Lamotrigine
(PYZRQGJRPPTADH-UHFFFAOYSA-N)
Structure
- SMILES
- Nc1nnc(c(n1)N)c1cccc(c1Cl)Cl
- Type(s)
- Approved; Investigational
- ATC code(s)
- N03AX09
- Molecular Formula:
- C9H7Cl2N5
- Molecular Weight:
- 256.091
- Log P:
- 3.1722
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 90.71
- CAS Number(s):
- 84057-84-1
Synonym(s)
1.
Lamotrigine
2.
3,5-Diamino-6-(2,3-dichlorophenyl)-1,2,4-triazine
3.
3,5-Diamino-6-(2,3-dichlorophenyl)-as-triazine
4.
BW-430C
5.
Crisomet
6.
Labileno
7.
Lamictal
8.
Lamiktal
9.
BW 430C
10.
BW430C
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 968 Canada Vigilance: 30 | Canada Vigilance US FAERS | |
| 2 | Product substitution issue | FAERS: 783 Canada Vigilance: 7 | Canada Vigilance OFFSIDES US FAERS | |
| 3 | Stevens-Johnson Syndrome | FAERS: 653 Canada Vigilance: 21 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 4 | Drug exposure during pregnancy | FAERS: 628 | OFFSIDES US FAERS | |
| 5 | Headache | FAERS: 480 Canada Vigilance: 5 | 10448828 11052335 15845756 | CTD SIDER Canada Vigilance US FAERS |
| 6 | Nausea | FAERS: 418 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 7 | Dizziness | FAERS: 400 Canada Vigilance: 6 | 9577998 10448828 | CTD SIDER Canada Vigilance US FAERS |
| 8 | Malaise | FAERS: 350 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 9 | Pruritus | FAERS: 320 Canada Vigilance: 13 | 19221540 | CTD SIDER Canada Vigilance US FAERS |
| 10 | Vomiting | FAERS: 320 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 11 | Fatigue | FAERS: 273 Canada Vigilance: 3 | 10448828 | CTD SIDER Canada Vigilance US FAERS |
| 12 | Overdose | FAERS: 257 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 13 | Lymphadenopathy | FAERS: 234 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 14 | Feeling abnormal | FAERS: 233 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 15 | Drug dose omission | FAERS: 224 | US FAERS | |
| 16 | Toxic Epidermal Necrolysis | FAERS: 223 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 17 | Anxiety | FAERS: 218 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 18 | Hypersensitivity | FAERS: 216 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 19 | Agitation | FAERS: 214 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 20 | Somnolence | FAERS: 211 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 21 | Tremor | FAERS: 203 Canada Vigilance: 1 | 8101290 | CTD SIDER Canada Vigilance US FAERS |
| 22 | Toxicity to various agents | FAERS: 200 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 23 | Alopecia | FAERS: 199 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 24 | Product quality issue | FAERS: 197 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 25 | Erythema | FAERS: 175 Canada Vigilance: 8 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 26 | Therapeutic response unexpected with drug substitution | FAERS: 159 | OFFSIDES US FAERS | |
| 27 | Pain | FAERS: 156 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 28 | Urticaria | FAERS: 156 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 29 | Adverse event | FAERS: 148 | OFFSIDES US FAERS | |
| 30 | Epilepsy | FAERS: 141 | CTD OFFSIDES US FAERS | |
| 31 | Crying | FAERS: 138 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 32 | Memory impairment | FAERS: 133 | US FAERS | |
| 33 | Asthenia | FAERS: 126 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 34 | Arthralgia | FAERS: 115 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 35 | Rash erythematous | FAERS: 110 | US FAERS | |
| 36 | Drug administration error | FAERS: 106 | OFFSIDES US FAERS | |
| 37 | Amnesia | FAERS: 104 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 38 | Suicide attempt | FAERS: 103 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 39 | Drug dispensing error | FAERS: 101 | OFFSIDES US FAERS | |
| 40 | Myalgia | FAERS: 101 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 41 | Ataxia | FAERS: 98 Canada Vigilance: 1 | 19681008 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 42 | Alanine Aminotransferase Increased | FAERS: 90 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 43 | Anger | FAERS: 87 | US FAERS | |
| 44 | Oropharyngeal pain | FAERS: 87 | OFFSIDES US FAERS | |
| 45 | Incorrect dose administered | FAERS: 85 | US FAERS | |
| 46 | Stomatitis | FAERS: 82 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 47 | Live Birth | FAERS: 81 | OFFSIDES US FAERS | |
| 48 | Abdominal Pain | FAERS: 77 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 49 | Diplopia | FAERS: 77 Canada Vigilance: 1 | 9577998 11052335 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 50 | Eosinophilia | FAERS: 76 | 19221540 | CTD SIDER US FAERS |
| 51 | Thrombocytopenia | FAERS: 76 | SIDER US FAERS | |
| 52 | Weight decreased | FAERS: 75 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 53 | Medication Error | FAERS: 74 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Mood swings | FAERS: 74 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 55 | Back Pain | FAERS: 72 | 15845756 | CTD SIDER US FAERS |
| 56 | Visual Impairment | FAERS: 69 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 57 | Aspartate Aminotransferase Increased | FAERS: 68 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 58 | Tachycardia | FAERS: 68 | SIDER US FAERS | |
| 59 | Chills | FAERS: 66 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 60 | Erythema Multiforme | FAERS: 66 | OFFSIDES SIDER US FAERS | |
| 61 | Nasopharyngitis | FAERS: 66 | US FAERS | |
| 62 | Accidental exposure to product by child | FAERS: 64 | US FAERS | |
| 63 | Dysgeusia | FAERS: 64 | SIDER US FAERS | |
| 64 | Pharmaceutical product complaint | FAERS: 62 | US FAERS | |
| 65 | Drug exposure via breast milk | FAERS: 61 | OFFSIDES US FAERS | |
| 66 | Depressed Level of Consciousness | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 67 | Lip swelling | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 68 | Skin lesion | FAERS: 60 | OFFSIDES US FAERS | |
| 69 | Dysarthria | FAERS: 59 | SIDER US FAERS | |
| 70 | Status Epilepticus | FAERS: 59 | 17846277 | CTD OFFSIDES SIDER US FAERS |
| 71 | Lethargy | FAERS: 58 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 72 | Myoclonus | FAERS: 58 | 16157917 16702909 | CTD SIDER US FAERS |
| 73 | Accidental overdose | FAERS: 57 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Acne | FAERS: 57 | OFFSIDES SIDER US FAERS | |
| 75 | Completed Suicide | FAERS: 57 | SIDER US FAERS | |
| 76 | Impaired work ability | FAERS: 57 | US FAERS | |
| 77 | Maternal exposure during pregnancy | FAERS: 57 | US FAERS | |
| 78 | Aphasia | FAERS: 56 | SIDER US FAERS | |
| 79 | Transaminases increased | FAERS: 55 | US FAERS | |
| 80 | Hypotension | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Bipolar Disorder | FAERS: 53 |
12505823
12734768 15169707 15845756 16442685 16519947 16566634 16702909 16806624 16866770 16889444 17209152 18585548 19077780 20021991 | CTD OFFSIDES SIDER US FAERS |
| 82 | Pneumonia | FAERS: 53 | 16442685 | CTD SIDER US FAERS |
| 83 | Vertigo | FAERS: 53 | SIDER US FAERS | |
| 84 | Conjunctivitis | FAERS: 51 | SIDER US FAERS | |
| 85 | Chest Pain | FAERS: 50 | SIDER US FAERS | |
| 86 | Swelling | FAERS: 49 | US FAERS | |
| 87 | White blood cell count decreased | FAERS: 49 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 88 | Altered state of consciousness | FAERS: 48 | SIDER US FAERS | |
| 89 | Burning sensation | FAERS: 48 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 90 | Therapeutic response unexpected | FAERS: 48 | OFFSIDES US FAERS | |
| 91 | jaundice | FAERS: 48 | 17923349 19031378 | CTD US FAERS |
| 92 | Exposure during breast feeding | FAERS: 47 | US FAERS | |
| 93 | Mental impairment | FAERS: 47 | US FAERS | |
| 94 | Cleft Palate | FAERS: 45 | OFFSIDES US FAERS | |
| 95 | Depressed mood | FAERS: 45 | US FAERS | |
| 96 | Wrong technique in product usage process | FAERS: 45 | US FAERS | |
| 97 | Blindness | FAERS: 44 | US FAERS | |
| 98 | Neutropenia | FAERS: 44 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 99 | Disseminated Intravascular Coagulation | FAERS: 43 | 9371937 | CTD OFFSIDES SIDER US FAERS |
| 100 | Drug withdrawal syndrome | FAERS: 43 | SIDER US FAERS | |
| 101 | Eye pain | FAERS: 43 | SIDER US FAERS | |
| 102 | Disorientation | FAERS: 42 | US FAERS | |
| 103 | Photophobia | FAERS: 42 | SIDER US FAERS | |
| 104 | Pregnancy | FAERS: 42 | US FAERS | |
| 105 | Rhabdomyolysis | FAERS: 42 | 9371937 | CTD SIDER US FAERS |
| 106 | Sinus Tachycardia | FAERS: 42 | US FAERS | |
| 107 | Drug screen positive | FAERS: 41 | OFFSIDES US FAERS | |
| 108 | Hepatitis | FAERS: 41 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 109 | Restlessness | FAERS: 41 | US FAERS | |
| 110 | Cerebrovascular accident | FAERS: 39 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 111 | Drug level decreased | FAERS: 39 | US FAERS | |
| 112 | Drug toxicity | FAERS: 39 | US FAERS | |
| 113 | Gamma-Glutamyltransferase Increased | FAERS: 39 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 114 | Stress | FAERS: 39 | US FAERS | |
| 115 | Cardiac Arrest | FAERS: 38 | SIDER US FAERS | |
| 116 | General physical health deterioration | FAERS: 38 | US FAERS | |
| 117 | Dehydration | FAERS: 37 | US FAERS | |
| 118 | Leukopenia | FAERS: 37 | SIDER US FAERS | |
| 119 | Therapeutic response changed | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 120 | Musculoskeletal stiffness | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 121 | Nystagmus | FAERS: 36 | OFFSIDES SIDER US FAERS | |
| 122 | Tinnitus | FAERS: 36 | SIDER US FAERS | |
| 123 | Neck Pain | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 124 | Personality Change | FAERS: 35 | OFFSIDES US FAERS | |
| 125 | Abdominal discomfort | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 126 | Constipation | FAERS: 34 | SIDER US FAERS | |
| 127 | Palpitations | FAERS: 34 | SIDER US FAERS | |
| 128 | Serotonin Syndrome | FAERS: 34 | US FAERS | |
| 129 | Influenza | FAERS: 33 | SIDER US FAERS | |
| 130 | Nervousness | FAERS: 33 | SIDER US FAERS | |
| 131 | Aura | FAERS: 32 | US FAERS | |
| 132 | Drug level increased | FAERS: 32 | US FAERS | |
| 133 | Drug screen false positive | FAERS: 32 | US FAERS | |
| 134 | Dry skin | FAERS: 32 | SIDER US FAERS | |
| 135 | Retching | FAERS: 32 | US FAERS | |
| 136 | Talipes | FAERS: 32 | OFFSIDES US FAERS | |
| 137 | Activities of daily living impaired | FAERS: 31 | US FAERS | |
| 138 | Blood creatinine increased | FAERS: 31 | US FAERS | |
| 139 | Eczema | FAERS: 31 | OFFSIDES SIDER US FAERS | |
| 140 | Emotional distress | FAERS: 31 | US FAERS | |
| 141 | Disability | FAERS: 30 | US FAERS | |
| 142 | Emotional disorder | FAERS: 30 | US FAERS | |
| 143 | Leukocytosis | FAERS: 30 | SIDER US FAERS | |
| 144 | Oral pain | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 145 | Respiratory distress | FAERS: 30 | US FAERS | |
| 146 | Intentional product use issue | FAERS: 29 | US FAERS | |
| 147 | Mental status changes | FAERS: 29 | US FAERS | |
| 148 | Product dose omission | FAERS: 29 | US FAERS | |
| 149 | Cholestasis | FAERS: 28 | US FAERS | |
| 150 | Disease recurrence | FAERS: 28 | US FAERS | |
| 151 | Feeding disorder neonatal | FAERS: 28 | US FAERS | |
| 152 | Pallor | FAERS: 28 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 153 | Pancytopenia | FAERS: 28 | 16442685 | CTD SIDER US FAERS |
| 154 | Product use in unapproved indication | FAERS: 28 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 155 | Unevaluable event | FAERS: 28 | US FAERS | |
| 156 | Cyanosis | FAERS: 27 | US FAERS | |
| 157 | Exposure via breast milk | FAERS: 27 | US FAERS | |
| 158 | Infection | FAERS: 27 | SIDER US FAERS | |
| 159 | Stillbirth | FAERS: 27 | US FAERS | |
| 160 | Syncope | FAERS: 27 | SIDER US FAERS | |
| 161 | nervous system disorder | FAERS: 27 | SIDER US FAERS | |
| 162 | Angioedema | FAERS: 26 | SIDER US FAERS | |
| 163 | Blood glucose increased | FAERS: 26 | US FAERS | |
| 164 | Choking | FAERS: 26 | US FAERS | |
| 165 | Clonus | FAERS: 26 | OFFSIDES US FAERS | |
| 166 | Retinal pigment epitheliopathy | FAERS: 26 | US FAERS | |
| 167 | Blood creatine phosphokinase increased | FAERS: 25 | US FAERS | |
| 168 | Cheilitis | FAERS: 25 | OFFSIDES US FAERS | |
| 169 | Impaired driving ability | FAERS: 25 | US FAERS | |
| 170 | Lupus-like syndrome | FAERS: 25 | OFFSIDES US FAERS | |
| 171 | Pancreatitis | FAERS: 25 | SIDER US FAERS | |
| 172 | Poor quality sleep | FAERS: 25 | US FAERS | |
| 173 | Product use issue | FAERS: 25 | US FAERS | |
| 174 | treatment failure | FAERS: 25 | US FAERS | |
| 175 | Acute kidney injury | FAERS: 24 | US FAERS | |
| 176 | Anencephaly | FAERS: 24 | OFFSIDES US FAERS | |
