MetaADEDB: Drug

MetaADEDB 2.0 @ LMMD

Dexamethasone

(UREBDLICKHMUKA-CXSFZGCWSA-N)

Structure

SMILES: OCC(=O)[C@@]1(O)[C@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2CCC2=CC(=O)C=C[C@]12C)F
Type(s): Approved; Investigational; Vet_approved
ATC code(s): A01AC02; C05AA09; D07AB19; D07CB04; D07XB05; D10AA03; H02AB02; R01AD03; R01AD53; S01BA01; S01CA01; S01CB01; S02BA06; S02CA06; S03BA01; S03CA01
Molecular Formula:: C22H29FO5
Molecular Weight:: 392.461
Log P:: 1.8957
Hydrogen Bond Acceptor:: 5
Hydrogen Bond Donor:: 3
TPSA:: 94.83
CAS Number(s):: 50-02-2; 18296; 23495-06-9

Synonym(s)

Dexamethasone

Hexadecadrol

Decaject

Decaject-L.A.

Decameth

Decaspray

Dexasone

Dexpak

Hexadrol

10.

Maxidex

11.

Methylfluorprednisolone

12.

Millicorten

13.

Oradexon

14.

Decaject L.A.

External Link(s)

MeSH	D003907
PubChem Compound	5743
BindingDB	18207 18703
ChEBI	41879
CHEMBL	CHEMBL384467
DrugBank	DB01234
DrugCentral	824
IUPHAR/BPS Guide to PHARMACOLOGY	2768 3447
KEGG	cpd:C15643 dr:D00292
Therapeutic Target Database	D0IT2G
ZINC	3875332

Adverse Drug Event(s)

