Norgestrel
(WWYNJERNGUHSAO-XUDSTZEESA-N)
Structure
- SMILES
- C#C[C@]1(O)CC[C@@H]2[C@]1(CC)CC[C@H]1[C@H]2CCC2=CC(=O)CC[C@H]12
- Type(s)
- Approved; Investigational
- ATC code(s)
- G03AA07; G03AB03; G03AC03; G03AD01; G03FA11; G03FB09
- Molecular Formula:
- C21H28O2
- Molecular Weight:
- 312.446
- Log P:
- 3.8826
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 1
- TPSA:
- 37.3
- CAS Number(s):
- 797-63-7; 6533-00-2
Synonym(s)
1.
Norgestrel
2.
DL-Norgestrel
3.
Neogest
4.
Ovrette
5.
Postinor
6.
Wy-3707
7.
DL Norgestrel
8.
Wy 3707
9.
Wy3707
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Device expulsion | FAERS: 31774 Canada Vigilance: 1115 | Canada Vigilance SIDER US FAERS | |
| 2 | Device dislocation | FAERS: 13302 Canada Vigilance: 1399 | Canada Vigilance OFFSIDES US FAERS | |
| 3 | Abdominal Pain | FAERS: 7126 Canada Vigilance: 387 | 385243 12413624 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 4 | Pregnancy with contraceptive device | FAERS: 6480 Canada Vigilance: 271 | Canada Vigilance OFFSIDES US FAERS | |
| 5 | Pain | FAERS: 6419 Canada Vigilance: 192 | 7475634 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 6 | Nausea | FAERS: 5653 Canada Vigilance: 151 | CTD SIDER Canada Vigilance US FAERS | |
| 7 | Uterine Perforation | FAERS: 5485 Canada Vigilance: 596 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 8 | Pelvic Pain | FAERS: 5040 Canada Vigilance: 121 | Canada Vigilance SIDER US FAERS | |
| 9 | Headache | FAERS: 4447 Canada Vigilance: 153 |
385243
1908815 7760885 7793168 7847530 7853277 8070260 8222653 8576880 8631187 9115001 9827162 11535212 11861056 12413624 | CTD SIDER Canada Vigilance US FAERS |
| 10 | Drug ineffective | FAERS: 4247 Canada Vigilance: 350 | Canada Vigilance US FAERS | |
| 11 | Menorrhagia | FAERS: 3595 Canada Vigilance: 195 | CTD SIDER Canada Vigilance US FAERS | |
| 12 | Device difficult to use | FAERS: 3498 Canada Vigilance: 290 | Canada Vigilance US FAERS | |
| 13 | Fatigue | FAERS: 3487 Canada Vigilance: 200 | 7491061 7793168 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 14 | Vomiting | FAERS: 3061 Canada Vigilance: 49 | 1908815 12413624 | CTD SIDER Canada Vigilance US FAERS |
| 15 | Anxiety | FAERS: 3055 Canada Vigilance: 155 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 16 | Back Pain | FAERS: 2967 Canada Vigilance: 115 | Canada Vigilance SIDER US FAERS | |
| 17 | Dizziness | FAERS: 2922 Canada Vigilance: 112 | 1908815 11861056 12413624 | CTD SIDER Canada Vigilance US FAERS |
| 18 | Complication of device insertion | FAERS: 2369 Canada Vigilance: 229 | Canada Vigilance OFFSIDES US FAERS | |
| 19 | Emotional distress | FAERS: 2305 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 20 | Vaginal Discharge | FAERS: 2301 Canada Vigilance: 56 | Canada Vigilance SIDER US FAERS | |
| 21 | Embedded device | FAERS: 2110 Canada Vigilance: 436 | Canada Vigilance US FAERS | |
| 22 | Alopecia | FAERS: 2087 Canada Vigilance: 110 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 23 | Metrorrhagia | FAERS: 2028 Canada Vigilance: 52 | 2178992 9115001 | CTD SIDER Canada Vigilance US FAERS |
| 24 | Device breakage | FAERS: 1764 Canada Vigilance: 91 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 25 | Breast tenderness | FAERS: 1726 Canada Vigilance: 25 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 26 | Uterine Rupture | FAERS: 1726 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 27 | Acne | FAERS: 1599 Canada Vigilance: 85 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 28 | Medical device complication | FAERS: 1593 | OFFSIDES SIDER US FAERS | |
| 29 | Pregnancy after post coital contraception | FAERS: 1554 Canada Vigilance: 82 | Canada Vigilance OFFSIDES US FAERS | |
| 30 | Complication of device removal | FAERS: 1526 Canada Vigilance: 113 | Canada Vigilance OFFSIDES US FAERS | |
| 31 | Dyspareunia | FAERS: 1499 Canada Vigilance: 77 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 32 | Medical device discomfort | FAERS: 1284 Canada Vigilance: 64 | Canada Vigilance US FAERS | |
| 33 | Mood swings | FAERS: 1253 Canada Vigilance: 103 | Canada Vigilance SIDER US FAERS | |
| 34 | Feeling abnormal | FAERS: 1139 Canada Vigilance: 41 | Canada Vigilance OFFSIDES US FAERS | |
| 35 | No adverse event | FAERS: 940 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 36 | Post procedural discomfort | FAERS: 937 Canada Vigilance: 30 | Canada Vigilance OFFSIDES US FAERS | |
| 37 | Arthralgia | FAERS: 908 Canada Vigilance: 34 | Canada Vigilance US FAERS | |
| 38 | Device use issue | FAERS: 885 Canada Vigilance: 68 | Canada Vigilance US FAERS | |
| 39 | Malaise | FAERS: 807 Canada Vigilance: 33 | Canada Vigilance US FAERS | |
| 40 | Asthenia | FAERS: 754 Canada Vigilance: 38 | Canada Vigilance SIDER US FAERS | |
| 41 | Device deployment issue | FAERS: 734 Canada Vigilance: 99 | Canada Vigilance US FAERS | |
| 42 | Medical device pain | FAERS: 734 Canada Vigilance: 12 | Canada Vigilance OFFSIDES US FAERS | |
| 43 | Discomfort | FAERS: 731 Canada Vigilance: 32 | Canada Vigilance SIDER US FAERS | |
| 44 | Abdominal discomfort | FAERS: 688 Canada Vigilance: 28 | Canada Vigilance OFFSIDES US FAERS | |
| 45 | Vertigo | FAERS: 688 Canada Vigilance: 37 | Canada Vigilance SIDER US FAERS | |
| 46 | Coital bleeding | FAERS: 687 Canada Vigilance: 32 | Canada Vigilance OFFSIDES US FAERS | |
| 47 | Urinary tract infection | FAERS: 674 Canada Vigilance: 10 | Canada Vigilance SIDER US FAERS | |
| 48 | Ectopic pregnancy with contraceptive device | FAERS: 667 Canada Vigilance: 66 | Canada Vigilance US FAERS | |
| 49 | Depressed mood | FAERS: 615 Canada Vigilance: 47 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 50 | Infection | FAERS: 609 Canada Vigilance: 25 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 51 | Visual Impairment | FAERS: 608 Canada Vigilance: 28 | Canada Vigilance SIDER US FAERS | |
| 52 | Ectopic pregnancy with intrauterine device | FAERS: 595 | OFFSIDES US FAERS | |
| 53 | Unintentional medical device removal | FAERS: 587 Canada Vigilance: 31 | Canada Vigilance US FAERS | |
| 54 | Uterine spasm | FAERS: 580 Canada Vigilance: 27 | Canada Vigilance OFFSIDES US FAERS | |
| 55 | Ectopic Pregnancy | FAERS: 574 Canada Vigilance: 27 | Canada Vigilance SIDER US FAERS | |
| 56 | Palpitations | FAERS: 552 Canada Vigilance: 26 | Canada Vigilance SIDER US FAERS | |
| 57 | General physical health deterioration | FAERS: 547 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 58 | Pregnancy | FAERS: 533 Canada Vigilance: 18 | Canada Vigilance SIDER US FAERS | |
| 59 | Anhedonia | FAERS: 514 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 60 | Urticaria | FAERS: 498 Canada Vigilance: 10 | Canada Vigilance SIDER US FAERS | |
| 61 | Syncope | FAERS: 494 Canada Vigilance: 21 | Canada Vigilance SIDER US FAERS | |
| 62 | Pruritus | FAERS: 480 Canada Vigilance: 10 | 15861022 | CTD SIDER Canada Vigilance US FAERS |
| 63 | Pelvic Inflammatory Disease | FAERS: 475 Canada Vigilance: 33 | Canada Vigilance SIDER US FAERS | |
| 64 | Tinnitus | FAERS: 441 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 65 | Maternal exposure before pregnancy | FAERS: 430 Canada Vigilance: 20 | Canada Vigilance US FAERS | |
| 66 | Presyncope | FAERS: 421 Canada Vigilance: 26 | Canada Vigilance US FAERS | |
| 67 | Weight decreased | FAERS: 420 Canada Vigilance: 22 | Canada Vigilance SIDER US FAERS | |
| 68 | Device Failure | FAERS: 393 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 69 | Stress | FAERS: 389 Canada Vigilance: 24 | Canada Vigilance US FAERS | |
| 70 | Nervousness | FAERS: 386 Canada Vigilance: 19 | Canada Vigilance SIDER US FAERS | |
| 71 | Chest Pain | FAERS: 374 Canada Vigilance: 16 | Canada Vigilance SIDER US FAERS | |
| 72 | Amnesia | FAERS: 367 Canada Vigilance: 23 | Canada Vigilance US FAERS | |
| 73 | Intentional product misuse | FAERS: 363 | US FAERS | |
| 74 | Device use error | FAERS: 362 Canada Vigilance: 17 | Canada Vigilance US FAERS | |
| 75 | Adverse event | FAERS: 360 Canada Vigilance: 12 | Canada Vigilance OFFSIDES US FAERS | |
| 76 | Myalgia | FAERS: 359 Canada Vigilance: 18 | Canada Vigilance SIDER US FAERS | |
| 77 | Genital pain | FAERS: 343 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 78 | Adnexa uteri pain | FAERS: 342 Canada Vigilance: 14 | Canada Vigilance OFFSIDES US FAERS | |
| 79 | Neck Pain | FAERS: 337 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 80 | Crying | FAERS: 334 Canada Vigilance: 19 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 81 | Ruptured ectopic pregnancy | FAERS: 319 Canada Vigilance: 9 | Canada Vigilance OFFSIDES US FAERS | |
| 82 | Tachycardia | FAERS: 305 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 83 | Cervical dysplasia | FAERS: 293 Canada Vigilance: 17 | Canada Vigilance OFFSIDES US FAERS | |
| 84 | Emotional disorder | FAERS: 290 Canada Vigilance: 13 | Canada Vigilance OFFSIDES US FAERS | |
| 85 | Device physical property issue | FAERS: 289 Canada Vigilance: 34 | Canada Vigilance US FAERS | |
| 86 | Cyst | FAERS: 283 Canada Vigilance: 9 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 87 | Vulvovaginal pain | FAERS: 280 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 88 | Medication Error | FAERS: 278 Canada Vigilance: 25 | Canada Vigilance US FAERS | |
| 89 | Dysuria | FAERS: 276 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 90 | Constipation | FAERS: 273 Canada Vigilance: 15 | Canada Vigilance SIDER US FAERS | |
| 91 | Drug exposure during pregnancy | FAERS: 273 | US FAERS | |
| 92 | Product use issue | FAERS: 272 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 93 | Hypertrichosis | FAERS: 271 Canada Vigilance: 20 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 94 | Expired device used | FAERS: 265 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 95 | Unevaluable event | FAERS: 253 Canada Vigilance: 9 | Canada Vigilance OFFSIDES US FAERS | |
| 96 | Musculoskeletal Pain | FAERS: 246 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 97 | Uterine cervix stenosis | FAERS: 236 Canada Vigilance: 9 | Canada Vigilance OFFSIDES US FAERS | |
| 98 | Chills | FAERS: 235 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 99 | Night sweats | FAERS: 227 Canada Vigilance: 26 | Canada Vigilance US FAERS | |
| 100 | Hypersensitivity | FAERS: 222 Canada Vigilance: 10 | Canada Vigilance SIDER US FAERS | |
| 101 | Hormone level abnormal | FAERS: 220 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 102 | Thrombosis | FAERS: 219 Canada Vigilance: 11 | 2119546 | CTD Canada Vigilance US FAERS |
| 103 | Tremor | FAERS: 215 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 104 | Memory impairment | FAERS: 209 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 105 | Inappropriate schedule of drug administration | FAERS: 207 | US FAERS | |
| 106 | Anger | FAERS: 206 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 107 | Pulmonary Embolism | FAERS: 205 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 108 | Premenstrual syndrome | FAERS: 202 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 109 | Blindness | FAERS: 201 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 110 | Diffuse alopecia | FAERS: 200 | US FAERS | |
| 111 | Cerebrovascular accident | FAERS: 198 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 112 | Vulvovaginal pruritus | FAERS: 198 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 113 | Vulvovaginal discomfort | FAERS: 197 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 114 | Diplopia | FAERS: 193 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 115 | Hirsutism | FAERS: 190 Canada Vigilance: 4 | 7847530 | CTD SIDER Canada Vigilance US FAERS |
| 116 | Off label use of device | FAERS: 190 Canada Vigilance: 30 | Canada Vigilance US FAERS | |
| 117 | Vulvovaginal mycotic infection | FAERS: 189 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 118 | Device malfunction | FAERS: 182 Canada Vigilance: 26 | Canada Vigilance OFFSIDES US FAERS | |
| 119 | Nipple pain | FAERS: 177 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 120 | Somnolence | FAERS: 177 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 121 | Dyspepsia | FAERS: 175 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 122 | Deep Vein Thrombosis | FAERS: 170 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 123 | Suppressed lactation | FAERS: 169 Canada Vigilance: 28 | Canada Vigilance OFFSIDES US FAERS | |
| 124 | Procedural complication | FAERS: 168 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 125 | Flatulence | FAERS: 162 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 126 | Endometriosis | FAERS: 160 Canada Vigilance: 7 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 127 | Internal injury | FAERS: 153 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 128 | Swelling | FAERS: 153 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 129 | Maternal exposure during pregnancy | FAERS: 152 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 130 | Pelvic discomfort | FAERS: 145 Canada Vigilance: 7 | Canada Vigilance OFFSIDES US FAERS | |
| 131 | Pregnancy with implant contraceptive | FAERS: 144 | US FAERS | |
| 132 | Vulvovaginal dryness | FAERS: 137 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 133 | Blood urine present | FAERS: 136 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 134 | Eczema | FAERS: 135 Canada Vigilance: 13 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 135 | Cystitis | FAERS: 128 | SIDER US FAERS | |
| 136 | Device defective | FAERS: 127 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 137 | Endometritis | FAERS: 126 Canada Vigilance: 17 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 138 | Hypotension | FAERS: 126 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 139 | Chest discomfort | FAERS: 124 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 140 | Abnormal weight gain | FAERS: 122 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 141 | Formication | FAERS: 122 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 142 | Pregnancy test positive | FAERS: 122 Canada Vigilance: 9 | Canada Vigilance OFFSIDES US FAERS | |
| 143 | Burning sensation | FAERS: 120 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 144 | Impaired work ability | FAERS: 120 Canada Vigilance: 27 | Canada Vigilance US FAERS | |
| 145 | Product use in unapproved indication | FAERS: 118 Canada Vigilance: 28 | Canada Vigilance US FAERS | |
| 146 | Sinusitis | FAERS: 118 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 147 | Activities of daily living impaired | FAERS: 117 | US FAERS | |
| 148 | Breast Cyst | FAERS: 113 Canada Vigilance: 6 | Canada Vigilance OFFSIDES US FAERS | |
| 149 | Hunger | FAERS: 113 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 150 | Breast discomfort | FAERS: 108 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 151 | Genital discharge | FAERS: 108 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 152 | Oropharyngeal pain | FAERS: 107 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 153 | Product quality issue | FAERS: 104 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 154 | Bacterial Vaginosis | FAERS: 101 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 155 | Exposure during breast feeding | FAERS: 100 | US FAERS | |
| 156 | Erythema | FAERS: 99 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 157 | Product shape issue | FAERS: 99 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 158 | Prescription drug used without a prescription | FAERS: 97 | US FAERS | |
| 159 | Sepsis | FAERS: 97 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 160 | Intentional product use issue | FAERS: 96 | US FAERS | |
| 161 | Uterine Polyp | FAERS: 95 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 162 | Photophobia | FAERS: 92 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 163 | Migraine with Aura | FAERS: 89 Canada Vigilance: 6 | Canada Vigilance OFFSIDES US FAERS | |
| 164 | Depression suicidal | FAERS: 87 Canada Vigilance: 6 | Canada Vigilance OFFSIDES US FAERS | |
| 165 | Musculoskeletal stiffness | FAERS: 87 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 166 | Nasopharyngitis | FAERS: 87 | US FAERS | |
| 167 | Pelvic Infection | FAERS: 87 Canada Vigilance: 11 | Canada Vigilance OFFSIDES US FAERS | |
| 168 | Food craving | FAERS: 85 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 169 | Hysterectomy | FAERS: 85 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 170 | Device component issue | FAERS: 84 | US FAERS | |
| 171 | Infertility | FAERS: 83 | US FAERS | |
| 172 | Restlessness | FAERS: 83 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 173 | Contraindicated device used | FAERS: 82 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 174 | Complication associated with device | FAERS: 81 Canada Vigilance: 59 | Canada Vigilance US FAERS | |
