Risperidone
(RAPZEAPATHNIPO-UHFFFAOYSA-N)
Structure
- SMILES
- Fc1ccc2c(c1)onc2C1CCN(CC1)CCc1c(C)nc2n(c1=O)CCCC2
- Type(s)
- Approved; Investigational
- ATC code(s)
- N05AX08
- Molecular Formula:
- C23H27FN4O2
- Molecular Weight:
- 410.484
- Log P:
- 3.5283
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 0
- TPSA:
- 64.16
- CAS Number(s):
- 106266-06-2
Synonym(s)
1.
Risperidone
2.
R-64,766
3.
R-64766
4.
Risperdal Consta
5.
Risperidal
6.
Consta, Risperdal
7.
R 64,766
8.
R 64766
9.
R64,766
10.
R64766
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Abnormal weight gain | FAERS: 6949 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Emotional disorder | FAERS: 5309 | US FAERS | |
| 3 | Product use issue | FAERS: 3051 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Product use in unapproved indication | FAERS: 2197 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 5 | Drug dose omission | FAERS: 1488 | US FAERS | |
| 6 | Adverse event | FAERS: 1000 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 7 | Obesity | FAERS: 954 | 16493877 | CTD SIDER US FAERS |
| 8 | Device malfunction | FAERS: 840 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 9 | Drug ineffective | FAERS: 731 Canada Vigilance: 42 | Canada Vigilance US FAERS | |
| 10 | Emotional distress | FAERS: 595 | US FAERS | |
| 11 | Diabetes Mellitus | FAERS: 524 Canada Vigilance: 11 | 16493877 | CTD SIDER Canada Vigilance US FAERS |
| 12 | Accidental exposure to product | FAERS: 508 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 13 | Device leakage | FAERS: 483 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 14 | Somnolence | FAERS: 464 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 15 | Blood prolactin increased | FAERS: 427 Canada Vigilance: 7 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 16 | Anxiety | FAERS: 389 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 17 | Tardive Dyskinesia | FAERS: 377 Canada Vigilance: 18 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 18 | Inappropriate schedule of drug administration | FAERS: 330 | US FAERS | |
| 19 | Suicide attempt | FAERS: 328 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 20 | Product quality issue | FAERS: 318 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 21 | Overdose | FAERS: 310 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 22 | Syringe issue | FAERS: 309 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Headache | FAERS: 290 Canada Vigilance: 14 | 15323593 | CTD SIDER Canada Vigilance US FAERS |
| 24 | Tremor | FAERS: 273 Canada Vigilance: 15 | CTD SIDER Canada Vigilance US FAERS | |
| 25 | Fatigue | FAERS: 268 Canada Vigilance: 11 | 10917413 11757991 | CTD SIDER Canada Vigilance US FAERS |
| 26 | Feeling abnormal | FAERS: 231 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 27 | Dizziness | FAERS: 230 Canada Vigilance: 15 | CTD SIDER Canada Vigilance US FAERS | |
| 28 | Exposure to contaminated device | FAERS: 226 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 29 | Injury associated with device | FAERS: 220 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 30 | Incorrect dose administered | FAERS: 218 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 31 | Agitation | FAERS: 214 Canada Vigilance: 10 | Canada Vigilance SIDER US FAERS | |
| 32 | Tachycardia | FAERS: 209 Canada Vigilance: 10 | 9097896 | CTD SIDER Canada Vigilance US FAERS |
| 33 | Drug administration error | FAERS: 207 | OFFSIDES US FAERS | |
| 34 | Dystonia | FAERS: 201 Canada Vigilance: 6 | CTD Canada Vigilance US FAERS | |
| 35 | Medication Error | FAERS: 195 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 36 | Needle issue | FAERS: 194 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 37 | Akathisia | FAERS: 188 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 38 | Malaise | FAERS: 182 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 39 | Neuroleptic Malignant Syndrome | FAERS: 174 Canada Vigilance: 15 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 40 | Wrong technique in drug usage process | FAERS: 171 | US FAERS | |
| 41 | Schizophrenia | FAERS: 170 Canada Vigilance: 6 |
7475677
7508675 7521534 7540426 7540798 7543499 7592504 7694306 8768340 8927682 9097896 9241011 9448657 9522104 9555595 9818633 9988841 9989566 10322240 10484947 10646830 10653224 10693159 10831489 10847307 10868556 11037386 11207340 11252123 11305704 11329400 11418277 11793611 12355680 12380707 12416598 12505132 12721815 12740756 12787855 12860772 12974991 14642020 14754789 14966260 15096069 15289996 15323593 15358990 15565299 15641867 15659005 15677612 15710053 15812261 16055781 16513859 16601995 16683970 16889453 17054409 17151160 17414944 17459549 17542047 17566512 17875112 17933497 18058087 18074829 18081639 18082302 18218293 18262394 18262704 18278980 18408528 18451200 18562423 19028422 19040345 19118983 19154706 19302830 19566763 19825908 19910723 20107430 20563569 20583904 20620267 20661022 21869689 22187885 22595365 22967779 | CTD OFFSIDES Canada Vigilance US FAERS |
| 42 | Completed Suicide | FAERS: 161 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 43 | Cerebrovascular accident | FAERS: 160 Canada Vigilance: 12 | Canada Vigilance SIDER US FAERS | |
| 44 | Asthenia | FAERS: 159 Canada Vigilance: 11 | Canada Vigilance SIDER US FAERS | |
| 45 | Wrong technique in product usage process | FAERS: 155 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Musculoskeletal stiffness | FAERS: 153 Canada Vigilance: 7 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 47 | Device breakage | FAERS: 151 | US FAERS | |
| 48 | Nausea | FAERS: 150 Canada Vigilance: 13 | 10917413 11379837 | CTD SIDER Canada Vigilance US FAERS |
| 49 | Pain | FAERS: 146 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 50 | Vomiting | FAERS: 143 Canada Vigilance: 7 | 7514873 12109969 | CTD SIDER Canada Vigilance US FAERS |
| 51 | Restlessness | FAERS: 140 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 52 | Leukopenia | FAERS: 135 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 53 | Overweight | FAERS: 128 | US FAERS | |
| 54 | Weight decreased | FAERS: 128 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 55 | Chest Pain | FAERS: 123 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 56 | Hypotension | FAERS: 123 Canada Vigilance: 7 | CTD SIDER Canada Vigilance US FAERS | |
| 57 | Product dose omission | FAERS: 123 | US FAERS | |
| 58 | Erectile dysfunction | FAERS: 117 Canada Vigilance: 1 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 59 | Myocardial Infarction | FAERS: 116 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 60 | Device occlusion | FAERS: 113 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 61 | Blood creatine phosphokinase increased | FAERS: 110 Canada Vigilance: 14 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 62 | Product substitution issue | FAERS: 109 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 63 | Pulmonary Embolism | FAERS: 109 Canada Vigilance: 2 | 12520151 16841636 18281175 | CTD SIDER Canada Vigilance US FAERS |
| 64 | Incorrect product storage | FAERS: 105 | US FAERS | |
| 65 | Toxicity to various agents | FAERS: 105 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 66 | Muscle Rigidity | FAERS: 102 Canada Vigilance: 11 | CTD SIDER Canada Vigilance US FAERS | |
| 67 | Paranoia | FAERS: 99 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 68 | Intentional self-injury | FAERS: 95 | US FAERS | |
| 69 | Unevaluable event | FAERS: 95 | US FAERS | |
| 70 | Neutropenia | FAERS: 94 Canada Vigilance: 26 | 15677612 16191206 20176014 | CTD SIDER Canada Vigilance US FAERS |
| 71 | Mental impairment | FAERS: 92 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 72 | Constipation | FAERS: 91 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 73 | Therapy cessation | FAERS: 91 | US FAERS | |
| 74 | Memory impairment | FAERS: 90 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 75 | Deep Vein Thrombosis | FAERS: 89 | SIDER US FAERS | |
| 76 | Incorrect route of drug administration | FAERS: 89 | US FAERS | |
| 77 | Priapism | FAERS: 87 Canada Vigilance: 11 | 11926728 17327965 20016438 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 78 | Thrombocytopenia | FAERS: 87 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 79 | Palpitations | FAERS: 86 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 80 | Syncope | FAERS: 85 Canada Vigilance: 3 | 19606005 | CTD SIDER Canada Vigilance US FAERS |
| 81 | Drug exposure during pregnancy | FAERS: 83 | US FAERS | |
| 82 | Sexual Dysfunction | FAERS: 81 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 83 | Drug abuse | FAERS: 79 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Lethargy | FAERS: 76 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 85 | Product physical issue | FAERS: 76 | US FAERS | |
| 86 | Urinary Incontinence | FAERS: 75 Canada Vigilance: 4 | 18387724 | CTD SIDER Canada Vigilance US FAERS |
| 87 | Procedural complication | FAERS: 74 | US FAERS | |
| 88 | Accidental overdose | FAERS: 73 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 89 | Blood glucose increased | FAERS: 73 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 90 | Delirium | FAERS: 73 Canada Vigilance: 1 | CTD SIDER Canada Vigilance US FAERS | |
| 91 | Pneumonia | FAERS: 73 | SIDER US FAERS | |
| 92 | Depressed Level of Consciousness | FAERS: 72 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 93 | Sopor | FAERS: 72 | US FAERS | |
| 94 | White blood cell count decreased | FAERS: 72 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 95 | Drug prescribing error | FAERS: 71 | US FAERS | |
| 96 | Anger | FAERS: 69 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 97 | Diabetic Ketoacidosis | FAERS: 69 | SIDER US FAERS | |
| 98 | Drooling | FAERS: 68 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 99 | Drug ineffective for unapproved indication | FAERS: 67 | US FAERS | |
| 100 | Accidental exposure | FAERS: 64 | US FAERS | |
| 101 | Blood cholesterol increased | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 102 | Sluggishness | FAERS: 64 | SIDER US FAERS | |
| 103 | Amnesia | FAERS: 62 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 104 | Catatonia | FAERS: 61 Canada Vigilance: 1 | CTD SIDER Canada Vigilance US FAERS | |
| 105 | Rhabdomyolysis | FAERS: 61 Canada Vigilance: 17 | 15358990 16841636 19087798 | CTD SIDER Canada Vigilance US FAERS |
| 106 | Incoherent | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 107 | Mastitis | FAERS: 60 | 12450970 | CTD SIDER US FAERS |
| 108 | Visual Impairment | FAERS: 60 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 109 | Abdominal Pain | FAERS: 59 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 110 | Bradycardia | FAERS: 59 Canada Vigilance: 2 | 14638604 15271756 15569911 | CTD SIDER Canada Vigilance US FAERS |
| 111 | Injection site pain | FAERS: 58 | SIDER US FAERS | |
| 112 | Pancreatitis | FAERS: 58 Canada Vigilance: 1 | 11593080 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 113 | Aphasia | FAERS: 57 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 114 | Drug dispensing error | FAERS: 56 | OFFSIDES US FAERS | |
| 115 | Dysarthria | FAERS: 56 Canada Vigilance: 3 | 20661022 | CTD SIDER Canada Vigilance US FAERS |
| 116 | Crying | FAERS: 55 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 117 | General physical health deterioration | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 118 | Cardiac Arrest | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 119 | Disorientation | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 120 | Hypersomnia | FAERS: 52 | SIDER US FAERS | |
| 121 | Dementia | FAERS: 49 Canada Vigilance: 3 | CTD SIDER Canada Vigilance US FAERS | |
| 122 | Medical device complication | FAERS: 49 | US FAERS | |
| 123 | Product packaging issue | FAERS: 49 | US FAERS | |
| 124 | Pruritus | FAERS: 49 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 125 | Sinus Tachycardia | FAERS: 49 | SIDER US FAERS | |
| 126 | Urinary tract infection | FAERS: 47 | SIDER US FAERS | |
| 127 | Apathy | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 128 | Depressed mood | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 129 | nervous system disorder | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 130 | Abasia | FAERS: 44 | US FAERS | |
| 131 | Back Pain | FAERS: 44 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 132 | Activities of daily living impaired | FAERS: 43 | US FAERS | |
| 133 | Dysuria | FAERS: 43 | 14731314 | CTD OFFSIDES SIDER US FAERS |
| 134 | Blindness | FAERS: 41 | US FAERS | |
| 135 | Product container issue | FAERS: 41 | US FAERS | |
| 136 | Mood swings | FAERS: 40 | SIDER US FAERS | |
| 137 | Hypersensitivity | FAERS: 39 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 138 | Obsessive-Compulsive Disorder | FAERS: 39 Canada Vigilance: 3 |
7592506
8890690 9004062 9619164 9632039 10362445 10616638 10630458 11147933 11874209 12352268 12505824 12880504 14674056 15213579 15253471 18480697 18582189 19644229 | CTD Canada Vigilance US FAERS |
| 139 | Stress | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 140 | Urinary Retention | FAERS: 38 | 11448089 | CTD SIDER US FAERS |
| 141 | Burning sensation | FAERS: 36 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 142 | Lower respiratory tract infection | FAERS: 36 | SIDER US FAERS | |