| 177 | Blood lactate dehydrogenase increased | FAERS: 24 | US FAERS | |
| 178 | Eye irritation | FAERS: 24 | US FAERS | |
| 179 | Hyperreflexia | FAERS: 24 | SIDER US FAERS | |
| 180 | Oculogyric crisis | FAERS: 24 | US FAERS | |
| 181 | Psoriasis | FAERS: 24 | US FAERS | |
| 182 | Abasia | FAERS: 23 | US FAERS | |
| 183 | Electrocardiogram abnormal | FAERS: 23 | US FAERS | |
| 184 | Epistaxis | FAERS: 23 | SIDER US FAERS | |
| 185 | Hypomania | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 186 | Muscle Rigidity | FAERS: 23 | US FAERS | |
| 187 | Sepsis | FAERS: 23 | US FAERS | |
| 188 | Urinary tract infection | FAERS: 23 | SIDER US FAERS | |
| 189 | Hypersomnia | FAERS: 22 | US FAERS | |
| 190 | Inability to afford medication | FAERS: 22 | US FAERS | |
| 191 | Lip erosion | FAERS: 22 | OFFSIDES US FAERS | |
| 192 | Pharyngolaryngeal Pain | FAERS: 22 | OFFSIDES SIDER US FAERS | |
| 193 | Respiratory arrest | FAERS: 22 | US FAERS | |
| 194 | Flushing | FAERS: 21 | SIDER US FAERS | |
| 195 | Inappropriate schedule of drug administration | FAERS: 21 | US FAERS | |
| 196 | Intentional product misuse | FAERS: 21 | US FAERS | |
| 197 | Menorrhagia | FAERS: 21 | SIDER US FAERS | |
| 198 | Respiratory Failure | FAERS: 21 | US FAERS | |
| 199 | Skin Ulcer | FAERS: 21 | SIDER US FAERS | |
| 200 | Splenomegaly | FAERS: 21 | US FAERS | |
| 201 | Therapy cessation | FAERS: 21 | US FAERS | |
| 202 | Thirst | FAERS: 21 | SIDER US FAERS | |
| 203 | Dermatitis | FAERS: 20 | SIDER US FAERS | |
| 204 | Discomfort | FAERS: 20 | SIDER US FAERS | |
| 205 | Drug effect incomplete | FAERS: 20 | US FAERS | |
| 206 | Drug prescribing error | FAERS: 20 | US FAERS | |
| 207 | Dystonia | FAERS: 20 | 19681008 | CTD US FAERS |
| 208 | Hypophagia | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 209 | Inflammation | FAERS: 20 | US FAERS | |
| 210 | Myocarditis | FAERS: 20 | US FAERS | |
| 211 | Bronchitis | FAERS: 19 | SIDER US FAERS | |
| 212 | Hepatomegaly | FAERS: 19 Canada Vigilance: 1 | 17923349 | CTD Canada Vigilance US FAERS |
| 213 | Myocardial Infarction | FAERS: 19 | SIDER US FAERS | |
| 214 | Sinusitis | FAERS: 19 | SIDER US FAERS | |
| 215 | Thermal burn | FAERS: 19 | US FAERS | |
| 216 | Blood alkaline phosphatase increased | FAERS: 18 | US FAERS | |
| 217 | Clumsiness | FAERS: 18 | OFFSIDES US FAERS | |
| 218 | Delirium | FAERS: 18 | 15169707 18593793 | CTD SIDER US FAERS |
| 219 | Drug abuse | FAERS: 18 | US FAERS | |
| 220 | Skin reaction | FAERS: 18 | US FAERS | |
| 221 | Unresponsive to stimuli | FAERS: 18 | US FAERS | |
| 222 | Asthma | FAERS: 17 | SIDER US FAERS | |
| 223 | Hyperphagia | FAERS: 17 | US FAERS | |
| 224 | Meningitis | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 225 | Mucosal erosion | FAERS: 17 | OFFSIDES US FAERS | |
| 226 | Obsessive-Compulsive Disorder | FAERS: 17 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 227 | Product administration error | FAERS: 17 | US FAERS | |
| 228 | Pulmonary Valve Stenosis | FAERS: 17 | US FAERS | |
| 229 | Scab | FAERS: 17 | US FAERS | |
| 230 | Staring | FAERS: 17 | US FAERS | |
| 231 | Thrombosis | FAERS: 17 | SIDER US FAERS | |
| 232 | Urinary Incontinence | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 233 | Visual disturbance | FAERS: 17 | OFFSIDES US FAERS | |
| 234 | Anorexia | FAERS: 16 | SIDER US FAERS | |
| 235 | Anticonvulsant drug level above therapeutic | FAERS: 16 | OFFSIDES US FAERS | |
| 236 | Anticonvulsant drug level below therapeutic | FAERS: 16 | OFFSIDES US FAERS | |
| 237 | Dysphemia | FAERS: 16 | US FAERS | |
| 238 | Dysphonia | FAERS: 16 | US FAERS | |
| 239 | Dysuria | FAERS: 16 | SIDER US FAERS | |
| 240 | Night sweats | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 241 | Prescribed overdose | FAERS: 16 | US FAERS | |
| 242 | Retinal phototoxicity | FAERS: 16 | US FAERS | |
| 243 | Wrong drug administered | FAERS: 16 | OFFSIDES US FAERS | |
| 244 | Apathy | FAERS: 15 | SIDER US FAERS | |
| 245 | Atypical femur fracture | FAERS: 15 | US FAERS | |
| 246 | Blepharospasm | FAERS: 15 | US FAERS | |
| 247 | Chest discomfort | FAERS: 15 | US FAERS | |
| 248 | Dental caries | FAERS: 15 | US FAERS | |
| 249 | Emergency care examination | FAERS: 15 | US FAERS | |
| 250 | Feeling jittery | FAERS: 15 | US FAERS | |
| 251 | Hypothyroidism | FAERS: 15 | SIDER US FAERS | |
| 252 | Metabolic acidosis | FAERS: 15 | US FAERS | |
| 253 | No adverse event | FAERS: 15 | US FAERS | |
| 254 | Paranoia | FAERS: 15 | SIDER US FAERS | |
| 255 | Product taste abnormal | FAERS: 15 | US FAERS | |
| 256 | Septic Shock | FAERS: 15 | US FAERS | |
| 257 | Therapy change | FAERS: 15 | US FAERS | |
| 258 | Wrong technique in drug usage process | FAERS: 15 | US FAERS | |
| 259 | Dyspepsia | FAERS: 14 | SIDER US FAERS | |
| 260 | Infantile apnoeic attack | FAERS: 14 | OFFSIDES US FAERS | |
| 261 | Intestinal Obstruction | FAERS: 14 | US FAERS | |
| 262 | Lymphadenitis | FAERS: 14 | US FAERS | |
| 263 | Mydriasis | FAERS: 14 | US FAERS | |
| 264 | Oral mucosal eruption | FAERS: 14 | US FAERS | |
| 265 | Papule | FAERS: 14 | US FAERS | |
| 266 | Patent ductus arteriosus | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 267 | Proteinuria | FAERS: 14 | US FAERS | |
| 268 | Respiratory Depression | FAERS: 14 | US FAERS | |
| 269 | Trisomy 21 | FAERS: 14 | US FAERS | |
| 270 | Uveitis | FAERS: 14 | SIDER US FAERS | |
| 271 | Aphonia | FAERS: 13 | US FAERS | |
| 272 | Apparent death | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 273 | Cataract | FAERS: 13 | US FAERS | |
| 274 | Complex partial seizures | FAERS: 13 | OFFSIDES US FAERS | |
| 275 | Corneal Opacity | FAERS: 13 | US FAERS | |
| 276 | Dementia | FAERS: 13 | US FAERS | |
| 277 | Dysmorphism | FAERS: 13 | US FAERS | |
| 278 | Expired product administered | FAERS: 13 | US FAERS | |
| 279 | Intentional self-injury | FAERS: 13 | US FAERS | |
| 280 | Neutrophil count decreased | FAERS: 13 | US FAERS | |
| 281 | Osteoporosis | FAERS: 13 | US FAERS | |
| 282 | Blood potassium decreased | FAERS: 12 | US FAERS | |
| 283 | Cellulitis | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 284 | Chorea | FAERS: 12 | 11792164 16900938 19681008 | CTD US FAERS |
| 285 | Choreoathetosis | FAERS: 12 | SIDER US FAERS | |
| 286 | Chromaturia | FAERS: 12 | US FAERS | |
| 287 | Circumstance or information capable of leading to medication error | FAERS: 12 | US FAERS | |
| 288 | Eosinophilic myocarditis | FAERS: 12 | US FAERS | |
| 289 | Epidermal necrosis | FAERS: 12 | OFFSIDES US FAERS | |
| 290 | Flatulence | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 291 | Increased tendency to bruise | FAERS: 12 | US FAERS | |
| 292 | Joint swelling | FAERS: 12 | US FAERS | |
| 293 | Lymphocyte stimulation test positive | FAERS: 12 | US FAERS | |
| 294 | Lymphopenia | FAERS: 12 | US FAERS | |
| 295 | Multiple allergies | FAERS: 12 | US FAERS | |
| 296 | Myoclonic Epilepsy | FAERS: 12 | OFFSIDES US FAERS | |
| 297 | Neonatal disorder | FAERS: 12 | US FAERS | |
| 298 | Nonspecific reaction | FAERS: 12 | OFFSIDES US FAERS | |
| 299 | Peripheral swelling | FAERS: 12 | US FAERS | |
| 300 | Pulmonary Hypertension | FAERS: 12 | US FAERS | |
| 301 | Purpura | FAERS: 12 | US FAERS | |
| 302 | Screaming | FAERS: 12 | US FAERS | |
| 303 | Shock | FAERS: 12 | SIDER US FAERS | |
| 304 | Sudden death | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 305 | Symblepharon | FAERS: 12 | OFFSIDES US FAERS | |
| 306 | Ulcer | FAERS: 12 | US FAERS | |
| 307 | pseudomembranous colitis | FAERS: 12 | US FAERS | |
| 308 | Accidental exposure to product | FAERS: 11 | US FAERS | |
| 309 | Acidosis | FAERS: 11 | US FAERS | |
| 310 | Anticonvulsant drug level decreased | FAERS: 11 | OFFSIDES US FAERS | |
| 311 | Deafness | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 312 | Drug level fluctuating | FAERS: 11 | OFFSIDES US FAERS | |
| 313 | Emergency Care | FAERS: 11 | US FAERS | |
| 314 | Formication | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 315 | Histiocytosis haematophagic | FAERS: 11 | OFFSIDES US FAERS | |
| 316 | Hyperacusis | FAERS: 11 | US FAERS | |
| 317 | Initial insomnia | FAERS: 11 | US FAERS | |
| 318 | Maternal exposure during breast feeding | FAERS: 11 | US FAERS | |
| 319 | Middle insomnia | FAERS: 11 | US FAERS | |
| 320 | Nephrolithiasis | FAERS: 11 | US FAERS | |
| 321 | Rheumatoid Arthritis | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 322 | Wheezing | FAERS: 11 | US FAERS | |
| 323 | Accidental drug intake by child | FAERS: 10 | OFFSIDES US FAERS | |
| 324 | Acute respiratory failure | FAERS: 10 | US FAERS | |
| 325 | Anhedonia | FAERS: 10 | US FAERS | |
| 326 | Bradycardia | FAERS: 10 | US FAERS | |
| 327 | Economic problem | FAERS: 10 | US FAERS | |
| 328 | Hepatic necrosis | FAERS: 10 | OFFSIDES US FAERS | |
| 329 | Hypospadias | FAERS: 10 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 330 | Idiosyncratic drug reaction | FAERS: 10 | OFFSIDES US FAERS | |
| 331 | Low birth weight baby | FAERS: 10 | US FAERS | |
| 332 | Metrorrhagia | FAERS: 10 | US FAERS | |
| 333 | Microcephaly | FAERS: 10 | US FAERS | |
| 334 | Oropharyngeal blistering | FAERS: 10 | OFFSIDES US FAERS | |
| 335 | Pain of skin | FAERS: 10 | OFFSIDES US FAERS | |
| 336 | Pericarditis | FAERS: 10 | US FAERS | |
| 337 | Pneumonitis | FAERS: 10 | US FAERS | |
| 338 | Poisoning | FAERS: 10 | US FAERS | |
| 339 | Tachyphrenia | FAERS: 10 | US FAERS | |
| 340 | Vasculitis | FAERS: 10 | SIDER US FAERS | |
| 341 | Ventricular Fibrillation | FAERS: 10 | US FAERS | |
| 342 | Ammonia increased | FAERS: 9 | OFFSIDES US FAERS | |
| 343 | Anal inflammation | FAERS: 9 | US FAERS | |
| 344 | Ankle Fracture | FAERS: 9 | US FAERS | |
| 345 | Aphthous Stomatitis | FAERS: 9 | SIDER US FAERS | |
| 346 | Arthritis | FAERS: 9 | SIDER US FAERS | |
| 347 | Atrioventricular Block | FAERS: 9 | US FAERS | |
| 348 | Blood amylase increased | FAERS: 9 | OFFSIDES US FAERS | |
| 349 | Blood glucose decreased | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 350 | Cardiotoxicity | FAERS: 9 | US FAERS | |
| 351 | Cold sweat | FAERS: 9 | US FAERS | |
| 352 | Colitis | FAERS: 9 | US FAERS | |
| 353 | Dissociation | FAERS: 9 | US FAERS | |
| 354 | Drug level below therapeutic | FAERS: 9 | OFFSIDES US FAERS | |
| 355 | Ectopic Pregnancy | FAERS: 9 | US FAERS | |
| 356 | Eye inflammation | FAERS: 9 | OFFSIDES US FAERS | |
| 357 | Foreign body trauma | FAERS: 9 | US FAERS | |
| 358 | Gestational Diabetes | FAERS: 9 | US FAERS | |
| 359 | Hepatotoxicity | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 360 | Human herpes virus 6 serology positive | FAERS: 9 | OFFSIDES US FAERS | |
| 361 | Hyperthyroidism | FAERS: 9 | US FAERS | |
| 362 | Incoherent | FAERS: 9 | US FAERS | |
| 363 | Laryngitis | FAERS: 9 | US FAERS | |
| 364 | Lymphocytic infiltration | FAERS: 9 | OFFSIDES US FAERS | |
| 365 | Ocular discomfort | FAERS: 9 | US FAERS | |
| 366 | Petechiae | FAERS: 9 | SIDER US FAERS | |
| 367 | Product availability issue | FAERS: 9 | US FAERS | |
| 368 | Product physical issue | FAERS: 9 | US FAERS | |
| 369 | Pseudolymphoma | FAERS: 9 | US FAERS | |
| 370 | Skin Erosion | FAERS: 9 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 371 | Skin irritation | FAERS: 9 | US FAERS | |
| 372 | Spina Bifida | FAERS: 9 | OFFSIDES US FAERS | |
| 373 | Temperature regulation disorder | FAERS: 9 | US FAERS | |
| 374 | Tonic clonic movements | FAERS: 9 | US FAERS | |
| 375 | Urinary Retention | FAERS: 9 | SIDER US FAERS | |
| 376 | Acute myopia | FAERS: 8 | US FAERS | |
| 377 | Anticonvulsant drug level increased | FAERS: 8 | OFFSIDES US FAERS | |
| 378 | Arthropathy | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 379 | Ascites | FAERS: 8 | US FAERS | |
| 380 | Bipolar I disorder | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 381 | Blood sodium decreased | FAERS: 8 | US FAERS | |
| 382 | Blood urea increased | FAERS: 8 | US FAERS | |
| 383 | Conversion disorder | FAERS: 8 | US FAERS | |
| 384 | Deafness Neurosensory | FAERS: 8 | US FAERS | |
| 385 | Drooling | FAERS: 8 | US FAERS | |
| 386 | Drug level above therapeutic | FAERS: 8 | US FAERS | |
| 387 | Electroencephalogram abnormal | FAERS: 8 | US FAERS | |
| 388 | Extra dose administered | FAERS: 8 | US FAERS | |
| 389 | Facial Pain | FAERS: 8 | SIDER US FAERS | |
| 390 | Failure to Thrive | FAERS: 8 | US FAERS | |
| 391 | Foaming at mouth | FAERS: 8 | US FAERS | |
| 392 | Fracture | FAERS: 8 | US FAERS | |
| 393 | Hypokinesia | FAERS: 8 | SIDER US FAERS | |
| 394 | Hypoplastic Left Heart Syndrome | FAERS: 8 | US FAERS | |
| 395 | Hyporeflexia | FAERS: 8 | SIDER US FAERS | |
| 396 | Incontinence | FAERS: 8 | US FAERS | |
| 397 | Infertility | FAERS: 8 | US FAERS | |
| 398 | Iridocyclitis | FAERS: 8 | US FAERS | |