	Name	Number of Reports	Reference(s)	Data Source
1	Device dislocation	FAERS: 148		SIDER US FAERS
2	Endophthalmitis	FAERS: 130		SIDER US FAERS
3	Complication of device insertion	FAERS: 120		SIDER US FAERS
4	Drug ineffective	FAERS: 120 Canada Vigilance: 2		Canada Vigilance US FAERS
5	Visual Impairment	FAERS: 70		SIDER US FAERS
6	Cataract	FAERS: 51		SIDER US FAERS
7	Blindness	FAERS: 50 Canada Vigilance: 1	1341094	CTD SIDER Canada Vigilance US FAERS
8	Eye pain	FAERS: 50 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
9	Recalled product administered	FAERS: 46		US FAERS
10	Headache	FAERS: 45 Canada Vigilance: 6	View details 7636556 10084258 10089087 10864982 11565520	CTD SIDER Canada Vigilance US FAERS
11	Retinal Detachment	FAERS: 39 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
12	Glaucoma	FAERS: 36 Canada Vigilance: 7	24691439	CTD SIDER Canada Vigilance US FAERS
13	Sepsis	FAERS: 33	10545589 23373965	CTD US FAERS
14	Respiratory Failure	FAERS: 32		OFFSIDES US FAERS
15	Strongyloidiasis	FAERS: 32 Canada Vigilance: 2		Canada Vigilance US FAERS
16	Asthenia	FAERS: 31 Canada Vigilance: 2		Canada Vigilance OFFSIDES SIDER US FAERS
17	Vomiting	FAERS: 31 Canada Vigilance: 6	View details 1659980 6539363 7695964 7993831 8826554 9186541 9544829 10089087 10688811 12099946 16256900 16304666 17600880 20552375 20623144 21383291 21539837 21808994 21840870 21996961	CTD SIDER Canada Vigilance US FAERS
18	Maternal exposure during pregnancy	FAERS: 29 Canada Vigilance: 2		Canada Vigilance US FAERS
19	Delirium	FAERS: 28 Canada Vigilance: 2	9054921	CTD Canada Vigilance US FAERS
20	Drug exposure during pregnancy	FAERS: 28		US FAERS
21	Diabetic Ketoacidosis	FAERS: 27		US FAERS
22	Nausea	FAERS: 27 Canada Vigilance: 5	View details 1749637 3098151 6539363 7636556 8891570 9234591 10089087 10688811 12099946 16256900 16304666 17600880 19800799 20552375 21383291 21539837 21808994 21840870 21996961	CTD OFFSIDES SIDER Canada Vigilance US FAERS
23	Product use issue	FAERS: 27		US FAERS
24	Ocular Hypertension	FAERS: 26	View details 3740174 6615752 7843916 9227220 9400772 9493783 10088814 11054340 11133859 11846512 14552178 15932528 16020952 16338581 17004631 17595475 19064852 24691439	CTD SIDER US FAERS
25	Pneumonia	FAERS: 26 Canada Vigilance: 1	10380089 21414392	CTD Canada Vigilance US FAERS
26	Anxiety	FAERS: 24		OFFSIDES SIDER US FAERS
27	Blood glucose increased	FAERS: 24 Canada Vigilance: 3		Canada Vigilance US FAERS
28	Eye irritation	FAERS: 23 Canada Vigilance: 1		Canada Vigilance US FAERS
29	Medication Error	FAERS: 23 Canada Vigilance: 1		Canada Vigilance US FAERS
30	Pain	FAERS: 23	View details 10864982 12075649 15742264 15953004 18640467 27608943 28559105	CTD OFFSIDES SIDER US FAERS
31	Adrenogenital Syndrome	FAERS: 21		US FAERS
32	Agitation	FAERS: 21 Canada Vigilance: 2		Canada Vigilance US FAERS
33	Corneal decompensation	FAERS: 21		US FAERS
34	Eye inflammation	FAERS: 20		US FAERS
35	Hypersensitivity	FAERS: 20	11455223 28529457	CTD SIDER US FAERS
36	Product administered at inappropriate site	FAERS: 19		US FAERS
37	Vitreous floaters	FAERS: 19		SIDER US FAERS
38	Shock	FAERS: 18		SIDER US FAERS
39	Blood cortisol decreased	FAERS: 17		OFFSIDES US FAERS
40	Blood thyroid stimulating hormone decreased	FAERS: 17		US FAERS
41	Dizziness	FAERS: 17 Canada Vigilance: 5	View details 7636556 8891570 9186541 9544829 9717322	CTD SIDER Canada Vigilance US FAERS
42	Needle issue	FAERS: 17		US FAERS
43	Product quality issue	FAERS: 17		US FAERS
44	Fatigue	FAERS: 16 Canada Vigilance: 3	View details 7636556 15953004 20385792 20400291	CTD OFFSIDES SIDER Canada Vigilance US FAERS
45	Memory impairment	FAERS: 16		US FAERS
46	Pruritus	FAERS: 16 Canada Vigilance: 4	14616644 21804303	CTD SIDER Canada Vigilance US FAERS
47	Device malfunction	FAERS: 15		US FAERS
48	Hypotension	FAERS: 15 Canada Vigilance: 1	View details 9763554 10688811 11698066 16158007 16858973	CTD SIDER Canada Vigilance US FAERS
49	Immunosuppression	FAERS: 15		OFFSIDES US FAERS
50	Myopathy	FAERS: 15 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
51	Acne	FAERS: 14 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
52	Colitis	FAERS: 14		OFFSIDES US FAERS
53	Dehydration	FAERS: 14	7695964	CTD OFFSIDES US FAERS
54	Malaise	FAERS: 14		SIDER US FAERS
55	Reverse tri-iodothyronine increased	FAERS: 14		US FAERS
56	Uveitis	FAERS: 14	1336536	CTD US FAERS
57	Crying	FAERS: 13 Canada Vigilance: 1		Canada Vigilance US FAERS
58	Diabetes Mellitus	FAERS: 13 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
59	Feeling abnormal	FAERS: 13 Canada Vigilance: 3		Canada Vigilance SIDER US FAERS
60	Infection	FAERS: 13	24673398	CTD OFFSIDES SIDER US FAERS
61	Low birth weight baby	FAERS: 13 Canada Vigilance: 3		Canada Vigilance SIDER US FAERS
62	Pneumocystis jiroveci pneumonia	FAERS: 13		US FAERS
63	Thrombocytopenia	FAERS: 13	View details 20385792 20575631 24673398 24928523	CTD SIDER US FAERS
64	Tympanic Membrane Perforation	FAERS: 13		US FAERS
65	Mental status changes	FAERS: 12		OFFSIDES US FAERS
66	Posterior capsule rupture	FAERS: 12		US FAERS
67	Pulmonary Embolism	FAERS: 12	18414984	CTD US FAERS
68	Respiratory distress	FAERS: 12		US FAERS
69	Urinary tract infection	FAERS: 12		US FAERS
70	Adverse event	FAERS: 11		US FAERS
71	Cerebral atrophy	FAERS: 11		US FAERS
72	Erythema	FAERS: 11 Canada Vigilance: 3	17495388 19489054 29458014	CTD OFFSIDES SIDER Canada Vigilance US FAERS
73	Flushing	FAERS: 11 Canada Vigilance: 3		Canada Vigilance US FAERS
74	General physical health deterioration	FAERS: 11		OFFSIDES US FAERS
75	Hypopyon	FAERS: 11		US FAERS
76	Metabolic acidosis	FAERS: 11		OFFSIDES US FAERS
77	Septic Shock	FAERS: 11 Canada Vigilance: 2		Canada Vigilance OFFSIDES US FAERS
78	Bronchopulmonary Aspergillosis	FAERS: 10		US FAERS
79	Cellulitis	FAERS: 10		OFFSIDES US FAERS
80	Cerebral Palsy	FAERS: 10	11745009 12042559 19204058	CTD US FAERS
81	Croup infectious	FAERS: 10		US FAERS
82	Disease Progression	FAERS: 10		OFFSIDES US FAERS
83	Disease recurrence	FAERS: 10		US FAERS
84	Posterior reversible encephalopathy syndrome	FAERS: 10		US FAERS
85	Swelling	FAERS: 10		US FAERS
86	Urticaria	FAERS: 10	7582165 16628721	CTD SIDER US FAERS
87	Chest Pain	FAERS: 9		US FAERS
88	Corneal Opacity	FAERS: 9		US FAERS
89	Drug withdrawal syndrome	FAERS: 9 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
90	Duodenal perforation	FAERS: 9		US FAERS
91	Gestational Diabetes	FAERS: 9		US FAERS
92	Incorrect route of drug administration	FAERS: 9		US FAERS
93	Injection site pain	FAERS: 9		US FAERS
94	Intentional self-injury	FAERS: 9		US FAERS
95	Live Birth	FAERS: 9		US FAERS
96	Mood swings	FAERS: 9		SIDER US FAERS
97	Obesity	FAERS: 9		US FAERS
98	Ocular discomfort	FAERS: 9 Canada Vigilance: 1		Canada Vigilance US FAERS
99	Overdose	FAERS: 9		US FAERS
100	Photophobia	FAERS: 9		US FAERS
101	Product use in unapproved indication	FAERS: 9		US FAERS
102	Steroid withdrawal syndrome	FAERS: 9		SIDER US FAERS
103	Wrong technique in product usage process	FAERS: 9		US FAERS
104	Abdominal Pain	FAERS: 8	1749637 9234591	CTD OFFSIDES SIDER US FAERS
105	Brain Abscess	FAERS: 8	4010863	CTD US FAERS
106	Burning sensation	FAERS: 8		US FAERS
107	Constipation	FAERS: 8 Canada Vigilance: 2	View details 7636556 10084258 10089087 15953004	CTD Canada Vigilance US FAERS
108	Device breakage	FAERS: 8		US FAERS
109	Drug abuse	FAERS: 8		US FAERS
110	Hypervigilance	FAERS: 8		US FAERS
111	Myocardial Infarction	FAERS: 8	3960084 12632228	CTD SIDER US FAERS
112	Tremor	FAERS: 8		US FAERS
113	Vitreous loss	FAERS: 8		US FAERS
114	Aspergillosis	FAERS: 7		US FAERS
115	Atrial Fibrillation	FAERS: 7 Canada Vigilance: 3		Canada Vigilance US FAERS
116	Back Pain	FAERS: 7		US FAERS
117	Blood potassium increased	FAERS: 7		US FAERS
118	Blood sodium decreased	FAERS: 7		US FAERS
119	Bone pain	FAERS: 7		US FAERS
120	Bronchopulmonary Dysplasia	FAERS: 7	View details 1735831 2235226 2358896 2651132 2903296 7575834 8339005 8417533 9084709 9097827 9253312 9303216 9527943 11158452 11455412 11745009 15044641 16651362	CTD US FAERS
121	Cardiac Arrest	FAERS: 7		SIDER US FAERS
122	Cleft Palate	FAERS: 7		US FAERS
123	Diabetes Insipidus	FAERS: 7		US FAERS
124	Diplopia	FAERS: 7		US FAERS
125	Febrile Neutropenia	FAERS: 7		OFFSIDES US FAERS