| 143 | Arthralgia | FAERS: 35 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 144 | Drug withdrawal syndrome | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 145 | Mental status changes | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 146 | Pleurothotonus | FAERS: 35 | SIDER US FAERS | |
| 147 | Sinus bradycardia | FAERS: 35 | SIDER US FAERS | |
| 148 | Epilepsy | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 149 | Myalgia | FAERS: 34 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 150 | Respiratory Failure | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Urticaria | FAERS: 34 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 152 | Altered state of consciousness | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 153 | Incontinence | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 154 | Oculogyric crisis | FAERS: 33 Canada Vigilance: 11 | Canada Vigilance SIDER US FAERS | |
| 155 | Trismus | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 156 | Bipolar Disorder | FAERS: 32 Canada Vigilance: 2 |
8780439
9004061 9501895 9862609 10200867 10846716 11030483 11561935 11780879 12141273 12503843 12562742 14693627 15213579 15289703 15504660 15610953 15999955 17196055 17314721 18278980 18681757 19154706 19295181 19567772 19573494 20305608 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 157 | Epistaxis | FAERS: 32 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 158 | Nervousness | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 159 | Product storage error | FAERS: 32 | US FAERS | |
| 160 | Dehydration | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 161 | Thirst | FAERS: 31 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 162 | jaundice | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 163 | Enuresis | FAERS: 30 Canada Vigilance: 2 | 7528602 | CTD SIDER Canada Vigilance US FAERS |
| 164 | Respiratory arrest | FAERS: 30 | US FAERS | |
| 165 | Thrombosis | FAERS: 30 | US FAERS | |
| 166 | Alanine Aminotransferase Increased | FAERS: 29 | SIDER US FAERS | |
| 167 | Cogwheel Rigidity | FAERS: 29 | OFFSIDES SIDER US FAERS | |
| 168 | Drug toxicity | FAERS: 29 | OFFSIDES US FAERS | |
| 169 | Electrocardiogram abnormal | FAERS: 29 | SIDER US FAERS | |
| 170 | Intentional product misuse | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 171 | Personality Change | FAERS: 29 | US FAERS | |
| 172 | Poisoning | FAERS: 29 | US FAERS | |
| 173 | Accidental needle stick | FAERS: 28 | US FAERS | |
| 174 | Alopecia | FAERS: 28 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 175 | Blood testosterone decreased | FAERS: 28 | SIDER US FAERS | |
| 176 | Blood triglycerides increased | FAERS: 28 | OFFSIDES SIDER US FAERS | |
| 177 | Respiratory distress | FAERS: 28 | US FAERS | |
| 178 | Sepsis | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 179 | Supraventricular tachycardia | FAERS: 28 | US FAERS | |
| 180 | Hypogonadism | FAERS: 27 | 11194712 | CTD US FAERS |
| 181 | Intentional drug misuse | FAERS: 27 | US FAERS | |
| 182 | Wrong drug administered | FAERS: 27 | US FAERS | |
| 183 | Breast tenderness | FAERS: 26 | US FAERS | |
| 184 | Chest discomfort | FAERS: 26 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 185 | Hypokinesia | FAERS: 26 Canada Vigilance: 3 | 10847307 | CTD SIDER Canada Vigilance US FAERS |
| 186 | Infection | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 187 | Infertility | FAERS: 26 | US FAERS | |
| 188 | Menorrhagia | FAERS: 26 | SIDER US FAERS | |
| 189 | Precocious Puberty | FAERS: 26 | SIDER US FAERS | |
| 190 | Sudden death | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 191 | Swelling | FAERS: 26 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 192 | Bedridden | FAERS: 25 | US FAERS | |
| 193 | Erythema | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 194 | Inappropriate schedule of product administration | FAERS: 25 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 195 | Pancytopenia | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 196 | Poor quality drug administered | FAERS: 25 | US FAERS | |
| 197 | Poor quality sleep | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 198 | Psychiatric symptom | FAERS: 25 | US FAERS | |
| 199 | Respiratory Depression | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 200 | Restless Legs Syndrome | FAERS: 25 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 201 | Abdominal discomfort | FAERS: 24 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 202 | Aspartate Aminotransferase Increased | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 203 | Choking | FAERS: 24 | SIDER US FAERS | |
| 204 | Hepatitis | FAERS: 24 | 11593080 15771859 16199856 | CTD SIDER US FAERS |
| 205 | Prescribed overdose | FAERS: 24 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 206 | Asthma | FAERS: 23 | SIDER US FAERS | |
| 207 | Drug Dependence | FAERS: 23 | US FAERS | |
| 208 | Dyspepsia | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 209 | Growth retardation | FAERS: 23 | US FAERS | |
| 210 | Lactation Disorder | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 211 | Oromandibular dystonia | FAERS: 23 | US FAERS | |
| 212 | Product packaging quantity issue | FAERS: 23 | US FAERS | |
| 213 | Visual disturbance | FAERS: 23 | US FAERS | |
| 214 | Diabetes mellitus inadequate control | FAERS: 22 | OFFSIDES US FAERS | |
| 215 | Discomfort | FAERS: 22 | SIDER US FAERS | |
| 216 | Granuloma | FAERS: 22 | US FAERS | |
| 217 | Hormone level abnormal | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 218 | Impaired work ability | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 219 | Unresponsive to stimuli | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 220 | Ataxia | FAERS: 21 | 18609423 | CTD SIDER US FAERS |
| 221 | Atrial tachycardia | FAERS: 21 | US FAERS | |
| 222 | Cyanosis | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 223 | Drug administered to patient of inappropriate age | FAERS: 21 | US FAERS | |
| 224 | Dysphonia | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 225 | Hypothyroidism | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 226 | Opisthotonus | FAERS: 21 | SIDER US FAERS | |
| 227 | Therapeutic response unexpected with drug substitution | FAERS: 21 | US FAERS | |
| 228 | Atrial Fibrillation | FAERS: 20 | SIDER US FAERS | |
| 229 | Chills | FAERS: 20 | SIDER US FAERS | |
| 230 | Maternal exposure during pregnancy | FAERS: 20 | US FAERS | |
| 231 | Soliloquy | FAERS: 20 | OFFSIDES US FAERS | |
| 232 | Staring | FAERS: 20 | US FAERS | |
| 233 | Drug delivery system malfunction | FAERS: 19 | US FAERS | |
| 234 | Leukocytosis | FAERS: 19 | SIDER US FAERS | |
| 235 | Osteoporosis | FAERS: 19 Canada Vigilance: 1 | 14870961 | CTD Canada Vigilance US FAERS |
| 236 | Polydipsia | FAERS: 19 | SIDER US FAERS | |
| 237 | Tinnitus | FAERS: 19 | SIDER US FAERS | |
| 238 | Blood alkaline phosphatase increased | FAERS: 18 | US FAERS | |
| 239 | Dissociation | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 240 | Liquid product physical issue | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 241 | Mutism | FAERS: 18 | US FAERS | |
| 242 | Torticollis | FAERS: 18 | 8959475 9949942 10389620 | CTD SIDER US FAERS |
| 243 | Accidental exposure to product by child | FAERS: 17 | US FAERS | |
| 244 | Acute psychosis | FAERS: 17 | OFFSIDES US FAERS | |
| 245 | Bruxism | FAERS: 17 | OFFSIDES US FAERS | |
| 246 | Device defective | FAERS: 17 | US FAERS | |
| 247 | Disease recurrence | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 248 | General physical condition abnormal | FAERS: 17 | US FAERS | |
| 249 | Nipple pain | FAERS: 17 | OFFSIDES US FAERS | |
| 250 | Posterior reversible encephalopathy syndrome | FAERS: 17 | US FAERS | |
| 251 | Somatoform disorder pregnancy | FAERS: 17 | US FAERS | |
| 252 | Transaminases increased | FAERS: 17 | SIDER US FAERS | |
| 253 | Vertigo | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 254 | Angioedema | FAERS: 16 Canada Vigilance: 3 | 7488898 11777744 17880358 | CTD SIDER Canada Vigilance US FAERS |
| 255 | Blood creatinine increased | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 256 | Bone pain | FAERS: 16 | SIDER US FAERS | |
| 257 | Cellulitis | FAERS: 16 | OFFSIDES SIDER US FAERS | |
| 258 | Cerebral Infarction | FAERS: 16 | US FAERS | |
| 259 | Cholelithiasis | FAERS: 16 | SIDER US FAERS | |
| 260 | Delayed Puberty | FAERS: 16 | US FAERS | |
| 261 | Drug diversion | FAERS: 16 | US FAERS | |
| 262 | Electrocardiogram ST-T change | FAERS: 16 | US FAERS | |
| 263 | Excessive eye blinking | FAERS: 16 | US FAERS | |
| 264 | Fracture | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 265 | Homicide | FAERS: 16 | US FAERS | |
| 266 | Hostility | FAERS: 16 | US FAERS | |
| 267 | Hyperphagia | FAERS: 16 | SIDER US FAERS | |
| 268 | Venous Thrombosis | FAERS: 16 | US FAERS | |
| 269 | Acne | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 270 | Immobile | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 271 | Injection site extravasation | FAERS: 15 | US FAERS | |
| 272 | Joint stiffness | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 273 | Mydriasis | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 274 | Nasopharyngitis | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 275 | Oropharyngeal pain | FAERS: 15 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 276 | Pharmaceutical product complaint | FAERS: 15 | US FAERS | |
| 277 | Stevens-Johnson Syndrome | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 278 | Wolff-Parkinson-White Syndrome | FAERS: 15 | US FAERS | |
| 279 | treatment failure | FAERS: 15 | US FAERS | |
| 280 | Accidental drug intake by child | FAERS: 14 | US FAERS | |
| 281 | Asphyxia | FAERS: 14 | US FAERS | |
| 282 | Blood sodium decreased | FAERS: 14 | US FAERS | |
| 283 | Dependence | FAERS: 14 | US FAERS | |
| 284 | Disability | FAERS: 14 | US FAERS | |
| 285 | Drug abuser | FAERS: 14 | US FAERS | |
| 286 | Dysphemia | FAERS: 14 | US FAERS | |
| 287 | Eye pain | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 288 | Injection Site Reaction | FAERS: 14 | SIDER US FAERS | |
| 289 | Intestinal Obstruction | FAERS: 14 | SIDER US FAERS | |
| 290 | Low density lipoprotein increased | FAERS: 14 | US FAERS | |
| 291 | Neutrophil count decreased | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 292 | Pallor | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 293 | Screaming | FAERS: 14 | US FAERS | |
| 294 | Shock | FAERS: 14 | SIDER US FAERS | |
| 295 | Sinus Arrhythmia | FAERS: 14 | SIDER US FAERS | |
| 296 | Acidosis | FAERS: 13 | US FAERS | |
| 297 | Acute myocardial infarction | FAERS: 13 | US FAERS | |
| 298 | Bone density decreased | FAERS: 13 | US FAERS | |
| 299 | Cataract | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 300 | Diplopia | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 301 | Drug level decreased | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 302 | Dry skin | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 303 | Dysgeusia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 304 | Eczema | FAERS: 13 | SIDER US FAERS | |
| 305 | Flat affect | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 306 | Gamma-Glutamyltransferase Increased | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 307 | Gaze palsy | FAERS: 13 | US FAERS | |
| 308 | Hyperacusis | FAERS: 13 | 19204655 | CTD SIDER US FAERS |
| 309 | Impaired self-care | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 310 | Lymphadenopathy | FAERS: 13 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 311 | Myasthenia Gravis | FAERS: 13 | US FAERS | |
| 312 | Osteopenia | FAERS: 13 | US FAERS | |
| 313 | Peripheral swelling | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 314 | Product reconstitution quality issue | FAERS: 13 | US FAERS | |
| 315 | Psoriasis | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 316 | Stupor | FAERS: 13 | SIDER US FAERS | |
| 317 | Angina Pectoris | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 318 | Anticholinergic Syndrome | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 319 | Anuria | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 320 | Blepharospasm | FAERS: 12 Canada Vigilance: 3 | 11037386 14870960 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 321 | Cerebral atrophy | FAERS: 12 | US FAERS | |
| 322 | Cerebral disorder | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 323 | Diabetes Insipidus | FAERS: 12 | US FAERS | |
| 324 | Electroencephalogram abnormal | FAERS: 12 | US FAERS | |
| 325 | Eye irritation | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 326 | Gastritis | FAERS: 12 | SIDER US FAERS | |
| 327 | Hunger | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 328 | Impaired driving ability | FAERS: 12 | US FAERS | |
| 329 | Initial insomnia | FAERS: 12 | SIDER US FAERS | |
| 330 | Limb injury | FAERS: 12 | US FAERS | |
| 331 | Multiple Sclerosis | FAERS: 12 | OFFSIDES US FAERS | |
| 332 | Musculoskeletal Pain | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 333 | Neck Pain | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 334 | Product label issue | FAERS: 12 | US FAERS | |
| 335 | Schizoaffective Disorder | FAERS: 12 | OFFSIDES US FAERS | |
