Topiramate
(KJADKKWYZYXHBB-XBWDGYHZSA-N)
Structure
- SMILES
- NS(=O)(=O)OC[C@]12OC[C@@H]3[C@H]([C@@H]2OC(O1)(C)C)OC(O3)(C)C
- Type(s)
- Approved
- ATC code(s)
- N03AX11
- Molecular Formula:
- C12H21NO8S
- Molecular Weight:
- 339.362
- Log P:
- 1.3857
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 1
- TPSA:
- 123.92
- CAS Number(s):
- 97240-79-4
Synonym(s)
1.
Topiramate
2.
2,3-4,5-bis-O-(1-methylethylidene)-beta-D-fructopyranose sulfamate
3.
Epitomax
4.
McN 4853
5.
McN-4853
6.
Topamax
7.
USL255
8.
McN4853
External Link(s)
| MeSH | D000077236 |
| PubChem Compound | 5284627 |
| BindingDB | 10887 |
| ChEBI | 63631 |
| CHEMBL | CHEMBL220492 |
| DrugBank | DB00273 |
| DrugCentral | 2706 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 6849 |
| KEGG | cpd:C07502 dr:D00537 |
| Therapeutic Target Database | D07VDZ |
| ZINC | 95616603 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 490 Canada Vigilance: 194 | Canada Vigilance US FAERS | |
| 2 | Headache | FAERS: 404 Canada Vigilance: 16 | Canada Vigilance SIDER US FAERS | |
| 3 | Product substitution issue | FAERS: 388 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 4 | Angle Closure Glaucoma | FAERS: 328 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 5 | Weight decreased | FAERS: 313 Canada Vigilance: 18 | Canada Vigilance SIDER US FAERS | |
| 6 | Dizziness | FAERS: 243 Canada Vigilance: 7 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 7 | Alopecia | FAERS: 241 Canada Vigilance: 7 | 20656711 | CTD SIDER Canada Vigilance US FAERS |
| 8 | Nausea | FAERS: 240 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 9 | Fatigue | FAERS: 232 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 10 | Memory impairment | FAERS: 216 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 11 | Somnolence | FAERS: 206 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 12 | Myopia | FAERS: 195 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 13 | Product use issue | FAERS: 181 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 14 | Feeling abnormal | FAERS: 166 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 15 | Nephrolithiasis | FAERS: 166 Canada Vigilance: 6 | 12042105 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 16 | Drug exposure during pregnancy | FAERS: 139 | OFFSIDES US FAERS | |
| 17 | Amnesia | FAERS: 138 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 18 | Blindness | FAERS: 133 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 19 | Vomiting | FAERS: 129 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 20 | Anxiety | FAERS: 126 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 21 | Tremor | FAERS: 121 Canada Vigilance: 2 | 19050415 | CTD SIDER Canada Vigilance US FAERS |
| 22 | Drug dose omission | FAERS: 114 | US FAERS | |
| 23 | Eye pain | FAERS: 113 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 24 | Malaise | FAERS: 112 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 25 | Visual Impairment | FAERS: 111 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 26 | Metabolic acidosis | FAERS: 106 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 27 | Pain | FAERS: 97 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 28 | Dysgeusia | FAERS: 96 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 29 | Adverse event | FAERS: 92 | US FAERS | |
| 30 | Aphasia | FAERS: 92 Canada Vigilance: 2 | 20656711 | CTD SIDER Canada Vigilance US FAERS |
| 31 | Product use in unapproved indication | FAERS: 91 | US FAERS | |
| 32 | Overdose | FAERS: 88 | OFFSIDES US FAERS | |
| 33 | Asthenia | FAERS: 87 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 34 | Pruritus | FAERS: 77 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 35 | Agitation | FAERS: 72 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 36 | Epilepsy | FAERS: 71 Canada Vigilance: 1 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 37 | Glaucoma | FAERS: 68 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 38 | Renal tubular acidosis | FAERS: 68 | OFFSIDES SIDER US FAERS | |
| 39 | Disorientation | FAERS: 67 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 40 | Palpitations | FAERS: 67 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 41 | Dysarthria | FAERS: 65 Canada Vigilance: 4 | 16496496 | CTD SIDER Canada Vigilance US FAERS |
| 42 | Abdominal Pain | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 43 | Drug ineffective for unapproved indication | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Suicide attempt | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 45 | Mood swings | FAERS: 60 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 46 | Anger | FAERS: 58 | SIDER US FAERS | |
| 47 | Arthralgia | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 48 | Chest Pain | FAERS: 56 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 49 | Product quality issue | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Toxicity to various agents | FAERS: 54 | US FAERS | |
| 51 | Tinnitus | FAERS: 52 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 52 | Vertigo | FAERS: 52 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 53 | Mental impairment | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Constipation | FAERS: 47 | SIDER US FAERS | |
| 55 | Status Epilepticus | FAERS: 47 | OFFSIDES SIDER US FAERS | |
| 56 | Lethargy | FAERS: 45 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 57 | Iridocyclitis | FAERS: 43 | US FAERS | |
| 58 | Back Pain | FAERS: 42 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 59 | Crying | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 60 | Hypospadias | FAERS: 42 | US FAERS | |
| 61 | Cataract | FAERS: 41 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 62 | Hypersensitivity | FAERS: 41 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 63 | Therapeutic response unexpected | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 64 | Uveitis | FAERS: 39 | US FAERS | |
| 65 | Burning sensation | FAERS: 38 | OFFSIDES SIDER US FAERS | |
| 66 | Paranoia | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 67 | Chest discomfort | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Intentional self-injury | FAERS: 36 | US FAERS | |
| 69 | Activities of daily living impaired | FAERS: 35 | OFFSIDES US FAERS | |
| 70 | Anhidrosis | FAERS: 35 | OFFSIDES SIDER US FAERS | |
| 71 | Deafness | FAERS: 35 | OFFSIDES SIDER US FAERS | |
| 72 | Impaired work ability | FAERS: 35 | US FAERS | |
| 73 | Incorrect dose administered | FAERS: 35 | US FAERS | |
| 74 | Myalgia | FAERS: 35 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 75 | Impaired driving ability | FAERS: 34 | US FAERS | |
| 76 | Nervousness | FAERS: 34 | SIDER US FAERS | |
| 77 | Cerebrovascular accident | FAERS: 33 | US FAERS | |
| 78 | Choroidal Detachment | FAERS: 33 | US FAERS | |
| 79 | Urticaria | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 80 | Unevaluable event | FAERS: 32 | US FAERS | |
| 81 | Visual disturbance | FAERS: 32 | SIDER US FAERS | |
| 82 | Temperature intolerance | FAERS: 31 | OFFSIDES SIDER US FAERS | |
| 83 | Cleft Palate | FAERS: 30 | US FAERS | |
| 84 | Neutropenia | FAERS: 30 | SIDER US FAERS | |
| 85 | Tachycardia | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 86 | Completed Suicide | FAERS: 29 | SIDER US FAERS | |
| 87 | Depressed mood | FAERS: 29 | OFFSIDES SIDER US FAERS | |
| 88 | Hypohidrosis | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 89 | Hypokinesia | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 90 | Medication Error | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 91 | Blood potassium decreased | FAERS: 28 | OFFSIDES SIDER US FAERS | |
| 92 | Bradyphrenia | FAERS: 28 | SIDER US FAERS | |
| 93 | Epistaxis | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 94 | Erythema | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 95 | Heat Stroke | FAERS: 28 | US FAERS | |