| 399 | Joint injury | FAERS: 8 | US FAERS | |
| 400 | Lymphocytosis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 401 | Lymphoma | FAERS: 8 | US FAERS | |
| 402 | Macrocytosis | FAERS: 8 | US FAERS | |
| 403 | Mouth swelling | FAERS: 8 | US FAERS | |
| 404 | Neuralgia | FAERS: 8 | 16113981 | CTD SIDER US FAERS |
| 405 | Obsessive thoughts | FAERS: 8 | US FAERS | |
| 406 | Oculomucocutaneous syndrome | FAERS: 8 | US FAERS | |
| 407 | Performance status decreased | FAERS: 8 | OFFSIDES US FAERS | |
| 408 | Pharyngitis | FAERS: 8 | SIDER US FAERS | |
| 409 | Post-Traumatic Stress Disorder | FAERS: 8 | US FAERS | |
| 410 | Product dispensing error | FAERS: 8 | US FAERS | |
| 411 | Pulmonary Embolism | FAERS: 8 | US FAERS | |
| 412 | Sick Sinus Syndrome | FAERS: 8 | US FAERS | |
| 413 | Terminal state | FAERS: 8 | OFFSIDES US FAERS | |
| 414 | Trichiasis | FAERS: 8 | OFFSIDES US FAERS | |
| 415 | Allergic reaction to excipient | FAERS: 7 | US FAERS | |
| 416 | Aphagia | FAERS: 7 | US FAERS | |
| 417 | Blood urine present | FAERS: 7 | US FAERS | |
| 418 | Candidiasis | FAERS: 7 | US FAERS | |
| 419 | Cell Death | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 420 | Congenital diaphragmatic hernia | FAERS: 7 | OFFSIDES US FAERS | |
| 421 | Congenital skin dimples | FAERS: 7 | US FAERS | |
| 422 | Deep Vein Thrombosis | FAERS: 7 | US FAERS | |
| 423 | Educational problem | FAERS: 7 | US FAERS | |
| 424 | Euphoric mood | FAERS: 7 | SIDER US FAERS | |
| 425 | Glomerulonephritis | FAERS: 7 | OFFSIDES US FAERS | |
| 426 | Head discomfort | FAERS: 7 | US FAERS | |
| 427 | Holoprosencephaly | FAERS: 7 | OFFSIDES US FAERS | |
| 428 | Hydronephrosis | FAERS: 7 | US FAERS | |
| 429 | Hypoxia | FAERS: 7 | US FAERS | |
| 430 | Liver Abscess | FAERS: 7 | US FAERS | |
| 431 | Medication residue | FAERS: 7 | US FAERS | |
| 432 | Multiple Sclerosis | FAERS: 7 | US FAERS | |
| 433 | Muscle tightness | FAERS: 7 | OFFSIDES US FAERS | |
| 434 | Musculoskeletal Pain | FAERS: 7 | US FAERS | |
| 435 | Neuroleptic Malignant Syndrome | FAERS: 7 | US FAERS | |
| 436 | Pericardial effusion | FAERS: 7 | US FAERS | |
| 437 | Polydactyly | FAERS: 7 | US FAERS | |
| 438 | Pre-Eclampsia | FAERS: 7 | US FAERS | |
| 439 | Protein total increased | FAERS: 7 | US FAERS | |
| 440 | Renal pain | FAERS: 7 | SIDER US FAERS | |
| 441 | Retinal Artery Occlusion | FAERS: 7 | US FAERS | |
| 442 | Retrognathia | FAERS: 7 | US FAERS | |
| 443 | Sunburn | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 444 | Tardive Dyskinesia | FAERS: 7 | US FAERS | |
| 445 | Temperature intolerance | FAERS: 7 | OFFSIDES US FAERS | |
| 446 | Therapy non-responder | FAERS: 7 | US FAERS | |
| 447 | Throat irritation | FAERS: 7 | US FAERS | |
| 448 | Thrombocytosis | FAERS: 7 | US FAERS | |
| 449 | Toothache | FAERS: 7 | US FAERS | |
| 450 | Vanishing bile duct syndrome | FAERS: 7 | US FAERS | |
| 451 | furuncle | FAERS: 7 | US FAERS | |
| 452 | Accidental exposure | FAERS: 6 | US FAERS | |
| 453 | Ageusia | FAERS: 6 | SIDER US FAERS | |
| 454 | Anuria | FAERS: 6 | US FAERS | |
| 455 | Atrial Fibrillation | FAERS: 6 | SIDER US FAERS | |
| 456 | Bedridden | FAERS: 6 | US FAERS | |
| 457 | Bicuspid aortic valve | FAERS: 6 | US FAERS | |
| 458 | Bradyphrenia | FAERS: 6 | US FAERS | |
| 459 | Breast tenderness | FAERS: 6 | US FAERS | |
| 460 | Bruxism | FAERS: 6 | US FAERS | |
| 461 | Congenital Hydrocephalus | FAERS: 6 | US FAERS | |
| 462 | Cytolytic hepatitis | FAERS: 6 | US FAERS | |
| 463 | Dandy-Walker Syndrome | FAERS: 6 | OFFSIDES US FAERS | |
| 464 | Diabetes Mellitus | FAERS: 6 | US FAERS | |
| 465 | Drug Dependence | FAERS: 6 | US FAERS | |
| 466 | Drug abuser | FAERS: 6 | US FAERS | |
| 467 | Drug ineffective for unapproved indication | FAERS: 6 | US FAERS | |
| 468 | Drug titration error | FAERS: 6 | US FAERS | |
| 469 | Dysgraphia | FAERS: 6 | US FAERS | |
| 470 | Elevated mood | FAERS: 6 | OFFSIDES US FAERS | |
| 471 | Encephalocele | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 472 | False positive investigation result | FAERS: 6 | US FAERS | |
| 473 | Flight of ideas | FAERS: 6 | US FAERS | |
| 474 | Gastritis | FAERS: 6 | SIDER US FAERS | |
| 475 | Gastrointestinal Pain | FAERS: 6 | SIDER US FAERS | |
| 476 | Genital erosion | FAERS: 6 | OFFSIDES US FAERS | |
| 477 | Genital pain | FAERS: 6 | US FAERS | |
| 478 | Head titubation | FAERS: 6 | OFFSIDES US FAERS | |
| 479 | Hormone level abnormal | FAERS: 6 | US FAERS | |
| 480 | Hypohidrosis | FAERS: 6 | US FAERS | |
| 481 | Immobile | FAERS: 6 | US FAERS | |
| 482 | Laceration | FAERS: 6 | US FAERS | |
| 483 | Medication residue present | FAERS: 6 | US FAERS | |
| 484 | Muscle Spasticity | FAERS: 6 | US FAERS | |
| 485 | Negative thoughts | FAERS: 6 | US FAERS | |
| 486 | Nerve injury | FAERS: 6 | US FAERS | |
| 487 | Neutropenic sepsis | FAERS: 6 | US FAERS | |
| 488 | Ocular Hypertension | FAERS: 6 | US FAERS | |
| 489 | Palmar erythema | FAERS: 6 | US FAERS | |
| 490 | Perivascular dermatitis | FAERS: 6 | US FAERS | |
| 491 | Poverty of speech | FAERS: 6 | US FAERS | |
| 492 | Pregnancy on oral contraceptive | FAERS: 6 | US FAERS | |
| 493 | Presyncope | FAERS: 6 | US FAERS | |
| 494 | Protein urine present | FAERS: 6 | US FAERS | |
| 495 | Prothrombin level decreased | FAERS: 6 | OFFSIDES US FAERS | |
| 496 | Pulmonary Fibrosis | FAERS: 6 | US FAERS | |
| 497 | Retinal Detachment | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 498 | Skin necrosis | FAERS: 6 | US FAERS | |
| 499 | Sneezing | FAERS: 6 | US FAERS | |
| 500 | Tongue blistering | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 501 | Tooth Loss | FAERS: 6 | US FAERS | |
| 502 | Ureteric perforation | FAERS: 6 | US FAERS | |
| 503 | Vulvovaginal pruritus | FAERS: 6 | OFFSIDES US FAERS | |
| 504 | Agranulocytosis | FAERS: 5 | SIDER US FAERS | |
| 505 | Akathisia | FAERS: 5 | SIDER US FAERS | |
| 506 | Alveolitis | FAERS: 5 | US FAERS | |
| 507 | Asphyxia | FAERS: 5 | US FAERS | |
| 508 | Atelectasis | FAERS: 5 | US FAERS | |
| 509 | Back disorder | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 510 | Blighted ovum | FAERS: 5 | US FAERS | |
| 511 | Blood blister | FAERS: 5 | US FAERS | |
| 512 | Blood cholesterol increased | FAERS: 5 | US FAERS | |
| 513 | Blood triglycerides increased | FAERS: 5 | US FAERS | |
| 514 | Bowel movement irregularity | FAERS: 5 | US FAERS | |
| 515 | Breast Feeding | FAERS: 5 | SIDER US FAERS | |
| 516 | Cataract operation | FAERS: 5 | US FAERS | |
| 517 | Catatonia | FAERS: 5 | US FAERS | |
| 518 | Cerebral Infarction | FAERS: 5 | US FAERS | |
| 519 | Cerebral disorder | FAERS: 5 | US FAERS | |
| 520 | Cerebral ventricle dilatation | FAERS: 5 | US FAERS | |
| 521 | Choanal Atresia | FAERS: 5 | OFFSIDES US FAERS | |
| 522 | Combined immunodeficiency | FAERS: 5 | US FAERS | |
| 523 | Congenital cystic kidney disease | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 524 | Cytopenia | FAERS: 5 | US FAERS | |
| 525 | Demyelination | FAERS: 5 | US FAERS | |
| 526 | Dermatitis acneiform | FAERS: 5 | US FAERS | |
| 527 | Drug level changed | FAERS: 5 | OFFSIDES US FAERS | |
| 528 | Drug name confusion | FAERS: 5 | US FAERS | |
| 529 | Dwarfism | FAERS: 5 | US FAERS | |
| 530 | Enteritis | FAERS: 5 | US FAERS | |
| 531 | Eosinophil percentage increased | FAERS: 5 | US FAERS | |
| 532 | Epileptic aura | FAERS: 5 | OFFSIDES US FAERS | |
| 533 | Erectile dysfunction | FAERS: 5 | 10728528 | CTD SIDER US FAERS |
| 534 | Exfoliative rash | FAERS: 5 | OFFSIDES US FAERS | |
| 535 | Expired drug administered | FAERS: 5 | OFFSIDES US FAERS | |
| 536 | Fibromyalgia | FAERS: 5 | US FAERS | |
| 537 | Glaucoma | FAERS: 5 | US FAERS | |
| 538 | Hallucinations, mixed | FAERS: 5 | US FAERS | |
| 539 | Hernia | FAERS: 5 | US FAERS | |
| 540 | Hostility | FAERS: 5 | SIDER US FAERS | |
| 541 | Hypertrophic Cardiomyopathy | FAERS: 5 | US FAERS | |
| 542 | Hyperventilation | FAERS: 5 | SIDER US FAERS | |
| 543 | Hypotrichosis | FAERS: 5 | US FAERS | |
| 544 | Ileus | FAERS: 5 | US FAERS | |
| 545 | Intentional drug misuse | FAERS: 5 | US FAERS | |
| 546 | Intercepted drug dispensing error | FAERS: 5 | US FAERS | |
| 547 | Limb injury | FAERS: 5 | US FAERS | |
| 548 | Loss of personal independence in daily activities | FAERS: 5 | US FAERS | |
| 549 | Low set ears | FAERS: 5 | US FAERS | |
| 550 | Lymphocyte count decreased | FAERS: 5 | US FAERS | |
| 551 | Macule | FAERS: 5 | US FAERS | |
| 552 | Maternal exposure before pregnancy | FAERS: 5 | US FAERS | |
| 553 | Mucormycosis | FAERS: 5 | US FAERS | |
| 554 | Neutrophil percentage increased | FAERS: 5 | US FAERS | |
| 555 | Normal delivery | FAERS: 5 | OFFSIDES US FAERS | |
| 556 | Physical assault | FAERS: 5 | US FAERS | |
| 557 | Pneumothorax | FAERS: 5 | US FAERS | |
| 558 | Post inflammatory pigmentation change | FAERS: 5 | OFFSIDES US FAERS | |
| 559 | Product solubility abnormal | FAERS: 5 | US FAERS | |
| 560 | Product use complaint | FAERS: 5 | US FAERS | |
| 561 | Productive Cough | FAERS: 5 | US FAERS | |
| 562 | Quadriplegia | FAERS: 5 | US FAERS | |
| 563 | Rehabilitation therapy | FAERS: 5 | US FAERS | |
| 564 | Sensitive skin | FAERS: 5 | US FAERS | |
| 565 | Sinus headache | FAERS: 5 | US FAERS | |
| 566 | Sjogren's Syndrome | FAERS: 5 | OFFSIDES US FAERS | |
| 567 | Sleep Paralysis | FAERS: 5 | US FAERS | |
| 568 | Stupor | FAERS: 5 | SIDER US FAERS | |
| 569 | Synovitis | FAERS: 5 | US FAERS | |
| 570 | Tension | FAERS: 5 | SIDER US FAERS | |
| 571 | Tooth Extraction | FAERS: 5 | US FAERS | |
| 572 | Toxic Shock Syndrome | FAERS: 5 | US FAERS | |
| 573 | Trismus | FAERS: 5 | US FAERS | |
| 574 | Upper airway obstruction | FAERS: 5 | US FAERS | |
| 575 | Ventricular arrhythmia | FAERS: 5 | US FAERS | |
| 576 | Violence-related symptom | FAERS: 5 | US FAERS | |
| 577 | Antinuclear antibody increased | FAERS: 4 | OFFSIDES US FAERS | |
| 578 | Arthropod bite | FAERS: 4 | US FAERS | |
| 579 | Atopy | FAERS: 4 | US FAERS | |
| 580 | Beta 2 microglobulin urine increased | FAERS: 4 | US FAERS | |
| 581 | Blister rupture | FAERS: 4 | US FAERS | |
| 582 | Blood albumin decreased | FAERS: 4 | US FAERS | |
| 583 | Blood sodium increased | FAERS: 4 | US FAERS | |
| 584 | Bone pain | FAERS: 4 | US FAERS | |
| 585 | Cerebellar Hypoplasia | FAERS: 4 | US FAERS | |
| 586 | Cholangitis | FAERS: 4 | US FAERS | |
| 587 | Coma scale abnormal | FAERS: 4 | US FAERS | |
| 588 | Congenital hydronephrosis | FAERS: 4 | OFFSIDES US FAERS | |
| 589 | Congenital inguinal hernia | FAERS: 4 | US FAERS | |
| 590 | Congenital intestinal malformation | FAERS: 4 | US FAERS | |
| 591 | Corneal Scar | FAERS: 4 | OFFSIDES US FAERS | |
| 592 | Craniosynostosis | FAERS: 4 | US FAERS | |
| 593 | Cyst | FAERS: 4 | US FAERS | |
| 594 | Dacryostenosis acquired | FAERS: 4 | US FAERS | |
| 595 | Decreased immune responsiveness | FAERS: 4 | US FAERS | |
| 596 | Dependence | FAERS: 4 | US FAERS | |
| 597 | Drug administered to patient of inappropriate age | FAERS: 4 | US FAERS | |
| 598 | Dysphasia | FAERS: 4 | US FAERS | |
| 599 | Ecchymosis | FAERS: 4 | SIDER US FAERS | |
| 600 | Entropion | FAERS: 4 | OFFSIDES US FAERS | |
| 601 | Epidermolysis | FAERS: 4 | US FAERS | |
| 602 | Eructation | FAERS: 4 | SIDER US FAERS | |
| 603 | Excessive eye blinking | FAERS: 4 | OFFSIDES US FAERS | |
| 604 | Eye Infection | FAERS: 4 | US FAERS | |
| 605 | Gastroenteritis | FAERS: 4 | US FAERS | |
| 606 | Gastroschisis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 607 | Gaze palsy | FAERS: 4 | US FAERS | |
| 608 | Genital rash | FAERS: 4 | OFFSIDES US FAERS | |
| 609 | Glossitis | FAERS: 4 | SIDER US FAERS | |
| 610 | Growth retardation | FAERS: 4 | US FAERS | |
| 611 | HELLP Syndrome | FAERS: 4 | US FAERS | |
| 612 | Hepatosplenomegaly | FAERS: 4 | OFFSIDES US FAERS | |
| 613 | Hip Dysplasia | FAERS: 4 | OFFSIDES US FAERS | |
| 614 | Hospice Care | FAERS: 4 | US FAERS | |
| 615 | Hypoaesthesia facial | FAERS: 4 | US FAERS | |
| 616 | Impaired quality of life | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 617 | Impatience | FAERS: 4 | US FAERS | |
| 618 | Joint stiffness | FAERS: 4 | US FAERS | |
| 619 | Keratitis | FAERS: 4 | SIDER US FAERS | |
| 620 | Lip exfoliation | FAERS: 4 | OFFSIDES US FAERS | |
| 621 | Lipase increased | FAERS: 4 | US FAERS | |
| 622 | Living in residential institution | FAERS: 4 | US FAERS | |
| 623 | Malabsorption | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 624 | Metabolic myopathy | FAERS: 4 | US FAERS | |
| 625 | Metamorphopsia | FAERS: 4 | US FAERS | |
| 626 | Monocyte count increased | FAERS: 4 | US FAERS | |
| 627 | Negativism | FAERS: 4 | US FAERS | |
| 628 | Ocular icterus | FAERS: 4 | OFFSIDES US FAERS | |
| 629 | Oligohydramnios | FAERS: 4 | OFFSIDES US FAERS | |