126	Gastritis	FAERS: 7		US FAERS
127	Hemiplegia	FAERS: 7		OFFSIDES US FAERS
128	Hypophagia	FAERS: 7		OFFSIDES US FAERS
129	Hypoxia	FAERS: 7		OFFSIDES US FAERS
130	Inflammation	FAERS: 7 Canada Vigilance: 1	View details 8960868 11099482 11291649 17595475 17615583 19839048 21356098 21804303 27608943	CTD Canada Vigilance US FAERS
131	Injection site erythema	FAERS: 7		US FAERS
132	Intestinal Perforation	FAERS: 7 Canada Vigilance: 2		Canada Vigilance US FAERS
133	Macular fibrosis	FAERS: 7		US FAERS
134	Oligohydramnios	FAERS: 7		US FAERS
135	Peritonitis	FAERS: 7	23872256 27568862	CTD OFFSIDES US FAERS
136	Product physical issue	FAERS: 7		US FAERS
137	Serous retinal detachment	FAERS: 7		US FAERS
138	Activities of daily living impaired	FAERS: 6		US FAERS
139	Alopecia	FAERS: 6		SIDER US FAERS
140	Amnesia	FAERS: 6 Canada Vigilance: 1	12361696	CTD Canada Vigilance US FAERS
141	Blood immunoglobulin G decreased	FAERS: 6		US FAERS
142	Blood lactate dehydrogenase increased	FAERS: 6		OFFSIDES US FAERS
143	Botryomycosis	FAERS: 6 Canada Vigilance: 2		Canada Vigilance US FAERS
144	Bradycardia	FAERS: 6 Canada Vigilance: 2	2903296 2904093	CTD SIDER Canada Vigilance US FAERS
145	Bronchial Hyperreactivity	FAERS: 6	15330010 22776411	CTD US FAERS
146	Chills	FAERS: 6		US FAERS
147	Choroidal Detachment	FAERS: 6		US FAERS
148	Cytomegalovirus chorioretinitis	FAERS: 6		US FAERS
149	Deformity	FAERS: 6		US FAERS
150	Discomfort	FAERS: 6		SIDER US FAERS
151	Disorientation	FAERS: 6		US FAERS
152	Drug dispensing error	FAERS: 6		US FAERS
153	Drug prescribing error	FAERS: 6		US FAERS
154	Epistaxis	FAERS: 6 Canada Vigilance: 1		Canada Vigilance US FAERS
155	Foreign body sensation in eyes	FAERS: 6		US FAERS
156	Hemiparesis	FAERS: 6		US FAERS
157	Leukopenia	FAERS: 6	12601542	CTD US FAERS
158	Medical device complication	FAERS: 6		US FAERS
159	Neutropenia	FAERS: 6	12601542 20385792 24928523	CTD US FAERS
160	Oral candidiasis	FAERS: 6		US FAERS
161	Retinal Vein Occlusion	FAERS: 6		US FAERS
162	Tachycardia	FAERS: 6	6256527	CTD SIDER US FAERS
163	Weight decreased	FAERS: 6 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
164	Zygomycosis	FAERS: 6		US FAERS
165	nervous system disorder	FAERS: 6		SIDER US FAERS
166	Abdominal discomfort	FAERS: 5 Canada Vigilance: 2		Canada Vigilance OFFSIDES US FAERS
167	Acute myocardial infarction	FAERS: 5		OFFSIDES US FAERS
168	Acute psychosis	FAERS: 5		US FAERS
169	Amniotic fluid volume decreased	FAERS: 5		US FAERS
170	Anger	FAERS: 5 Canada Vigilance: 1		Canada Vigilance US FAERS
171	Blood corticotrophin increased	FAERS: 5		US FAERS
172	Blood glucose abnormal	FAERS: 5		US FAERS
173	Central nervous system lesion	FAERS: 5		US FAERS
174	Device deployment issue	FAERS: 5		US FAERS
175	Drug administered at inappropriate site	FAERS: 5		US FAERS
176	Dysphonia	FAERS: 5	15785267	CTD US FAERS
177	Escherichia sepsis	FAERS: 5		US FAERS
178	Hyperpyrexia	FAERS: 5		US FAERS
179	Hypertensive crisis	FAERS: 5		US FAERS
180	Ileus	FAERS: 5 Canada Vigilance: 1		Canada Vigilance US FAERS
181	Injection site warmth	FAERS: 5		US FAERS
182	Iritis	FAERS: 5		US FAERS
183	Keratitis	FAERS: 5 Canada Vigilance: 1	4232838	CTD SIDER Canada Vigilance US FAERS
184	Keratopathy	FAERS: 5		US FAERS
185	Lethargy	FAERS: 5		SIDER US FAERS
186	Myopia	FAERS: 5	16338581	CTD US FAERS
187	Non-infectious endophthalmitis	FAERS: 5		US FAERS
188	Otitis Externa	FAERS: 5		US FAERS
189	Palpitations	FAERS: 5		US FAERS
190	Paranoia	FAERS: 5 Canada Vigilance: 1		Canada Vigilance US FAERS
191	Polydactyly	FAERS: 5		US FAERS
192	Polyuria	FAERS: 5 Canada Vigilance: 1	7695964 7790612	CTD Canada Vigilance US FAERS
193	Product contamination	FAERS: 5		US FAERS
194	Somnolence	FAERS: 5 Canada Vigilance: 1		Canada Vigilance US FAERS
195	Substance-induced mood disorder	FAERS: 5		US FAERS
196	Superinfection	FAERS: 5		US FAERS
197	Unevaluable event	FAERS: 5 Canada Vigilance: 1		Canada Vigilance US FAERS
198	Abulia	FAERS: 4		US FAERS
199	Accidental overdose	FAERS: 4		US FAERS
200	Acute kidney injury	FAERS: 4	8546128 9763554	CTD US FAERS
201	Acute respiratory failure	FAERS: 4		US FAERS
202	Anaphylactic shock	FAERS: 4		SIDER US FAERS
203	Arthralgia	FAERS: 4		SIDER US FAERS
204	Ascites	FAERS: 4		US FAERS
205	Blood chloride decreased	FAERS: 4		US FAERS
206	Bone infarction	FAERS: 4		OFFSIDES US FAERS
207	Conjunctivitis	FAERS: 4 Canada Vigilance: 1	7582165	CTD SIDER Canada Vigilance US FAERS
208	Deep Vein Thrombosis	FAERS: 4		US FAERS
209	Depressed Level of Consciousness	FAERS: 4 Canada Vigilance: 2		Canada Vigilance OFFSIDES US FAERS
210	Detachment of retinal pigment epithelium	FAERS: 4		US FAERS
211	Device use error	FAERS: 4		US FAERS
212	Disseminated Intravascular Coagulation	FAERS: 4	19112952	CTD OFFSIDES US FAERS
213	Drug Dependence	FAERS: 4		SIDER US FAERS
214	Drug effect incomplete	FAERS: 4		US FAERS
215	Drug resistance	FAERS: 4		US FAERS
216	Ecchymosis	FAERS: 4		SIDER US FAERS
217	Epidural lipomatosis	FAERS: 4		US FAERS
218	Escherichia infection	FAERS: 4 Canada Vigilance: 1		Canada Vigilance US FAERS
219	Gastroenteritis	FAERS: 4		OFFSIDES US FAERS
220	Haematotoxicity	FAERS: 4		OFFSIDES US FAERS
221	Hepatorenal Syndrome	FAERS: 4		US FAERS
222	Hypertrophic Cardiomyopathy	FAERS: 4		SIDER US FAERS
223	Incorrect drug administration duration	FAERS: 4		US FAERS
224	Leukocytosis	FAERS: 4		SIDER US FAERS
225	Listeriosis	FAERS: 4		US FAERS
226	Migration of implanted drug	FAERS: 4		US FAERS
227	Mucormycosis	FAERS: 4		OFFSIDES US FAERS
228	Multiple Myeloma	FAERS: 4	View details 1445746 1806033 7549842 9234591 9436937 9445200 11979358 12229885 12724497 12855565 14587053 15045823 15048060 15070696 15161947 15314284 15528922 15574755 15693790 15744524 15867202 15953004 16118317 16166312 16330438 16397023 16520348 16790586 16840727 16860177 16923587 17050881 18414984 18696182 19259673 19274460 19330649 20038224 20192986 20351701 20379113 20385792 20423566 20458563 20864405 20979938 21245421 23063726 23318440 23864035 23892921 24673398 24928523 29177954	CTD OFFSIDES US FAERS
229	Myalgia	FAERS: 4		SIDER US FAERS
230	Mydriasis	FAERS: 4 Canada Vigilance: 1		Canada Vigilance US FAERS
231	Nephrolithiasis	FAERS: 4		US FAERS
232	Nervousness	FAERS: 4 Canada Vigilance: 1		Canada Vigilance US FAERS
233	Personality Change	FAERS: 4 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
234	Placental Insufficiency	FAERS: 4		US FAERS
235	Plasmacytoma	FAERS: 4		OFFSIDES US FAERS
236	Restlessness	FAERS: 4 Canada Vigilance: 1		Canada Vigilance US FAERS
237	Retinitis	FAERS: 4		US FAERS
238	Syncope	FAERS: 4		SIDER US FAERS
239	Therapy non-responder	FAERS: 4		US FAERS
240	Tinnitus	FAERS: 4	15742264	CTD US FAERS
241	Vitritis	FAERS: 4		US FAERS
242	Abdominal Infection	FAERS: 3		US FAERS
243	Acute Coronary Syndrome	FAERS: 3		SIDER US FAERS
244	Ageusia	FAERS: 3		US FAERS
245	Anterior chamber inflammation	FAERS: 3		SIDER US FAERS
246	Aortic Aneurysm	FAERS: 3		US FAERS
247	Aphasia	FAERS: 3	17356399	CTD US FAERS
248	Asthma	FAERS: 3	View details 15330010 16569937 16740865 23210436	CTD US FAERS
249	Bipolar Disorder	FAERS: 3	7918509	CTD US FAERS
250	Blood cortisol increased	FAERS: 3		US FAERS
251	Blood glucose decreased	FAERS: 3		US FAERS
252	Body height below normal	FAERS: 3		US FAERS
253	Brain empyema	FAERS: 3		US FAERS
254	Cardiomegaly	FAERS: 3	View details 1533279 9303216 10942214 11455412 12438668	CTD SIDER US FAERS
255	Catatonia	FAERS: 3		US FAERS
256	Central Nervous System Infection	FAERS: 3		US FAERS
257	Cerebellar infarction	FAERS: 3		US FAERS
258	Cerebral aspergillosis	FAERS: 3		US FAERS
259	Cerebrovascular accident	FAERS: 3		US FAERS
260	Completed Suicide	FAERS: 3		US FAERS
261	Corneal Perforation	FAERS: 3		US FAERS
262	Corneal abscess	FAERS: 3		US FAERS
263	Corneal lesion	FAERS: 3		US FAERS
264	Corneal thinning	FAERS: 3		SIDER US FAERS
265	Counterfeit drug administered	FAERS: 3		US FAERS
266	Dementia	FAERS: 3 Canada Vigilance: 1		Canada Vigilance US FAERS
267	Diverticular perforation	FAERS: 3		US FAERS
268	Drug diversion	FAERS: 3		US FAERS
269	Drug dose omission	FAERS: 3		US FAERS
270	Drug ineffective for unapproved indication	FAERS: 3		US FAERS
271	Epilepsy	FAERS: 3	1331416 19813778	CTD SIDER US FAERS
272	Eye Infection	FAERS: 3 Canada Vigilance: 1		Canada Vigilance OFFSIDES SIDER US FAERS