| 336 | Skin lesion | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 337 | Water Intoxication | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 338 | Acute kidney injury | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 339 | Blood glucose abnormal | FAERS: 11 | US FAERS | |
| 340 | Body fat disorder | FAERS: 11 | US FAERS | |
| 341 | Chromaturia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 342 | Dental caries | FAERS: 11 | US FAERS | |
| 343 | Device connection issue | FAERS: 11 | US FAERS | |
| 344 | Expired product administered | FAERS: 11 | US FAERS | |
| 345 | Gastrointestinal hypomotility | FAERS: 11 | US FAERS | |
| 346 | Glaucoma | FAERS: 11 | SIDER US FAERS | |
| 347 | Hallucinations, mixed | FAERS: 11 | US FAERS | |
| 348 | Hyperkinesia | FAERS: 11 | SIDER US FAERS | |
| 349 | Injection site mass | FAERS: 11 | US FAERS | |
| 350 | Physical assault | FAERS: 11 | US FAERS | |
| 351 | Physical disability | FAERS: 11 | US FAERS | |
| 352 | Polyuria | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 353 | Post-Traumatic Stress Disorder | FAERS: 11 | US FAERS | |
| 354 | Quality of life decreased | FAERS: 11 | US FAERS | |
| 355 | Respiratory muscle weakness | FAERS: 11 | US FAERS | |
| 356 | Rhinitis | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 357 | Serum Sickness | FAERS: 11 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 358 | Stridor | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 359 | Blood potassium decreased | FAERS: 10 | US FAERS | |
| 360 | Bradykinesia | FAERS: 10 | SIDER US FAERS | |
| 361 | Diabetic gastropathy | FAERS: 10 | US FAERS | |
| 362 | Euphoric mood | FAERS: 10 | SIDER US FAERS | |
| 363 | Feeling of body temperature change | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 364 | Floppy iris syndrome | FAERS: 10 | SIDER US FAERS | |
| 365 | Gastrointestinal motility disorder | FAERS: 10 | US FAERS | |
| 366 | Hypophagia | FAERS: 10 | US FAERS | |
| 367 | Hypothalamo-pituitary disorder | FAERS: 10 | US FAERS | |
| 368 | Inappropriate affect | FAERS: 10 | OFFSIDES US FAERS | |
| 369 | Inflammation | FAERS: 10 | US FAERS | |
| 370 | Injection site nodule | FAERS: 10 | US FAERS | |
| 371 | Intercepted medication error | FAERS: 10 | US FAERS | |
| 372 | Lipase increased | FAERS: 10 | US FAERS | |
| 373 | Muscle tightness | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 374 | Myoclonus | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 375 | Nephrolithiasis | FAERS: 10 | OFFSIDES US FAERS | |
| 376 | Nerve injury | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 377 | No adverse event | FAERS: 10 | US FAERS | |
| 378 | Obsessive thoughts | FAERS: 10 | US FAERS | |
| 379 | Product complaint | FAERS: 10 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 380 | Product solubility abnormal | FAERS: 10 | US FAERS | |
| 381 | Proteinuria | FAERS: 10 | US FAERS | |
| 382 | Pyelonephritis | FAERS: 10 | US FAERS | |
| 383 | Sedation complication | FAERS: 10 | US FAERS | |
| 384 | Strabismus | FAERS: 10 | US FAERS | |
| 385 | Therapeutic response unexpected | FAERS: 10 | US FAERS | |
| 386 | Vulvovaginal dryness | FAERS: 10 | SIDER US FAERS | |
| 387 | Akinesia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 388 | Amylase increased | FAERS: 9 | US FAERS | |
| 389 | Anorexia | FAERS: 9 | SIDER US FAERS | |
| 390 | Aphonia | FAERS: 9 | US FAERS | |
| 391 | Arthritis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 392 | Blood lactate dehydrogenase increased | FAERS: 9 | US FAERS | |
| 393 | Bradyphrenia | FAERS: 9 | US FAERS | |
| 394 | Breast discomfort | FAERS: 9 | SIDER US FAERS | |
| 395 | Deafness | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 396 | Disease Progression | FAERS: 9 | US FAERS | |
| 397 | Duodenitis | FAERS: 9 | US FAERS | |
| 398 | Dysgraphia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 399 | Eosinophilia | FAERS: 9 | US FAERS | |
| 400 | Flatulence | FAERS: 9 | SIDER US FAERS | |
| 401 | Flushing | FAERS: 9 | SIDER US FAERS | |
| 402 | Frustration tolerance decreased | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 403 | Head discomfort | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 404 | Hemiparesis | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 405 | Ileus | FAERS: 9 | SIDER US FAERS | |
| 406 | Injection site scar | FAERS: 9 | US FAERS | |
| 407 | Joint swelling | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 408 | Laceration | FAERS: 9 | OFFSIDES US FAERS | |
| 409 | Lupus-like syndrome | FAERS: 9 | US FAERS | |
| 410 | Lymphopenia | FAERS: 9 | SIDER US FAERS | |
| 411 | Monoplegia | FAERS: 9 | US FAERS | |
| 412 | Paroxysmal perceptual alteration | FAERS: 9 | US FAERS | |
| 413 | Presyncope | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 414 | Product preparation error | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 415 | Product taste abnormal | FAERS: 9 | US FAERS | |
| 416 | Progressive supranuclear palsy | FAERS: 9 | US FAERS | |
| 417 | Prolactinoma | FAERS: 9 | 14750048 19153927 | CTD US FAERS |
| 418 | Pseudogynaecomastia | FAERS: 9 | US FAERS | |
| 419 | Skin Ulcer | FAERS: 9 | SIDER US FAERS | |
| 420 | Blood glucose fluctuation | FAERS: 8 | US FAERS | |
| 421 | Breast Cyst | FAERS: 8 | US FAERS | |
| 422 | Bronchitis | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 423 | Cardiomegaly | FAERS: 8 | US FAERS | |
| 424 | Colitis | FAERS: 8 | SIDER US FAERS | |
| 425 | Drowning | FAERS: 8 | US FAERS | |
| 426 | Drug effect incomplete | FAERS: 8 | US FAERS | |
| 427 | Electrocardiogram ST-T segment abnormal | FAERS: 8 | US FAERS | |
| 428 | Extra dose administered | FAERS: 8 | US FAERS | |
| 429 | Frustration | FAERS: 8 | US FAERS | |
| 430 | Hepatotoxicity | FAERS: 8 | US FAERS | |
| 431 | Hyperthyroidism | FAERS: 8 | US FAERS | |
| 432 | Hyponatraemic seizure | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 433 | Infectious peritonitis | FAERS: 8 | US FAERS | |
| 434 | Influenza | FAERS: 8 | SIDER US FAERS | |
| 435 | Injection site necrosis | FAERS: 8 | SIDER US FAERS | |
| 436 | Intestinal Perforation | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 437 | Living in residential institution | FAERS: 8 | US FAERS | |
| 438 | Musculoskeletal chest pain | FAERS: 8 | SIDER US FAERS | |
| 439 | Negativism | FAERS: 8 | US FAERS | |
| 440 | Pancreatic carcinoma | FAERS: 8 | US FAERS | |
| 441 | Psychomotor skills impaired | FAERS: 8 | US FAERS | |
| 442 | Rabbit syndrome | FAERS: 8 | US FAERS | |
| 443 | Rheumatoid Arthritis | FAERS: 8 | US FAERS | |
| 444 | Sight disability | FAERS: 8 | US FAERS | |
| 445 | Suspected counterfeit product | FAERS: 8 | US FAERS | |
| 446 | Tension | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 447 | Thermal burn | FAERS: 8 | US FAERS | |
| 448 | Toothache | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 449 | Agranulocytosis | FAERS: 7 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 450 | Anorgasmia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 451 | Aphagia | FAERS: 7 | OFFSIDES US FAERS | |
| 452 | Autonomic nervous system imbalance | FAERS: 7 | SIDER US FAERS | |
| 453 | Bipolar I disorder | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 454 | Complication associated with device | FAERS: 7 | US FAERS | |
| 455 | Coronary Artery Disease | FAERS: 7 | US FAERS | |
| 456 | Deformity | FAERS: 7 | US FAERS | |
| 457 | Disseminated Intravascular Coagulation | FAERS: 7 | US FAERS | |
| 458 | Drug level increased | FAERS: 7 | US FAERS | |
| 459 | Ectopic Pregnancy | FAERS: 7 | US FAERS | |
| 460 | Electrocardiogram change | FAERS: 7 | SIDER US FAERS | |
| 461 | Erection increased | FAERS: 7 | US FAERS | |
| 462 | Feeling jittery | FAERS: 7 | US FAERS | |
| 463 | Gastric ulcer | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 464 | Hemiplegia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 465 | Ketoacidosis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 466 | Loss of personal independence in daily activities | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 467 | Muscle Spasticity | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 468 | Nonspecific reaction | FAERS: 7 | US FAERS | |
| 469 | Phlebitis | FAERS: 7 | SIDER US FAERS | |
| 470 | Polyneuropathy | FAERS: 7 | OFFSIDES US FAERS | |
| 471 | Premature Menopause | FAERS: 7 | US FAERS | |
| 472 | Product administration error | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 473 | Product availability issue | FAERS: 7 | US FAERS | |
| 474 | Purpura | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 475 | Retching | FAERS: 7 | US FAERS | |
| 476 | Thrombophlebitis | FAERS: 7 | SIDER US FAERS | |
| 477 | Tobacco user | FAERS: 7 | US FAERS | |
| 478 | Wheezing | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 479 | muscle injury | FAERS: 7 | US FAERS | |
| 480 | Abscess | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 481 | Accidental death | FAERS: 6 | US FAERS | |
| 482 | Acute respiratory failure | FAERS: 6 | US FAERS | |
| 483 | Alcohol poisoning | FAERS: 6 | US FAERS | |
| 484 | Anhedonia | FAERS: 6 | US FAERS | |
| 485 | Antipsychotic drug level below therapeutic | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 486 | Arteriosclerosis | FAERS: 6 | OFFSIDES US FAERS | |
| 487 | Arthropathy | FAERS: 6 | SIDER US FAERS | |
| 488 | Ascites | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 489 | Blood pressure fluctuation | FAERS: 6 | US FAERS | |
| 490 | Blood thyroid stimulating hormone increased | FAERS: 6 | US FAERS | |
| 491 | Blood urine present | FAERS: 6 | US FAERS | |
| 492 | Cold sweat | FAERS: 6 | US FAERS | |
| 493 | Conjunctivitis | FAERS: 6 | SIDER US FAERS | |
| 494 | Device Failure | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 495 | Ejection Fraction Decreased | FAERS: 6 | US FAERS | |
| 496 | Encephalitis | FAERS: 6 | US FAERS | |
| 497 | Exhibitionism | FAERS: 6 | US FAERS | |
| 498 | Failure to Thrive | FAERS: 6 | US FAERS | |
| 499 | Foaming at mouth | FAERS: 6 | US FAERS | |
| 500 | Formication | FAERS: 6 | US FAERS | |
| 501 | Hydronephrosis | FAERS: 6 | US FAERS | |
| 502 | Hyperpyrexia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 503 | Hypertensive crisis | FAERS: 6 | US FAERS | |
| 504 | Hypoxia | FAERS: 6 | OFFSIDES US FAERS | |
| 505 | Infarction | FAERS: 6 | US FAERS | |
| 506 | Intracranial Aneurysm | FAERS: 6 | US FAERS | |
| 507 | Limb discomfort | FAERS: 6 | US FAERS | |
| 508 | Metabolic acidosis | FAERS: 6 | US FAERS | |
| 509 | Obsessive-compulsive symptom | FAERS: 6 | US FAERS | |
| 510 | Occupational exposure to product | FAERS: 6 | US FAERS | |
| 511 | Osteomyelitis | FAERS: 6 | OFFSIDES US FAERS | |
| 512 | Panic Disorder | FAERS: 6 | 9241019 11207340 | CTD US FAERS |
| 513 | Pericardial effusion | FAERS: 6 | US FAERS | |
| 514 | Petechiae | FAERS: 6 | US FAERS | |
| 515 | Pituitary cyst | FAERS: 6 | US FAERS | |
| 516 | Pneumothorax | FAERS: 6 | OFFSIDES US FAERS | |
| 517 | Product dispensing error | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 518 | Product leakage | FAERS: 6 | US FAERS | |
| 519 | Respiratory dyskinesia | FAERS: 6 | US FAERS | |
| 520 | Retinal scar | FAERS: 6 | US FAERS | |
| 521 | Retrograde ejaculation | FAERS: 6 | SIDER US FAERS | |
| 522 | Scab | FAERS: 6 | US FAERS | |
| 523 | Sperm count decreased | FAERS: 6 | US FAERS | |
| 524 | Status Epilepticus | FAERS: 6 | US FAERS | |
| 525 | Stillbirth | FAERS: 6 | SIDER US FAERS | |
| 526 | Temperature intolerance | FAERS: 6 | US FAERS | |
| 527 | Thyroid Neoplasm | FAERS: 6 | US FAERS | |
| 528 | Tongue spasm | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 529 | Trisomy 21 | FAERS: 6 | US FAERS | |
| 530 | VIIth nerve paralysis | FAERS: 6 | US FAERS | |
| 531 | Vasculitis | FAERS: 6 | US FAERS | |
| 532 | Violence-related symptom | FAERS: 6 | US FAERS | |
| 533 | Alcohol abuse | FAERS: 5 | OFFSIDES US FAERS | |
| 534 | Amnestic Disorder | FAERS: 5 | US FAERS | |
| 535 | Ankle Fracture | FAERS: 5 | US FAERS | |
| 536 | Benign Neoplasm | FAERS: 5 | US FAERS | |
| 537 | Blunted affect | FAERS: 5 | SIDER US FAERS | |
| 538 | Body temperature fluctuation | FAERS: 5 | US FAERS | |
| 539 | Breast hyperplasia | FAERS: 5 | US FAERS | |
| 540 | Carpal Tunnel Syndrome | FAERS: 5 | US FAERS | |
| 541 | Cholecystitis | FAERS: 5 | SIDER US FAERS | |
| 542 | Circumstance or information capable of leading to medication error | FAERS: 5 | US FAERS | |
| 543 | Conduct Disorder | FAERS: 5 | CTD US FAERS | |
| 544 | Device damage | FAERS: 5 | US FAERS | |
| 545 | Drug administered at inappropriate site | FAERS: 5 | US FAERS | |
| 546 | Drug exposure via breast milk | FAERS: 5 | US FAERS | |
| 547 | Drug screen positive | FAERS: 5 | US FAERS | |
| 548 | Educational problem | FAERS: 5 | US FAERS | |
| 549 | Electrocardiogram repolarisation abnormality | FAERS: 5 | US FAERS | |
| 550 | Eructation | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 551 | Exophthalmos | FAERS: 5 | US FAERS | |
| 552 | Hepatitis C | FAERS: 5 | US FAERS | |
| 553 | Incorrect drug administration duration | FAERS: 5 | US FAERS | |
| 554 | Injection site ulcer | FAERS: 5 | SIDER US FAERS | |
| 555 | Insulin Resistance | FAERS: 5 | US FAERS | |
| 556 | Intentional product use issue | FAERS: 5 | US FAERS | |
| 557 | Lactose Intolerance | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 558 | Libido disorder | FAERS: 5 | US FAERS | |
