: 96 | US FAERS | |
| 68 | Musculoskeletal Pain | FAERS: 94 | OFFSIDES US FAERS | |
| 69 | Alopecia | FAERS: 89 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 70 | Drug ineffective | FAERS: 89 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 71 | Impaired work ability | FAERS: 88 Canada Vigilance: 5 | Canada Vigilance OFFSIDES US FAERS | |
| 72 | Weight decreased | FAERS: 87 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 73 | Discomfort | FAERS: 86 | SIDER US FAERS | |
| 74 | Muscle strain | FAERS: 86 | OFFSIDES US FAERS | |
| 75 | Myocardial Infarction | FAERS: 86 | US FAERS | |
| 76 | Maternal exposure during pregnancy | FAERS: 85 | US FAERS | |
| 77 | Pulmonary Hypertension | FAERS: 85 | OFFSIDES US FAERS | |
| 78 | Acne | FAERS: 84 | SIDER US FAERS | |
| 79 | Drug prescribing error | FAERS: 84 | US FAERS | |
| 80 | Blood cholesterol increased | FAERS: 83 | US FAERS | |
| 81 | Pleurisy | FAERS: 83 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 82 | Urticaria | FAERS: 83 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 83 | Medical device site discomfort | FAERS: 82 | US FAERS | |
| 84 | Irritable Bowel Syndrome | FAERS: 81 | US FAERS | |
| 85 | Musculoskeletal chest pain | FAERS: 79 | OFFSIDES US FAERS | |
| 86 | Vaginal contraceptive device expelled | FAERS: 79 | OFFSIDES SIDER US FAERS | |
| 87 | Feeling abnormal | FAERS: 78 | SIDER US FAERS | |
| 88 | Device Failure | FAERS: 77 | OFFSIDES US FAERS | |
| 89 | Cardiac Arrest | FAERS: 76 | US FAERS | |
| 90 | Hypersensitivity | FAERS: 76 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 91 | Cerebral Infarction | FAERS: 75 | US FAERS | |
| 92 | Device difficult to use | FAERS: 73 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 93 | Breast tenderness | FAERS: 72 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 94 | Phlebitis | FAERS: 71 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 95 | Overdose | FAERS: 70 | US FAERS | |
| 96 | Dyspareunia | FAERS: 68 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 97 | Endometriosis | FAERS: 68 | OFFSIDES US FAERS | |
| 98 | Medical device complication | FAERS: 68 | OFFSIDES SIDER US FAERS | |
| 99 | Nasopharyngitis | FAERS: 68 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 100 | Cellulitis | FAERS: 67 | OFFSIDES US FAERS | |
| 101 | Pregnancy on contraceptive | FAERS: 67 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 102 | Vulvovaginal mycotic infection | FAERS: 67 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 103 | Antiphospholipid antibodies positive | FAERS: 66 | OFFSIDES US FAERS | |
| 104 | Dehydration | FAERS: 66 | OFFSIDES US FAERS | |
| 105 | Hypotension | FAERS: 66 | US FAERS | |
| 106 | Pleuritic pain | FAERS: 66 | US FAERS | |
| 107 | Post-Traumatic Stress Disorder | FAERS: 66 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 108 | Diabetes Mellitus | FAERS: 65 | US FAERS | |
| 109 | Cystitis | FAERS: 63 | SIDER US FAERS | |
| 110 | Pharyngitis | FAERS: 63 | SIDER US FAERS | |
| 111 | Pruritus | FAERS: 63 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 112 | Myalgia | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 113 | Presyncope | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 114 | Thrombectomy | FAERS: 61 | US FAERS | |
| 115 | Thrombophlebitis | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 116 | Lymphadenopathy | FAERS: 60 | US FAERS | |
| 117 | Oropharyngeal pain | FAERS: 59 | OFFSIDES US FAERS | |
| 118 | Portal Vein Thrombosis | FAERS: 58 | US FAERS | |
| 119 | Tonsillectomy | FAERS: 58 | US FAERS | |
| 120 | Ectopic Pregnancy | FAERS: 57 | US FAERS | |
| 121 | Chest discomfort | FAERS: 56 | US FAERS | |
| 122 | Dysuria | FAERS: 56 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 123 | Fibrin D dimer increased | FAERS: 55 | US FAERS | |
| 124 | Peripheral swelling | FAERS: 55 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 125 | Anticoagulation drug level below therapeutic | FAERS: 54 | US FAERS | |
| 126 | Joint injury | FAERS: 54 | OFFSIDES US FAERS | |
| 127 | Accidental underdose | FAERS: 52 | US FAERS | |
| 128 | Cerebral Thrombosis | FAERS: 51 | OFFSIDES US FAERS | |
| 129 | Embolism | FAERS: 51 | OFFSIDES US FAERS | |
| 130 | Epistaxis | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 131 | Limb injury | FAERS: 51 | OFFSIDES US FAERS | |
| 132 | Pyelonephritis | FAERS: 50 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 133 | Fibromyalgia | FAERS: 49 | US FAERS | |
| 134 | Poor quality drug administered | FAERS: 49 | US FAERS | |
| 135 | Respiratory Failure | FAERS: 49 | OFFSIDES US FAERS | |
| 136 | Angina Pectoris | FAERS: 48 | US FAERS | |
| 137 | Dyspepsia | FAERS: 48 | US FAERS | |
| 138 | Venous Thrombosis | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 139 | Visual Impairment | FAERS: 48 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 140 | Cyst | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 141 | Night sweats | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 142 | Vulvovaginal pruritus | FAERS: 46 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 143 | Cardiomegaly | FAERS: 45 | US FAERS | |
| 144 | Inappropriate schedule of product administration | FAERS: 45 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 145 | Crying | FAERS: 44 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 146 | Gastritis | FAERS: 44 | US FAERS | |
| 147 | Influenza | FAERS: 44 | US FAERS | |
| 148 | Antiphospholipid Syndrome | FAERS: 43 | OFFSIDES US FAERS | |
| 149 | Pulmonary thrombosis | FAERS: 43 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 150 | Vertigo | FAERS: 43 | US FAERS | |
| 151 | Vitamin D Deficiency | FAERS: 42 | US FAERS | |
| 152 | Flank Pain | FAERS: 41 | OFFSIDES US FAERS | |
| 153 | Sciatica | FAERS: 41 | US FAERS | |
| 154 | Bipolar Disorder | FAERS: 40 | OFFSIDES US FAERS | |
| 155 | Supraventricular tachycardia | FAERS: 40 | OFFSIDES US FAERS | |
| 156 | Vulvovaginal pain | FAERS: 40 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 157 | Appendicitis | FAERS: 39 | US FAERS | |
| 158 | Product shape issue | FAERS: 39 | US FAERS | |
| 159 | Acute myocardial infarction | FAERS: 38 | OFFSIDES US FAERS | |
| 160 | Hysterectomy | FAERS: 38 | US FAERS | |
| 161 | Joint swelling | FAERS: 38 | US FAERS | |
| 162 | Vulvovaginal dryness | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 163 | Vulvovaginal swelling | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 164 | Peripheral embolism | FAERS: 37 | US FAERS | |
| 165 | Somnolence | FAERS: 37 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 166 | Vulvovaginal burning sensation | FAERS: 37 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 167 | Amnesia | FAERS: 36 | OFFSIDES US FAERS | |
| 168 | Anger | FAERS: 36 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 169 | Chills | FAERS: 36 | US FAERS | |
| 170 | Eczema | FAERS: 36 | SIDER US FAERS | |
| 171 | Renal cyst | FAERS: 36 | OFFSIDES US FAERS | |
| 172 | Incorrect product administration duration | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 173 | Pelvic Inflammatory Disease | FAERS: 35 | US FAERS | |
| 174 | Blood glucose increased | FAERS: 34 | US FAERS | |
| 175 | Carpal Tunnel Syndrome | FAERS: 34 | US FAERS | |
| 176 | May-Thurner Syndrome | FAERS: 34 | US FAERS | |
| 177 | Venous Insufficiency | FAERS: 34 | OFFSIDES US FAERS | |
| 178 | Aneurysm | FAERS: 33 | OFFSIDES US FAERS | |
| 179 | Bacterial Vaginosis | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 180 | Medication Error | FAERS: 33 | US FAERS | |
| 181 | Otitis Media | FAERS: 33 | US FAERS | |
| 182 | Pelvic venous thrombosis | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 183 | Tremor | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 184 | Arthropod bite | FAERS: 32 | OFFSIDES US FAERS | |
| 185 | Depressed mood | FAERS: 32 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 186 | Drug exposure before pregnancy | FAERS: 32 | OFFSIDES US FAERS | |
| 187 | Factor V Leiden mutation | FAERS: 32 | OFFSIDES US FAERS | |
| 188 | Protein S Deficiency | FAERS: 32 | US FAERS | |
| 189 | Tension Headache | FAERS: 32 | OFFSIDES US FAERS | |
| 190 | Thyroid Neoplasm | FAERS: 32 | US FAERS | |
| 191 | nervous system disorder | FAERS: 32 | SIDER US FAERS | |
| 192 | Abdominal discomfort | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 193 | Circumstance or information capable of leading to medication error | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 194 | Lobar Pneumonia | FAERS: 31 | US FAERS | |
| 195 | Burning sensation | FAERS: 30 | US FAERS | |
| 196 | Gastroenteritis | FAERS: 30 | OFFSIDES US FAERS | |
| 197 | Intervertebral Disc Degeneration | FAERS: 30 | OFFSIDES US FAERS | |
| 198 | Memory impairment | FAERS: 30 | US FAERS | |
| 199 | Musculoskeletal discomfort | FAERS: 30 | OFFSIDES US FAERS | |
| 200 | Angioplasty | FAERS: 29 | US FAERS | |
| 201 | Atrial Fibrillation | FAERS: 29 | US FAERS | |
| 202 | Bradycardia | FAERS: 29 | OFFSIDES US FAERS | |
| 203 | Vaginal mycosis | FAERS: 29 | OFFSIDES US FAERS | |
| 204 | Ankle Fracture | FAERS: 28 | OFFSIDES US FAERS | |
| 205 | Erythema | FAERS: 28 | US FAERS | |
| 206 | Hormone level abnormal | FAERS: 28 | US FAERS | |
| 207 | Synovial Cyst | FAERS: 28 | OFFSIDES US FAERS | |
| 208 | Thrombocytopenia | FAERS: 28 | US FAERS | |
| 209 | Venous stent insertion | FAERS: 28 | US FAERS | |
| 210 | Acute sinusitis | FAERS: 27 | OFFSIDES US FAERS | |
| 211 | Arthritis | FAERS: 27 | US FAERS | |
| 212 | Drug abuse | FAERS: 27 | US FAERS | |
| 213 | Epilepsy | FAERS: 27 | US FAERS | |
| 214 | Iron deficiency | FAERS: 27 | US FAERS | |
| 215 | Limb discomfort | FAERS: 27 | OFFSIDES US FAERS | |
| 216 | Mental status changes | FAERS: 27 | OFFSIDES US FAERS | |
| 217 | Emotional distress | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 218 | Photophobia | FAERS: 26 | US FAERS | |
| 219 | Premenstrual syndrome | FAERS: 26 | SIDER US FAERS | |
| 220 | Cervix carcinoma | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 221 | Migraine with Aura | FAERS: 25 | OFFSIDES US FAERS | |
| 222 | Protein C Deficiency | FAERS: 25 | OFFSIDES US FAERS | |
| 223 | Unevaluable event | FAERS: 25 | OFFSIDES US FAERS | |
| 224 | Lung consolidation | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 225 | Multiple Sclerosis | FAERS: 24 | US FAERS | |
| 226 | Nervousness | FAERS: 24 | US FAERS | |
| 227 | Pancreatitis | FAERS: 24 | US FAERS | |
| 228 | Panic Disorder | FAERS: 24 | OFFSIDES US FAERS | |
| 229 | Peripheral venous disease | FAERS: 24 | US FAERS | |
| 230 | Vulvovaginal injury | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 231 | Acute respiratory failure | FAERS: 23 | US FAERS | |
| 232 | Aphasia | FAERS: 23 | US FAERS | |
| 233 | Blood potassium decreased | FAERS: 23 | OFFSIDES US FAERS | |
| 234 | Cholecystitis | FAERS: 23 | US FAERS | |
| 235 | Hypoxia | FAERS: 23 | OFFSIDES US FAERS | |
| 236 | Incorrect storage of drug | FAERS: 23 | US FAERS | |
| 237 | Left Ventricular Hypertrophy | FAERS: 23 | OFFSIDES US FAERS | |
| 238 | Product physical issue | FAERS: 23 | US FAERS | |
| 239 | Bunion operation | FAERS: 22 | US FAERS | |
| 240 | Conjunctivitis | FAERS: 22 | US FAERS | |
| 241 | Hydronephrosis | FAERS: 22 | OFFSIDES US FAERS | |
| 242 | Inflammation | FAERS: 22 | US FAERS | |
| 243 | Leukopenia | FAERS: 22 | US FAERS | |
| 244 | Pericardial effusion | FAERS: 22 | OFFSIDES US FAERS | |
| 245 | Pre-Eclampsia | FAERS: 22 | US FAERS | |
| 246 | Respiratory arrest | FAERS: 22 | US FAERS | |
| 247 | Rheumatoid Arthritis | FAERS: 22 | US FAERS | |
| 248 | Arthropathy | FAERS: 21 | US FAERS | |
| 249 | Arthroscopy | FAERS: 21 | US FAERS | |
| 250 | Coital bleeding | FAERS: 21 | SIDER US FAERS | |
| 251 | Gastric Bypass | FAERS: 21 | US FAERS | |
| 252 | Toxic Shock Syndrome | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 253 | Bronchospasm | FAERS: 20 | US FAERS | |
| 254 | Cerebellar infarction | FAERS: 20 | US FAERS | |
| 255 | Colitis | FAERS: 20 | US FAERS | |
| 256 | Device dislocation | FAERS: 20 | US FAERS | |
| 257 | Loop electrosurgical excision procedure | FAERS: 20 | US FAERS | |
| 258 | Poor quality device used | FAERS: 20 | US FAERS | |
| 259 | Protein S decreased | FAERS: 20 | OFFSIDES US FAERS | |
| 260 | Pulmonary congestion | FAERS: 20 | OFFSIDES US FAERS | |
| 261 | Snoring | FAERS: 20 | OFFSIDES US FAERS | |
| 262 | Therapeutic response unexpected | FAERS: 20 | US FAERS | |
| 263 | Wrong technique in drug usage process | FAERS: 20 | US FAERS | |
| 264 | Abscess | FAERS: 19 | US FAERS | |
| 265 | Drug Dependence | FAERS: 19 | US FAERS | |
| 266 | Genital Herpes | FAERS: 19 | OFFSIDES US FAERS | |
| 267 | Hemiparesis | FAERS: 19 | US FAERS | |
| 268 | Ligament rupture | FAERS: 19 | OFFSIDES US FAERS | |
| 269 | Metabolic acidosis | FAERS: 19 | US FAERS | |
| 270 | Paranoia | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 271 | Retinal Vein Occlusion | FAERS: 19 | US FAERS | |
| 272 | Salpingitis | FAERS: 19 | OFFSIDES US FAERS | |
| 273 | Tonsillitis | FAERS: 19 | OFFSIDES US FAERS | |
| 274 | Activities of daily living impaired | FAERS: 18 | OFFSIDES US FAERS | |
| 275 | Blindness | FAERS: 18 | US FAERS | |