| 96 | Wrong technique in drug usage process | FAERS: 28 | OFFSIDES US FAERS | |
| 97 | treatment failure | FAERS: 28 | US FAERS | |
| 98 | Anorexia | FAERS: 27 | OFFSIDES SIDER US FAERS | |
| 99 | Diplopia | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 100 | Abdominal discomfort | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 101 | Drug prescribing error | FAERS: 26 | US FAERS | |
| 102 | Retinal Detachment | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 103 | Urinary Incontinence | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 104 | Drug administered to patient of inappropriate age | FAERS: 25 | US FAERS | |
| 105 | Alice in Wonderland Syndrome | FAERS: 24 | US FAERS | |
| 106 | Emotional disorder | FAERS: 24 | US FAERS | |
| 107 | Mental status changes | FAERS: 24 | OFFSIDES US FAERS | |
| 108 | Myokymia | FAERS: 24 | US FAERS | |
| 109 | Drug abuse | FAERS: 23 | SIDER US FAERS | |
| 110 | Dyspepsia | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 111 | Erectile dysfunction | FAERS: 23 | SIDER US FAERS | |
| 112 | Hypocitraturia | FAERS: 23 | US FAERS | |
| 113 | Mydriasis | FAERS: 23 | 20656711 | CTD SIDER US FAERS |
| 114 | Wrong technique in product usage process | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 115 | Anorexia Nervosa | FAERS: 22 | US FAERS | |
| 116 | Dysphonia | FAERS: 22 | OFFSIDES SIDER US FAERS | |
| 117 | Hypophagia | FAERS: 22 | US FAERS | |
| 118 | Dehydration | FAERS: 21 | SIDER US FAERS | |
| 119 | Hydronephrosis | FAERS: 21 | OFFSIDES US FAERS | |
| 120 | Oropharyngeal pain | FAERS: 21 | US FAERS | |
| 121 | Depressed Level of Consciousness | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 122 | Hypersomnia | FAERS: 20 | SIDER US FAERS | |
| 123 | Osteoporosis | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 124 | Photophobia | FAERS: 20 | SIDER US FAERS | |
| 125 | Swelling | FAERS: 20 | US FAERS | |
| 126 | Syncope | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 127 | Bone pain | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 128 | Joint swelling | FAERS: 19 | SIDER US FAERS | |
| 129 | Poor quality sleep | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 130 | Restless Legs Syndrome | FAERS: 19 Canada Vigilance: 1 | 19444538 | CTD Canada Vigilance US FAERS |
| 131 | Sluggishness | FAERS: 19 | SIDER US FAERS | |
| 132 | Wheezing | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 133 | Acidosis | FAERS: 18 | OFFSIDES SIDER US FAERS | |
| 134 | Central nervous system lesion | FAERS: 18 | OFFSIDES US FAERS | |
| 135 | Chills | FAERS: 18 | SIDER US FAERS | |
| 136 | Inappropriate schedule of drug administration | FAERS: 18 | US FAERS | |
| 137 | Myoclonus | FAERS: 18 | 19050415 | CTD US FAERS |
| 138 | Nystagmus | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 139 | Pregnancy | FAERS: 18 | US FAERS | |
| 140 | Product dose omission | FAERS: 18 | US FAERS | |
| 141 | Restlessness | FAERS: 18 | US FAERS | |
| 142 | Stress | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 143 | Therapy cessation | FAERS: 18 | US FAERS | |
| 144 | Thirst | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 145 | Aspartate Aminotransferase Increased | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 146 | Asthma | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 147 | Delirium | FAERS: 17 | SIDER US FAERS | |
| 148 | Hallucinations, mixed | FAERS: 17 | OFFSIDES US FAERS | |
| 149 | Hemiparesis | FAERS: 17 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 150 | Hypotension | FAERS: 17 | SIDER US FAERS | |
| 151 | Urinary tract infection | FAERS: 17 | SIDER US FAERS | |
| 152 | Acne | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 153 | Cholelithiasis | FAERS: 16 | US FAERS | |
| 154 | Musculoskeletal stiffness | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 155 | Noninfective encephalitis | FAERS: 16 | US FAERS | |
| 156 | Pneumonia | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 157 | Abasia | FAERS: 15 | OFFSIDES US FAERS | |
| 158 | Drug dispensing error | FAERS: 15 | US FAERS | |
| 159 | Dysgraphia | FAERS: 15 | SIDER US FAERS | |
| 160 | Dysphemia | FAERS: 15 | OFFSIDES SIDER US FAERS | |
| 161 | Exposure during breast feeding | FAERS: 15 | US FAERS | |
| 162 | Middle insomnia | FAERS: 15 | SIDER US FAERS | |
| 163 | Nasopharyngitis | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 164 | Neck Pain | FAERS: 15 | US FAERS | |
| 165 | Personality Change | FAERS: 15 | US FAERS | |
| 166 | Psychomotor skills impaired | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 167 | Somnambulism | FAERS: 15 | US FAERS | |
| 168 | Unresponsive to stimuli | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 169 | Ageusia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 170 | Alanine Aminotransferase Increased | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 171 | Blepharospasm | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 172 | Infection | FAERS: 14 | SIDER US FAERS | |
| 173 | Low birth weight baby | FAERS: 14 | US FAERS | |
| 174 | Ataxia | FAERS: 13 | SIDER US FAERS | |
| 175 | Atrial Fibrillation | FAERS: 13 | US FAERS | |
| 176 | Aura | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 177 | Blood creatinine increased | FAERS: 13 | SIDER US FAERS | |
| 178 | Bradycardia | FAERS: 13 | SIDER US FAERS | |
| 179 | Bulimia Nervosa | FAERS: 13 | US FAERS | |
| 180 | Dry skin | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 181 | Hyperventilation | FAERS: 13 | US FAERS | |
| 182 | Maternal exposure during pregnancy | FAERS: 13 | US FAERS | |
| 183 | Myocardial Infarction | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 184 | Neuralgia | FAERS: 13 | 18777607 | CTD US FAERS |
| 185 | Pancreatitis | FAERS: 13 | OFFSIDES SIDER US FAERS | |
| 186 | Pulmonary Embolism | FAERS: 13 | SIDER US FAERS | |
| 187 | Pulmonary Eosinophilia | FAERS: 13 | US FAERS | |
| 188 | Renal cyst | FAERS: 13 | US FAERS | |
| 189 | nervous system disorder | FAERS: 13 | SIDER US FAERS | |
| 190 | Dementia | FAERS: 12 | US FAERS | |
| 191 | Drug withdrawal convulsions | FAERS: 12 | US FAERS | |
| 192 | Formication | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 193 | Hypocapnia | FAERS: 12 | US FAERS | |
| 194 | Hypothyroidism | FAERS: 12 | US FAERS | |
| 195 | Orthostatic intolerance | FAERS: 12 | US FAERS | |
| 196 | Patent ductus arteriosus | FAERS: 12 | US FAERS | |
| 197 | Peripheral swelling | FAERS: 12 | US FAERS | |
| 198 | Respiratory distress | FAERS: 12 | US FAERS | |
| 199 | Rhabdomyolysis | FAERS: 12 | US FAERS | |
| 200 | Self-induced vomiting | FAERS: 12 | US FAERS | |
| 201 | Shock | FAERS: 12 | SIDER US FAERS | |
| 202 | Sopor | FAERS: 12 | US FAERS | |
| 203 | Altered state of consciousness | FAERS: 11 | SIDER US FAERS | |
| 204 | Apathy | FAERS: 11 | SIDER US FAERS | |
| 205 | Bipolar Disorder | FAERS: 11 Canada Vigilance: 1 | 15610953 16566634 19573494 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 206 | Cardiac Arrest | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 207 | Conjunctivitis | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 208 | Dissociation | FAERS: 11 | US FAERS | |
| 209 | Drug administration error | FAERS: 11 | US FAERS | |
| 210 | Drug effect incomplete | FAERS: 11 | US FAERS | |
| 211 | Dysuria | FAERS: 11 | SIDER US FAERS | |
| 212 | Feeling Cold | FAERS: 11 | US FAERS | |
| 213 | Flank Pain | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 214 | Granuloma Annulare | FAERS: 11 | US FAERS | |
| 215 | Growth retardation | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 216 | Hip Dysplasia | FAERS: 11 | US FAERS | |
| 217 | Hypercalciuria | FAERS: 11 | US FAERS | |
| 218 | Hypopyon | FAERS: 11 | US FAERS | |
| 219 | Intentional drug misuse | FAERS: 11 | US FAERS | |
| 220 | Nephrocalcinosis | FAERS: 11 | US FAERS | |
| 221 | Pancreatic Cyst | FAERS: 11 | US FAERS | |