| 175 | Dry skin | FAERS: 81 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 176 | Myocardial Infarction | FAERS: 81 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 177 | Intentional medical device removal by patient | FAERS: 80 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 178 | Peripheral swelling | FAERS: 80 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 179 | Nephrolithiasis | FAERS: 79 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 180 | Abdominal tenderness | FAERS: 78 Canada Vigilance: 5 | Canada Vigilance OFFSIDES US FAERS | |
| 181 | Lymphadenopathy | FAERS: 78 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 182 | Limb discomfort | FAERS: 77 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 183 | Vulvovaginal burning sensation | FAERS: 77 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 184 | Expired drug administered | FAERS: 76 | US FAERS | |
| 185 | Flank Pain | FAERS: 76 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 186 | Inflammation | FAERS: 76 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 187 | Medical device monitoring error | FAERS: 76 Canada Vigilance: 19 | Canada Vigilance US FAERS | |
| 188 | Apathy | FAERS: 74 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 189 | Blighted ovum | FAERS: 73 | OFFSIDES US FAERS | |
| 190 | Intentional device misuse | FAERS: 73 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 191 | Joint swelling | FAERS: 72 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 192 | Lethargy | FAERS: 72 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 193 | Salpingitis | FAERS: 72 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 194 | Uterine cervical pain | FAERS: 72 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 195 | Abasia | FAERS: 70 | US FAERS | |
| 196 | Dysgeusia | FAERS: 69 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 197 | Eye pain | FAERS: 69 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 198 | Patient-device incompatibility | FAERS: 69 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 199 | Peritonitis | FAERS: 68 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 200 | Urinary Incontinence | FAERS: 68 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 201 | Cervix carcinoma | FAERS: 67 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 202 | Pallor | FAERS: 67 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 203 | Procedural dizziness | FAERS: 67 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 204 | Feeling Cold | FAERS: 65 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 205 | Loop electrosurgical excision procedure | FAERS: 65 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 206 | Procedural nausea | FAERS: 65 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 207 | Epilepsy | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 208 | Focal Nodular Hyperplasia | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 209 | Expired product administered | FAERS: 60 | US FAERS | |
| 210 | Pharmaceutical product complaint | FAERS: 60 | US FAERS | |
| 211 | Psychological Trauma | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 212 | Sexual Dysfunction | FAERS: 60 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 213 | Meningioma | FAERS: 59 | 8008172 | CTD OFFSIDES US FAERS |
| 214 | Cholelithiasis | FAERS: 57 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 215 | Influenza | FAERS: 57 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 216 | Suicide attempt | FAERS: 56 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 217 | Hypersomnia | FAERS: 55 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 218 | Chloasma | FAERS: 54 | OFFSIDES SIDER US FAERS | |
| 219 | Hypothyroidism | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 220 | Quality of life decreased | FAERS: 54 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 221 | Actinomycosis | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 222 | Agitation | FAERS: 53 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 223 | Dehydration | FAERS: 53 | US FAERS | |
| 224 | Endometrial Hyperplasia | FAERS: 53 Canada Vigilance: 2 | 12554277 16824305 | CTD OFFSIDES Canada Vigilance US FAERS |
| 225 | Secretion discharge | FAERS: 52 | OFFSIDES US FAERS | |
| 226 | Vitreous floaters | FAERS: 52 | US FAERS | |
| 227 | Post procedural complication | FAERS: 51 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 228 | Angioedema | FAERS: 50 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 229 | Premature Menopause | FAERS: 50 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 230 | Abdominal adhesions | FAERS: 49 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 231 | Appendicitis | FAERS: 49 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 232 | Bone pain | FAERS: 49 | US FAERS | |
| 233 | Vulvovaginal swelling | FAERS: 49 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 234 | Hydrometra | FAERS: 48 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 235 | Ocular discomfort | FAERS: 48 | US FAERS | |
| 236 | Therapeutic response unexpected | FAERS: 48 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 237 | Rheumatoid Arthritis | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 238 | Actinomyces test positive | FAERS: 46 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 239 | Drug ineffective for unapproved indication | FAERS: 46 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 240 | Pneumonia | FAERS: 46 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 241 | Rash erythematous | FAERS: 46 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 242 | Septic Shock | FAERS: 46 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 243 | Device related infection | FAERS: 45 | US FAERS | |
| 244 | Incorrect drug administration duration | FAERS: 45 | US FAERS | |
| 245 | Pelvic adhesions | FAERS: 45 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 246 | Procedural vomiting | FAERS: 45 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 247 | Psoriasis | FAERS: 45 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 248 | Asthma | FAERS: 44 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 249 | Device intolerance | FAERS: 44 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 250 | Epistaxis | FAERS: 44 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 251 | Feeling jittery | FAERS: 44 | US FAERS | |
| 252 | Fibromyalgia | FAERS: 44 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 253 | Muscle tightness | FAERS: 44 | US FAERS | |
| 254 | Bronchitis | FAERS: 43 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 255 | Tubo-ovarian abscess | FAERS: 43 | OFFSIDES US FAERS | |
| 256 | Bipolar Disorder | FAERS: 41 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 257 | Cervical polyp | FAERS: 41 Canada Vigilance: 5 | Canada Vigilance OFFSIDES US FAERS | |
| 258 | Genital discomfort | FAERS: 41 | OFFSIDES US FAERS | |
| 259 | Head discomfort | FAERS: 41 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 260 | Lip swelling | FAERS: 41 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 261 | Sciatica | FAERS: 41 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 262 | Abdominal rigidity | FAERS: 40 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 263 | Aphasia | FAERS: 40 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 264 | Arthropathy | FAERS: 40 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 265 | Wrong technique in product usage process | FAERS: 40 | US FAERS | |
| 266 | Angina Pectoris | FAERS: 39 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 267 | Autoimmune thyroiditis | FAERS: 39 | OFFSIDES US FAERS | |
| 268 | Endometrial hypertrophy | FAERS: 39 | OFFSIDES US FAERS | |
| 269 | Product solubility abnormal | FAERS: 39 | US FAERS | |
| 270 | Chromaturia | FAERS: 38 | US FAERS | |
| 271 | Device ineffective | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 272 | Dysarthria | FAERS: 38 Canada Vigilance: 1 | 7491061 | CTD Canada Vigilance US FAERS |
| 273 | Multiple use of single-use product | FAERS: 38 | US FAERS | |
| 274 | Neuralgia | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 275 | Pelvic fluid collection | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 276 | Disorientation | FAERS: 37 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 277 | Hemiparesis | FAERS: 37 | US FAERS | |
| 278 | Irritable Bowel Syndrome | FAERS: 37 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 279 | Live Birth | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 280 | Menopause | FAERS: 37 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 281 | nervous system disorder | FAERS: 37 | SIDER US FAERS | |
| 282 | Erythema Nodosum | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 283 | Gamma-Glutamyltransferase Increased | FAERS: 36 | US FAERS | |
| 284 | Multiple Sclerosis | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 285 | Paranoia | FAERS: 36 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 286 | Progesterone decreased | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 287 | Retained products of conception | FAERS: 36 Canada Vigilance: 30 | Canada Vigilance US FAERS | |
| 288 | Flushing | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 289 | Hyperventilation | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 290 | Invasive Ductal Breast Carcinoma | FAERS: 35 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 291 | Uterine inflammation | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 292 | Cold sweat | FAERS: 34 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 293 | Uterine Cancer | FAERS: 34 | OFFSIDES US FAERS | |
| 294 | Human papilloma virus test positive | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 295 | Negative thoughts | FAERS: 33 Canada Vigilance: 15 | Canada Vigilance US FAERS | |
| 296 | Toothache | FAERS: 33 | SIDER US FAERS | |
| 297 | Eructation | FAERS: 32 | US FAERS | |
| 298 | Fibroadenoma of breast | FAERS: 32 | OFFSIDES SIDER US FAERS | |
| 299 | Libido disorder | FAERS: 32 | US FAERS | |
| 300 | Musculoskeletal discomfort | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 301 | Personality Change | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 302 | Anorexia | FAERS: 31 | SIDER US FAERS | |
| 303 | Arthritis | FAERS: 31 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 304 | Deformity | FAERS: 31 | US FAERS | |
| 305 | Feeling of body temperature change | FAERS: 31 | OFFSIDES US FAERS | |
| 306 | Gastrointestinal Pain | FAERS: 31 | SIDER US FAERS | |
| 307 | Lactation Disorder | FAERS: 31 Canada Vigilance: 5 | Canada Vigilance OFFSIDES US FAERS | |
| 308 | Placenta Accreta | FAERS: 31 | OFFSIDES US FAERS | |
| 309 | Aphagia | FAERS: 30 | US FAERS | |
| 310 | Cerebral Infarction | FAERS: 30 | US FAERS | |
| 311 | Device shape alteration | FAERS: 30 | OFFSIDES US FAERS | |
| 312 | Mastitis | FAERS: 30 | SIDER US FAERS | |
| 313 | Middle insomnia | FAERS: 30 | US FAERS | |
| 314 | Poor quality sleep | FAERS: 30 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 315 | Pregnancy test negative | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 316 | Purulent discharge | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 317 | Renal pain | FAERS: 30 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 318 | Retching | FAERS: 30 | US FAERS | |
| 319 | Salpingectomy | FAERS: 30 | OFFSIDES US FAERS | |
| 320 | Unintentional medical device removal by patient | FAERS: 30 | US FAERS | |
| 321 | Blood glucose increased | FAERS: 29 | SIDER US FAERS | |
| 322 | Deafness | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 323 | Loss of personal independence in daily activities | FAERS: 29 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 324 | Medical device site discomfort | FAERS: 29 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 325 | Mental impairment | FAERS: 29 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 326 | Post procedural infection | FAERS: 29 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 327 | Pregnancy on oral contraceptive | FAERS: 29 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 328 | Pyelonephritis | FAERS: 29 | OFFSIDES US FAERS | |
| 329 | Economic problem | FAERS: 28 | US FAERS | |
| 330 | Endometrial disorder | FAERS: 28 | OFFSIDES US FAERS | |
| 331 | Fallopian tube perforation | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 332 | Frustration | FAERS: 28 | US FAERS | |
| 333 | Gestational Diabetes | FAERS: 28 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 334 | Pelvic abscess | FAERS: 28 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 335 | Genital rash | FAERS: 27 | OFFSIDES US FAERS | |
| 336 | Hyperthyroidism | FAERS: 27 | US FAERS | |
| 337 | Phlebitis | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 338 | Pre-Eclampsia | FAERS: 27 | US FAERS | |
| 339 | Psychiatric symptom | FAERS: 27 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 340 | jaundice | FAERS: 27 | US FAERS | |
| 341 | Alanine Aminotransferase Increased | FAERS: 26 | US FAERS | |
| 342 | Blood pressure fluctuation | FAERS: 26 | US FAERS | |
| 343 | Bradycardia | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 344 | Impatience | FAERS: 26 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 345 | Pregnancy test false positive | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 346 | Procedural anxiety | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 347 | Abortion of ectopic pregnancy | FAERS: 25 | OFFSIDES US FAERS | |
| 348 | Ascites | FAERS: 25 | US FAERS | |
| 349 | Aspartate Aminotransferase Increased | FAERS: 25 | US FAERS | |
| 350 | Carpal Tunnel Syndrome | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 351 | Chlamydia test positive | FAERS: 25 | US FAERS | |
| 352 | Ear discomfort | FAERS: 25 | US FAERS | |
| 353 | Endometrial thickening | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 354 | Medical device site pain | FAERS: 25 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 355 | Musculoskeletal chest pain | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 356 | Pre-existing condition improved | FAERS: 25 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 357 | Tension | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 358 | Alopecia Areata | FAERS: 24 | US FAERS | |
| 359 | Anaphylactic shock | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 360 | Eye irritation | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 361 | Human chorionic gonadotropin decreased | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 362 | Hyperacusis | FAERS: 24 | US FAERS | |
| 363 | Low birth weight baby | FAERS: 24 | US FAERS | |
| 364 | Ovarian enlargement | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 365 | Pelvic venous thrombosis | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 366 | Procedural headache | FAERS: 24 | US FAERS | |
| 367 | Blood cholesterol increased | FAERS: 23 | US FAERS | |
| 368 | Blood iron decreased | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 369 | Blood potassium decreased | FAERS: 23 | US FAERS | |
| 370 | Hyperphagia | FAERS: 23 | US FAERS | |
| 371 | Injury associated with device | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 372 | Intestinal Perforation | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 373 | Skin irritation | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 374 | Stillbirth | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 375 | Visual disturbance | FAERS: 23 | US FAERS | |
| 376 | Bladder pain | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 377 | Blood human chorionic gonadotropin decreased | FAERS: 22 | OFFSIDES US FAERS | |
| 378 | Colposcopy | FAERS: 22 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 379 | Hypoaesthesia facial | FAERS: 22 | US FAERS | |
| 380 | Medical device entrapment | FAERS: 22 | US FAERS | |
| 381 | Ocular icterus | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 382 | Panic Disorder | FAERS: 22 Canada Vigilance: 2 | 7989280 | CTD Canada Vigilance US FAERS |
| 383 | Throat irritation | FAERS: 22 | US FAERS | |
| 384 | Toxic Shock Syndrome | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 385 | Urinary Retention | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 386 | Adnexa uteri mass | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 387 | Bedridden | FAERS: 21 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 388 | Breast cancer stage II | FAERS: 21 | OFFSIDES US FAERS | |
| 389 | Gastritis | FAERS: 21 | US FAERS | |
| 390 | Hemiplegia | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 391 | Joint stiffness | FAERS: 21 | US FAERS | |
| 392 | Sjogren's Syndrome | FAERS: 21 | OFFSIDES US FAERS | |
| 393 | fibroma | FAERS: 21 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 394 | Abscess | FAERS: 20 | US FAERS | |
| 395 | Candidiasis | FAERS: 20 | US FAERS | |
| 396 | Dermatitis | FAERS: 20 | SIDER US FAERS | |
| 397 | Drug administration error | FAERS: 20 | US FAERS | |