| 630 | Oliguria | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 631 | Oral mucosal erythema | FAERS: 4 | OFFSIDES US FAERS | |
| 632 | PO2 decreased | FAERS: 4 | US FAERS | |
| 633 | Pancreatic Cyst | FAERS: 4 | US FAERS | |
| 634 | Pancreatic carcinoma | FAERS: 4 | US FAERS | |
| 635 | Plantar erythema | FAERS: 4 | US FAERS | |
| 636 | Pleurisy | FAERS: 4 | US FAERS | |
| 637 | Polydipsia | FAERS: 4 | US FAERS | |
| 638 | Polyhydramnios | FAERS: 4 | OFFSIDES US FAERS | |
| 639 | Product difficult to swallow | FAERS: 4 | US FAERS | |
| 640 | Product formulation issue | FAERS: 4 | US FAERS | |
| 641 | Product label issue | FAERS: 4 | US FAERS | |
| 642 | Psychiatric symptom | FAERS: 4 | US FAERS | |
| 643 | Psychomotor skills impaired | FAERS: 4 | US FAERS | |
| 644 | Pulmonary malformation | FAERS: 4 | OFFSIDES US FAERS | |
| 645 | Pyelocaliectasis | FAERS: 4 | US FAERS | |
| 646 | Renal cyst | FAERS: 4 | US FAERS | |
| 647 | Restless Legs Syndrome | FAERS: 4 | US FAERS | |
| 648 | Sarcoidosis | FAERS: 4 | US FAERS | |
| 649 | Schizophrenia | FAERS: 4 | 20621163 | CTD US FAERS |
| 650 | Scleritis | FAERS: 4 | US FAERS | |
| 651 | Sexual Dysfunction | FAERS: 4 | US FAERS | |
| 652 | Skin laceration | FAERS: 4 | US FAERS | |
| 653 | Sluggishness | FAERS: 4 | US FAERS | |
| 654 | Sopor | FAERS: 4 | US FAERS | |
| 655 | Syndactyly | FAERS: 4 | US FAERS | |
| 656 | Throat cancer | FAERS: 4 | US FAERS | |
| 657 | Traumatic Brain Injury | FAERS: 4 | US FAERS | |
| 658 | Ventricular hypoplasia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 659 | Vitamin D Deficiency | FAERS: 4 | US FAERS | |
| 660 | Vitreous floaters | FAERS: 4 | US FAERS | |
| 661 | Wrong patient received medication | FAERS: 4 | US FAERS | |
| 662 | Anorgasmia | FAERS: 3 | SIDER US FAERS | |
| 663 | Anticonvulsant drug level abnormal | FAERS: 3 | US FAERS | |
| 664 | Aplasia Cutis Congenita | FAERS: 3 | US FAERS | |
| 665 | Asthenopia | FAERS: 3 | OFFSIDES US FAERS | |
| 666 | Beta 2 microglobulin increased | FAERS: 3 | US FAERS | |
| 667 | Biopsy | FAERS: 3 | US FAERS | |
| 668 | Blepharitis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 669 | Blood electrolytes abnormal | FAERS: 3 | US FAERS | |
| 670 | Blood immunoglobulin E increased | FAERS: 3 | US FAERS | |
| 671 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 672 | Blood prolactin increased | FAERS: 3 | OFFSIDES US FAERS | |
| 673 | Blood testosterone decreased | FAERS: 3 | US FAERS | |
| 674 | Bone marrow depression | FAERS: 3 | US FAERS | |
| 675 | Breast Cyst | FAERS: 3 | US FAERS | |
| 676 | Bronchospasm | FAERS: 3 | SIDER US FAERS | |
| 677 | Butterfly rash | FAERS: 3 | US FAERS | |
| 678 | Cerebral atrophy | FAERS: 3 | US FAERS | |
| 679 | Chemotherapy | FAERS: 3 | US FAERS | |
| 680 | Cholangiolitis | FAERS: 3 | OFFSIDES US FAERS | |
| 681 | Cholecystitis | FAERS: 3 | US FAERS | |
| 682 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 683 | Conduct Disorder | FAERS: 3 | US FAERS | |
| 684 | Congenital cystic lung | FAERS: 3 | US FAERS | |
| 685 | Congenital scoliosis | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 686 | Consciousness fluctuating | FAERS: 3 | US FAERS | |
| 687 | Corneal erosion | FAERS: 3 | OFFSIDES US FAERS | |
| 688 | Dermo-hypodermitis | FAERS: 3 | US FAERS | |
| 689 | Diverticulitis | FAERS: 3 | US FAERS | |
| 690 | Drug withdrawal convulsions | FAERS: 3 | SIDER US FAERS | |
| 691 | Dyslalia | FAERS: 3 | US FAERS | |
| 692 | Dyslexia | FAERS: 3 | US FAERS | |
| 693 | Ear discomfort | FAERS: 3 | US FAERS | |
| 694 | Ejection Fraction Decreased | FAERS: 3 | US FAERS | |
| 695 | Electrolyte imbalance | FAERS: 3 | US FAERS | |
| 696 | Enuresis | FAERS: 3 | US FAERS | |
| 697 | Escherichia infection | FAERS: 3 | US FAERS | |
| 698 | Exposure via ingestion | FAERS: 3 | US FAERS | |
| 699 | Eyelid Function Disorder | FAERS: 3 | OFFSIDES US FAERS | |
| 700 | Eyelid erosion | FAERS: 3 | OFFSIDES US FAERS | |
| 701 | Eyelid margin crusting | FAERS: 3 | OFFSIDES US FAERS | |
| 702 | False negative investigation result | FAERS: 3 | US FAERS | |
| 703 | Feeling Cold | FAERS: 3 | US FAERS | |
| 704 | Folliculitis | FAERS: 3 | US FAERS | |
| 705 | Foreign body in respiratory tract | FAERS: 3 | US FAERS | |
| 706 | Gastric Bypass | FAERS: 3 | US FAERS | |
| 707 | Glioblastoma | FAERS: 3 | US FAERS | |
| 708 | Gluten sensitivity | FAERS: 3 | US FAERS | |
| 709 | Hepatic Encephalopathy | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 710 | Hirsutism | FAERS: 3 | SIDER US FAERS | |
| 711 | Hydrocephalus | FAERS: 3 | US FAERS | |
| 712 | Hydrometra | FAERS: 3 | OFFSIDES US FAERS | |
| 713 | Hyperferritinaemia | FAERS: 3 | US FAERS | |
| 714 | Hyperkinesia | FAERS: 3 | SIDER US FAERS | |
| 715 | Impaired gastric emptying | FAERS: 3 | US FAERS | |
| 716 | Inappropriate affect | FAERS: 3 | US FAERS | |
| 717 | Incorrect route of drug administration | FAERS: 3 | US FAERS | |
| 718 | Infectious Mononucleosis | FAERS: 3 | US FAERS | |
| 719 | Intentional misuse | FAERS: 3 | US FAERS | |
| 720 | Intercepted drug prescribing error | FAERS: 3 | US FAERS | |
| 721 | Intercepted medication error | FAERS: 3 | US FAERS | |
| 722 | Iritis | FAERS: 3 | US FAERS | |
| 723 | Kaolin cephalin clotting time prolonged | FAERS: 3 | US FAERS | |
| 724 | Libido disorder | FAERS: 3 | US FAERS | |
| 725 | Lissencephaly | FAERS: 3 | US FAERS | |
| 726 | Lyme Disease | FAERS: 3 | US FAERS | |
| 727 | Lymphocyte count increased | FAERS: 3 | US FAERS | |
| 728 | Lymphocyte stimulation test negative | FAERS: 3 | US FAERS | |
| 729 | Lymphoid tissue hyperplasia | FAERS: 3 | OFFSIDES US FAERS | |
| 730 | Medical device implantation | FAERS: 3 | US FAERS | |
| 731 | Meibomian gland dysfunction | FAERS: 3 | US FAERS | |
| 732 | Meningism | FAERS: 3 | US FAERS | |
| 733 | Milk Allergy | FAERS: 3 | US FAERS | |
| 734 | Motion Sickness | FAERS: 3 | US FAERS | |
| 735 | Multi-organ disorder | FAERS: 3 | US FAERS | |
| 736 | Muscle strain | FAERS: 3 | US FAERS | |
| 737 | Musculoskeletal chest pain | FAERS: 3 | US FAERS | |
| 738 | Myopathy | FAERS: 3 | US FAERS | |
| 739 | Myositis | FAERS: 3 | US FAERS | |
| 740 | Necrosis | FAERS: 3 | US FAERS | |
| 741 | Nephritis | FAERS: 3 | US FAERS | |
| 742 | Neuralgic Amyotrophy | FAERS: 3 | US FAERS | |
| 743 | Neurological decompensation | FAERS: 3 | US FAERS | |
| 744 | Nocturia | FAERS: 3 | SIDER US FAERS | |
| 745 | Oculogyration | FAERS: 3 | US FAERS | |
| 746 | Open wound | FAERS: 3 | US FAERS | |
| 747 | Opisthotonus | FAERS: 3 | US FAERS | |
| 748 | Optic Neuritis | FAERS: 3 | US FAERS | |
| 749 | Oral mucosal exfoliation | FAERS: 3 | OFFSIDES US FAERS | |
| 750 | Oropharyngeal discomfort | FAERS: 3 | US FAERS | |
| 751 | Persistent cloaca | FAERS: 3 | US FAERS | |
| 752 | Pharyngeal lesion | FAERS: 3 | OFFSIDES US FAERS | |
| 753 | Pharyngeal swelling | FAERS: 3 | US FAERS | |
| 754 | Pilonidal cyst congenital | FAERS: 3 | OFFSIDES US FAERS | |
| 755 | Pityriasis Rosea | FAERS: 3 | US FAERS | |
| 756 | Polyserositis | FAERS: 3 | US FAERS | |
| 757 | Premenstrual syndrome | FAERS: 3 | US FAERS | |
| 758 | Priapism | FAERS: 3 | US FAERS | |
| 759 | Procedural complication | FAERS: 3 | US FAERS | |
| 760 | Product shape issue | FAERS: 3 | US FAERS | |
| 761 | Product size issue | FAERS: 3 | US FAERS | |
| 762 | Prolactinoma | FAERS: 3 | US FAERS | |
| 763 | Prurigo | FAERS: 3 | US FAERS | |
| 764 | Psychiatric decompensation | FAERS: 3 | US FAERS | |
| 765 | Pulmonary congestion | FAERS: 3 | US FAERS | |
| 766 | Quality of life decreased | FAERS: 3 | US FAERS | |
| 767 | Reaction to drug excipients | FAERS: 3 | US FAERS | |
| 768 | Rebound effect | FAERS: 3 | US FAERS | |
| 769 | Saliva altered | FAERS: 3 | US FAERS | |
| 770 | Scotoma | FAERS: 3 | SIDER US FAERS | |
| 771 | Serum amyloid A protein increased | FAERS: 3 | US FAERS | |
| 772 | Single umbilical artery | FAERS: 3 | OFFSIDES US FAERS | |
| 773 | Skin tightness | FAERS: 3 | US FAERS | |
| 774 | Stridor | FAERS: 3 | US FAERS | |
| 775 | Sudden infant death syndrome | FAERS: 3 | US FAERS | |
| 776 | Sudden onset of sleep | FAERS: 3 | US FAERS | |
| 777 | Systemic Inflammatory Response Syndrome | FAERS: 3 | US FAERS | |
| 778 | Tension Headache | FAERS: 3 | OFFSIDES US FAERS | |
| 779 | Tongue biting | FAERS: 3 | OFFSIDES US FAERS | |
| 780 | Tongue eruption | FAERS: 3 | OFFSIDES US FAERS | |
| 781 | Tongue exfoliation | FAERS: 3 | US FAERS | |
| 782 | Tonsillitis | FAERS: 3 | US FAERS | |
| 783 | Umbilical hernia | FAERS: 3 | US FAERS | |
| 784 | Unable to afford prescribed medication | FAERS: 3 | US FAERS | |
| 785 | Unemployment | FAERS: 3 | US FAERS | |
| 786 | Urea urine increased | FAERS: 3 | US FAERS | |
| 787 | Urine potassium increased | FAERS: 3 | US FAERS | |
| 788 | VIIth nerve paralysis | FAERS: 3 | US FAERS | |
| 789 | Vaginal Discharge | FAERS: 3 | US FAERS | |
| 790 | Vaginal mucosal blistering | FAERS: 3 | OFFSIDES US FAERS | |
| 791 | Vulvovaginal discomfort | FAERS: 3 | US FAERS | |
| 792 | Vulvovaginal mycotic infection | FAERS: 3 | SIDER US FAERS | |
| 793 | Vulvovaginal rash | FAERS: 3 | US FAERS | |
| 794 | White blood cell count abnormal | FAERS: 3 | OFFSIDES US FAERS | |
| 795 | Yawning | FAERS: 3 | SIDER US FAERS | |
| 796 | Abdominal tenderness | FAERS: 2 | US FAERS | |
| 797 | Acute prerenal failure | FAERS: 2 | US FAERS | |
| 798 | Adactyly | FAERS: 2 | US FAERS | |
| 799 | Agoraphobia | FAERS: 2 | US FAERS | |
| 800 | Agraphia | FAERS: 2 | OFFSIDES US FAERS | |
| 801 | Akinesia | FAERS: 2 | US FAERS | |
| 802 | Alcohol interaction | FAERS: 2 | US FAERS | |
| 803 | Alopecia Areata | FAERS: 2 | US FAERS | |
| 804 | Alpha 2 globulin increased | FAERS: 2 | OFFSIDES US FAERS | |
| 805 | Altered visual depth perception | FAERS: 2 | OFFSIDES US FAERS | |
| 806 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 807 | Angle Closure Glaucoma | FAERS: 2 | US FAERS | |
| 808 | Apoptosis | FAERS: 2 | US FAERS | |
| 809 | Arteriosclerosis | FAERS: 2 | US FAERS | |
| 810 | Atypical pneumonia | FAERS: 2 | US FAERS | |
| 811 | Autoimmune thyroiditis | FAERS: 2 | US FAERS | |
| 812 | Autophobia | FAERS: 2 | US FAERS | |
| 813 | Autoscopy | FAERS: 2 | US FAERS | |
| 814 | Bilirubin conjugated increased | FAERS: 2 | US FAERS | |
| 815 | Bipolar II disorder | FAERS: 2 | US FAERS | |
| 816 | Bladder pain | FAERS: 2 | SIDER US FAERS | |
| 817 | Blood chloride increased | FAERS: 2 | US FAERS | |
| 818 | Blood count abnormal | FAERS: 2 | US FAERS | |
| 819 | Blood creatine increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 820 | Blood fibrinogen decreased | FAERS: 2 | US FAERS | |
| 821 | Blood fibrinogen increased | FAERS: 2 | US FAERS | |
| 822 | Blood immunoglobulin A decreased | FAERS: 2 | US FAERS | |
| 823 | Blood immunoglobulin G decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 824 | Blood immunoglobulin G increased | FAERS: 2 | US FAERS | |
| 825 | Blood immunoglobulin M decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 826 | Blood pH decreased | FAERS: 2 | US FAERS | |
| 827 | Blood pH increased | FAERS: 2 | US FAERS | |
| 828 | Brain Death | FAERS: 2 | US FAERS | |
| 829 | Brain natriuretic peptide increased | FAERS: 2 | US FAERS | |
| 830 | Breakthrough Pain | FAERS: 2 | US FAERS | |
| 831 | Breech Presentation | FAERS: 2 | US FAERS | |
| 832 | Cardiac enzymes increased | FAERS: 2 | US FAERS | |
| 833 | Carnitine deficiency | FAERS: 2 | US FAERS | |
| 834 | Carpal Tunnel Syndrome | FAERS: 2 | US FAERS | |
| 835 | Catabolic state | FAERS: 2 | US FAERS | |
| 836 | Central nervous system lesion | FAERS: 2 | OFFSIDES US FAERS | |
| 837 | Cerebral Palsy | FAERS: 2 | US FAERS | |
| 838 | Choking sensation | FAERS: 2 | US FAERS | |
| 839 | Coating in mouth | FAERS: 2 | US FAERS | |
| 840 | Complications of maternal exposure to therapeutic drugs | FAERS: 2 | US FAERS | |
| 841 | Concomitant disease aggravated | FAERS: 2 | US FAERS | |
| 842 | Congenital Hypothyroidism | FAERS: 2 | US FAERS | |
| 843 | Congenital choroid plexus cyst | FAERS: 2 | OFFSIDES US FAERS | |
| 844 | Congenital ureterocele | FAERS: 2 | US FAERS | |
| 845 | Conjunctival cyst | FAERS: 2 | US FAERS | |
| 846 | Conjunctival ulcer | FAERS: 2 | US FAERS | |
| 847 | Conjunctivochalasis | FAERS: 2 | US FAERS | |
| 848 | Corneal Perforation | FAERS: 2 | OFFSIDES US FAERS | |
| 849 | Corneal epithelium defect | FAERS: 2 | US FAERS | |
| 850 | Corneal lesion | FAERS: 2 | US FAERS | |
| 851 | Craniotomy | FAERS: 2 | US FAERS | |
| 852 | Critical illness myopathy | FAERS: 2 | US FAERS | |
| 853 | Dark circles under eyes | FAERS: 2 | US FAERS | |
| 854 | Decreased eye contact | FAERS: 2 | US FAERS | |
| 855 | Depression suicidal | FAERS: 2 | US FAERS | |
| 856 | Device related infection | FAERS: 2 | US FAERS | |