| 222 | Plagiocephaly | FAERS: 11 | US FAERS | |
| 223 | Product availability issue | FAERS: 11 | US FAERS | |
| 224 | Renal pain | FAERS: 11 | SIDER US FAERS | |
| 225 | Respiratory Failure | FAERS: 11 | US FAERS | |
| 226 | Sepsis | FAERS: 11 | US FAERS | |
| 227 | Sinus bradycardia | FAERS: 11 | SIDER US FAERS | |
| 228 | Thrombocytopenia | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 229 | Acute myopia | FAERS: 10 | US FAERS | |
| 230 | Blood creatine phosphokinase increased | FAERS: 10 | US FAERS | |
| 231 | Catatonia | FAERS: 10 | US FAERS | |
| 232 | Dental caries | FAERS: 10 | OFFSIDES US FAERS | |
| 233 | Dissociative disorder | FAERS: 10 | US FAERS | |
| 234 | Drug toxicity | FAERS: 10 | US FAERS | |
| 235 | Drug withdrawal syndrome | FAERS: 10 | US FAERS | |
| 236 | Emotional distress | FAERS: 10 | US FAERS | |
| 237 | Feeling jittery | FAERS: 10 | SIDER US FAERS | |
| 238 | Gastritis | FAERS: 10 | SIDER US FAERS | |
| 239 | Musculoskeletal Pain | FAERS: 10 | SIDER US FAERS | |
| 240 | Stillbirth | FAERS: 10 | US FAERS | |
| 241 | Talipes | FAERS: 10 | US FAERS | |
| 242 | Accidental exposure | FAERS: 9 | US FAERS | |
| 243 | Ammonia increased | FAERS: 9 | OFFSIDES US FAERS | |
| 244 | Anal Fissure | FAERS: 9 | US FAERS | |
| 245 | Arthropathy | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 246 | Blood glucose increased | FAERS: 9 | US FAERS | |
| 247 | Bradykinesia | FAERS: 9 | US FAERS | |
| 248 | Bronchitis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 249 | Complex partial seizures | FAERS: 9 | US FAERS | |
| 250 | Cyanosis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 251 | Disease recurrence | FAERS: 9 | US FAERS | |
| 252 | Drug Dependence | FAERS: 9 | US FAERS | |
| 253 | Economic problem | FAERS: 9 | US FAERS | |
| 254 | Euphoric mood | FAERS: 9 | SIDER US FAERS | |
| 255 | Eye irritation | FAERS: 9 | US FAERS | |
| 256 | Flatulence | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 257 | Flushing | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 258 | Leukocytosis | FAERS: 9 | US FAERS | |
| 259 | Macular degeneration | FAERS: 9 | US FAERS | |
| 260 | Metrorrhagia | FAERS: 9 | SIDER US FAERS | |
| 261 | Ocular discomfort | FAERS: 9 | US FAERS | |
| 262 | Onychoclasis | FAERS: 9 | US FAERS | |
| 263 | Osteopenia | FAERS: 9 | US FAERS | |
| 264 | Post-Traumatic Stress Disorder | FAERS: 9 | US FAERS | |
| 265 | Product counterfeit | FAERS: 9 | US FAERS | |
| 266 | Productive Cough | FAERS: 9 | US FAERS | |
| 267 | Screaming | FAERS: 9 | US FAERS | |
| 268 | Staring | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 269 | Syndactyly | FAERS: 9 | US FAERS | |
| 270 | White blood cell count decreased | FAERS: 9 | SIDER US FAERS | |
| 271 | Anaphylactic shock | FAERS: 8 | US FAERS | |
| 272 | Anosmia | FAERS: 8 | SIDER US FAERS | |
| 273 | Aphonia | FAERS: 8 | US FAERS | |
| 274 | Bone density abnormal | FAERS: 8 | US FAERS | |
| 275 | Borderline Personality Disorder | FAERS: 8 | US FAERS | |
| 276 | Cold sweat | FAERS: 8 | US FAERS | |
| 277 | Drug level decreased | FAERS: 8 | US FAERS | |
| 278 | Drug screen positive | FAERS: 8 | US FAERS | |
| 279 | Dysmorphism | FAERS: 8 | US FAERS | |
| 280 | Dystonia | FAERS: 8 | US FAERS | |
| 281 | Educational problem | FAERS: 8 | US FAERS | |
| 282 | Fibromyalgia | FAERS: 8 | OFFSIDES US FAERS | |
| 283 | Gastrostomy | FAERS: 8 | US FAERS | |
| 284 | Hostility | FAERS: 8 | US FAERS | |
| 285 | Hyperaldosteronism | FAERS: 8 | US FAERS | |
| 286 | Hyperthyroidism | FAERS: 8 | SIDER US FAERS | |
| 287 | Hypoaesthesia facial | FAERS: 8 | SIDER US FAERS | |
| 288 | Impaired self-care | FAERS: 8 | US FAERS | |
| 289 | Incorrect route of drug administration | FAERS: 8 | US FAERS | |
| 290 | Leukopenia | FAERS: 8 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 291 | Lymphopenia | FAERS: 8 | SIDER US FAERS | |
| 292 | Meningism | FAERS: 8 | US FAERS | |
| 293 | Metamorphopsia | FAERS: 8 | US FAERS | |
| 294 | Perseveration | FAERS: 8 | SIDER US FAERS | |
| 295 | Poor quality drug administered | FAERS: 8 | US FAERS | |
| 296 | Product dispensing error | FAERS: 8 | US FAERS | |
| 297 | Sinusitis | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 298 | Thrombosis | FAERS: 8 | US FAERS | |
| 299 | Accidental drug intake by child | FAERS: 7 | US FAERS | |
| 300 | Asthenopia | FAERS: 7 | OFFSIDES US FAERS | |
| 301 | Bruxism | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 302 | Burning Mouth Syndrome | FAERS: 7 | US FAERS | |
| 303 | Conversion disorder | FAERS: 7 | US FAERS | |
| 304 | Deep Vein Thrombosis | FAERS: 7 | SIDER US FAERS | |
| 305 | Diabetes Mellitus | FAERS: 7 | SIDER US FAERS | |
| 306 | Drug exposure via breast milk | FAERS: 7 | US FAERS | |
| 307 | General physical health deterioration | FAERS: 7 | US FAERS | |
| 308 | Granuloma | FAERS: 7 | US FAERS | |
| 309 | Hyperreflexia | FAERS: 7 | US FAERS | |
| 310 | Incoherent | FAERS: 7 | US FAERS | |
| 311 | Influenza | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 312 | Intentional product misuse | FAERS: 7 | US FAERS | |
| 313 | Irritable Bowel Syndrome | FAERS: 7 | US FAERS | |
| 314 | Lack of spontaneous speech | FAERS: 7 | SIDER US FAERS | |
| 315 | Libido disorder | FAERS: 7 | US FAERS | |
| 316 | Muscle Rigidity | FAERS: 7 | US FAERS | |
| 317 | Otitis Media | FAERS: 7 | SIDER US FAERS | |
| 318 | Presyncope | FAERS: 7 | SIDER US FAERS | |
| 319 | Retinal Vein Occlusion | FAERS: 7 | US FAERS | |
| 320 | Slow response to stimuli | FAERS: 7 | US FAERS | |
| 321 | Urinary Retention | FAERS: 7 | SIDER US FAERS | |
| 322 | Vitreous floaters | FAERS: 7 | US FAERS | |
| 323 | Accidental overdose | FAERS: 6 | US FAERS | |
| 324 | Akathisia | FAERS: 6 | US FAERS | |
| 325 | Astigmatism | FAERS: 6 | US FAERS | |
| 326 | Bedridden | FAERS: 6 | US FAERS | |
| 327 | Blood urea increased | FAERS: 6 | US FAERS | |
| 328 | Body temperature fluctuation | FAERS: 6 | US FAERS | |
| 329 | Breathing-related sleep disorder | FAERS: 6 | US FAERS | |
| 330 | Bronchopneumonia | FAERS: 6 | US FAERS | |
| 331 | Discomfort | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 332 | Expired product administered | FAERS: 6 | US FAERS | |
| 333 | Familial Periodic Paralysis | FAERS: 6 | US FAERS | |
| 334 | Lens dislocation | FAERS: 6 | US FAERS | |
| 335 | Loss of personal independence in daily activities | FAERS: 6 | US FAERS | |
| 336 | Obsessive-Compulsive Disorder | FAERS: 6 | US FAERS | |
| 337 | Oliguria | FAERS: 6 | SIDER US FAERS | |
| 338 | Optic Neuritis | FAERS: 6 | OFFSIDES US FAERS | |
| 339 | Pharmaceutical product complaint | FAERS: 6 | US FAERS | |
| 340 | Potassium wasting nephropathy | FAERS: 6 | US FAERS | |
| 341 | Priapism | FAERS: 6 | US FAERS | |
| 342 | Schizophrenia | FAERS: 6 | US FAERS | |
| 343 | Seizure like phenomena | FAERS: 6 | US FAERS | |
| 344 | Sexual Dysfunction | FAERS: 6 | SIDER US FAERS | |
| 345 | Therapeutic response unexpected with drug substitution | FAERS: 6 | US FAERS | |
| 346 | jaundice | FAERS: 6 | 17923349 | CTD US FAERS |
| 347 | Allodynia | FAERS: 5 | US FAERS | |
| 348 | Amblyopia | FAERS: 5 | SIDER US FAERS | |
| 349 | Angioedema | FAERS: 5 | OFFSIDES US FAERS | |
| 350 | Blood glucose decreased | FAERS: 5 | US FAERS | |
| 351 | Blood prolactin increased | FAERS: 5 | OFFSIDES US FAERS | |
| 352 | Body height below normal | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 353 | Breast Feeding | FAERS: 5 | US FAERS | |
| 354 | Cardiac Flutter | FAERS: 5 | US FAERS | |
| 355 | Carpal Tunnel Syndrome | FAERS: 5 | US FAERS | |
| 356 | Choking | FAERS: 5 | US FAERS | |
| 357 | Craniofacial deformity | FAERS: 5 | US FAERS | |
| 358 | Crystal urine present | FAERS: 5 | SIDER US FAERS | |
| 359 | Disability | FAERS: 5 | US FAERS | |
| 360 | Disease Progression | FAERS: 5 | US FAERS | |
| 361 | Eczema | FAERS: 5 | SIDER US FAERS | |