| 398 | Dysphonia | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 399 | Impaired driving ability | FAERS: 20 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 400 | Post procedural discharge | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 401 | Thirst | FAERS: 20 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 402 | Vaginal pain | FAERS: 20 | US FAERS | |
| 403 | Abdominal Infection | FAERS: 19 | OFFSIDES US FAERS | |
| 404 | Optic Neuritis | FAERS: 19 | US FAERS | |
| 405 | Pregnancy on contraceptive | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 406 | Thrombophlebitis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 407 | Tooth Infection | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 408 | Uterine stenosis | FAERS: 19 | US FAERS | |
| 409 | Back disorder | FAERS: 18 | US FAERS | |
| 410 | Blood glucose decreased | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 411 | Cellulitis | FAERS: 18 | US FAERS | |
| 412 | Device allergy | FAERS: 18 | US FAERS | |
| 413 | Food Allergy | FAERS: 18 | US FAERS | |
| 414 | Gastrointestinal motility disorder | FAERS: 18 | US FAERS | |
| 415 | Genital infection fungal | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 416 | Intentional device use issue | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 417 | Product contamination | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 418 | Shock | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 419 | Skin lesion | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 420 | Suprapubic pain | FAERS: 18 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 421 | Thrombocytopenia | FAERS: 18 | US FAERS | |
| 422 | Trichorrhexis | FAERS: 18 | US FAERS | |
| 423 | furuncle | FAERS: 18 | US FAERS | |
| 424 | Anorectal discomfort | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 425 | Blood follicle stimulating hormone increased | FAERS: 17 | US FAERS | |
| 426 | Blood prolactin increased | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 427 | Breast cancer recurrent | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 428 | Device damage | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 429 | Diabetes Mellitus | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 430 | Drug exposure before pregnancy | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 431 | Genital Herpes | FAERS: 17 | US FAERS | |
| 432 | Motion Sickness | FAERS: 17 | US FAERS | |
| 433 | Pancreatitis | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 434 | Patient dissatisfaction with treatment | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 435 | Rosacea | FAERS: 17 | US FAERS | |
| 436 | Uterine Prolapse | FAERS: 17 | US FAERS | |
| 437 | Wrong technique in device usage process | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 438 | Anosmia | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 439 | Breast engorgement | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 440 | Cholestasis | FAERS: 16 | 15861022 | CTD US FAERS |
| 441 | Complications of maternal exposure to therapeutic drugs | FAERS: 16 | US FAERS | |
| 442 | Endometrial adenocarcinoma | FAERS: 16 | US FAERS | |
| 443 | Intrauterine infection | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 444 | Joint injury | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 445 | Oophoritis | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 446 | Ovarian germ cell teratoma benign | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 447 | Product contamination microbial | FAERS: 16 | US FAERS | |
| 448 | Screaming | FAERS: 16 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 449 | Subcutaneous Abscess | FAERS: 16 | US FAERS | |
| 450 | Temperature intolerance | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 451 | Transaminases increased | FAERS: 16 | US FAERS | |
| 452 | Venous Thrombosis | FAERS: 16 | 15869587 | CTD US FAERS |
| 453 | Venous thrombosis limb | FAERS: 16 | US FAERS | |
| 454 | Abnormal withdrawal bleeding | FAERS: 15 | US FAERS | |
| 455 | Acute myocardial infarction | FAERS: 15 | US FAERS | |
| 456 | Alcohol Intolerance | FAERS: 15 | OFFSIDES US FAERS | |
| 457 | Asthenopia | FAERS: 15 | OFFSIDES US FAERS | |
| 458 | Bowel movement irregularity | FAERS: 15 | US FAERS | |
| 459 | Cardiac Flutter | FAERS: 15 | US FAERS | |
| 460 | Device deposit issue | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 461 | Large intestine perforation | FAERS: 15 | US FAERS | |
| 462 | Overweight | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 463 | Pharyngitis | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 464 | Post-Traumatic Stress Disorder | FAERS: 15 | US FAERS | |
| 465 | Tension Headache | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 466 | Thyroid Neoplasm | FAERS: 15 | US FAERS | |
| 467 | Ulcer | FAERS: 15 | US FAERS | |
| 468 | Vasculitis | FAERS: 15 | US FAERS | |
| 469 | Ageusia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 470 | Agoraphobia | FAERS: 14 Canada Vigilance: 2 | 8601550 | CTD Canada Vigilance US FAERS |
| 471 | Anorgasmia | FAERS: 14 | US FAERS | |
| 472 | Atrophic vulvovaginitis | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 473 | Bacterial test positive | FAERS: 14 | OFFSIDES US FAERS | |
| 474 | Bladder discomfort | FAERS: 14 | OFFSIDES US FAERS | |
| 475 | Breech Presentation | FAERS: 14 | US FAERS | |
| 476 | Cerebral Thrombosis | FAERS: 14 | US FAERS | |
| 477 | Colitis | FAERS: 14 | US FAERS | |
| 478 | Conversion disorder | FAERS: 14 | US FAERS | |
| 479 | Disability | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 480 | Frustration tolerance decreased | FAERS: 14 | US FAERS | |
| 481 | Gait inability | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 482 | Gastrointestinal sounds abnormal | FAERS: 14 | US FAERS | |
| 483 | Hydronephrosis | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 484 | Hypertensive crisis | FAERS: 14 | US FAERS | |
| 485 | Nerve injury | FAERS: 14 | US FAERS | |
| 486 | Pain of skin | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 487 | Patient dissatisfaction with device | FAERS: 14 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 488 | Product prescribing issue | FAERS: 14 | US FAERS | |
| 489 | Pulmonary Hypertension | FAERS: 14 | US FAERS | |
| 490 | Retinal vascular thrombosis | FAERS: 14 | OFFSIDES US FAERS | |
| 491 | Trisomy 21 | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 492 | Vulvovaginal erythema | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 493 | ovarian neoplasm | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 494 | Atrial Fibrillation | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 495 | Blood testosterone increased | FAERS: 13 | US FAERS | |
| 496 | Contraceptive device complication | FAERS: 13 | US FAERS | |
| 497 | Disease recurrence | FAERS: 13 | US FAERS | |
| 498 | Drug prescribing error | FAERS: 13 | US FAERS | |
| 499 | Facial Paresis | FAERS: 13 | US FAERS | |
| 500 | Fibrin D dimer increased | FAERS: 13 | US FAERS | |
| 501 | Initial insomnia | FAERS: 13 | US FAERS | |
| 502 | Onychoclasis | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 503 | Pulmonary thrombosis | FAERS: 13 | US FAERS | |
| 504 | Retinal Vein Occlusion | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 505 | Vitamin D Deficiency | FAERS: 13 | US FAERS | |
| 506 | Vulvitis | FAERS: 13 | US FAERS | |
| 507 | Adnexa uteri cyst | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 508 | Blood human chorionic gonadotropin increased | FAERS: 12 | OFFSIDES US FAERS | |
| 509 | Bruxism | FAERS: 12 | US FAERS | |
| 510 | Contact lens intolerance | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 511 | Dysplasia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 512 | Enterococcal infection | FAERS: 12 | US FAERS | |
| 513 | Facial paralysis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 514 | Genital injury | FAERS: 12 | US FAERS | |
| 515 | Incorrect dose administered | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 516 | Limb injury | FAERS: 12 | US FAERS | |
| 517 | Obesity | FAERS: 12 | US FAERS | |
| 518 | Otosclerosis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 519 | Phonophobia | FAERS: 12 | US FAERS | |
| 520 | Polyarthritis | FAERS: 12 | US FAERS | |
| 521 | Precancerous cells present | FAERS: 12 | US FAERS | |
| 522 | Regurgitation | FAERS: 12 | US FAERS | |
| 523 | Suspected counterfeit product | FAERS: 12 | US FAERS | |
| 524 | Abdominal mass | FAERS: 11 | US FAERS | |
| 525 | Anembryonic gestation | FAERS: 11 | US FAERS | |
| 526 | Bacteria cervical specimen identified | FAERS: 11 | OFFSIDES US FAERS | |
| 527 | Bacterial vulvovaginitis | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 528 | Blood glucose fluctuation | FAERS: 11 | US FAERS | |
| 529 | Breast cancer stage III | FAERS: 11 | OFFSIDES US FAERS | |
| 530 | Breast hyperplasia | FAERS: 11 | US FAERS | |
| 531 | Coronary Artery Disease | FAERS: 11 | US FAERS | |
| 532 | Depressed Level of Consciousness | FAERS: 11 | US FAERS | |
| 533 | Drug exposure via breast milk | FAERS: 11 | US FAERS | |
| 534 | Ectopic pregnancy under hormonal contraception | FAERS: 11 | US FAERS | |
| 535 | Escherichia infection | FAERS: 11 | US FAERS | |
| 536 | Food aversion | FAERS: 11 | OFFSIDES US FAERS | |
| 537 | Gastric ulcer | FAERS: 11 | US FAERS | |
| 538 | Glaucoma | FAERS: 11 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 539 | Hepatitis | FAERS: 11 | US FAERS | |
| 540 | Hysteroscopy | FAERS: 11 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 541 | Imminent abortion | FAERS: 11 | OFFSIDES US FAERS | |
| 542 | Incontinence | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 543 | Incorrect product storage | FAERS: 11 | US FAERS | |
| 544 | Keratitis | FAERS: 11 | US FAERS | |
| 545 | Leukocytoclastic vasculitis | FAERS: 11 | US FAERS | |
| 546 | Medical device removal | FAERS: 11 Canada Vigilance: 18 | Canada Vigilance US FAERS | |
| 547 | Mental status changes | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 548 | Muscle strain | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 549 | Oligohydramnios | FAERS: 11 | US FAERS | |
| 550 | Partner stress | FAERS: 11 | US FAERS | |
| 551 | Pneumothorax | FAERS: 11 | US FAERS | |
| 552 | Post abortion complication | FAERS: 11 Canada Vigilance: 6 | Canada Vigilance OFFSIDES US FAERS | |
| 553 | Product physical issue | FAERS: 11 | US FAERS | |
| 554 | Protein urine present | FAERS: 11 | SIDER US FAERS | |
| 555 | Renal cyst | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 556 | Restless Legs Syndrome | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 557 | Thyroiditis | FAERS: 11 | US FAERS | |
| 558 | Tongue biting | FAERS: 11 | US FAERS | |
| 559 | Vaginal lesion | FAERS: 11 | OFFSIDES US FAERS | |
| 560 | Vulvovaginitis | FAERS: 11 | SIDER US FAERS | |
| 561 | Wrong technique in drug usage process | FAERS: 11 | US FAERS | |
| 562 | treatment failure | FAERS: 11 | OFFSIDES US FAERS | |
| 563 | Amniotic fluid volume decreased | FAERS: 10 | US FAERS | |
| 564 | Bipolar I disorder | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 565 | Blood creatinine increased | FAERS: 10 | US FAERS | |
| 566 | Breast Feeding | FAERS: 10 | US FAERS | |
| 567 | Calcinosis | FAERS: 10 | US FAERS | |
| 568 | Diverticulitis | FAERS: 10 | US FAERS | |
| 569 | Gastric Dilatation | FAERS: 10 | US FAERS | |
| 570 | Gastroenteritis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 571 | Hepatomegaly | FAERS: 10 | US FAERS | |
| 572 | Increased tendency to bruise | FAERS: 10 | US FAERS | |
| 573 | Lower respiratory tract infection | FAERS: 10 | US FAERS | |
| 574 | Maternal exposure during breast feeding | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 575 | Pelvic mass | FAERS: 10 | OFFSIDES US FAERS | |
| 576 | Pericarditis | FAERS: 10 | US FAERS | |
| 577 | Perineal pain | FAERS: 10 | SIDER US FAERS | |
| 578 | Polymenorrhagia | FAERS: 10 | OFFSIDES US FAERS | |
| 579 | Post procedural pain | FAERS: 10 | OFFSIDES US FAERS | |
| 580 | Premenstrual Dysphoric Disorder | FAERS: 10 | US FAERS | |
| 581 | Premenstrual cramps | FAERS: 10 | US FAERS | |
| 582 | Skin reaction | FAERS: 10 | US FAERS | |
| 583 | Strabismus | FAERS: 10 | US FAERS | |
| 584 | Tubal rupture | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 585 | Vaginal Perforation | FAERS: 10 | OFFSIDES US FAERS | |
| 586 | Abdominal symptom | FAERS: 9 | US FAERS | |
| 587 | Adenocarcinoma | FAERS: 9 | OFFSIDES US FAERS | |
| 588 | Allergy to chemicals | FAERS: 9 | US FAERS | |
| 589 | Autoimmune hepatitis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 590 | Bacterial culture positive | FAERS: 9 | OFFSIDES US FAERS | |
| 591 | Bradyphrenia | FAERS: 9 | US FAERS | |
| 592 | Cardiac Arrest | FAERS: 9 | US FAERS | |
| 593 | Cardiac discomfort | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 594 | Cervix erythema | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 595 | Choking sensation | FAERS: 9 | US FAERS | |
| 596 | Chorioamnionitis | FAERS: 9 | OFFSIDES US FAERS | |
| 597 | Completed Suicide | FAERS: 9 | US FAERS | |
| 598 | Contraindicated product administered | FAERS: 9 | US FAERS | |
| 599 | Dermoid Cyst | FAERS: 9 | US FAERS | |
| 600 | Device migration | FAERS: 9 | OFFSIDES US FAERS | |
| 601 | Disseminated Intravascular Coagulation | FAERS: 9 | US FAERS | |
| 602 | Facial Pain | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 603 | Genital burning sensation | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 604 | Genital infection | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 605 | Genito-pelvic pain/penetration disorder | FAERS: 9 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 606 | Hepatitis C | FAERS: 9 | US FAERS | |
| 607 | Insulin Resistance | FAERS: 9 | OFFSIDES US FAERS | |
| 608 | Invasive Lobular Breast Carcinoma | FAERS: 9 | US FAERS | |
| 609 | Joint Range of Motion Decreased | FAERS: 9 | US FAERS | |
| 610 | Laceration | FAERS: 9 | US FAERS | |
| 611 | Leukopenia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 612 | Menstrual discomfort | FAERS: 9 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 613 | Monoplegia | FAERS: 9 | US FAERS | |
| 614 | Ovarian Rupture | FAERS: 9 | US FAERS | |
| 615 | Progesterone increased | FAERS: 9 | OFFSIDES US FAERS | |
| 616 | Sarcoidosis | FAERS: 9 | US FAERS | |
| 617 | Scleroderma | FAERS: 9 | US FAERS | |
| 618 | Sluggishness | FAERS: 9 | US FAERS | |
| 619 | Wound Infection | FAERS: 9 | US FAERS | |
| 620 | Abdominal Abscess | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 621 | Altered state of consciousness | FAERS: 8 | US FAERS | |
| 622 | Blood alkaline phosphatase increased | FAERS: 8 | US FAERS | |
| 623 | Breast Microcalcification | FAERS: 8 | OFFSIDES US FAERS | |
| 624 | Chlamydial cervicitis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 625 | Cholecystitis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 626 | Cyanosis | FAERS: 8 | US FAERS | |
| 627 | Dermatitis acneiform | FAERS: 8 | US FAERS | |
| 628 | Device kink | FAERS: 8 | US FAERS | |
| 629 | Drug effective for unapproved indication | FAERS: 8 | US FAERS | |
| 630 | Escherichia urinary tract infection | FAERS: 8 | US FAERS | |
| 631 | Feeding disorder neonatal | FAERS: 8 | US FAERS | |
| 632 | Gingivitis | FAERS: 8 | US FAERS | |
| 633 | Growth retardation | FAERS: 8 | US FAERS | |
| 634 | Hernia | FAERS: 8 | US FAERS | |
| 635 | Iatrogenic injury | FAERS: 8 | US FAERS | |
| 636 | Immune thrombocytopenic purpura | FAERS: 8 | US FAERS | |
| 637 | Incision site pain | FAERS: 8 | US FAERS | |
| 638 | Intentional drug misuse | FAERS: 8 | US FAERS | |
| 639 | Leukocytosis | FAERS: 8 | US FAERS | |
| 640 | Multiple allergies | FAERS: 8 | US FAERS | |
| 641 | Necrosis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 642 | Ovarian adenoma | FAERS: 8 | OFFSIDES US FAERS | |
| 643 | Procedural hypotension | FAERS: 8 | US FAERS | |
| 644 | Respiratory arrest | FAERS: 8 | US FAERS | |
| 645 | Sinus headache | FAERS: 8 | US FAERS | |
| 646 | Sneezing | FAERS: 8 | US FAERS | |
| 647 | Streptococcus test positive | FAERS: 8 | US FAERS | |
| 648 | Uterine contractions during pregnancy | FAERS: 8 | US FAERS | |
| 649 | VIIth nerve paralysis | FAERS: 8 | US FAERS | |
| 650 | Vulvovaginal rash | FAERS: 8 | US FAERS | |
| 651 | Acute kidney injury | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 652 | Antiphospholipid Syndrome | FAERS: 7 | US FAERS | |
| 653 | Autonomic nervous system imbalance | FAERS: 7 | US FAERS | |
| 654 | Bladder spasm | FAERS: 7 | US FAERS | |
| 655 | Blood count abnormal | FAERS: 7 | US FAERS | |
| 656 | Blood pressure inadequately controlled | FAERS: 7 | US FAERS | |
| 657 | Carcinoma in Situ | FAERS: 7 | US FAERS | |
| 658 | Cataract | FAERS: 7 | US FAERS | |
| 659 | Chlamydial pelvic inflammatory disease | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 660 | Clumsiness | FAERS: 7 | US FAERS | |