| 857 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 858 | Diabetic Ketoacidosis | FAERS: 2 | US FAERS | |
| 859 | Disease Progression | FAERS: 2 | US FAERS | |
| 860 | Double stranded DNA antibody positive | FAERS: 2 | US FAERS | |
| 861 | Drug clearance decreased | FAERS: 2 | US FAERS | |
| 862 | Drug cross-reactivity | FAERS: 2 | US FAERS | |
| 863 | Drug dispensed to wrong patient | FAERS: 2 | US FAERS | |
| 864 | Drug resistance | FAERS: 2 | US FAERS | |
| 865 | Drug withdrawal headache | FAERS: 2 | US FAERS | |
| 866 | Drug-disease interaction | FAERS: 2 | US FAERS | |
| 867 | Dyscalculia | FAERS: 2 | OFFSIDES US FAERS | |
| 868 | Elective procedure | FAERS: 2 | US FAERS | |
| 869 | Electroencephalogram | FAERS: 2 | US FAERS | |
| 870 | Emotional poverty | FAERS: 2 | US FAERS | |
| 871 | Enamel anomaly | FAERS: 2 | US FAERS | |
| 872 | Encephalitis | FAERS: 2 | US FAERS | |
| 873 | Endometriosis | FAERS: 2 | US FAERS | |
| 874 | Enterocolitis | FAERS: 2 | US FAERS | |
| 875 | Eosinophilic Pneumonia | FAERS: 2 | US FAERS | |
| 876 | Erythema Nodosum | FAERS: 2 | US FAERS | |
| 877 | Excoriation | FAERS: 2 | US FAERS | |
| 878 | Exposure via body fluid | FAERS: 2 | US FAERS | |
| 879 | Eye Burns | FAERS: 2 | US FAERS | |
| 880 | Eyelid rash | FAERS: 2 | US FAERS | |
| 881 | False positive laboratory result | FAERS: 2 | OFFSIDES US FAERS | |
| 882 | Feelings of worthlessness | FAERS: 2 | US FAERS | |
| 883 | Focal dyscognitive seizures | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 884 | Gastrointestinal motility disorder | FAERS: 2 | US FAERS | |
| 885 | Gastrointestinal mucosal disorder | FAERS: 2 | US FAERS | |
| 886 | Gastrointestinal obstruction | FAERS: 2 | US FAERS | |
| 887 | Gastrointestinal tract adenoma | FAERS: 2 | US FAERS | |
| 888 | Gene Mutation | FAERS: 2 | US FAERS | |
| 889 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 890 | General symptom | FAERS: 2 | US FAERS | |
| 891 | Genital burning sensation | FAERS: 2 | US FAERS | |
| 892 | Gingival Atrophy | FAERS: 2 | US FAERS | |
| 893 | Gingival Hypertrophy | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 894 | Gingival Recession | FAERS: 2 | US FAERS | |
| 895 | Granuloma | FAERS: 2 | US FAERS | |
| 896 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 897 | Hemiparesis | FAERS: 2 | US FAERS | |
| 898 | Hepatitis C | FAERS: 2 | US FAERS | |
| 899 | Histiocytosis | FAERS: 2 | US FAERS | |
| 900 | Hyperkeratosis | FAERS: 2 | US FAERS | |
| 901 | Hyperpyrexia | FAERS: 2 | US FAERS | |
| 902 | Hypertransaminasaemia | FAERS: 2 | OFFSIDES US FAERS | |
| 903 | Hypervigilance | FAERS: 2 | OFFSIDES US FAERS | |
| 904 | Inadequate analgesia | FAERS: 2 | US FAERS | |
| 905 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 906 | Infection reactivation | FAERS: 2 | US FAERS | |
| 907 | Infusion site cellulitis | FAERS: 2 | US FAERS | |
| 908 | Intelligence test abnormal | FAERS: 2 | US FAERS | |
| 909 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 910 | Intestinal Atresia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 911 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 912 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 913 | Juvenile arthritis | FAERS: 2 | US FAERS | |
| 914 | Keratoconjunctivitis Sicca | FAERS: 2 | US FAERS | |
| 915 | Lactation Disorder | FAERS: 2 | US FAERS | |
| 916 | Lactose Intolerance | FAERS: 2 | OFFSIDES US FAERS | |
| 917 | Laryngomalacia | FAERS: 2 | US FAERS | |
| 918 | Laryngospasm | FAERS: 2 | US FAERS | |
| 919 | Limb discomfort | FAERS: 2 | US FAERS | |
| 920 | Limb operation | FAERS: 2 | US FAERS | |
| 921 | Lower respiratory tract congestion | FAERS: 2 | US FAERS | |
| 922 | Lymphocyte percentage decreased | FAERS: 2 | US FAERS | |
| 923 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 924 | Macular degeneration | FAERS: 2 | US FAERS | |
| 925 | Mallory-Weiss Syndrome | FAERS: 2 | US FAERS | |
| 926 | Malnutrition | FAERS: 2 | SIDER US FAERS | |
| 927 | Mastectomy | FAERS: 2 | US FAERS | |
| 928 | Mastication disorder | FAERS: 2 | US FAERS | |
| 929 | Mastitis | FAERS: 2 | US FAERS | |
| 930 | Measles | FAERS: 2 | US FAERS | |
| 931 | Mechanical ventilation | FAERS: 2 | US FAERS | |
| 932 | Microphthalmos | FAERS: 2 | US FAERS | |
| 933 | Monocyte count decreased | FAERS: 2 | US FAERS | |
| 934 | Mononucleosis syndrome | FAERS: 2 | OFFSIDES US FAERS | |
| 935 | Mucocutaneous rash | FAERS: 2 | US FAERS | |
| 936 | Multiple Pregnancy | FAERS: 2 | OFFSIDES US FAERS | |
| 937 | Muscular Dystrophy | FAERS: 2 | US FAERS | |
| 938 | Musculoskeletal discomfort | FAERS: 2 | SIDER US FAERS | |
| 939 | Mycosis Fungoides | FAERS: 2 | US FAERS | |
| 940 | Myopia | FAERS: 2 | US FAERS | |
| 941 | Narcolepsy | FAERS: 2 | US FAERS | |
| 942 | Neonatal infection | FAERS: 2 | US FAERS | |
| 943 | Neuritis | FAERS: 2 | SIDER US FAERS | |
| 944 | Neurological examination abnormal | FAERS: 2 | US FAERS | |
| 945 | No adverse effect | FAERS: 2 | US FAERS | |
| 946 | Non-cardiac chest pain | FAERS: 2 | US FAERS | |
| 947 | Nuchal Rigidity | FAERS: 2 | US FAERS | |
| 948 | Optic Nerve Hypoplasia | FAERS: 2 | US FAERS | |
| 949 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 950 | Oral infection | FAERS: 2 | US FAERS | |
| 951 | Osteopenia | FAERS: 2 | US FAERS | |
| 952 | Pancreatic Insufficiency | FAERS: 2 | US FAERS | |
| 953 | Parasomnia | FAERS: 2 | US FAERS | |
| 954 | Patient Isolation | FAERS: 2 | US FAERS | |
| 955 | Persistent genital arousal disorder | FAERS: 2 | US FAERS | |
| 956 | Phalangeal agenesis | FAERS: 2 | US FAERS | |
| 957 | Pharyngitis bacterial | FAERS: 2 | US FAERS | |
| 958 | Polyuria | FAERS: 2 | SIDER US FAERS | |
| 959 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 960 | Pregnancy of partner | FAERS: 2 | US FAERS | |
| 961 | Product complaint | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 962 | Product label confusion | FAERS: 2 | US FAERS | |
| 963 | Product prescribing error | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 964 | Product storage error | FAERS: 2 | US FAERS | |
| 965 | Punctate keratitis | FAERS: 2 | US FAERS | |
| 966 | QRS axis abnormal | FAERS: 2 | US FAERS | |
| 967 | Rales | FAERS: 2 | US FAERS | |
| 968 | Reaction to excipient | FAERS: 2 | US FAERS | |
| 969 | Regurgitation | FAERS: 2 | OFFSIDES US FAERS | |
| 970 | Retinal toxicity | FAERS: 2 | US FAERS | |
| 971 | Rhesus incompatibility | FAERS: 2 | US FAERS | |
| 972 | Rosacea | FAERS: 2 | US FAERS | |
| 973 | Roseolovirus test positive | FAERS: 2 | US FAERS | |
| 974 | Sarcoma | FAERS: 2 | US FAERS | |
| 975 | Sciatica | FAERS: 2 | US FAERS | |
| 976 | Similar reaction on previous exposure to drug | FAERS: 2 | US FAERS | |
| 977 | Simple Partial Seizures | FAERS: 2 | US FAERS | |
| 978 | Sinus Arrhythmia | FAERS: 2 | US FAERS | |
| 979 | Skin test positive | FAERS: 2 | US FAERS | |
| 980 | Somnambulism | FAERS: 2 | US FAERS | |
| 981 | Spermatozoa morphology abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 982 | Spinal fusion surgery | FAERS: 2 | US FAERS | |
| 983 | Staphylococcal Scalded Skin Syndrome | FAERS: 2 | OFFSIDES US FAERS | |
| 984 | Strabismus | FAERS: 2 | US FAERS | |
| 985 | Stress at work | FAERS: 2 | US FAERS | |
| 986 | Subacute hepatic failure | FAERS: 2 | OFFSIDES US FAERS | |
| 987 | Subcutaneous Abscess | FAERS: 2 | US FAERS | |
| 988 | Subcutaneous nodule | FAERS: 2 | US FAERS | |
| 989 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 990 | Symptom recurrence | FAERS: 2 | US FAERS | |
| 991 | Synovial Cyst | FAERS: 2 | US FAERS | |
| 992 | T-Cell Lymphoma | FAERS: 2 | US FAERS | |
| 993 | Tablet issue | FAERS: 2 | US FAERS | |
| 994 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 995 | Thyroid Neoplasm | FAERS: 2 | US FAERS | |
| 996 | Troponin T increased | FAERS: 2 | US FAERS | |
| 997 | Troponin increased | FAERS: 2 | US FAERS | |
| 998 | Tuberous Sclerosis | FAERS: 2 | US FAERS | |
| 999 | Ultrasound scan abnormal | FAERS: 2 | US FAERS | |
| 1000 | Underweight | FAERS: 2 | US FAERS | |
| 1001 | Urethral Obstruction | FAERS: 2 | US FAERS | |
| 1002 | Urethral Stenosis | FAERS: 2 | US FAERS | |
| 1003 | Urethritis | FAERS: 2 | US FAERS | |
| 1004 | Vagal nerve stimulator implantation | FAERS: 2 | US FAERS | |
| 1005 | Victim of child abuse | FAERS: 2 | US FAERS | |
| 1006 | Victim of homicide | FAERS: 2 | US FAERS | |
| 1007 | Vulvitis | FAERS: 2 | US FAERS | |
| 1008 | Vulvovaginal burning sensation | FAERS: 2 | US FAERS | |
| 1009 | Vulvovaginal erythema | FAERS: 2 | US FAERS | |
| 1010 | Vulvovaginal pain | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1011 | Vulvovaginitis | FAERS: 2 | US FAERS | |
| 1012 | liposarcoma | FAERS: 2 | US FAERS | |
| 1013 | Abdominal adhesions | FAERS: 1 | US FAERS | |
| 1014 | Abdominal rebound tenderness | FAERS: 1 | US FAERS | |
| 1015 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 1016 | Abscess | FAERS: 1 | SIDER US FAERS | |
| 1017 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 1018 | Acquired night blindness | FAERS: 1 | US FAERS | |
| 1019 | Acrochordon excision | FAERS: 1 | US FAERS | |
| 1020 | Activation syndrome | FAERS: 1 | US FAERS | |
| 1021 | Acute Coronary Syndrome | FAERS: 1 | SIDER US FAERS | |
| 1022 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 1023 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 1024 | Acute psychosis | FAERS: 1 | US FAERS | |
| 1025 | Acute tonsillitis | FAERS: 1 | US FAERS | |
| 1026 | Adnexa uteri pain | FAERS: 1 | US FAERS | |
| 1027 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 1028 | Alcohol Intolerance | FAERS: 1 | SIDER US FAERS | |
| 1029 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 1030 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 1031 | Allergy test positive | FAERS: 1 | US FAERS | |
| 1032 | Allergy to animal | FAERS: 1 | US FAERS | |
| 1033 | Amnestic Disorder | FAERS: 1 | US FAERS | |
| 1034 | Amniocentesis | FAERS: 1 | US FAERS | |
| 1035 | Amniotic cavity disorder | FAERS: 1 | US FAERS | |
| 1036 | Amniotic fluid volume decreased | FAERS: 1 | US FAERS | |
| 1037 | Amniotic membrane graft | FAERS: 1 | US FAERS | |
| 1038 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 1039 | Amputation of penis | FAERS: 1 | US FAERS | |
| 1040 | Amygdalohippocampectomy | FAERS: 1 | US FAERS | |
| 1041 | Amylase increased | FAERS: 1 | US FAERS | |
| 1042 | Anal Fistula | FAERS: 1 | US FAERS | |
| 1043 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 1044 | Aneurysm | FAERS: 1 | US FAERS | |
| 1045 | Angina Pectoris | FAERS: 1 | SIDER US FAERS | |
| 1046 | Angiogram retina abnormal | FAERS: 1 | US FAERS | |
| 1047 | Animal bite | FAERS: 1 | US FAERS | |
| 1048 | Aniridia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1049 | Anisocytosis | FAERS: 1 | OFFSIDES US FAERS | |
| 1050 | Anorectal discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1051 | Anorectal operation | FAERS: 1 | US FAERS | |
| 1052 | Anorexia Nervosa | FAERS: 1 | US FAERS | |
| 1053 | Anosmia | FAERS: 1 | OFFSIDES US FAERS | |
| 1054 | Anterior displaced anus | FAERS: 1 | US FAERS | |
| 1055 | Antiphospholipid Antibodies | FAERS: 1 | US FAERS | |
| 1056 | Antiphospholipid Syndrome | FAERS: 1 | US FAERS | |
| 1057 | Antiphospholipid antibodies positive | FAERS: 1 | US FAERS | |
| 1058 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 1059 | Apgar score abnormal | FAERS: 1 | US FAERS | |
| 1060 | Application site papules | FAERS: 1 | US FAERS | |
| 1061 | Application site reaction | FAERS: 1 | US FAERS | |
| 1062 | Arthropod sting | FAERS: 1 | US FAERS | |
| 1063 | Artificial crown procedure | FAERS: 1 | US FAERS | |
| 1064 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 1065 | Asterixis | FAERS: 1 | US FAERS | |
| 1066 | Astigmatism | FAERS: 1 | US FAERS | |
| 1067 | Atrial tachycardia | FAERS: 1 | US FAERS | |
| 1068 | Auricular swelling | FAERS: 1 | OFFSIDES US FAERS | |
| 1069 | Autoantibody positive | FAERS: 1 | US FAERS | |
| 1070 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 1071 | Automatism | FAERS: 1 | OFFSIDES US FAERS | |
| 1072 | Azoospermia | FAERS: 1 | US FAERS | |
| 1073 | B-lymphocyte abnormalities | FAERS: 1 | US FAERS | |
| 1074 | Bacteria stool identified | FAERS: 1 | US FAERS | |
| 1075 | Balanoposthitis | FAERS: 1 | US FAERS | |
| 1076 | Ballismus | FAERS: 1 | OFFSIDES US FAERS | |
| 1077 | Barbiturates positive | FAERS: 1 | US FAERS | |
| 1078 | Benign Neoplasm | FAERS: 1 | US FAERS | |
| 1079 | Bicytopenia | FAERS: 1 | US FAERS | |
| 1080 | Bladder prolapse | FAERS: 1 | OFFSIDES US FAERS | |