| 362 | Electrocardiogram ST-T change | FAERS: 5 | US FAERS | |
| 363 | Electrocardiogram abnormal | FAERS: 5 | SIDER US FAERS | |
| 364 | Enuresis | FAERS: 5 | US FAERS | |
| 365 | Hepatitis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 366 | Hydrocephalus | FAERS: 5 | US FAERS | |
| 367 | Hyperchlorhydria | FAERS: 5 | US FAERS | |
| 368 | Inflammation | FAERS: 5 | 21849664 | CTD US FAERS |
| 369 | Medication residue present | FAERS: 5 | US FAERS | |
| 370 | Microcephaly | FAERS: 5 | US FAERS | |
| 371 | Multiple Sclerosis | FAERS: 5 | OFFSIDES US FAERS | |
| 372 | Neonatal disorder | FAERS: 5 | US FAERS | |
| 373 | No adverse event | FAERS: 5 | US FAERS | |
| 374 | Pain of skin | FAERS: 5 | US FAERS | |
| 375 | Poisoning | FAERS: 5 | 16496496 | CTD US FAERS |
| 376 | Psoriasis | FAERS: 5 | US FAERS | |
| 377 | Renal Colic | FAERS: 5 | SIDER US FAERS | |
| 378 | Skin lesion | FAERS: 5 | US FAERS | |
| 379 | Slow speech | FAERS: 5 | US FAERS | |
| 380 | Stupor | FAERS: 5 | SIDER US FAERS | |
| 381 | Supraventricular tachycardia | FAERS: 5 | US FAERS | |
| 382 | Therapy change | FAERS: 5 | US FAERS | |
| 383 | Troponin increased | FAERS: 5 | US FAERS | |
| 384 | Unexpected therapeutic drug effect | FAERS: 5 | OFFSIDES US FAERS | |
| 385 | Ureterolithiasis | FAERS: 5 | US FAERS | |
| 386 | pH urine increased | FAERS: 5 | US FAERS | |
| 387 | Accidental exposure to product by child | FAERS: 4 | US FAERS | |
| 388 | Agranulocytosis | FAERS: 4 | SIDER US FAERS | |
| 389 | Altered visual depth perception | FAERS: 4 | SIDER US FAERS | |
| 390 | Ankle Fracture | FAERS: 4 | US FAERS | |
| 391 | Arachnodactyly | FAERS: 4 | US FAERS | |
| 392 | Blood chloride increased | FAERS: 4 | OFFSIDES US FAERS | |
| 393 | Blood sodium decreased | FAERS: 4 | US FAERS | |
| 394 | Carbon dioxide decreased | FAERS: 4 | US FAERS | |
| 395 | Circumstance or information capable of leading to medication error | FAERS: 4 | US FAERS | |
| 396 | Clumsiness | FAERS: 4 | SIDER US FAERS | |
| 397 | Colitis | FAERS: 4 | OFFSIDES US FAERS | |
| 398 | Craniosynostosis | FAERS: 4 | US FAERS | |
| 399 | Disseminated Intravascular Coagulation | FAERS: 4 | US FAERS | |
| 400 | Facial Pain | FAERS: 4 | US FAERS | |
| 401 | Food Allergy | FAERS: 4 | US FAERS | |
| 402 | Gamma-Glutamyltransferase Increased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 403 | Hemiplegia | FAERS: 4 | US FAERS | |
| 404 | Hyperacusis | FAERS: 4 | US FAERS | |
| 405 | Hypertransaminasaemia | FAERS: 4 | US FAERS | |
| 406 | Initial insomnia | FAERS: 4 | SIDER US FAERS | |
| 407 | Intestinal Obstruction | FAERS: 4 | US FAERS | |
| 408 | Intracranial Aneurysm | FAERS: 4 | US FAERS | |
| 409 | Intracranial Hypotension | FAERS: 4 | US FAERS | |
| 410 | Iritis | FAERS: 4 | SIDER US FAERS | |
| 411 | Lactose Intolerance | FAERS: 4 | US FAERS | |
| 412 | Lymphadenopathy | FAERS: 4 | SIDER US FAERS | |
| 413 | Macular detachment | FAERS: 4 | US FAERS | |
| 414 | Malnutrition | FAERS: 4 | SIDER US FAERS | |
| 415 | Menorrhagia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 416 | Morbid thoughts | FAERS: 4 | US FAERS | |
| 417 | Muscle tightness | FAERS: 4 | US FAERS | |
| 418 | Night sweats | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 419 | Occult blood positive | FAERS: 4 | US FAERS | |
| 420 | Osteochondrosis | FAERS: 4 | US FAERS | |
| 421 | Papule | FAERS: 4 | US FAERS | |
| 422 | Pharyngolaryngeal Pain | FAERS: 4 | US FAERS | |
| 423 | Pilonidal cyst congenital | FAERS: 4 | US FAERS | |
| 424 | Pre-Eclampsia | FAERS: 4 | OFFSIDES US FAERS | |
| 425 | Prerenal failure | FAERS: 4 | US FAERS | |
| 426 | Prothrombin level decreased | FAERS: 4 | US FAERS | |
| 427 | Psychiatric symptom | FAERS: 4 | US FAERS | |
| 428 | Pulmonary Valve Stenosis | FAERS: 4 | US FAERS | |
| 429 | Quality of life decreased | FAERS: 4 | US FAERS | |
| 430 | Septic Shock | FAERS: 4 | US FAERS | |
| 431 | Spina Bifida | FAERS: 4 | US FAERS | |
| 432 | Spinal column stenosis | FAERS: 4 | OFFSIDES US FAERS | |
| 433 | Superficial injury of eye | FAERS: 4 | US FAERS | |
| 434 | Ulcer | FAERS: 4 | 21849664 | CTD US FAERS |
| 435 | Urinary tract obstruction | FAERS: 4 | US FAERS | |
| 436 | Uterine Polyp | FAERS: 4 | OFFSIDES US FAERS | |
| 437 | Visual acuity reduced transiently | FAERS: 4 | US FAERS | |
| 438 | Wrong drug administered | FAERS: 4 | US FAERS | |
| 439 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 440 | Acute myocardial infarction | FAERS: 3 | US FAERS | |
| 441 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 442 | Alcohol interaction | FAERS: 3 | US FAERS | |
| 443 | Alcohol poisoning | FAERS: 3 | US FAERS | |
| 444 | Ammonia abnormal | FAERS: 3 | US FAERS | |
| 445 | Angina Pectoris | FAERS: 3 | SIDER US FAERS | |
| 446 | Anorgasmia | FAERS: 3 | SIDER US FAERS | |
| 447 | Anticonvulsant drug level abnormal | FAERS: 3 | US FAERS | |
| 448 | Anticonvulsant drug level above therapeutic | FAERS: 3 | US FAERS | |
| 449 | Arthritis | FAERS: 3 | OFFSIDES US FAERS | |
| 450 | Autoimmune hepatitis | FAERS: 3 | US FAERS | |
| 451 | Back disorder | FAERS: 3 | US FAERS | |
| 452 | Band neutrophil count increased | FAERS: 3 | US FAERS | |
| 453 | Blood alkaline phosphatase increased | FAERS: 3 | SIDER US FAERS | |
| 454 | Blood cholesterol increased | FAERS: 3 | US FAERS | |
| 455 | Bone density decreased | FAERS: 3 | US FAERS | |
| 456 | Breast tenderness | FAERS: 3 | US FAERS | |
| 457 | Candidiasis | FAERS: 3 | US FAERS | |
| 458 | Cellulitis | FAERS: 3 | US FAERS | |
| 459 | Cerebellar Ataxia | FAERS: 3 | US FAERS | |
| 460 | Cerebral Palsy | FAERS: 3 | 15128855 | CTD US FAERS |
| 461 | Cerebral disorder | FAERS: 3 | US FAERS | |
| 462 | Chorea | FAERS: 3 | US FAERS | |
| 463 | Corneal Opacity | FAERS: 3 | US FAERS | |
| 464 | Cystitis | FAERS: 3 | SIDER US FAERS | |
| 465 | Dacryostenosis congenital | FAERS: 3 | US FAERS | |
| 466 | Dermoid Cyst | FAERS: 3 | US FAERS | |
| 467 | Drowning | FAERS: 3 | US FAERS | |
| 468 | Drug screen false positive | FAERS: 3 | US FAERS | |
| 469 | Dyslexia | FAERS: 3 | SIDER US FAERS | |
| 470 | Dyslogia | FAERS: 3 | US FAERS | |
| 471 | Dysplasia | FAERS: 3 | US FAERS | |
| 472 | Electrocardiogram ST segment abnormal | FAERS: 3 | US FAERS | |
| 473 | Electroencephalogram abnormal | FAERS: 3 | SIDER US FAERS | |
| 474 | Electrolyte imbalance | FAERS: 3 | US FAERS | |
| 475 | Endometriosis | FAERS: 3 | US FAERS | |
| 476 | Erythema Nodosum | FAERS: 3 | US FAERS | |
| 477 | Escherichia infection | FAERS: 3 | US FAERS | |
| 478 | Exophthalmos | FAERS: 3 | US FAERS | |
| 479 | Failure to Thrive | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 480 | Feelings of worthlessness | FAERS: 3 | US FAERS | |
| 481 | Food aversion | FAERS: 3 | US FAERS | |
| 482 | Gastrectomy | FAERS: 3 | US FAERS | |
| 483 | Gastric Bypass | FAERS: 3 | US FAERS | |
| 484 | General physical condition abnormal | FAERS: 3 | US FAERS | |
| 485 | Gestational Diabetes | FAERS: 3 | OFFSIDES US FAERS | |
| 486 | Glossitis | FAERS: 3 | SIDER US FAERS | |
| 487 | Head discomfort | FAERS: 3 | US FAERS | |
| 488 | Hepatic Encephalopathy | FAERS: 3 | 10915174 | CTD US FAERS |
| 489 | Hepatomegaly | FAERS: 3 | 17923349 | CTD US FAERS |
| 490 | Homicide | FAERS: 3 | US FAERS | |
| 491 | Hunger | FAERS: 3 | US FAERS | |
| 492 | Hyperphagia | FAERS: 3 | US FAERS | |
| 493 | Hypertensive crisis | FAERS: 3 | US FAERS | |
| 494 | Hypomania | FAERS: 3 | SIDER US FAERS | |
| 495 | Idiosyncratic drug reaction | FAERS: 3 | US FAERS | |
| 496 | Immature respiratory system | FAERS: 3 | US FAERS | |
| 497 | Inappropriate affect | FAERS: 3 | US FAERS | |
| 498 | Inappropriate schedule of product administration | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 499 | Incontinence | FAERS: 3 | SIDER US FAERS | |
| 500 | Incorrect drug dosage form administered | FAERS: 3 | US FAERS | |
| 501 | Incorrect route of product administration | FAERS: 3 | US FAERS | |