| 661 | Complication of delivery | FAERS: 7 | US FAERS | |
| 662 | Demyelination | FAERS: 7 | US FAERS | |
| 663 | Dyschezia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 664 | Educational problem | FAERS: 7 | US FAERS | |
| 665 | Exposure via breast milk | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 666 | Fallopian tube obstruction | FAERS: 7 | OFFSIDES US FAERS | |
| 667 | False negative pregnancy test | FAERS: 7 | OFFSIDES US FAERS | |
| 668 | Hepatotoxicity | FAERS: 7 | US FAERS | |
| 669 | Hyperemesis Gravidarum | FAERS: 7 | OFFSIDES US FAERS | |
| 670 | Infectious peritonitis | FAERS: 7 | US FAERS | |
| 671 | Insulin-like growth factor increased | FAERS: 7 | OFFSIDES US FAERS | |
| 672 | Keratoconjunctivitis Sicca | FAERS: 7 | US FAERS | |
| 673 | Localised intraabdominal fluid collection | FAERS: 7 | US FAERS | |
| 674 | Medical device site calcification | FAERS: 7 | US FAERS | |
| 675 | Medical procedure | FAERS: 7 | US FAERS | |
| 676 | Migration of implanted drug | FAERS: 7 | US FAERS | |
| 677 | Nuchal Rigidity | FAERS: 7 | OFFSIDES US FAERS | |
| 678 | Oropharyngeal discomfort | FAERS: 7 | US FAERS | |
| 679 | Ovarian vein thrombosis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 680 | Performance status decreased | FAERS: 7 | US FAERS | |
| 681 | Physical disability | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 682 | Polyuria | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 683 | Product monitoring error | FAERS: 7 | US FAERS | |
| 684 | Product prescribing error | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 685 | Retinal Artery Occlusion | FAERS: 7 | US FAERS | |
| 686 | Retinal Detachment | FAERS: 7 | US FAERS | |
| 687 | Reversible cerebral vasoconstriction syndrome | FAERS: 7 | US FAERS | |
| 688 | Salpingo-oophorectomy | FAERS: 7 | US FAERS | |
| 689 | Thrombotic stroke | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 690 | Tooth Extraction | FAERS: 7 | US FAERS | |
| 691 | Trismus | FAERS: 7 | US FAERS | |
| 692 | Tumour haemorrhage | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 693 | Urine human chorionic gonadotropin increased | FAERS: 7 | OFFSIDES US FAERS | |
| 694 | Wheezing | FAERS: 7 | US FAERS | |
| 695 | Abortion early | FAERS: 6 | US FAERS | |
| 696 | Acromegaly | FAERS: 6 | OFFSIDES US FAERS | |
| 697 | Allergic sinusitis | FAERS: 6 | OFFSIDES US FAERS | |
| 698 | Amblyopia | FAERS: 6 | OFFSIDES US FAERS | |
| 699 | Anogenital dysplasia | FAERS: 6 | US FAERS | |
| 700 | Astrocytoma | FAERS: 6 | OFFSIDES US FAERS | |
| 701 | Aura | FAERS: 6 | US FAERS | |
| 702 | Bacterial sepsis | FAERS: 6 | US FAERS | |
| 703 | Bartholinitis | FAERS: 6 | US FAERS | |
| 704 | Blood follicle stimulating hormone abnormal | FAERS: 6 | US FAERS | |
| 705 | Blood glucose abnormal | FAERS: 6 | OFFSIDES US FAERS | |
| 706 | Blood homocysteine increased | FAERS: 6 | US FAERS | |
| 707 | Blood potassium increased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 708 | Cerebral disorder | FAERS: 6 | US FAERS | |
| 709 | Cervicitis human papilloma virus | FAERS: 6 | OFFSIDES US FAERS | |
| 710 | Choking | FAERS: 6 | US FAERS | |
| 711 | Dark circles under eyes | FAERS: 6 | US FAERS | |
| 712 | Dissociation | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 713 | Drug diversion | FAERS: 6 | US FAERS | |
| 714 | Embolism | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 715 | Female sexual dysfunction | FAERS: 6 | US FAERS | |
| 716 | Foreign body trauma | FAERS: 6 | OFFSIDES US FAERS | |
| 717 | Gallbladder pain | FAERS: 6 | US FAERS | |
| 718 | Gastric Bypass | FAERS: 6 | US FAERS | |
| 719 | Genital swelling | FAERS: 6 | US FAERS | |
| 720 | Grief reaction | FAERS: 6 | US FAERS | |
| 721 | Hydrocephalus | FAERS: 6 | US FAERS | |
| 722 | Hypophagia | FAERS: 6 | US FAERS | |
| 723 | Ileus | FAERS: 6 | US FAERS | |
| 724 | Inappropriate schedule of product administration | FAERS: 6 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 725 | Intentional self-injury | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 726 | Iritis | FAERS: 6 | OFFSIDES US FAERS | |
| 727 | Labyrinthitis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 728 | Lupus-like syndrome | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 729 | Lymphoma | FAERS: 6 | US FAERS | |
| 730 | Medication monitoring error | FAERS: 6 | US FAERS | |
| 731 | Metamorphopsia | FAERS: 6 | US FAERS | |
| 732 | Myocarditis | FAERS: 6 | US FAERS | |
| 733 | Narcolepsy | FAERS: 6 | US FAERS | |
| 734 | Neonatal disorder | FAERS: 6 | US FAERS | |
| 735 | Obsessive thoughts | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 736 | Obsessive-Compulsive Disorder | FAERS: 6 | 8601550 9847494 | CTD US FAERS |
| 737 | Oral pain | FAERS: 6 | US FAERS | |
| 738 | Osteopenia | FAERS: 6 | US FAERS | |
| 739 | Ovarian failure | FAERS: 6 | US FAERS | |
| 740 | Overdose | FAERS: 6 | US FAERS | |
| 741 | Pelvic cyst | FAERS: 6 | US FAERS | |
| 742 | Penile Infection | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 743 | Phobia of driving | FAERS: 6 | US FAERS | |
| 744 | Post procedural pulmonary embolism | FAERS: 6 | OFFSIDES US FAERS | |
| 745 | Post procedural swelling | FAERS: 6 | US FAERS | |
| 746 | Product label issue | FAERS: 6 | US FAERS | |
| 747 | Prolactinoma | FAERS: 6 | OFFSIDES US FAERS | |
| 748 | Renal Colic | FAERS: 6 | US FAERS | |
| 749 | Respiratory Failure | FAERS: 6 | US FAERS | |
| 750 | Respiratory tract congestion | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 751 | Scotoma | FAERS: 6 | US FAERS | |
| 752 | Sinus Tachycardia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 753 | Tachyphrenia | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 754 | Thalamic infarction | FAERS: 6 | US FAERS | |
| 755 | Therapeutic product ineffective | FAERS: 6 | US FAERS | |
| 756 | Torticollis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 757 | Ultrasound pelvis abnormal | FAERS: 6 | US FAERS | |
| 758 | Unresponsive to stimuli | FAERS: 6 | US FAERS | |
| 759 | Uterine Inversion | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 760 | Uterine necrosis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 761 | Viral upper respiratory tract infection | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 762 | Waist circumference increased | FAERS: 6 | US FAERS | |
| 763 | Wrong drug administered | FAERS: 6 | US FAERS | |
| 764 | Adjustment disorder with depressed mood | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 765 | Amnestic Disorder | FAERS: 5 | US FAERS | |
| 766 | Ankylosing spondylitis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 767 | Aphonia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 768 | Application site pain | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 769 | Benign Neoplasm | FAERS: 5 | US FAERS | |
| 770 | Blood amylase increased | FAERS: 5 | US FAERS | |
| 771 | Blood iron increased | FAERS: 5 | US FAERS | |
| 772 | Blood lactate dehydrogenase increased | FAERS: 5 | US FAERS | |
| 773 | Blood testosterone decreased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 774 | Cerebellar infarction | FAERS: 5 | US FAERS | |
| 775 | Cervical friability | FAERS: 5 | US FAERS | |
| 776 | Circumstance or information capable of leading to device use error | FAERS: 5 | US FAERS | |
| 777 | Cleft Palate | FAERS: 5 | US FAERS | |
| 778 | Cluster Headache | FAERS: 5 | US FAERS | |
| 779 | Colposcopy abnormal | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 780 | Congenital cystic kidney disease | FAERS: 5 | US FAERS | |
| 781 | Counterfeit drug administered | FAERS: 5 | US FAERS | |
| 782 | Deafness Neurosensory | FAERS: 5 | US FAERS | |
| 783 | Drug dispensing error | FAERS: 5 | US FAERS | |
| 784 | Drug screen positive | FAERS: 5 | US FAERS | |
| 785 | Drug withdrawal syndrome | FAERS: 5 | US FAERS | |
| 786 | Ectropion of cervix | FAERS: 5 | US FAERS | |
| 787 | Enterocolitis | FAERS: 5 | US FAERS | |
| 788 | Erythema Infectiosum | FAERS: 5 | US FAERS | |
| 789 | Eye Infection | FAERS: 5 | US FAERS | |
| 790 | Fallopian tube enlargement | FAERS: 5 | US FAERS | |
| 791 | Feelings of worthlessness | FAERS: 5 | US FAERS | |
| 792 | Female Orgasmic Disorder | FAERS: 5 | US FAERS | |
| 793 | Folliculitis | FAERS: 5 | SIDER US FAERS | |
| 794 | Food Poisoning | FAERS: 5 | US FAERS | |
| 795 | Genital erythema | FAERS: 5 | US FAERS | |
| 796 | Genitourinary chlamydia infection | FAERS: 5 | OFFSIDES US FAERS | |
| 797 | Gestational trophoblastic detachment | FAERS: 5 | US FAERS | |
| 798 | Gluten sensitivity | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 799 | Grip strength decreased | FAERS: 5 | US FAERS | |
| 800 | Haemoconcentration | FAERS: 5 | US FAERS | |
| 801 | Hemicephalalgia | FAERS: 5 | US FAERS | |
| 802 | Hepatosplenomegaly | FAERS: 5 | US FAERS | |
| 803 | Hostility | FAERS: 5 | US FAERS | |
| 804 | Human chorionic gonadotropin increased | FAERS: 5 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 805 | Hyperchlorhydria | FAERS: 5 | US FAERS | |
| 806 | Hyperplasia | FAERS: 5 | US FAERS | |
| 807 | Hyporeflexia | FAERS: 5 | US FAERS | |
| 808 | Hypothalamo-pituitary disorder | FAERS: 5 | US FAERS | |
| 809 | Impaired quality of life | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 810 | Inadequate aseptic technique in use of product | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 811 | Increased upper airway secretion | FAERS: 5 | US FAERS | |
| 812 | Infarction | FAERS: 5 | US FAERS | |
| 813 | Infectious Mononucleosis | FAERS: 5 | US FAERS | |
| 814 | Intervertebral disc disorder | FAERS: 5 | US FAERS | |
| 815 | Intracranial Aneurysm | FAERS: 5 | US FAERS | |
| 816 | Lyme Disease | FAERS: 5 | US FAERS | |
| 817 | Lymphadenitis | FAERS: 5 | US FAERS | |
| 818 | Meningitis | FAERS: 5 | US FAERS | |
| 819 | Muscle Fatigue | FAERS: 5 | US FAERS | |
| 820 | Myositis | FAERS: 5 | US FAERS | |
| 821 | Nasal discomfort | FAERS: 5 | US FAERS | |
| 822 | Neurodermatitis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 823 | Nuclear magnetic resonance imaging brain | FAERS: 5 | US FAERS | |
| 824 | Osteoporosis | FAERS: 5 Canada Vigilance: 2 | 12665316 | CTD Canada Vigilance US FAERS |
| 825 | Ovarian Infection | FAERS: 5 | OFFSIDES US FAERS | |
| 826 | Ovarian adhesion | FAERS: 5 | OFFSIDES US FAERS | |
| 827 | Ovarian cyst torsion | FAERS: 5 | OFFSIDES US FAERS | |
| 828 | Ovulation disorder | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 829 | Papule | FAERS: 5 | US FAERS | |
| 830 | Penile erythema | FAERS: 5 | US FAERS | |
| 831 | Penile swelling | FAERS: 5 | US FAERS | |
| 832 | Pericardial effusion | FAERS: 5 | US FAERS | |
| 833 | Pharyngolaryngeal Pain | FAERS: 5 | US FAERS | |
| 834 | Pleurisy | FAERS: 5 | US FAERS | |
| 835 | Pneumonitis | FAERS: 5 | US FAERS | |
| 836 | Poisoning | FAERS: 5 | US FAERS | |
| 837 | Poor peripheral circulation | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 838 | Premature ovulation | FAERS: 5 | US FAERS | |
| 839 | Product packaging issue | FAERS: 5 | US FAERS | |
| 840 | Product use complaint | FAERS: 5 | US FAERS | |
| 841 | Productive Cough | FAERS: 5 | US FAERS | |
| 842 | Renal fusion anomaly | FAERS: 5 | OFFSIDES US FAERS | |
| 843 | Respiratory distress | FAERS: 5 | US FAERS | |
| 844 | Retinal infarction | FAERS: 5 | OFFSIDES US FAERS | |
| 845 | Rhinitis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 846 | Sarcoma | FAERS: 5 | US FAERS | |
| 847 | Seizure like phenomena | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 848 | Seroma | FAERS: 5 | US FAERS | |
| 849 | Skin Ulcer | FAERS: 5 | US FAERS | |
| 850 | Somatic symptom disorder of pregnancy | FAERS: 5 | US FAERS | |
| 851 | Somatoform disorder pregnancy | FAERS: 5 | US FAERS | |
| 852 | Spina Bifida | FAERS: 5 | US FAERS | |
| 853 | Supraventricular tachycardia | FAERS: 5 | US FAERS | |
| 854 | Talipes | FAERS: 5 | US FAERS | |
| 855 | Teeth brittle | FAERS: 5 | US FAERS | |
| 856 | Therapeutic response changed | FAERS: 5 | US FAERS | |
| 857 | Therapy non-responder | FAERS: 5 | US FAERS | |
| 858 | Thyroidectomy | FAERS: 5 | US FAERS | |
| 859 | Tonsillitis | FAERS: 5 | US FAERS | |
| 860 | Tooth Loss | FAERS: 5 | US FAERS | |
| 861 | Toxicity to various agents | FAERS: 5 | US FAERS | |
| 862 | Trigeminal Neuralgia | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 863 | Urinary Tract Pain | FAERS: 5 | US FAERS | |
| 864 | Uterine abscess | FAERS: 5 | OFFSIDES US FAERS | |
| 865 | Vaginal erosion | FAERS: 5 | US FAERS | |
| 866 | Vaginal pH abnormal | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 867 | Vitiligo | FAERS: 5 | US FAERS | |
| 868 | Vulvovaginal injury | FAERS: 5 | US FAERS | |
| 869 | White blood cell count decreased | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 870 | Wound dehiscence | FAERS: 5 | US FAERS | |
| 871 | Alopecia universalis | FAERS: 4 | US FAERS | |
| 872 | Anal Fissure | FAERS: 4 | US FAERS | |
| 873 | Anaphylactoid Reaction | FAERS: 4 | US FAERS | |
| 874 | Antinuclear antibody increased | FAERS: 4 | US FAERS | |
| 875 | Apparent death | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 876 | Arteriovenous fistula | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 877 | Asphyxia | FAERS: 4 | US FAERS | |
| 878 | Ataxia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 879 | Auricular swelling | FAERS: 4 | US FAERS | |
| 880 | Bed rest | FAERS: 4 | US FAERS | |
| 881 | Biopsy cervix abnormal | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 882 | Bladder dysfunction | FAERS: 4 | US FAERS | |
| 883 | Blood human chorionic gonadotropin positive | FAERS: 4 | OFFSIDES US FAERS | |
| 884 | Blood pressure immeasurable | FAERS: 4 | US FAERS | |
| 885 | Blood thyroid stimulating hormone increased | FAERS: 4 | US FAERS | |
| 886 | Borderline Personality Disorder | FAERS: 4 | US FAERS | |
| 887 | Bulimia Nervosa | FAERS: 4 | US FAERS | |
| 888 | Cavernous Sinus Thrombosis | FAERS: 4 | US FAERS | |
| 889 | Chronic Fatigue Syndrome | FAERS: 4 | US FAERS | |
| 890 | Chronic sinusitis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 891 | Circumstance or information capable of leading to medication error | FAERS: 4 | OFFSIDES US FAERS | |
| 892 | Conjunctivitis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 893 | Cytolytic hepatitis | FAERS: 4 | US FAERS | |
| 894 | Dental caries | FAERS: 4 | US FAERS | |
| 895 | Dermoid cyst of ovary | FAERS: 4 | OFFSIDES US FAERS | |
| 896 | Device extrusion | FAERS: 4 | US FAERS | |
| 897 | Device material issue | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 898 | Diabetes mellitus inadequate control | FAERS: 4 | US FAERS | |
| 899 | Dysgraphia | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 900 | Dysphemia | FAERS: 4 | US FAERS | |
| 901 | Electrocardiogram abnormal | FAERS: 4 | US FAERS | |
| 902 | Embolic stroke | FAERS: 4 | US FAERS | |
| 903 | Enuresis | FAERS: 4 | US FAERS | |
| 904 | Epigastric discomfort | FAERS: 4 | US FAERS | |
| 905 | Epileptic aura | FAERS: 4 | US FAERS | |
| 906 | Episcleritis | FAERS: 4 | OFFSIDES US FAERS | |
| 907 | Erysipelas | FAERS: 4 | US FAERS | |
| 908 | Euphoric mood | FAERS: 4 | US FAERS | |
| 909 | Facial Neuralgia | FAERS: 4 | US FAERS | |
| 910 | Female sexual arousal disorder | FAERS: 4 | US FAERS | |
| 911 | Foaming at mouth | FAERS: 4 | US FAERS | |
| 912 | Gastric infection | FAERS: 4 | US FAERS | |
| 913 | Gastrointestinal carcinoma | FAERS: 4 | US FAERS | |
| 914 | Gastrointestinal inflammation | FAERS: 4 | US FAERS | |
| 915 | General symptom | FAERS: 4 | US FAERS | |
| 916 | Genitourinary tract infection | FAERS: 4 | OFFSIDES US FAERS | |
| 917 | Granuloma | FAERS: 4 | US FAERS | |
| 918 | HER-2 positive breast cancer | FAERS: 4 | US FAERS | |
| 919 | Illness anxiety disorder | FAERS: 4 | US FAERS | |
| 920 | Impaired reasoning | FAERS: 4 | US FAERS | |
| 921 | Impaired self-care | FAERS: 4 | US FAERS | |
| 922 | Implant site infection | FAERS: 4 | US FAERS | |
| 923 | Implant site reaction | FAERS: 4 | US FAERS | |
| 924 | Inappropriate affect | FAERS: 4 | US FAERS | |
| 925 | Incoherent | FAERS: 4 | US FAERS | |
| 926 | Infected cyst | FAERS: 4 | US FAERS | |
| 927 | Infrequent bowel movements | FAERS: 4 | US FAERS | |
| 928 | Intraductal papilloma of breast | FAERS: 4 | US FAERS | |
| 929 | Iron deficiency | FAERS: 4 | US FAERS | |
| 930 | Joint sprain | FAERS: 4 | US FAERS | |
| 931 | Lactose Intolerance | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 932 | Laparoscopy | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 933 | Laparotomy | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 934 | Ligament rupture | FAERS: 4 | US FAERS | |
| 935 | Limb operation | FAERS: 4 | OFFSIDES US FAERS | |
| 936 | Lipase increased | FAERS: 4 | US FAERS | |
| 937 | Lipoma | FAERS: 4 | US FAERS | |
| 938 | Mechanical ventilation | FAERS: 4 | US FAERS | |
| 939 | Morbid thoughts | FAERS: 4 | US FAERS | |
| 940 | Myopia | FAERS: 4 | US FAERS | |
| 941 | Negativism | FAERS: 4 | US FAERS | |