| 276 | Blood triglycerides increased | FAERS: 18 | US FAERS | |
| 277 | Coagulation factor VIII level increased | FAERS: 18 | OFFSIDES US FAERS | |
| 278 | Fibroadenoma of breast | FAERS: 18 | OFFSIDES SIDER US FAERS | |
| 279 | Hilar lymphadenopathy | FAERS: 18 | OFFSIDES US FAERS | |
| 280 | Increased tendency to bruise | FAERS: 18 | US FAERS | |
| 281 | Infectious Mononucleosis | FAERS: 18 | OFFSIDES US FAERS | |
| 282 | Intracranial Aneurysm | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 283 | Laceration | FAERS: 18 | OFFSIDES US FAERS | |
| 284 | Pneumonitis | FAERS: 18 | US FAERS | |
| 285 | Sinus headache | FAERS: 18 | US FAERS | |
| 286 | Transaminases increased | FAERS: 18 | OFFSIDES US FAERS | |
| 287 | Upper-airway cough syndrome | FAERS: 18 | US FAERS | |
| 288 | Uterine Polyp | FAERS: 18 | OFFSIDES US FAERS | |
| 289 | Wrong technique in product usage process | FAERS: 18 | US FAERS | |
| 290 | Accidental overdose | FAERS: 17 | US FAERS | |
| 291 | Cyanosis | FAERS: 17 | OFFSIDES US FAERS | |
| 292 | Human papilloma virus test positive | FAERS: 17 | OFFSIDES US FAERS | |
| 293 | Meniscus injury | FAERS: 17 | US FAERS | |
| 294 | Pregnancy with implant contraceptive | FAERS: 17 | US FAERS | |
| 295 | Sarcoidosis | FAERS: 17 | OFFSIDES US FAERS | |
| 296 | Adnexa uteri pain | FAERS: 16 | US FAERS | |
| 297 | Economic problem | FAERS: 16 | OFFSIDES US FAERS | |
| 298 | Expired product administered | FAERS: 16 | US FAERS | |
| 299 | Psoriasis | FAERS: 16 | US FAERS | |
| 300 | Pulmonary Fibrosis | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 301 | Skin lesion | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 302 | Venous thrombosis limb | FAERS: 16 | US FAERS | |
| 303 | Vertebral Artery Dissection | FAERS: 16 | US FAERS | |
| 304 | Anaphylactic shock | FAERS: 15 | US FAERS | |
| 305 | Carotid artery occlusion | FAERS: 15 | OFFSIDES US FAERS | |
| 306 | Cavernous Sinus Thrombosis | FAERS: 15 | OFFSIDES US FAERS | |
| 307 | Disseminated Intravascular Coagulation | FAERS: 15 | US FAERS | |
| 308 | Electrocardiogram abnormal | FAERS: 15 | US FAERS | |
| 309 | Limb operation | FAERS: 15 | US FAERS | |
| 310 | Respiratory distress | FAERS: 15 | US FAERS | |
| 311 | Restless Legs Syndrome | FAERS: 15 | US FAERS | |
| 312 | Right ventricular failure | FAERS: 15 | US FAERS | |
| 313 | Splenomegaly | FAERS: 15 | US FAERS | |
| 314 | Urinary Retention | FAERS: 15 | US FAERS | |
| 315 | Viral upper respiratory tract infection | FAERS: 15 | US FAERS | |
| 316 | Withdrawal bleeding irregular | FAERS: 15 | OFFSIDES US FAERS | |
| 317 | Back disorder | FAERS: 14 | US FAERS | |
| 318 | Breast Feeding | FAERS: 14 | US FAERS | |
| 319 | Complication associated with device | FAERS: 14 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 320 | Contraceptive device complication | FAERS: 14 | OFFSIDES SIDER US FAERS | |
| 321 | Dermatitis | FAERS: 14 | SIDER US FAERS | |
| 322 | Diplopia | FAERS: 14 | OFFSIDES US FAERS | |
| 323 | Encephalomalacia | FAERS: 14 | OFFSIDES US FAERS | |
| 324 | Escherichia urinary tract infection | FAERS: 14 | OFFSIDES US FAERS | |
| 325 | Lethargy | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 326 | Neuralgia | FAERS: 14 | OFFSIDES US FAERS | |
| 327 | Periarthritis | FAERS: 14 | US FAERS | |
| 328 | Poor quality sleep | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 329 | Post procedural complication | FAERS: 14 | OFFSIDES US FAERS | |
| 330 | Pulmonary granuloma | FAERS: 14 | US FAERS | |
| 331 | Rotator cuff syndrome | FAERS: 14 | US FAERS | |
| 332 | Suicide attempt | FAERS: 14 | US FAERS | |
| 333 | Tinnitus | FAERS: 14 | US FAERS | |
| 334 | Unresponsive to stimuli | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 335 | Urinary Incontinence | FAERS: 14 | US FAERS | |
| 336 | Blood urine present | FAERS: 13 | US FAERS | |
| 337 | Breast Cyst | FAERS: 13 | OFFSIDES US FAERS | |
| 338 | Colposcopy | FAERS: 13 | US FAERS | |
| 339 | Disease recurrence | FAERS: 13 | OFFSIDES US FAERS | |
| 340 | Dysthymic Disorder | FAERS: 13 | OFFSIDES US FAERS | |
| 341 | Factor V deficiency | FAERS: 13 | OFFSIDES US FAERS | |
| 342 | Hyperthyroidism | FAERS: 13 | US FAERS | |
| 343 | Intentional product misuse | FAERS: 13 | US FAERS | |
| 344 | Joint sprain | FAERS: 13 | OFFSIDES US FAERS | |
| 345 | Lyme Disease | FAERS: 13 | US FAERS | |
| 346 | Musculoskeletal stiffness | FAERS: 13 | OFFSIDES US FAERS | |
| 347 | Narcolepsy | FAERS: 13 | US FAERS | |
| 348 | Product dose omission | FAERS: 13 | US FAERS | |
| 349 | Sepsis | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 350 | Sinus polyp | FAERS: 13 | OFFSIDES US FAERS | |
| 351 | Temperature intolerance | FAERS: 13 | US FAERS | |
| 352 | Thalamic infarction | FAERS: 13 | US FAERS | |
| 353 | Umbilical hernia | FAERS: 13 | US FAERS | |
| 354 | Venous occlusion | FAERS: 13 | OFFSIDES US FAERS | |
| 355 | Abdominal tenderness | FAERS: 12 | US FAERS | |
| 356 | Adenoidectomy | FAERS: 12 | US FAERS | |
| 357 | Adnexa uteri cyst | FAERS: 12 | OFFSIDES US FAERS | |
| 358 | Alanine Aminotransferase Increased | FAERS: 12 | US FAERS | |
| 359 | Blood creatinine increased | FAERS: 12 | OFFSIDES US FAERS | |
| 360 | Bursitis | FAERS: 12 | US FAERS | |
| 361 | Disorientation | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 362 | Drug ineffective for unapproved indication | FAERS: 12 | US FAERS | |
| 363 | Embolic stroke | FAERS: 12 | US FAERS | |
| 364 | Flatulence | FAERS: 12 | OFFSIDES US FAERS | |
| 365 | General physical condition abnormal | FAERS: 12 | US FAERS | |
| 366 | Gestational Diabetes | FAERS: 12 | US FAERS | |
| 367 | Heparin-induced thrombocytopenia | FAERS: 12 | US FAERS | |
| 368 | Hepatitis | FAERS: 12 | US FAERS | |
| 369 | Hirsutism | FAERS: 12 | US FAERS | |
| 370 | Hypocoagulable state | FAERS: 12 | OFFSIDES US FAERS | |
| 371 | Immobile | FAERS: 12 | OFFSIDES US FAERS | |
| 372 | Implant site fibrosis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 373 | Infarction | FAERS: 12 | US FAERS | |
| 374 | Nerve injury | FAERS: 12 | US FAERS | |
| 375 | Nodule | FAERS: 12 | US FAERS | |
| 376 | Quality of life decreased | FAERS: 12 | OFFSIDES US FAERS | |
| 377 | Rosacea | FAERS: 12 | US FAERS | |
| 378 | Sinus operation | FAERS: 12 | US FAERS | |
| 379 | Spinal column stenosis | FAERS: 12 | OFFSIDES US FAERS | |
| 380 | Spinal fusion surgery | FAERS: 12 | US FAERS | |
| 381 | Splenic vein thrombosis | FAERS: 12 | US FAERS | |
| 382 | Ventricular Fibrillation | FAERS: 12 | US FAERS | |
| 383 | Antiphospholipid Antibodies | FAERS: 11 | OFFSIDES US FAERS | |
| 384 | Blood albumin decreased | FAERS: 11 | OFFSIDES US FAERS | |
| 385 | Blood prolactin increased | FAERS: 11 | US FAERS | |
| 386 | Coronary Artery Disease | FAERS: 11 | US FAERS | |
| 387 | Diverticulum | FAERS: 11 | US FAERS | |
| 388 | Ecchymosis | FAERS: 11 | US FAERS | |
| 389 | Essential Hypertension | FAERS: 11 | OFFSIDES US FAERS | |
| 390 | Excoriation | FAERS: 11 | OFFSIDES US FAERS | |
| 391 | Eye pain | FAERS: 11 | US FAERS | |
| 392 | Food Allergy | FAERS: 11 | US FAERS | |
| 393 | Hepatomegaly | FAERS: 11 | US FAERS | |
| 394 | Hyperventilation | FAERS: 11 | OFFSIDES US FAERS | |
| 395 | Low density lipoprotein increased | FAERS: 11 | US FAERS | |
| 396 | Lumbar radiculopathy | FAERS: 11 | US FAERS | |
| 397 | Macular degeneration | FAERS: 11 | US FAERS | |
| 398 | Medical device change | FAERS: 11 | OFFSIDES US FAERS | |
| 399 | Multiple allergies | FAERS: 11 | OFFSIDES US FAERS | |
| 400 | Muscle tightness | FAERS: 11 | US FAERS | |
| 401 | Ovarian vein thrombosis | FAERS: 11 | US FAERS | |
| 402 | Pneumothorax | FAERS: 11 | US FAERS | |
| 403 | Productive Cough | FAERS: 11 | US FAERS | |
| 404 | Septic Shock | FAERS: 11 | US FAERS | |
| 405 | Sinus bradycardia | FAERS: 11 | OFFSIDES US FAERS | |
| 406 | Tooth Extraction | FAERS: 11 | US FAERS | |
| 407 | Vaginal burning sensation | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 408 | furuncle | FAERS: 11 | OFFSIDES US FAERS | |
| 409 | jaundice | FAERS: 11 | US FAERS | |
| 410 | Acute kidney injury | FAERS: 10 | US FAERS | |
| 411 | Bronchial Hyperreactivity | FAERS: 10 | US FAERS | |
| 412 | Cerebral artery occlusion | FAERS: 10 | OFFSIDES US FAERS | |
| 413 | Cerebral artery stenosis | FAERS: 10 | OFFSIDES US FAERS | |
| 414 | Chlamydia test positive | FAERS: 10 | US FAERS | |
| 415 | Chronic sinusitis | FAERS: 10 | OFFSIDES US FAERS | |
| 416 | Complication of delivery | FAERS: 10 | US FAERS | |
| 417 | Complication of device insertion | FAERS: 10 | US FAERS | |
| 418 | Cystoscopy | FAERS: 10 | US FAERS | |
| 419 | Device kink | FAERS: 10 | US FAERS | |
| 420 | Diverticulitis | FAERS: 10 | US FAERS | |
| 421 | Drug screen positive | FAERS: 10 | OFFSIDES US FAERS | |
| 422 | Feeling Cold | FAERS: 10 | US FAERS | |
| 423 | Gastrointestinal infection | FAERS: 10 | US FAERS | |
| 424 | Genital discomfort | FAERS: 10 | US FAERS | |
| 425 | Ileus | FAERS: 10 | US FAERS | |
| 426 | Initial insomnia | FAERS: 10 | US FAERS | |
| 427 | Keratomileusis | FAERS: 10 | US FAERS | |
| 428 | Lower respiratory tract infection | FAERS: 10 | US FAERS | |
| 429 | Myopia | FAERS: 10 | OFFSIDES US FAERS | |
| 430 | Osteopenia | FAERS: 10 | US FAERS | |
| 431 | Patellofemoral Pain Syndrome | FAERS: 10 | US FAERS | |
| 432 | Pelvic discomfort | FAERS: 10 | SIDER US FAERS | |
| 433 | Right atrial dilatation | FAERS: 10 | OFFSIDES US FAERS | |
| 434 | Thrombocytosis | FAERS: 10 | US FAERS | |
| 435 | Troponin increased | FAERS: 10 | US FAERS | |
| 436 | Ventricular hypokinesia | FAERS: 10 | OFFSIDES US FAERS | |
| 437 | Abasia | FAERS: 9 | US FAERS | |
| 438 | Adjustment disorder with depressed mood | FAERS: 9 | US FAERS | |
| 439 | Blighted ovum | FAERS: 9 | US FAERS | |
| 440 | Candidiasis | FAERS: 9 | US FAERS | |
| 441 | Culture urine positive | FAERS: 9 | US FAERS | |
| 442 | Cyst removal | FAERS: 9 | US FAERS | |
| 443 | Device physical property issue | FAERS: 9 | US FAERS | |
| 444 | Dysarthria | FAERS: 9 | US FAERS | |
| 445 | Ectropion of cervix | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 446 | Ejection Fraction Decreased | FAERS: 9 | OFFSIDES US FAERS | |
| 447 | Electrocardiogram ST-T segment abnormal | FAERS: 9 | US FAERS | |
| 448 | Endometrial hypertrophy | FAERS: 9 | US FAERS | |
| 449 | Facial Paresis | FAERS: 9 | US FAERS | |
| 450 | Focal Nodular Hyperplasia | FAERS: 9 | OFFSIDES US FAERS | |
| 451 | Hidradenitis | FAERS: 9 | OFFSIDES US FAERS | |
| 452 | Hypersomnia | FAERS: 9 | US FAERS | |
| 453 | Incorrect route of drug administration | FAERS: 9 | US FAERS | |
| 454 | Protein C increased | FAERS: 9 | OFFSIDES US FAERS | |
| 455 | Respiratory tract congestion | FAERS: 9 | US FAERS | |
| 456 | Streptococcus test positive | FAERS: 9 | US FAERS | |
| 457 | Suppressed lactation | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 458 | Uterine spasm | FAERS: 9 | SIDER US FAERS | |
| 459 | VIIth nerve paralysis | FAERS: 9 | US FAERS | |
| 460 | Venous stenosis | FAERS: 9 | OFFSIDES US FAERS | |
| 461 | treatment failure | FAERS: 9 | OFFSIDES US FAERS | |
| 462 | Abnormal weight gain | FAERS: 8 | US FAERS | |
| 463 | Ascites | FAERS: 8 | US FAERS | |
| 464 | Blood homocysteine increased | FAERS: 8 | US FAERS | |
| 465 | Blood human chorionic gonadotropin increased | FAERS: 8 | OFFSIDES US FAERS | |
| 466 | Blood urea increased | FAERS: 8 | US FAERS | |
| 467 | Bulimia Nervosa | FAERS: 8 | US FAERS | |
| 468 | Cardiac ablation | FAERS: 8 | US FAERS | |
| 469 | Chloasma | FAERS: 8 | US FAERS | |
| 470 | Complication of device removal | FAERS: 8 | US FAERS | |
| 471 | Coronary artery embolism | FAERS: 8 | US FAERS | |
| 472 | Delirium | FAERS: 8 | US FAERS | |
| 473 | Diastolic dysfunction | FAERS: 8 | OFFSIDES US FAERS | |
| 474 | General physical health deterioration | FAERS: 8 | US FAERS | |
| 475 | Hemiplegia | FAERS: 8 | OFFSIDES US FAERS | |
| 476 | Hypoaesthesia facial | FAERS: 8 | US FAERS | |
| 477 | Intervertebral disc disorder | FAERS: 8 | OFFSIDES US FAERS | |
| 478 | Lip swelling | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 479 | Meningitis | FAERS: 8 | US FAERS | |
| 480 | Metaplasia | FAERS: 8 | OFFSIDES US FAERS | |
| 481 | Muscle Cramp | FAERS: 8 | US FAERS | |
| 482 | Myomectomy | FAERS: 8 | OFFSIDES US FAERS | |
| 483 | Nipple pain | FAERS: 8 | US FAERS | |
| 484 | Onychomycosis | FAERS: 8 | US FAERS | |
| 485 | Premature Menopause | FAERS: 8 | US FAERS | |
| 486 | Protein C decreased | FAERS: 8 | OFFSIDES US FAERS | |
| 487 | Radiculopathy | FAERS: 8 | US FAERS | |
| 488 | Ruptured ectopic pregnancy | FAERS: 8 | US FAERS | |
| 489 | Subcutaneous Abscess | FAERS: 8 | OFFSIDES US FAERS | |
| 490 | Thromboembolectomy | FAERS: 8 | US FAERS | |
| 491 | Thrombotic stroke | FAERS: 8 | OFFSIDES US FAERS | |
| 492 | Toothache | FAERS: 8 | SIDER US FAERS | |
| 493 | Vaginal pain | FAERS: 8 | SIDER US FAERS | |
| 494 | Wheezing | FAERS: 8 | US FAERS | |
| 495 | Agoraphobia | FAERS: 7 | OFFSIDES US FAERS | |
| 496 | Anorgasmia | FAERS: 7 | OFFSIDES US FAERS | |
| 497 | Atrial Flutter | FAERS: 7 | US FAERS | |
| 498 | Bronchiectasis | FAERS: 7 | US FAERS | |
| 499 | Cervical polyp | FAERS: 7 | SIDER US FAERS | |
| 500 | Cervicitis human papilloma virus | FAERS: 7 | US FAERS | |