| 559 | Lip swelling | FAERS: 5 | SIDER US FAERS | |
| 560 | Malignant neoplasm progression | FAERS: 5 | US FAERS | |
| 561 | Mental Retardation | FAERS: 5 | US FAERS | |
| 562 | Monocytosis | FAERS: 5 | US FAERS | |
| 563 | Multi-organ disorder | FAERS: 5 | US FAERS | |
| 564 | Myocardial necrosis marker increased | FAERS: 5 | US FAERS | |
| 565 | Optic Atrophy | FAERS: 5 | US FAERS | |
| 566 | Optic Neuritis | FAERS: 5 | US FAERS | |
| 567 | Patent ductus arteriosus | FAERS: 5 | US FAERS | |
| 568 | Photophobia | FAERS: 5 | SIDER US FAERS | |
| 569 | Pituitary enlargement | FAERS: 5 | US FAERS | |
| 570 | Platelet function test abnormal | FAERS: 5 | US FAERS | |
| 571 | Pregnancy | FAERS: 5 | SIDER US FAERS | |
| 572 | Product contamination | FAERS: 5 | US FAERS | |
| 573 | Product counterfeit | FAERS: 5 | US FAERS | |
| 574 | Product physical consistency issue | FAERS: 5 | US FAERS | |
| 575 | Product prescribing error | FAERS: 5 | US FAERS | |
| 576 | Product sterility lacking | FAERS: 5 | US FAERS | |
| 577 | Pulmonary Infarction | FAERS: 5 | US FAERS | |
| 578 | Reduced facial expression | FAERS: 5 | US FAERS | |
| 579 | Renal abscess | FAERS: 5 | US FAERS | |
| 580 | Serotonin Syndrome | FAERS: 5 | US FAERS | |
| 581 | Sinusitis | FAERS: 5 | SIDER US FAERS | |
| 582 | Slow response to stimuli | FAERS: 5 | US FAERS | |
| 583 | Splenomegaly | FAERS: 5 | US FAERS | |
| 584 | Subcutaneous Abscess | FAERS: 5 | SIDER US FAERS | |
| 585 | Temperature regulation disorder | FAERS: 5 | US FAERS | |
| 586 | Therapy change | FAERS: 5 | US FAERS | |
| 587 | Tongue biting | FAERS: 5 | US FAERS | |
| 588 | Ventricular Fibrillation | FAERS: 5 | SIDER US FAERS | |
| 589 | Ventricular hypertrophy | FAERS: 5 | US FAERS | |
| 590 | Waxy flexibility | FAERS: 5 | US FAERS | |
| 591 | Wrong dose | FAERS: 5 | US FAERS | |
| 592 | Acromegaly | FAERS: 4 | US FAERS | |
| 593 | Administration site reaction | FAERS: 4 | US FAERS | |
| 594 | Anaphylactic shock | FAERS: 4 | SIDER US FAERS | |
| 595 | Aspermia | FAERS: 4 | US FAERS | |
| 596 | Bicytopenia | FAERS: 4 | OFFSIDES US FAERS | |
| 597 | Blood albumin decreased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 598 | Blood human chorionic gonadotropin increased | FAERS: 4 | US FAERS | |
| 599 | Blood triglycerides | FAERS: 4 | US FAERS | |
| 600 | Breast cancer recurrent | FAERS: 4 | US FAERS | |
| 601 | Carotid artery occlusion | FAERS: 4 | US FAERS | |
| 602 | Cerebral cyst | FAERS: 4 | US FAERS | |
| 603 | Cholangitis | FAERS: 4 | US FAERS | |
| 604 | Colectomy | FAERS: 4 | US FAERS | |
| 605 | Conversion disorder | FAERS: 4 | US FAERS | |
| 606 | Cystitis | FAERS: 4 | 9628639 | CTD SIDER US FAERS |
| 607 | Cytolytic hepatitis | FAERS: 4 | US FAERS | |
| 608 | Dermatitis | FAERS: 4 | SIDER US FAERS | |
| 609 | Diverticulitis | FAERS: 4 | SIDER US FAERS | |
| 610 | Drug Tolerance | FAERS: 4 | US FAERS | |
| 611 | Dysmorphism | FAERS: 4 | US FAERS | |
| 612 | Electrolyte imbalance | FAERS: 4 | US FAERS | |
| 613 | Embolism | FAERS: 4 | US FAERS | |
| 614 | Exposure during breast feeding | FAERS: 4 | US FAERS | |
| 615 | Exposure via skin contact | FAERS: 4 | US FAERS | |
| 616 | Fat necrosis | FAERS: 4 | US FAERS | |
| 617 | Feeling Cold | FAERS: 4 | US FAERS | |
| 618 | Feelings of worthlessness | FAERS: 4 | US FAERS | |
| 619 | Fibromyalgia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 620 | Gait inability | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 621 | Gastroenteritis | FAERS: 4 | SIDER US FAERS | |
| 622 | Gastrointestinal carcinoma | FAERS: 4 | US FAERS | |
| 623 | Hirsutism | FAERS: 4 | US FAERS | |
| 624 | Hyperreflexia | FAERS: 4 | SIDER US FAERS | |
| 625 | Hysterectomy | FAERS: 4 | US FAERS | |
| 626 | Injection site discomfort | FAERS: 4 | US FAERS | |
| 627 | Intellectual Disability | FAERS: 4 | 18349709 | CTD US FAERS |
| 628 | Iron deficiency | FAERS: 4 | US FAERS | |
| 629 | Irritable Bowel Syndrome | FAERS: 4 | SIDER US FAERS | |
| 630 | Lymphocytosis | FAERS: 4 | US FAERS | |
| 631 | Malnutrition | FAERS: 4 | SIDER US FAERS | |
| 632 | Mastectomy | FAERS: 4 | US FAERS | |
| 633 | Medication residue present | FAERS: 4 | US FAERS | |
| 634 | Microcephaly | FAERS: 4 | US FAERS | |
| 635 | Middle insomnia | FAERS: 4 | SIDER US FAERS | |
| 636 | Musculoskeletal discomfort | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 637 | Narcolepsy | FAERS: 4 | US FAERS | |
| 638 | Negative thoughts | FAERS: 4 | US FAERS | |
| 639 | Onychoclasis | FAERS: 4 | US FAERS | |
| 640 | Oral fungal infection | FAERS: 4 | US FAERS | |
| 641 | Paradoxical drug reaction | FAERS: 4 | US FAERS | |
| 642 | Pelvic venous thrombosis | FAERS: 4 | US FAERS | |
| 643 | Penile size reduced | FAERS: 4 | US FAERS | |
| 644 | Photosensitivity allergic reaction | FAERS: 4 | US FAERS | |
| 645 | Pneumatosis intestinalis | FAERS: 4 | US FAERS | |
| 646 | Pneumonitis | FAERS: 4 | US FAERS | |
| 647 | Poor personal hygiene | FAERS: 4 | US FAERS | |
| 648 | Poriomania | FAERS: 4 | US FAERS | |
| 649 | Pre-Eclampsia | FAERS: 4 | US FAERS | |
| 650 | Product lot number issue | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 651 | Productive Cough | FAERS: 4 | SIDER US FAERS | |
| 652 | Psychotic symptom | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 653 | Pulmonary Fibrosis | FAERS: 4 | US FAERS | |
| 654 | Pulmonary Hypertension | FAERS: 4 | US FAERS | |
| 655 | Rash erythematous | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 656 | Refusal of treatment by relative | FAERS: 4 | US FAERS | |
| 657 | Renal pain | FAERS: 4 | SIDER US FAERS | |
| 658 | Retinal Artery Occlusion | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 659 | Retinal Detachment | FAERS: 4 | US FAERS | |
| 660 | Retinal Vein Occlusion | FAERS: 4 | US FAERS | |
| 661 | Retinitis Pigmentosa | FAERS: 4 | US FAERS | |
| 662 | Semen volume decreased | FAERS: 4 | US FAERS | |
| 663 | Sick Sinus Syndrome | FAERS: 4 | US FAERS | |
| 664 | Subileus | FAERS: 4 | US FAERS | |
| 665 | Sudden Cardiac Death | FAERS: 4 | US FAERS | |
| 666 | Talipes | FAERS: 4 | OFFSIDES US FAERS | |
| 667 | Therapeutic product ineffective | FAERS: 4 | US FAERS | |
| 668 | Therapy non-responder | FAERS: 4 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 669 | Tooth Extraction | FAERS: 4 | US FAERS | |
| 670 | Tooth Loss | FAERS: 4 | US FAERS | |
| 671 | Toxic Epidermal Necrolysis | FAERS: 4 | US FAERS | |
| 672 | Transcription medication error | FAERS: 4 | US FAERS | |
| 673 | Ulcer | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 674 | Urine human chorionic gonadotropin increased | FAERS: 4 | US FAERS | |
| 675 | Abdominal rigidity | FAERS: 3 | US FAERS | |
| 676 | Abulia | FAERS: 3 | US FAERS | |
| 677 | Ageusia | FAERS: 3 | US FAERS | |
| 678 | Antipsychotic drug level increased | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 679 | Appendicitis | FAERS: 3 | US FAERS | |
| 680 | Atrial Flutter | FAERS: 3 | US FAERS | |
| 681 | Atrioventricular Block | FAERS: 3 Canada Vigilance: 1 | 19128732 | CTD SIDER Canada Vigilance US FAERS |
| 682 | Bilirubin conjugated increased | FAERS: 3 | OFFSIDES US FAERS | |
| 683 | Blood antidiuretic hormone increased | FAERS: 3 | US FAERS | |
| 684 | Blood bilirubin unconjugated increased | FAERS: 3 | US FAERS | |
| 685 | Blood prolactin decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 686 | Blood testosterone increased | FAERS: 3 | US FAERS | |
| 687 | Bowel movement irregularity | FAERS: 3 | US FAERS | |
| 688 | Brain Death | FAERS: 3 | OFFSIDES US FAERS | |
| 689 | Bronchopneumonia | FAERS: 3 | SIDER US FAERS | |
| 690 | Bronchospasm | FAERS: 3 | SIDER US FAERS | |
| 691 | Cardiotoxicity | FAERS: 3 | US FAERS | |
| 692 | Cerebral hypoperfusion | FAERS: 3 | US FAERS | |
| 693 | Cerebral ventricle dilatation | FAERS: 3 | US FAERS | |
| 694 | Cheilitis | FAERS: 3 | SIDER US FAERS | |
| 695 | Choreoathetosis | FAERS: 3 | SIDER US FAERS | |
| 696 | Coma scale abnormal | FAERS: 3 | US FAERS | |
| 697 | Corneal thinning | FAERS: 3 | US FAERS | |
| 698 | Cyst | FAERS: 3 | US FAERS | |
| 699 | Diaphragmatic Hernia | FAERS: 3 | US FAERS | |
| 700 | Diet refusal | FAERS: 3 | US FAERS | |
| 701 | Drug resistance | FAERS: 3 | US FAERS | |
| 702 | Dyslalia | FAERS: 3 | US FAERS | |
| 703 | Economic problem | FAERS: 3 | US FAERS | |
| 704 | Electrocardiogram T wave biphasic | FAERS: 3 | US FAERS | |
| 705 | Electrocardiogram U-wave abnormality | FAERS: 3 | US FAERS | |
| 706 | Emotional poverty | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 707 | Eosinophilic Pneumonia | FAERS: 3 | US FAERS | |
| 708 | Epiphyseal injury | FAERS: 3 | US FAERS | |
| 709 | Excessive masturbation | FAERS: 3 | US FAERS | |
| 710 | Facial Paresis | FAERS: 3 | US FAERS | |
| 711 | Febrile Neutropenia | FAERS: 3 | US FAERS | |
| 712 | Flight of ideas | FAERS: 3 | US FAERS | |
| 713 | Foreign body aspiration | FAERS: 3 | US FAERS | |
| 714 | Frontotemporal dementia | FAERS: 3 | 18217890 | CTD US FAERS |
| 715 | Gastric Dilatation | FAERS: 3 | US FAERS | |
| 716 | Gastrointestinal Pain | FAERS: 3 | SIDER US FAERS | |
| 717 | General symptom | FAERS: 3 | US FAERS | |
| 718 | Gestational Diabetes | FAERS: 3 | US FAERS | |
| 719 | Gingivitis | FAERS: 3 | SIDER US FAERS | |
| 720 | Hair metal test abnormal | FAERS: 3 | US FAERS | |
| 721 | Head titubation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 722 | Hepatomegaly | FAERS: 3 | SIDER US FAERS | |
| 723 | Hernia | FAERS: 3 | US FAERS | |
| 724 | Hydrocephalus | FAERS: 3 | US FAERS | |
| 725 | Hypertransaminasaemia | FAERS: 3 | OFFSIDES US FAERS | |
| 726 | Impaired quality of life | FAERS: 3 | US FAERS | |
| 727 | Impatience | FAERS: 3 | US FAERS | |
| 728 | Incorrect dose administered by device | FAERS: 3 | US FAERS | |
| 729 | Incorrect storage of drug | FAERS: 3 | US FAERS | |
| 730 | Injection site erythema | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 731 | Injury asphyxiation | FAERS: 3 | US FAERS | |
| 732 | Intercepted drug dispensing error | FAERS: 3 | US FAERS | |
| 733 | Keratitis | FAERS: 3 | US FAERS | |
| 734 | Laryngospasm | FAERS: 3 | SIDER US FAERS | |
| 735 | Left Ventricular Hypertrophy | FAERS: 3 | US FAERS | |
| 736 | Leptin level increased | FAERS: 3 | US FAERS | |
| 737 | Lipodystrophy acquired | FAERS: 3 | US FAERS | |
| 738 | Lipoma | FAERS: 3 | US FAERS | |
| 739 | MYELODYSPLASTIC SYNDROME | FAERS: 3 | US FAERS | |
| 740 | Mastication disorder | FAERS: 3 | US FAERS | |
| 741 | Meningioma | FAERS: 3 | US FAERS | |
| 742 | Metrorrhagia | FAERS: 3 | SIDER US FAERS | |
| 743 | Morbid thoughts | FAERS: 3 | US FAERS | |
| 744 | Muscle hypertrophy | FAERS: 3 | US FAERS | |
| 745 | Myocarditis | FAERS: 3 | SIDER US FAERS | |
| 746 | Myoglobin blood increased | FAERS: 3 | OFFSIDES US FAERS | |
| 747 | Myoglobinaemia | FAERS: 3 | US FAERS | |
| 748 | Myopathy | FAERS: 3 | US FAERS | |
| 749 | Myositis | FAERS: 3 | US FAERS | |
| 750 | Myotonia | FAERS: 3 | SIDER US FAERS | |
| 751 | Neonatal aspiration | FAERS: 3 | US FAERS | |
| 752 | Nephrotic Syndrome | FAERS: 3 | US FAERS | |
| 753 | Neurodermatitis | FAERS: 3 | US FAERS | |
| 754 | Neuropathy | FAERS: 3 | US FAERS | |
| 755 | Night sweats | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 756 | Nipple neoplasm | FAERS: 3 | US FAERS | |
| 757 | Nocturia | FAERS: 3 | US FAERS | |
| 758 | Nodule | FAERS: 3 | SIDER US FAERS | |
| 759 | Penile necrosis | FAERS: 3 | US FAERS | |
| 760 | Performance status decreased | FAERS: 3 | US FAERS | |
| 761 | Pericarditis | FAERS: 3 | US FAERS | |
| 762 | Pharyngitis | FAERS: 3 | SIDER US FAERS | |
| 763 | Pharyngolaryngeal Pain | FAERS: 3 | SIDER US FAERS | |
| 764 | Post procedural cellulitis | FAERS: 3 | US FAERS | |
| 765 | Product container seal issue | FAERS: 3 | US FAERS | |
| 766 | Product difficult to swallow | FAERS: 3 | US FAERS | |
| 767 | Product measured potency issue | FAERS: 3 | US FAERS | |
| 768 | Protein total decreased | FAERS: 3 | US FAERS | |
| 769 | Protein urine present | FAERS: 3 | US FAERS | |
| 770 | Psychological Trauma | FAERS: 3 | US FAERS | |
| 771 | Pulmonary thrombosis | FAERS: 3 | US FAERS | |
| 772 | Pustular psoriasis | FAERS: 3 | US FAERS | |
| 773 | Reaction to drug excipients | FAERS: 3 | US FAERS | |
| 774 | Rhonchi | FAERS: 3 | US FAERS | |
| 775 | Rubella | FAERS: 3 | US FAERS | |
| 776 | Sarcopenia | FAERS: 3 | US FAERS | |
| 777 | Scotoma | FAERS: 3 | US FAERS | |
| 778 | Selective eating disorder | FAERS: 3 | US FAERS | |
| 779 | Septic Shock | FAERS: 3 | US FAERS | |
| 780 | Sexual abuse | FAERS: 3 | US FAERS | |
| 781 | Skin Papilloma | FAERS: 3 | SIDER US FAERS | |
| 782 | Skin irritation | FAERS: 3 | US FAERS | |
| 783 | Skin laceration | FAERS: 3 | OFFSIDES US FAERS | |
| 784 | Skin reaction | FAERS: 3 | US FAERS | |
| 785 | Sleep-related eating disorder | FAERS: 3 | US FAERS | |
| 786 | Slow speech | FAERS: 3 | US FAERS | |
| 787 | Somnambulism | FAERS: 3 | 15003084 | CTD US FAERS |
| 788 | Spina Bifida | FAERS: 3 | US FAERS | |
| 789 | Spontaneous penile erection | FAERS: 3 | US FAERS | |
| 790 | Systolic dysfunction | FAERS: 3 | US FAERS | |
| 791 | Tachyphrenia | FAERS: 3 | US FAERS | |
| 792 | Therapeutic product effect decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 793 | Therapeutic response changed | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 794 | Therapeutic response delayed | FAERS: 3 | US FAERS | |