| 502 | Joint stiffness | FAERS: 3 | OFFSIDES US FAERS | |
| 503 | Laceration | FAERS: 3 | US FAERS | |
| 504 | Lip swelling | FAERS: 3 | US FAERS | |
| 505 | Loose tooth | FAERS: 3 | OFFSIDES US FAERS | |
| 506 | Macroglossia | FAERS: 3 | US FAERS | |
| 507 | Malabsorption | FAERS: 3 | US FAERS | |
| 508 | Meningomyelocele | FAERS: 3 | US FAERS | |
| 509 | Multiple allergies | FAERS: 3 | US FAERS | |
| 510 | Myocarditis | FAERS: 3 | US FAERS | |
| 511 | Myoclonic Epilepsy | FAERS: 3 | US FAERS | |
| 512 | Myopathy | FAERS: 3 | US FAERS | |
| 513 | Nephritis | FAERS: 3 | US FAERS | |
| 514 | Nocturia | FAERS: 3 | SIDER US FAERS | |
| 515 | Nonspecific reaction | FAERS: 3 | US FAERS | |
| 516 | Obesity | FAERS: 3 | 17363756 17391164 | CTD SIDER US FAERS |
| 517 | Ocular Hypertension | FAERS: 3 | US FAERS | |
| 518 | Ophthalmoplegia | FAERS: 3 | US FAERS | |
| 519 | Optic Atrophy | FAERS: 3 | OFFSIDES US FAERS | |
| 520 | Oral Cavity Fistula | FAERS: 3 | US FAERS | |
| 521 | Oral candidiasis | FAERS: 3 | US FAERS | |
| 522 | Periarthritis | FAERS: 3 | OFFSIDES US FAERS | |
| 523 | Phalangeal agenesis | FAERS: 3 | US FAERS | |
| 524 | Pharyngitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 525 | Physical assault | FAERS: 3 | US FAERS | |
| 526 | Physical product label issue | FAERS: 3 | US FAERS | |
| 527 | Polydactyly | FAERS: 3 | US FAERS | |
| 528 | Poor weight gain neonatal | FAERS: 3 | US FAERS | |
| 529 | Product packaging issue | FAERS: 3 | US FAERS | |
| 530 | Product packaging quantity issue | FAERS: 3 | US FAERS | |
| 531 | Product physical issue | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 532 | Product prescribing error | FAERS: 3 | US FAERS | |
| 533 | Product size issue | FAERS: 3 | US FAERS | |
| 534 | Product solubility abnormal | FAERS: 3 | US FAERS | |
| 535 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 536 | Pulmonary artery stenosis | FAERS: 3 | US FAERS | |
| 537 | Pyelonephritis | FAERS: 3 | US FAERS | |
| 538 | Rash erythematous | FAERS: 3 | SIDER US FAERS | |
| 539 | Renal tubular disorder | FAERS: 3 | US FAERS | |
| 540 | Respiratory arrest | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 541 | Retinal Degeneration | FAERS: 3 | US FAERS | |
| 542 | Scleritis | FAERS: 3 | US FAERS | |
| 543 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 544 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 545 | Stomatitis | FAERS: 3 | SIDER US FAERS | |
| 546 | Tardive Dyskinesia | FAERS: 3 | OFFSIDES US FAERS | |
| 547 | Tooth Loss | FAERS: 3 | OFFSIDES US FAERS | |
| 548 | Underweight | FAERS: 3 | US FAERS | |
| 549 | VIIth nerve paralysis | FAERS: 3 | US FAERS | |
| 550 | Vaginal pain | FAERS: 3 | US FAERS | |
| 551 | Vasculitis | FAERS: 3 | US FAERS | |
| 552 | Vitamin D Deficiency | FAERS: 3 | US FAERS | |
| 553 | Vulvovaginal burning sensation | FAERS: 3 | US FAERS | |
| 554 | Vulvovaginal dryness | FAERS: 3 | US FAERS | |
| 555 | Vulvovaginal mycotic infection | FAERS: 3 | US FAERS | |
| 556 | Abnormal weight gain | FAERS: 2 | US FAERS | |
| 557 | Alcohol Intolerance | FAERS: 2 | SIDER US FAERS | |
| 558 | Alkalosis | FAERS: 2 | US FAERS | |
| 559 | Allergic reaction to excipient | FAERS: 2 | US FAERS | |
| 560 | Alopecia Areata | FAERS: 2 | US FAERS | |
| 561 | Alopecia effluvium | FAERS: 2 | US FAERS | |
| 562 | Anticonvulsant drug level increased | FAERS: 2 | US FAERS | |
| 563 | Arteriovenous fistula occlusion | FAERS: 2 | US FAERS | |
| 564 | Asphyxia | FAERS: 2 | OFFSIDES US FAERS | |
| 565 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 566 | Atrioventricular Block | FAERS: 2 | SIDER US FAERS | |
| 567 | Autonomic nervous system imbalance | FAERS: 2 | US FAERS | |
| 568 | Biliary Colic | FAERS: 2 | US FAERS | |
| 569 | Bladder discomfort | FAERS: 2 | US FAERS | |
| 570 | Blighted ovum | FAERS: 2 | US FAERS | |
| 571 | Blood human chorionic gonadotropin increased | FAERS: 2 | US FAERS | |
| 572 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 573 | Blood potassium abnormal | FAERS: 2 | US FAERS | |
| 574 | Blood urine present | FAERS: 2 | US FAERS | |
| 575 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 576 | Brain stem syndrome | FAERS: 2 | US FAERS | |
| 577 | Breast Cyst | FAERS: 2 | OFFSIDES US FAERS | |
| 578 | Bulbar palsy | FAERS: 2 | US FAERS | |
| 579 | Carotid artery occlusion | FAERS: 2 | US FAERS | |
| 580 | Cataract operation | FAERS: 2 | US FAERS | |
| 581 | Caudal Regression Syndrome | FAERS: 2 | US FAERS | |
| 582 | Change in sustained attention | FAERS: 2 | US FAERS | |
| 583 | Cheilitis | FAERS: 2 | US FAERS | |
| 584 | Choking sensation | FAERS: 2 | OFFSIDES US FAERS | |
| 585 | Chordee | FAERS: 2 | US FAERS | |
| 586 | Choroiditis | FAERS: 2 | US FAERS | |
| 587 | Chromatopsia | FAERS: 2 | US FAERS | |
| 588 | Chronic Fatigue Syndrome | FAERS: 2 | US FAERS | |
| 589 | Conduct Disorder | FAERS: 2 | US FAERS | |
| 590 | Congenital osteodystrophy | FAERS: 2 | US FAERS | |
| 591 | Congenital scoliosis | FAERS: 2 | US FAERS | |
| 592 | Contracted bladder | FAERS: 2 | US FAERS | |
| 593 | Contrast media reaction | FAERS: 2 | US FAERS | |
| 594 | Corneal thickening | FAERS: 2 | US FAERS | |
| 595 | Corrective lens user | FAERS: 2 | US FAERS | |
| 596 | Cyst | FAERS: 2 | OFFSIDES US FAERS | |
| 597 | Deafness Neurosensory | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 598 | Demyelination | FAERS: 2 | US FAERS | |
| 599 | Dependence | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 600 | Dermatitis | FAERS: 2 | SIDER US FAERS | |
| 601 | Device malfunction | FAERS: 2 | US FAERS | |
| 602 | Double ureter | FAERS: 2 | US FAERS | |
| 603 | Drooling | FAERS: 2 | SIDER US FAERS | |
| 604 | Drug abuser | FAERS: 2 | OFFSIDES US FAERS | |
| 605 | Drug level below therapeutic | FAERS: 2 | US FAERS | |
| 606 | Drug level fluctuating | FAERS: 2 | US FAERS | |
| 607 | Drug resistance | FAERS: 2 | US FAERS | |
| 608 | Drug withdrawal headache | FAERS: 2 | OFFSIDES US FAERS | |
| 609 | Dysmetropsia | FAERS: 2 | US FAERS | |
| 610 | Ear discomfort | FAERS: 2 | SIDER US FAERS | |
| 611 | Eating disorder symptom | FAERS: 2 | US FAERS | |
| 612 | Echolalia | FAERS: 2 | US FAERS | |
| 613 | Enterocolitis | FAERS: 2 | US FAERS | |
| 614 | Enzyme abnormality | FAERS: 2 | US FAERS | |
| 615 | Exhibitionism | FAERS: 2 | US FAERS | |
| 616 | Expired drug administered | FAERS: 2 | US FAERS | |
| 617 | Exposure via breast milk | FAERS: 2 | US FAERS | |
| 618 | Extra dose administered | FAERS: 2 | US FAERS | |
| 619 | Facial paralysis | FAERS: 2 | US FAERS | |
| 620 | Flat affect | FAERS: 2 | SIDER US FAERS | |
| 621 | Flight of ideas | FAERS: 2 | US FAERS | |
| 622 | Foreign body sensation in eyes | FAERS: 2 | US FAERS | |
| 623 | Fracture | FAERS: 2 | US FAERS | |
| 624 | Frustration | FAERS: 2 | US FAERS | |
| 625 | Gastric ulcer | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 626 | Gingival Recession | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 627 | Gingival pruritus | FAERS: 2 | US FAERS | |
| 628 | Glioblastoma | FAERS: 2 | US FAERS | |
| 629 | Glossoptosis | FAERS: 2 | US FAERS | |
| 630 | Gout | FAERS: 2 | US FAERS | |
| 631 | Grip strength decreased | FAERS: 2 | US FAERS | |
| 632 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 633 | Hepatitis C | FAERS: 2 | OFFSIDES US FAERS | |
| 634 | Hepatotoxicity | FAERS: 2 | OFFSIDES US FAERS | |
| 635 | Hormone level abnormal | FAERS: 2 | US FAERS | |
| 636 | Hyperpyrexia | FAERS: 2 | US FAERS | |
| 637 | Hyporesponsive to stimuli | FAERS: 2 | US FAERS | |
| 638 | Hypoxia | FAERS: 2 | US FAERS | |
| 639 | Infertility | FAERS: 2 | US FAERS | |
| 640 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 641 | Iris convex | FAERS: 2 | US FAERS | |
| 642 | Ketoacidosis | FAERS: 2 | US FAERS | |
| 643 | Limb discomfort | FAERS: 2 | SIDER US FAERS | |
| 644 | Limb injury | FAERS: 2 | US FAERS | |