273	Eye complication associated with device	FAERS: 3		US FAERS
274	Fluid overload	FAERS: 3		OFFSIDES US FAERS
275	Glioblastoma Multiforme	FAERS: 3		US FAERS
276	Granuloma	FAERS: 3	21149847	CTD US FAERS
277	Growth retardation	FAERS: 3		SIDER US FAERS
278	Hepatitis B	FAERS: 3		US FAERS
279	Hypopituitarism	FAERS: 3	10463118	CTD US FAERS
280	Impaired work ability	FAERS: 3		US FAERS
281	Incorrect dose administered	FAERS: 3		US FAERS
282	Incorrect route of product administration	FAERS: 3		US FAERS
283	Influenza	FAERS: 3		US FAERS
284	Intentional product misuse	FAERS: 3		US FAERS
285	Iridocyclitis	FAERS: 3		US FAERS
286	Joint swelling	FAERS: 3		US FAERS
287	Large intestine perforation	FAERS: 3		US FAERS
288	Lymphadenopathy	FAERS: 3		US FAERS
289	Macular degeneration	FAERS: 3		US FAERS
290	Malignant neoplasm progression	FAERS: 3		OFFSIDES US FAERS
291	Maternal exposure during delivery	FAERS: 3		US FAERS
292	Mental impairment	FAERS: 3		US FAERS
293	Multiple Sclerosis	FAERS: 3		US FAERS
294	Musculoskeletal Pain	FAERS: 3		OFFSIDES US FAERS
295	Myocarditis	FAERS: 3		US FAERS
296	Neonatal disorder	FAERS: 3		US FAERS
297	Oropharyngeal pain	FAERS: 3		US FAERS
298	Osteomyelitis	FAERS: 3		OFFSIDES US FAERS
299	Otitis Media	FAERS: 3		US FAERS
300	Pancreatitis	FAERS: 3		SIDER US FAERS
301	Pancytopenia	FAERS: 3		US FAERS
302	Panophthalmitis	FAERS: 3		SIDER US FAERS
303	Pneumothorax	FAERS: 3		OFFSIDES US FAERS
304	Post procedural complication	FAERS: 3		US FAERS
305	Prescribed overdose	FAERS: 3		US FAERS
306	Psychomotor skills impaired	FAERS: 3		US FAERS
307	Rebound effect	FAERS: 3		US FAERS
308	Retinal Artery Occlusion	FAERS: 3		US FAERS
309	Scedosporium infection	FAERS: 3		US FAERS
310	Screaming	FAERS: 3		US FAERS
311	Stress	FAERS: 3		US FAERS
312	Thirst	FAERS: 3 Canada Vigilance: 1		Canada Vigilance US FAERS
313	Thrombosis	FAERS: 3	16790586 20385792 20979938	CTD US FAERS
314	Toxicity to various agents	FAERS: 3		US FAERS
315	Tuberculosis	FAERS: 3		SIDER US FAERS
316	Unresponsive to stimuli	FAERS: 3		US FAERS
317	Vitreous opacities	FAERS: 3		SIDER US FAERS
318	Wound sepsis	FAERS: 3		US FAERS
319	treatment failure	FAERS: 3		US FAERS
320	Abasia	FAERS: 2		US FAERS
321	Acanthosis Nigricans	FAERS: 2		US FAERS
322	Altered visual depth perception	FAERS: 2		US FAERS
323	Angina Pectoris	FAERS: 2		US FAERS
324	Angioedema	FAERS: 2		OFFSIDES SIDER US FAERS
325	Anorexia	FAERS: 2	15824971	CTD OFFSIDES SIDER US FAERS
326	Appendicitis	FAERS: 2		US FAERS
327	Balamuthia Infection	FAERS: 2		US FAERS
328	Belligerence	FAERS: 2		US FAERS
329	Blood albumin decreased	FAERS: 2		OFFSIDES US FAERS
330	Blood immunoglobulin G increased	FAERS: 2		US FAERS
331	Blood potassium decreased	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
332	Blood urea increased	FAERS: 2		OFFSIDES US FAERS
333	Brief psychotic disorder, with postpartum onset	FAERS: 2		US FAERS
334	Bronchopneumonia	FAERS: 2		US FAERS
335	Candidiasis	FAERS: 2		US FAERS
336	Carbon dioxide abnormal	FAERS: 2		US FAERS
337	Cardiac Flutter	FAERS: 2		US FAERS
338	Cardiac Hypertrophy	FAERS: 2		US FAERS
339	Cerebral Infarction	FAERS: 2	2739598	CTD US FAERS
340	Cerebral ventricle dilatation	FAERS: 2		US FAERS
341	Chest discomfort	FAERS: 2		US FAERS
342	Cholelithiasis	FAERS: 2		US FAERS
343	Chorea	FAERS: 2		US FAERS
344	Concomitant disease aggravated	FAERS: 2		US FAERS
345	Confabulation	FAERS: 2		OFFSIDES US FAERS
346	Congenital diaphragmatic hernia	FAERS: 2		US FAERS
347	Conjunctival laceration	FAERS: 2		US FAERS
348	Contraindicated drug administered	FAERS: 2		US FAERS
349	Contraindicated product administered	FAERS: 2		US FAERS
350	Corneal defect	FAERS: 2		US FAERS
351	Corneal epithelium defect	FAERS: 2		US FAERS
352	Cortisol deficiency	FAERS: 2		US FAERS
353	Cytomegalovirus test	FAERS: 2		US FAERS
354	Deafness	FAERS: 2	2419818	CTD US FAERS
355	Device expulsion	FAERS: 2		US FAERS
356	Diet refusal	FAERS: 2		US FAERS
357	Drug withdrawal convulsions	FAERS: 2		US FAERS
358	Dry skin	FAERS: 2		SIDER US FAERS
359	Ductus arteriosus premature closure	FAERS: 2		US FAERS
360	Duodenal Ulcer	FAERS: 2		US FAERS
361	Dysgeusia	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
362	Dyspepsia	FAERS: 2	16552437	CTD SIDER US FAERS
363	Emotional disorder	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
364	Emotional distress	FAERS: 2		OFFSIDES US FAERS
365	Episcleritis	FAERS: 2		US FAERS
366	Erysipelas	FAERS: 2		US FAERS
367	Escherichia urinary tract infection	FAERS: 2		US FAERS
368	Expired product administered	FAERS: 2		US FAERS
369	Eye ulcer	FAERS: 2		US FAERS
370	Failure to Thrive	FAERS: 2		OFFSIDES US FAERS
371	Familial Periodic Paralysis	FAERS: 2		US FAERS
372	Flight of ideas	FAERS: 2		US FAERS
373	Foreign body in respiratory tract	FAERS: 2		US FAERS
374	Fungal abscess central nervous system	FAERS: 2		US FAERS
375	Gastric ulcer	FAERS: 2		US FAERS
376	Gastrointestinal motility disorder	FAERS: 2		US FAERS
377	Gastrostomy	FAERS: 2		US FAERS
378	Gaze palsy	FAERS: 2		US FAERS
379	Grip strength decreased	FAERS: 2		US FAERS
380	Hepatosplenomegaly	FAERS: 2		US FAERS
381	Hirsutism	FAERS: 2 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
382	Histiocytosis haematophagic	FAERS: 2		US FAERS
383	Hunger	FAERS: 2		US FAERS
384	Hydrothorax	FAERS: 2		US FAERS
385	Hyperreflexia	FAERS: 2		US FAERS
386	Hypoaldosteronism	FAERS: 2		US FAERS
387	Hypomania	FAERS: 2		US FAERS
388	Implant site reaction	FAERS: 2		US FAERS
389	Incorrect product administration duration	FAERS: 2		US FAERS
390	Injection site ulcer	FAERS: 2		US FAERS
391	Insulin Resistance	FAERS: 2	19852296 19967395	CTD US FAERS
392	Ketoacidosis	FAERS: 2		US FAERS
393	Lenticular injury	FAERS: 2		US FAERS
394	Lip swelling	FAERS: 2		US FAERS
395	Lung Abscess	FAERS: 2		US FAERS
396	Meconium plug syndrome	FAERS: 2		US FAERS
397	Meningitis	FAERS: 2 Canada Vigilance: 1	10545589 17329921	CTD SIDER Canada Vigilance US FAERS
398	Muscle Rigidity	FAERS: 2		US FAERS
399	Nasal discomfort	FAERS: 2		US FAERS
400	Nasopharyngitis	FAERS: 2		US FAERS
401	Neonatal respiratory distress	FAERS: 2		US FAERS
402	Nephrocalcinosis	FAERS: 2		US FAERS
403	Nodule on extremity	FAERS: 2		US FAERS
404	Non-cardiac chest pain	FAERS: 2		US FAERS
405	Oliguria	FAERS: 2	16858973	CTD US FAERS
406	Optic Atrophy	FAERS: 2		US FAERS
407	Optic Neuropathy	FAERS: 2		US FAERS
408	Osteoporosis	FAERS: 2	View details 10463118 27387537 27478807 28363435	CTD SIDER US FAERS
409	Pachymeningitis	FAERS: 2		US FAERS
410	Patent ductus arteriosus	FAERS: 2		US FAERS
411	Peptic Ulcer Perforation	FAERS: 2		US FAERS
412	Pericardial effusion	FAERS: 2	9763554 12632228 16858973	CTD US FAERS
413	Pharyngolaryngeal Pain	FAERS: 2		US FAERS
414	Pneumoperitoneum	FAERS: 2		OFFSIDES US FAERS
415	Polyhydramnios	FAERS: 2		US FAERS
416	Polymyalgia Rheumatica	FAERS: 2		US FAERS
417	Polymyositis	FAERS: 2		US FAERS
418	Poor peripheral circulation	FAERS: 2		US FAERS
419	Poor quality sleep	FAERS: 2		US FAERS
420	Post procedural infection	FAERS: 2		US FAERS
421	Posterior capsule opacification	FAERS: 2		US FAERS
422	Postoperative wound complication	FAERS: 2		US FAERS
423	Procedural complication	FAERS: 2		US FAERS
424	Product administration error	FAERS: 2		US FAERS
425	Product availability issue	FAERS: 2		US FAERS
426	Product physical consistency issue	FAERS: 2		US FAERS
427	Productive Cough	FAERS: 2		US FAERS
428	Pseudoendophthalmitis	FAERS: 2		US FAERS
429	Pseudomonas test positive	FAERS: 2		US FAERS
430	Quadriparesis	FAERS: 2		US FAERS
431	Rash erythematous	FAERS: 2 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
432	Reaction to drug excipients	FAERS: 2		US FAERS
433	Renin increased	FAERS: 2		US FAERS
434	Retinal Degeneration	FAERS: 2		US FAERS
435	Retinal Vasculitis	FAERS: 2		US FAERS
436	Retinal pigmentation	FAERS: 2		US FAERS
437	Reverse tri-iodothyronine decreased	FAERS: 2		US FAERS
438	Rhabdomyolysis	FAERS: 2		US FAERS
439	Right Ventricular Dysfunction	FAERS: 2		US FAERS
440	Skin Ulcer	FAERS: 2		US FAERS
441	Skin lesion	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
442	Suspected product contamination	FAERS: 2		US FAERS
443	Thyrotoxic periodic paralysis	FAERS: 2		US FAERS
444	Toxoplasmosis	FAERS: 2		US FAERS