| 942 | Neonatal aspiration | FAERS: 4 | US FAERS | |
| 943 | Nocturia | FAERS: 4 | US FAERS | |
| 944 | Onychomycosis | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 945 | Optic Neuropathy | FAERS: 4 | US FAERS | |
| 946 | Peritoneal lesion | FAERS: 4 | OFFSIDES US FAERS | |
| 947 | Peritoneal perforation | FAERS: 4 | US FAERS | |
| 948 | Peritonsillar Abscess | FAERS: 4 | US FAERS | |
| 949 | Placental Insufficiency | FAERS: 4 | US FAERS | |
| 950 | Polyhydramnios | FAERS: 4 | US FAERS | |
| 951 | Poor weight gain neonatal | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 952 | Portal Vein Thrombosis | FAERS: 4 | US FAERS | |
| 953 | Post procedural fever | FAERS: 4 | US FAERS | |
| 954 | Post procedural sepsis | FAERS: 4 | US FAERS | |
| 955 | Postoperative adhesion | FAERS: 4 | OFFSIDES US FAERS | |
| 956 | Premenstrual pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 957 | Product complaint | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 958 | Pubic pain | FAERS: 4 | US FAERS | |
| 959 | Pulmonary Infarction | FAERS: 4 | US FAERS | |
| 960 | Purpura | FAERS: 4 | 10875858 | CTD SIDER US FAERS |
| 961 | Purulence | FAERS: 4 | US FAERS | |
| 962 | Pyelocaliectasis | FAERS: 4 | US FAERS | |
| 963 | Schizophrenia | FAERS: 4 | US FAERS | |
| 964 | Scleritis | FAERS: 4 | US FAERS | |
| 965 | Sense of oppression | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 966 | Single umbilical artery | FAERS: 4 | US FAERS | |
| 967 | Splenic Infarction | FAERS: 4 | US FAERS | |
| 968 | Squamous cell carcinoma | FAERS: 4 | US FAERS | |
| 969 | Staring | FAERS: 4 | OFFSIDES US FAERS | |
| 970 | Stomatitis | FAERS: 4 | US FAERS | |
| 971 | Systemic Inflammatory Response Syndrome | FAERS: 4 | US FAERS | |
| 972 | Tendon discomfort | FAERS: 4 | US FAERS | |
| 973 | Thoracic Outlet Syndrome | FAERS: 4 | US FAERS | |
| 974 | Umbilical cord vascular disorder | FAERS: 4 | US FAERS | |
| 975 | Vaginal obstruction | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 976 | Vascular occlusion | FAERS: 4 | US FAERS | |
| 977 | Ventricular Fibrillation | FAERS: 4 | US FAERS | |
| 978 | Weight decrease neonatal | FAERS: 4 | US FAERS | |
| 979 | Yawning | FAERS: 4 | US FAERS | |
| 980 | colonoscopy | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 981 | leiomyosarcoma | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 982 | Abortion late | FAERS: 3 | US FAERS | |
| 983 | Accidental drug intake by child | FAERS: 3 | US FAERS | |
| 984 | Accidental overdose | FAERS: 3 | US FAERS | |
| 985 | Acute psychosis | FAERS: 3 | US FAERS | |
| 986 | Agranulocytosis | FAERS: 3 | US FAERS | |
| 987 | Anencephaly | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 988 | Aneurysm | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 989 | Ankle Fracture | FAERS: 3 | US FAERS | |
| 990 | Apparent life threatening event | FAERS: 3 | US FAERS | |
| 991 | Arterial thrombosis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 992 | Astigmatism | FAERS: 3 | US FAERS | |
| 993 | Autophobia | FAERS: 3 | US FAERS | |
| 994 | Biliary Colic | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 995 | Biochemical pregnancy | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 996 | Biopsy | FAERS: 3 | US FAERS | |
| 997 | Blepharitis | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 998 | Blood bilirubin unconjugated increased | FAERS: 3 | US FAERS | |
| 999 | Blood cortisol increased | FAERS: 3 | US FAERS | |
| 1000 | Blood follicle stimulating hormone decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 1001 | Blood gonadotrophin decreased | FAERS: 3 | US FAERS | |
| 1002 | Blood human chorionic gonadotropin abnormal | FAERS: 3 | US FAERS | |
| 1003 | Blood immunoglobulin E increased | FAERS: 3 | US FAERS | |
| 1004 | Blood magnesium decreased | FAERS: 3 | US FAERS | |
| 1005 | Blood thyroid stimulating hormone abnormal | FAERS: 3 | US FAERS | |
| 1006 | Blood thyroid stimulating hormone decreased | FAERS: 3 | US FAERS | |
| 1007 | Blood triglycerides increased | FAERS: 3 | US FAERS | |
| 1008 | Blood urea increased | FAERS: 3 | US FAERS | |
| 1009 | Bone density decreased | FAERS: 3 | US FAERS | |
| 1010 | Bursitis | FAERS: 3 | US FAERS | |
| 1011 | Candida sepsis | FAERS: 3 | OFFSIDES US FAERS | |
| 1012 | Cardiomegaly | FAERS: 3 | US FAERS | |
| 1013 | Carotid artery occlusion | FAERS: 3 | US FAERS | |
| 1014 | Cerebral cyst | FAERS: 3 | US FAERS | |
| 1015 | Cerebrospinal fluid retention | FAERS: 3 | US FAERS | |
| 1016 | Cervicobrachial syndrome | FAERS: 3 | US FAERS | |
| 1017 | Chlamydia identification test positive | FAERS: 3 | US FAERS | |
| 1018 | Coronary artery insufficiency | FAERS: 3 | OFFSIDES US FAERS | |
| 1019 | Culture positive | FAERS: 3 | US FAERS | |
| 1020 | Decreased immune responsiveness | FAERS: 3 | US FAERS | |
| 1021 | Dehydroepiandrosterone decreased | FAERS: 3 | US FAERS | |
| 1022 | Device monitoring procedure not performed | FAERS: 3 | US FAERS | |
| 1023 | Diet refusal | FAERS: 3 | US FAERS | |
| 1024 | Diplegia | FAERS: 3 | US FAERS | |
| 1025 | Disturbance in sexual arousal | FAERS: 3 | SIDER US FAERS | |
| 1026 | Drooling | FAERS: 3 | US FAERS | |
| 1027 | Drug administered to patient of inappropriate age | FAERS: 3 | US FAERS | |
| 1028 | Drug dose omission | FAERS: 3 | US FAERS | |
| 1029 | Drug toxicity | FAERS: 3 | US FAERS | |
| 1030 | Drug withdrawal headache | FAERS: 3 | US FAERS | |
| 1031 | Duodenal atresia | FAERS: 3 | US FAERS | |
| 1032 | Dyslexia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1033 | Dystrophic calcification | FAERS: 3 | US FAERS | |
| 1034 | Early satiety | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1035 | Electrocardiogram change | FAERS: 3 | US FAERS | |
| 1036 | Empty Sella Syndrome | FAERS: 3 | US FAERS | |
| 1037 | Encephalitis | FAERS: 3 | US FAERS | |
| 1038 | Endocarditis | FAERS: 3 | US FAERS | |
| 1039 | Endodontic procedure | FAERS: 3 | US FAERS | |
| 1040 | Endometrial dysplasia | FAERS: 3 | US FAERS | |
| 1041 | Enteritis | FAERS: 3 | US FAERS | |
| 1042 | Epicondylitis | FAERS: 3 | US FAERS | |
| 1043 | Escherichia test positive | FAERS: 3 | US FAERS | |
| 1044 | Exfoliative rash | FAERS: 3 | US FAERS | |
| 1045 | Exposure via contaminated device | FAERS: 3 | US FAERS | |
| 1046 | Extra dose administered | FAERS: 3 | US FAERS | |
| 1047 | Extremity necrosis | FAERS: 3 | US FAERS | |
| 1048 | Eye allergy | FAERS: 3 | US FAERS | |
| 1049 | Eye inflammation | FAERS: 3 | US FAERS | |
| 1050 | Facial asymmetry | FAERS: 3 | US FAERS | |
| 1051 | Fasciitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1052 | Febrile infection | FAERS: 3 | US FAERS | |
| 1053 | Fibromatosis | FAERS: 3 | US FAERS | |
| 1054 | Focal dyscognitive seizures | FAERS: 3 | US FAERS | |
| 1055 | Foreign body sensation in eyes | FAERS: 3 | US FAERS | |
| 1056 | Gangrene | FAERS: 3 | US FAERS | |
| 1057 | Gastrointestinal perforation | FAERS: 3 | US FAERS | |
| 1058 | Genital cyst | FAERS: 3 | US FAERS | |
| 1059 | Genital tract inflammation | FAERS: 3 | US FAERS | |
| 1060 | Granulomatous liver disease | FAERS: 3 | OFFSIDES US FAERS | |
| 1061 | Hemiparaesthesia | FAERS: 3 | US FAERS | |
| 1062 | Hemiplegic migraine | FAERS: 3 | US FAERS | |
| 1063 | Hepatic necrosis | FAERS: 3 | US FAERS | |
| 1064 | Hepatitis B | FAERS: 3 | US FAERS | |
| 1065 | Hepatitis C virus test positive | FAERS: 3 | US FAERS | |
| 1066 | Hidradenitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1067 | Hypocapnia | FAERS: 3 | US FAERS | |
| 1068 | Hypokinesia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1069 | Hypospadias | FAERS: 3 | US FAERS | |
| 1070 | Hypoventilation | FAERS: 3 | US FAERS | |
| 1071 | Immobile | FAERS: 3 | US FAERS | |
| 1072 | Immunosuppression | FAERS: 3 | US FAERS | |
| 1073 | Implant site erythema | FAERS: 3 | US FAERS | |
| 1074 | Implant site inflammation | FAERS: 3 | US FAERS | |
| 1075 | Implant site pain | FAERS: 3 | US FAERS | |
| 1076 | Implant site rash | FAERS: 3 | US FAERS | |
| 1077 | Inadequate lubrication | FAERS: 3 | US FAERS | |
| 1078 | Incision site complication | FAERS: 3 | US FAERS | |
| 1079 | Incorrect dose administered by device | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1080 | Intervertebral Disc Degeneration | FAERS: 3 | US FAERS | |
| 1081 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 1082 | Intestinal polypectomy | FAERS: 3 | US FAERS | |
| 1083 | Intra-abdominal fluid collection | FAERS: 3 | US FAERS | |
| 1084 | Lemierre Syndrome | FAERS: 3 | US FAERS | |
| 1085 | Ligament pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1086 | Lipodystrophy acquired | FAERS: 3 | US FAERS | |
| 1087 | Livedo Reticularis | FAERS: 3 | US FAERS | |
| 1088 | Malignant Hypertension | FAERS: 3 | US FAERS | |
| 1089 | Malignant ovarian cyst | FAERS: 3 | US FAERS | |
| 1090 | Mastectomy | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1091 | Mechanical complication of implant | FAERS: 3 | OFFSIDES US FAERS | |
| 1092 | Meningorrhagia | FAERS: 3 | OFFSIDES US FAERS | |
| 1093 | Mental Fatigue | FAERS: 3 | US FAERS | |
| 1094 | Microcephaly | FAERS: 3 | US FAERS | |
| 1095 | Migraine-triggered seizure | FAERS: 3 | US FAERS | |
| 1096 | Milk Allergy | FAERS: 3 | US FAERS | |
| 1097 | Mineral deficiency | FAERS: 3 | US FAERS | |
| 1098 | Monoparesis | FAERS: 3 | US FAERS | |
| 1099 | Mouth swelling | FAERS: 3 | US FAERS | |
| 1100 | Multi-organ disorder | FAERS: 3 | US FAERS | |
| 1101 | Myasthenia Gravis | FAERS: 3 | 7491061 | CTD US FAERS |
| 1102 | Myomectomy | FAERS: 3 | US FAERS | |
| 1103 | Nodule | FAERS: 3 | US FAERS | |
| 1104 | Noninfective oophoritis | FAERS: 3 | US FAERS | |
| 1105 | Oral infection | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1106 | Orgasmic sensation decreased | FAERS: 3 | US FAERS | |
| 1107 | Papillary serous endometrial carcinoma | FAERS: 3 | US FAERS | |
| 1108 | Paranasal sinus hypersecretion | FAERS: 3 | US FAERS | |
| 1109 | Paraplegia | FAERS: 3 | US FAERS | |
| 1110 | Paresis | FAERS: 3 | US FAERS | |
| 1111 | Patent ductus arteriosus | FAERS: 3 | US FAERS | |
| 1112 | Pelvic Floor Muscle Weakness | FAERS: 3 | US FAERS | |
| 1113 | Pelvic prolapse | FAERS: 3 | US FAERS | |
| 1114 | Periarthritis | FAERS: 3 | US FAERS | |
| 1115 | Petechiae | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1116 | Pilonidal Cyst | FAERS: 3 | US FAERS | |
| 1117 | Podagra | FAERS: 3 | US FAERS | |
| 1118 | Poor quality drug administered | FAERS: 3 | US FAERS | |
| 1119 | Post abortion infection | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1120 | Post lumbar puncture syndrome | FAERS: 3 | OFFSIDES US FAERS | |
| 1121 | Postoperative constipation | FAERS: 3 | US FAERS | |
| 1122 | Pregnancy of unknown location | FAERS: 3 | US FAERS | |
| 1123 | Premenstrual headache | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1124 | Procedural shock | FAERS: 3 | US FAERS | |
| 1125 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 1126 | Proteinuria | FAERS: 3 | US FAERS | |
| 1127 | Pyloric Stenosis | FAERS: 3 | US FAERS | |
| 1128 | Pyometra | FAERS: 3 | OFFSIDES US FAERS | |
| 1129 | Rheumatic disorder | FAERS: 3 | US FAERS | |
| 1130 | Ruptured cerebral aneurysm | FAERS: 3 | US FAERS | |
| 1131 | Scab | FAERS: 3 | US FAERS | |
| 1132 | Sexual relationship change | FAERS: 3 | US FAERS | |
| 1133 | Shortened cervix | FAERS: 3 | US FAERS | |
| 1134 | Skin hypertrophy | FAERS: 3 | US FAERS | |
| 1135 | Skin nodule | FAERS: 3 | US FAERS | |
| 1136 | Snoring | FAERS: 3 | US FAERS | |
| 1137 | Somatic symptom disorder | FAERS: 3 | US FAERS | |
| 1138 | Staphylococcus test positive | FAERS: 3 | US FAERS | |
| 1139 | Stargardt's disease | FAERS: 3 | OFFSIDES US FAERS | |
| 1140 | Streptococcal urinary tract infection | FAERS: 3 | US FAERS | |
| 1141 | Stress at work | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 1142 | Superficial vein prominence | FAERS: 3 | US FAERS | |
| 1143 | Superovulation | FAERS: 3 | US FAERS | |
| 1144 | Sweat gland infection | FAERS: 3 | OFFSIDES US FAERS | |
| 1145 | Tetany | FAERS: 3 | US FAERS | |
| 1146 | Therapeutic product ineffective for unapproved indication | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1147 | Tuberculosis | FAERS: 3 | US FAERS | |
| 1148 | Tubular breast carcinoma | FAERS: 3 | US FAERS | |
| 1149 | Ulnar Nerve Palsy | FAERS: 3 | US FAERS | |
| 1150 | Ultrasound uterus abnormal | FAERS: 3 | US FAERS | |
| 1151 | Umbilical hernia | FAERS: 3 | US FAERS | |
| 1152 | Urinary hesitation | FAERS: 3 | US FAERS | |
| 1153 | Uterine cervix atrophy | FAERS: 3 | US FAERS | |
| 1154 | Vaginal abscess | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1155 | Vertebral Artery Dissection | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1156 | Violence-related symptom | FAERS: 3 | US FAERS | |
| 1157 | Vital functions abnormal | FAERS: 3 | US FAERS | |
| 1158 | Wrong device used | FAERS: 3 | US FAERS | |
| 1159 | liposarcoma | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1160 | Abdominal rebound tenderness | FAERS: 2 | US FAERS | |
| 1161 | Abdominal sepsis | FAERS: 2 | US FAERS | |
| 1162 | Abulia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1163 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 1164 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 1165 | Acidosis | FAERS: 2 | US FAERS | |
| 1166 | Acute Coronary Syndrome | FAERS: 2 | US FAERS | |
| 1167 | Adrenal mass | FAERS: 2 | US FAERS | |
| 1168 | Afterbirth pain | FAERS: 2 | US FAERS | |
| 1169 | Alexia | FAERS: 2 | US FAERS | |
| 1170 | Allergy to animal | FAERS: 2 | US FAERS | |
| 1171 | Alveolitis | FAERS: 2 | US FAERS | |
| 1172 | Amniotic cavity disorder | FAERS: 2 | US FAERS | |
| 1173 | Anal Fistula | FAERS: 2 | US FAERS | |
| 1174 | Anal abscess | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1175 | Androgenetic Alopecia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1176 | Antibiotic therapy | FAERS: 2 | US FAERS | |
| 1177 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 1178 | Arteriosclerosis | FAERS: 2 | US FAERS | |
| 1179 | Arthropod bite | FAERS: 2 | US FAERS | |
| 1180 | Atelectasis | FAERS: 2 | US FAERS | |
| 1181 | Atrioventricular Septal Defect | FAERS: 2 | US FAERS | |
| 1182 | Autoimmune dermatitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1183 | Bacteroides test positive | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1184 | Balanitis | FAERS: 2 | US FAERS | |
| 1185 | Basal cell carcinoma | FAERS: 2 | US FAERS | |
| 1186 | Belligerence | FAERS: 2 | US FAERS | |
| 1187 | Birth mark | FAERS: 2 | US FAERS | |
| 1188 | Bladder prolapse | FAERS: 2 | US FAERS | |
| 1189 | Blepharospasm | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1190 | Blood cholesterol | FAERS: 2 | US FAERS | |
| 1191 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 1192 | Blood human chorionic gonadotropin negative | FAERS: 2 | US FAERS | |
| 1193 | Blood pH decreased | FAERS: 2 | US FAERS | |
| 1194 | Body temperature fluctuation | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1195 | Brain Death | FAERS: 2 | US FAERS | |
| 1196 | Brain stem thrombosis | FAERS: 2 | US FAERS | |
| 1197 | Breast fibroma | FAERS: 2 | US FAERS | |
| 1198 | Breast infection | FAERS: 2 | US FAERS | |
| 1199 | Breast necrosis | FAERS: 2 | US FAERS | |
| 1200 | Bronchiolitis | FAERS: 2 | US FAERS | |
| 1201 | Bronchopulmonary Dysplasia | FAERS: 2 | US FAERS | |
| 1202 | Burning Mouth Syndrome | FAERS: 2 | US FAERS | |
| 1203 | CREST Syndrome | FAERS: 2 | OFFSIDES US FAERS | |
| 1204 | Capillaritis | FAERS: 2 | US FAERS | |
| 1205 | Carcinoembryonic antigen increased | FAERS: 2 | US FAERS | |
| 1206 | Cartilage injury | FAERS: 2 | US FAERS | |
| 1207 | Caudal Regression Syndrome | FAERS: 2 | OFFSIDES US FAERS | |
| 1208 | Cerebral Palsy | FAERS: 2 | US FAERS | |
| 1209 | Cheilitis | FAERS: 2 | US FAERS | |
| 1210 | Chemotherapy | FAERS: 2 | US FAERS | |
| 1211 | Chronic gastritis | FAERS: 2 | US FAERS | |
| 1212 | Circulating anticoagulant positive | FAERS: 2 | US FAERS | |
| 1213 | Claustrophobia | FAERS: 2 | US FAERS | |
| 1214 | Clitoris abscess | FAERS: 2 | US FAERS | |
| 1215 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 1216 | Complex partial seizures | FAERS: 2 | US FAERS | |
| 1217 | Congenital diaphragmatic hernia | FAERS: 2 | US FAERS | |
| 1218 | Congenital hearing disorder | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1219 | Congenital hydronephrosis | FAERS: 2 | US FAERS | |
| 1220 | Congenital scoliosis | FAERS: 2 | US FAERS | |
| 1221 | Cor pulmonale | FAERS: 2 | US FAERS | |
| 1222 | Cystopexy | FAERS: 2 | US FAERS | |
| 1223 | Deja Vu | FAERS: 2 | US FAERS | |
| 1224 | Delirium | FAERS: 2 | US FAERS | |
| 1225 | Dengue Fever | FAERS: 2 | US FAERS | |
| 1226 | Depressive delusion | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1227 | Diabetes Insipidus | FAERS: 2 | US FAERS | |
| 1228 | Drug Dependence | FAERS: 2 | US FAERS | |
| 1229 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 1230 | Drug level increased | FAERS: 2 | US FAERS | |