| 501 | Clostridium difficile colitis | FAERS: 7 | US FAERS | |
| 502 | Cold sweat | FAERS: 7 | OFFSIDES US FAERS | |
| 503 | Craniectomy | FAERS: 7 | US FAERS | |
| 504 | Depressed Level of Consciousness | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 505 | Electrocardiogram ST-T change | FAERS: 7 | US FAERS | |
| 506 | Endometrial Hyperplasia | FAERS: 7 | US FAERS | |
| 507 | Erythema Nodosum | FAERS: 7 | OFFSIDES US FAERS | |
| 508 | Expired drug administered | FAERS: 7 | US FAERS | |
| 509 | Flushing | FAERS: 7 | US FAERS | |
| 510 | Food Poisoning | FAERS: 7 | OFFSIDES US FAERS | |
| 511 | Gastric ulcer | FAERS: 7 | US FAERS | |
| 512 | General symptom | FAERS: 7 | US FAERS | |
| 513 | Genital rash | FAERS: 7 | US FAERS | |
| 514 | Hepatic Vein Thrombosis | FAERS: 7 | OFFSIDES US FAERS | |
| 515 | Hypertensive crisis | FAERS: 7 | US FAERS | |
| 516 | Infertility | FAERS: 7 | US FAERS | |
| 517 | Insulin Resistance | FAERS: 7 | US FAERS | |
| 518 | Intestinal Obstruction | FAERS: 7 | US FAERS | |
| 519 | Laparoscopy | FAERS: 7 | US FAERS | |
| 520 | Left atrial dilatation | FAERS: 7 | US FAERS | |
| 521 | Low birth weight baby | FAERS: 7 | US FAERS | |
| 522 | Malnutrition | FAERS: 7 | SIDER US FAERS | |
| 523 | Nephrotic Syndrome | FAERS: 7 | OFFSIDES US FAERS | |
| 524 | Neutropenia | FAERS: 7 | US FAERS | |
| 525 | Obsessive-Compulsive Disorder | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 526 | Oophoritis | FAERS: 7 | OFFSIDES US FAERS | |
| 527 | Overweight | FAERS: 7 | US FAERS | |
| 528 | Pancytopenia | FAERS: 7 | US FAERS | |
| 529 | Paranasal cyst | FAERS: 7 | US FAERS | |
| 530 | Peptic Ulcer | FAERS: 7 | US FAERS | |
| 531 | Peripheral arterial occlusive disease | FAERS: 7 | OFFSIDES US FAERS | |
| 532 | Peripheral artery thrombosis | FAERS: 7 | US FAERS | |
| 533 | Pharmaceutical product complaint | FAERS: 7 | US FAERS | |
| 534 | Physical assault | FAERS: 7 | US FAERS | |
| 535 | Product packaging quantity issue | FAERS: 7 | US FAERS | |
| 536 | Proteinuria | FAERS: 7 | US FAERS | |
| 537 | Pulmonary arterial hypertension | FAERS: 7 | US FAERS | |
| 538 | Renal Colic | FAERS: 7 | US FAERS | |
| 539 | Retinal Artery Occlusion | FAERS: 7 | US FAERS | |
| 540 | Rheumatic disorder | FAERS: 7 | US FAERS | |
| 541 | Right Ventricular Dysfunction | FAERS: 7 | US FAERS | |
| 542 | Salpingo-oophorectomy unilateral | FAERS: 7 | US FAERS | |
| 543 | Screaming | FAERS: 7 | OFFSIDES US FAERS | |
| 544 | Septic embolus | FAERS: 7 | OFFSIDES US FAERS | |
| 545 | Sexual Dysfunction | FAERS: 7 | US FAERS | |
| 546 | Sinus Arrhythmia | FAERS: 7 | US FAERS | |
| 547 | Skin Papilloma | FAERS: 7 | US FAERS | |
| 548 | Splenic cyst | FAERS: 7 | US FAERS | |
| 549 | Tinea Pedis | FAERS: 7 | US FAERS | |
| 550 | Varicose vein operation | FAERS: 7 | US FAERS | |
| 551 | Vascular stent insertion | FAERS: 7 | US FAERS | |
| 552 | Vulvitis | FAERS: 7 | US FAERS | |
| 553 | Acarodermatitis | FAERS: 6 | OFFSIDES US FAERS | |
| 554 | Acute tonsillitis | FAERS: 6 | US FAERS | |
| 555 | Agitation | FAERS: 6 | US FAERS | |
| 556 | Animal bite | FAERS: 6 | US FAERS | |
| 557 | Antithrombin III decreased | FAERS: 6 | OFFSIDES US FAERS | |
| 558 | Apparent death | FAERS: 6 | US FAERS | |
| 559 | Aspartate Aminotransferase Increased | FAERS: 6 | US FAERS | |
| 560 | Basal cell carcinoma | FAERS: 6 | US FAERS | |
| 561 | Blood follicle stimulating hormone increased | FAERS: 6 | OFFSIDES US FAERS | |
| 562 | Breech Presentation | FAERS: 6 | OFFSIDES US FAERS | |
| 563 | Bronchopneumonia | FAERS: 6 | US FAERS | |
| 564 | Cardiac ventricular thrombosis | FAERS: 6 | US FAERS | |
| 565 | Conversion disorder | FAERS: 6 | US FAERS | |
| 566 | Debridement | FAERS: 6 | US FAERS | |
| 567 | Device deployment issue | FAERS: 6 | US FAERS | |
| 568 | Device use error | FAERS: 6 | US FAERS | |
| 569 | Disability | FAERS: 6 | US FAERS | |
| 570 | Drug level below therapeutic | FAERS: 6 | US FAERS | |
| 571 | Dry skin | FAERS: 6 | OFFSIDES US FAERS | |
| 572 | Dysgeusia | FAERS: 6 | US FAERS | |
| 573 | Endometrial disorder | FAERS: 6 | OFFSIDES US FAERS | |
| 574 | Eructation | FAERS: 6 | US FAERS | |
| 575 | Gastrectomy | FAERS: 6 | US FAERS | |
| 576 | Hepatitis C | FAERS: 6 | OFFSIDES US FAERS | |
| 577 | Hyperplasia | FAERS: 6 | US FAERS | |
| 578 | Immune thrombocytopenic purpura | FAERS: 6 | US FAERS | |
| 579 | Implantable defibrillator insertion | FAERS: 6 | US FAERS | |
| 580 | Incision site pain | FAERS: 6 | OFFSIDES US FAERS | |
| 581 | Injection site pain | FAERS: 6 | US FAERS | |
| 582 | Lactose Intolerance | FAERS: 6 | US FAERS | |
| 583 | Middle insomnia | FAERS: 6 | US FAERS | |
| 584 | Myocarditis | FAERS: 6 | US FAERS | |
| 585 | Nocturia | FAERS: 6 | US FAERS | |
| 586 | Otitis Externa | FAERS: 6 | US FAERS | |
| 587 | Paranasal sinus hypersecretion | FAERS: 6 | US FAERS | |
| 588 | Pericarditis | FAERS: 6 | US FAERS | |
| 589 | Peritonitis | FAERS: 6 | US FAERS | |
| 590 | Phonophobia | FAERS: 6 | OFFSIDES US FAERS | |
| 591 | Procedural vomiting | FAERS: 6 | US FAERS | |
| 592 | Rubber sensitivity | FAERS: 6 | US FAERS | |
| 593 | Shock | FAERS: 6 | US FAERS | |
| 594 | Soft tissue mass | FAERS: 6 | US FAERS | |
| 595 | Splenic Infarction | FAERS: 6 | US FAERS | |
| 596 | Stomatitis | FAERS: 6 | US FAERS | |
| 597 | Systemic Inflammatory Response Syndrome | FAERS: 6 | US FAERS | |
| 598 | Thirst | FAERS: 6 | US FAERS | |
| 599 | Thyroidectomy | FAERS: 6 | US FAERS | |
| 600 | Thyroiditis | FAERS: 6 | US FAERS | |
| 601 | Tooth Infection | FAERS: 6 | US FAERS | |
| 602 | Uterine inflammation | FAERS: 6 | US FAERS | |
| 603 | Vasculitis | FAERS: 6 | US FAERS | |
| 604 | Visual disturbance | FAERS: 6 | SIDER US FAERS | |
| 605 | White blood cell count decreased | FAERS: 6 | US FAERS | |
| 606 | carbuncle | FAERS: 6 | US FAERS | |
| 607 | rhinoplasty | FAERS: 6 | US FAERS | |
| 608 | Abdominal mass | FAERS: 5 | US FAERS | |
| 609 | Acute Chest Syndrome | FAERS: 5 | US FAERS | |
| 610 | Adjustment disorder with mixed anxiety and depressed mood | FAERS: 5 | US FAERS | |
| 611 | Adnexa uteri mass | FAERS: 5 | US FAERS | |
| 612 | Analgesic drug level increased | FAERS: 5 | US FAERS | |
| 613 | Angioedema | FAERS: 5 | US FAERS | |
| 614 | Anhedonia | FAERS: 5 | US FAERS | |
| 615 | Anogenital dysplasia | FAERS: 5 | US FAERS | |
| 616 | Antithrombin III Deficiency | FAERS: 5 | OFFSIDES US FAERS | |
| 617 | Apathy | FAERS: 5 | US FAERS | |
| 618 | Arterial thrombosis | FAERS: 5 | OFFSIDES US FAERS | |
| 619 | Ataxia | FAERS: 5 | US FAERS | |
| 620 | Atrophic vulvovaginitis | FAERS: 5 | US FAERS | |
| 621 | Blood alkaline phosphatase increased | FAERS: 5 | US FAERS | |
| 622 | Blood creatine phosphokinase increased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 623 | Blood iron decreased | FAERS: 5 | US FAERS | |
| 624 | Blood testosterone abnormal | FAERS: 5 | US FAERS | |
| 625 | Borderline Personality Disorder | FAERS: 5 | OFFSIDES US FAERS | |
| 626 | Brain Death | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 627 | Cardiac ventricular disorder | FAERS: 5 | US FAERS | |
| 628 | Chronic Fatigue Syndrome | FAERS: 5 | US FAERS | |
| 629 | Chronic tonsillitis | FAERS: 5 | OFFSIDES US FAERS | |
| 630 | Deafness | FAERS: 5 | US FAERS | |
| 631 | Decidual cast | FAERS: 5 | US FAERS | |
| 632 | Deformity | FAERS: 5 | US FAERS | |
| 633 | Dental caries | FAERS: 5 | US FAERS | |
| 634 | Dermoid Cyst | FAERS: 5 | US FAERS | |
| 635 | Drug withdrawal syndrome | FAERS: 5 | US FAERS | |
| 636 | Dysplasia | FAERS: 5 | US FAERS | |
| 637 | Electrolyte imbalance | FAERS: 5 | US FAERS | |
| 638 | Enchondroma | FAERS: 5 | US FAERS | |
| 639 | Endometritis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 640 | Escherichia test positive | FAERS: 5 | US FAERS | |
| 641 | Exposure via partner | FAERS: 5 | US FAERS | |
| 642 | Fluid overload | FAERS: 5 | US FAERS | |
| 643 | Food craving | FAERS: 5 | US FAERS | |
| 644 | Frustration | FAERS: 5 | US FAERS | |
| 645 | Gastrointestinal Pain | FAERS: 5 | SIDER US FAERS | |
| 646 | Genital pain | FAERS: 5 | US FAERS | |
| 647 | Glaucoma | FAERS: 5 | US FAERS | |
| 648 | Granuloma | FAERS: 5 | OFFSIDES US FAERS | |
| 649 | Hepatic necrosis | FAERS: 5 | US FAERS | |
| 650 | Hypertensive heart disease | FAERS: 5 | US FAERS | |
| 651 | Impaired driving ability | FAERS: 5 | OFFSIDES US FAERS | |
| 652 | Inadequate analgesia | FAERS: 5 | US FAERS | |
| 653 | Intentional self-injury | FAERS: 5 | US FAERS | |
| 654 | Laser Therapy | FAERS: 5 | US FAERS | |
| 655 | Lipoma | FAERS: 5 | US FAERS | |
| 656 | Lymphadenitis | FAERS: 5 | US FAERS | |
| 657 | Lymphoma | FAERS: 5 | OFFSIDES US FAERS | |
| 658 | Malabsorption | FAERS: 5 | US FAERS | |
| 659 | Mastoiditis | FAERS: 5 | US FAERS | |
| 660 | Meningioma | FAERS: 5 | US FAERS | |
| 661 | Meningism | FAERS: 5 | US FAERS | |
| 662 | Mitral valve sclerosis | FAERS: 5 | US FAERS | |
| 663 | Myocardial strain | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 664 | Myositis | FAERS: 5 | US FAERS | |
| 665 | Obesity surgery | FAERS: 5 | US FAERS | |
| 666 | Pelvic adhesions | FAERS: 5 | US FAERS | |
| 667 | Poor quality product administered | FAERS: 5 | US FAERS | |
| 668 | Post procedural infection | FAERS: 5 | US FAERS | |
| 669 | Product expiration date issue | FAERS: 5 | US FAERS | |
| 670 | Product packaging issue | FAERS: 5 | US FAERS | |
| 671 | Proteus test positive | FAERS: 5 | US FAERS | |
| 672 | Pulmonary endarterectomy | FAERS: 5 | US FAERS | |
| 673 | Pyuria | FAERS: 5 | US FAERS | |
| 674 | Rash erythematous | FAERS: 5 | US FAERS | |
| 675 | Retained products of conception | FAERS: 5 | US FAERS | |
| 676 | Rhinitis | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 677 | Skin irritation | FAERS: 5 | US FAERS | |
| 678 | Systolic dysfunction | FAERS: 5 | US FAERS | |
| 679 | Throat irritation | FAERS: 5 | US FAERS | |
| 680 | Urinary hesitation | FAERS: 5 | US FAERS | |
| 681 | Vaginal lesion | FAERS: 5 | OFFSIDES US FAERS | |
| 682 | Vaginitis | FAERS: 5 | US FAERS | |
| 683 | Ventricular Dysfunction | FAERS: 5 | US FAERS | |
| 684 | Vulvovaginitis | FAERS: 5 | US FAERS | |
| 685 | effusion | FAERS: 5 | OFFSIDES US FAERS | |
| 686 | Alcohol poisoning | FAERS: 4 | US FAERS | |
| 687 | Anal Fissure | FAERS: 4 | OFFSIDES US FAERS | |
| 688 | Anorexia | FAERS: 4 | US FAERS | |
| 689 | Anticoagulation drug level above therapeutic | FAERS: 4 | US FAERS | |
| 690 | Arthropod sting | FAERS: 4 | US FAERS | |
| 691 | Astigmatism | FAERS: 4 | US FAERS | |
| 692 | Atrial thrombosis | FAERS: 4 | OFFSIDES US FAERS | |
| 693 | Atypical pneumonia | FAERS: 4 | US FAERS | |
| 694 | Aura | FAERS: 4 | US FAERS | |
| 695 | Autoimmune thyroiditis | FAERS: 4 | US FAERS | |
| 696 | Avulsion fracture | FAERS: 4 | US FAERS | |
| 697 | Axillary vein thrombosis | FAERS: 4 | US FAERS | |
| 698 | Bacterial test positive | FAERS: 4 | OFFSIDES US FAERS | |
| 699 | Bedridden | FAERS: 4 | US FAERS | |
| 700 | Benign Neoplasm | FAERS: 4 | US FAERS | |
| 701 | Bladder pain | FAERS: 4 | SIDER US FAERS | |
| 702 | Bladder prolapse | FAERS: 4 | US FAERS | |
| 703 | Blood alcohol increased | FAERS: 4 | US FAERS | |
| 704 | Blood cholesterol abnormal | FAERS: 4 | US FAERS | |
| 705 | Blood lactate dehydrogenase increased | FAERS: 4 | US FAERS | |
| 706 | Blood pressure inadequately controlled | FAERS: 4 | US FAERS | |
| 707 | Blood thyroid stimulating hormone increased | FAERS: 4 | US FAERS | |
| 708 | Breast discomfort | FAERS: 4 | SIDER US FAERS | |
| 709 | Breast hyperplasia | FAERS: 4 | OFFSIDES US FAERS | |
| 710 | Bruxism | FAERS: 4 | US FAERS | |
| 711 | Bunion | FAERS: 4 | OFFSIDES US FAERS | |
| 712 | Cardiac valve vegetation | FAERS: 4 | OFFSIDES US FAERS | |
| 713 | Carotidynia | FAERS: 4 | US FAERS | |
| 714 | Coccidioidomycosis | FAERS: 4 | US FAERS | |
| 715 | Craniotomy | FAERS: 4 | US FAERS | |
| 716 | Cryotherapy | FAERS: 4 | US FAERS | |
| 717 | Cystocele | FAERS: 4 | US FAERS | |
| 718 | Diabetic Ketoacidosis | FAERS: 4 | US FAERS | |
| 719 | Disease complication | FAERS: 4 | OFFSIDES US FAERS | |
| 720 | Dissociation | FAERS: 4 | US FAERS | |
| 721 | Drug administered to patient of inappropriate age | FAERS: 4 | US FAERS | |
| 722 | Drug resistance | FAERS: 4 | OFFSIDES US FAERS | |
| 723 | Early satiety | FAERS: 4 | US FAERS | |
| 724 | Ectopic pregnancy under hormonal contraception | FAERS: 4 | US FAERS | |
| 725 | Ectopic pregnancy with contraceptive device | FAERS: 4 | US FAERS | |
| 726 | Electroencephalogram abnormal | FAERS: 4 | US FAERS | |
| 727 | Electromechanical dissociation | FAERS: 4 | OFFSIDES US FAERS | |
| 728 | Endarterectomy | FAERS: 4 | US FAERS | |
| 729 | Endocarditis | FAERS: 4 | OFFSIDES US FAERS | |
| 730 | Endocrine toxicity | FAERS: 4 | US FAERS | |
| 731 | Escherichia sepsis | FAERS: 4 | US FAERS | |
| 732 | Exposure during breast feeding | FAERS: 4 | US FAERS | |
| 733 | Eye Infection | FAERS: 4 | US FAERS | |
| 734 | Facial Pain | FAERS: 4 | US FAERS | |
| 735 | Factor II mutation | FAERS: 4 | US FAERS | |
| 736 | Fasciotomy | FAERS: 4 | US FAERS | |
| 737 | Genitourinary tract infection | FAERS: 4 | US FAERS | |
| 738 | Grief reaction | FAERS: 4 | US FAERS | |
| 739 | Hepatosplenomegaly | FAERS: 4 | OFFSIDES US FAERS | |
| 740 | High frequency ablation | FAERS: 4 | US FAERS | |