| 645 | Limb operation | FAERS: 2 | US FAERS | |
| 646 | Lip exfoliation | FAERS: 2 | US FAERS | |
| 647 | Live Birth | FAERS: 2 | US FAERS | |
| 648 | Locked-In Syndrome | FAERS: 2 | US FAERS | |
| 649 | Lupus-like syndrome | FAERS: 2 | US FAERS | |
| 650 | Lymphoma | FAERS: 2 | US FAERS | |
| 651 | Macular fibrosis | FAERS: 2 | US FAERS | |
| 652 | Manufacturing issue | FAERS: 2 | US FAERS | |
| 653 | Mental retardation severity unspecified | FAERS: 2 | US FAERS | |
| 654 | Metastatic Neoplasm | FAERS: 2 | US FAERS | |
| 655 | Microphthalmos | FAERS: 2 | US FAERS | |
| 656 | Migraine with Aura | FAERS: 2 | US FAERS | |
| 657 | Mixed Connective Tissue Disease | FAERS: 2 | US FAERS | |
| 658 | Motion Sickness | FAERS: 2 | US FAERS | |
| 659 | Multi-organ disorder | FAERS: 2 | US FAERS | |
| 660 | Multiple sclerosis relapse | FAERS: 2 | OFFSIDES US FAERS | |
| 661 | Muscle Spasticity | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 662 | Musculoskeletal chest pain | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 663 | Nerve injury | FAERS: 2 | US FAERS | |
| 664 | Obesity surgery | FAERS: 2 | US FAERS | |
| 665 | Obsessive thoughts | FAERS: 2 | US FAERS | |
| 666 | Oculogyric crisis | FAERS: 2 | US FAERS | |
| 667 | Oligohydramnios | FAERS: 2 | US FAERS | |
| 668 | Optic Neuropathy | FAERS: 2 | OFFSIDES US FAERS | |
| 669 | Oral pain | FAERS: 2 | SIDER US FAERS | |
| 670 | Pain management | FAERS: 2 | US FAERS | |
| 671 | Pallor | FAERS: 2 | SIDER US FAERS | |
| 672 | Pancytopenia | FAERS: 2 | SIDER US FAERS | |
| 673 | Paradoxical drug reaction | FAERS: 2 | US FAERS | |
| 674 | Persistent depressive disorder | FAERS: 2 | US FAERS | |
| 675 | Pharmaceutical product counterfeit | FAERS: 2 | US FAERS | |
| 676 | Pneumothorax | FAERS: 2 | US FAERS | |
| 677 | Polyarthritis | FAERS: 2 | US FAERS | |
| 678 | Polydipsia | FAERS: 2 | SIDER US FAERS | |
| 679 | Portal hypertensive gastropathy | FAERS: 2 | US FAERS | |
| 680 | Post inflammatory pigmentation change | FAERS: 2 | US FAERS | |
| 681 | Pregnancy test positive | FAERS: 2 | US FAERS | |
| 682 | Prescribed overdose | FAERS: 2 | OFFSIDES US FAERS | |
| 683 | Product container seal issue | FAERS: 2 | US FAERS | |
| 684 | Product label confusion | FAERS: 2 | US FAERS | |
| 685 | Product label issue | FAERS: 2 | US FAERS | |
| 686 | Product label on wrong product | FAERS: 2 | US FAERS | |
| 687 | Product lot number issue | FAERS: 2 | US FAERS | |
| 688 | Product measured potency issue | FAERS: 2 | US FAERS | |
| 689 | Pseudomyopia | FAERS: 2 | US FAERS | |
| 690 | Regurgitation | FAERS: 2 | US FAERS | |
| 691 | Retching | FAERS: 2 | US FAERS | |
| 692 | Retinal pigment epitheliopathy | FAERS: 2 | US FAERS | |
| 693 | Retinogram abnormal | FAERS: 2 | US FAERS | |
| 694 | Rotator cuff syndrome | FAERS: 2 | US FAERS | |
| 695 | Saliva altered | FAERS: 2 | US FAERS | |
| 696 | Scotoma | FAERS: 2 | SIDER US FAERS | |
| 697 | Sjogren's Syndrome | FAERS: 2 | OFFSIDES US FAERS | |
| 698 | Skin tightness | FAERS: 2 | OFFSIDES US FAERS | |
| 699 | Splenomegaly | FAERS: 2 | US FAERS | |
| 700 | Stevens-Johnson Syndrome | FAERS: 2 | 25811541 | CTD SIDER US FAERS |
| 701 | Strabismus | FAERS: 2 | US FAERS | |
| 702 | Sudden death | FAERS: 2 | US FAERS | |
| 703 | Sunburn | FAERS: 2 | US FAERS | |
| 704 | Tachyphrenia | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 705 | Tension Headache | FAERS: 2 | US FAERS | |
| 706 | Therapeutic product ineffective | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 707 | Therapeutic product ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 708 | Therapeutic response changed | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 709 | Throat irritation | FAERS: 2 | US FAERS | |
| 710 | Tinea cruris | FAERS: 2 | US FAERS | |
| 711 | Toothache | FAERS: 2 | SIDER US FAERS | |
| 712 | Torticollis | FAERS: 2 | US FAERS | |
| 713 | Toxic Epidermal Necrolysis | FAERS: 2 | SIDER US FAERS | |
| 714 | Transaminases increased | FAERS: 2 | US FAERS | |
| 715 | Trigeminal Neuralgia | FAERS: 2 | US FAERS | |
| 716 | Trisomy 21 | FAERS: 2 | US FAERS | |
| 717 | Tuberous Sclerosis | FAERS: 2 | US FAERS | |
| 718 | Urge Incontinence | FAERS: 2 | US FAERS | |
| 719 | Vascular anomaly | FAERS: 2 | US FAERS | |
| 720 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 721 | Ventricular Dysfunction | FAERS: 2 | US FAERS | |
| 722 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 723 | Violence-related symptom | FAERS: 2 | OFFSIDES US FAERS | |
| 724 | Vitreous Detachment | FAERS: 2 | US FAERS | |
| 725 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 726 | Walking aid user | FAERS: 2 | US FAERS | |
| 727 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 728 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 729 | Abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 730 | Accidental death | FAERS: 1 | US FAERS | |
| 731 | Acquired night blindness | FAERS: 1 | US FAERS | |
| 732 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 733 | Acute psychosis | FAERS: 1 | US FAERS | |
| 734 | Adactyly | FAERS: 1 | US FAERS | |
| 735 | Agnosia | FAERS: 1 | US FAERS | |
| 736 | Agoraphobia | FAERS: 1 | US FAERS | |
| 737 | Akinesia | FAERS: 1 | SIDER US FAERS | |
| 738 | Alexia | FAERS: 1 | US FAERS | |
| 739 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 740 | Amniotic infection syndrome of Blane | FAERS: 1 | US FAERS | |
| 741 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 742 | Anal abscess | FAERS: 1 | US FAERS | |
| 743 | Anal inflammation | FAERS: 1 | US FAERS | |
| 744 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 745 | Androgenetic Alopecia | FAERS: 1 | US FAERS | |
| 746 | Anencephaly | FAERS: 1 | US FAERS | |
| 747 | Aneurysm | FAERS: 1 | OFFSIDES US FAERS | |
| 748 | Angular cheilitis | FAERS: 1 | US FAERS | |
| 749 | Anhedonia | FAERS: 1 | US FAERS | |
| 750 | Anterior chamber opacity | FAERS: 1 | US FAERS | |
| 751 | Anticonvulsant drug level below therapeutic | FAERS: 1 | US FAERS | |
| 752 | Anticonvulsant drug level decreased | FAERS: 1 | US FAERS | |
| 753 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 754 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 755 | Appendicitis | FAERS: 1 | US FAERS | |
| 756 | Arteritis | FAERS: 1 | US FAERS | |
| 757 | Aspergillosis | FAERS: 1 | US FAERS | |
| 758 | Aspermia | FAERS: 1 | US FAERS | |
| 759 | Atrophic vulvovaginitis | FAERS: 1 | US FAERS | |
| 760 | Autistic Disorder | FAERS: 1 | US FAERS | |
| 761 | Automatism | FAERS: 1 | OFFSIDES US FAERS | |
| 762 | Autonomic neuropathy | FAERS: 1 | SIDER US FAERS | |
| 763 | Autosomal chromosome anomaly | FAERS: 1 | US FAERS | |
| 764 | Bacteriuria | FAERS: 1 | US FAERS | |
| 765 | Belligerence | FAERS: 1 | US FAERS | |
| 766 | Bipolar I disorder | FAERS: 1 | SIDER US FAERS | |
| 767 | Bipolar II disorder | FAERS: 1 | US FAERS | |
| 768 | Bladder pain | FAERS: 1 | SIDER US FAERS | |
| 769 | Blood blister | FAERS: 1 | US FAERS | |
| 770 | Blood brain barrier defect | FAERS: 1 | US FAERS | |
| 771 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 772 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 773 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 774 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 775 | Blood ethanol increased | FAERS: 1 | US FAERS | |
| 776 | Blood follicle stimulating hormone increased | FAERS: 1 | US FAERS | |
| 777 | Blood gases abnormal | FAERS: 1 | US FAERS | |
| 778 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 779 | Blood homocysteine increased | FAERS: 1 | US FAERS | |
| 780 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 781 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 782 | Blood pH increased | FAERS: 1 | US FAERS | |
| 783 | Blood parathyroid hormone increased | FAERS: 1 | US FAERS | |