| 1081 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 1082 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 1083 | Blood chloride decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1084 | Blood cortisol decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 1085 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 1086 | Blood electrolytes decreased | FAERS: 1 | US FAERS | |
| 1087 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 1088 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 1089 | Blood homocysteine increased | FAERS: 1 | US FAERS | |
| 1090 | Blood immunoglobulin E decreased | FAERS: 1 | US FAERS | |
| 1091 | Blood immunoglobulin M increased | FAERS: 1 | US FAERS | |
| 1092 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 1093 | Blood lactate dehydrogenase decreased | FAERS: 1 | US FAERS | |
| 1094 | Blood osmolarity decreased | FAERS: 1 | US FAERS | |
| 1095 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 1096 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 1097 | Blood testosterone increased | FAERS: 1 | OFFSIDES US FAERS | |
| 1098 | Body temperature fluctuation | FAERS: 1 | OFFSIDES US FAERS | |
| 1099 | Bone density decreased | FAERS: 1 | US FAERS | |
| 1100 | Bone scan abnormal | FAERS: 1 | US FAERS | |
| 1101 | Bone swelling | FAERS: 1 | US FAERS | |
| 1102 | Borderline Personality Disorder | FAERS: 1 | US FAERS | |
| 1103 | Brachydactyly | FAERS: 1 | US FAERS | |
| 1104 | Bradykinesia | FAERS: 1 | US FAERS | |
| 1105 | Brain Abscess | FAERS: 1 | US FAERS | |
| 1106 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 1107 | Breast engorgement | FAERS: 1 | US FAERS | |
| 1108 | Breast hyperplasia | FAERS: 1 | US FAERS | |
| 1109 | Breast infection | FAERS: 1 | US FAERS | |
| 1110 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 1111 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 1112 | Bronchoalveolar lavage abnormal | FAERS: 1 | US FAERS | |
| 1113 | Bursitis | FAERS: 1 | SIDER US FAERS | |
| 1114 | C-reactive protein abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 1115 | CD30 expression | FAERS: 1 | US FAERS | |
| 1116 | CD4/CD8 ratio increased | FAERS: 1 | US FAERS | |
| 1117 | CD8 lymphocytes increased | FAERS: 1 | US FAERS | |
| 1118 | CHARGE Syndrome | FAERS: 1 | US FAERS | |
| 1119 | Candida test positive | FAERS: 1 | US FAERS | |
| 1120 | Carbon dioxide decreased | FAERS: 1 | US FAERS | |
| 1121 | Carcinoembryonic antigen increased | FAERS: 1 | US FAERS | |
| 1122 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 1123 | Cardiac assistance device user | FAERS: 1 | US FAERS | |
| 1124 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 1125 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 1126 | Caustic injury | FAERS: 1 | OFFSIDES US FAERS | |
| 1127 | Central Nervous System Infection | FAERS: 1 | US FAERS | |
| 1128 | Childhood depression | FAERS: 1 | US FAERS | |
| 1129 | Chloasma | FAERS: 1 | US FAERS | |
| 1130 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 1131 | Chondroma | FAERS: 1 | US FAERS | |
| 1132 | Chordee | FAERS: 1 | US FAERS | |
| 1133 | Chromatopsia | FAERS: 1 | OFFSIDES US FAERS | |
| 1134 | Chromosomal mutation | FAERS: 1 | US FAERS | |
| 1135 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 1136 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 1137 | Claustrophobia | FAERS: 1 | US FAERS | |
| 1138 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 1139 | Cluster Headache | FAERS: 1 | US FAERS | |
| 1140 | Colectomy | FAERS: 1 | US FAERS | |
| 1141 | Complement factor C3 decreased | FAERS: 1 | US FAERS | |
| 1142 | Complication of delivery | FAERS: 1 | US FAERS | |
| 1143 | Compression fracture | FAERS: 1 | US FAERS | |
| 1144 | Compulsive shopping | FAERS: 1 | US FAERS | |
| 1145 | Congenital abdominal hernia | FAERS: 1 | US FAERS | |
| 1146 | Congenital astigmatism | FAERS: 1 | US FAERS | |
| 1147 | Congenital cerebral cyst | FAERS: 1 | US FAERS | |
| 1148 | Congenital hepatobiliary anomaly | FAERS: 1 | US FAERS | |
| 1149 | Congenital intestinal obstruction | FAERS: 1 | US FAERS | |
| 1150 | Congenital neurological disorder | FAERS: 1 | US FAERS | |
| 1151 | Congenital nystagmus | FAERS: 1 | US FAERS | |
| 1152 | Congenital osteodystrophy | FAERS: 1 | US FAERS | |
| 1153 | Congenital pulmonary hypertension | FAERS: 1 | US FAERS | |
| 1154 | Congenital pyelocaliectasis | FAERS: 1 | US FAERS | |
| 1155 | Congenital renal disorder | FAERS: 1 | US FAERS | |
| 1156 | Conjunctival erosion | FAERS: 1 | US FAERS | |
| 1157 | Conjunctival scar | FAERS: 1 | OFFSIDES US FAERS | |
| 1158 | Constricted ear deformity | FAERS: 1 | US FAERS | |
| 1159 | Corneal defect | FAERS: 1 | US FAERS | |
| 1160 | Culture wound positive | FAERS: 1 | US FAERS | |
| 1161 | Cyclothymic Disorder | FAERS: 1 | US FAERS | |
| 1162 | Cyst removal | FAERS: 1 | OFFSIDES US FAERS | |
| 1163 | Cystitis | FAERS: 1 | SIDER US FAERS | |
| 1164 | Dacryoadenitis acquired | FAERS: 1 | OFFSIDES US FAERS | |
| 1165 | Dactylitis | FAERS: 1 | US FAERS | |
| 1166 | Decorticate posture | FAERS: 1 | US FAERS | |
| 1167 | Deformity | FAERS: 1 | US FAERS | |
| 1168 | Deja Vu | FAERS: 1 | US FAERS | |
| 1169 | Delirium febrile | FAERS: 1 | US FAERS | |
| 1170 | Dental alveolar anomaly | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1171 | Dental prosthesis user | FAERS: 1 | US FAERS | |
| 1172 | Dermoid Cyst | FAERS: 1 | US FAERS | |
| 1173 | Device Failure | FAERS: 1 | US FAERS | |
| 1174 | Device related sepsis | FAERS: 1 | US FAERS | |
| 1175 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 1176 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 1177 | Diaphragmatic Hernia | FAERS: 1 | US FAERS | |
| 1178 | Disease complication | FAERS: 1 | US FAERS | |
| 1179 | Double ureter | FAERS: 1 | US FAERS | |
| 1180 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 1181 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 1182 | Drug exposure before pregnancy | FAERS: 1 | US FAERS | |
| 1183 | Drug monitoring procedure incorrectly performed | FAERS: 1 | US FAERS | |
| 1184 | Drug-device interaction | FAERS: 1 | US FAERS | |
| 1185 | Duodenal atresia | FAERS: 1 | US FAERS | |
| 1186 | Dyschromatopsia | FAERS: 1 | US FAERS | |
| 1187 | Dysplasia | FAERS: 1 | US FAERS | |
| 1188 | Eclampsia | FAERS: 1 | OFFSIDES US FAERS | |
| 1189 | Ectropion | FAERS: 1 | US FAERS | |
| 1190 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 1191 | Electrocardiogram poor R-wave progression | FAERS: 1 | US FAERS | |
| 1192 | Electrocardiogram repolarisation abnormality | FAERS: 1 | US FAERS | |
| 1193 | Electroconvulsive Therapy | FAERS: 1 | OFFSIDES US FAERS | |
| 1194 | Encephalomyelitis | FAERS: 1 | US FAERS | |
| 1195 | Endocarditis | FAERS: 1 | US FAERS | |
| 1196 | Enterobacter sepsis | FAERS: 1 | US FAERS | |
| 1197 | Enterococcus test positive | FAERS: 1 | US FAERS | |
| 1198 | Enterocutaneous Fistula | FAERS: 1 | US FAERS | |
| 1199 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 1200 | Epididymitis | FAERS: 1 | SIDER US FAERS | |
| 1201 | Epiglottis ulcer | FAERS: 1 | US FAERS | |
| 1202 | Epiglottitis | FAERS: 1 | US FAERS | |
| 1203 | Epstein-Barr virus test positive | FAERS: 1 | US FAERS | |
| 1204 | Erection increased | FAERS: 1 | US FAERS | |
| 1205 | Eschar | FAERS: 1 | OFFSIDES US FAERS | |
| 1206 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 1207 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 1208 | Essential Tremor | FAERS: 1 | US FAERS | |
| 1209 | Exaggerated startle response | FAERS: 1 | US FAERS | |
| 1210 | Excitability | FAERS: 1 | US FAERS | |
| 1211 | Exophthalmos | FAERS: 1 | US FAERS | |
| 1212 | Exposure to household chemicals | FAERS: 1 | US FAERS | |
| 1213 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 1214 | Extremity necrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 1215 | Eye Redness | FAERS: 1 | US FAERS | |
| 1216 | Eye symptom | FAERS: 1 | US FAERS | |
| 1217 | Eye ulcer | FAERS: 1 | US FAERS | |
| 1218 | Facial Hemiatrophy | FAERS: 1 | US FAERS | |
| 1219 | Facial Paresis | FAERS: 1 | US FAERS | |
| 1220 | Facial paralysis | FAERS: 1 | US FAERS | |
| 1221 | Familial risk factor | FAERS: 1 | US FAERS | |
| 1222 | Feeding disorder of infancy OR early childhood | FAERS: 1 | US FAERS | |
| 1223 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 1224 | Female sexual arousal disorder | FAERS: 1 | US FAERS | |
| 1225 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 1226 | Fibrosis | FAERS: 1 | US FAERS | |
| 1227 | Flank Pain | FAERS: 1 | US FAERS | |
| 1228 | Flat affect | FAERS: 1 | SIDER US FAERS | |
| 1229 | Floppy iris syndrome | FAERS: 1 | US FAERS | |
| 1230 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 1231 | Food Poisoning | FAERS: 1 | US FAERS | |
| 1232 | Food aversion | FAERS: 1 | US FAERS | |
| 1233 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 1234 | Frenulum breve | FAERS: 1 | US FAERS | |
| 1235 | Frustration | FAERS: 1 | US FAERS | |
| 1236 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 1237 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 1238 | Gangrene | FAERS: 1 | US FAERS | |
| 1239 | Gastrectomy | FAERS: 1 | US FAERS | |
| 1240 | Gastric Lavage | FAERS: 1 | US FAERS | |
| 1241 | Gastric infection | FAERS: 1 | US FAERS | |
| 1242 | Gastric polypectomy | FAERS: 1 | US FAERS | |
| 1243 | Gastric ulcer | FAERS: 1 | SIDER US FAERS | |
| 1244 | Gastrointestinal bacterial overgrowth | FAERS: 1 | US FAERS | |
| 1245 | Gastrointestinal infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1246 | Gastrointestinal mucosal exfoliation | FAERS: 1 | US FAERS | |
| 1247 | Genital discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 1248 | Genital infection | FAERS: 1 | US FAERS | |
| 1249 | Genital labial adhesions | FAERS: 1 | US FAERS | |
| 1250 | Genital swelling | FAERS: 1 | US FAERS | |
| 1251 | Gingival Hyperplasia | FAERS: 1 | SIDER US FAERS | |
| 1252 | Gingival blister | FAERS: 1 | US FAERS | |
| 1253 | Gingival erythema | FAERS: 1 | US FAERS | |
| 1254 | Gingivitis | FAERS: 1 | SIDER US FAERS | |
| 1255 | Glioma | FAERS: 1 | US FAERS | |
| 1256 | Grief reaction | FAERS: 1 | US FAERS | |
| 1257 | Group B streptococcus neonatal sepsis | FAERS: 1 | US FAERS | |
| 1258 | HLA marker study positive | FAERS: 1 | US FAERS | |
| 1259 | Halitosis | FAERS: 1 | US FAERS | |
| 1260 | Head circumference abnormal | FAERS: 1 | US FAERS | |
| 1261 | Head deformity | FAERS: 1 | US FAERS | |
| 1262 | Heliotrope rash | FAERS: 1 | US FAERS | |
| 1263 | Hemiplegia | FAERS: 1 | SIDER US FAERS | |
| 1264 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 1265 | Homicide | FAERS: 1 | US FAERS | |
| 1266 | Homocystinuria | FAERS: 1 | US FAERS | |
| 1267 | Human rhinovirus test positive | FAERS: 1 | US FAERS | |
| 1268 | Hunger | FAERS: 1 | US FAERS | |
| 1269 | Hydrothorax | FAERS: 1 | US FAERS | |
| 1270 | Hyperandrogenism | FAERS: 1 | US FAERS | |
| 1271 | Hyperplasia | FAERS: 1 | US FAERS | |
| 1272 | Hypertensive Encephalopathy | FAERS: 1 | US FAERS | |
| 1273 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 1274 | Hypertrophy | FAERS: 1 | US FAERS | |
| 1275 | Hypometabolism | FAERS: 1 | OFFSIDES US FAERS | |
| 1276 | Hypoventilation | FAERS: 1 | US FAERS | |
| 1277 | Hysterectomy | FAERS: 1 | US FAERS | |
| 1278 | Iatrogenic injury | FAERS: 1 | OFFSIDES US FAERS | |
| 1279 | Illogical thinking | FAERS: 1 | US FAERS | |
| 1280 | Immunosuppression | FAERS: 1 | US FAERS | |
| 1281 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 1282 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 1283 | Incorrect product formulation administered | FAERS: 1 | US FAERS | |
| 1284 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 1285 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 1286 | Increased viscosity of bronchial secretion | FAERS: 1 | OFFSIDES US FAERS | |
| 1287 | Induration | FAERS: 1 | US FAERS | |
| 1288 | Infarction | FAERS: 1 | US FAERS | |
| 1289 | Infected dermal cyst | FAERS: 1 | US FAERS | |
| 1290 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 1291 | Inflammatory marker test | FAERS: 1 | US FAERS | |
| 1292 | Influenza virus test positive | FAERS: 1 | US FAERS | |
| 1293 | Injection site bruising | FAERS: 1 | US FAERS | |
| 1294 | Injury asphyxiation | FAERS: 1 | US FAERS | |
| 1295 | Intercepted product dispensing error | FAERS: 1 | US FAERS | |
| 1296 | Interleukin level increased | FAERS: 1 | US FAERS | |
| 1297 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 1298 | Intervertebral disc injury | FAERS: 1 | US FAERS | |
| 1299 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 1300 | Intrathecal pump insertion | FAERS: 1 | US FAERS | |
| 1301 | Intrusive thoughts | FAERS: 1 | US FAERS | |
| 1302 | Iodine uptake increased | FAERS: 1 | US FAERS | |
| 1303 | Iridocele | FAERS: 1 | US FAERS | |
| 1304 | Irregular breathing | FAERS: 1 | US FAERS | |
| 1305 | Itching scar | FAERS: 1 | US FAERS | |