| 741 | Hordeolum | FAERS: 4 | US FAERS | |
| 742 | Hunger | FAERS: 4 | US FAERS | |
| 743 | Hyperchlorhydria | FAERS: 4 | US FAERS | |
| 744 | Hyperemesis Gravidarum | FAERS: 4 | OFFSIDES US FAERS | |
| 745 | Hypophagia | FAERS: 4 | OFFSIDES US FAERS | |
| 746 | Hypothalamo-pituitary disorder | FAERS: 4 | US FAERS | |
| 747 | Hypoventilation | FAERS: 4 | US FAERS | |
| 748 | Hysteroscopy | FAERS: 4 | US FAERS | |
| 749 | Impaired gastric emptying | FAERS: 4 | US FAERS | |
| 750 | Impetigo | FAERS: 4 | US FAERS | |
| 751 | Incisional hernia | FAERS: 4 | US FAERS | |
| 752 | Incontinence | FAERS: 4 | US FAERS | |
| 753 | Insulin-requiring type 2 diabetes mellitus | FAERS: 4 | US FAERS | |
| 754 | Intermittent Claudication | FAERS: 4 | OFFSIDES US FAERS | |
| 755 | Joint stiffness | FAERS: 4 | OFFSIDES US FAERS | |
| 756 | Laryngitis | FAERS: 4 | US FAERS | |
| 757 | Ligament injury | FAERS: 4 | US FAERS | |
| 758 | Lung cyst | FAERS: 4 | US FAERS | |
| 759 | Menopause | FAERS: 4 | US FAERS | |
| 760 | Menstrual discomfort | FAERS: 4 | OFFSIDES US FAERS | |
| 761 | Metastatic Neoplasm | FAERS: 4 | US FAERS | |
| 762 | Non-cardiac chest pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 763 | Oligohydramnios | FAERS: 4 | US FAERS | |
| 764 | Optic Neuritis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 765 | Ovarian Infection | FAERS: 4 | US FAERS | |
| 766 | Partner stress | FAERS: 4 | OFFSIDES US FAERS | |
| 767 | Pelvic mass | FAERS: 4 | US FAERS | |
| 768 | Peripheral paralysis | FAERS: 4 | US FAERS | |
| 769 | Petechiae | FAERS: 4 | US FAERS | |
| 770 | Poisoning | FAERS: 4 | US FAERS | |
| 771 | Polyuria | FAERS: 4 | US FAERS | |
| 772 | Post lumbar puncture syndrome | FAERS: 4 | US FAERS | |
| 773 | Procedural complication | FAERS: 4 | US FAERS | |
| 774 | Product availability issue | FAERS: 4 | US FAERS | |
| 775 | Pulmonary pneumatocele | FAERS: 4 | US FAERS | |
| 776 | Purulent discharge | FAERS: 4 | US FAERS | |
| 777 | QRS axis abnormal | FAERS: 4 | US FAERS | |
| 778 | Rectal polyp | FAERS: 4 | US FAERS | |
| 779 | Rhabdomyolysis | FAERS: 4 | US FAERS | |
| 780 | Rheumatoid factor increased | FAERS: 4 | US FAERS | |
| 781 | Salpingectomy | FAERS: 4 | US FAERS | |
| 782 | Schizophrenia | FAERS: 4 | US FAERS | |
| 783 | Sclerotherapy | FAERS: 4 | US FAERS | |
| 784 | Simplex virus test positive | FAERS: 4 | US FAERS | |
| 785 | Skin neoplasm excision | FAERS: 4 | US FAERS | |
| 786 | Splenectomy | FAERS: 4 | US FAERS | |
| 787 | Stasis dermatitis | FAERS: 4 | US FAERS | |
| 788 | Subacute endocarditis | FAERS: 4 | OFFSIDES US FAERS | |
| 789 | Thermal burn | FAERS: 4 | US FAERS | |
| 790 | Ulcer | FAERS: 4 | US FAERS | |
| 791 | Ureteral stent insertion | FAERS: 4 | US FAERS | |
| 792 | Urinary tract infection staphylococcal | FAERS: 4 | US FAERS | |
| 793 | Uterine cervix stenosis | FAERS: 4 | US FAERS | |
| 794 | Venous Injury | FAERS: 4 | US FAERS | |
| 795 | Vulvovaginal erythema | FAERS: 4 | US FAERS | |
| 796 | Vulvovaginal inflammation | FAERS: 4 | US FAERS | |
| 797 | Vulvovaginal rash | FAERS: 4 | US FAERS | |
| 798 | Wolff-Parkinson-White Syndrome | FAERS: 4 | US FAERS | |
| 799 | colonoscopy | FAERS: 4 | US FAERS | |
| 800 | muscle injury | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 801 | Abdominal Abscess | FAERS: 3 | OFFSIDES US FAERS | |
| 802 | Abortion complete | FAERS: 3 | US FAERS | |
| 803 | Acidosis | FAERS: 3 | US FAERS | |
| 804 | Acquired Protein S Deficiency | FAERS: 3 | OFFSIDES US FAERS | |
| 805 | Alcohol abuse | FAERS: 3 | OFFSIDES US FAERS | |
| 806 | Allergic sinusitis | FAERS: 3 | US FAERS | |
| 807 | Amblyopia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 808 | Androgenetic Alopecia | FAERS: 3 | US FAERS | |
| 809 | Ankylosing spondylitis | FAERS: 3 | US FAERS | |
| 810 | Anoxic Encephalopathy | FAERS: 3 | OFFSIDES US FAERS | |
| 811 | Antibody test positive | FAERS: 3 | US FAERS | |
| 812 | Anticoagulant therapy | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 813 | Antidepressant therapy | FAERS: 3 | US FAERS | |
| 814 | Antinuclear antibody increased | FAERS: 3 | OFFSIDES US FAERS | |
| 815 | Aortic valve sclerosis | FAERS: 3 | OFFSIDES US FAERS | |
| 816 | Atrial tachycardia | FAERS: 3 | OFFSIDES US FAERS | |
| 817 | Benign neoplasm of thyroid gland | FAERS: 3 | US FAERS | |
| 818 | Biliary Colic | FAERS: 3 | US FAERS | |
| 819 | Blood glucose abnormal | FAERS: 3 | OFFSIDES US FAERS | |
| 820 | Bone infarction | FAERS: 3 | US FAERS | |
| 821 | Bone lesion | FAERS: 3 | US FAERS | |
| 822 | Bone pain | FAERS: 3 | US FAERS | |
| 823 | Brain natriuretic peptide increased | FAERS: 3 | OFFSIDES US FAERS | |
| 824 | Calcinosis | FAERS: 3 | US FAERS | |
| 825 | Cardiac Flutter | FAERS: 3 | US FAERS | |
| 826 | Carotid artery aneurysm | FAERS: 3 | US FAERS | |
| 827 | Cartilage injury | FAERS: 3 | US FAERS | |
| 828 | Central nervous system lesion | FAERS: 3 | OFFSIDES US FAERS | |
| 829 | Central pain syndrome | FAERS: 3 | US FAERS | |
| 830 | Cholecystitis infective | FAERS: 3 | US FAERS | |
| 831 | Cholestasis | FAERS: 3 | US FAERS | |
| 832 | Cluster Headache | FAERS: 3 | US FAERS | |
| 833 | Contrast media allergy | FAERS: 3 | US FAERS | |
| 834 | Coombs test positive | FAERS: 3 | US FAERS | |
| 835 | Cor pulmonale | FAERS: 3 | US FAERS | |
| 836 | Cystic Fibrosis | FAERS: 3 | US FAERS | |
| 837 | Depression suicidal | FAERS: 3 | US FAERS | |
| 838 | Diabetes mellitus inadequate control | FAERS: 3 | US FAERS | |
| 839 | Drug effective for unapproved indication | FAERS: 3 | US FAERS | |
| 840 | Drug level fluctuating | FAERS: 3 | US FAERS | |
| 841 | Dysphemia | FAERS: 3 | US FAERS | |
| 842 | Dysphonia | FAERS: 3 | US FAERS | |
| 843 | Ear discomfort | FAERS: 3 | US FAERS | |
| 844 | Ear tube insertion | FAERS: 3 | US FAERS | |
| 845 | Ectopic pregnancy with intrauterine device | FAERS: 3 | US FAERS | |
| 846 | Electrocardiogram ST segment abnormal | FAERS: 3 | US FAERS | |
| 847 | Enteritis | FAERS: 3 | US FAERS | |
| 848 | Eosinophilic pustular folliculitis | FAERS: 3 | US FAERS | |
| 849 | Essential Tremor | FAERS: 3 | US FAERS | |
| 850 | Ethmoid sinus surgery | FAERS: 3 | US FAERS | |
| 851 | Feelings of worthlessness | FAERS: 3 | US FAERS | |
| 852 | Female sexual dysfunction | FAERS: 3 | OFFSIDES US FAERS | |
| 853 | Folliculitis | FAERS: 3 | OFFSIDES US FAERS | |
| 854 | Fracture treatment | FAERS: 3 | US FAERS | |
| 855 | Fracture | FAERS: 3 | US FAERS | |
| 856 | Gastrostomy | FAERS: 3 | US FAERS | |
| 857 | Gene Mutation | FAERS: 3 | OFFSIDES US FAERS | |
| 858 | Genital discharge | FAERS: 3 | OFFSIDES US FAERS | |
| 859 | HELLP Syndrome | FAERS: 3 | OFFSIDES US FAERS | |
| 860 | Hernia | FAERS: 3 | US FAERS | |
| 861 | Hormone Therapy | FAERS: 3 | US FAERS | |
| 862 | Hydrometra | FAERS: 3 | US FAERS | |
| 863 | Hypochondriasis | FAERS: 3 | US FAERS | |
| 864 | Hypokinesia | FAERS: 3 | US FAERS | |
| 865 | Iatrogenic injury | FAERS: 3 | OFFSIDES US FAERS | |
| 866 | Incision site complication | FAERS: 3 | US FAERS | |
| 867 | Incision site infection | FAERS: 3 | US FAERS | |
| 868 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 869 | Increased bronchial secretion | FAERS: 3 | US FAERS | |
| 870 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 871 | Labyrinthine fistula | FAERS: 3 | US FAERS | |
| 872 | Lipoprotein (a) increased | FAERS: 3 | US FAERS | |
| 873 | Localised intraabdominal fluid collection | FAERS: 3 | US FAERS | |
| 874 | Lupus Nephritis | FAERS: 3 | US FAERS | |
| 875 | Lymphocytosis | FAERS: 3 | US FAERS | |
| 876 | Mass excision | FAERS: 3 | US FAERS | |
| 877 | Mastitis | FAERS: 3 | US FAERS | |
| 878 | Methylenetetrahydrofolate reductase gene mutation | FAERS: 3 | US FAERS | |
| 879 | Motion Sickness | FAERS: 3 | US FAERS | |
| 880 | Myasthenia Gravis | FAERS: 3 | US FAERS | |
| 881 | Mydriasis | FAERS: 3 | US FAERS | |
| 882 | Open reduction of fracture | FAERS: 3 | US FAERS | |
| 883 | Ovulation disorder | FAERS: 3 | US FAERS | |
| 884 | Pain management | FAERS: 3 | US FAERS | |
| 885 | Pelvic fluid collection | FAERS: 3 | US FAERS | |
| 886 | Penile swelling | FAERS: 3 | OFFSIDES US FAERS | |
| 887 | Platelet Transfusion | FAERS: 3 | US FAERS | |
| 888 | Pneumoperitoneum | FAERS: 3 | OFFSIDES US FAERS | |
| 889 | Post-traumatic neck syndrome | FAERS: 3 | US FAERS | |
| 890 | Precancerous cells present | FAERS: 3 | US FAERS | |
| 891 | Premenstrual Dysphoric Disorder | FAERS: 3 | US FAERS | |
| 892 | Premenstrual pain | FAERS: 3 | US FAERS | |
| 893 | Product quality control issue | FAERS: 3 | US FAERS | |
| 894 | Protein urine present | FAERS: 3 | US FAERS | |
| 895 | Pruritus allergic | FAERS: 3 | US FAERS | |
| 896 | Psychogenic seizure | FAERS: 3 | US FAERS | |
| 897 | Pulmonary arterial pressure increased | FAERS: 3 | US FAERS | |
| 898 | Pulmonary artery thrombosis | FAERS: 3 | US FAERS | |
| 899 | Pulmonary venous thrombosis | FAERS: 3 | US FAERS | |
| 900 | Restlessness | FAERS: 3 | US FAERS | |
| 901 | Retching | FAERS: 3 | US FAERS | |
| 902 | Russell's viper venom time abnormal | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 903 | Scarlet Fever | FAERS: 3 | US FAERS | |
| 904 | Scotoma | FAERS: 3 | US FAERS | |
| 905 | Secretion discharge | FAERS: 3 | US FAERS | |
| 906 | Simple Partial Seizures | FAERS: 3 | US FAERS | |
| 907 | Sinus antrostomy | FAERS: 3 | US FAERS | |
| 908 | Squamous cell carcinoma | FAERS: 3 | US FAERS | |
| 909 | Staphylococcus test positive | FAERS: 3 | US FAERS | |
| 910 | Stevens-Johnson Syndrome | FAERS: 3 | OFFSIDES US FAERS | |
| 911 | Stress at work | FAERS: 3 | US FAERS | |
| 912 | Therapy cessation | FAERS: 3 | US FAERS | |
| 913 | Therapy non-responder | FAERS: 3 | OFFSIDES US FAERS | |
| 914 | Thoracic Outlet Syndrome | FAERS: 3 | OFFSIDES US FAERS | |
| 915 | Thymoma | FAERS: 3 | US FAERS | |
| 916 | Toe operation | FAERS: 3 | US FAERS | |
| 917 | Tongue biting | FAERS: 3 | US FAERS | |
| 918 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 919 | Trisomy 21 | FAERS: 3 | OFFSIDES US FAERS | |
| 920 | Unemployment | FAERS: 3 | OFFSIDES US FAERS | |
| 921 | Upper respiratory fungal infection | FAERS: 3 | US FAERS | |
| 922 | Urethritis noninfective | FAERS: 3 | US FAERS | |
| 923 | Urinary tract infection enterococcal | FAERS: 3 | US FAERS | |
| 924 | Vaginal contraceptive device complication | FAERS: 3 | OFFSIDES US FAERS | |
| 925 | Vascular insufficiency | FAERS: 3 | US FAERS | |
| 926 | Vascular occlusion | FAERS: 3 | US FAERS | |
| 927 | Ventricular hypertrophy | FAERS: 3 | US FAERS | |
| 928 | Victim of sexual abuse | FAERS: 3 | OFFSIDES US FAERS | |
| 929 | Victim of spousal abuse | FAERS: 3 | US FAERS | |
| 930 | Vitreous floaters | FAERS: 3 | US FAERS | |
| 931 | Vocal Cord Paralysis | FAERS: 3 | OFFSIDES US FAERS | |
| 932 | Vocal cord polypectomy | FAERS: 3 | US FAERS | |
| 933 | Wound Infection | FAERS: 3 | OFFSIDES US FAERS | |
| 934 | Wound infection staphylococcal | FAERS: 3 | US FAERS | |
| 935 | fibroma | FAERS: 3 | US FAERS | |
| 936 | ovarian neoplasm | FAERS: 3 | US FAERS | |
| 937 | skin abrasion | FAERS: 3 | US FAERS | |
| 938 | Abortion of ectopic pregnancy | FAERS: 2 | US FAERS | |
| 939 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 940 | Acquired diaphragmatic eventration | FAERS: 2 | OFFSIDES US FAERS | |
| 941 | Acute Coronary Syndrome | FAERS: 2 | US FAERS | |
| 942 | Agonal rhythm | FAERS: 2 | US FAERS | |
| 943 | Allergy to animal | FAERS: 2 | US FAERS | |
| 944 | Alopecia Areata | FAERS: 2 | US FAERS | |
| 945 | Amniotic fluid volume decreased | FAERS: 2 | US FAERS | |
| 946 | Angiomyolipoma | FAERS: 2 | US FAERS | |
| 947 | Anoxia | FAERS: 2 | US FAERS | |
| 948 | Antisynthetase syndrome | FAERS: 2 | US FAERS | |
| 949 | Anuria | FAERS: 2 | US FAERS | |
| 950 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 951 | Aortic embolus | FAERS: 2 | OFFSIDES US FAERS | |
| 952 | Arterial insufficiency | FAERS: 2 | US FAERS | |
| 953 | Arteriovenous fistula | FAERS: 2 | US FAERS | |
| 954 | Atherosclerotic plaque rupture | FAERS: 2 | US FAERS | |
| 955 | Autoimmune hepatitis | FAERS: 2 | US FAERS | |
| 956 | Bacteria blood identified | FAERS: 2 | OFFSIDES US FAERS | |
| 957 | Basilar artery thrombosis | FAERS: 2 | US FAERS | |
| 958 | Benign breast lump removal | FAERS: 2 | US FAERS | |
| 959 | Bereavement | FAERS: 2 | US FAERS | |
| 960 | Biliary dilatation | FAERS: 2 | US FAERS | |
| 961 | Bladder discomfort | FAERS: 2 | US FAERS | |
| 962 | Blood cannabinoids increased | FAERS: 2 | US FAERS | |
| 963 | Blood cortisol decreased | FAERS: 2 | US FAERS | |
| 964 | Blood count abnormal | FAERS: 2 | US FAERS | |
| 965 | Blood fibrinogen decreased | FAERS: 2 | US FAERS | |
| 966 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 967 | Blood osmolarity decreased | FAERS: 2 | US FAERS | |
| 968 | Blood pH decreased | FAERS: 2 | US FAERS | |
| 969 | Blood pressure fluctuation | FAERS: 2 | OFFSIDES US FAERS | |
| 970 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 971 | Blood testosterone decreased | FAERS: 2 | US FAERS | |
| 972 | Blood thyroid stimulating hormone abnormal | FAERS: 2 | US FAERS | |
| 973 | Breast prosthesis user | FAERS: 2 | US FAERS | |
| 974 | Breathing-related sleep disorder | FAERS: 2 | US FAERS | |