| 1231 | Eczema weeping | FAERS: 2 | US FAERS | |
| 1232 | Electroencephalogram abnormal | FAERS: 2 | US FAERS | |
| 1233 | Elevated mood | FAERS: 2 | US FAERS | |
| 1234 | Encapsulation reaction | FAERS: 2 | US FAERS | |
| 1235 | Endocervical curettage | FAERS: 2 | US FAERS | |
| 1236 | Endometrial cancer stage II | FAERS: 2 | US FAERS | |
| 1237 | Endometritis bacterial | FAERS: 2 | US FAERS | |
| 1238 | Enterococcus test positive | FAERS: 2 | US FAERS | |
| 1239 | Eosinophilia | FAERS: 2 | US FAERS | |
| 1240 | Erythema Multiforme | FAERS: 2 | US FAERS | |
| 1241 | Erythroplasia | FAERS: 2 | US FAERS | |
| 1242 | Excoriation | FAERS: 2 | US FAERS | |
| 1243 | Exposure to contaminated device | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1244 | Expulsion of medication | FAERS: 2 | US FAERS | |
| 1245 | Eye Burns | FAERS: 2 | US FAERS | |
| 1246 | Eyelid irritation | FAERS: 2 | OFFSIDES US FAERS | |
| 1247 | Facet joint block | FAERS: 2 | US FAERS | |
| 1248 | Failure to Thrive | FAERS: 2 | US FAERS | |
| 1249 | False positive investigation result | FAERS: 2 | US FAERS | |
| 1250 | Fear of weight gain | FAERS: 2 | US FAERS | |
| 1251 | Febrile Neutropenia | FAERS: 2 | US FAERS | |
| 1252 | Female sex hormone level abnormal | FAERS: 2 | US FAERS | |
| 1253 | Fibronectin increased | FAERS: 2 | US FAERS | |
| 1254 | Flat affect | FAERS: 2 | US FAERS | |
| 1255 | Foreign body in reproductive tract | FAERS: 2 | US FAERS | |
| 1256 | Gallbladder anomaly congenital | FAERS: 2 | US FAERS | |
| 1257 | Gardnerella test positive | FAERS: 2 | US FAERS | |
| 1258 | Gastric pH decreased | FAERS: 2 | US FAERS | |
| 1259 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 1260 | Gingival Recession | FAERS: 2 | US FAERS | |
| 1261 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 1262 | Heart sounds abnormal | FAERS: 2 | US FAERS | |
| 1263 | Hepatitis A | FAERS: 2 | US FAERS | |
| 1264 | Hilar lymphadenopathy | FAERS: 2 | OFFSIDES US FAERS | |
| 1265 | Histamine intolerance | FAERS: 2 | US FAERS | |
| 1266 | Hordeolum | FAERS: 2 | US FAERS | |
| 1267 | Human Chorionic Gonadotropin | FAERS: 2 | US FAERS | |
| 1268 | Human chorionic gonadotropin positive | FAERS: 2 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 1269 | Hyperaldosteronism | FAERS: 2 | US FAERS | |
| 1270 | Hypermetabolism | FAERS: 2 | US FAERS | |
| 1271 | Hypermobility syndrome | FAERS: 2 | US FAERS | |
| 1272 | Hypogeusia | FAERS: 2 | US FAERS | |
| 1273 | Impaired gastric emptying | FAERS: 2 | US FAERS | |
| 1274 | Implant site abscess | FAERS: 2 | US FAERS | |
| 1275 | Implant site extravasation | FAERS: 2 | US FAERS | |
| 1276 | Implant site nerve injury | FAERS: 2 | US FAERS | |
| 1277 | Implant site swelling | FAERS: 2 | US FAERS | |
| 1278 | Inadequate analgesia | FAERS: 2 | US FAERS | |
| 1279 | Incisional hernia | FAERS: 2 | US FAERS | |
| 1280 | Incorrect product administration duration | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1281 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 1282 | Incorrect storage of drug | FAERS: 2 | US FAERS | |
| 1283 | Infantile Colic | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 1284 | Inguinal mass | FAERS: 2 | US FAERS | |
| 1285 | Injection Site Reaction | FAERS: 2 | US FAERS | |
| 1286 | Intestinal infarction | FAERS: 2 | US FAERS | |
| 1287 | Intracranial mass | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1288 | Itching scar | FAERS: 2 | US FAERS | |
| 1289 | Joint Instability | FAERS: 2 | US FAERS | |
| 1290 | Large intestinal stenosis | FAERS: 2 | US FAERS | |
| 1291 | Laryngitis | FAERS: 2 | US FAERS | |
| 1292 | Latex allergy | FAERS: 2 | US FAERS | |
| 1293 | Laziness | FAERS: 2 | US FAERS | |
| 1294 | Leukoderma | FAERS: 2 | US FAERS | |
| 1295 | Lichen Planus | FAERS: 2 | US FAERS | |
| 1296 | Lip exfoliation | FAERS: 2 | US FAERS | |
| 1297 | Lip pruritus | FAERS: 2 | US FAERS | |
| 1298 | Lumbar radiculopathy | FAERS: 2 | US FAERS | |
| 1299 | Lung Abscess | FAERS: 2 | US FAERS | |
| 1300 | Lymph node palpable | FAERS: 2 | US FAERS | |
| 1301 | Macular degeneration | FAERS: 2 | US FAERS | |
| 1302 | Maternal exposure timing unspecified | FAERS: 2 | US FAERS | |
| 1303 | Mechanical urticaria | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1304 | Medical device repositioning | FAERS: 2 | US FAERS | |
| 1305 | Medical device site injury | FAERS: 2 | US FAERS | |
| 1306 | Medical device site reaction | FAERS: 2 | US FAERS | |
| 1307 | Metastasis | FAERS: 2 | US FAERS | |
| 1308 | Metastatic Neoplasm | FAERS: 2 | US FAERS | |
| 1309 | Miliaria | FAERS: 2 | US FAERS | |
| 1310 | Mixed Connective Tissue Disease | FAERS: 2 | US FAERS | |
| 1311 | Molluscum Contagiosum | FAERS: 2 | US FAERS | |
| 1312 | Morning Sickness | FAERS: 2 | US FAERS | |
| 1313 | Morose | FAERS: 2 | US FAERS | |
| 1314 | Multiple Pregnancy | FAERS: 2 | US FAERS | |
| 1315 | Multiple sclerosis relapse | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1316 | Muscle Cramp | FAERS: 2 | US FAERS | |
| 1317 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 1318 | Neonatal infection | FAERS: 2 | US FAERS | |
| 1319 | Nephritis | FAERS: 2 | US FAERS | |
| 1320 | Nephrotic Syndrome | FAERS: 2 | US FAERS | |
| 1321 | Neutropenia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1322 | No adverse effect | FAERS: 2 | US FAERS | |
| 1323 | No adverse reaction | FAERS: 2 | US FAERS | |
| 1324 | No reaction on previous exposure to drug | FAERS: 2 | US FAERS | |
| 1325 | Noninfective gingivitis | FAERS: 2 | US FAERS | |
| 1326 | Nosophobia | FAERS: 2 | US FAERS | |
| 1327 | Nuclear magnetic resonance imaging abdominal | FAERS: 2 | US FAERS | |
| 1328 | Obstetric procedure complication | FAERS: 2 | US FAERS | |
| 1329 | Ocular Hypertension | FAERS: 2 | US FAERS | |
| 1330 | Oral pruritus | FAERS: 2 | US FAERS | |
| 1331 | Oropharyngeal blistering | FAERS: 2 | US FAERS | |
| 1332 | Oropharyngeal swelling | FAERS: 2 | US FAERS | |
| 1333 | Osteitis | FAERS: 2 | US FAERS | |
| 1334 | Osteochondrosis | FAERS: 2 | US FAERS | |
| 1335 | Osteomyelitis | FAERS: 2 | US FAERS | |
| 1336 | Ovarian fibrosis | FAERS: 2 | US FAERS | |
| 1337 | Painful ejaculation | FAERS: 2 | US FAERS | |
| 1338 | Palmar erythema | FAERS: 2 | US FAERS | |
| 1339 | Papillophlebitis | FAERS: 2 | OFFSIDES US FAERS | |
| 1340 | Paranasal sinus discomfort | FAERS: 2 | US FAERS | |
| 1341 | Patient Isolation | FAERS: 2 | US FAERS | |
| 1342 | Penile blister | FAERS: 2 | US FAERS | |
| 1343 | Peptic Ulcer | FAERS: 2 | US FAERS | |
| 1344 | Peptostreptococcus test positive | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1345 | Peripheral venous disease | FAERS: 2 | US FAERS | |
| 1346 | Pharyngeal swelling | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1347 | Photosensitivity allergic reaction | FAERS: 2 | US FAERS | |
| 1348 | Physical assault | FAERS: 2 | US FAERS | |
| 1349 | Pigmentation lip | FAERS: 2 | US FAERS | |
| 1350 | Piloerection | FAERS: 2 | US FAERS | |
| 1351 | Pituitary enlargement | FAERS: 2 | OFFSIDES US FAERS | |
| 1352 | Porphyria non-acute | FAERS: 2 | US FAERS | |
| 1353 | Post-traumatic pain | FAERS: 2 | US FAERS | |
| 1354 | Postoperative abscess | FAERS: 2 | US FAERS | |
| 1355 | Postoperative ileus | FAERS: 2 | US FAERS | |
| 1356 | Postoperative thrombosis | FAERS: 2 | US FAERS | |
| 1357 | Proctocolitis | FAERS: 2 | US FAERS | |
| 1358 | Product administration error | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1359 | Product counterfeit | FAERS: 2 | US FAERS | |
| 1360 | Product formulation issue | FAERS: 2 | US FAERS | |
| 1361 | Product package associated injury | FAERS: 2 | US FAERS | |
| 1362 | Product packaging quantity issue | FAERS: 2 | US FAERS | |
| 1363 | Product substitution issue | FAERS: 2 | US FAERS | |
| 1364 | Psychomotor skills impaired | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1365 | Pulmonary vascular resistance abnormality | FAERS: 2 | US FAERS | |
| 1366 | Quadriplegia | FAERS: 2 | US FAERS | |
| 1367 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 1368 | Reaction to preservatives | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1369 | Reproductive complication associated with device | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1370 | Retinal Vascular Disorder | FAERS: 2 | US FAERS | |
| 1371 | Retinal vascular occlusion | FAERS: 2 | US FAERS | |
| 1372 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 1373 | Rotator cuff syndrome | FAERS: 2 | US FAERS | |
| 1374 | Rubber sensitivity | FAERS: 2 | US FAERS | |
| 1375 | SLE arthritis | FAERS: 2 | US FAERS | |
| 1376 | Salpingo-oophorectomy unilateral | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 1377 | Seasonal Affective Disorder | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1378 | Sexual transmission of infection | FAERS: 2 | US FAERS | |
| 1379 | Simple Partial Seizures | FAERS: 2 | US FAERS | |
| 1380 | Simplex virus test positive | FAERS: 2 | US FAERS | |
| 1381 | Skin Papilloma | FAERS: 2 | US FAERS | |
| 1382 | Skin discomfort | FAERS: 2 | US FAERS | |
| 1383 | Skin laceration | FAERS: 2 | US FAERS | |
| 1384 | Skin necrosis | FAERS: 2 | US FAERS | |
| 1385 | Sleep Paralysis | FAERS: 2 | US FAERS | |
| 1386 | Smoke sensitivity | FAERS: 2 | US FAERS | |
| 1387 | Spinal column injury | FAERS: 2 | US FAERS | |
| 1388 | Splenomegaly | FAERS: 2 | US FAERS | |
| 1389 | Status Migrainosus | FAERS: 2 | US FAERS | |
| 1390 | Stupor | FAERS: 2 | US FAERS | |
| 1391 | Sunburn | FAERS: 2 | US FAERS | |
| 1392 | Symphysiolysis | FAERS: 2 | US FAERS | |
| 1393 | Systemic lupus erythematosus rash | FAERS: 2 | US FAERS | |
| 1394 | Therapeutic product contamination | FAERS: 2 | US FAERS | |
| 1395 | Therapeutic product effective for unapproved indication | FAERS: 2 | US FAERS | |
| 1396 | Therapy cessation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1397 | Thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 1398 | Tinea cruris | FAERS: 2 | US FAERS | |
| 1399 | Tongue discomfort | FAERS: 2 | US FAERS | |
| 1400 | Transplant | FAERS: 2 | US FAERS | |
| 1401 | Traumatic liver injury | FAERS: 2 | US FAERS | |
| 1402 | Trigeminal Nerve Disorder | FAERS: 2 | US FAERS | |
| 1403 | Troponin increased | FAERS: 2 | US FAERS | |
| 1404 | Ultrasound abdomen abnormal | FAERS: 2 | US FAERS | |
| 1405 | Upper airway obstruction | FAERS: 2 | US FAERS | |
| 1406 | Upper-airway cough syndrome | FAERS: 2 | US FAERS | |
| 1407 | Urethral Stenosis | FAERS: 2 | US FAERS | |
| 1408 | Urinary tract infection enterococcal | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1409 | Urinary tract infection fungal | FAERS: 2 | US FAERS | |
| 1410 | Urinary tract inflammation | FAERS: 2 | US FAERS | |
| 1411 | Urine output increased | FAERS: 2 | US FAERS | |
| 1412 | Uterine atrophy | FAERS: 2 | US FAERS | |
| 1413 | Uterine myoma expulsion | FAERS: 2 | US FAERS | |
| 1414 | Uveitis | FAERS: 2 | US FAERS | |
| 1415 | Vaginal mucosal blistering | FAERS: 2 | US FAERS | |
| 1416 | Vascular anomaly | FAERS: 2 | US FAERS | |
| 1417 | Vascular pain | FAERS: 2 | US FAERS | |
| 1418 | Venous Insufficiency | FAERS: 2 | US FAERS | |
| 1419 | Ventilation/perfusion scan abnormal | FAERS: 2 | US FAERS | |
| 1420 | Vestibular Neuronitis | FAERS: 2 | US FAERS | |
| 1421 | Visceral Pain | FAERS: 2 | US FAERS | |
| 1422 | Vulvar erosion | FAERS: 2 | US FAERS | |
| 1423 | Vulvovaginal human papilloma virus infection | FAERS: 2 | US FAERS | |
| 1424 | Xerophthalmia | FAERS: 2 | US FAERS | |
| 1425 | diagnostic procedure | FAERS: 2 | US FAERS | |
| 1426 | 17-hydroxyprogesterone increased | FAERS: 1 | US FAERS | |
| 1427 | Abdominal bruit | FAERS: 1 | US FAERS | |
| 1428 | Abdominal wound dehiscence | FAERS: 1 | US FAERS | |
| 1429 | Abortion induced complicated | FAERS: 1 | US FAERS | |
| 1430 | Acanthosis Nigricans | FAERS: 1 | US FAERS | |
| 1431 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 1432 | Accidental death | FAERS: 1 | US FAERS | |
| 1433 | Accidental device ingestion | FAERS: 1 | US FAERS | |
| 1434 | Accidental exposure | FAERS: 1 | US FAERS | |
| 1435 | Accidental underdose | FAERS: 1 | US FAERS | |
| 1436 | Acrodermatitis | FAERS: 1 | US FAERS | |
| 1437 | Activated Protein C Resistance | FAERS: 1 | US FAERS | |
| 1438 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 1439 | Acute tonsillitis | FAERS: 1 | SIDER US FAERS | |
| 1440 | Administration site discomfort | FAERS: 1 | US FAERS | |
| 1441 | Administration site infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1442 | Adnexitis | FAERS: 1 | OFFSIDES US FAERS | |
| 1443 | Adrenocortical carcinoma | FAERS: 1 | US FAERS | |
| 1444 | Agnosia | FAERS: 1 | US FAERS | |
| 1445 | Air Embolism | FAERS: 1 | US FAERS | |
| 1446 | Allergy to synthetic fabric | FAERS: 1 | US FAERS | |
| 1447 | Allodynia | FAERS: 1 | US FAERS | |
| 1448 | Alopecia totalis | FAERS: 1 | US FAERS | |
| 1449 | Amaurosis | FAERS: 1 | US FAERS | |
| 1450 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 1451 | Anal infection | FAERS: 1 | US FAERS | |
| 1452 | Anal inflammation | FAERS: 1 | US FAERS | |
| 1453 | Analgesic drug level increased | FAERS: 1 | US FAERS | |
| 1454 | Androgens increased | FAERS: 1 | OFFSIDES US FAERS | |
| 1455 | Angiomyolipoma | FAERS: 1 | US FAERS | |
| 1456 | Angioplasty | FAERS: 1 | US FAERS | |
| 1457 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 1458 | Anorexia Nervosa | FAERS: 1 | US FAERS | |
| 1459 | Antibiotic resistant Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 1460 | Antiinflammatory therapy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1461 | Antiphospholipid Antibodies | FAERS: 1 | US FAERS | |
| 1462 | Antiphospholipid antibodies positive | FAERS: 1 | US FAERS | |
| 1463 | Anxiety postoperative | FAERS: 1 | US FAERS | |
| 1464 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 1465 | Application site erosion | FAERS: 1 | US FAERS | |
| 1466 | Application site swelling | FAERS: 1 | US FAERS | |
| 1467 | Arterial Injury | FAERS: 1 | US FAERS | |
| 1468 | Atopy | FAERS: 1 | US FAERS | |
| 1469 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 1470 | Autoimmune progesterone dermatitis | FAERS: 1 | US FAERS | |
| 1471 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 1472 | Axillary vein thrombosis | FAERS: 1 | US FAERS | |
| 1473 | Bacterial disease carrier | FAERS: 1 | US FAERS | |
| 1474 | Bacteriuria | FAERS: 1 | US FAERS | |
| 1475 | Band sensation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1476 | Basilar artery thrombosis | FAERS: 1 | US FAERS | |
| 1477 | Benign breast lump removal | FAERS: 1 | US FAERS | |
| 1478 | Benign neoplasm of skin | FAERS: 1 | US FAERS | |
| 1479 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 1480 | Biopsy breast abnormal | FAERS: 1 | US FAERS | |
| 1481 | Biopsy endometrium abnormal | FAERS: 1 | US FAERS | |
| 1482 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 1483 | Bladder neck suspension | FAERS: 1 | US FAERS | |
| 1484 | Blood Corticotrophin Decreased | FAERS: 1 | US FAERS | |
| 1485 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 1486 | Blood alkaline phosphatase abnormal | FAERS: 1 | US FAERS | |
| 1487 | Blood brain barrier defect | FAERS: 1 | US FAERS | |
| 1488 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 1489 | Blood copper increased | FAERS: 1 | US FAERS | |
| 1490 | Blood cortisol abnormal | FAERS: 1 | US FAERS | |
| 1491 | Blood gases abnormal | FAERS: 1 | US FAERS | |
| 1492 | Blood growth hormone increased | FAERS: 1 | US FAERS | |
| 1493 | Blood immunoglobulin A increased | FAERS: 1 | US FAERS | |
| 1494 | Blood immunoglobulin G increased | FAERS: 1 | US FAERS | |
| 1495 | Blood insulin abnormal | FAERS: 1 | US FAERS | |
| 1496 | Blood parathyroid hormone increased | FAERS: 1 | US FAERS | |
| 1497 | Blood prolactin | FAERS: 1 | US FAERS | |
| 1498 | Blunted affect | FAERS: 1 | US FAERS | |
| 1499 | Bone contusion | FAERS: 1 | US FAERS | |
| 1500 | Bone density abnormal | FAERS: 1 | US FAERS | |
| 1501 | Bone swelling | FAERS: 1 | US FAERS | |
| 1502 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 1503 | Brain Stem Glioma | FAERS: 1 | US FAERS | |
| 1504 | Breast adenoma | FAERS: 1 | US FAERS | |
| 1505 | Breast discharge infected | FAERS: 1 | US FAERS | |
| 1506 | Bromhidrosis | FAERS: 1 | US FAERS | |
| 1507 | Bronchospasm | FAERS: 1 | US FAERS | |
| 1508 | Capillary Fragility | FAERS: 1 | US FAERS | |
| 1509 | Capillary nail refill test abnormal | FAERS: 1 | US FAERS | |
| 1510 | Carbohydrate antigen 19-9 increased | FAERS: 1 | US FAERS | |
| 1511 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 1512 | Catheter site infection | FAERS: 1 | US FAERS | |
| 1513 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 1514 | Cerebellar Hypoplasia | FAERS: 1 | US FAERS | |
| 1515 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 1516 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 1517 | Cerebral vasoconstriction | FAERS: 1 | US FAERS | |