| 1306 | Jealous delusion | FAERS: 1 | US FAERS | |
| 1307 | Keratic precipitates | FAERS: 1 | US FAERS | |
| 1308 | Keratopathy | FAERS: 1 | US FAERS | |
| 1309 | Klebsiella test positive | FAERS: 1 | US FAERS | |
| 1310 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 1311 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 1312 | Lagophthalmos | FAERS: 1 | US FAERS | |
| 1313 | Laryngeal cleft | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1314 | Laryngeal discomfort | FAERS: 1 | US FAERS | |
| 1315 | Laryngeal erythema | FAERS: 1 | OFFSIDES US FAERS | |
| 1316 | Laryngeal tremor | FAERS: 1 | US FAERS | |
| 1317 | Laser Therapy | FAERS: 1 | US FAERS | |
| 1318 | Left ventricle outflow tract obstruction | FAERS: 1 | US FAERS | |
| 1319 | Lentigo | FAERS: 1 | US FAERS | |
| 1320 | Leprosy | FAERS: 1 | US FAERS | |
| 1321 | Leucine aminopeptidase increased | FAERS: 1 | US FAERS | |
| 1322 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 1323 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 1324 | Lichen Nitidus | FAERS: 1 | US FAERS | |
| 1325 | Lichen Planus | FAERS: 1 | US FAERS | |
| 1326 | Ligneous conjunctivitis | FAERS: 1 | US FAERS | |
| 1327 | Limb crushing injury | FAERS: 1 | US FAERS | |
| 1328 | Limbal stem cell deficiency | FAERS: 1 | US FAERS | |
| 1329 | Lip pruritus | FAERS: 1 | US FAERS | |
| 1330 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 1331 | Long QT Syndrome | FAERS: 1 | US FAERS | |
| 1332 | Loose tooth | FAERS: 1 | US FAERS | |
| 1333 | Loss of dreaming | FAERS: 1 | US FAERS | |
| 1334 | Lymph node abscess | FAERS: 1 | US FAERS | |
| 1335 | Lymph node palpable | FAERS: 1 | US FAERS | |
| 1336 | Lymphocyte percentage increased | FAERS: 1 | US FAERS | |
| 1337 | Lymphocyte transformation test positive | FAERS: 1 | US FAERS | |
| 1338 | Macrocephaly | FAERS: 1 | US FAERS | |
| 1339 | Macular pigmentation | FAERS: 1 | US FAERS | |
| 1340 | Magnesium Deficiency | FAERS: 1 | US FAERS | |
| 1341 | Malocclusion | FAERS: 1 | US FAERS | |
| 1342 | Mantle cell lymphoma recurrent | FAERS: 1 | US FAERS | |
| 1343 | Mantle cell lymphoma | FAERS: 1 | US FAERS | |
| 1344 | Manufacturing product shipping issue | FAERS: 1 | US FAERS | |
| 1345 | Markedly reduced dietary intake | FAERS: 1 | US FAERS | |
| 1346 | Measles antibody positive | FAERS: 1 | US FAERS | |
| 1347 | Meconium Aspiration Syndrome | FAERS: 1 | US FAERS | |
| 1348 | Meconium abnormal | FAERS: 1 | US FAERS | |
| 1349 | Medical device battery replacement | FAERS: 1 | US FAERS | |
| 1350 | Medical observation | FAERS: 1 | US FAERS | |
| 1351 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 1352 | Meniscus injury | FAERS: 1 | US FAERS | |
| 1353 | Meniscus operation | FAERS: 1 | US FAERS | |
| 1354 | Menopause | FAERS: 1 | US FAERS | |
| 1355 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 1356 | Mental Retardation | FAERS: 1 | US FAERS | |
| 1357 | Merycism | FAERS: 1 | OFFSIDES US FAERS | |
| 1358 | Micrococcus infection | FAERS: 1 | US FAERS | |
| 1359 | Micrococcus test positive | FAERS: 1 | US FAERS | |
| 1360 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 1361 | Mineral deficiency | FAERS: 1 | US FAERS | |
| 1362 | Miscarriage of partner | FAERS: 1 | US FAERS | |
| 1363 | Mixed liver injury | FAERS: 1 | US FAERS | |
| 1364 | Mononucleosis heterophile test positive | FAERS: 1 | US FAERS | |
| 1365 | Monoparesis | FAERS: 1 | US FAERS | |
| 1366 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 1367 | Mouth plaque | FAERS: 1 | OFFSIDES US FAERS | |
| 1368 | Mucosal pain | FAERS: 1 | US FAERS | |
| 1369 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 1370 | Mutism | FAERS: 1 | US FAERS | |
| 1371 | Mycoplasma test positive | FAERS: 1 | US FAERS | |
| 1372 | Mycotoxicosis | FAERS: 1 | US FAERS | |
| 1373 | Nasal inflammation | FAERS: 1 | US FAERS | |
| 1374 | Nasal mucosal disorder | FAERS: 1 | US FAERS | |
| 1375 | Necrotising myositis | FAERS: 1 | US FAERS | |
| 1376 | Neurodermatitis | FAERS: 1 | US FAERS | |
| 1377 | Neuropathy | FAERS: 1 | US FAERS | |
| 1378 | Neutropenic infection | FAERS: 1 | US FAERS | |
| 1379 | Neutrophil count abnormal | FAERS: 1 | US FAERS | |
| 1380 | Nicotine Dependence | FAERS: 1 | US FAERS | |
| 1381 | Noninfective encephalitis | FAERS: 1 | US FAERS | |
| 1382 | Oligodipsia | FAERS: 1 | OFFSIDES US FAERS | |
| 1383 | Onychalgia | FAERS: 1 | US FAERS | |
| 1384 | Onychoclasis | FAERS: 1 | US FAERS | |
| 1385 | Onycholysis | FAERS: 1 | US FAERS | |
| 1386 | Open reduction of fracture | FAERS: 1 | US FAERS | |
| 1387 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 1388 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 1389 | Oral mucosal petechiae | FAERS: 1 | US FAERS | |
| 1390 | Orthosis user | FAERS: 1 | US FAERS | |
| 1391 | Osmotic demyelination syndrome | FAERS: 1 | US FAERS | |
| 1392 | Osteomalacia | FAERS: 1 | US FAERS | |
| 1393 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 1394 | PO2 increased | FAERS: 1 | US FAERS | |
| 1395 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 1396 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 1397 | Parkinsonian rest tremor | FAERS: 1 | US FAERS | |
| 1398 | Parotitis | FAERS: 1 | US FAERS | |
| 1399 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 1400 | Pectus excavatum | FAERS: 1 | US FAERS | |
| 1401 | Pemphigus | FAERS: 1 | US FAERS | |
| 1402 | Penile swelling | FAERS: 1 | US FAERS | |
| 1403 | Periorbital swelling | FAERS: 1 | US FAERS | |
| 1404 | Peripartum cardiomyopathy | FAERS: 1 | US FAERS | |
| 1405 | Pertussis | FAERS: 1 | OFFSIDES US FAERS | |
| 1406 | Phimosis | FAERS: 1 | US FAERS | |
| 1407 | Photodermatosis | FAERS: 1 | OFFSIDES US FAERS | |
| 1408 | Phototherapy | FAERS: 1 | US FAERS | |
| 1409 | Pierre Robin Syndrome | FAERS: 1 | US FAERS | |
| 1410 | Piloerection | FAERS: 1 | US FAERS | |
| 1411 | Plagiocephaly | FAERS: 1 | OFFSIDES US FAERS | |
| 1412 | Plastic surgery to the face | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1413 | Platelet count abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1414 | Pneumocystis test positive | FAERS: 1 | US FAERS | |
| 1415 | Pneumonectomy | FAERS: 1 | US FAERS | |
| 1416 | Polymerase Chain Reaction | FAERS: 1 | US FAERS | |
| 1417 | Poor feeding infant | FAERS: 1 | US FAERS | |
| 1418 | Poor sucking reflex | FAERS: 1 | US FAERS | |
| 1419 | Poor weight gain neonatal | FAERS: 1 | US FAERS | |
| 1420 | Porphyria non-acute | FAERS: 1 | US FAERS | |
| 1421 | Post procedural infection | FAERS: 1 | US FAERS | |
| 1422 | Post-traumatic neck syndrome | FAERS: 1 | US FAERS | |
| 1423 | Postural Orthostatic Tachycardia Syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 1424 | Posturing | FAERS: 1 | US FAERS | |
| 1425 | Preauricular cyst | FAERS: 1 | US FAERS | |
| 1426 | Pregnancy test false positive | FAERS: 1 | US FAERS | |
| 1427 | Premature Ejaculation | FAERS: 1 | US FAERS | |
| 1428 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 1429 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 1430 | Procalcitonin increased | FAERS: 1 | US FAERS | |
| 1431 | Product appearance confusion | FAERS: 1 | US FAERS | |
| 1432 | Product blister packaging issue | FAERS: 1 | US FAERS | |
| 1433 | Product contamination | FAERS: 1 | US FAERS | |
| 1434 | Product counterfeit | FAERS: 1 | OFFSIDES US FAERS | |
| 1435 | Product design issue | FAERS: 1 | US FAERS | |
| 1436 | Product distribution issue | FAERS: 1 | US FAERS | |
| 1437 | Product friable | FAERS: 1 | US FAERS | |
| 1438 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 1439 | Product name confusion | FAERS: 1 | US FAERS | |
| 1440 | Product origin unknown | FAERS: 1 | US FAERS | |
| 1441 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 1442 | Product packaging issue | FAERS: 1 | US FAERS | |
| 1443 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 1444 | Product preparation error | FAERS: 1 | US FAERS | |
| 1445 | Product raw material issue | FAERS: 1 | US FAERS | |
| 1446 | Product residue present | FAERS: 1 | US FAERS | |
| 1447 | Product selection error | FAERS: 1 | US FAERS | |
| 1448 | Product supply issue | FAERS: 1 | US FAERS | |
| 1449 | Product tampering | FAERS: 1 | US FAERS | |
| 1450 | Progesterone decreased | FAERS: 1 | US FAERS | |
| 1451 | Prolonged rupture of membranes | FAERS: 1 | US FAERS | |
| 1452 | Prosthesis user | FAERS: 1 | US FAERS | |
| 1453 | Protein total abnormal | FAERS: 1 | US FAERS | |
| 1454 | Protein total decreased | FAERS: 1 | US FAERS | |
| 1455 | Pseudodementia | FAERS: 1 | OFFSIDES US FAERS | |
| 1456 | Psychogenic seizure | FAERS: 1 | US FAERS | |
| 1457 | Pupillary light reflex tests abnormal | FAERS: 1 | US FAERS | |
| 1458 | Pustular psoriasis | FAERS: 1 | US FAERS | |
| 1459 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 1460 | Pyoderma | FAERS: 1 | US FAERS | |
| 1461 | Quadriparesis | FAERS: 1 | US FAERS | |
| 1462 | Rash papulosquamous | FAERS: 1 | US FAERS | |
| 1463 | Reaction to azo-dyes | FAERS: 1 | OFFSIDES US FAERS | |
| 1464 | Reactive perforating collagenosis | FAERS: 1 | US FAERS | |
| 1465 | Rectal polyp | FAERS: 1 | US FAERS | |
| 1466 | Regurgitation of food | FAERS: 1 | US FAERS | |
| 1467 | Renal Colic | FAERS: 1 | US FAERS | |
| 1468 | Renal dysplasia | FAERS: 1 | US FAERS | |
| 1469 | Respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 1470 | Respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 1471 | Retinal depigmentation | FAERS: 1 | US FAERS | |
| 1472 | Retinitis | FAERS: 1 | OFFSIDES US FAERS | |
| 1473 | Retrograde ejaculation | FAERS: 1 | US FAERS | |
| 1474 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 1475 | Retroperitoneal lymphadenopathy | FAERS: 1 | US FAERS | |
| 1476 | Rhinalgia | FAERS: 1 | US FAERS | |
| 1477 | Rocky Mountain Spotted Fever | FAERS: 1 | OFFSIDES US FAERS | |
| 1478 | Romberg test positive | FAERS: 1 | US FAERS | |
| 1479 | Rubella | FAERS: 1 | US FAERS | |
| 1480 | Salpingectomy | FAERS: 1 | OFFSIDES US FAERS | |
| 1481 | Salt craving | FAERS: 1 | US FAERS | |
| 1482 | Scleral graft | FAERS: 1 | US FAERS | |
| 1483 | Secretion discharge | FAERS: 1 | US FAERS | |
| 1484 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 1485 | Selective eating disorder | FAERS: 1 | US FAERS | |
| 1486 | Septic necrosis | FAERS: 1 | US FAERS | |
| 1487 | Seronegative arthritis | FAERS: 1 | US FAERS | |
| 1488 | Sexual abuse | FAERS: 1 | US FAERS | |
| 1489 | Simple mastectomy | FAERS: 1 | US FAERS | |
| 1490 | Sinoatrial Block | FAERS: 1 | US FAERS | |
| 1491 | Sinus operation | FAERS: 1 | US FAERS | |
| 1492 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 1493 | Skin discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 1494 | Slow speech | FAERS: 1 | US FAERS | |
| 1495 | Snoring | FAERS: 1 | US FAERS | |
| 1496 | Soft tissue necrosis | FAERS: 1 | US FAERS | |
| 1497 | Sperm concentration decreased | FAERS: 1 | US FAERS | |
| 1498 | Spina Bifida Occulta | FAERS: 1 | OFFSIDES US FAERS | |
| 1499 | Spinal rod insertion | FAERS: 1 | US FAERS | |
| 1500 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 1501 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 1502 | Starvation | FAERS: 1 | US FAERS | |
| 1503 | Status Asthmaticus | FAERS: 1 | US FAERS | |
| 1504 | Stem cell transplant | FAERS: 1 | US FAERS | |
| 1505 | Streptococcus test positive | FAERS: 1 | US FAERS | |
| 1506 | Subcorneal pustular dermatosis | FAERS: 1 | US FAERS | |
| 1507 | Sudden Visual Loss | FAERS: 1 | US FAERS | |
| 1508 | Superinfection | FAERS: 1 | US FAERS | |
| 1509 | Suppressed lactation | FAERS: 1 | US FAERS | |
| 1510 | Surgical failure | FAERS: 1 | US FAERS | |
| 1511 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 1512 | Symphysiolysis | FAERS: 1 | US FAERS | |
| 1513 | T-lymphocyte count increased | FAERS: 1 | US FAERS | |
| 1514 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 1515 | Teeth brittle | FAERS: 1 | US FAERS | |
| 1516 | Tenosynovitis | FAERS: 1 | US FAERS | |
| 1517 | Therapeutic drug monitoring analysis not performed | FAERS: 1 | US FAERS | |
| 1518 | Therapeutic product cross-reactivity | FAERS: 1 | US FAERS | |
| 1519 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 1520 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 1521 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 1522 | Tick-borne fever | FAERS: 1 | US FAERS | |
| 1523 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 1524 | Tongue spasm | FAERS: 1 | US FAERS | |
| 1525 | Tonsillectomy | FAERS: 1 | US FAERS | |
| 1526 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 1527 | Tooth Infection | FAERS: 1 | US FAERS | |
| 1528 | Tooth repair | FAERS: 1 | US FAERS | |
| 1529 | Transplant | FAERS: 1 | US FAERS | |