| 975 | Bronchopulmonary Dysplasia | FAERS: 2 | US FAERS | |
| 976 | Carcinoma in Situ | FAERS: 2 | US FAERS | |
| 977 | Carotid Artery Thrombosis | FAERS: 2 | OFFSIDES US FAERS | |
| 978 | Cataract | FAERS: 2 | US FAERS | |
| 979 | Catheter placement | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 980 | Catheter site abscess | FAERS: 2 | US FAERS | |
| 981 | Catheter site swelling | FAERS: 2 | US FAERS | |
| 982 | Cerebral atrophy | FAERS: 2 | US FAERS | |
| 983 | Cerebral ventricle dilatation | FAERS: 2 | US FAERS | |
| 984 | Cervical friability | FAERS: 2 | US FAERS | |
| 985 | Cervical polypectomy | FAERS: 2 | US FAERS | |
| 986 | Choking sensation | FAERS: 2 | OFFSIDES US FAERS | |
| 987 | Cholesteatoma | FAERS: 2 | US FAERS | |
| 988 | Chromaturia | FAERS: 2 | US FAERS | |
| 989 | Circumstance or information capable of leading to device use error | FAERS: 2 | US FAERS | |
| 990 | Claustrophobia | FAERS: 2 | OFFSIDES US FAERS | |
| 991 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 992 | Coagulation test abnormal | FAERS: 2 | US FAERS | |
| 993 | Collateral Circulation | FAERS: 2 | US FAERS | |
| 994 | Colon adenoma | FAERS: 2 | US FAERS | |
| 995 | Complex partial seizures | FAERS: 2 | US FAERS | |
| 996 | Complications of maternal exposure to therapeutic drugs | FAERS: 2 | US FAERS | |
| 997 | Contact lens intolerance | FAERS: 2 | US FAERS | |
| 998 | Contracted bladder | FAERS: 2 | US FAERS | |
| 999 | Contrast media reaction | FAERS: 2 | US FAERS | |
| 1000 | Cranioplasty | FAERS: 2 | US FAERS | |
| 1001 | Cytology abnormal | FAERS: 2 | US FAERS | |
| 1002 | Dengue Fever | FAERS: 2 | US FAERS | |
| 1003 | Device malfunction | FAERS: 2 | US FAERS | |
| 1004 | Device migration | FAERS: 2 | US FAERS | |
| 1005 | Device related infection | FAERS: 2 | US FAERS | |
| 1006 | Diastolic hypertension | FAERS: 2 | US FAERS | |
| 1007 | Drug abuser | FAERS: 2 | US FAERS | |
| 1008 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 1009 | Duodenal Ulcer | FAERS: 2 | US FAERS | |
| 1010 | Dyschezia | FAERS: 2 | US FAERS | |
| 1011 | Dystonia | FAERS: 2 | US FAERS | |
| 1012 | Embolic cerebral infarction | FAERS: 2 | OFFSIDES US FAERS | |
| 1013 | Encephalitis | FAERS: 2 | US FAERS | |
| 1014 | Endometriosis ablation | FAERS: 2 | US FAERS | |
| 1015 | Endovenous ablation | FAERS: 2 | US FAERS | |
| 1016 | Epigastric discomfort | FAERS: 2 | US FAERS | |
| 1017 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 1018 | Erythema Multiforme | FAERS: 2 | US FAERS | |
| 1019 | Excessive skin | FAERS: 2 | US FAERS | |
| 1020 | Exploratory operation | FAERS: 2 | US FAERS | |
| 1021 | Extremity contracture | FAERS: 2 | US FAERS | |
| 1022 | Eye irritation | FAERS: 2 | US FAERS | |
| 1023 | Eye symptom | FAERS: 2 | US FAERS | |
| 1024 | Feeling jittery | FAERS: 2 | US FAERS | |
| 1025 | Fibromatosis | FAERS: 2 | US FAERS | |
| 1026 | Fibrosis | FAERS: 2 | US FAERS | |
| 1027 | Frustration tolerance decreased | FAERS: 2 | US FAERS | |
| 1028 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 1029 | Gardnerella test positive | FAERS: 2 | US FAERS | |
| 1030 | Gastric infection | FAERS: 2 | US FAERS | |
| 1031 | Gastrointestinal stoma complication | FAERS: 2 | US FAERS | |
| 1032 | Gastrointestinal vascular malformation | FAERS: 2 | US FAERS | |
| 1033 | Gastroschisis | FAERS: 2 | US FAERS | |
| 1034 | Giardiasis | FAERS: 2 | US FAERS | |
| 1035 | Granulomatous liver disease | FAERS: 2 | US FAERS | |
| 1036 | HER-2 positive breast cancer | FAERS: 2 | US FAERS | |
| 1037 | Hepatectomy | FAERS: 2 | US FAERS | |
| 1038 | Herpes simplex serology positive | FAERS: 2 | US FAERS | |
| 1039 | Hip surgery | FAERS: 2 | US FAERS | |
| 1040 | Histamine intolerance | FAERS: 2 | US FAERS | |
| 1041 | Histoplasmosis | FAERS: 2 | OFFSIDES US FAERS | |
| 1042 | Homans' sign positive | FAERS: 2 | US FAERS | |
| 1043 | Hydrocephalus | FAERS: 2 | US FAERS | |
| 1044 | Hyperacusis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1045 | Hyperphagia | FAERS: 2 | US FAERS | |
| 1046 | Hypogonadism | FAERS: 2 | US FAERS | |
| 1047 | Hypoplastic Left Heart Syndrome | FAERS: 2 | US FAERS | |
| 1048 | In-stent coronary artery restenosis | FAERS: 2 | US FAERS | |
| 1049 | Inability to afford medication | FAERS: 2 | US FAERS | |
| 1050 | Incision site cellulitis | FAERS: 2 | US FAERS | |
| 1051 | Incoherent | FAERS: 2 | US FAERS | |
| 1052 | Infectious peritonitis | FAERS: 2 | US FAERS | |
| 1053 | Infusion Site Extravasation | FAERS: 2 | OFFSIDES US FAERS | |
| 1054 | Inguinal mass | FAERS: 2 | US FAERS | |
| 1055 | Injection site injury | FAERS: 2 | US FAERS | |
| 1056 | Intestinal resection | FAERS: 2 | US FAERS | |
| 1057 | Joint Instability | FAERS: 2 | US FAERS | |
| 1058 | Ketonuria | FAERS: 2 | US FAERS | |
| 1059 | Laboratory test interference | FAERS: 2 | US FAERS | |
| 1060 | Labyrinthitis | FAERS: 2 | US FAERS | |
| 1061 | Laparotomy | FAERS: 2 | US FAERS | |
| 1062 | Large intestinal polypectomy | FAERS: 2 | US FAERS | |
| 1063 | Latex allergy | FAERS: 2 | US FAERS | |
| 1064 | Lesion excision | FAERS: 2 | US FAERS | |
| 1065 | Libido disorder | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1066 | Ligament pain | FAERS: 2 | US FAERS | |
| 1067 | Limb mass | FAERS: 2 | US FAERS | |
| 1068 | Lipodystrophy acquired | FAERS: 2 | OFFSIDES US FAERS | |
| 1069 | Lipoma of breast | FAERS: 2 | US FAERS | |
| 1070 | Lithotripsy | FAERS: 2 | US FAERS | |
| 1071 | Long QT Syndrome | FAERS: 2 | US FAERS | |
| 1072 | Loss of personal independence in daily activities | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1073 | Low set ears | FAERS: 2 | US FAERS | |
| 1074 | Lupus-like syndrome | FAERS: 2 | US FAERS | |
| 1075 | Lymph node palpable | FAERS: 2 | US FAERS | |
| 1076 | Lymphocyte percentage decreased | FAERS: 2 | US FAERS | |
| 1077 | Mammary duct ectasia | FAERS: 2 | US FAERS | |
| 1078 | Mastectomy | FAERS: 2 | US FAERS | |
| 1079 | Mastocytosis | FAERS: 2 | US FAERS | |
| 1080 | Maternal exposure timing unspecified | FAERS: 2 | US FAERS | |
| 1081 | Maxillofacial operation | FAERS: 2 | US FAERS | |
| 1082 | Medical device pain | FAERS: 2 | US FAERS | |
| 1083 | Meniscus operation | FAERS: 2 | US FAERS | |
| 1084 | Microcytosis | FAERS: 2 | OFFSIDES US FAERS | |
| 1085 | Mite allergy | FAERS: 2 | US FAERS | |
| 1086 | Mitral Valve Stenosis | FAERS: 2 | US FAERS | |
| 1087 | Moaning | FAERS: 2 | US FAERS | |
| 1088 | Monoparesis | FAERS: 2 | US FAERS | |
| 1089 | Monoplegia | FAERS: 2 | US FAERS | |
| 1090 | Multiple Pregnancy | FAERS: 2 | US FAERS | |
| 1091 | Muscle Spasticity | FAERS: 2 | US FAERS | |
| 1092 | Nasal Polyps | FAERS: 2 | US FAERS | |
| 1093 | Necrosis | FAERS: 2 | US FAERS | |
| 1094 | Neonatal disorder | FAERS: 2 | US FAERS | |
| 1095 | Nephrosclerosis | FAERS: 2 | US FAERS | |
| 1096 | Neutrophil percentage increased | FAERS: 2 | US FAERS | |
| 1097 | Nicotine Dependence | FAERS: 2 | US FAERS | |
| 1098 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 1099 | Off label use of device | FAERS: 2 | US FAERS | |
| 1100 | Oliguria | FAERS: 2 | OFFSIDES US FAERS | |
| 1101 | Ophthalmoplegia | FAERS: 2 | US FAERS | |
| 1102 | Ophthalmoplegic Migraine | FAERS: 2 | US FAERS | |
| 1103 | Opiates positive | FAERS: 2 | US FAERS | |
| 1104 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 1105 | Oral fungal infection | FAERS: 2 | US FAERS | |
| 1106 | Ovarian enlargement | FAERS: 2 | US FAERS | |
| 1107 | PO2 decreased | FAERS: 2 | US FAERS | |
| 1108 | Pain of skin | FAERS: 2 | US FAERS | |
| 1109 | Pallor | FAERS: 2 | US FAERS | |
| 1110 | Pancreatectomy | FAERS: 2 | US FAERS | |
| 1111 | Papilloma | FAERS: 2 | US FAERS | |
| 1112 | Papule | FAERS: 2 | US FAERS | |
| 1113 | Parakeratosis | FAERS: 2 | OFFSIDES US FAERS | |
| 1114 | Paranasal sinus discomfort | FAERS: 2 | US FAERS | |
| 1115 | Paranasal sinus mucosal hypertrophy | FAERS: 2 | US FAERS | |
| 1116 | Paraplegia | FAERS: 2 | US FAERS | |
| 1117 | Pelvic Infection | FAERS: 2 | US FAERS | |
| 1118 | Pelvic cyst | FAERS: 2 | US FAERS | |
| 1119 | Pelvic laparoscopy | FAERS: 2 | US FAERS | |
| 1120 | Penile erythema | FAERS: 2 | US FAERS | |
| 1121 | Peripheral artery stenosis | FAERS: 2 | US FAERS | |
| 1122 | Peritonsillar Abscess | FAERS: 2 | US FAERS | |
| 1123 | Persistent depressive disorder | FAERS: 2 | US FAERS | |
| 1124 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 1125 | Physical abuse | FAERS: 2 | US FAERS | |
| 1126 | Pilonidal Cyst | FAERS: 2 | US FAERS | |
| 1127 | Pilonidal sinus repair | FAERS: 2 | US FAERS | |
| 1128 | Pityriasis Rosea | FAERS: 2 | US FAERS | |
| 1129 | Placental Insufficiency | FAERS: 2 | US FAERS | |
| 1130 | Plasminogen activator inhibitor polymorphism | FAERS: 2 | US FAERS | |
| 1131 | Pleuropericarditis | FAERS: 2 | US FAERS | |
| 1132 | Polyneuropathy | FAERS: 2 | US FAERS | |
| 1133 | Poor personal hygiene | FAERS: 2 | US FAERS | |
| 1134 | Post inflammatory pigmentation change | FAERS: 2 | US FAERS | |
| 1135 | Post procedural constipation | FAERS: 2 | US FAERS | |
| 1136 | Post-tussive vomiting | FAERS: 2 | US FAERS | |
| 1137 | Pregnancy test positive | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1138 | Prehypertension | FAERS: 2 | US FAERS | |
| 1139 | Primary Hypothyroidism | FAERS: 2 | US FAERS | |
| 1140 | Procedural nausea | FAERS: 2 | US FAERS | |
| 1141 | Product contamination | FAERS: 2 | US FAERS | |
| 1142 | Product prescribing error | FAERS: 2 | US FAERS | |
| 1143 | Product size issue | FAERS: 2 | US FAERS | |
| 1144 | Product supply issue | FAERS: 2 | US FAERS | |
| 1145 | Product used for unknown indication | FAERS: 2 | US FAERS | |
| 1146 | Prolactinoma | FAERS: 2 | US FAERS | |
| 1147 | Protein total increased | FAERS: 2 | US FAERS | |
| 1148 | Prothrombin level decreased | FAERS: 2 | US FAERS | |
| 1149 | Prothrombin time abnormal | FAERS: 2 | US FAERS | |
| 1150 | Pseudobulbar Palsy | FAERS: 2 | US FAERS | |
| 1151 | Psychiatric symptom | FAERS: 2 | US FAERS | |
| 1152 | Puncture site pain | FAERS: 2 | US FAERS | |
| 1153 | Rales | FAERS: 2 | US FAERS | |
| 1154 | Rectal fissure | FAERS: 2 | US FAERS | |
| 1155 | Rectal tenesmus | FAERS: 2 | US FAERS | |
| 1156 | Rectocele | FAERS: 2 | US FAERS | |
| 1157 | Reflux laryngitis | FAERS: 2 | US FAERS | |
| 1158 | Renal abscess | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 1159 | Renal pain | FAERS: 2 | US FAERS | |
| 1160 | Respiratory tract irritation | FAERS: 2 | US FAERS | |
| 1161 | Retinal Degeneration | FAERS: 2 | US FAERS | |
| 1162 | Retinal vascular thrombosis | FAERS: 2 | US FAERS | |
| 1163 | Retinopathy congenital | FAERS: 2 | OFFSIDES US FAERS | |
| 1164 | Rhinitis perennial | FAERS: 2 | US FAERS | |
| 1165 | Sacroiliitis | FAERS: 2 | US FAERS | |
| 1166 | Salpingo-oophorectomy | FAERS: 2 | US FAERS | |
| 1167 | Scab | FAERS: 2 | US FAERS | |
| 1168 | Skeletal injury | FAERS: 2 | US FAERS | |
| 1169 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 1170 | Skin laceration | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 1171 | Skin reaction | FAERS: 2 | US FAERS | |
| 1172 | Sneezing | FAERS: 2 | US FAERS | |
| 1173 | Somnambulism | FAERS: 2 | US FAERS | |
| 1174 | Spina Bifida | FAERS: 2 | US FAERS | |
| 1175 | Splenic thrombosis | FAERS: 2 | US FAERS | |
| 1176 | Spondylolisthesis | FAERS: 2 | US FAERS | |
| 1177 | Staphylococcal abscess | FAERS: 2 | US FAERS | |
| 1178 | Streptococcal urinary tract infection | FAERS: 2 | US FAERS | |
| 1179 | Stridor | FAERS: 2 | OFFSIDES US FAERS | |
| 1180 | Subclavian artery embolism | FAERS: 2 | US FAERS | |
| 1181 | Subileus | FAERS: 2 | US FAERS | |
| 1182 | Superior Vena Cava Syndrome | FAERS: 2 | US FAERS | |
| 1183 | Suprapubic pain | FAERS: 2 | US FAERS | |
| 1184 | Surgical failure | FAERS: 2 | OFFSIDES US FAERS | |
| 1185 | Syndactyly | FAERS: 2 | US FAERS | |
| 1186 | Temperature regulation disorder | FAERS: 2 | US FAERS | |
| 1187 | Temporal Arteritis | FAERS: 2 | US FAERS | |
| 1188 | Therapeutic procedure | FAERS: 2 | US FAERS | |
| 1189 | Therapeutic product ineffective | FAERS: 2 | US FAERS | |
| 1190 | Therapeutic response delayed | FAERS: 2 | US FAERS | |
| 1191 | Thoracostomy | FAERS: 2 | US FAERS | |
| 1192 | Thrombosis in device | FAERS: 2 | OFFSIDES US FAERS | |
| 1193 | Thymus enlargement | FAERS: 2 | US FAERS | |
| 1194 | Thyroglossal Cyst | FAERS: 2 | US FAERS | |
| 1195 | Tinea cruris | FAERS: 2 | OFFSIDES US FAERS | |
| 1196 | Trigeminal Neuralgia | FAERS: 2 | US FAERS | |
| 1197 | Troponin I increased | FAERS: 2 | US FAERS | |
| 1198 | Tuberculosis | FAERS: 2 | US FAERS | |
| 1199 | Tympanic Membrane Perforation | FAERS: 2 | US FAERS | |
| 1200 | Tympanosclerosis | FAERS: 2 | US FAERS | |
| 1201 | Upper airway obstruction | FAERS: 2 | OFFSIDES US FAERS | |
| 1202 | Upper airway resistance syndrome | FAERS: 2 | US FAERS | |
| 1203 | Ureterolithiasis | FAERS: 2 | US FAERS | |
| 1204 | Urethral Obstruction | FAERS: 2 | OFFSIDES US FAERS | |
| 1205 | Urethral cyst | FAERS: 2 | US FAERS | |
| 1206 | Urine human chorionic gonadotropin increased | FAERS: 2 | US FAERS | |
| 1207 | Urine ketone body present | FAERS: 2 | US FAERS | |
| 1208 | Uterine cervical pain | FAERS: 2 | US FAERS | |
| 1209 | Uterine cervix ulcer | FAERS: 2 | US FAERS | |