| 795 | Therapy regimen changed | FAERS: 3 | US FAERS | |
| 796 | Throat irritation | FAERS: 3 | US FAERS | |
| 797 | Thrombocytopenic purpura | FAERS: 3 | US FAERS | |
| 798 | Tongue movement disturbance | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 799 | Tonsillitis | FAERS: 3 | SIDER US FAERS | |
| 800 | Tooth Erosion | FAERS: 3 | US FAERS | |
| 801 | Total cholesterol/HDL ratio abnormal | FAERS: 3 | US FAERS | |
| 802 | Umbilical hernia | FAERS: 3 | US FAERS | |
| 803 | Upper airway obstruction | FAERS: 3 | US FAERS | |
| 804 | Uveitis | FAERS: 3 | US FAERS | |
| 805 | Vaginal Discharge | FAERS: 3 | SIDER US FAERS | |
| 806 | Ventricular internal diameter abnormal | FAERS: 3 | US FAERS | |
| 807 | Waist circumference increased | FAERS: 3 | US FAERS | |
| 808 | furuncle | FAERS: 3 | SIDER US FAERS | |
| 809 | Acarodermatitis | FAERS: 2 | SIDER US FAERS | |
| 810 | Acute Coronary Syndrome | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 811 | Alcohol problem | FAERS: 2 | US FAERS | |
| 812 | Alopecia universalis | FAERS: 2 | US FAERS | |
| 813 | Ammonia increased | FAERS: 2 | US FAERS | |
| 814 | Amputation | FAERS: 2 | OFFSIDES US FAERS | |
| 815 | Amyotrophic Lateral Sclerosis | FAERS: 2 | US FAERS | |
| 816 | Anal Fissure | FAERS: 2 | US FAERS | |
| 817 | Anorexia Nervosa | FAERS: 2 | US FAERS | |
| 818 | Anti-thyroid antibody positive | FAERS: 2 | US FAERS | |
| 819 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 820 | Apallic syndrome | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 821 | Apparent life threatening event | FAERS: 2 | US FAERS | |
| 822 | Application site reaction | FAERS: 2 | US FAERS | |
| 823 | Asterixis | FAERS: 2 | US FAERS | |
| 824 | Auricular swelling | FAERS: 2 | US FAERS | |
| 825 | Autoimmune thyroiditis | FAERS: 2 | US FAERS | |
| 826 | Automatism | FAERS: 2 | SIDER US FAERS | |
| 827 | Azoospermia | FAERS: 2 | US FAERS | |
| 828 | Back disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 829 | Blood alcohol increased | FAERS: 2 | US FAERS | |
| 830 | Blood cholesterol abnormal | FAERS: 2 | US FAERS | |
| 831 | Blood creatine phosphokinase MB increased | FAERS: 2 | US FAERS | |
| 832 | Blood electrolytes abnormal | FAERS: 2 | US FAERS | |
| 833 | Blood glucose decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 834 | Blood growth hormone increased | FAERS: 2 | US FAERS | |
| 835 | Blood iron decreased | FAERS: 2 | SIDER US FAERS | |
| 836 | Blood iron increased | FAERS: 2 | US FAERS | |
| 837 | Blood potassium abnormal | FAERS: 2 | US FAERS | |
| 838 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 839 | Blood testosterone abnormal | FAERS: 2 | US FAERS | |
| 840 | Blood triglycerides abnormal | FAERS: 2 | US FAERS | |
| 841 | Blood urea increased | FAERS: 2 | US FAERS | |
| 842 | Boredom | FAERS: 2 | US FAERS | |
| 843 | Brain scan abnormal | FAERS: 2 | US FAERS | |
| 844 | Brief psychotic disorder with marked stressors | FAERS: 2 | US FAERS | |
| 845 | Bulimia Nervosa | FAERS: 2 | 9114956 | CTD US FAERS |
| 846 | Bursitis | FAERS: 2 | SIDER US FAERS | |
| 847 | CHARGE Syndrome | FAERS: 2 | US FAERS | |
| 848 | Cachexia | FAERS: 2 | SIDER US FAERS | |
| 849 | Candidiasis | FAERS: 2 | US FAERS | |
| 850 | Cardiac Death | FAERS: 2 | US FAERS | |
| 851 | Carditis | FAERS: 2 | US FAERS | |
| 852 | Cataract operation | FAERS: 2 | US FAERS | |
| 853 | Cerebral Palsy | FAERS: 2 | OFFSIDES US FAERS | |
| 854 | Cerebral artery stenosis | FAERS: 2 | US FAERS | |
| 855 | Cholestasis | FAERS: 2 | CTD US FAERS | |
| 856 | Chronic Fatigue Syndrome | FAERS: 2 | US FAERS | |
| 857 | Clostridium colitis | FAERS: 2 | US FAERS | |
| 858 | Coagulation factor VII level decreased | FAERS: 2 | US FAERS | |
| 859 | Complex partial seizures | FAERS: 2 | US FAERS | |
| 860 | Complications of maternal exposure to therapeutic drugs | FAERS: 2 | US FAERS | |
| 861 | Congenital cystic kidney disease | FAERS: 2 | US FAERS | |
| 862 | Congenital heart valve disorder | FAERS: 2 | US FAERS | |
| 863 | Contraindicated product administered | FAERS: 2 | US FAERS | |
| 864 | Creatinine renal clearance decreased | FAERS: 2 | US FAERS | |
| 865 | Deafness Neurosensory | FAERS: 2 | US FAERS | |
| 866 | Delusional perception | FAERS: 2 | US FAERS | |
| 867 | Deposit eye | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 868 | Device related infection | FAERS: 2 | US FAERS | |
| 869 | Diabetic Foot | FAERS: 2 | OFFSIDES US FAERS | |
| 870 | Diastolic dysfunction | FAERS: 2 | US FAERS | |
| 871 | Dissociative Amnesia | FAERS: 2 | US FAERS | |
| 872 | Drug level below therapeutic | FAERS: 2 | US FAERS | |
| 873 | Drug withdrawal convulsions | FAERS: 2 | US FAERS | |
| 874 | Ear discomfort | FAERS: 2 | US FAERS | |
| 875 | Echolalia | FAERS: 2 | US FAERS | |
| 876 | Electrocardiogram ST segment abnormal | FAERS: 2 | US FAERS | |
| 877 | Electrocardiogram ST-T segment depression | FAERS: 2 | US FAERS | |
| 878 | Electroconvulsive Therapy | FAERS: 2 | US FAERS | |
| 879 | Endometrial Hyperplasia | FAERS: 2 | US FAERS | |
| 880 | Eosinophilic Fasciitis | FAERS: 2 | US FAERS | |
| 881 | Erythema Multiforme | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 882 | Eschar | FAERS: 2 | US FAERS | |
| 883 | Exposure via father | FAERS: 2 | US FAERS | |
| 884 | Eye inflammation | FAERS: 2 | US FAERS | |
| 885 | Facial paralysis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 886 | Female sex hormone level abnormal | FAERS: 2 | US FAERS | |
| 887 | Fine motor delay | FAERS: 2 | US FAERS | |
| 888 | Flank Pain | FAERS: 2 | US FAERS | |
| 889 | Food aversion | FAERS: 2 | US FAERS | |
| 890 | Gambling | FAERS: 2 | US FAERS | |
| 891 | Ganglioneuroma | FAERS: 2 | US FAERS | |
| 892 | Gangrene | FAERS: 2 | US FAERS | |
| 893 | Gastric Bypass | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 894 | Gastric infection | FAERS: 2 | US FAERS | |
| 895 | Gastrointestinal sounds abnormal | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 896 | Genital pain | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 897 | Gingival Recession | FAERS: 2 | US FAERS | |
| 898 | Glossoptosis | FAERS: 2 | US FAERS | |
| 899 | Glycosuria | FAERS: 2 | SIDER US FAERS | |
| 900 | Gout | FAERS: 2 | OFFSIDES US FAERS | |
| 901 | Granulocyte count decreased | FAERS: 2 | US FAERS | |
| 902 | Grip strength decreased | FAERS: 2 | US FAERS | |
| 903 | Head Banging | FAERS: 2 | US FAERS | |
| 904 | Head deformity | FAERS: 2 | US FAERS | |
| 905 | Heat illness | FAERS: 2 | US FAERS | |
| 906 | Hepatic Encephalopathy | FAERS: 2 | US FAERS | |
| 907 | Hepatic cancer stage IV | FAERS: 2 | US FAERS | |
| 908 | Hepatitis B | FAERS: 2 | US FAERS | |
| 909 | Hepatosplenomegaly | FAERS: 2 | US FAERS | |
| 910 | High density lipoprotein increased | FAERS: 2 | US FAERS | |
| 911 | Hyperkeratosis | FAERS: 2 | SIDER US FAERS | |
| 912 | Hypertrophy | FAERS: 2 | US FAERS | |
| 913 | Hyperventilation | FAERS: 2 | SIDER US FAERS | |
| 914 | Hypervigilance | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 915 | Hypohidrosis | FAERS: 2 | SIDER US FAERS | |
| 916 | Hypomania | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 917 | Hypoplastic Left Heart Syndrome | FAERS: 2 | US FAERS | |
| 918 | Hyporesponsive to stimuli | FAERS: 2 | US FAERS | |
| 919 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 920 | Infectious Mononucleosis | FAERS: 2 | US FAERS | |
| 921 | Insulin resistance syndrome | FAERS: 2 | US FAERS | |
| 922 | Intercepted drug administration error | FAERS: 2 | US FAERS | |
| 923 | Intermittent Explosive Disorder | FAERS: 2 | US FAERS | |
| 924 | Internal injury | FAERS: 2 | US FAERS | |
| 925 | Irregular sleep phase | FAERS: 2 | US FAERS | |
| 926 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 927 | Labile blood pressure | FAERS: 2 | US FAERS | |
| 928 | Laboratory test interference | FAERS: 2 | US FAERS | |
| 929 | Lack of spontaneous speech | FAERS: 2 | US FAERS | |
| 930 | Laziness | FAERS: 2 | US FAERS | |
| 931 | Leukocytoclastic vasculitis | FAERS: 2 | US FAERS | |
| 932 | Lipids abnormal | FAERS: 2 | US FAERS | |
| 933 | Live Birth | FAERS: 2 | US FAERS | |
| 934 | Long QT Syndrome | FAERS: 2 | 14597690 16859777 | CTD OFFSIDES SIDER US FAERS |
| 935 | Loss of dreaming | FAERS: 2 | US FAERS | |
| 936 | Low birth weight baby | FAERS: 2 | US FAERS | |
| 937 | Lymphocyte count decreased | FAERS: 2 | US FAERS | |
| 938 | Marasmus | FAERS: 2 | US FAERS | |
| 939 | Mechanical ileus | FAERS: 2 | US FAERS | |
| 940 | Mechanical ventilation | FAERS: 2 | US FAERS | |
| 941 | Megacolon | FAERS: 2 | US FAERS | |
| 942 | Micropenis | FAERS: 2 | US FAERS | |
| 943 | Moaning | FAERS: 2 | US FAERS | |
| 944 | Motion Sickness | FAERS: 2 | US FAERS | |
| 945 | Multiple allergies | FAERS: 2 | US FAERS | |
| 946 | Multiple drug overdose | FAERS: 2 | OFFSIDES US FAERS | |
| 947 | Murder | FAERS: 2 | US FAERS | |
| 948 | Muscle Fatigue | FAERS: 2 | US FAERS | |
| 949 | Muscular Dystrophy | FAERS: 2 | US FAERS | |
| 950 | Myasthenic Syndrome | FAERS: 2 | US FAERS | |
| 951 | Myringitis | FAERS: 2 | US FAERS | |
| 952 | Neuralgia | FAERS: 2 | US FAERS | |
| 953 | Norepinephrine increased | FAERS: 2 | US FAERS | |
| 954 | Ocular icterus | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 955 | Oculogyration | FAERS: 2 | SIDER US FAERS | |
| 956 | Onychomycosis | FAERS: 2 | SIDER US FAERS | |
| 957 | Open wound | FAERS: 2 | US FAERS | |
| 958 | Oppositional Defiant Disorder | FAERS: 2 | US FAERS | |
| 959 | Oral pain | FAERS: 2 | US FAERS | |
| 960 | Orchitis | FAERS: 2 | US FAERS | |
| 961 | Overgrowth fungal | FAERS: 2 | US FAERS | |
| 962 | PCO2 increased | FAERS: 2 | US FAERS | |
| 963 | Pectus excavatum | FAERS: 2 | US FAERS | |
| 964 | Penile swelling | FAERS: 2 | US FAERS | |
| 965 | Periarthritis | FAERS: 2 | US FAERS | |
| 966 | Periodontitis | FAERS: 2 | US FAERS | |
| 967 | Phalangeal agenesis | FAERS: 2 | US FAERS | |
| 968 | Platelet aggregation decreased | FAERS: 2 | US FAERS | |
| 969 | Pleurisy | FAERS: 2 | US FAERS | |
| 970 | Polyarthritis | FAERS: 2 | US FAERS | |
| 971 | Polysubstance dependence | FAERS: 2 | US FAERS | |
| 972 | Poor peripheral circulation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 973 | Poor quality product administered | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 974 | Post procedural complication | FAERS: 2 | US FAERS | |
| 975 | Pregnancy of partner | FAERS: 2 | US FAERS | |
| 976 | Product dropper issue | FAERS: 2 | US FAERS | |
| 977 | Product formulation issue | FAERS: 2 | US FAERS | |
| 978 | Product packaging confusion | FAERS: 2 | US FAERS | |
| 979 | Product use complaint | FAERS: 2 | US FAERS | |
| 980 | Product used for unknown indication | FAERS: 2 | US FAERS | |
| 981 | Protein albumin ratio | FAERS: 2 | US FAERS | |
| 982 | Pseudobulbar Palsy | FAERS: 2 | US FAERS | |
| 983 | Rebound effect | FAERS: 2 | US FAERS | |
| 984 | Rehabilitation therapy | FAERS: 2 | US FAERS | |
| 985 | Renal Artery Stenosis | FAERS: 2 | US FAERS | |
| 986 | Renal Colic | FAERS: 2 | US FAERS | |
| 987 | Renal tubular acidosis | FAERS: 2 | US FAERS | |
| 988 | Renal tubular disorder | FAERS: 2 | US FAERS | |
| 989 | Respiratory fume inhalation disorder | FAERS: 2 | US FAERS | |
| 990 | Retinal Degeneration | FAERS: 2 | US FAERS | |
| 991 | Retinal Vasculitis | FAERS: 2 | US FAERS | |
| 992 | Retinal vascular occlusion | FAERS: 2 | US FAERS | |
| 993 | Retinal vascular thrombosis | FAERS: 2 | US FAERS | |
| 994 | Sciatica | FAERS: 2 | US FAERS | |
| 995 | Selective Mutism | FAERS: 2 | US FAERS | |
| 996 | Sinoatrial Block | FAERS: 2 | US FAERS | |
| 997 | Skin Wrinkling | FAERS: 2 | US FAERS | |
| 998 | Snoring | FAERS: 2 | US FAERS | |
| 999 | Somatic symptom disorder of pregnancy | FAERS: 2 | US FAERS | |
| 1000 | Sperm concentration decreased | FAERS: 2 | US FAERS | |
| 1001 | Spinal column injury | FAERS: 2 | US FAERS | |
| 1002 | Spinal column stenosis | FAERS: 2 | US FAERS | |
| 1003 | Stem cell transplant | FAERS: 2 | US FAERS | |
| 1004 | Stomatitis | FAERS: 2 | SIDER US FAERS | |
| 1005 | Supportive care | FAERS: 2 | US FAERS | |
| 1006 | Suppressed lactation | FAERS: 2 | US FAERS | |
| 1007 | Tablet physical issue | FAERS: 2 | US FAERS | |
| 1008 | Thought insertion | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1009 | Tinea Pedis | FAERS: 2 | US FAERS | |
| 1010 | Upper-airway cough syndrome | FAERS: 2 | US FAERS | |
| 1011 | Urethral fistula | FAERS: 2 | US FAERS | |
| 1012 | Urinary Tract Pain | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1013 | Urinary hesitation | FAERS: 2 | US FAERS | |
| 1014 | Urine output increased | FAERS: 2 | SIDER US FAERS | |
| 1015 | Urticarial vasculitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1016 | Verbigeration | FAERS: 2 | US FAERS | |
| 1017 | Victim of sexual abuse | FAERS: 2 | US FAERS | |
| 1018 | Walking aid user | FAERS: 2 | US FAERS | |
| 1019 | Yawning | FAERS: 2 | SIDER US FAERS | |
| 1020 | ovarian neoplasm | FAERS: 2 | US FAERS | |
| 1021 | Abdominal mass | FAERS: 1 | US FAERS | |
| 1022 | Abdominal strangulated hernia | FAERS: 1 | US FAERS | |
| 1023 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 1024 | Abnormal Involuntary Movement Scale | FAERS: 1 | US FAERS | |