| 1518 | Cerebral ventricle collapse | FAERS: 1 | US FAERS | |
| 1519 | Cerebrovascular stenosis | FAERS: 1 | US FAERS | |
| 1520 | Cervix carcinoma recurrent | FAERS: 1 | US FAERS | |
| 1521 | Cholangitis | FAERS: 1 | US FAERS | |
| 1522 | Cholelithiasis migration | FAERS: 1 | US FAERS | |
| 1523 | Cholelithotomy | FAERS: 1 | US FAERS | |
| 1524 | Cholestasis of pregnancy | FAERS: 1 | US FAERS | |
| 1525 | Choriocarcinoma | FAERS: 1 | US FAERS | |
| 1526 | Choroidal Detachment | FAERS: 1 | US FAERS | |
| 1527 | Chronic Paroxysmal Hemicrania | FAERS: 1 | US FAERS | |
| 1528 | Coagulation time shortened | FAERS: 1 | US FAERS | |
| 1529 | Colon adenoma | FAERS: 1 | US FAERS | |
| 1530 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 1531 | Confabulation | FAERS: 1 | US FAERS | |
| 1532 | Congenital Hydrocephalus | FAERS: 1 | US FAERS | |
| 1533 | Congenital brain damage | FAERS: 1 | US FAERS | |
| 1534 | Congenital neurological disorder | FAERS: 1 | US FAERS | |
| 1535 | Congenital pyelocaliectasis | FAERS: 1 | US FAERS | |
| 1536 | Congenital visual acuity reduced | FAERS: 1 | US FAERS | |
| 1537 | Contact lens complication | FAERS: 1 | US FAERS | |
| 1538 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 1539 | Contraindicated product prescribed | FAERS: 1 | US FAERS | |
| 1540 | Coronary artery embolism | FAERS: 1 | US FAERS | |
| 1541 | Cortisol increased | FAERS: 1 | US FAERS | |
| 1542 | Craniosynostosis | FAERS: 1 | US FAERS | |
| 1543 | Cryotherapy | FAERS: 1 | US FAERS | |
| 1544 | Culture cervix positive | FAERS: 1 | US FAERS | |
| 1545 | Culture urine positive | FAERS: 1 | US FAERS | |
| 1546 | Cutis Laxa | FAERS: 1 | US FAERS | |
| 1547 | Cyanopsia | FAERS: 1 | US FAERS | |
| 1548 | Cyst removal | FAERS: 1 | US FAERS | |
| 1549 | Cystic Fibrosis | FAERS: 1 | US FAERS | |
| 1550 | Cystocele | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1551 | Cystostomy | FAERS: 1 | US FAERS | |
| 1552 | Dacryocystitis | FAERS: 1 | US FAERS | |
| 1553 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 1554 | Death of relative | FAERS: 1 | US FAERS | |
| 1555 | Decompression Sickness | FAERS: 1 | US FAERS | |
| 1556 | Degeneration of uterine fibroid | FAERS: 1 | US FAERS | |
| 1557 | Delayed delivery | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1558 | Dental Fistula | FAERS: 1 | US FAERS | |
| 1559 | Dental discomfort | FAERS: 1 | US FAERS | |
| 1560 | Device effect decreased | FAERS: 1 | US FAERS | |
| 1561 | Device effect incomplete | FAERS: 1 | US FAERS | |
| 1562 | Device interaction | FAERS: 1 | US FAERS | |
| 1563 | Device lead damage | FAERS: 1 | US FAERS | |
| 1564 | Device leakage | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1565 | Device toxicity | FAERS: 1 | US FAERS | |
| 1566 | Device used for unapproved schedule | FAERS: 1 | US FAERS | |
| 1567 | Disease Progression | FAERS: 1 | US FAERS | |
| 1568 | Disease complication | FAERS: 1 | US FAERS | |
| 1569 | Disease risk factor | FAERS: 1 | US FAERS | |
| 1570 | Diverticulum | FAERS: 1 | US FAERS | |
| 1571 | Dropped head syndrome | FAERS: 1 | US FAERS | |
| 1572 | Drug abuser | FAERS: 1 | US FAERS | |
| 1573 | Drug abuse | FAERS: 1 | US FAERS | |
| 1574 | Drug label confusion | FAERS: 1 | US FAERS | |
| 1575 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 1576 | Drug therapeutic incompatibility | FAERS: 1 | US FAERS | |
| 1577 | Duodenitis | FAERS: 1 | US FAERS | |
| 1578 | Dyscalculia | FAERS: 1 | US FAERS | |
| 1579 | Dyschromatopsia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1580 | Dysmorphism | FAERS: 1 | US FAERS | |
| 1581 | Dyspnoea exacerbated | FAERS: 1 | US FAERS | |
| 1582 | Dystonia | FAERS: 1 | US FAERS | |
| 1583 | Ear congestion | FAERS: 1 | US FAERS | |
| 1584 | Ecchymosis | FAERS: 1 | 10875858 | CTD US FAERS |
| 1585 | Elective procedure | FAERS: 1 | US FAERS | |
| 1586 | Electrocardiogram ST-T segment abnormal | FAERS: 1 | US FAERS | |
| 1587 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 1588 | Electromyogram abnormal | FAERS: 1 | US FAERS | |
| 1589 | Elephantiasis | FAERS: 1 | US FAERS | |
| 1590 | Embolic cerebral infarction | FAERS: 1 | US FAERS | |
| 1591 | Emergency Care | FAERS: 1 | US FAERS | |
| 1592 | Emergency care examination | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1593 | Emotional poverty | FAERS: 1 | US FAERS | |
| 1594 | Encephalocele | FAERS: 1 | US FAERS | |
| 1595 | Endocrine test abnormal | FAERS: 1 | US FAERS | |
| 1596 | Endolymphatic Hydrops | FAERS: 1 | OFFSIDES US FAERS | |
| 1597 | Endometrial Stromal Sarcoma | FAERS: 1 | US FAERS | |
| 1598 | Endometrial sarcoma | FAERS: 1 | US FAERS | |
| 1599 | Endometriosis ablation | FAERS: 1 | US FAERS | |
| 1600 | Endosalpingiosis | FAERS: 1 | US FAERS | |
| 1601 | Endoscopy upper gastrointestinal tract abnormal | FAERS: 1 | US FAERS | |
| 1602 | Enterobacter test positive | FAERS: 1 | US FAERS | |
| 1603 | Enterocolitis fungal | FAERS: 1 | US FAERS | |
| 1604 | Enthesopathy | FAERS: 1 | US FAERS | |
| 1605 | Eosinophilic colitis | FAERS: 1 | US FAERS | |
| 1606 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 1607 | Erection increased | FAERS: 1 | US FAERS | |
| 1608 | Erythrosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1609 | Escherichia vaginitis | FAERS: 1 | US FAERS | |
| 1610 | Essential Tremor | FAERS: 1 | US FAERS | |
| 1611 | Evans syndrome | FAERS: 1 | US FAERS | |
| 1612 | Exaggerated startle response | FAERS: 1 | US FAERS | |
| 1613 | Exophthalmos | FAERS: 1 | US FAERS | |
| 1614 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 1615 | Extravasation | FAERS: 1 | US FAERS | |
| 1616 | Eyelid pain | FAERS: 1 | US FAERS | |
| 1617 | Eyelid skin dryness | FAERS: 1 | US FAERS | |
| 1618 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 1619 | Factor V Leiden mutation | FAERS: 1 | US FAERS | |
| 1620 | Factor V deficiency | FAERS: 1 | US FAERS | |
| 1621 | Failure of implant | FAERS: 1 | US FAERS | |
| 1622 | Fallopian tube spasm | FAERS: 1 | US FAERS | |
| 1623 | Familial Hemiplegic Migraine | FAERS: 1 | US FAERS | |
| 1624 | Fat redistribution | FAERS: 1 | US FAERS | |
| 1625 | Feeding disorder of infancy OR early childhood | FAERS: 1 | US FAERS | |
| 1626 | Female genital organs X-ray abnormal | FAERS: 1 | US FAERS | |
| 1627 | Fibrosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1628 | Floppy iris syndrome | FAERS: 1 | US FAERS | |
| 1629 | Fluid overload | FAERS: 1 | US FAERS | |
| 1630 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 1631 | Fracture | FAERS: 1 | US FAERS | |
| 1632 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 1633 | Fungal test positive | FAERS: 1 | US FAERS | |
| 1634 | Gastrectomy | FAERS: 1 | US FAERS | |
| 1635 | Gastric mucosal lesion | FAERS: 1 | US FAERS | |
| 1636 | Gastrointestinal angiodysplasia | FAERS: 1 | US FAERS | |
| 1637 | Gastrointestinal dysplasia | FAERS: 1 | US FAERS | |
| 1638 | Gastrointestinal hypermotility | FAERS: 1 | US FAERS | |
| 1639 | Gastrointestinal mucosal disorder | FAERS: 1 | US FAERS | |
| 1640 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 1641 | Gastrointestinal stromal cancer | FAERS: 1 | US FAERS | |
| 1642 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 1643 | Gastroschisis | FAERS: 1 | US FAERS | |
| 1644 | Gene Mutation | FAERS: 1 | US FAERS | |
| 1645 | Genital abscess | FAERS: 1 | US FAERS | |
| 1646 | Genitourinary operation | FAERS: 1 | US FAERS | |
| 1647 | Gingival erythema | FAERS: 1 | US FAERS | |
| 1648 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 1649 | Glioblastoma | FAERS: 1 | US FAERS | |
| 1650 | Granulomatosis with polyangiitis | FAERS: 1 | US FAERS | |
| 1651 | Groin infection | FAERS: 1 | US FAERS | |
| 1652 | Growth failure | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1653 | HELLP Syndrome | FAERS: 1 | US FAERS | |
| 1654 | Hair growth rate abnormal | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1655 | Hamartoma | FAERS: 1 | US FAERS | |
| 1656 | Head Banging | FAERS: 1 | US FAERS | |
| 1657 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 1658 | Hepatic cyst infection | FAERS: 1 | US FAERS | |
| 1659 | Hereditary non-polyposis colorectal cancer syndrome | FAERS: 1 | US FAERS | |
| 1660 | Herpes simplex test positive | FAERS: 1 | US FAERS | |
| 1661 | Histamine level increased | FAERS: 1 | US FAERS | |
| 1662 | Holoprosencephaly | FAERS: 1 | US FAERS | |
| 1663 | Human chorionic gonadotropin negative | FAERS: 1 | US FAERS | |
| 1664 | Hydrothorax | FAERS: 1 | US FAERS | |
| 1665 | Hydroxycorticosteroids increased | FAERS: 1 | US FAERS | |
| 1666 | Hyperandrogenism | FAERS: 1 | US FAERS | |
| 1667 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 1668 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 1669 | Hypertrophy | FAERS: 1 | US FAERS | |
| 1670 | Hypomania | FAERS: 1 | US FAERS | |
| 1671 | Hypoperfusion | FAERS: 1 | US FAERS | |
| 1672 | Hypothermia neonatal | FAERS: 1 | US FAERS | |
| 1673 | Hypotrichosis | FAERS: 1 | CTD US FAERS | |
| 1674 | Hysterosalpingo-oophorectomy | FAERS: 1 | US FAERS | |
| 1675 | Hysterosalpingogram abnormal | FAERS: 1 | US FAERS | |
| 1676 | Immature respiratory system | FAERS: 1 | US FAERS | |
| 1677 | Impetigo | FAERS: 1 | US FAERS | |
| 1678 | Implant site calcification | FAERS: 1 | US FAERS | |
| 1679 | Implant site cellulitis | FAERS: 1 | US FAERS | |
| 1680 | Implant site effusion | FAERS: 1 | US FAERS | |
| 1681 | Implant site fibrosis | FAERS: 1 | US FAERS | |
| 1682 | Implant site hypersensitivity | FAERS: 1 | US FAERS | |
| 1683 | Implant site mass | FAERS: 1 | US FAERS | |
| 1684 | Implant site pruritus | FAERS: 1 | US FAERS | |
| 1685 | Implant site scar | FAERS: 1 | US FAERS | |
| 1686 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 1687 | Incision site abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 1688 | Incision site cellulitis | FAERS: 1 | US FAERS | |
| 1689 | Incision site inflammation | FAERS: 1 | US FAERS | |
| 1690 | Incision site swelling | FAERS: 1 | US FAERS | |
| 1691 | Increased viscosity of upper respiratory secretion | FAERS: 1 | US FAERS | |
| 1692 | Induced abortion infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1693 | Infected dermal cyst | FAERS: 1 | US FAERS | |
| 1694 | Infectious colitis | FAERS: 1 | US FAERS | |
| 1695 | Infective spondylitis | FAERS: 1 | US FAERS | |
| 1696 | Infective tenosynovitis | FAERS: 1 | US FAERS | |
| 1697 | Inflammatory carcinoma of breast stage III | FAERS: 1 | US FAERS | |
| 1698 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 1699 | Injection site abscess | FAERS: 1 | US FAERS | |
| 1700 | Injection site pruritus | FAERS: 1 | US FAERS | |
| 1701 | Inner ear operation | FAERS: 1 | US FAERS | |
| 1702 | Insurance issue | FAERS: 1 | US FAERS | |
| 1703 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 1704 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 1705 | Intercepted product monitoring error | FAERS: 1 | US FAERS | |
| 1706 | Intercepted product prescribing error | FAERS: 1 | US FAERS | |
| 1707 | Interventional procedure | FAERS: 1 | US FAERS | |
| 1708 | Intervertebral disc annular tear | FAERS: 1 | US FAERS | |
| 1709 | Intervertebral disc injury | FAERS: 1 | US FAERS | |
| 1710 | Intestinal gangrene | FAERS: 1 | US FAERS | |
| 1711 | Intestinal resection | FAERS: 1 | US FAERS | |
| 1712 | Intestinal scarring | FAERS: 1 | US FAERS | |
| 1713 | Intraductal papillary breast neoplasm | FAERS: 1 | US FAERS | |
| 1714 | Invasive papillary breast carcinoma | FAERS: 1 | US FAERS | |
| 1715 | Iodine uptake increased | FAERS: 1 | US FAERS | |
| 1716 | Iron Overload | FAERS: 1 | US FAERS | |
| 1717 | Irregular sleep wake rhythm disorder | FAERS: 1 | US FAERS | |
| 1718 | Joint abscess | FAERS: 1 | US FAERS | |
| 1719 | Kidney congestion | FAERS: 1 | US FAERS | |
| 1720 | Labile hypertension | FAERS: 1 | US FAERS | |
| 1721 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 1722 | Lactobacillus infection | FAERS: 1 | US FAERS | |
| 1723 | Laryngospasm | FAERS: 1 | US FAERS | |
| 1724 | Left atrial dilatation | FAERS: 1 | US FAERS | |
| 1725 | Leishmaniasis | FAERS: 1 | US FAERS | |
| 1726 | Lentigo | FAERS: 1 | US FAERS | |
| 1727 | Ligament injury | FAERS: 1 | US FAERS | |
| 1728 | Limb asymmetry | FAERS: 1 | US FAERS | |
| 1729 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 1730 | Lipoatrophy | FAERS: 1 | US FAERS | |
| 1731 | Local reaction | FAERS: 1 | US FAERS | |
| 1732 | Lochial infection | FAERS: 1 | US FAERS | |
| 1733 | Long QT Syndrome | FAERS: 1 | US FAERS | |
| 1734 | Lower respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 1735 | Lymphangioleiomyomatosis | FAERS: 1 | US FAERS | |
| 1736 | Lymphangioma | FAERS: 1 | US FAERS | |
| 1737 | Lymphangiosis carcinomatosa | FAERS: 1 | US FAERS | |
| 1738 | Lymphocele | FAERS: 1 | US FAERS | |
| 1739 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 1740 | Lymphopenia | FAERS: 1 | US FAERS | |
| 1741 | Magnesium Deficiency | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1742 | Malabsorption | FAERS: 1 | US FAERS | |
| 1743 | Malignant neoplasm of uterine adnexa | FAERS: 1 | US FAERS | |
| 1744 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 1745 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 1746 | Mammary duct ectasia | FAERS: 1 | US FAERS | |
| 1747 | Manufacturing issue | FAERS: 1 | US FAERS | |
| 1748 | Mastocytosis | FAERS: 1 | US FAERS | |
| 1749 | Maternal exposure during delivery | FAERS: 1 | US FAERS | |
| 1750 | Medical device site inflammation | FAERS: 1 | US FAERS | |
| 1751 | Medical observation | FAERS: 1 | US FAERS | |
| 1752 | Meibomian gland dysfunction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1753 | Melanosis | FAERS: 1 | 8631187 | CTD US FAERS |
| 1754 | Meniscus operation | FAERS: 1 | US FAERS | |
| 1755 | Menopausal depression | FAERS: 1 | US FAERS | |
| 1756 | Mentally late developer | FAERS: 1 | US FAERS | |
| 1757 | Metaplasia | FAERS: 1 | US FAERS | |
| 1758 | Metastases to abdominal cavity | FAERS: 1 | US FAERS | |
| 1759 | Metastases to diaphragm | FAERS: 1 | US FAERS | |
| 1760 | Metastases to pelvis | FAERS: 1 | US FAERS | |
| 1761 | Microscopy | FAERS: 1 | US FAERS | |
| 1762 | Microsleep | FAERS: 1 | US FAERS | |
| 1763 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 1764 | Migration of implant | FAERS: 1 | US FAERS | |
| 1765 | Moaning | FAERS: 1 | US FAERS | |
| 1766 | Mole excision | FAERS: 1 | US FAERS | |
| 1767 | Mood disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 1768 | Mouth cyst | FAERS: 1 | US FAERS | |
| 1769 | Moyamoya Disease | FAERS: 1 | US FAERS | |
| 1770 | Multiple Chemical Sensitivity | FAERS: 1 | US FAERS | |
| 1771 | Murphy's sign positive | FAERS: 1 | US FAERS | |
| 1772 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 1773 | Muscle hypertrophy | FAERS: 1 | US FAERS | |
| 1774 | Muscle necrosis | FAERS: 1 | US FAERS | |
| 1775 | Mutism | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1776 | Mydriasis | FAERS: 1 | US FAERS | |
| 1777 | Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 1778 | Myoclonus | FAERS: 1 | US FAERS | |
| 1779 | Myokymia | FAERS: 1 | US FAERS | |
| 1780 | Myometritis | FAERS: 1 | US FAERS | |
| 1781 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 1782 | Neisseria test positive | FAERS: 1 | US FAERS | |
| 1783 | Neurological decompensation | FAERS: 1 | US FAERS | |
| 1784 | Nodal osteoarthritis | FAERS: 1 | US FAERS | |
| 1785 | Nodular regenerative hyperplasia | FAERS: 1 | US FAERS | |
| 1786 | Nodule on extremity | FAERS: 1 | US FAERS | |
| 1787 | Nuclear magnetic resonance imaging breast abnormal | FAERS: 1 | US FAERS | |
| 1788 | Nuclear magnetic resonance imaging neck | FAERS: 1 | US FAERS | |
| 1789 | Nystagmus | FAERS: 1 | US FAERS | |
| 1790 | Occult blood positive | FAERS: 1 | US FAERS | |
| 1791 | Omphalitis | FAERS: 1 | US FAERS | |
| 1792 | Omphalorrhexis | FAERS: 1 | US FAERS | |
| 1793 | Open wound | FAERS: 1 | US FAERS | |
| 1794 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 1795 | Orchitis noninfective | FAERS: 1 | US FAERS | |
| 1796 | Otitis Externa | FAERS: 1 | US FAERS | |
| 1797 | Out of specification test results | FAERS: 1 | US FAERS | |
| 1798 | Ovarian Hyperstimulation Syndrome | FAERS: 1 | US FAERS | |
| 1799 | Ovarian injury | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1800 | Ovariocentesis | FAERS: 1 | US FAERS | |
| 1801 | Ovulation Induction | FAERS: 1 | US FAERS | |
| 1802 | PCO2 increased | FAERS: 1 | US FAERS | |
| 1803 | Packaging design issue | FAERS: 1 | US FAERS | |
| 1804 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 1805 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 1806 | Parametritis | FAERS: 1 | US FAERS | |
| 1807 | Paraparesis | FAERS: 1 | US FAERS | |
| 1808 | Parapharyngeal abscess | FAERS: 1 | US FAERS | |
| 1809 | Parent-child problem | FAERS: 1 | US FAERS | |
| 1810 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 1811 | Pelvic floor dyssynergia | FAERS: 1 | US FAERS | |