| 1210 | Vaginal flatulence | FAERS: 2 | US FAERS | |
| 1211 | Vascular rupture | FAERS: 2 | US FAERS | |
| 1212 | Vascular stenosis | FAERS: 2 | US FAERS | |
| 1213 | Venous angioma of brain | FAERS: 2 | OFFSIDES US FAERS | |
| 1214 | Venous ligation | FAERS: 2 | US FAERS | |
| 1215 | Walking aid user | FAERS: 2 | US FAERS | |
| 1216 | White matter lesion | FAERS: 2 | US FAERS | |
| 1217 | Wound dehiscence | FAERS: 2 | US FAERS | |
| 1218 | neurofibroma | FAERS: 2 | US FAERS | |
| 1219 | Abdominal adhesions | FAERS: 1 | US FAERS | |
| 1220 | Abnormal clotting factor | FAERS: 1 | US FAERS | |
| 1221 | Abortion complicated | FAERS: 1 | US FAERS | |
| 1222 | Abortion induced complete | FAERS: 1 | US FAERS | |
| 1223 | Acanthosis Nigricans | FAERS: 1 | US FAERS | |
| 1224 | Accidental death | FAERS: 1 | US FAERS | |
| 1225 | Accidental exposure | FAERS: 1 | US FAERS | |
| 1226 | Acoustic Neuroma | FAERS: 1 | US FAERS | |
| 1227 | Acquired gene mutation | FAERS: 1 | US FAERS | |
| 1228 | Activated Protein C Resistance | FAERS: 1 | US FAERS | |
| 1229 | Activated partial thromboplastin time shortened | FAERS: 1 | US FAERS | |
| 1230 | Acute psychosis | FAERS: 1 | US FAERS | |
| 1231 | Adactyly | FAERS: 1 | US FAERS | |
| 1232 | Adrenal calcification | FAERS: 1 | US FAERS | |
| 1233 | Ageusia | FAERS: 1 | US FAERS | |
| 1234 | Agitated depression | FAERS: 1 | US FAERS | |
| 1235 | Albumin globulin ratio abnormal | FAERS: 1 | US FAERS | |
| 1236 | Allergic respiratory symptom | FAERS: 1 | US FAERS | |
| 1237 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 1238 | Allergy to vaccine | FAERS: 1 | US FAERS | |
| 1239 | Allodynia | FAERS: 1 | US FAERS | |
| 1240 | Alopecia totalis | FAERS: 1 | US FAERS | |
| 1241 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 1242 | Alveolar lung disease | FAERS: 1 | US FAERS | |
| 1243 | Amniotic cavity disorder | FAERS: 1 | US FAERS | |
| 1244 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 1245 | Anastomotic Leak | FAERS: 1 | US FAERS | |
| 1246 | Anencephaly | FAERS: 1 | US FAERS | |
| 1247 | Animal scratch | FAERS: 1 | US FAERS | |
| 1248 | Anorectal cellulitis | FAERS: 1 | US FAERS | |
| 1249 | Anorexia Nervosa | FAERS: 1 | US FAERS | |
| 1250 | Anosmia | FAERS: 1 | US FAERS | |
| 1251 | Antibiotic resistant Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 1252 | Antibiotic therapy | FAERS: 1 | US FAERS | |
| 1253 | Anticonvulsant drug level below therapeutic | FAERS: 1 | US FAERS | |
| 1254 | Antithrombin III increased | FAERS: 1 | OFFSIDES US FAERS | |
| 1255 | Aortic surgery | FAERS: 1 | US FAERS | |
| 1256 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 1257 | Aphagia | FAERS: 1 | US FAERS | |
| 1258 | Aphonia | FAERS: 1 | US FAERS | |
| 1259 | Aphthous Stomatitis | FAERS: 1 | OFFSIDES US FAERS | |
| 1260 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 1261 | Appendicolith | FAERS: 1 | US FAERS | |
| 1262 | Application site scar | FAERS: 1 | US FAERS | |
| 1263 | Arterectomy with graft replacement | FAERS: 1 | US FAERS | |
| 1264 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 1265 | Ascariasis | FAERS: 1 | US FAERS | |
| 1266 | Asphyxia | FAERS: 1 | US FAERS | |
| 1267 | Auricular swelling | FAERS: 1 | OFFSIDES US FAERS | |
| 1268 | Autoimmune thrombocytopenia | FAERS: 1 | US FAERS | |
| 1269 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 1270 | Bacillus test positive | FAERS: 1 | US FAERS | |
| 1271 | Bacteria urine identified | FAERS: 1 | US FAERS | |
| 1272 | Bacterial disease carrier | FAERS: 1 | US FAERS | |
| 1273 | Bacterial rhinitis | FAERS: 1 | US FAERS | |
| 1274 | Balanitis | FAERS: 1 | US FAERS | |
| 1275 | Bariatric gastric balloon insertion | FAERS: 1 | US FAERS | |
| 1276 | Bartholinitis | FAERS: 1 | US FAERS | |
| 1277 | Beta-2 glycoprotein antibody positive | FAERS: 1 | OFFSIDES US FAERS | |
| 1278 | Biopsy endometrium abnormal | FAERS: 1 | US FAERS | |
| 1279 | Biopsy | FAERS: 1 | US FAERS | |
| 1280 | Bipolar I disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 1281 | Bladder dysfunction | FAERS: 1 | US FAERS | |
| 1282 | Bladder neck suspension | FAERS: 1 | US FAERS | |
| 1283 | Bladder spasm | FAERS: 1 | US FAERS | |
| 1284 | Blepharitis | FAERS: 1 | US FAERS | |
| 1285 | Blood Pressure | FAERS: 1 | US FAERS | |
| 1286 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 1287 | Blood chloride increased | FAERS: 1 | OFFSIDES US FAERS | |
| 1288 | Blood copper increased | FAERS: 1 | US FAERS | |
| 1289 | Blood cortisol increased | FAERS: 1 | US FAERS | |
| 1290 | Blood culture | FAERS: 1 | US FAERS | |
| 1291 | Blood fibrinogen increased | FAERS: 1 | US FAERS | |
| 1292 | Blood follicle stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 1293 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 1294 | Blood homocysteine abnormal | FAERS: 1 | US FAERS | |
| 1295 | Blood homocysteine decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 1296 | Blood human chorionic gonadotropin abnormal | FAERS: 1 | US FAERS | |
| 1297 | Blood immunoglobulin G decreased | FAERS: 1 | US FAERS | |
| 1298 | Blood immunoglobulin G increased | FAERS: 1 | US FAERS | |
| 1299 | Blood immunoglobulin M increased | FAERS: 1 | US FAERS | |
| 1300 | Blood iron increased | FAERS: 1 | US FAERS | |
| 1301 | Blood mercury abnormal | FAERS: 1 | US FAERS | |
| 1302 | Blood pH increased | FAERS: 1 | US FAERS | |
| 1303 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 1304 | Blood sodium increased | FAERS: 1 | OFFSIDES US FAERS | |
| 1305 | Blood thromboplastin abnormal | FAERS: 1 | US FAERS | |
| 1306 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 1307 | Blood triglycerides abnormal | FAERS: 1 | US FAERS | |
| 1308 | Bone Tuberculosis | FAERS: 1 | US FAERS | |
| 1309 | Bone density decreased | FAERS: 1 | US FAERS | |
| 1310 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 1311 | Breast adenoma | FAERS: 1 | US FAERS | |
| 1312 | Breast fibroma | FAERS: 1 | US FAERS | |
| 1313 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 1314 | Bronchial wall thickening | FAERS: 1 | US FAERS | |
| 1315 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 1316 | Budd-Chiari Syndrome | FAERS: 1 | US FAERS | |
| 1317 | Bullous lung disease | FAERS: 1 | US FAERS | |
| 1318 | CHARGE Syndrome | FAERS: 1 | US FAERS | |
| 1319 | Candida test positive | FAERS: 1 | US FAERS | |
| 1320 | Candiduria | FAERS: 1 | US FAERS | |
| 1321 | Carbohydrate intolerance | FAERS: 1 | US FAERS | |
| 1322 | Carbon dioxide decreased | FAERS: 1 | US FAERS | |
| 1323 | Cardiac Hypertrophy | FAERS: 1 | US FAERS | |
| 1324 | Cardiac septal defect repair | FAERS: 1 | US FAERS | |
| 1325 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 1326 | Cataplexy | FAERS: 1 | US FAERS | |
| 1327 | Catheter related infection | FAERS: 1 | US FAERS | |
| 1328 | Catheter site pain | FAERS: 1 | US FAERS | |
| 1329 | Catheter site related reaction | FAERS: 1 | US FAERS | |
| 1330 | Caustic injury | FAERS: 1 | US FAERS | |
| 1331 | Cells in urine | FAERS: 1 | US FAERS | |
| 1332 | Central Nervous System Infection | FAERS: 1 | US FAERS | |
| 1333 | Cerebellar artery occlusion | FAERS: 1 | US FAERS | |
| 1334 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 1335 | Cerebral calcification | FAERS: 1 | OFFSIDES US FAERS | |
| 1336 | Cerebral hypoperfusion | FAERS: 1 | US FAERS | |
| 1337 | Cerebral salt-wasting syndrome | FAERS: 1 | US FAERS | |
| 1338 | Cerebrovascular Insufficiency | FAERS: 1 | US FAERS | |
| 1339 | Cervical cord compression | FAERS: 1 | US FAERS | |
| 1340 | Cervicobrachial syndrome | FAERS: 1 | US FAERS | |
| 1341 | Cervix carcinoma stage I | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1342 | Cervix enlargement | FAERS: 1 | US FAERS | |
| 1343 | Cervix erythema | FAERS: 1 | US FAERS | |
| 1344 | Cervix warts | FAERS: 1 | US FAERS | |
| 1345 | Cheilitis | FAERS: 1 | US FAERS | |
| 1346 | Chemical injury | FAERS: 1 | US FAERS | |
| 1347 | Chemotherapy | FAERS: 1 | US FAERS | |
| 1348 | Chlamydial cervicitis | FAERS: 1 | US FAERS | |
| 1349 | Chlamydial pelvic inflammatory disease | FAERS: 1 | US FAERS | |
| 1350 | Chondroplasty | FAERS: 1 | US FAERS | |
| 1351 | Clostridium colitis | FAERS: 1 | US FAERS | |
| 1352 | Clumsiness | FAERS: 1 | US FAERS | |
| 1353 | Coagulation factor V level abnormal | FAERS: 1 | US FAERS | |
| 1354 | Coagulation factor V level decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 1355 | Coagulation factor mutation | FAERS: 1 | OFFSIDES US FAERS | |
| 1356 | Colectomy | FAERS: 1 | US FAERS | |
| 1357 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 1358 | Complement factor C3 increased | FAERS: 1 | US FAERS | |
| 1359 | Complement factor C4 increased | FAERS: 1 | US FAERS | |
| 1360 | Completed Suicide | FAERS: 1 | US FAERS | |
| 1361 | Compression fracture | FAERS: 1 | US FAERS | |
| 1362 | Congenital hearing disorder | FAERS: 1 | US FAERS | |
| 1363 | Conjunctival pallor | FAERS: 1 | US FAERS | |
| 1364 | Contact lens complication | FAERS: 1 | US FAERS | |
| 1365 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 1366 | Coronary angioplasty | FAERS: 1 | US FAERS | |
| 1367 | Cortical laminar necrosis | FAERS: 1 | US FAERS | |
| 1368 | Cytolytic vaginosis | FAERS: 1 | US FAERS | |
| 1369 | Cytomegalovirus test positive | FAERS: 1 | US FAERS | |
| 1370 | Dandy-Walker Syndrome | FAERS: 1 | US FAERS | |
| 1371 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 1372 | Death of relative | FAERS: 1 | US FAERS | |
| 1373 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 1374 | Demyelination | FAERS: 1 | OFFSIDES US FAERS | |
| 1375 | Dental discomfort | FAERS: 1 | US FAERS | |
| 1376 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 1377 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 1378 | Device allergy | FAERS: 1 | US FAERS | |
| 1379 | Device damage | FAERS: 1 | US FAERS | |
| 1380 | Device defective | FAERS: 1 | US FAERS | |
| 1381 | Device extrusion | FAERS: 1 | US FAERS | |
| 1382 | Device leakage | FAERS: 1 | US FAERS | |
| 1383 | Device loosening | FAERS: 1 | US FAERS | |
| 1384 | Device material issue | FAERS: 1 | US FAERS | |
| 1385 | Dextrocardia | FAERS: 1 | US FAERS | |
| 1386 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 1387 | Diabetic Retinopathy | FAERS: 1 | US FAERS | |
| 1388 | Dilatation intrahepatic duct acquired | FAERS: 1 | US FAERS | |
| 1389 | Distributive shock | FAERS: 1 | US FAERS | |
| 1390 | Disturbance in sexual arousal | FAERS: 1 | SIDER US FAERS | |
| 1391 | Double stranded DNA antibody positive | FAERS: 1 | US FAERS | |
| 1392 | Dreamy state | FAERS: 1 | US FAERS | |
| 1393 | Drug administered at inappropriate site | FAERS: 1 | US FAERS | |
| 1394 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 1395 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 1396 | Drug level increased | FAERS: 1 | US FAERS | |
| 1397 | Drug screen negative | FAERS: 1 | US FAERS | |
| 1398 | Drug toxicity | FAERS: 1 | US FAERS | |
| 1399 | Dumping Syndrome | FAERS: 1 | US FAERS | |
| 1400 | Dural fistula | FAERS: 1 | US FAERS | |
| 1401 | Ear congestion | FAERS: 1 | US FAERS | |
| 1402 | Eating disorder symptom | FAERS: 1 | US FAERS | |
| 1403 | Echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 1404 | Elbow operation | FAERS: 1 | US FAERS | |
| 1405 | Electrocardiogram poor R-wave progression | FAERS: 1 | US FAERS | |
| 1406 | Embedded device | FAERS: 1 | US FAERS | |
| 1407 | Encephalocele | FAERS: 1 | US FAERS | |
| 1408 | Endocervical curettage | FAERS: 1 | US FAERS | |
| 1409 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 1410 | Endometrial dysplasia | FAERS: 1 | US FAERS | |
| 1411 | Enterobacter test positive | FAERS: 1 | US FAERS | |
| 1412 | Enterococcal infection | FAERS: 1 | OFFSIDES US FAERS | |
| 1413 | Enterococcus test positive | FAERS: 1 | US FAERS | |
| 1414 | Eosinophilia | FAERS: 1 | US FAERS | |
| 1415 | Epstein-Barr virus antibody negative | FAERS: 1 | US FAERS | |
| 1416 | Euphoric mood | FAERS: 1 | US FAERS | |
| 1417 | Exertional headache | FAERS: 1 | US FAERS | |
| 1418 | Exophthalmos | FAERS: 1 | US FAERS | |
| 1419 | Expired device used | FAERS: 1 | US FAERS | |
| 1420 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 1421 | Exposure via body fluid | FAERS: 1 | US FAERS | |
| 1422 | External ear cellulitis | FAERS: 1 | US FAERS | |
| 1423 | Extravasation | FAERS: 1 | US FAERS | |
| 1424 | Extrinsic iliac vein compression | FAERS: 1 | US FAERS | |
| 1425 | Eye laser surgery | FAERS: 1 | US FAERS | |
| 1426 | Eyelid pain | FAERS: 1 | US FAERS | |
| 1427 | Facial paralysis | FAERS: 1 | US FAERS | |
| 1428 | Factor II deficiency | FAERS: 1 | US FAERS | |
| 1429 | Fallopian tube obstruction | FAERS: 1 | US FAERS | |
| 1430 | Familial Periodic Paralysis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1431 | Febrile infection | FAERS: 1 | US FAERS | |
| 1432 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 1433 | Female sexual arousal disorder | FAERS: 1 | US FAERS | |
| 1434 | Flat affect | FAERS: 1 | US FAERS | |
| 1435 | Forceps delivery | FAERS: 1 | US FAERS | |
| 1436 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 1437 | Formication | FAERS: 1 | OFFSIDES US FAERS | |
| 1438 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 1439 | Gastric banding reversal | FAERS: 1 | US FAERS | |