| 1530 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 1531 | Troponin I increased | FAERS: 1 | US FAERS | |
| 1532 | Tuberculosis | FAERS: 1 | US FAERS | |
| 1533 | Ultrasound skull abnormal | FAERS: 1 | US FAERS | |
| 1534 | Unexpected therapeutic drug effect | FAERS: 1 | US FAERS | |
| 1535 | Up and down phenomenon | FAERS: 1 | US FAERS | |
| 1536 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 1537 | Urethral perforation | FAERS: 1 | US FAERS | |
| 1538 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 1539 | Urine amphetamine positive | FAERS: 1 | US FAERS | |
| 1540 | Urine osmolarity increased | FAERS: 1 | US FAERS | |
| 1541 | Urine output increased | FAERS: 1 | SIDER US FAERS | |
| 1542 | Uterine atrophy | FAERS: 1 | US FAERS | |
| 1543 | Uterine spasm | FAERS: 1 | US FAERS | |
| 1544 | Vaginal lesion | FAERS: 1 | OFFSIDES US FAERS | |
| 1545 | Venous Injury | FAERS: 1 | US FAERS | |
| 1546 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 1547 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 1548 | Verbigeration | FAERS: 1 | OFFSIDES US FAERS | |
| 1549 | Vesicoureteral reflux surgery | FAERS: 1 | US FAERS | |
| 1550 | Visual acuity tests abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 1551 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 1552 | Vitreous opacities | FAERS: 1 | US FAERS | |
| 1553 | Vocal Cord Dysfunction | FAERS: 1 | US FAERS | |
| 1554 | Vulvar erosion | FAERS: 1 | US FAERS | |
| 1555 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 1556 | Vulvovaginal inflammation | FAERS: 1 | US FAERS | |
| 1557 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 1558 | Walking aid user | FAERS: 1 | US FAERS | |
| 1559 | Weight decrease neonatal | FAERS: 1 | US FAERS | |
| 1560 | White blood cells stool | FAERS: 1 | US FAERS | |
| 1561 | Wolf-Hirschhorn Syndrome | FAERS: 1 | US FAERS | |
| 1562 | Wolff-Parkinson-White Syndrome | FAERS: 1 | US FAERS | |
| 1563 | Wound Complication | FAERS: 1 | US FAERS | |
| 1564 | Wound infection pseudomonas | FAERS: 1 | US FAERS | |
| 1565 | Wrong dosage form | FAERS: 1 | US FAERS | |
| 1566 | Wrong strength | FAERS: 1 | US FAERS | |
| 1567 | Wrong technique in device usage process | FAERS: 1 | US FAERS | |
| 1568 | Xerosis | FAERS: 1 | US FAERS | |
| 1569 | cancer surgery | FAERS: 1 | US FAERS | |
| 1570 | cold agglutinins | FAERS: 1 | US FAERS | |
| 1571 | intensive care | FAERS: 1 | US FAERS | |
| 1572 | kyphosis | FAERS: 1 | US FAERS | |
| 1573 | prostatitis | FAERS: 1 | US FAERS | |
| 1574 | skin abrasion | FAERS: 1 | US FAERS | |
| 1575 | Abdominal wall cyst | OFFSIDES | ||
| 1576 | Abnormal ejaculation | SIDER | ||
| 1577 | Abnormal palmar/plantar creases | OFFSIDES | ||
| 1578 | Accidental needle stick | OFFSIDES | ||
| 1579 | Action Tremor | SIDER | ||
| 1580 | Adenitis | OFFSIDES | ||
| 1581 | Allergic pharyngitis | OFFSIDES | ||
| 1582 | Amblyopia | SIDER | ||
| 1583 | Anal cancer metastatic | OFFSIDES | ||
| 1584 | Anal candidiasis | OFFSIDES | ||
| 1585 | Anti-platelet antibody | OFFSIDES | ||
| 1586 | Antidepressant drug clearance increased | OFFSIDES | ||
| 1587 | Aortogram abnormal | OFFSIDES | ||
| 1588 | Application site scab | OFFSIDES | ||
| 1589 | Arterial bypass operation | OFFSIDES | ||
| 1590 | Arthrodesis | OFFSIDES | ||
| 1591 | Aseptic Meningitis | OFFSIDES | ||
| 1592 | Astrocytoma | OFFSIDES | ||
| 1593 | Athetosis | OFFSIDES | ||
| 1594 | Atrophy of tongue papillae | OFFSIDES | ||
| 1595 | Atypical benign partial epilepsy | OFFSIDES | ||
| 1596 | Avulsion fracture | OFFSIDES | ||
| 1597 | Balanitis | SIDER | ||
| 1598 | Band neutrophil count increased | OFFSIDES | ||
| 1599 | Basal Ganglia Diseases | 19681008 | CTD | |
| 1600 | Blood Coagulation Disorders | 17923349 | CTD | |
| 1601 | Blood ethanol increased | OFFSIDES | ||
| 1602 | Blood homocysteine | OFFSIDES | ||
| 1603 | Blood immunoglobulin E | OFFSIDES | ||
| 1604 | Blood pressure orthostatic increased | OFFSIDES | ||
| 1605 | Blurred vision | OFFSIDES | ||
| 1606 | Bone fistula | OFFSIDES | ||
| 1607 | Borderline glaucoma | OFFSIDES | ||
| 1608 | Breath Holding | OFFSIDES | ||
| 1609 | C-reactive protein | OFFSIDES | ||
| 1610 | Cardiac Tamponade | OFFSIDES | ||
| 1611 | Cardioactive drug level | OFFSIDES | ||
| 1612 | Chemical and Drug Induced Liver Injury | CTD | ||
| 1613 | Child Behavior Disorders | 19681008 | CTD | |
| 1614 | Cholestasis of pregnancy | OFFSIDES | ||
| 1615 | Choroiditis | OFFSIDES | ||
| 1616 | Coagulation factor V level decreased | OFFSIDES | ||
| 1617 | Cocaine-Related Disorders | CTD | ||
| 1618 | Cognition Disorders | 11806303 12724501 | CTD | |
| 1619 | Cognitive deterioration | OFFSIDES | ||
| 1620 | Congenital hypertrichosis | OFFSIDES | ||
| 1621 | Congenital torticollis | OFFSIDES | ||
| 1622 | Conjunctival deposit | OFFSIDES | ||
| 1623 | Corneal Ulcer | OFFSIDES | ||
| 1624 | Corneal leukoma | OFFSIDES | ||
| 1625 | Corneal thinning | OFFSIDES | ||
| 1626 | Cramps of lower extremities | SIDER | ||
| 1627 | Cryotherapy | OFFSIDES | ||
| 1628 | Cytology abnormal | OFFSIDES | ||
| 1629 | Dacryocystitis infective | OFFSIDES | ||
| 1630 | Death of friend | OFFSIDES | ||
| 1631 | Delayed menarche | OFFSIDES | ||
| 1632 | Delusional perception | OFFSIDES | ||
| 1633 | Depressive disorder | CTD | ||
| 1634 | Diabetes with hyperosmolarity | OFFSIDES | ||
| 1635 | Disturbance in sexual arousal | SIDER | ||
| 1636 | Drowsiness | SIDER | ||
| 1637 | Drug Eruptions | 12926190 29644860 | CTD | |
| 1638 | Drug therapeutic incompatibility | OFFSIDES | ||
| 1639 | Dyspareunia | OFFSIDES | ||
| 1640 | Ear and labyrinth disorders | SIDER | ||
| 1641 | Edema | 17923349 | CTD | |
| 1642 | Engraftment syndrome | OFFSIDES | ||
| 1643 | Enlargement abdomen | SIDER | ||
| 1644 | Epilepsies, Partial | 10728528 15642451 17116037 | CTD | |
| 1645 | Epilepsy, Complex Partial | 14733874 15169707 | CTD | |
| 1646 | Epilepsy, Generalized | 11052335 | CTD | |
| 1647 | Epilepsy, Temporal Lobe | 16499746 | CTD | |
| 1648 | Erythema Infectiosum | OFFSIDES | ||
| 1649 | Esophageal Perforation | OFFSIDES | ||
| 1650 | Ethmoid sinus surgery | OFFSIDES | ||
| 1651 | Eustachian tube disorder | OFFSIDES | ||
| 1652 | Exanthema | CTD | ||
| 1653 | Excessive masturbation | OFFSIDES | ||
| 1654 | Eyelid exfoliation | Canada Vigilance: 1 | Canada Vigilance | |
| 1655 | Eyelid irritation | Canada Vigilance: 1 | Canada Vigilance | |
| 1656 | Eyelid pain | OFFSIDES | ||
| 1657 | Eyelids pruritus | OFFSIDES | ||
| 1658 | Factor V deficiency | OFFSIDES | ||
| 1659 | Feeding problem in child | OFFSIDES | ||
| 1660 | Femoral artery occlusion | OFFSIDES | ||
| 1661 | Fever | 11052335 16442685 19221540 | CTD | |
| 1662 | Fungal rash | OFFSIDES | ||
| 1663 | Galactocele | OFFSIDES | ||
| 1664 | Gastrointestinal Diseases | 10448828 | CTD | |
| 1665 | Gastrointestinal inflammation | OFFSIDES | ||
| 1666 | Genital erythema | OFFSIDES | ||
| 1667 | Goiter | OFFSIDES | ||
| 1668 | Granulocyte count increased | OFFSIDES | ||
| 1669 | Hallucinations | 10448828 | CTD | |
| 1670 | Hemorrhagic colitis | SIDER | ||
| 1671 | Hyperalgesia | 8577488 | CTD | |
| 1672 | Hyperlipasaemia | OFFSIDES | ||
| 1673 | Hyperosmolar state | OFFSIDES | ||
| 1674 | Hyperparathyroidism | OFFSIDES | ||
| 1675 | Hypersensitive syndrome | SIDER | ||
| 1676 | Hypogonadism | OFFSIDES | ||
| 1677 | Hypopituitarism | OFFSIDES | ||
| 1678 | Illiteracy | OFFSIDES | ||
| 1679 | Immune thrombocytopenic purpura | Canada Vigilance: 1 | Canada Vigilance | |
| 1680 | Implant site abscess | OFFSIDES | ||
| 1681 | Inability to crawl | OFFSIDES | ||
| 1682 | Infestation | SIDER | ||
| 1683 | Infrequent bowel movements | OFFSIDES | ||
| 1684 | Infusion Site Extravasation | OFFSIDES | ||
| 1685 | Intertrigo | OFFSIDES | ||
| 1686 | Keratoconus | OFFSIDES | ||
| 1687 | Labile hypertension | OFFSIDES | ||
| 1688 | Laboratory test interference | OFFSIDES | ||
| 1689 | Lacrimal structural disorder | SIDER | ||
| 1690 | Leukoaraiosis | OFFSIDES | ||
| 1691 | Leukoderma | SIDER | ||
| 1692 | Lipase | OFFSIDES | ||
| 1693 | Liver Failure, Acute | CTD | ||
| 1694 | Lividity | OFFSIDES | ||
| 1695 | Loose associations | OFFSIDES | ||
| 1696 | Lupus Erythematosus | SIDER | ||
| 1697 | Lymphatic Diseases | 19221540 | CTD | |
| 1698 | Male sexual dysfunction | OFFSIDES | ||
| 1699 | Malformations of Cortical Development | 18166379 | CTD | |
| 1700 | Memory Disorders | 12724501 | CTD | |
| 1701 | Mental disorder due to a general medical condition | OFFSIDES | ||
| 1702 | Microgenia | OFFSIDES | ||
| 1703 | Micrographic skin surgery | OFFSIDES | ||
| 1704 | Microsporum infection | OFFSIDES | ||
| 1705 | Mitral valve sclerosis | OFFSIDES | ||
| 1706 | Moaning | OFFSIDES | ||
| 1707 | Monoclonal immunoglobulin present | OFFSIDES | ||
| 1708 | Mood Disorders | 18593793 | CTD | |
| 1709 | Motor retardation | OFFSIDES | ||
| 1710 | Movement Disorders | 22107891 | CTD | |
| 1711 | Mucopolysaccharidosis III | 19681008 | CTD | |
| 1712 | Multiple Organ Failure | 9371937 | CTD | |
| 1713 | Muscle relaxant therapy | SIDER | ||
| 1714 | Musculoskeletal Deformity | OFFSIDES | ||
| 1715 | Myasthenic Syndrome | OFFSIDES | ||
| 1716 | Nail bed infection | OFFSIDES | ||
| 1717 | Nerve Degeneration | 12192617 | CTD | |
| 1718 | Neurological infection | OFFSIDES | ||
| 1719 | Obstruction | OFFSIDES | ||
| 1720 | Orthostatic intolerance | OFFSIDES | ||
| 1721 | Ovarian Infection | OFFSIDES | ||
| 1722 | Pancreatic Neoplasm | OFFSIDES | ||
| 1723 | Pancreatic Pseudocyst | OFFSIDES | ||
| 1724 | Paranoid reaction | SIDER | ||
| 1725 | Paraparesis | OFFSIDES | ||
| 1726 | Parvovirus B19 serology positive | OFFSIDES | ||
| 1727 | Pelvic abscess | OFFSIDES | ||
| 1728 | Peptic Ulcer | SIDER | ||
| 1729 | Perceptual Disorders | 11806303 | CTD | |
| 1730 | Peripheral arterial occlusive disease | OFFSIDES | ||
| 1731 | Plasmapheresis | OFFSIDES | ||
| 1732 | Pleocytosis | OFFSIDES | ||
| 1733 | Polymenorrhea | OFFSIDES | ||
| 1734 | Potentiating drug interaction | OFFSIDES | ||
| 1735 | Pregnancy on contraceptive | OFFSIDES | ||
| 1736 | Pregnancy with implant contraceptive | OFFSIDES | ||
| 1737 | Prolapse repair | OFFSIDES | ||
| 1738 | Protein C increased | OFFSIDES | ||
| 1739 | Psychoses, Substance-Induced | CTD | ||
| 1740 | Pulmonary artery thrombosis | OFFSIDES | ||
| 1741 | Pyloric Stenosis | OFFSIDES | ||
| 1742 | Rash maculovesicular | OFFSIDES | ||
| 1743 | Rectal tenesmus | OFFSIDES | ||
| 1744 | Reflux laryngitis | OFFSIDES | ||
| 1745 | Respiratory Therapy | OFFSIDES | ||
| 1746 | Retinal Vasculitis | OFFSIDES | ||
| 1747 | Retinal deposits | OFFSIDES | ||
| 1748 | Rhinitis | SIDER | ||
| 1749 | Rhonchi | OFFSIDES | ||
| 1750 | Rickets | OFFSIDES | ||
| 1751 | SUNCT Syndrome | 20656711 | CTD OFFSIDES | |
| 1752 | Scarlet Fever | OFFSIDES | ||
| 1753 | Sebaceous hyperplasia | OFFSIDES | ||
| 1754 | Seizures |
9249254
9844417 10448828 11738929 14636342 14704477 15680200 16499746 16702909 17901576 17956996 18028184 18253065 18459937 19221540 20407029 20511737 22107891 26216692 | CTD | |
| 1755 | Senile dementia | OFFSIDES | ||
| 1756 | Septoplasty | OFFSIDES | ||
| 1757 | Sinus antrostomy | OFFSIDES | ||
| 1758 | Sleep Initiation and Maintenance Disorders | 10448828 | CTD | |
| 1759 | Sleep study abnormal | OFFSIDES | ||
| 1760 | Soft tissue atrophy | OFFSIDES | ||
| 1761 | Sore eye | SIDER | ||
| 1762 | Sore mouth | SIDER | ||
| 1763 | Substance Withdrawal Syndrome | 10553755 | CTD | |
| 1764 | Suicide | SIDER | ||
| 1765 | Sweating | SIDER | ||
| 1766 | Tachyphylaxis | OFFSIDES | ||
| 1767 | Therapeutic reaction time decreased | OFFSIDES | ||
| 1768 | Thermohyperaesthesia | OFFSIDES | ||
| 1769 | Thirst decreased | OFFSIDES | ||
| 1770 | Thromboangiitis Obliterans | OFFSIDES | ||
| 1771 | Thrombophlebitis | SIDER | ||
| 1772 | Thyroiditis | OFFSIDES | ||
| 1773 | Tobacco withdrawal symptoms | OFFSIDES | ||
| 1774 | Toxoplasmosis | OFFSIDES | ||
| 1775 | Tracheal Stenosis | OFFSIDES | ||
| 1776 | Trigeminal Nerve Disorder | OFFSIDES | ||
| 1777 | Tubo-ovarian abscess | OFFSIDES | ||
| 1778 | Type II hypersensitivity | OFFSIDES | ||
| 1779 | Ultrasound antenatal screen | OFFSIDES | ||
| 1780 | Urine alcohol test positive | OFFSIDES | ||
| 1781 | Urine human chorionic gonadotropin decreased | OFFSIDES | ||
| 1782 | Uterovaginal prolapse | OFFSIDES | ||
| 1783 | Vasodilation procedure | SIDER | ||
| 1784 | Vasodilation | SIDER | ||
| 1785 | Vesiculobullous rash | SIDER | ||
| 1786 | Vestibular Neuronitis | OFFSIDES | ||
| 1787 | Vestibulitis | OFFSIDES | ||
| 1788 | Visceral congestion | OFFSIDES | ||
| 1789 | Vitamin B 12 Deficiency | OFFSIDES | ||
| 1790 | Withdrawal seizures | SIDER | ||
| 1791 | Wound decomposition | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.