| 1812 | Penile burning sensation | FAERS: 1 | US FAERS | |
| 1813 | Perihepatitis | FAERS: 1 | US FAERS | |
| 1814 | Perinatal stroke | FAERS: 1 | US FAERS | |
| 1815 | Perineal cyst | FAERS: 1 | US FAERS | |
| 1816 | Perineal disorder | FAERS: 1 | US FAERS | |
| 1817 | Periodontitis | FAERS: 1 | US FAERS | |
| 1818 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 1819 | Peripheral artery dissection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1820 | Peripheral artery stenosis | FAERS: 1 | US FAERS | |
| 1821 | Peripheral arthritis | FAERS: 1 | US FAERS | |
| 1822 | Peripheral nerve lesion | FAERS: 1 | US FAERS | |
| 1823 | Periportal sinus dilatation | FAERS: 1 | US FAERS | |
| 1824 | Peritoneal carcinoma metastatic | FAERS: 1 | US FAERS | |
| 1825 | Peritoneal chlamydia infection | FAERS: 1 | US FAERS | |
| 1826 | Perivascular dermatitis | FAERS: 1 | US FAERS | |
| 1827 | Persistent depressive disorder | FAERS: 1 | US FAERS | |
| 1828 | Persistent urogenital sinus | FAERS: 1 | US FAERS | |
| 1829 | Pertussis | FAERS: 1 | US FAERS | |
| 1830 | Pharyngolaryngeal discomfort | FAERS: 1 | US FAERS | |
| 1831 | Pharyngotonsillitis | FAERS: 1 | US FAERS | |
| 1832 | Phlebitis deep | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1833 | Physical examination abnormal | FAERS: 1 | US FAERS | |
| 1834 | Pituitary cyst | FAERS: 1 | US FAERS | |
| 1835 | Pityriasis Rosea | FAERS: 1 | US FAERS | |
| 1836 | Planning to become pregnant | FAERS: 1 | US FAERS | |
| 1837 | Plasmapheresis | FAERS: 1 | US FAERS | |
| 1838 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 1839 | Pneumococcal sepsis | FAERS: 1 | US FAERS | |
| 1840 | Pneumoperitoneum | FAERS: 1 | US FAERS | |
| 1841 | Poor dental condition | FAERS: 1 | US FAERS | |
| 1842 | Poor feeding infant | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1843 | Post procedural inflammation | FAERS: 1 | US FAERS | |
| 1844 | Postictal headache | FAERS: 1 | US FAERS | |
| 1845 | Postmenopause | FAERS: 1 | US FAERS | |
| 1846 | Postoperative fever | FAERS: 1 | US FAERS | |
| 1847 | Postoperative hypopituitarism | FAERS: 1 | US FAERS | |
| 1848 | Postoperative wound complication | FAERS: 1 | US FAERS | |
| 1849 | Precancerous skin lesion | FAERS: 1 | US FAERS | |
| 1850 | Primary Biliary Cholangitis | FAERS: 1 | US FAERS | |
| 1851 | Primary headache associated with sexual activity | FAERS: 1 | US FAERS | |
| 1852 | Procedural site reaction | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1853 | Proctitis | FAERS: 1 | US FAERS | |
| 1854 | Product availability issue | FAERS: 1 | US FAERS | |
| 1855 | Product deposit | FAERS: 1 | US FAERS | |
| 1856 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 1857 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 1858 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 1859 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 1860 | Prosopagnosia | FAERS: 1 | US FAERS | |
| 1861 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 1862 | Pseudomeningocele | FAERS: 1 | US FAERS | |
| 1863 | Psychogenic seizure | FAERS: 1 | US FAERS | |
| 1864 | Puberty | FAERS: 1 | US FAERS | |
| 1865 | Pudendal canal syndrome | FAERS: 1 | US FAERS | |
| 1866 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 1867 | Pulmonary malformation | FAERS: 1 | US FAERS | |
| 1868 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 1869 | Pustular psoriasis | FAERS: 1 | US FAERS | |
| 1870 | Pyelitis | FAERS: 1 | US FAERS | |
| 1871 | Quadriparesis | FAERS: 1 | US FAERS | |
| 1872 | Radiation injury | FAERS: 1 | US FAERS | |
| 1873 | Radiculopathy | FAERS: 1 | US FAERS | |
| 1874 | Rectal abscess | FAERS: 1 | US FAERS | |
| 1875 | Rectal spasm | FAERS: 1 | US FAERS | |
| 1876 | Relapsing Fever | FAERS: 1 | US FAERS | |
| 1877 | Renal disorder in pregnancy | FAERS: 1 | US FAERS | |
| 1878 | Renal dysplasia | FAERS: 1 | US FAERS | |
| 1879 | Renal mass | FAERS: 1 | US FAERS | |
| 1880 | Retinal artery embolism | FAERS: 1 | US FAERS | |
| 1881 | Retinal pigment epitheliopathy | FAERS: 1 | US FAERS | |
| 1882 | Retrognathia | FAERS: 1 | US FAERS | |
| 1883 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 1884 | Rheumatic Fever | FAERS: 1 | US FAERS | |
| 1885 | Rheumatic Heart Disease | FAERS: 1 | US FAERS | |
| 1886 | Rheumatoid factor increased | FAERS: 1 | US FAERS | |
| 1887 | Right Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 1888 | Sacroiliitis | FAERS: 1 | US FAERS | |
| 1889 | Salpingostomy | FAERS: 1 | US FAERS | |
| 1890 | Self-induced vomiting | FAERS: 1 | US FAERS | |
| 1891 | Sensitive skin | FAERS: 1 | US FAERS | |
| 1892 | Sensorimotor disorder | FAERS: 1 | US FAERS | |
| 1893 | Septic embolus | FAERS: 1 | US FAERS | |
| 1894 | Serology abnormal | FAERS: 1 | US FAERS | |
| 1895 | Seronegative arthritis | FAERS: 1 | US FAERS | |
| 1896 | Serositis | FAERS: 1 | US FAERS | |
| 1897 | Sex hormone binding globulin increased | FAERS: 1 | US FAERS | |
| 1898 | Sexual Aversion Disorder | FAERS: 1 | US FAERS | |
| 1899 | Sexual abuse | FAERS: 1 | US FAERS | |
| 1900 | Sexual inhibition | FAERS: 1 | US FAERS | |
| 1901 | Shoulder Dystocia | FAERS: 1 | US FAERS | |
| 1902 | Shunt infection | FAERS: 1 | US FAERS | |
| 1903 | Sigmoiditis | FAERS: 1 | US FAERS | |
| 1904 | Similar reaction on previous exposure to drug | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1905 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 1906 | Skeletal dysplasia | FAERS: 1 | US FAERS | |
| 1907 | Skin Wrinkling | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1908 | Skin tightness | FAERS: 1 | US FAERS | |
| 1909 | Skin weeping | FAERS: 1 | US FAERS | |
| 1910 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 1911 | Small size placenta | FAERS: 1 | US FAERS | |
| 1912 | Smear cervix normal | FAERS: 1 | SIDER US FAERS | |
| 1913 | Somnambulism | FAERS: 1 | US FAERS | |
| 1914 | Splenic Infection | FAERS: 1 | US FAERS | |
| 1915 | Splenic cyst | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1916 | Spondylitis | FAERS: 1 | US FAERS | |
| 1917 | Status Asthmaticus | FAERS: 1 | US FAERS | |
| 1918 | Steatohepatitis | FAERS: 1 | US FAERS | |
| 1919 | Stenosis | FAERS: 1 | US FAERS | |
| 1920 | Stenotrophomonas infection | FAERS: 1 | US FAERS | |
| 1921 | Stenotrophomonas sepsis | FAERS: 1 | US FAERS | |
| 1922 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 1923 | Strangulated umbilical hernia | FAERS: 1 | US FAERS | |
| 1924 | Streptococcal abscess | FAERS: 1 | US FAERS | |
| 1925 | Streptococcal endocarditis | FAERS: 1 | US FAERS | |
| 1926 | Sturge-Weber Syndrome | FAERS: 1 | US FAERS | |
| 1927 | Suicide threat | FAERS: 1 | US FAERS | |
| 1928 | Superinfection | FAERS: 1 | US FAERS | |
| 1929 | Suspected product quality issue | FAERS: 1 | US FAERS | |
| 1930 | Suture rupture | FAERS: 1 | US FAERS | |
| 1931 | Syndactyly | FAERS: 1 | US FAERS | |
| 1932 | Syphilis | FAERS: 1 | US FAERS | |
| 1933 | Systemic leakage | FAERS: 1 | US FAERS | |
| 1934 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 1935 | Temperature regulation disorder | FAERS: 1 | US FAERS | |
| 1936 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 1937 | Terminal dribbling | FAERS: 1 | US FAERS | |
| 1938 | Testicular hypertrophy | FAERS: 1 | US FAERS | |
| 1939 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 1940 | Thirst decreased | FAERS: 1 | US FAERS | |
| 1941 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 1942 | Thrombosed varicose vein | FAERS: 1 | US FAERS | |
| 1943 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 1944 | Thyroglobulin increased | FAERS: 1 | US FAERS | |
| 1945 | Thyroid hormones decreased | FAERS: 1 | US FAERS | |
| 1946 | Thyrotoxic periodic paralysis | FAERS: 1 | US FAERS | |
| 1947 | Tongue blistering | FAERS: 1 | US FAERS | |
| 1948 | Tongue eruption | FAERS: 1 | US FAERS | |
| 1949 | Tongue erythema | FAERS: 1 | US FAERS | |
| 1950 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 1951 | Tonsillectomy | FAERS: 1 | US FAERS | |
| 1952 | Total bile acids increased | FAERS: 1 | US FAERS | |
| 1953 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 1954 | Tracheal Stenosis | FAERS: 1 | US FAERS | |
| 1955 | Transmission of an infectious agent via product | FAERS: 1 | US FAERS | |
| 1956 | Traumatic delivery | FAERS: 1 | US FAERS | |
| 1957 | Tubal Ligation | FAERS: 1 | US FAERS | |
| 1958 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 1959 | Ulnar Neuritis | FAERS: 1 | US FAERS | |
| 1960 | Ultrasound breast abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 1961 | Ultrasound ovary abnormal | FAERS: 1 | US FAERS | |
| 1962 | Ultrasound scan vagina abnormal | FAERS: 1 | US FAERS | |
| 1963 | Umbilical discharge | FAERS: 1 | US FAERS | |
| 1964 | Underweight | FAERS: 1 | US FAERS | |
| 1965 | Unhealthy diet | FAERS: 1 | US FAERS | |
| 1966 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 1967 | Ureterolithiasis | FAERS: 1 | US FAERS | |
| 1968 | Urethral Obstruction | FAERS: 1 | US FAERS | |
| 1969 | Urethral atrophy | FAERS: 1 | US FAERS | |
| 1970 | Urethral cyst | FAERS: 1 | US FAERS | |
| 1971 | Urethral discharge | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1972 | Urethral perforation | FAERS: 1 | US FAERS | |
| 1973 | Urethral spasm | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1974 | Urethritis noninfective | FAERS: 1 | US FAERS | |
| 1975 | Urinary casts present | FAERS: 1 | US FAERS | |
| 1976 | Urinary tract discomfort | FAERS: 1 | US FAERS | |
| 1977 | Urine cotinine test positive | FAERS: 1 | US FAERS | |
| 1978 | Urine human chorionic gonadotropin positive | FAERS: 1 | US FAERS | |
| 1979 | Urine leukocyte esterase positive | FAERS: 1 | US FAERS | |
| 1980 | Uterine Fistula | FAERS: 1 | US FAERS | |
| 1981 | Uterine Obstruction | FAERS: 1 | US FAERS | |
| 1982 | Uterine cervical exfoliation | FAERS: 1 | US FAERS | |
| 1983 | Uterine cervical metaplasia | FAERS: 1 | US FAERS | |
| 1984 | Uterovaginal prolapse | FAERS: 1 | US FAERS | |
| 1985 | VIth nerve paresis | FAERS: 1 | US FAERS | |
| 1986 | Vaginal Prolapse | FAERS: 1 | US FAERS | |
| 1987 | Vaginal cellulitis | FAERS: 1 | US FAERS | |
| 1988 | Vaginal exfoliation | FAERS: 1 | US FAERS | |
| 1989 | Vaginal flatulence | FAERS: 1 | US FAERS | |
| 1990 | Vaginitis chlamydial | FAERS: 1 | US FAERS | |
| 1991 | Varicophlebitis | FAERS: 1 | OFFSIDES US FAERS | |
| 1992 | Varicose vein operation | FAERS: 1 | US FAERS | |
| 1993 | Varicose veins vaginal | FAERS: 1 | US FAERS | |
| 1994 | Vascular rupture | FAERS: 1 | US FAERS | |
| 1995 | Vasculitic rash | FAERS: 1 | US FAERS | |
| 1996 | Vasospasm | FAERS: 1 | US FAERS | |
| 1997 | Venous occlusion | FAERS: 1 | US FAERS | |
| 1998 | Venous stasis retinopathy | FAERS: 1 | US FAERS | |
| 1999 | Ventricular wall thickening | FAERS: 1 | US FAERS | |
| 2000 | Vessel perforation | FAERS: 1 | US FAERS | |
| 2001 | Violent ideation | FAERS: 1 | US FAERS | |
| 2002 | Viral test positive | FAERS: 1 | US FAERS | |
| 2003 | Visual acuity reduced transiently | FAERS: 1 | US FAERS | |
| 2004 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 2005 | Vulvovaginal warts | FAERS: 1 | US FAERS | |
| 2006 | Walking aid user | FAERS: 1 | US FAERS | |
| 2007 | Walking distance test abnormal | FAERS: 1 | US FAERS | |
| 2008 | Weight | FAERS: 1 | US FAERS | |
| 2009 | White matter lesion | FAERS: 1 | US FAERS | |
| 2010 | Withdrawal bleeding irregular | FAERS: 1 | US FAERS | |
| 2011 | Wound Complication | FAERS: 1 | US FAERS | |
| 2012 | X-ray abnormal | FAERS: 1 | US FAERS | |
| 2013 | Xanthopsia | FAERS: 1 | US FAERS | |
| 2014 | intensive care | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2015 | muscle injury | FAERS: 1 | US FAERS | |
| 2016 | pH body fluid abnormal | FAERS: 1 | US FAERS | |
| 2017 | skin abrasion | FAERS: 1 | US FAERS | |
| 2018 | Abdominal bloating | SIDER | ||
| 2019 | Abnormal cervical smear | OFFSIDES | ||
| 2020 | Abnormal vision | OFFSIDES SIDER | ||
| 2021 | Acne Vulgaris | CTD | ||
| 2022 | Amenorrhea | 8576880 12554277 | CTD OFFSIDES | |
| 2023 | Amylase increased | Canada Vigilance: 1 | Canada Vigilance | |
| 2024 | Anhidrosis | OFFSIDES | ||
| 2025 | Antibody test abnormal | OFFSIDES | ||
| 2026 | Anxiety Disorders | 22634062 | CTD | |
| 2027 | Appendectomy | OFFSIDES | ||
| 2028 | Application site erythema | OFFSIDES | ||
| 2029 | Application site infection | OFFSIDES | ||
| 2030 | Application site irritation | OFFSIDES | ||
| 2031 | Application site pruritus | OFFSIDES | ||
| 2032 | Application site rash | OFFSIDES | ||
| 2033 | Application site reaction | SIDER | ||
| 2034 | Application site ulcer | OFFSIDES | ||
| 2035 | Application site urticaria | OFFSIDES | ||
| 2036 | Application site vesicles | OFFSIDES | ||
| 2037 | Arteriovenous graft thrombosis | OFFSIDES | ||
| 2038 | Biliary adenoma | OFFSIDES | ||
| 2039 | Biliary dilatation | Canada Vigilance: 1 | Canada Vigilance | |
| 2040 | Bleeding time abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 2041 | Blepharoptosis | 7491061 | CTD | |
| 2042 | Blood homocysteine | OFFSIDES | ||
| 2043 | Blood iron abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 2044 | Breast tension | SIDER | ||
| 2045 | Carcinoma, Endometrioid | 6920328 12554277 16824305 | CTD | |
| 2046 | Cardiac ventricular thrombosis | Canada Vigilance: 1 | Canada Vigilance | |
| 2047 | Cardiovascular Diseases | 6801981 9166189 | CTD | |
| 2048 | Catheter sepsis | OFFSIDES | ||
| 2049 | Cerebral aspergillosis | OFFSIDES | ||
| 2050 | Chorea | 1850638 | CTD | |
| 2051 | Colitis erosive | OFFSIDES | ||
| 2052 | Congenital hypertrichosis | OFFSIDES | ||
| 2053 | Corpus Luteum Cyst | SIDER | ||
| 2054 | Cramps of lower extremities | SIDER | ||
| 2055 | Cryptorchidism | OFFSIDES | ||
| 2056 | Decreased Libido | OFFSIDES | ||
| 2057 | Depressive disorder | 9847494 | CTD | |
| 2058 | Dysmenorrhea | OFFSIDES | ||
| 2059 | Enlargement abdomen | SIDER | ||
| 2060 | Exacerbation of acne | SIDER | ||
| 2061 | Extremity contracture | OFFSIDES | ||
| 2062 | Familial Mediterranean Fever | OFFSIDES | ||
| 2063 | Fibroadenosis of breast | SIDER | ||
| 2064 | Galactorrhea | OFFSIDES | ||
| 2065 | Gas in stomach | SIDER | ||
| 2066 | Gonococcal pelvic inflammatory disease | Canada Vigilance: 1 | Canada Vigilance | |
| 2067 | Gonorrhea | OFFSIDES | ||
| 2068 | Hemorrhage | 8671483 | CTD | |
| 2069 | Hypesthesia | 7852942 | CTD | |
| 2070 | Hypomenorrhea | OFFSIDES | ||
| 2071 | Infestation | SIDER | ||
| 2072 | Influenza-like symptoms | SIDER | ||
| 2073 | Intracranial Embolism and Thrombosis | 9673837 | CTD | |
| 2074 | Leukorrhea | SIDER | ||
| 2075 | Lightheadedness | SIDER | ||
| 2076 | Limb mass | Canada Vigilance: 1 | Canada Vigilance | |
| 2077 | Medical device site irritation | Canada Vigilance: 2 | Canada Vigilance | |
| 2078 | Menstruation Disturbances | CTD | ||
| 2079 | Mood Disorders | 11861056 | CTD | |
| 2080 | Muscle Weakness | 7491061 | CTD | |
| 2081 | Nervous tension | OFFSIDES | ||
| 2082 | Numbness | SIDER | ||
| 2083 | Optic Disc Edema | OFFSIDES | ||
| 2084 | Otitis Media | SIDER | ||
| 2085 | Papilloma | SIDER | ||
| 2086 | Paresthesia | 7852942 | CTD | |
| 2087 | Peripheral Nervous System Diseases | 7852942 | CTD | |
| 2088 | Peritoneal Infection | OFFSIDES | ||
| 2089 | Polydipsia | SIDER | ||
| 2090 | Polymenorrhea | OFFSIDES | ||
| 2091 | Post procedural dizziness | OFFSIDES | ||
| 2092 | Post procedural headache | OFFSIDES | ||
| 2093 | Post procedural nausea | OFFSIDES | ||
| 2094 | Premenstrual Tension | SIDER | ||
| 2095 | Presbyopia | OFFSIDES | ||
| 2096 | Procedural hypertension | Canada Vigilance: 1 | Canada Vigilance | |
| 2097 | Progesterone receptor assay | OFFSIDES | ||
| 2098 | Radical hysterectomy | OFFSIDES | ||
| 2099 | Rectal cancer stage I | OFFSIDES | ||
| 2100 | Rectocele | Canada Vigilance: 1 | Canada Vigilance | |
| 2101 | Redness | SIDER | ||
| 2102 | Renal interstitial fibrosis | OFFSIDES | ||
| 2103 | Renal tubular atrophy | OFFSIDES | ||
| 2104 | Skin Induration | OFFSIDES | ||
| 2105 | Stasis dermatitis | OFFSIDES | ||
| 2106 | Swelling of eyelid | Canada Vigilance: 1 | Canada Vigilance | |
| 2107 | Testicular Diseases | 21914719 | CTD | |
| 2108 | Thelitis | OFFSIDES | ||
| 2109 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 2110 | Thromboembolism | 6933346 | CTD | |
| 2111 | Thyroid Diseases | 21705715 | CTD | |
| 2112 | Ultrasound pelvis | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 2113 | Ultrasound scan vagina | Canada Vigilance: 1 | Canada Vigilance | |
| 2114 | Urinary protein increased | SIDER | ||
| 2115 | Urine flow decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 2116 | Uterine Diseases | 10875858 19821400 | CTD | |
| 2117 | Vaginal mycosis | SIDER | ||
| 2118 | Vascular purpura | SIDER | ||
| 2119 | Vestibulitis | Canada Vigilance: 1 | Canada Vigilance | |
| 2120 | Vision Disorders | 7491061 | CTD | |
| 2121 | Weight Gain | CTD OFFSIDES | ||
| 2122 | streptococcal serology | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.