| 1025 | Accelerated Idioventricular Rhythm | FAERS: 1 | US FAERS | |
| 1026 | Accessory cardiac pathway | FAERS: 1 | US FAERS | |
| 1027 | Acute sinusitis | FAERS: 1 | US FAERS | |
| 1028 | Adams-Stokes Syndrome | FAERS: 1 | US FAERS | |
| 1029 | Adenocarcinoma | FAERS: 1 | SIDER US FAERS | |
| 1030 | Adjustment disorder with depressed mood | FAERS: 1 | US FAERS | |
| 1031 | Adnexa uteri pain | FAERS: 1 | US FAERS | |
| 1032 | Adrenal glomerular zone abnormal | FAERS: 1 | US FAERS | |
| 1033 | Agoraphobia | FAERS: 1 | US FAERS | |
| 1034 | Alkalosis | FAERS: 1 | US FAERS | |
| 1035 | Alpha hydroxybutyrate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 1036 | Amimia | FAERS: 1 | US FAERS | |
| 1037 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 1038 | Amputation of penis | FAERS: 1 | US FAERS | |
| 1039 | Anal abscess | FAERS: 1 | US FAERS | |
| 1040 | Aneurysm | FAERS: 1 | US FAERS | |
| 1041 | Anomalous atrioventricular excitation | FAERS: 1 | US FAERS | |
| 1042 | Anosognosia | FAERS: 1 | US FAERS | |
| 1043 | Anticoagulant therapy | FAERS: 1 | US FAERS | |
| 1044 | Antiphospholipid Syndrome | FAERS: 1 | US FAERS | |
| 1045 | Antiphospholipid antibodies positive | FAERS: 1 | US FAERS | |
| 1046 | Antipsychotic drug level decreased | FAERS: 1 | US FAERS | |
| 1047 | Apparent death | FAERS: 1 | US FAERS | |
| 1048 | Application site erythema | FAERS: 1 | US FAERS | |
| 1049 | Application site swelling | FAERS: 1 | US FAERS | |
| 1050 | Arteriosclerotic retinopathy | FAERS: 1 | US FAERS | |
| 1051 | Arthropod bite | FAERS: 1 | US FAERS | |
| 1052 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 1053 | Atelectasis | FAERS: 1 | US FAERS | |
| 1054 | Atrioventricular Septal Defect | FAERS: 1 | US FAERS | |
| 1055 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 1056 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 1057 | Aversion | FAERS: 1 | US FAERS | |
| 1058 | Avoidant Personality Disorder | FAERS: 1 | US FAERS | |
| 1059 | Band neutrophil percentage decreased | FAERS: 1 | US FAERS | |
| 1060 | Bankruptcy | FAERS: 1 | US FAERS | |
| 1061 | Basilar artery thrombosis | FAERS: 1 | US FAERS | |
| 1062 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 1063 | Benign nipple neoplasm | FAERS: 1 | US FAERS | |
| 1064 | Bilateral breast buds | FAERS: 1 | US FAERS | |
| 1065 | Biliary Fistula | FAERS: 1 | US FAERS | |
| 1066 | Biliary cirrhosis | FAERS: 1 | US FAERS | |
| 1067 | Biopsy | FAERS: 1 | US FAERS | |
| 1068 | Bladder pain | FAERS: 1 | SIDER US FAERS | |
| 1069 | Blast cells present | FAERS: 1 | US FAERS | |
| 1070 | Blastomycosis | FAERS: 1 | US FAERS | |
| 1071 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 1072 | Blood antidiuretic hormone decreased | FAERS: 1 | US FAERS | |
| 1073 | Blood chloride increased | FAERS: 1 | US FAERS | |
| 1074 | Blood cholesterol | FAERS: 1 | OFFSIDES US FAERS | |
| 1075 | Blood cortisol decreased | FAERS: 1 | US FAERS | |
| 1076 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 1077 | Blood creatine decreased | FAERS: 1 | US FAERS | |
| 1078 | Blood creatine phosphokinase | FAERS: 1 | US FAERS | |
| 1079 | Blood creatine phosphokinase BB increased | FAERS: 1 | US FAERS | |
| 1080 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 1081 | Blood ethanol increased | FAERS: 1 | US FAERS | |
| 1082 | Blood growth hormone decreased | FAERS: 1 | US FAERS | |
| 1083 | Blood insulin decreased | FAERS: 1 | US FAERS | |
| 1084 | Blood ketone body increased | FAERS: 1 | US FAERS | |
| 1085 | Blood ketone body present | FAERS: 1 | US FAERS | |
| 1086 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 1087 | Blood osmolarity increased | FAERS: 1 | US FAERS | |
| 1088 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 1089 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 1090 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 1091 | Blood thyroid stimulating hormone | FAERS: 1 | US FAERS | |
| 1092 | Blood thyroid stimulating hormone abnormal | FAERS: 1 | US FAERS | |
| 1093 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 1094 | Bone decalcification | FAERS: 1 | US FAERS | |
| 1095 | Bone density abnormal | FAERS: 1 | US FAERS | |
| 1096 | Bone erosion | FAERS: 1 | US FAERS | |
| 1097 | Brain Contusion | FAERS: 1 | US FAERS | |
| 1098 | Breast Feeding | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 1099 | Breast cancer stage III | FAERS: 1 | US FAERS | |
| 1100 | Breast fibroma | FAERS: 1 | US FAERS | |
| 1101 | Breast infection | FAERS: 1 | US FAERS | |
| 1102 | Breath alcohol test positive | FAERS: 1 | US FAERS | |
| 1103 | Brucellosis | FAERS: 1 | US FAERS | |
| 1104 | Carcinoma | FAERS: 1 | US FAERS | |
| 1105 | Cardiac Flutter | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1106 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 1107 | Cardiac ventricular disorder | FAERS: 1 | US FAERS | |
| 1108 | Cardiometabolic syndrome | FAERS: 1 | US FAERS | |
| 1109 | Catheter site discharge | FAERS: 1 | US FAERS | |
| 1110 | Catheter site related reaction | FAERS: 1 | US FAERS | |
| 1111 | Cavernous Sinus Thrombosis | FAERS: 1 | US FAERS | |
| 1112 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 1113 | Cerebellar artery thrombosis | FAERS: 1 | US FAERS | |
| 1114 | Cerebral Arteriosclerosis | FAERS: 1 | US FAERS | |
| 1115 | Cerebral Atherosclerosis | FAERS: 1 | US FAERS | |
| 1116 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 1117 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 1118 | Cerebral circulatory failure | FAERS: 1 | US FAERS | |
| 1119 | Cerebrospinal fluid retention | FAERS: 1 | US FAERS | |
| 1120 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 1121 | Chemical injury | FAERS: 1 | US FAERS | |
| 1122 | Cheyne-Stokes Respiration | FAERS: 1 | US FAERS | |
| 1123 | Choking sensation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1124 | Chorea | FAERS: 1 | SIDER US FAERS | |
| 1125 | Claustrophobia | FAERS: 1 | US FAERS | |
| 1126 | Cleft Palate | FAERS: 1 | US FAERS | |
| 1127 | Clonus | FAERS: 1 | US FAERS | |
| 1128 | Clubbing | FAERS: 1 | US FAERS | |
| 1129 | Clumsiness | FAERS: 1 | US FAERS | |
| 1130 | Coagulation factor IX level decreased | FAERS: 1 | US FAERS | |
| 1131 | Coagulation factor V level decreased | FAERS: 1 | US FAERS | |
| 1132 | Coagulation factor X level decreased | FAERS: 1 | US FAERS | |
| 1133 | Complication of device removal | FAERS: 1 | US FAERS | |
| 1134 | Compression fracture | FAERS: 1 | US FAERS | |
| 1135 | Compulsive shopping | FAERS: 1 | US FAERS | |
| 1136 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 1137 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 1138 | Coronary angioplasty | FAERS: 1 | US FAERS | |
| 1139 | Coronary artery insufficiency | FAERS: 1 | US FAERS | |
| 1140 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 1141 | Cyclothymic Disorder | FAERS: 1 | US FAERS | |
| 1142 | Cytopenia | FAERS: 1 | US FAERS | |
| 1143 | Decapitation | FAERS: 1 | US FAERS | |
| 1144 | Decreased eye contact | FAERS: 1 | US FAERS | |
| 1145 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 1146 | Delusion of reference | FAERS: 1 | US FAERS | |
| 1147 | Delusional disorder, unspecified type | FAERS: 1 | US FAERS | |
| 1148 | Dengue Fever | FAERS: 1 | US FAERS | |
| 1149 | Dentofacial anomaly | FAERS: 1 | US FAERS | |
| 1150 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 1151 | Dermoid Cyst | FAERS: 1 | US FAERS | |
| 1152 | Device dispensing error | FAERS: 1 | US FAERS | |
| 1153 | Device use error | FAERS: 1 | US FAERS | |
| 1154 | Diabetic Amyotrophy | FAERS: 1 | US FAERS | |
| 1155 | Diabetic Retinopathy | FAERS: 1 | OFFSIDES US FAERS | |
| 1156 | Dialysis related complication | FAERS: 1 | US FAERS | |
| 1157 | Diastolic hypertension | FAERS: 1 | US FAERS | |
| 1158 | Diffuse alopecia | FAERS: 1 | US FAERS | |
| 1159 | Diphtheria | FAERS: 1 | US FAERS | |
| 1160 | Disease risk factor | FAERS: 1 | US FAERS | |
| 1161 | Disturbance in sexual arousal | FAERS: 1 | SIDER US FAERS | |
| 1162 | Diverticulum | FAERS: 1 | OFFSIDES US FAERS | |
| 1163 | Dose calculation error | FAERS: 1 | US FAERS | |
| 1164 | Drug chemical incompatibility | FAERS: 1 | US FAERS | |
| 1165 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 1166 | Drug exposure before pregnancy | FAERS: 1 | US FAERS | |
| 1167 | Drug screen negative | FAERS: 1 | US FAERS | |
| 1168 | Drug withdrawal headache | FAERS: 1 | US FAERS | |
| 1169 | Dyscalculia | FAERS: 1 | US FAERS | |
| 1170 | Eating disorder symptom | FAERS: 1 | US FAERS | |
| 1171 | Ecchymosis | FAERS: 1 | US FAERS | |
| 1172 | Echopraxia | FAERS: 1 | US FAERS | |
| 1173 | Egocentrism | FAERS: 1 | US FAERS | |
| 1174 | Electrocardiogram QT interval abnormal | FAERS: 1 | SIDER US FAERS | |
| 1175 | Electrocardiogram delta waves abnormal | FAERS: 1 | US FAERS | |
| 1176 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 1177 | Embolic cerebral infarction | FAERS: 1 | US FAERS | |
| 1178 | Emergency Care | FAERS: 1 | US FAERS | |
| 1179 | Enterocolitis | FAERS: 1 | US FAERS | |
| 1180 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 1181 | Eosinophilic colitis | FAERS: 1 | US FAERS | |
| 1182 | Epinephrine increased | FAERS: 1 | US FAERS | |
| 1183 | Erysipelas | FAERS: 1 | US FAERS | |
| 1184 | Erythema Infectiosum | FAERS: 1 | US FAERS | |
| 1185 | Erythropenia | FAERS: 1 | US FAERS | |
| 1186 | Escherichia sepsis | FAERS: 1 | OFFSIDES US FAERS | |
| 1187 | Excitability | FAERS: 1 | US FAERS | |
| 1188 | Excoriation | FAERS: 1 | US FAERS | |
| 1189 | Expired drug administered | FAERS: 1 | US FAERS | |
| 1190 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 1191 | Exposure to unspecified agent | FAERS: 1 | US FAERS | |
| 1192 | Exposure via direct contact | FAERS: 1 | US FAERS | |
| 1193 | Extremity contracture | FAERS: 1 | US FAERS | |
| 1194 | Eye Burns | FAERS: 1 | US FAERS | |
| 1195 | Eye Infection | FAERS: 1 | SIDER US FAERS | |
| 1196 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 1197 | Face presentation | FAERS: 1 | US FAERS | |
| 1198 | Fasciitis | FAERS: 1 | US FAERS | |
| 1199 | Febrile infection | FAERS: 1 | US FAERS | |
| 1200 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 1201 | Fibrosis | FAERS: 1 | 17631667 | CTD US FAERS |
| 1202 | Filariasis | FAERS: 1 | US FAERS | |
| 1203 | Fixed drug eruption | FAERS: 1 | US FAERS | |
| 1204 | Folliculitis | FAERS: 1 | US FAERS | |
| 1205 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 1206 | Freezing phenomenon | FAERS: 1 | US FAERS | |
| 1207 | Frostbite | FAERS: 1 | US FAERS | |
| 1208 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 1209 | Galactocele | FAERS: 1 | OFFSIDES US FAERS | |
| 1210 | Gastrectomy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1211 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 1212 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 1213 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 1214 | Gender Dysphoria | FAERS: 1 | US FAERS | |
| 1215 | Genital abscess | FAERS: 1 | US FAERS | |
| 1216 | Glabellar reflex abnormal | FAERS: 1 | SIDER US FAERS | |
| 1217 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 1218 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 1219 | Granulomatous liver disease | FAERS: 1 | US FAERS | |
| 1220 | Grip strength | FAERS: 1 | OFFSIDES US FAERS | |
| 1221 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 1222 | Hamartoma | FAERS: 1 | US FAERS | |
| 1223 | Hand-eye coordination impaired | FAERS: 1 | US FAERS | |
| 1224 | Heat Stroke | FAERS: 1 | SIDER US FAERS | |
| 1225 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 1226 | High turnover osteopathy | FAERS: 1 | US FAERS | |
| 1227 | Hip Dysplasia | FAERS: 1 | US FAERS | |
| 1228 | Hip surgery | FAERS: 1 | US FAERS | |
| 1229 | Hypercapnic coma | FAERS: 1 | US FAERS | |
| 1230 | Hyperlipasaemia | FAERS: 1 | US FAERS | |
| 1231 | Hypertensive heart disease | FAERS: 1 | OFFSIDES US FAERS | |
| 1232 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 1233 | Hypochondriasis | FAERS: 1 | US FAERS | |
| 1234 | Hypometabolism | FAERS: 1 | US FAERS | |
| 1235 | Hyponatraemic coma | FAERS: 1 | US FAERS | |
| 1236 | Hypotrichosis | FAERS: 1 | US FAERS | |
| 1237 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 1238 | Idiosyncratic drug reaction | FAERS: 1 | US FAERS | |
| 1239 | Illogical thinking | FAERS: 1 | US FAERS | |
| 1240 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 1241 | Impaired reasoning | FAERS: 1 | US FAERS | |
| 1242 | Impetigo | FAERS: 1 | US FAERS | |
| 1243 | Incision site complication | FAERS: 1 | US FAERS | |
| 1244 | Incorrect route of product administration | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1245 | Increased insulin requirement | FAERS: 1 | US FAERS | |
| 1246 | Induration | FAERS: 1 | SIDER US FAERS | |
| 1247 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 1248 | Injection site abscess | FAERS: 1 | SIDER US FAERS | |
| 1249 | Injection site cellulitis | FAERS: 1 | SIDER US FAERS | |
| 1250 | Injection site cyst | FAERS: 1 | SIDER US FAERS | |
| 1251 | Injection site injury | FAERS: 1 | US FAERS | |
| 1252 | Injection site irritation | FAERS: 1 | US FAERS | |
| 1253 | Injection site pruritus | FAERS: 1 | US FAERS | |
| 1254 | Insulin resistance test | FAERS: 1 | US FAERS | |
| 1255 | Insulin-requiring type 2 diabetes mellitus | FAERS: 1 | OFFSIDES US FAERS | |