445	Tuberculosis of intrathoracic lymph nodes	FAERS: 2		US FAERS
446	Tumour haemorrhage	FAERS: 2		US FAERS
447	Ulcer	FAERS: 2		OFFSIDES SIDER US FAERS
448	Unmasking of previously unidentified disease	FAERS: 2		US FAERS
449	Vaginal Discharge	FAERS: 2		US FAERS
450	Varicella Zoster Virus Infection	FAERS: 2		US FAERS
451	Venous Thrombosis	FAERS: 2	View details 12229885 15048060 16840727 17549307 18278812 18414984 23892921	CTD US FAERS
452	Ventricular hypertrophy	FAERS: 2		US FAERS
453	Vitreous Detachment	FAERS: 2		SIDER US FAERS
454	Vocal Cord Paralysis	FAERS: 2		US FAERS
455	Wound infection staphylococcal	FAERS: 2		US FAERS
456	Wrong drug administered	FAERS: 2		US FAERS
457	Wrong technique in device usage process	FAERS: 2		US FAERS
458	Wrong technique in drug usage process	FAERS: 2		US FAERS
459	17-hydroxyprogesterone increased	FAERS: 1		US FAERS
460	Absorbable device issue	FAERS: 1		US FAERS
461	Accidental exposure to product	FAERS: 1		US FAERS
462	Acidosis	FAERS: 1		OFFSIDES US FAERS
463	Adrenal atrophy	FAERS: 1		US FAERS
464	Alveolar lung disease	FAERS: 1		US FAERS
465	Anal abscess	FAERS: 1		US FAERS
466	Anastomotic Leak	FAERS: 1		US FAERS
467	Anastomotic complication	FAERS: 1		US FAERS
468	Anhedonia	FAERS: 1		US FAERS
469	Anterior capsular rupture	FAERS: 1		US FAERS
470	Anuria	FAERS: 1		US FAERS
471	Aphonia	FAERS: 1		US FAERS
472	Aspiration tracheal abnormal	FAERS: 1		US FAERS
473	Atelectasis	FAERS: 1		US FAERS
474	Bacillus infection	FAERS: 1		US FAERS
475	Bacillus test positive	FAERS: 1		US FAERS
476	Bacterial abscess central nervous system	FAERS: 1		US FAERS
477	Bacterial sepsis	FAERS: 1		OFFSIDES US FAERS
478	Bacteriuria	FAERS: 1		US FAERS
479	Bedridden	FAERS: 1		US FAERS
480	Biliary dilatation	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
481	Biliary sepsis	FAERS: 1		US FAERS
482	Bilirubin conjugated increased	FAERS: 1		US FAERS
483	Bipolar I disorder	FAERS: 1		US FAERS
484	Bladder pain	FAERS: 1		US FAERS
485	Blood cholesterol increased	FAERS: 1		US FAERS
486	Blood creatine increased	FAERS: 1		US FAERS
487	Blood creatinine increased	FAERS: 1		OFFSIDES US FAERS
488	Blood lactate dehydrogenase abnormal	FAERS: 1		US FAERS
489	Blood lactic acid abnormal	FAERS: 1		US FAERS
490	Blood urine present	FAERS: 1		US FAERS
491	Bone lesion	FAERS: 1		OFFSIDES US FAERS
492	Borderline glaucoma	FAERS: 1		US FAERS
493	Brain stem thrombosis	FAERS: 1		US FAERS
494	Cachexia	FAERS: 1		US FAERS
495	Candidiasis of trachea	FAERS: 1		US FAERS
496	Carcinoembryonic antigen increased	FAERS: 1		US FAERS
497	Cardiac ablation	FAERS: 1		US FAERS
498	Cardiac valve vegetation	FAERS: 1		US FAERS
499	Cataract operation	FAERS: 1		US FAERS
500	Catheter related infection	FAERS: 1		US FAERS
501	Cerebral cyst	FAERS: 1		US FAERS
502	Cholangitis	FAERS: 1	11677951	CTD US FAERS
503	Cholecystitis	FAERS: 1		OFFSIDES US FAERS
504	Chorioretinitis	FAERS: 1		US FAERS
505	Chromaturia	FAERS: 1		US FAERS
506	Ciliary zonular dehiscence	FAERS: 1		US FAERS
507	Circumstance or information capable of leading to device use error	FAERS: 1		US FAERS
508	Citrobacter infection	FAERS: 1		OFFSIDES US FAERS
509	Clostridium difficile colitis	FAERS: 1		OFFSIDES US FAERS
510	Clostridium difficile infection	FAERS: 1		US FAERS
511	Clostridium test positive	FAERS: 1		US FAERS
512	Complex partial seizures	FAERS: 1		US FAERS
513	Complication associated with device	FAERS: 1		US FAERS
514	Congenital pneumonia	FAERS: 1		US FAERS
515	Corneal degeneration	FAERS: 1		US FAERS
516	Corneal exfoliation	FAERS: 1		US FAERS
517	Corneal leukoma	FAERS: 1		US FAERS
518	Cryptococcal cutaneous infection	FAERS: 1		US FAERS
519	Culture urine positive	FAERS: 1		US FAERS
520	Cyanosis	FAERS: 1		OFFSIDES US FAERS
521	Cyst	FAERS: 1		US FAERS
522	Cytolytic hepatitis	FAERS: 1		US FAERS
523	Cytomegalovirus gastrointestinal ulcer	FAERS: 1		US FAERS
524	Deposit eye	FAERS: 1		US FAERS
525	Depressed mood	FAERS: 1		US FAERS
526	Dermatitis	FAERS: 1		SIDER US FAERS
527	Developmental Coordination Disorder	FAERS: 1		US FAERS
528	Device Failure	FAERS: 1		US FAERS
529	Device defective	FAERS: 1		US FAERS
530	Device difficult to use	FAERS: 1		US FAERS
531	Device ineffective	FAERS: 1		US FAERS
532	Device material issue	FAERS: 1		US FAERS
533	Device occlusion	FAERS: 1		US FAERS
534	Diplegia	FAERS: 1		SIDER US FAERS
535	Disease complication	FAERS: 1		US FAERS
536	Diverticulitis	FAERS: 1		US FAERS
537	Drooling	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
538	Drug abuser	FAERS: 1		US FAERS
539	Drug administration error	FAERS: 1		OFFSIDES US FAERS
540	Drug dispensed to wrong patient	FAERS: 1		US FAERS
541	Drug monitoring procedure not performed	FAERS: 1		US FAERS
542	Duodenal ulcer perforation	FAERS: 1		US FAERS
543	Dysarthria	FAERS: 1		US FAERS
544	Dysuria	FAERS: 1		US FAERS
545	Ejection Fraction Decreased	FAERS: 1		OFFSIDES US FAERS
546	Electrocardiogram T wave amplitude increased	FAERS: 1		US FAERS
547	Electrocardiogram T wave peaked	FAERS: 1		US FAERS
548	Electrolyte imbalance	FAERS: 1		SIDER US FAERS
549	Empty Sella Syndrome	FAERS: 1		US FAERS
550	Empyema	FAERS: 1		US FAERS
551	Encephalocele	FAERS: 1		US FAERS
552	Endocardial Fibroelastosis	FAERS: 1		US FAERS
553	Enophthalmos	FAERS: 1		US FAERS
554	Enterococcal infection	FAERS: 1		US FAERS
555	Enterovirus test positive	FAERS: 1		US FAERS
556	Entropion	FAERS: 1		US FAERS
557	Eosinophilia	FAERS: 1	12944497 21916510	CTD US FAERS
558	Erdheim-Chester Disease	FAERS: 1		US FAERS
559	Eructation	FAERS: 1		US FAERS
560	Excoriation	FAERS: 1		US FAERS
561	Exposure during breast feeding	FAERS: 1		US FAERS
562	Extra dose administered	FAERS: 1		US FAERS
563	Eye allergy	FAERS: 1		US FAERS
564	Eyelid Function Disorder	FAERS: 1		US FAERS
565	Eyelid infection	FAERS: 1		US FAERS
566	Eyelid irritation	FAERS: 1		US FAERS
567	Eyelids pruritus	FAERS: 1		US FAERS
568	Facial Pain	FAERS: 1		US FAERS
569	Facial Paresis	FAERS: 1		US FAERS
570	Fat redistribution	FAERS: 1		US FAERS
571	Feeling Cold	FAERS: 1		US FAERS
572	Feeling jittery	FAERS: 1		US FAERS
573	Fibrosis	FAERS: 1	12414515	CTD US FAERS
574	Fixed eruption	FAERS: 1		US FAERS
575	Fracture	FAERS: 1		SIDER US FAERS
576	Fungal test positive	FAERS: 1		US FAERS
577	Gait inability	FAERS: 1		US FAERS
578	Gastrointestinal erosion	FAERS: 1		US FAERS
579	Gastrointestinal hypomotility	FAERS: 1		US FAERS
580	Gastrointestinal inflammation	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
581	Gastrointestinal mucosal exfoliation	FAERS: 1		US FAERS
582	Gastrointestinal perforation	FAERS: 1		OFFSIDES US FAERS
583	General symptom	FAERS: 1		US FAERS
584	Genital burning sensation	FAERS: 1		US FAERS
585	Glossitis	FAERS: 1		US FAERS
586	Gout	FAERS: 1		US FAERS
587	Hallucinations, mixed	FAERS: 1		US FAERS
588	Head Banging	FAERS: 1		US FAERS
589	Head circumference abnormal	FAERS: 1		US FAERS
590	Heart valve calcification	FAERS: 1		US FAERS
591	Hepatic Encephalopathy	FAERS: 1		US FAERS
592	Hepatic Vein Thrombosis	FAERS: 1		US FAERS
593	Hepatitis C	FAERS: 1		OFFSIDES US FAERS
594	Human rhinovirus test positive	FAERS: 1		US FAERS
595	Hyperoxaluria	FAERS: 1		US FAERS
596	Hypersplenism	FAERS: 1		US FAERS
597	Hypertrophy	FAERS: 1	19158320	CTD US FAERS
598	Hyperventilation	FAERS: 1		US FAERS
599	Hypothyroidism	FAERS: 1		US FAERS
600	Illogical thinking	FAERS: 1		US FAERS
601	Impaired driving ability	FAERS: 1		US FAERS
602	Implantable defibrillator malfunction	FAERS: 1		US FAERS
603	Incision site abscess	FAERS: 1		US FAERS
604	Incontinence	FAERS: 1		OFFSIDES US FAERS
605	Infectious colitis	FAERS: 1		US FAERS
606	Infectious peritonitis	FAERS: 1		US FAERS
607	Infertility	FAERS: 1		US FAERS
608	Infestation	FAERS: 1		US FAERS
609	Injection Site Reaction	FAERS: 1		US FAERS
610	Injection site extravasation	FAERS: 1		US FAERS
611	Injection site irritation	FAERS: 1		US FAERS
612	Injection site scab	FAERS: 1		US FAERS
613	Injection site streaking	FAERS: 1		US FAERS
614	Instillation site erythema	FAERS: 1		US FAERS
615	Intelligence test abnormal	FAERS: 1		US FAERS
616	Intentional product use issue	FAERS: 1		US FAERS
617	Intestinal Obstruction	FAERS: 1		US FAERS
618	Intestinal resection	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
619	Intestinal stoma	FAERS: 1		US FAERS