| 784 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 785 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 786 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 787 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 788 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 789 | Blunted affect | FAERS: 1 | US FAERS | |
| 790 | Bone contusion | FAERS: 1 | US FAERS | |
| 791 | Brachiocephalic vein stenosis | FAERS: 1 | US FAERS | |
| 792 | Bradyphagia | FAERS: 1 | US FAERS | |
| 793 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 794 | Breast discomfort | FAERS: 1 | US FAERS | |
| 795 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 796 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 797 | Bronchopulmonary Dysplasia | FAERS: 1 | US FAERS | |
| 798 | Bronchospasm | FAERS: 1 | US FAERS | |
| 799 | Bunion | FAERS: 1 | US FAERS | |
| 800 | Calcinosis | FAERS: 1 | SIDER US FAERS | |
| 801 | Calcium deficiency | FAERS: 1 | US FAERS | |
| 802 | Capsule physical issue | FAERS: 1 | US FAERS | |
| 803 | Carbohydrate antigen 19-9 increased | FAERS: 1 | US FAERS | |
| 804 | Carbon Monoxide Poisoning | FAERS: 1 | US FAERS | |
| 805 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 806 | Carcinoma | FAERS: 1 | US FAERS | |
| 807 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 808 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 809 | Cerebral ataxia | FAERS: 1 | US FAERS | |
| 810 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 811 | Cerebral congestion | FAERS: 1 | US FAERS | |
| 812 | Charles Bonnet Syndrome | FAERS: 1 | US FAERS | |
| 813 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 814 | Cholecystitis | FAERS: 1 | OFFSIDES US FAERS | |
| 815 | Cholestasis | FAERS: 1 | US FAERS | |
| 816 | Chorioamnionitis | FAERS: 1 | US FAERS | |
| 817 | Choroid Plexus Papilloma | FAERS: 1 | US FAERS | |
| 818 | Chromaturia | FAERS: 1 | US FAERS | |
| 819 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 820 | Claustrophobia | FAERS: 1 | US FAERS | |
| 821 | Cleft uvula | FAERS: 1 | US FAERS | |
| 822 | Cluster Headache | FAERS: 1 | 15928910 | CTD US FAERS |
| 823 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 824 | Compression fracture | FAERS: 1 | OFFSIDES US FAERS | |
| 825 | Compulsive shopping | FAERS: 1 | OFFSIDES US FAERS | |
| 826 | Congenital absence of vertebra | FAERS: 1 | US FAERS | |
| 827 | Congenital brain damage | FAERS: 1 | US FAERS | |
| 828 | Congenital cerebral cyst | FAERS: 1 | US FAERS | |
| 829 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 830 | Congenital diaphragmatic hernia | FAERS: 1 | US FAERS | |
| 831 | Congenital hydronephrosis | FAERS: 1 | US FAERS | |
| 832 | Congenital inguinal hernia | FAERS: 1 | US FAERS | |
| 833 | Congenital labia pudendi adhesions | FAERS: 1 | US FAERS | |
| 834 | Congenital neoplasm | FAERS: 1 | US FAERS | |
| 835 | Congenital nystagmus | FAERS: 1 | US FAERS | |
| 836 | Congenital skin dimples | FAERS: 1 | US FAERS | |
| 837 | Congenital torticollis | FAERS: 1 | US FAERS | |
| 838 | Conjunctival cyst | FAERS: 1 | US FAERS | |
| 839 | Corneal Infection | FAERS: 1 | US FAERS | |
| 840 | Corneal degeneration | FAERS: 1 | US FAERS | |
| 841 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 842 | Corneal striae | FAERS: 1 | US FAERS | |
| 843 | Corneal thinning | FAERS: 1 | US FAERS | |
| 844 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 845 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 846 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 847 | Cyclitis | FAERS: 1 | US FAERS | |
| 848 | Cystic Fibrosis | FAERS: 1 | US FAERS | |
| 849 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 850 | Cytopenia | FAERS: 1 | US FAERS | |
| 851 | Deja Vu | FAERS: 1 | US FAERS | |
| 852 | Delayed Puberty | FAERS: 1 | US FAERS | |
| 853 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 854 | Diet refusal | FAERS: 1 | US FAERS | |
| 855 | Dissociative Identity Disorder | FAERS: 1 | US FAERS | |
| 856 | Drug clearance increased | FAERS: 1 | US FAERS | |
| 857 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 858 | Drug diversion | FAERS: 1 | US FAERS | |
| 859 | Drug effect variable | FAERS: 1 | US FAERS | |
| 860 | Drug level increased | FAERS: 1 | US FAERS | |
| 861 | Drug titration error | FAERS: 1 | US FAERS | |
| 862 | Drug-disease interaction | FAERS: 1 | US FAERS | |
| 863 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 864 | Duodenal atresia | FAERS: 1 | US FAERS | |
| 865 | Duodenitis | FAERS: 1 | US FAERS | |
| 866 | Dwarfism | FAERS: 1 | US FAERS | |
| 867 | Dyscalculia | FAERS: 1 | US FAERS | |
| 868 | Dyschromatopsia | FAERS: 1 | US FAERS | |
| 869 | Dyspareunia | FAERS: 1 | OFFSIDES US FAERS | |
| 870 | Dysphasia | FAERS: 1 | SIDER US FAERS | |
| 871 | Dysthymic Disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 872 | Ecchymosis | FAERS: 1 | US FAERS | |
| 873 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 874 | Elevated mood | FAERS: 1 | SIDER US FAERS | |
| 875 | Encephalitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 876 | Encephalomyelitis | FAERS: 1 | US FAERS | |
| 877 | Endometriosis ablation | FAERS: 1 | US FAERS | |
| 878 | Endophthalmitis | FAERS: 1 | SIDER US FAERS | |
| 879 | Enteritis | FAERS: 1 | US FAERS | |
| 880 | Eructation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 881 | Erythema Multiforme | FAERS: 1 | SIDER US FAERS | |
| 882 | Essential Tremor | FAERS: 1 | SIDER US FAERS | |
| 883 | Eustachian tube disorder | FAERS: 1 | US FAERS | |
| 884 | Excitability | FAERS: 1 | US FAERS | |
| 885 | Exposure via ingestion | FAERS: 1 | US FAERS | |
| 886 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 887 | Eye Infection | FAERS: 1 | US FAERS | |
| 888 | Eye Redness | FAERS: 1 | SIDER US FAERS | |
| 889 | Eye inflammation | FAERS: 1 | OFFSIDES US FAERS | |
| 890 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 891 | Eyelid pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 892 | Facial Neuralgia | FAERS: 1 | US FAERS | |
| 893 | Facial Paresis | FAERS: 1 | US FAERS | |
| 894 | Feeding disorder neonatal | FAERS: 1 | US FAERS | |
| 895 | Feeling of body temperature change | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 896 | Focal dyscognitive seizures | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 897 | Food Poisoning | FAERS: 1 | US FAERS | |
| 898 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 899 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 900 | Fumbling | FAERS: 1 | US FAERS | |
| 901 | Gait inability | FAERS: 1 | US FAERS | |
| 902 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 903 | Gastric Fistula | FAERS: 1 | US FAERS | |
| 904 | Gastric infection | FAERS: 1 | US FAERS | |
| 905 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 906 | Gastrointestinal candidiasis | FAERS: 1 | US FAERS | |
| 907 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 908 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 909 | Genital Herpes | FAERS: 1 | US FAERS | |
| 910 | Genital rash | FAERS: 1 | OFFSIDES US FAERS | |
| 911 | Gestational age test abnormal | FAERS: 1 | US FAERS | |
| 912 | Gingival Hyperplasia | FAERS: 1 | SIDER US FAERS | |
| 913 | Gingival erythema | FAERS: 1 | US FAERS | |
| 914 | Gingivitis | FAERS: 1 | SIDER US FAERS | |
| 915 | Global Amnesia | FAERS: 1 | US FAERS | |
| 916 | Gonioscopy abnormal | FAERS: 1 | US FAERS | |
| 917 | Head Banging | FAERS: 1 | US FAERS | |
| 918 | Hearing disability | FAERS: 1 | US FAERS | |
| 919 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 920 | Hip surgery | FAERS: 1 | US FAERS | |
| 921 | Horseshoe Kidney | FAERS: 1 | US FAERS | |
| 922 | Hyperkinesia | FAERS: 1 | SIDER US FAERS | |
| 923 | Hyperoxaluria | FAERS: 1 | US FAERS | |
| 924 | Hypervigilance | FAERS: 1 | US FAERS | |
| 925 | Hypogonadism | FAERS: 1 | US FAERS | |
| 926 | Hyporeflexia | FAERS: 1 | SIDER US FAERS | |
| 927 | Hypothalamo-pituitary disorder | FAERS: 1 | US FAERS | |
| 928 | Hysterectomy | FAERS: 1 | OFFSIDES US FAERS | |