| 1256 | Intelligence test abnormal | FAERS: 1 | US FAERS | |
| 1257 | Intermittent Claudication | FAERS: 1 | SIDER US FAERS | |
| 1258 | Intestinal resection | FAERS: 1 | US FAERS | |
| 1259 | Intestinal sepsis | FAERS: 1 | US FAERS | |
| 1260 | Intracranial Hypotension | FAERS: 1 | US FAERS | |
| 1261 | Intraocular pressure test | FAERS: 1 | US FAERS | |
| 1262 | Intrusive thoughts | FAERS: 1 | US FAERS | |
| 1263 | Intussusception | FAERS: 1 | US FAERS | |
| 1264 | Joint injury | FAERS: 1 | US FAERS | |
| 1265 | Juvenile arthritis | FAERS: 1 | US FAERS | |
| 1266 | Ketosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1267 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 1268 | Lack of injection site rotation | FAERS: 1 | US FAERS | |
| 1269 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 1270 | Left atrial dilatation | FAERS: 1 | US FAERS | |
| 1271 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 1272 | Leukotomy | FAERS: 1 | US FAERS | |
| 1273 | Limb operation | FAERS: 1 | US FAERS | |
| 1274 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 1275 | Lipomatosis | FAERS: 1 | US FAERS | |
| 1276 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 1277 | Liver Abscess | FAERS: 1 | US FAERS | |
| 1278 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 1279 | Locked-In Syndrome | FAERS: 1 | US FAERS | |
| 1280 | Loose associations | FAERS: 1 | US FAERS | |
| 1281 | Lordosis | FAERS: 1 | US FAERS | |
| 1282 | Lymphangitis | FAERS: 1 | US FAERS | |
| 1283 | Lymphoma | FAERS: 1 | US FAERS | |
| 1284 | Macroglossia | FAERS: 1 | US FAERS | |
| 1285 | Macule | FAERS: 1 | US FAERS | |
| 1286 | Magnesium Deficiency | FAERS: 1 | US FAERS | |
| 1287 | Malabsorption | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1288 | Male genital examination abnormal | FAERS: 1 | US FAERS | |
| 1289 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 1290 | Malocclusion | FAERS: 1 | US FAERS | |
| 1291 | Manufacturing materials issue | FAERS: 1 | US FAERS | |
| 1292 | Markedly reduced dietary intake | FAERS: 1 | US FAERS | |
| 1293 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 1294 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 1295 | Meningitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1296 | Meningomyelocele | FAERS: 1 | US FAERS | |
| 1297 | Menopause | FAERS: 1 | US FAERS | |
| 1298 | Mental retardation severity unspecified | FAERS: 1 | US FAERS | |
| 1299 | Merycism | FAERS: 1 | US FAERS | |
| 1300 | Metastasis | FAERS: 1 | US FAERS | |
| 1301 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 1302 | Microalbuminuria | FAERS: 1 | US FAERS | |
| 1303 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 1304 | Mitochondrial cytopathy | FAERS: 1 | US FAERS | |
| 1305 | Mixed liver injury | FAERS: 1 | US FAERS | |
| 1306 | Monocyte count decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1307 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 1308 | Monocytopenia | FAERS: 1 | US FAERS | |
| 1309 | Mucosal Infection | FAERS: 1 | US FAERS | |
| 1310 | Multiple drug overdose accidental | FAERS: 1 | US FAERS | |
| 1311 | Multiple drug overdose intentional | FAERS: 1 | US FAERS | |
| 1312 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 1313 | Muscle fibrosis | FAERS: 1 | US FAERS | |
| 1314 | Muscle necrosis | FAERS: 1 | US FAERS | |
| 1315 | Myelitis | FAERS: 1 | US FAERS | |
| 1316 | Myelofibrosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1317 | Myopia | FAERS: 1 | US FAERS | |
| 1318 | Necrosis | FAERS: 1 | 17631667 | CTD SIDER US FAERS |
| 1319 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 1320 | Nephrogenic Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 1321 | Neuropsychological test abnormal | FAERS: 1 | US FAERS | |
| 1322 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 1323 | Neutrophil Pelger-Huet anomaly present | FAERS: 1 | US FAERS | |
| 1324 | No adverse effect | FAERS: 1 | US FAERS | |
| 1325 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 1326 | Nuchal Rigidity | FAERS: 1 | SIDER US FAERS | |
| 1327 | Nystagmus | FAERS: 1 | US FAERS | |
| 1328 | Oculomucocutaneous syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 1329 | Oligohydramnios | FAERS: 1 | US FAERS | |
| 1330 | Oliguria | FAERS: 1 | US FAERS | |
| 1331 | Onycholysis | FAERS: 1 | US FAERS | |
| 1332 | Ophthalmoplegia | FAERS: 1 | US FAERS | |
| 1333 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 1334 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 1335 | Orgasmic sensation decreased | FAERS: 1 | US FAERS | |
| 1336 | Oropharyngeal spasm | FAERS: 1 | SIDER US FAERS | |
| 1337 | Osmotic demyelination syndrome | FAERS: 1 | US FAERS | |
| 1338 | PO2 decreased | FAERS: 1 | US FAERS | |
| 1339 | Packaging design issue | FAERS: 1 | US FAERS | |
| 1340 | Pain of skin | FAERS: 1 | US FAERS | |
| 1341 | Pancreatic Insufficiency | FAERS: 1 | US FAERS | |
| 1342 | Pancreatic Neoplasm | FAERS: 1 | SIDER US FAERS | |
| 1343 | Pancreatic Pseudocyst | FAERS: 1 | US FAERS | |
| 1344 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 1345 | Panniculitis | FAERS: 1 | US FAERS | |
| 1346 | Papule | FAERS: 1 | US FAERS | |
| 1347 | Paresis | FAERS: 1 | US FAERS | |
| 1348 | Parkinsonian rest tremor | FAERS: 1 | SIDER US FAERS | |
| 1349 | Paroxysmal choreoathetosis | FAERS: 1 | US FAERS | |
| 1350 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 1351 | Penile curvature | FAERS: 1 | US FAERS | |
| 1352 | Peptic Ulcer Perforation | FAERS: 1 | US FAERS | |
| 1353 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 1354 | Peripheral artery occlusion | FAERS: 1 | US FAERS | |
| 1355 | Peritonitis | FAERS: 1 | US FAERS | |
| 1356 | Phagophobia | FAERS: 1 | US FAERS | |
| 1357 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 1358 | Phimosis | FAERS: 1 | US FAERS | |
| 1359 | Physical abuse | FAERS: 1 | US FAERS | |
| 1360 | Pilonidal Cyst | FAERS: 1 | US FAERS | |
| 1361 | Plagiocephaly | FAERS: 1 | US FAERS | |
| 1362 | Platelet aggregation | FAERS: 1 | US FAERS | |
| 1363 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 1364 | Pleural Infection | FAERS: 1 | US FAERS | |
| 1365 | Polyarteritis Nodosa | FAERS: 1 | US FAERS | |
| 1366 | Poor dental condition | FAERS: 1 | US FAERS | |
| 1367 | Poor feeding infant | FAERS: 1 | US FAERS | |
| 1368 | Precancerous cells present | FAERS: 1 | US FAERS | |
| 1369 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 1370 | Pressure of speech | FAERS: 1 | US FAERS | |
| 1371 | Product appearance confusion | FAERS: 1 | US FAERS | |
| 1372 | Product commingling | FAERS: 1 | US FAERS | |
| 1373 | Product compounding quality issue | FAERS: 1 | US FAERS | |
| 1374 | Product contamination physical | FAERS: 1 | US FAERS | |
| 1375 | Product contamination with body fluid | FAERS: 1 | US FAERS | |
| 1376 | Product deposit | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1377 | Product design confusion | FAERS: 1 | US FAERS | |
| 1378 | Product distribution issue | FAERS: 1 | US FAERS | |
| 1379 | Product dosage form confusion | FAERS: 1 | US FAERS | |
| 1380 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 1381 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 1382 | Product label confusion | FAERS: 1 | US FAERS | |
| 1383 | Product name confusion | FAERS: 1 | US FAERS | |
| 1384 | Product preparation issue | FAERS: 1 | US FAERS | |
| 1385 | Product size issue | FAERS: 1 | US FAERS | |
| 1386 | Product tampering | FAERS: 1 | US FAERS | |
| 1387 | Progesterone increased | FAERS: 1 | US FAERS | |
| 1388 | Prostate examination abnormal | FAERS: 1 | US FAERS | |
| 1389 | Prostatic calcification | FAERS: 1 | US FAERS | |
| 1390 | Protein C Deficiency | FAERS: 1 | US FAERS | |
| 1391 | Prothrombin time abnormal | FAERS: 1 | US FAERS | |
| 1392 | Psychiatric decompensation | FAERS: 1 | US FAERS | |
| 1393 | Psychogenic seizure | FAERS: 1 | US FAERS | |
| 1394 | Psychological abuse | FAERS: 1 | US FAERS | |
| 1395 | Pulmonary congestion | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 1396 | Pulmonary malformation | FAERS: 1 | US FAERS | |
| 1397 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 1398 | Pulmonary sepsis | FAERS: 1 | US FAERS | |
| 1399 | Pupillary light reflex tests abnormal | FAERS: 1 | US FAERS | |
| 1400 | Purulence | FAERS: 1 | US FAERS | |
| 1401 | QRS axis abnormal | FAERS: 1 | US FAERS | |
| 1402 | Quadriplegia | FAERS: 1 | US FAERS | |
| 1403 | Rales | FAERS: 1 | SIDER US FAERS | |
| 1404 | Regurgitation of food | FAERS: 1 | US FAERS | |
| 1405 | Regurgitation | FAERS: 1 | US FAERS | |
| 1406 | Renal cyst | FAERS: 1 | US FAERS | |
| 1407 | Renal mass | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1408 | Renal scan abnormal | FAERS: 1 | US FAERS | |
| 1409 | Resting Tremor | FAERS: 1 | US FAERS | |
| 1410 | Retinal artery embolism | FAERS: 1 | US FAERS | |
| 1411 | Retinal infarction | FAERS: 1 | US FAERS | |
| 1412 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 1413 | Rhabdomyoma | FAERS: 1 | US FAERS | |
| 1414 | Rhinalgia | FAERS: 1 | US FAERS | |
| 1415 | Rosacea | FAERS: 1 | US FAERS | |
| 1416 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 1417 | Russell's viper venom time abnormal | FAERS: 1 | US FAERS | |
| 1418 | Sarcoma | FAERS: 1 | US FAERS | |
| 1419 | Secretion discharge | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1420 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 1421 | Self Mutilation | FAERS: 1 | US FAERS | |
| 1422 | Self-induced vomiting | FAERS: 1 | US FAERS | |
| 1423 | Semen viscosity decreased | FAERS: 1 | US FAERS | |
| 1424 | Sensitive skin | FAERS: 1 | US FAERS | |
| 1425 | Sensitivity to weather change | FAERS: 1 | US FAERS | |
| 1426 | Seronegative arthritis | FAERS: 1 | US FAERS | |
| 1427 | Shoulder deformity | FAERS: 1 | US FAERS | |
| 1428 | Skeletal injury | FAERS: 1 | US FAERS | |
| 1429 | Skeleton dysplasia | FAERS: 1 | US FAERS | |
| 1430 | Skin discomfort | FAERS: 1 | US FAERS | |
| 1431 | Skin necrosis | FAERS: 1 | US FAERS | |
| 1432 | Skin tightness | FAERS: 1 | US FAERS | |
| 1433 | Skinfold measurement | FAERS: 1 | US FAERS | |
| 1434 | Sleep Paralysis | FAERS: 1 | US FAERS | |
| 1435 | Somatic symptom disorder | FAERS: 1 | US FAERS | |
| 1436 | Somatoform Disorder | FAERS: 1 | US FAERS | |
| 1437 | Sperm count abnormal | FAERS: 1 | US FAERS | |
| 1438 | Spermatozoa abnormal | FAERS: 1 | US FAERS | |
| 1439 | Spermatozoa morphology abnormal | FAERS: 1 | US FAERS | |
| 1440 | Spermatozoa progressive motility abnormal | FAERS: 1 | US FAERS | |
| 1441 | Spermatozoa progressive motility decreased | FAERS: 1 | US FAERS | |
| 1442 | Splenic cyst | FAERS: 1 | US FAERS | |
| 1443 | Staphylococcal abscess | FAERS: 1 | US FAERS | |
| 1444 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 1445 | Streptococcus test positive | FAERS: 1 | US FAERS | |
| 1446 | Sudden Visual Loss | FAERS: 1 | US FAERS | |
| 1447 | Sunburn | FAERS: 1 | US FAERS | |
| 1448 | Supraventricular tachyarrhythmia | FAERS: 1 | US FAERS | |
| 1449 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 1450 | Tablet issue | FAERS: 1 | US FAERS | |
| 1451 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 1452 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 1453 | Tension Headache | FAERS: 1 | SIDER US FAERS | |
| 1454 | Tetany | FAERS: 1 | SIDER US FAERS | |
| 1455 | Theft | FAERS: 1 | US FAERS | |
| 1456 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 1457 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 1458 | Thought withdrawal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1459 | Thyroid hormones increased | FAERS: 1 | US FAERS | |
| 1460 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 1461 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 1462 | Tooth Infection | FAERS: 1 | US FAERS | |
| 1463 | Tracheitis | FAERS: 1 | US FAERS | |
| 1464 | Transfusion Reaction | FAERS: 1 | US FAERS | |
| 1465 | Transfusion-Related Acute Lung Injury | FAERS: 1 | US FAERS | |
| 1466 | Transmission of an infectious agent via a medicinal product | FAERS: 1 | US FAERS | |
| 1467 | Transplant | FAERS: 1 | US FAERS | |
| 1468 | Traumatic Brain Injury | FAERS: 1 | US FAERS | |
| 1469 | Treponema test positive | FAERS: 1 | US FAERS | |
| 1470 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 1471 | Trigeminal Nerve Disorder | FAERS: 1 | US FAERS | |
| 1472 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 1473 | Troponin T increased | FAERS: 1 | US FAERS | |
| 1474 | Tuberculosis | FAERS: 1 | US FAERS | |
| 1475 | Unresponsive to verbal stimuli | FAERS: 1 | US FAERS | |
| 1476 | Urethritis noninfective | FAERS: 1 | US FAERS | |
| 1477 | Urine ketone body present | FAERS: 1 | US FAERS | |
| 1478 | Urine osmolarity increased | FAERS: 1 | US FAERS | |
| 1479 | Urine phosphorus abnormal | FAERS: 1 | US FAERS | |
| 1480 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 1481 | Uterine Polyp | FAERS: 1 | US FAERS | |
| 1482 | Varicocele | FAERS: 1 | US FAERS | |
| 1483 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 1484 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 1485 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 1486 | Ventricular Flutter | FAERS: 1 | US FAERS | |
| 1487 | Ventricular arrhythmia | FAERS: 1 | SIDER US FAERS | |
| 1488 | Ventricular failure | FAERS: 1 | US FAERS | |