620	Intra-abdominal pressure increased	FAERS: 1		US FAERS
621	Intrauterine infection	FAERS: 1		US FAERS
622	Joint Tuberculosis	FAERS: 1		US FAERS
623	Joint injury	FAERS: 1		US FAERS
624	Laboratory test interference	FAERS: 1		US FAERS
625	Left Ventricular Hypertrophy	FAERS: 1		US FAERS
626	Lens dislocation	FAERS: 1		US FAERS
627	Leukoencephalopathy	FAERS: 1		US FAERS
628	Limb discomfort	FAERS: 1		US FAERS
629	Limb injury	FAERS: 1		US FAERS
630	Lipohypertrophy	FAERS: 1		US FAERS
631	Livedo Reticularis	FAERS: 1		US FAERS
632	Loss of visual contrast sensitivity	FAERS: 1		US FAERS
633	Lung consolidation	FAERS: 1		US FAERS
634	Lymphohistiocytosis	FAERS: 1		US FAERS
635	Macular pseudohole	FAERS: 1		US FAERS
636	Malnutrition	FAERS: 1		US FAERS
637	Maternal exposure timing unspecified	FAERS: 1		US FAERS
638	Medication monitoring error	FAERS: 1		US FAERS
639	Meningioma surgery	FAERS: 1		US FAERS
640	Metanephrine urine increased	FAERS: 1		US FAERS
641	Metrorrhagia	FAERS: 1		US FAERS
642	Muscle strain	FAERS: 1		US FAERS
643	Natural killer-cell lymphoblastic lymphoma	FAERS: 1		US FAERS
644	Necrosis	FAERS: 1	11751287 16146070 19997867	CTD SIDER US FAERS
645	Neonatal respiratory failure	FAERS: 1		US FAERS
646	Nerve injury	FAERS: 1		SIDER US FAERS
647	Neuroma	FAERS: 1		US FAERS
648	Neurosyphilis	FAERS: 1		US FAERS
649	Neutrophil count decreased	FAERS: 1		OFFSIDES US FAERS
650	No adverse event	FAERS: 1		US FAERS
651	Nocturia	FAERS: 1		US FAERS
652	Nodule	FAERS: 1		US FAERS
653	Normetanephrine urine increased	FAERS: 1		US FAERS
654	Obsessive-Compulsive Disorder	FAERS: 1	6834027 16145191	CTD US FAERS
655	Obstruction	FAERS: 1		US FAERS
656	Ocular Toxicity	FAERS: 1		US FAERS
657	Ocular fistula	FAERS: 1		US FAERS
658	Ocular vascular disorder	FAERS: 1		US FAERS
659	Open globe injury	FAERS: 1		US FAERS
660	Optic nerve cupping	FAERS: 1		US FAERS
661	Oral fungal infection	FAERS: 1		US FAERS
662	Osteitis	FAERS: 1		US FAERS
663	Pancreatic Cyst	FAERS: 1		US FAERS
664	Pancreatic Pseudocyst	FAERS: 1		US FAERS
665	Pancreatic carcinoma	FAERS: 1		US FAERS
666	Papule	FAERS: 1		US FAERS
667	Paraplegia	FAERS: 1		SIDER US FAERS
668	Pathological fracture	FAERS: 1		US FAERS
669	Perineal pain	FAERS: 1		US FAERS
670	Pharmaceutical product complaint	FAERS: 1		US FAERS
671	Placental hypertrophy	FAERS: 1		US FAERS
672	Platelet count abnormal	FAERS: 1		US FAERS
673	Pneumatosis Cystoides Intestinalis	FAERS: 1		US FAERS
674	Pneumatosis intestinalis	FAERS: 1		US FAERS
675	Pneumonitis	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
676	Pneumovirus test positive	FAERS: 1		US FAERS
677	Polydipsia	FAERS: 1		US FAERS
678	Polyneuropathy	FAERS: 1		US FAERS
679	Postoperative infection	FAERS: 1		US FAERS
680	Prader-Willi Syndrome	FAERS: 1		US FAERS
681	Pregnancy	FAERS: 1		US FAERS
682	Procedural site reaction	FAERS: 1		US FAERS
683	Product complaint	FAERS: 1		US FAERS
684	Product container issue	FAERS: 1		US FAERS
685	Product dosage form issue	FAERS: 1		US FAERS
686	Product dose omission	FAERS: 1		US FAERS
687	Product dropper issue	FAERS: 1		US FAERS
688	Product formulation issue	FAERS: 1		US FAERS
689	Product packaging quantity issue	FAERS: 1		US FAERS
690	Product residue present	FAERS: 1		US FAERS
691	Progressive multiple sclerosis	FAERS: 1		US FAERS
692	Proteus test positive	FAERS: 1		US FAERS
693	Pulmonary thrombosis	FAERS: 1		US FAERS
694	Punctate keratitis	FAERS: 1		US FAERS
695	Pupillary block	FAERS: 1		US FAERS
696	Pupillary light reflex tests abnormal	FAERS: 1		US FAERS
697	Purpura	FAERS: 1		US FAERS
698	Purulent discharge	FAERS: 1		OFFSIDES US FAERS
699	Quadriplegia	FAERS: 1	9186541	CTD US FAERS
700	Respiratory Depression	FAERS: 1		US FAERS
701	Retinal scar	FAERS: 1		US FAERS
702	Sclerectomy	FAERS: 1		US FAERS
703	Seidel test positive	FAERS: 1		US FAERS
704	Seizure like phenomena	FAERS: 1		US FAERS
705	Sinusitis	FAERS: 1		OFFSIDES US FAERS
706	Skeletal injury	FAERS: 1		US FAERS
707	Skin hypertrophy	FAERS: 1		OFFSIDES US FAERS
708	Soft tissue necrosis	FAERS: 1		US FAERS
709	Splenectomy	FAERS: 1		US FAERS
710	Splenic vein thrombosis	FAERS: 1		US FAERS
711	Splenomegaly	FAERS: 1		US FAERS
712	Staphylococcal abscess	FAERS: 1		US FAERS
713	Staphylococcus test positive	FAERS: 1		US FAERS
714	Starvation	FAERS: 1		US FAERS
715	Stent occlusion	FAERS: 1		US FAERS
716	Stevens-Johnson Syndrome	FAERS: 1		US FAERS
717	Stridor	FAERS: 1		US FAERS
718	Sudden Visual Loss	FAERS: 1		US FAERS
719	Sudden death	FAERS: 1		US FAERS
720	Suicide attempt	FAERS: 1		US FAERS
721	Sunburn	FAERS: 1		US FAERS
722	Superficial injury of eye	FAERS: 1		US FAERS
723	Supraventricular tachycardia	FAERS: 1		US FAERS
724	Suspected product quality issue	FAERS: 1		US FAERS
725	Suspected transmission of an infectious agent via product	FAERS: 1		US FAERS
726	Swelling of eyelid	FAERS: 1		US FAERS
727	Symptom masked	FAERS: 1		US FAERS
728	Syphilis	FAERS: 1		US FAERS
729	Syringe issue	FAERS: 1		US FAERS
730	Temperature intolerance	FAERS: 1		US FAERS
731	Tetany	FAERS: 1		US FAERS
732	Therapeutic response unexpected	FAERS: 1		US FAERS
733	Therapy change	FAERS: 1		US FAERS
734	Throat irritation	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
735	Tongue discomfort	FAERS: 1		US FAERS
736	Torticollis	FAERS: 1		US FAERS
737	Toxic anterior segment syndrome	FAERS: 1		US FAERS
738	Trabeculectomy	FAERS: 1		US FAERS
739	Trisomy 21	FAERS: 1		US FAERS
740	Troponin T increased	FAERS: 1		US FAERS
741	Urate nephropathy	FAERS: 1		US FAERS
742	Urinary Incontinence	FAERS: 1	17356399	CTD US FAERS
743	Urine ketone body present	FAERS: 1 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
744	Urine output increased	FAERS: 1		US FAERS
745	Vascular rupture	FAERS: 1		US FAERS
746	Vasculitis	FAERS: 1		SIDER US FAERS
747	Ventricular Dysfunction	FAERS: 1		US FAERS
748	Vertigo	FAERS: 1	2419818 15742264	CTD SIDER US FAERS
749	Viral uveitis	FAERS: 1		US FAERS
750	Viral vasculitis	FAERS: 1		US FAERS
751	Visual brightness	FAERS: 1		US FAERS
752	Visual disturbance	FAERS: 1		SIDER US FAERS
753	Vitreal cells	FAERS: 1		US FAERS
754	Vitreous fibrin	FAERS: 1		US FAERS
755	Vitreous haze	FAERS: 1		US FAERS
756	Walking aid user	FAERS: 1		OFFSIDES US FAERS
757	Wound abscess	FAERS: 1		US FAERS
758	Wound infection fungal	FAERS: 1		US FAERS
759	Wound infection pseudomonas	FAERS: 1		US FAERS
760	Wrong patient received product	FAERS: 1		US FAERS
761	effusion	FAERS: 1		US FAERS
762	pH body fluid decreased	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
763	ACTH Deficiency, Isolated		11141589	CTD
764	Abdominal Compartment Syndrome			OFFSIDES
765	Abdominal rigidity			OFFSIDES
766	Abnormalities, Drug-Induced		3193449 3868384	CTD
767	Abscess			OFFSIDES SIDER
768	Acne Vulgaris		16552437	CTD
769	Acrodermatitis		17495388	CTD
770	Actinomycosis			OFFSIDES
771	Activated partial thromboplastin time shortened			OFFSIDES
772	Acute Lung Injury		View details 11778176 21511011 25080890 25497111 25891457 30102002	CTD
773	Acute bronchitis			OFFSIDES
774	Acute prerenal failure			OFFSIDES
775	Acute sinusitis			OFFSIDES
776	Adenoma		8912846	CTD
777	Adnexa uteri mass			OFFSIDES
778	Adrenal Cortex Diseases		11370731	CTD
779	Adrenal Gland Diseases		9253312	CTD
780	Alanine Aminotransferase Increased			OFFSIDES
781	Albuminuria		12414515	CTD
782	Alcohol Intolerance	Canada Vigilance: 1		Canada Vigilance
783	Allergic reaction to excipient	Canada Vigilance: 1		Canada Vigilance
784	Altered state of consciousness	Canada Vigilance: 1		Canada Vigilance OFFSIDES
785	Altitude Sickness		10915127	CTD
786	Alveoloplasty			OFFSIDES
787	Amenorrhea		16207182	CTD
788	Anaphylactoid Reaction			SIDER
789	Anemia		12601542 24673398	CTD
790	Aneurysm			OFFSIDES
791	Anorexia Nervosa		11082797	CTD
792	Anterior chamber flare			SIDER
793	Antithrombin III Deficiency			OFFSIDES
794	Anxiety Disorders		View details 11005053 16197924 17148562 18614426	CTD
795	Apathy			OFFSIDES
796	Apnea			OFFSIDES
797	Arachnoiditis			SIDER
798	Arthritis, Experimental		17659584 24709313	CTD
799	Arthritis		17299831	CTD
800	Arthropathy			SIDER
801	Arthroscopy			OFFSIDES
802	Aseptic necrosis			SIDER
803	Astrocytoma			OFFSIDES
804	Ataxia		11005053	CTD
805	Atrial Flutter			OFFSIDES
806	Atrial tachycardia			OFFSIDES
807	Atrioventricular Block			OFFSIDES