| 1440 | Gastroenterostomy | FAERS: 1 | US FAERS | |
| 1441 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 1442 | Gastroplasty | FAERS: 1 | US FAERS | |
| 1443 | Gene mutation identification test positive | FAERS: 1 | US FAERS | |
| 1444 | Genital burning sensation | FAERS: 1 | OFFSIDES US FAERS | |
| 1445 | Genital erythema | FAERS: 1 | US FAERS | |
| 1446 | Genital injury | FAERS: 1 | US FAERS | |
| 1447 | Genital labial operation | FAERS: 1 | US FAERS | |
| 1448 | Genito-pelvic pain/penetration disorder | FAERS: 1 | US FAERS | |
| 1449 | Genitourinary tract gonococcal infection | FAERS: 1 | US FAERS | |
| 1450 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 1451 | Gliosis | FAERS: 1 | US FAERS | |
| 1452 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 1453 | Gout | FAERS: 1 | US FAERS | |
| 1454 | Gram stain positive | FAERS: 1 | US FAERS | |
| 1455 | Granulomatosis with polyangiitis | FAERS: 1 | US FAERS | |
| 1456 | Groin infection | FAERS: 1 | US FAERS | |
| 1457 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 1458 | Heat Stroke | FAERS: 1 | US FAERS | |
| 1459 | Heavy exposure to ultraviolet light | FAERS: 1 | US FAERS | |
| 1460 | Hemiplegic migraine | FAERS: 1 | US FAERS | |
| 1461 | Hepatic cancer stage IV | FAERS: 1 | US FAERS | |
| 1462 | Hepatitis A antigen positive | FAERS: 1 | US FAERS | |
| 1463 | Hepatitis B surface antibody positive | FAERS: 1 | US FAERS | |
| 1464 | High density lipoprotein increased | FAERS: 1 | US FAERS | |
| 1465 | Histamine level increased | FAERS: 1 | US FAERS | |
| 1466 | Human Bite | FAERS: 1 | OFFSIDES US FAERS | |
| 1467 | Human chorionic gonadotropin increased | FAERS: 1 | US FAERS | |
| 1468 | Human chorionic gonadotropin positive | FAERS: 1 | US FAERS | |
| 1469 | Hymenolepiasis | FAERS: 1 | US FAERS | |
| 1470 | Hyperaldosteronism | FAERS: 1 | US FAERS | |
| 1471 | Hypercalciuria | FAERS: 1 | US FAERS | |
| 1472 | Hyperdynamic left ventricle | FAERS: 1 | US FAERS | |
| 1473 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 1474 | Hypermetabolism | FAERS: 1 | US FAERS | |
| 1475 | Hyperplastic cholecystopathy | FAERS: 1 | US FAERS | |
| 1476 | Hypertensive Encephalopathy | FAERS: 1 | US FAERS | |
| 1477 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 1478 | Hypertrophy | FAERS: 1 | US FAERS | |
| 1479 | Hypopituitarism | FAERS: 1 | US FAERS | |
| 1480 | Hypotrichosis | FAERS: 1 | US FAERS | |
| 1481 | Idiopathic neutropenia | FAERS: 1 | US FAERS | |
| 1482 | Ileectomy | FAERS: 1 | US FAERS | |
| 1483 | Impatience | FAERS: 1 | US FAERS | |
| 1484 | Implant site reaction | FAERS: 1 | US FAERS | |
| 1485 | Inadequate aseptic technique in use of product | FAERS: 1 | US FAERS | |
| 1486 | Inadequate lubrication | FAERS: 1 | OFFSIDES US FAERS | |
| 1487 | Inappropriate Prescribing | FAERS: 1 | US FAERS | |
| 1488 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 1489 | Incorrect dose administered by device | FAERS: 1 | US FAERS | |
| 1490 | Infectious colitis | FAERS: 1 | US FAERS | |
| 1491 | Infectious pleural effusion | FAERS: 1 | US FAERS | |
| 1492 | Infective tenosynovitis | FAERS: 1 | US FAERS | |
| 1493 | Inflammatory pain | FAERS: 1 | US FAERS | |
| 1494 | Influenza virus test positive | FAERS: 1 | US FAERS | |
| 1495 | Infusion site swelling | FAERS: 1 | US FAERS | |
| 1496 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 1497 | Injection site bruising | FAERS: 1 | US FAERS | |
| 1498 | Injury associated with device | FAERS: 1 | US FAERS | |
| 1499 | Intentional device use issue | FAERS: 1 | US FAERS | |
| 1500 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 1501 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 1502 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 1503 | Intertrigo | FAERS: 1 | US FAERS | |
| 1504 | Intestinal Fistula | FAERS: 1 | US FAERS | |
| 1505 | Intestinal infarction | FAERS: 1 | US FAERS | |
| 1506 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 1507 | Intra-aortic balloon placement | FAERS: 1 | US FAERS | |
| 1508 | Intra-cerebral aneurysm operation | FAERS: 1 | US FAERS | |
| 1509 | Intracardiac mass | FAERS: 1 | US FAERS | |
| 1510 | Intracranial Hypotension | FAERS: 1 | US FAERS | |
| 1511 | Intussusception | FAERS: 1 | US FAERS | |
| 1512 | Invasive Ductal Breast Carcinoma | FAERS: 1 | US FAERS | |
| 1513 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 1514 | Iodine deficiency | FAERS: 1 | US FAERS | |
| 1515 | Iritis | FAERS: 1 | US FAERS | |
| 1516 | Irregular sleep phase | FAERS: 1 | US FAERS | |
| 1517 | JC polyomavirus test positive | FAERS: 1 | US FAERS | |
| 1518 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 1519 | Joint laxity | FAERS: 1 | US FAERS | |
| 1520 | Joint warmth | FAERS: 1 | US FAERS | |
| 1521 | Jugular vein distension | FAERS: 1 | US FAERS | |
| 1522 | Keratoconjunctivitis Sicca | FAERS: 1 | US FAERS | |
| 1523 | Lactation Disorder | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1524 | Laryngitis bacterial | FAERS: 1 | US FAERS | |
| 1525 | Laryngospasm | FAERS: 1 | US FAERS | |
| 1526 | Latent Tuberculosis | FAERS: 1 | US FAERS | |
| 1527 | Leukocyte antigen B-27 positive | FAERS: 1 | US FAERS | |
| 1528 | Lichen Planus | FAERS: 1 | US FAERS | |
| 1529 | Lichen striatus | FAERS: 1 | US FAERS | |
| 1530 | Limb asymmetry | FAERS: 1 | US FAERS | |
| 1531 | Lipase increased | FAERS: 1 | US FAERS | |
| 1532 | Lipids abnormal | FAERS: 1 | US FAERS | |
| 1533 | Lipoatrophy | FAERS: 1 | US FAERS | |
| 1534 | Liver scan abnormal | FAERS: 1 | US FAERS | |
| 1535 | Local reaction | FAERS: 1 | SIDER US FAERS | |
| 1536 | Low density lipoprotein abnormal | FAERS: 1 | US FAERS | |
| 1537 | Lumbar spine flattening | FAERS: 1 | US FAERS | |
| 1538 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 1539 | Lymphoid tissue hyperplasia | FAERS: 1 | US FAERS | |
| 1540 | Lymphoma operation | FAERS: 1 | US FAERS | |
| 1541 | Macule | FAERS: 1 | US FAERS | |
| 1542 | Manual Lymphatic Drainage | FAERS: 1 | US FAERS | |
| 1543 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 1544 | Medial Tibial Stress Syndrome | FAERS: 1 | US FAERS | |
| 1545 | Mediastinal mass | FAERS: 1 | US FAERS | |
| 1546 | Medical device implantation | FAERS: 1 | US FAERS | |
| 1547 | Medical device removal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1548 | Medical device site irritation | FAERS: 1 | US FAERS | |
| 1549 | Medical device site laceration | FAERS: 1 | US FAERS | |
| 1550 | Medical device site pain | FAERS: 1 | US FAERS | |
| 1551 | Medication monitoring error | FAERS: 1 | US FAERS | |
| 1552 | Medication overuse headache | FAERS: 1 | US FAERS | |
| 1553 | Medication residue present | FAERS: 1 | US FAERS | |
| 1554 | Melkersson-Rosenthal Syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 1555 | Meningomyelocele | FAERS: 1 | US FAERS | |
| 1556 | Meniscus removal | FAERS: 1 | US FAERS | |
| 1557 | Menstrual cycle management | FAERS: 1 | US FAERS | |
| 1558 | Mental disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 1559 | Mental impairment | FAERS: 1 | US FAERS | |
| 1560 | Mesenteric artery stent insertion | FAERS: 1 | US FAERS | |
| 1561 | Metabolic alkalosis | FAERS: 1 | US FAERS | |
| 1562 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 1563 | Methylenetetrahydrofolate reductase deficiency | FAERS: 1 | US FAERS | |
| 1564 | Migration of implant | FAERS: 1 | US FAERS | |
| 1565 | Milk Allergy | FAERS: 1 | US FAERS | |
| 1566 | Mole excision | FAERS: 1 | US FAERS | |
| 1567 | Monocyte percentage decreased | FAERS: 1 | US FAERS | |
| 1568 | Monocytosis | FAERS: 1 | US FAERS | |
| 1569 | Mosaicism | FAERS: 1 | US FAERS | |
| 1570 | Mouth cyst | FAERS: 1 | US FAERS | |
| 1571 | Moyamoya Disease | FAERS: 1 | US FAERS | |
| 1572 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 1573 | Myasthenic Syndrome | FAERS: 1 | US FAERS | |
| 1574 | Myelitis | FAERS: 1 | US FAERS | |
| 1575 | Myopathy | FAERS: 1 | US FAERS | |
| 1576 | Negative thoughts | FAERS: 1 | US FAERS | |
| 1577 | Nephrectomy | FAERS: 1 | US FAERS | |
| 1578 | Nephritic syndrome | FAERS: 1 | US FAERS | |
| 1579 | Nephrocalcinosis | FAERS: 1 | US FAERS | |
| 1580 | Nephroureterectomy | FAERS: 1 | US FAERS | |
| 1581 | Neuralgic Amyotrophy | FAERS: 1 | US FAERS | |
| 1582 | Neurectomy | FAERS: 1 | US FAERS | |
| 1583 | Neuritis | FAERS: 1 | US FAERS | |
| 1584 | Neuroma | FAERS: 1 | US FAERS | |
| 1585 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 1586 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 1587 | Noninfective encephalitis | FAERS: 1 | US FAERS | |
| 1588 | Nystagmus | FAERS: 1 | US FAERS | |
| 1589 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 1590 | Obstructive shock | FAERS: 1 | US FAERS | |
| 1591 | Occult blood positive | FAERS: 1 | OFFSIDES US FAERS | |
| 1592 | Occupational exposure to drug | FAERS: 1 | US FAERS | |
| 1593 | Ocular Hypertension | FAERS: 1 | US FAERS | |
| 1594 | Ocular icterus | FAERS: 1 | US FAERS | |
| 1595 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 1596 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 1597 | Oral pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1598 | Osteochondrosis | FAERS: 1 | US FAERS | |
| 1599 | Osteoporosis | FAERS: 1 | US FAERS | |
| 1600 | Osteosclerosis | FAERS: 1 | US FAERS | |
| 1601 | Ovarian germ cell teratoma benign | FAERS: 1 | US FAERS | |
| 1602 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 1603 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 1604 | PCO2 increased | FAERS: 1 | US FAERS | |
| 1605 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 1606 | Pancreatic Duct Stenosis | FAERS: 1 | US FAERS | |
| 1607 | Paranasal sinus hyposecretion | FAERS: 1 | US FAERS | |
| 1608 | Parotitis | FAERS: 1 | US FAERS | |
| 1609 | Partial lung resection | FAERS: 1 | US FAERS | |
| 1610 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 1611 | Pathologic myopia | FAERS: 1 | US FAERS | |
| 1612 | Pectus excavatum | FAERS: 1 | US FAERS | |
| 1613 | Penile burning sensation | FAERS: 1 | US FAERS | |
| 1614 | Penile contusion | FAERS: 1 | US FAERS | |
| 1615 | Pericardial Cyst | FAERS: 1 | US FAERS | |
| 1616 | Perineal injury | FAERS: 1 | US FAERS | |
| 1617 | Peripheral artery bypass | FAERS: 1 | US FAERS | |
| 1618 | Peripheral nerve lesion | FAERS: 1 | US FAERS | |
| 1619 | Personal relationship issue | FAERS: 1 | US FAERS | |
| 1620 | Pharyngitis bacterial | FAERS: 1 | US FAERS | |
| 1621 | Phlebitis deep | FAERS: 1 | US FAERS | |
| 1622 | Photodermatosis | FAERS: 1 | US FAERS | |
| 1623 | Physical deconditioning | FAERS: 1 | US FAERS | |
| 1624 | Physical thyroid examination abnormal | FAERS: 1 | US FAERS | |
| 1625 | Pituitary cyst | FAERS: 1 | US FAERS | |
| 1626 | Placental hypertrophy | FAERS: 1 | US FAERS | |
| 1627 | Placental polyp | FAERS: 1 | US FAERS | |
| 1628 | Plasminogen activator inhibitor increased | FAERS: 1 | US FAERS | |
| 1629 | Plastic surgery to the face | FAERS: 1 | US FAERS | |
| 1630 | Pleural decortication | FAERS: 1 | US FAERS | |
| 1631 | Pleurodesis | FAERS: 1 | US FAERS | |
| 1632 | Polymenorrhagia | FAERS: 1 | US FAERS | |
| 1633 | Polymorphonuclear chromatin clumping | FAERS: 1 | US FAERS | |
| 1634 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 1635 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 1636 | Positron emission tomogram abnormal | FAERS: 1 | US FAERS | |
| 1637 | Post procedural fistula | FAERS: 1 | US FAERS | |
| 1638 | Post procedural hypothyroidism | FAERS: 1 | US FAERS | |
| 1639 | Post procedural myocardial infarction | FAERS: 1 | US FAERS | |
| 1640 | Post procedural pulmonary embolism | FAERS: 1 | US FAERS | |
| 1641 | Post stroke depression | FAERS: 1 | US FAERS | |
| 1642 | Posterior fossa decompression | FAERS: 1 | US FAERS | |
| 1643 | Postoperative abscess | FAERS: 1 | US FAERS | |
| 1644 | Postoperative ileus | FAERS: 1 | US FAERS | |
| 1645 | Postoperative respiratory failure | FAERS: 1 | US FAERS | |
| 1646 | Postoperative thrombosis | FAERS: 1 | US FAERS | |
| 1647 | Postpartum stress disorder | FAERS: 1 | US FAERS | |
| 1648 | Pregnancy on oral contraceptive | FAERS: 1 | US FAERS | |
| 1649 | Pregnancy test false positive | FAERS: 1 | US FAERS | |
| 1650 | Pregnancy test negative | FAERS: 1 | US FAERS | |
| 1651 | Premenstrual cramps | FAERS: 1 | US FAERS | |
| 1652 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 1653 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 1654 | Proctocolitis | FAERS: 1 | US FAERS | |
| 1655 | Product administration error | FAERS: 1 | US FAERS | |
| 1656 | Product complaint | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1657 | Product container issue | FAERS: 1 | US FAERS | |
| 1658 | Product dispensing error | FAERS: 1 | US FAERS | |
| 1659 | Product distribution issue | FAERS: 1 | US FAERS | |
| 1660 | Product formulation issue | FAERS: 1 | US FAERS | |
| 1661 | Product label issue | FAERS: 1 | US FAERS | |
| 1662 | Product lot number issue | FAERS: 1 | US FAERS | |
| 1663 | Product preparation error | FAERS: 1 | US FAERS | |
| 1664 | Product primary packaging issue | FAERS: 1 | US FAERS | |
| 1665 | Product use complaint | FAERS: 1 | US FAERS | |
| 1666 | Progesterone increased | FAERS: 1 | US FAERS | |