| 1489 | Ventricular hypoplasia | FAERS: 1 | US FAERS | |
| 1490 | Vertebral Artery Stenosis | FAERS: 1 | US FAERS | |
| 1491 | Vibratory sense increased | FAERS: 1 | US FAERS | |
| 1492 | Victim of chemical submission | FAERS: 1 | US FAERS | |
| 1493 | Victim of homicide | FAERS: 1 | US FAERS | |
| 1494 | Victim of spousal abuse | FAERS: 1 | US FAERS | |
| 1495 | Visceral congestion | FAERS: 1 | US FAERS | |
| 1496 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 1497 | Vitreous loss | FAERS: 1 | US FAERS | |
| 1498 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 1499 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 1500 | Weight decrease neonatal | FAERS: 1 | US FAERS | |
| 1501 | Wound Infection | FAERS: 1 | US FAERS | |
| 1502 | Wound necrosis | FAERS: 1 | US FAERS | |
| 1503 | Wrong device used | FAERS: 1 | US FAERS | |
| 1504 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 1505 | Wrong product administered | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1506 | Xanthopsia | FAERS: 1 | US FAERS | |
| 1507 | Xerophthalmia | FAERS: 1 | SIDER US FAERS | |
| 1508 | fibroma | FAERS: 1 | US FAERS | |
| 1509 | kyphosis | FAERS: 1 | US FAERS | |
| 1510 | Abnormal vision | OFFSIDES SIDER | ||
| 1511 | Acid reflux | OFFSIDES | ||
| 1512 | Acute Disease | CTD | ||
| 1513 | Aggressive reaction | SIDER | ||
| 1514 | Akathisia, Drug-Induced | CTD | ||
| 1515 | Albinism | SIDER | ||
| 1516 | Allergy aggravated | SIDER | ||
| 1517 | Amenorrhea | CTD | ||
| 1518 | Amphetamine-Related Disorders | 17703711 18681757 | CTD | |
| 1519 | Amphetamines | OFFSIDES | ||
| 1520 | Anaphylactoid Reaction | SIDER | ||
| 1521 | Asperger Syndrome | 16401163 19473900 | CTD | |
| 1522 | Aspiration Pneumonia | OFFSIDES | ||
| 1523 | Atherosclerosis | 19028422 | CTD | |
| 1524 | Athetosis | SIDER | ||
| 1525 | Attention Deficit and Disruptive Behavior Disorders | 15668818 | CTD | |
| 1526 | Aura | OFFSIDES | ||
| 1527 | Autistic Disorder |
8768340
9229261 9672054 9808916 10933118 15492353 15543515 15930063 15994720 16239862 16379507 16601648 16730335 16948927 17019624 17069546 17822346 17929164 18026891 18080171 18278980 18349709 18387724 18775368 19013209 19154706 19232924 19368416 19997080 20013426 | CTD | |
| 1528 | BREAST PAIN FEMALE | SIDER | ||
| 1529 | Basal Ganglia Diseases |
7475677
8601557 9766782 9766783 9818633 9926106 9988841 10436199 10440009 10468313 10484947 10868556 11030483 11282699 11329400 11434401 11448089 11481167 11532387 11549212 11730575 11869410 11939686 11978161 12107616 12109969 12211096 12787855 12974991 14624190 14642020 14754793 14966260 15383198 15465997 15504657 15565299 15659005 16000684 16085789 16202185 16683970 16697060 16889453 17151160 17542047 18759643 19203692 19225277 19506579 19566763 19681008 19809337 20583904 20587746 | CTD | |
| 1530 | Benign neoplasm of spinal cord | OFFSIDES | ||
| 1531 | Bladder discomfort | OFFSIDES | ||
| 1532 | Blepharitis | SIDER | ||
| 1533 | Blepharoptosis | 15358981 | CTD | |
| 1534 | Blood Glucose | OFFSIDES | ||
| 1535 | Blood and lymphatic system disorders | SIDER | ||
| 1536 | Blood cholinesterase decreased | OFFSIDES | ||
| 1537 | Blood osmolarity decreased | OFFSIDES | ||
| 1538 | Blood sodium | OFFSIDES | ||
| 1539 | Blurred vision | OFFSIDES | ||
| 1540 | Body Temperature | OFFSIDES | ||
| 1541 | Bone Diseases | 22595365 | CTD | |
| 1542 | Borderline Personality Disorder | OFFSIDES | ||
| 1543 | Brain natriuretic peptide decreased | OFFSIDES | ||
| 1544 | Breast engorgement | SIDER | ||
| 1545 | Breast pain male | SIDER | ||
| 1546 | Bullous eruption | SIDER | ||
| 1547 | C1 esterase deficiency acquired | SIDER | ||
| 1548 | Cardiomyopathies | 19028422 | CTD | |
| 1549 | Cardiovascular Diseases | 19028422 | CTD | |
| 1550 | Catalepsy | CTD | ||
| 1551 | Catatonic reaction | SIDER | ||
| 1552 | Cerebral Amyloid Angiopathy | OFFSIDES | ||
| 1553 | Cerebrovascular Disorders | CTD | ||
| 1554 | Chemical and Drug Induced Liver Injury | 11204814 16199856 | CTD | |
| 1555 | Chemical burn of skin | Canada Vigilance: 1 | Canada Vigilance | |
| 1556 | Chemical burns of eye | Canada Vigilance: 1 | Canada Vigilance | |
| 1557 | Child Behavior Disorders | CTD | ||
| 1558 | Child Development Disorders, Pervasive | 17069545 | CTD | |
| 1559 | Chronic sinusitis | OFFSIDES | ||
| 1560 | Cocaine-Related Disorders | CTD | ||
| 1561 | Cognition Disorders | CTD | ||
| 1562 | Combat Disorders | 16013909 | CTD | |
| 1563 | Common wart | SIDER | ||
| 1564 | Compartment syndromes | 15358990 | CTD | |
| 1565 | Confusion | 7540798 10861920 | CTD | |
| 1566 | Congenital pyelocaliectasis | OFFSIDES | ||
| 1567 | Contracture | OFFSIDES | ||
| 1568 | Coronary Occlusion | 19028422 | CTD | |
| 1569 | Cramps of lower extremities | SIDER | ||
| 1570 | Creatine Phosphokinase Increased | SIDER | ||
| 1571 | Deglutition Disorders | 11569473 14731314 | CTD | |
| 1572 | Depressive disorder | CTD | ||
| 1573 | Diabetes | OFFSIDES | ||
| 1574 | Diabetes mellitus exacerbated | SIDER | ||
| 1575 | Diabetic Nephropathy | OFFSIDES | ||
| 1576 | Diabetic ulcer | OFFSIDES | ||
| 1577 | Diabetic | SIDER | ||
| 1578 | Directional Doppler flow tests abnormal | OFFSIDES | ||
| 1579 | Disorders of Excessive Somnolence | CTD | ||
| 1580 | Disruptive, Impulse Control, and Conduct Disorders | 12432978 15319026 20336598 | CTD | |
| 1581 | Diurnal Enuresis | 17822346 | CTD | |
| 1582 | Down Syndrome | 18349709 | CTD | |
| 1583 | Drowsiness | OFFSIDES SIDER | ||
| 1584 | Dyskinesia, Drug-Induced |
8615428
8633711 9114955 10572353 10653224 10775299 11418277 11748326 15999955 16648343 17700005 18408528 18554768 19681008 21206608 | CTD | |
| 1585 | Dyslipidemias | 16965214 | CTD | |
| 1586 | Dysmenorrhea | 15960571 17873693 19153927 | CTD | |
| 1587 | Dyssomnias | 15003084 | CTD | |
| 1588 | Dysthymic Disorder | OFFSIDES | ||
| 1589 | Ear and labyrinth disorders | SIDER | ||
| 1590 | Edema | 11763005 | CTD | |
| 1591 | Emprosthotonus | SIDER | ||
| 1592 | Endocrine System Diseases | 10468313 | CTD | |
| 1593 | Endophthalmitis | SIDER | ||
| 1594 | Enlargement abdomen | SIDER | ||
| 1595 | Essential Hypertension | OFFSIDES | ||
| 1596 | Eyelid margin crusting | SIDER | ||
| 1597 | Fatigability | SIDER | ||
| 1598 | Fatty Liver | 12934993 14571356 | CTD | |
| 1599 | Fecal Incontinence | 15633339 18387724 | CTD | |
| 1600 | Fever | 7540798 8826559 | CTD | |
| 1601 | Furunculosis | SIDER | ||
| 1602 | Galactorrhea | CTD OFFSIDES | ||
| 1603 | Granulocyte count increased | OFFSIDES | ||
| 1604 | Gynecomastia | 9696519 16633146 | CTD | |
| 1605 | Hallucinations | CTD | ||
| 1606 | Heart Diseases | 17631667 | CTD | |
| 1607 | Hematuria | 9628639 | CTD | |
| 1608 | Hemorrhage | 9628639 | CTD | |
| 1609 | Hepatitis B positive | OFFSIDES | ||
| 1610 | Hepatolenticular Degeneration | 11748326 | CTD | |
| 1611 | Hyperammonemia | 17314721 | CTD | |
| 1612 | Hyperglycemia | 11927762 18278980 | CTD | |
| 1613 | Hyperinsulinism | 11927762 | CTD SIDER | |
| 1614 | Hyperprolactinemia |
9766782
10084644 11155212 11194712 11838821 11838826 11927762 12019665 12450970 12549948 12625994 12650681 12860772 14509051 14624190 14750048 14870961 15003071 15286066 15289996 15465997 15641867 15960571 15985938 16055781 16085789 16379508 16633146 16716128 16889453 16889455 16965214 17017838 17069546 17187006 17196055 17502783 17519641 17566512 17606473 17873693 18063941 18480682 18585544 18848860 19038534 19153927 19265646 19339912 19473900 19653986 19744015 19809337 20035598 20176014 20305606 20331935 20595935 20732372 20814333 21179629 | CTD | |
| 1615 | Hypertrichosis | SIDER | ||
| 1616 | Hypokalemia | 15754671 | CTD | |
| 1617 | Hyponatremia | 9339885 | CTD | |
| 1618 | Hyporeflexia | SIDER | ||
| 1619 | Hypotension, Orthostatic | 9220048 9496415 11001613 | CTD | |
| 1620 | Infestation | SIDER | ||
| 1621 | Influenza-like symptoms | SIDER | ||
| 1622 | Intention tremor | OFFSIDES | ||
| 1623 | Itching scar | Canada Vigilance: 1 | Canada Vigilance | |
| 1624 | Lacrimation abnormal NOS | SIDER | ||
| 1625 | Lassitude | SIDER | ||
| 1626 | Leukopenia neonatal | OFFSIDES | ||
| 1627 | Leukorrhea | SIDER | ||
| 1628 | Lip exfoliation | OFFSIDES | ||
| 1629 | Malignant syndrome NOS | SIDER | ||
| 1630 | Manic psychosis | SIDER | ||
| 1631 | Meige Syndrome | 10618045 18081639 | CTD | |
| 1632 | Memory Disorders | 16697060 | CTD | |
| 1633 | Menstruation Disturbances | 16683970 | CTD | |
| 1634 | Mental disorders | CTD | ||
| 1635 | Mood Disorders | CTD | ||
| 1636 | Motor Skills Disorders | 12416598 | CTD | |
| 1637 | Movement Disorders | CTD | ||
| 1638 | Mucopolysaccharidosis III | 19681008 | CTD | |
| 1639 | Muscle Hypertonia | 10847307 | CTD | |
| 1640 | Muscle Weakness | 11763005 12109969 | CTD | |
| 1641 | Muscle relaxant therapy | SIDER | ||
| 1642 | Myoglobin urine present | SIDER | ||
| 1643 | Myoglobinuria | SIDER | ||
| 1644 | Myopericarditis | OFFSIDES | ||
| 1645 | Neologism | Canada Vigilance: 1 | Canada Vigilance | |
| 1646 | Neurotoxicity Syndromes | 17106843 | CTD | |
| 1647 | Night Terrors | 15993264 | CTD | |
| 1648 | Normocytic anemia | SIDER | ||
| 1649 | Numbness | SIDER | ||
| 1650 | Oculorespiratory syndrome | SIDER | ||
| 1651 | Oligomenorrhea | 18480682 | CTD | |
| 1652 | Oligospermia | 15960571 | CTD | |
| 1653 | Opioid-Related Disorders | 10350033 11730575 | CTD | |
| 1654 | Osteodystrophy | SIDER | ||
| 1655 | Osteoradionecrosis | OFFSIDES | ||
| 1656 | Otitis Media | SIDER | ||
| 1657 | Pain during injection | SIDER | ||
| 1658 | Paranoid reaction | SIDER | ||
| 1659 | Paresthesia | 8959470 | CTD | |
| 1660 | Parkinson's disease aggravated | SIDER | ||
| 1661 | Parkinsonian Disorders | 10389620 18217890 18494081 | CTD | |
| 1662 | Pathological fracture | Canada Vigilance: 1 | Canada Vigilance | |
| 1663 | Perceptual Disorders | 9241019 12013711 | CTD | |
| 1664 | Perineal pain | SIDER | ||
| 1665 | Personality Disorders | 11124399 | CTD | |
| 1666 | Pharyngeal Diseases | 11569473 | CTD | |
| 1667 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 1668 | Physical examination abnormal | OFFSIDES | ||
| 1669 | Pitting edema | SIDER | ||
| 1670 | Pituitary Adenoma | SIDER | ||
| 1671 | Pituitary Neoplasms | 16716128 | CTD | |
| 1672 | Plateletcrit decreased | SIDER | ||
| 1673 | Pneumocystis jiroveci pneumonia | OFFSIDES | ||
| 1674 | Poor sucking reflex | OFFSIDES | ||
| 1675 | Postural Orthostatic Tachycardia Syndrome | SIDER | ||
| 1676 | Prader-Willi Syndrome | 20158635 | CTD | |
| 1677 | Product administered to patient of inappropriate age | Canada Vigilance: 1 | Canada Vigilance | |
| 1678 | Psoriasis flare-up | SIDER | ||
| 1679 | Psychomotor Agitation | CTD | ||
| 1680 | Psychoses, Substance-Induced | CTD | ||
| 1681 | Psychotic Disorders |
7509495
9742515 10084637 10322240 10431061 10440009 10459911 11120421 11329400 11730575 11763005 11775050 11801812 11869410 11929457 12352268 12416598 12549948 12633121 12860772 14961937 15289699 15319026 15323593 15349029 15380868 15383198 15504657 15590043 15641867 15641877 15812261 15863797 16013909 16185378 16449491 16493564 16648343 17151160 17588130 17900775 19049484 19809337 20564506 | CTD | |
| 1682 | Pyuria | OFFSIDES | ||
| 1683 | Radial nerve palsy | OFFSIDES | ||
| 1684 | Redness | SIDER | ||
| 1685 | Reflex tachycardia | SIDER | ||
| 1686 | Renal Insufficiency | 19087798 | CTD | |
| 1687 | Reproductive toxicity | SIDER | ||
| 1688 | Respiratory tract congestion | SIDER | ||
| 1689 | Rhinorrhea | OFFSIDES | ||
| 1690 | Risus sardonicus | OFFSIDES SIDER | ||
| 1691 | Sarcoidosis | SIDER | ||
| 1692 | Schizophrenia, Catatonic | 11001613 | CTD | |
| 1693 | Seizures | 9501890 | CTD | |
| 1694 | Sequestrectomy | OFFSIDES | ||
| 1695 | Serum prolactin increased | SIDER | ||
| 1696 | Sialorrhea | 11379837 17069546 | CTD | |
| 1697 | Sinus Arrest, Cardiac | 19606005 | CTD | |
| 1698 | Sleep Initiation and Maintenance Disorders | CTD | ||
| 1699 | Sleep Talking | OFFSIDES | ||
| 1700 | Sleep Wake Disorders | 16202185 18278980 | CTD | |
| 1701 | Small bowel angioedema | SIDER | ||
| 1702 | Smith-Magenis syndrome | 17914318 | CTD | |
| 1703 | Smoker | OFFSIDES | ||
| 1704 | Stereotypic Movement Disorder | 15358981 20662826 | CTD | |
| 1705 | Stuttering | 11199937 20851282 | CTD | |
| 1706 | Substance Withdrawal Syndrome | CTD | ||
| 1707 | Suicide | SIDER | ||
| 1708 | Sweating | SIDER | ||
| 1709 | Tachycardia, Ventricular | 20210726 | CTD | |
| 1710 | Thoracotomy | OFFSIDES | ||
| 1711 | Thrombocytosis | Canada Vigilance: 2 | Canada Vigilance | |
| 1712 | Thromboembolism | 12520151 | CTD | |
| 1713 | Torsades de Pointes | 15345794 16859777 18030657 | CTD | |
| 1714 | Tracheobronchitis | SIDER | ||
| 1715 | Ulcerative stomatitis | SIDER | ||
| 1716 | Upset stomach | SIDER | ||
| 1717 | Urination Disorders | 8968309 11580866 12804132 | CTD | |
| 1718 | Vaginal dryness | SIDER | ||
| 1719 | Vascular insufficiency | OFFSIDES | ||
| 1720 | Vascular purpura | SIDER | ||
| 1721 | Weight Gain |
7508675
9097896 9114956 9808916 10917413 10933118 11030483 11247096 11329400 11329412 11379837 11642473 11708938 11927762 12625994 12682319 12860772 12934993 14571356 14624190 14642020 15232335 15610953 15641867 15994720 16379507 16493877 16965214 17069546 17151160 17933497 18197952 18218293 18294021 18759643 19625888 19809337 19997080 20375926 20564506 20620267 | CTD OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.