808	Aura			OFFSIDES
809	Autoimmune thrombocytopenia			OFFSIDES
810	Autonomic neuropathy			OFFSIDES
811	Azoospermia		16207182	CTD
812	Bereavement			OFFSIDES
813	Bladder dysfunction			SIDER
814	Bladder prolapse			OFFSIDES
815	Blepharitis			SIDER
816	Blood Glucose			OFFSIDES
817	Blood alkaline phosphatase increased			OFFSIDES
818	Blood bicarbonate			OFFSIDES
819	Blood creatinine decreased			OFFSIDES
820	Blood sodium			OFFSIDES
821	Body Weight Changes		22185406	CTD
822	Bone Marrow Diseases		7695964 23892921	CTD
823	Bone density decreased			OFFSIDES
824	Bone erosion			OFFSIDES
825	Brain Death			OFFSIDES
826	Brain Diseases		9186541 12681438	CTD
827	Brain Edema		106094 6834027	CTD
828	Brain Injuries		19236166 27655295 29935188	CTD
829	Brain Neoplasms		1866012 4058751	CTD
830	Brain natriuretic peptide increased			OFFSIDES
831	Breast necrosis			OFFSIDES
832	Bronchitis			OFFSIDES
833	Bulbar palsy			OFFSIDES
834	Burkitt Lymphoma		9186541 18782177 25023062	CTD
835	Bursitis			OFFSIDES
836	Calcific deposits removal			OFFSIDES
837	Calcinosis			SIDER
838	Cancer Pain			OFFSIDES
839	Candida sepsis			OFFSIDES
840	Capillary Leak Syndrome		20150504	CTD OFFSIDES
841	Carbohydrate tolerance decreased			SIDER
842	Carcinoma, Ovarian Epithelial		12442916	CTD
843	Cardiac Tamponade		12632228	CTD
844	Cardiomyopathies		11059621 17325706 19168726	CTD
845	Cardiovascular Abnormalities		20068362	CTD
846	Cartilage Diseases		29329878	CTD
847	Cerebellar Ataxia			OFFSIDES
848	Cerebral Hemorrhage		15500570 19887028	CTD
849	Cerebral artery stenosis			OFFSIDES
850	Cervical dysplasia			OFFSIDES
851	Chemical and Drug Induced Liver Injury		View details 15824971 16815962 16924418 19879934 19922765 21546349 21951872 22185406 26271896 28088388	CTD
852	Choking sensation			OFFSIDES
853	Chronic sinusitis			OFFSIDES
854	Chronic ulcerative colitis			OFFSIDES
855	Coagulation time abnormal			OFFSIDES
856	Cognition Disorders		View details 1499965 9565440 10864049 10864051 15044641 16406151 29111458	CTD
857	Cold sweat			OFFSIDES
858	Colonic Neoplasms		15824018	CTD
859	Compression fracture			OFFSIDES
860	Confusion		9186541 17438323	CTD
861	Contact Dermatitis			OFFSIDES
862	Continuous Positive Airway Pressure			OFFSIDES
863	Corneal Diseases		20002897	CTD
864	Corneal erosion			SIDER
865	Craniocerebral Trauma		660845	CTD
866	Craniofacial Abnormalities		17728286 28453788	CTD
867	Cushing Syndrome		1619017 3596646 10463118	CTD
868	Cysticercosis		16382035	CTD
869	Cystitis		10204687 14633084 22099998	CTD
870	Cystocele			OFFSIDES
871	Dark circles under eyes	Canada Vigilance: 1		Canada Vigilance
872	Debridement			OFFSIDES
873	Demyelinating Diseases		8625249	CTD
874	Demyelination			OFFSIDES
875	Dental abscess			OFFSIDES
876	Dental caries			OFFSIDES
877	Denture wearer			OFFSIDES
878	Depressive disorder		View details 5730293 9054921 10915127 11005053 11082797 16197924	CTD
879	Dermatitis acneiform	Canada Vigilance: 2		Canada Vigilance SIDER
880	Dermatitis, Allergic Contact		2530056 12438553 16945185	CTD
881	Dermatitis, Atopic		22842586	CTD
882	Developmental Disabilities		18492549 19204058	CTD
883	Diabetic			SIDER
884	Diarrhea		View details 7237001 7695964 7993831 10084258 25448682	CTD OFFSIDES
885	Dilatation intrahepatic duct acquired			OFFSIDES
886	Diverticulosis			OFFSIDES
887	Drowsiness			OFFSIDES
888	Drug Overdose		9174236	CTD
889	Drug withdrawal headache			OFFSIDES
890	Dyslipidemias		19936461	CTD
891	Dystonia		16677982	CTD OFFSIDES
892	Echinococcosis		21365454	CTD
893	Eczema		12438553	CTD
894	Edema		View details 7508328 9259316 10510257 11820457 14515793 16155371 19703484 24280380 26363199 27803785 28559105 29458014	CTD
895	Electrocardiogram poor R-wave progression			OFFSIDES
896	Embolism			OFFSIDES SIDER
897	Endocarditis			OFFSIDES
898	Endodontic procedure			OFFSIDES
899	Endometrial Neoplasms		12601542	CTD
900	Endotoxemia		21951872 27568862	CTD
901	Epicondylitis			OFFSIDES
902	Epidermal necrosis			OFFSIDES
903	Euphoric mood			SIDER
904	Exanthema		10688811	CTD
905	Exophthalmos			SIDER
906	Extravasation of Diagnostic and Therapeutic Materials		21875662 29458014	CTD
907	Extravasation			SIDER
908	Fatty Liver		View details 533221 19628874 19630272 19936461 21123945 25900201 28717104	CTD OFFSIDES
909	Febrile infection			OFFSIDES
910	Femur Head Necrosis		30506661	CTD
911	Fetal Growth Retardation		8446924	CTD
912	Fever		9763554 10688811 16858973	CTD
913	Fibrosarcoma		15990687	CTD
914	Folliculitis			SIDER
915	Food craving			OFFSIDES
916	Formication			OFFSIDES
917	Gastrointestinal Diseases		View details 1619017 11150359 19274460 24673398	CTD
918	Gastrointestinal Hemorrhage		11533345 29222744	CTD
919	Gastrointestinal Pain			SIDER
920	Gastrointestinal ulcer			OFFSIDES
921	Gingival Hypertrophy			OFFSIDES
922	Glioblastoma		18398572	CTD
923	Glioma		11550318	CTD
924	Glycosuria	Canada Vigilance: 1	16207182	CTD SIDER Canada Vigilance
925	Granulocyte count increased			OFFSIDES
926	Granulocytosis			OFFSIDES
927	Granuloma, Laryngeal		15656964	CTD
928	Growth Disorders		View details 1533279 9565440 10463118 11150359 15044641 20068362	CTD
929	Hallucinations		17356399	CTD
930	Head discomfort	Canada Vigilance: 1		Canada Vigilance
931	Hearing Loss		19442713	CTD
932	Heart Diseases		18079273	CTD
933	Heart failure		9457230 9763554	CTD
934	Hematoma		15500570	CTD
935	Hematuria		174842 9506681	CTD
936	Hemorrhage		12564432 14633084	CTD
937	Hepatitis B antibody positive			OFFSIDES
938	Hepatomegaly		View details 7958203 9880147 17324141 21356098 28717104 29222744	CTD SIDER
939	Hidradenitis			OFFSIDES
940	Hordeolum			OFFSIDES
941	Human papilloma virus test positive			OFFSIDES
942	Hydronephrosis		7695964	CTD
943	Hyperaldosteronism		View details 187612 7057836 7609119 11085685	CTD
944	Hyperalgesia		17912051	CTD
945	Hyperbilirubinemia		15824971	CTD
946	Hypercalciuria		14978156	CTD
947	Hypercapnia			OFFSIDES
948	Hypercholesterolemia		15824971	CTD
949	Hyperemia		1514632 11004044	CTD
950	Hyperglycemia		View details 1619017 8891570 11114284 11150359 11158452 11533345 15824971 19158320 19967395 21123945 21166656 23166830	CTD
951	Hyperinsulinism		View details 15824971 19158320 21123945 28292967	CTD
952	Hyperpigmentation		12564432	CTD
953	Hyperplasia		19158320	CTD
954	Hypertensive Encephalopathy		1537356 17557962	CTD
955	Hypertrichosis			SIDER
956	Hypertriglyceridemia		15824971 19628874	CTD
957	Hypervitaminosis			OFFSIDES
958	Hypoglycemia		8774068	CTD
959	Hypokalemia		174842 11085685	CTD
960	Hypotensive			SIDER
961	Hypoxia-Ischemia, Brain		9042522	CTD
962	Impetigo			OFFSIDES
963	Implant site infection			OFFSIDES
964	Incision site infection			OFFSIDES
965	Increased insulin requirement			SIDER
966	Increased tendency to bruise			SIDER
967	Infant, Premature, Diseases		1537356 10380089	CTD
968	Inflammatory Bowel Diseases		18830898	CTD
969	Infusion site mobility decreased			OFFSIDES
970	Intervertebral Disc Degeneration		21351055	CTD
971	Intervertebral disc disorder			OFFSIDES
972	Intracranial Hypertension		4010863 10473483 11565520	CTD
973	Intracranial Hypotension			OFFSIDES
974	Joint Instability			SIDER
975	Keratitis sicca			OFFSIDES
976	Ketosis	Canada Vigilance: 1		Canada Vigilance
977	Kidney Calculi		1671989 8576746	CTD
978	Kidney Diseases		View details 12414515 12574103 19879934 26271896	CTD
979	Kidney Failure			OFFSIDES
980	Laparotomy	Canada Vigilance: 2		Canada Vigilance
981	Laryngostenosis		15656964	CTD
982	Leukemia, Myelomonocytic, Chronic		10688811	CTD
983	Leukoderma			SIDER
984	Leukomalacia, Periventricular		2651132 11533345	CTD
985	Leukopenia neonatal			OFFSIDES
986	Ligament rupture			OFFSIDES
987	Lip erosion			OFFSIDES
988	Liver Cirrhosis, Experimental		16718785 26806094	CTD
989	Liver diseases		6650953	CTD
990	Liver neoplasms		11677951	CTD
991	Loop electrosurgical excision procedure			OFFSIDES
992	Loose tooth			OFFSIDES
993	Loss of personal independence in daily activities	Canada Vigilance: 1		Canada Vigilance
994	Loss of skin markings			SIDER
995	Lung Injury		18187276 26271896 30849337	CTD
996	Lung Neoplasms		8912846 11195469 15824018	CTD
997	Lung diseases		View details 1537356 8397569 8831080 11150359 12438668 12944497 15218577 18595991 21916510	CTD
998	Lupus Nephritis		28003376	CTD
999	Lymphocyte count decreased			OFFSIDES