| 1667 | Protein S abnormal | FAERS: 1 | US FAERS | |
| 1668 | Prurigo | FAERS: 1 | US FAERS | |
| 1669 | Psychological Trauma | FAERS: 1 | US FAERS | |
| 1670 | Pudendal canal syndrome | FAERS: 1 | US FAERS | |
| 1671 | Pulmonary Valve Stenosis | FAERS: 1 | US FAERS | |
| 1672 | Pulmonary artery stenosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1673 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 1674 | Pulmonary sepsis | FAERS: 1 | US FAERS | |
| 1675 | Pulmonary vascular disorder | FAERS: 1 | US FAERS | |
| 1676 | Punctate keratitis | FAERS: 1 | US FAERS | |
| 1677 | Purpura | FAERS: 1 | US FAERS | |
| 1678 | Pyelitis | FAERS: 1 | US FAERS | |
| 1679 | Radiation injury | FAERS: 1 | US FAERS | |
| 1680 | Reaction to azo-dyes | FAERS: 1 | US FAERS | |
| 1681 | Reaction to food additive | FAERS: 1 | US FAERS | |
| 1682 | Rectal abscess | FAERS: 1 | US FAERS | |
| 1683 | Rectal discharge | FAERS: 1 | OFFSIDES US FAERS | |
| 1684 | Reflux gastritis | FAERS: 1 | US FAERS | |
| 1685 | Regurgitation | FAERS: 1 | US FAERS | |
| 1686 | Renal artery stent placement | FAERS: 1 | US FAERS | |
| 1687 | Renal embolism | FAERS: 1 | US FAERS | |
| 1688 | Reperfusion Injury | FAERS: 1 | US FAERS | |
| 1689 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 1690 | Respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 1691 | Respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 1692 | Restrictive pulmonary disease | FAERS: 1 | US FAERS | |
| 1693 | Rhinalgia | FAERS: 1 | US FAERS | |
| 1694 | Right atrial pressure increased | FAERS: 1 | US FAERS | |
| 1695 | Right ventricular systolic pressure decreased | FAERS: 1 | US FAERS | |
| 1696 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 1697 | SLE arthritis | FAERS: 1 | US FAERS | |
| 1698 | Scan abdomen abnormal | FAERS: 1 | US FAERS | |
| 1699 | Scleroderma | FAERS: 1 | US FAERS | |
| 1700 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 1701 | Seroma | FAERS: 1 | OFFSIDES US FAERS | |
| 1702 | Serositis | FAERS: 1 | US FAERS | |
| 1703 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 1704 | Sexual abuse | FAERS: 1 | US FAERS | |
| 1705 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 1706 | Sickle Cell Trait | FAERS: 1 | US FAERS | |
| 1707 | Silent myocardial infarction | FAERS: 1 | US FAERS | |
| 1708 | Sinus Tarsi Syndrome | FAERS: 1 | US FAERS | |
| 1709 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 1710 | Skin Induration | FAERS: 1 | US FAERS | |
| 1711 | Skin cosmetic procedure | FAERS: 1 | US FAERS | |
| 1712 | Skin discomfort | FAERS: 1 | US FAERS | |
| 1713 | Skin nodule | FAERS: 1 | US FAERS | |
| 1714 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 1715 | Slow speech | FAERS: 1 | US FAERS | |
| 1716 | Somatoform Disorder | FAERS: 1 | US FAERS | |
| 1717 | Somatoform disorder skin | FAERS: 1 | US FAERS | |
| 1718 | Spinal column injury | FAERS: 1 | US FAERS | |
| 1719 | Splenic abscess | FAERS: 1 | US FAERS | |
| 1720 | Splenic granuloma | FAERS: 1 | US FAERS | |
| 1721 | Spondylitis | FAERS: 1 | US FAERS | |
| 1722 | Spousal Abuse | FAERS: 1 | US FAERS | |
| 1723 | Staring | FAERS: 1 | US FAERS | |
| 1724 | Status Migrainosus | FAERS: 1 | US FAERS | |
| 1725 | Stent embolisation | FAERS: 1 | US FAERS | |
| 1726 | Stillbirth | FAERS: 1 | US FAERS | |
| 1727 | Strabismus | FAERS: 1 | US FAERS | |
| 1728 | Stroke in evolution | FAERS: 1 | US FAERS | |
| 1729 | Subclavian artery thrombosis | FAERS: 1 | US FAERS | |
| 1730 | Subcutaneous Emphysema | FAERS: 1 | US FAERS | |
| 1731 | Subcutaneous nodule | FAERS: 1 | US FAERS | |
| 1732 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 1733 | Sudden infant death syndrome | FAERS: 1 | US FAERS | |
| 1734 | Sunburn | FAERS: 1 | US FAERS | |
| 1735 | Superficial vein prominence | FAERS: 1 | US FAERS | |
| 1736 | Superinfection bacterial | FAERS: 1 | US FAERS | |
| 1737 | Syringomyelia | FAERS: 1 | US FAERS | |
| 1738 | Systemic lupus erythematosus rash | FAERS: 1 | US FAERS | |
| 1739 | Systolic hypertension | FAERS: 1 | US FAERS | |
| 1740 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 1741 | Talipes | FAERS: 1 | US FAERS | |
| 1742 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 1743 | Tenosynovitis | FAERS: 1 | US FAERS | |
| 1744 | Tension | FAERS: 1 | US FAERS | |
| 1745 | Teratoma | FAERS: 1 | US FAERS | |
| 1746 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 1747 | Thrombin-antithrombin III complex decreased | FAERS: 1 | US FAERS | |
| 1748 | Thromboangiitis Obliterans | FAERS: 1 | US FAERS | |
| 1749 | Thrombosed varicose vein | FAERS: 1 | US FAERS | |
| 1750 | Thyroid hormones decreased | FAERS: 1 | US FAERS | |
| 1751 | Thyroid therapy | FAERS: 1 | US FAERS | |
| 1752 | Tobacco user | FAERS: 1 | OFFSIDES US FAERS | |
| 1753 | Torticollis | FAERS: 1 | US FAERS | |
| 1754 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 1755 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 1756 | Transaminases abnormal | FAERS: 1 | US FAERS | |
| 1757 | Transfusion Reaction | FAERS: 1 | US FAERS | |
| 1758 | Transplant | FAERS: 1 | US FAERS | |
| 1759 | Traumatic Brain Injury | FAERS: 1 | US FAERS | |
| 1760 | Traumatic delivery | FAERS: 1 | US FAERS | |
| 1761 | Traumatic fracture | FAERS: 1 | US FAERS | |
| 1762 | Traumatic liver injury | FAERS: 1 | US FAERS | |
| 1763 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 1764 | Trichotillomania | FAERS: 1 | US FAERS | |
| 1765 | Tubo-ovarian abscess | FAERS: 1 | US FAERS | |
| 1766 | Tympanoplasty | FAERS: 1 | US FAERS | |
| 1767 | Ultrasound liver abnormal | FAERS: 1 | US FAERS | |
| 1768 | Umbilical cord vascular disorder | FAERS: 1 | US FAERS | |
| 1769 | Underweight | FAERS: 1 | US FAERS | |
| 1770 | Unwanted pregnancy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 1771 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 1772 | Ureteral cyst | FAERS: 1 | US FAERS | |
| 1773 | Urethral Stenosis | FAERS: 1 | US FAERS | |
| 1774 | Urethritis | FAERS: 1 | US FAERS | |
| 1775 | Urge Incontinence | FAERS: 1 | US FAERS | |
| 1776 | Urinary straining | FAERS: 1 | US FAERS | |
| 1777 | Urinary tract discomfort | FAERS: 1 | US FAERS | |
| 1778 | Urinary tract infection viral | FAERS: 1 | US FAERS | |
| 1779 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 1780 | Urine human chorionic gonadotropin positive | FAERS: 1 | US FAERS | |
| 1781 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 1782 | Uterine Perforation | FAERS: 1 | US FAERS | |
| 1783 | Uterine Prolapse | FAERS: 1 | US FAERS | |
| 1784 | Uterine Rupture | FAERS: 1 | US FAERS | |
| 1785 | Uterine contractions during pregnancy | FAERS: 1 | US FAERS | |
| 1786 | Uterine dilation and evacuation | FAERS: 1 | US FAERS | |
| 1787 | Uterine stenosis | FAERS: 1 | US FAERS | |
| 1788 | Vaginal abscess | FAERS: 1 | US FAERS | |
| 1789 | Vaginal erosion | FAERS: 1 | OFFSIDES US FAERS | |
| 1790 | Vaginitis chlamydial | FAERS: 1 | US FAERS | |
| 1791 | Varicophlebitis | FAERS: 1 | US FAERS | |
| 1792 | Vascular compression | FAERS: 1 | US FAERS | |
| 1793 | Vascular pain | FAERS: 1 | US FAERS | |
| 1794 | Vasospasm | FAERS: 1 | OFFSIDES US FAERS | |
| 1795 | Vein collapse | FAERS: 1 | US FAERS | |
| 1796 | Venous stasis retinopathy | FAERS: 1 | US FAERS | |
| 1797 | Ventilation/perfusion scan abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1798 | Ventricular enlargement | FAERS: 1 | US FAERS | |
| 1799 | Vertebral Artery Stenosis | FAERS: 1 | US FAERS | |
| 1800 | Vertebral artery thrombosis | FAERS: 1 | US FAERS | |
| 1801 | Vertebral foraminal stenosis | FAERS: 1 | US FAERS | |
| 1802 | Vessel puncture site pain | FAERS: 1 | US FAERS | |
| 1803 | Vessel puncture site swelling | FAERS: 1 | US FAERS | |
| 1804 | Viral myocarditis | FAERS: 1 | US FAERS | |
| 1805 | Viral pharyngitis | FAERS: 1 | US FAERS | |
| 1806 | Viral rhinitis | FAERS: 1 | US FAERS | |
| 1807 | Visceral congestion | FAERS: 1 | US FAERS | |
| 1808 | Vitiligo | FAERS: 1 | US FAERS | |
| 1809 | Von Willebrand's factor activity increased | FAERS: 1 | US FAERS | |
| 1810 | Vulvar erosion | FAERS: 1 | US FAERS | |
| 1811 | Vulvovaginal adhesion | FAERS: 1 | US FAERS | |
| 1812 | Vulvovaginal human papilloma virus infection | FAERS: 1 | US FAERS | |
| 1813 | Wheelchair user | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1814 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 1815 | White blood cells stool positive | FAERS: 1 | US FAERS | |
| 1816 | Wound Complication | FAERS: 1 | US FAERS | |
| 1817 | Wound sepsis | FAERS: 1 | OFFSIDES US FAERS | |
| 1818 | cancer surgery | FAERS: 1 | US FAERS | |
| 1819 | kyphosis | FAERS: 1 | US FAERS | |
| 1820 | Abdominal Compartment Syndrome | OFFSIDES | ||
| 1821 | Abnormal cervical smear | OFFSIDES | ||
| 1822 | Abnormal vision | OFFSIDES | ||
| 1823 | Abortion early | Canada Vigilance: 1 | Canada Vigilance | |
| 1824 | Acid reflux | OFFSIDES | ||
| 1825 | Adnexitis | OFFSIDES | ||
| 1826 | Agraphia | OFFSIDES | ||
| 1827 | Alcohol consumption | OFFSIDES | ||
| 1828 | Altered bowel function | OFFSIDES | ||
| 1829 | Alveolitis | OFFSIDES | ||
| 1830 | Angiolipoma | OFFSIDES | ||
| 1831 | Anhidrosis | OFFSIDES | ||
| 1832 | Anisocoria | OFFSIDES | ||
| 1833 | Anticholinergic Syndrome | OFFSIDES | ||
| 1834 | Apnea | OFFSIDES | ||
| 1835 | Application site discomfort | OFFSIDES | ||
| 1836 | Aspiration Pneumonia | OFFSIDES | ||
| 1837 | Atrioventricular Block | OFFSIDES | ||
| 1838 | Automatism | OFFSIDES | ||
| 1839 | Bacterial Endocarditis | OFFSIDES | ||
| 1840 | Bipolar II disorder | OFFSIDES | ||
| 1841 | Blepharoptosis | OFFSIDES | ||
| 1842 | Blepharospasm | OFFSIDES | ||
| 1843 | Blood Glucose | OFFSIDES | ||
| 1844 | Blood cholesterol | OFFSIDES | ||
| 1845 | Blood homocysteine | OFFSIDES | ||
| 1846 | Blood human chorionic gonadotropin positive | OFFSIDES | ||
| 1847 | Blood sodium | OFFSIDES | ||
| 1848 | Blood thyroid stimulating hormone | OFFSIDES | ||
| 1849 | Blurred vision | OFFSIDES | ||
| 1850 | Body Temperature | OFFSIDES | ||
| 1851 | Body temperature fluctuation | OFFSIDES | ||
| 1852 | Brain Abscess | OFFSIDES | ||
| 1853 | Cardiac Tamponade | OFFSIDES | ||
| 1854 | Causalgia | OFFSIDES | ||
| 1855 | Chondrosarcoma | OFFSIDES | ||
| 1856 | Chronic ulcerative colitis | OFFSIDES | ||
| 1857 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 1858 | Culture positive | OFFSIDES | ||
| 1859 | Dependence | OFFSIDES | ||
| 1860 | Diabetes | OFFSIDES | ||
| 1861 | Diarrhea | OFFSIDES | ||
| 1862 | Diverticulosis | OFFSIDES | ||
| 1863 | Drowsiness | OFFSIDES | ||
| 1864 | Drug withdrawal headache | OFFSIDES | ||
| 1865 | Duodenitis | OFFSIDES | ||
| 1866 | Dysgraphia | OFFSIDES | ||
| 1867 | Dysmenorrhea | OFFSIDES | ||
| 1868 | Enlargement abdomen | SIDER | ||
| 1869 | Epicondylitis | OFFSIDES | ||
| 1870 | Escherichia infection | OFFSIDES | ||
| 1871 | Extrinsic vascular compression | OFFSIDES | ||
| 1872 | False positive laboratory result | OFFSIDES | ||
| 1873 | Fat necrosis | OFFSIDES | ||
| 1874 | Fatty Liver | OFFSIDES | ||
| 1875 | Fibroadenosis of breast | SIDER | ||
| 1876 | General physical condition | OFFSIDES | ||
| 1877 | Globulinuria | OFFSIDES | ||
| 1878 | Goiter | OFFSIDES | ||
| 1879 | Granulocytosis | OFFSIDES | ||
| 1880 | Hay fever | OFFSIDES | ||
| 1881 | Hepatobiliary scan | OFFSIDES | ||
| 1882 | Herpes dermatitis | OFFSIDES | ||
| 1883 | Homans' sign | OFFSIDES | ||
| 1884 | Iliac artery occlusion | OFFSIDES | ||
| 1885 | Iliac artery stenosis | OFFSIDES | ||
| 1886 | Implantable defibrillator malfunction | OFFSIDES | ||
| 1887 | Infestation | SIDER | ||
| 1888 | Influenza-like symptoms | SIDER | ||
| 1889 | Infusion site cellulitis | OFFSIDES | ||
| 1890 | Infusion site phlebitis | OFFSIDES | ||
| 1891 | Injection site phlebitis | OFFSIDES | ||
| 1892 | Injection site thrombosis | OFFSIDES | ||
| 1893 | Lentigo | OFFSIDES | ||
| 1894 | Leukorrhea | SIDER | ||
| 1895 | Livedo Reticularis | OFFSIDES | ||
| 1896 | Lumbar puncture abnormal | OFFSIDES | ||
| 1897 | Mallory-Weiss Syndrome | OFFSIDES | ||
| 1898 | Medical device site reaction | OFFSIDES | ||
| 1899 | Muscle necrosis | OFFSIDES | ||
| 1900 | Neurilemmoma | OFFSIDES | ||
| 1901 | Oligomenorrhea | OFFSIDES | ||
| 1902 | Orthopnea | OFFSIDES | ||
| 1903 | Osteolysis | OFFSIDES | ||
| 1904 | Plagiocephaly | OFFSIDES | ||
| 1905 | Post procedural cellulitis | OFFSIDES | ||
| 1906 | Post-traumatic pain | OFFSIDES | ||
| 1907 | Protein S increased | OFFSIDES | ||
| 1908 | Retinal vascular occlusion | OFFSIDES | ||
| 1909 | Sebaceous hyperplasia | OFFSIDES | ||
| 1910 | Skin Wrinkling | OFFSIDES | ||
| 1911 | Soft Tissue Injuries | OFFSIDES | ||
| 1912 | Superficial Thrombophlebitis | OFFSIDES | ||
| 1913 | Synovitis | OFFSIDES | ||
| 1914 | Tendinitis | OFFSIDES | ||
| 1915 | Thrombotic cerebral infarction | OFFSIDES | ||
| 1916 | Tinea Versicolor | OFFSIDES | ||
| 1917 | Tinea | OFFSIDES | ||
| 1918 | Urine alcohol test positive | OFFSIDES | ||
| 1919 | Vaginal discomfort | SIDER | ||
| 1920 | Venomous sting | OFFSIDES | ||
| 1921 | Venous Thromboembolism | SIDER | ||
| 1922 | Vestibulitis | OFFSIDES | ||
| 1923 | Vitamin A Deficiency | OFFSIDES | ||
| 1924 | Vitamin B 12 Deficiency | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.