1000	Lymphocyte percentage decreased			OFFSIDES
1001	Lymphoma, AIDS-Related		8697399	CTD
1002	Lymphoma		3334893	CTD
1003	Lymphopenia		3275734 20385792	CTD
1004	MELAS Syndrome		2739598	CTD
1005	Mass excision			OFFSIDES
1006	Mastication disorder			OFFSIDES
1007	Mastoiditis			OFFSIDES
1008	Meconium Aspiration Syndrome		10093144	CTD
1009	Medical device removal			OFFSIDES
1010	Memory Disorders		16406151 17884039 22484447	CTD
1011	Meningioma		21166656	CTD
1012	Meningitis, Cryptococcal		18398572	CTD
1013	Meningitis, Pneumococcal		17267155	CTD
1014	Meniscus removal			OFFSIDES
1015	Menstruation Disturbances		16207182	CTD
1016	Mesenteric vascular insufficiency			OFFSIDES
1017	Metastases to adrenals			OFFSIDES
1018	Middle Lobe Syndrome			OFFSIDES
1019	Migration of implant			SIDER
1020	Miliaria			SIDER
1021	Monoplegia			SIDER
1022	Mood Disorders		1499965 18240168 20385646	CTD
1023	Motor Neuron Disease		14518677	CTD
1024	Muscle Cramp		17136541	CTD
1025	Muscle Weakness		9186541 17356399	CTD
1026	Muscle necrosis			OFFSIDES
1027	Muscular Atrophy		View details 1351811 1947450 2424746 4441321 12135589 12721153 14518677 14618091 16318624 16967495 17053101 17153611 18436443 18467435 19032942 19967395 20169591 21094144 24124592 24550007	CTD
1028	Musculoskeletal discomfort			SIDER
1029	Musculoskeletal stiffness			OFFSIDES
1030	Myasthenia Gravis		5625960	CTD SIDER
1031	Myeloma recurrence			OFFSIDES
1032	Myocardial Ischemia		20458563	CTD
1033	Myocardial rupture			SIDER
1034	Myoclonus		View details 8094972 9445200 9926738 16162960 16256900 19276142	CTD
1035	Myositis		View details 7934481 10629576 16351631 18205843 19887701	CTD
1036	Myxedema		19934393	CTD
1037	Neoplasms, Experimental		106094 8912846 24154679	CTD
1038	Nephritis		11044214	CTD
1039	Nerve Degeneration		11311531 19969022 24691439	CTD
1040	Neuralgia	Canada Vigilance: 1	20385792	CTD OFFSIDES Canada Vigilance
1041	Neuritis			SIDER
1042	Neurocysticercosis		11565520	CTD
1043	Neurologic Manifestations		15500570 19204058	CTD
1044	Neuropathy			SIDER
1045	Neutropenic colitis			OFFSIDES
1046	Neutropenic sepsis			OFFSIDES
1047	Neutrophil Chemotactic Response, Abnormal		22776411	CTD
1048	Nitrogen balance negative			SIDER
1049	Nystagmus			OFFSIDES
1050	Ocular icterus			OFFSIDES
1051	Oculogyric crisis	Canada Vigilance: 1		Canada Vigilance
1052	Oligospermia		29902490	CTD
1053	Onychalgia			OFFSIDES
1054	Open wound			OFFSIDES
1055	Opportunistic Infections		18398572	CTD
1056	Optic Neuritis			SIDER
1057	Oral infection			OFFSIDES
1058	Osteolysis			OFFSIDES
1059	Osteosclerosis			OFFSIDES
1060	Pain, Postoperative		20935616	CTD
1061	Pallor	Canada Vigilance: 1		Canada Vigilance
1062	Panic Disorder		7918509	CTD
1063	Papilledema		18575860	CTD
1064	Paraparesis			SIDER
1065	Paraproteinemias		18452093	CTD
1066	Paresthesia		View details 2943576 9186541 17495388 19489054	CTD
1067	Pemphigus		5730293 16207182 19915258	CTD
1068	Peptic Ulcer			SIDER
1069	Periodontitis			OFFSIDES
1070	Peripheral Nervous System Diseases		View details 12601542 15048060 15953004 16840727 20385792 20575631 23864035 23892921 24673398 24928523	CTD
1071	Peripheral Vascular Diseases		20174656	CTD
1072	Petechiae			SIDER
1073	Phlebitis		12564432	CTD
1074	Physical disability			OFFSIDES
1075	Pituitary Apoplexy		12699433 12699434	CTD
1076	Pituitary Diseases		9253312	CTD
1077	Pituitary enlargement			OFFSIDES
1078	Polymorphonuclear leukocytosis			SIDER
1079	Poor quality drug administered			OFFSIDES
1080	Posterior Leukoencephalopathy Syndrome		19800799	CTD
1081	Posterior subcapsular cataract			SIDER
1082	Postoperative Nausea and Vomiting		16625358 16677982 20935616	CTD
1083	Precursor B-Cell Lymphoblastic Leukemia-Lymphoma		18176182 18191947 24154679	CTD
1084	Precursor T-Cell Lymphoblastic Leukemia-Lymphoma		12426685 20167372	CTD
1085	Prenatal Exposure Delayed Effects		View details 8446924 11318936 12574103 15353912 16197924 18252958 18400872 19473341 23166830 29111458 29329878 29902490	CTD
1086	Prenatal Injuries		25286332 26283537 30359671	CTD
1087	Primary sequestrum			OFFSIDES
1088	Procedural nausea			OFFSIDES
1089	Prostatic Neoplasms		11135218 16886663 18097517	CTD
1090	Proteinuria		View details 464098 9506681 18234956 28003376	CTD
1091	Proximal myopathy			SIDER
1092	Pseudotumor Cerebri		2973971 6805652 19018859	CTD
1093	Pseudotumor			SIDER
1094	Psychoses, Substance-Induced		View details 3398692 9054921 16401879 20385646	CTD
1095	Pulmonary Edema		View details 24722316 25080890 25891457 30102002 30849337	CTD
1096	Pulmonary Eosinophilia		10850854	CTD
1097	Pulmonary Fibrosis		14982598 22776411 28694203	CTD
1098	Pulmonary congestion			OFFSIDES
1099	Purulence			OFFSIDES
1100	Pyelonephritis			OFFSIDES
1101	Radiation associated pain			OFFSIDES
1102	Radical hysterectomy			OFFSIDES
1103	Radicular pain			OFFSIDES
1104	Rash follicular			SIDER
1105	Recall phenomenon			OFFSIDES
1106	Rectal polyp			OFFSIDES
1107	Rectocele			OFFSIDES
1108	Recurrence		11559723 29177954	CTD
1109	Renal Insufficiency		View details 174842 12844235 16860177 18234956 20351701	CTD
1110	Renal cyst			OFFSIDES
1111	Reperfusion Injury		10588920 12569807	CTD
1112	Respiration Disorders		9763554	CTD
1113	Respiratory Distress Syndrome, Adult		11700416 18379247	CTD
1114	Respiratory Distress Syndrome, Newborn		View details 9565440 10516395 15044641 15215491	CTD
1115	Retching	Canada Vigilance: 1		Canada Vigilance
1116	Retinal aneurysm			SIDER
1117	Retinopathy of Prematurity			OFFSIDES SIDER
1118	Retroperitoneal lymphadenopathy			OFFSIDES
1119	Rhinitis			OFFSIDES
1120	Risus sardonicus			OFFSIDES
1121	Sacroiliitis			OFFSIDES
1122	Salpingo-oophorectomy			OFFSIDES
1123	Sarcoidosis			OFFSIDES
1124	Sarcopenia		17587565	CTD
1125	Schizophrenia			SIDER
1126	Scleral thinning			SIDER
1127	Seizures		7824546 8287272 11565520	CTD
1128	Sequestrectomy			OFFSIDES
1129	Shock, Cardiogenic		11059621	CTD
1130	Shoulder Pain		15785267	CTD
1131	Sick Sinus Syndrome			OFFSIDES
1132	Sinus polyp			OFFSIDES
1133	Skin neoplasm excision			OFFSIDES
1134	Skin tightness			OFFSIDES
1135	Sleep Initiation and Maintenance Disorders		16552437	CTD
1136	Sleep Wake Disorders		8518660 20400291	CTD
1137	Soft tissue inflammation			OFFSIDES
1138	Sopor			OFFSIDES
1139	Spasm		18706170	CTD
1140	Spinal Cord Diseases		3047540	CTD
1141	Splenic Diseases		21123945	CTD
1142	Splenic Infarction			OFFSIDES
1143	Sputum culture positive			OFFSIDES
1144	Staphylococcal Infections		11709335 17562794	CTD
1145	Stem cell transplant			OFFSIDES
1146	Stillbirth	Canada Vigilance: 1		Canada Vigilance
1147	Stomach Diseases		15472012	CTD
1148	Stomatitis		9234591	CTD
1149	Stomatocytes present			OFFSIDES
1150	Subarachnoid Hemorrhage		10736113	CTD
1151	Substance Withdrawal Syndrome		3398692 12144610	CTD
1152	Superior Vena Cava Syndrome			OFFSIDES
1153	Synovial Cyst			OFFSIDES
1154	Synovitis			OFFSIDES
1155	Systemic Inflammatory Response Syndrome		28003376	CTD
1156	T-Cell Lymphoma			OFFSIDES
1157	Telangiectasis		952530	CTD
1158	Tendinitis			OFFSIDES
1159	Tenosynovitis			OFFSIDES
1160	Testicular Diseases		29902490	CTD
1161	Testicular Neoplasms		2688329	CTD
1162	Thromboembolism		17549307	CTD SIDER
1163	Thrombophilia		18690355	CTD
1164	Thrombophlebitis			SIDER
1165	Thyroiditis			OFFSIDES
1166	Thyrotoxicosis		9392993	CTD
1167	Tongue movement disturbance	Canada Vigilance: 1		Canada Vigilance
1168	Tonsillitis			OFFSIDES
1169	Tooth Extraction			OFFSIDES
1170	Tooth Infection			OFFSIDES
1171	Tooth Loss			OFFSIDES
1172	Toxoplasmosis, Cerebral		8272240	CTD
1173	Trauma			SIDER
1174	Troponin I increased			OFFSIDES
1175	Uremia		28003376	CTD
1176	Urinary Retention		606178 9186541	CTD
1177	Vascular Diseases		17179225	CTD
1178	Vascular calcification			OFFSIDES
1179	Vasculitis, Central Nervous System		17267155	CTD
1180	Vasospasm, Intracranial		17356399	CTD
1181	Venous Thromboembolism		20192986	CTD
1182	Ventricular Outflow Obstruction		View details 7575834 8660453 9097827 9527943 12632228 15656964	CTD
1183	Vertebroplasty			OFFSIDES
1184	Waldenstrom Macroglobulinemia		18347188	CTD
1185	Weight Gain		View details 9763554 15769980 16552437 19644504	CTD
1186	Wound Debridement			OFFSIDES
1187	Wounds and Injuries		20002897	CTD
1188	furuncle			OFFSIDES
1189	jaundice		11677951	CTD

Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141