| 929 | Ideas of reference | FAERS: 1 | US FAERS | |
| 930 | Impaired quality of life | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 931 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 932 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 933 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 934 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 935 | Inhibitory drug interaction | FAERS: 1 | US FAERS | |
| 936 | Insulin autoimmune syndrome | FAERS: 1 | US FAERS | |
| 937 | Intelligence test abnormal | FAERS: 1 | US FAERS | |
| 938 | Intentional misuse | FAERS: 1 | US FAERS | |
| 939 | Intervertebral Disc Degeneration | FAERS: 1 | OFFSIDES US FAERS | |
| 940 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 941 | Intussusception | FAERS: 1 | US FAERS | |
| 942 | Iris injury | FAERS: 1 | US FAERS | |
| 943 | Joint Instability | FAERS: 1 | OFFSIDES US FAERS | |
| 944 | Joint injury | FAERS: 1 | US FAERS | |
| 945 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 946 | Laryngitis | FAERS: 1 | SIDER US FAERS | |
| 947 | Lead dislodgement | FAERS: 1 | US FAERS | |
| 948 | Ligament injury | FAERS: 1 | OFFSIDES US FAERS | |
| 949 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 950 | Long QT Syndrome | FAERS: 1 | US FAERS | |
| 951 | Loss of bladder sensation | FAERS: 1 | US FAERS | |
| 952 | Low Cardiac Output Syndrome | FAERS: 1 | US FAERS | |
| 953 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 954 | Lung Abscess | FAERS: 1 | US FAERS | |
| 955 | Lyme Disease | FAERS: 1 | US FAERS | |
| 956 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 957 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 958 | Macrocephaly | FAERS: 1 | US FAERS | |
| 959 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 960 | Malocclusion | FAERS: 1 | US FAERS | |
| 961 | Mastication disorder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 962 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 963 | Medical induction of coma | FAERS: 1 | US FAERS | |
| 964 | Medication overuse headache | FAERS: 1 | US FAERS | |
| 965 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 966 | Meningioma | FAERS: 1 | US FAERS | |
| 967 | Meningitis | FAERS: 1 | US FAERS | |
| 968 | Merycism | FAERS: 1 | US FAERS | |
| 969 | Mesenteritis | FAERS: 1 | US FAERS | |
| 970 | Microgenia | FAERS: 1 | US FAERS | |
| 971 | Miliaria | FAERS: 1 | US FAERS | |
| 972 | Mineral deficiency | FAERS: 1 | US FAERS | |
| 973 | Monoplegia | FAERS: 1 | US FAERS | |
| 974 | Morose | FAERS: 1 | US FAERS | |
| 975 | Mouth swelling | FAERS: 1 | US FAERS | |
| 976 | Mucosal erosion | FAERS: 1 | US FAERS | |
| 977 | Multiple Epiphyseal Dysplasia | FAERS: 1 | US FAERS | |
| 978 | Muscle Fatigue | FAERS: 1 | SIDER US FAERS | |
| 979 | Myositis | FAERS: 1 | US FAERS | |
| 980 | Narcolepsy | FAERS: 1 | US FAERS | |
| 981 | Necrobiosis Lipoidica Diabeticorum | FAERS: 1 | US FAERS | |
| 982 | Negative thoughts | FAERS: 1 | US FAERS | |
| 983 | Neonatal tachycardia | FAERS: 1 | US FAERS | |
| 984 | Nephrectomy | FAERS: 1 | US FAERS | |
| 985 | Nerve root lesion | FAERS: 1 | US FAERS | |
| 986 | Neuroblastoma | FAERS: 1 | US FAERS | |
| 987 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 988 | Nipple pain | FAERS: 1 | US FAERS | |
| 989 | Nodule | FAERS: 1 | OFFSIDES US FAERS | |
| 990 | Non-cardiac chest pain | FAERS: 1 | OFFSIDES US FAERS | |
| 991 | Ocular Toxicity | FAERS: 1 | US FAERS | |
| 992 | Ocular icterus | FAERS: 1 | US FAERS | |
| 993 | Omphalitis | FAERS: 1 | US FAERS | |
| 994 | Open wound | FAERS: 1 | US FAERS | |
| 995 | Optic nerve cup/disc ratio increased | FAERS: 1 | US FAERS | |
| 996 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 997 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 998 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 999 | Osteomalacia | FAERS: 1 | SIDER US FAERS | |
| 1000 | PCO2 decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 1001 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 1002 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 1003 | Panic Disorder | FAERS: 1 | 16566634 | CTD SIDER US FAERS |
| 1004 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 1005 | Parasomnia | FAERS: 1 | US FAERS | |
| 1006 | Parathyroidectomy | FAERS: 1 | US FAERS | |
| 1007 | Paresis | FAERS: 1 | 12237075 | CTD US FAERS |
| 1008 | Parotitis | FAERS: 1 | US FAERS | |
| 1009 | Pathological fracture | FAERS: 1 | US FAERS | |
| 1010 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 1011 | Pelvic venous thrombosis | FAERS: 1 | US FAERS | |
| 1012 | Performance status decreased | FAERS: 1 | US FAERS | |
| 1013 | Pericarditis | FAERS: 1 | US FAERS | |
| 1014 | Periodontitis | FAERS: 1 | US FAERS | |
| 1015 | Pertussis | FAERS: 1 | US FAERS | |
| 1016 | Phimosis | FAERS: 1 | US FAERS | |
| 1017 | Phonological Disorder | FAERS: 1 | US FAERS | |
| 1018 | Photosensitivity allergic reaction | FAERS: 1 | US FAERS | |
| 1019 | Placenta Accreta | FAERS: 1 | US FAERS | |
| 1020 | Placental Insufficiency | FAERS: 1 | US FAERS | |
| 1021 | Platelet aggregation abnormal | FAERS: 1 | US FAERS | |
| 1022 | Pleurisy | FAERS: 1 | US FAERS | |
| 1023 | Podagra | FAERS: 1 | US FAERS | |
| 1024 | Polymyositis | FAERS: 1 | US FAERS | |
| 1025 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 1026 | Polyuria | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 1027 | Poriomania | FAERS: 1 | US FAERS | |
| 1028 | Post procedural complication | FAERS: 1 | US FAERS | |
| 1029 | Post procedural infection | FAERS: 1 | US FAERS | |
| 1030 | Postoperative ileus | FAERS: 1 | US FAERS | |
| 1031 | Prader-Willi Syndrome | FAERS: 1 | US FAERS | |
| 1032 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 1033 | Preauricular cyst | FAERS: 1 | US FAERS | |
| 1034 | Pregnancy on oral contraceptive | FAERS: 1 | US FAERS | |
| 1035 | Pregnancy with implant contraceptive | FAERS: 1 | US FAERS | |
| 1036 | Premature Ejaculation | FAERS: 1 | SIDER US FAERS | |
| 1037 | Premenstrual syndrome | FAERS: 1 | US FAERS | |
| 1038 | Procedural complication | FAERS: 1 | US FAERS | |
| 1039 | Product administration error | FAERS: 1 | US FAERS | |
| 1040 | Product commingling | FAERS: 1 | US FAERS | |
| 1041 | Product complaint | FAERS: 1 | US FAERS | |
| 1042 | Product container issue | FAERS: 1 | US FAERS | |
| 1043 | Product contamination microbial | FAERS: 1 | US FAERS | |
| 1044 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 1045 | Product dosage form confusion | FAERS: 1 | US FAERS | |
| 1046 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 1047 | Product formulation issue | FAERS: 1 | US FAERS | |
| 1048 | Product identification number issue | FAERS: 1 | US FAERS | |
| 1049 | Product preparation error | FAERS: 1 | US FAERS | |
| 1050 | Product tampering | FAERS: 1 | US FAERS | |
| 1051 | Progesterone increased | FAERS: 1 | US FAERS | |
| 1052 | Protein total abnormal | FAERS: 1 | US FAERS | |
| 1053 | Protein urine present | FAERS: 1 | US FAERS | |
| 1054 | Protein-losing gastroenteropathy | FAERS: 1 | US FAERS | |
| 1055 | Pseudodementia | FAERS: 1 | US FAERS | |
| 1056 | Pseudolymphoma | FAERS: 1 | US FAERS | |
| 1057 | Pseudoporphyria | FAERS: 1 | US FAERS | |
| 1058 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 1059 | Pulmonary malformation | FAERS: 1 | US FAERS | |
| 1060 | Purging | FAERS: 1 | US FAERS | |
| 1061 | Pyloric Stenosis | FAERS: 1 | US FAERS | |
| 1062 | Pyuria | FAERS: 1 | US FAERS | |
| 1063 | Quadriparesis | FAERS: 1 | US FAERS | |
| 1064 | Radicular pain | FAERS: 1 | US FAERS | |
| 1065 | Reaction to azo-dyes | FAERS: 1 | US FAERS | |
| 1066 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 1067 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 1068 | Renal fusion anomaly | FAERS: 1 | US FAERS | |
| 1069 | Renal hydrocele | FAERS: 1 | US FAERS | |
| 1070 | Retinal exudates | FAERS: 1 | US FAERS | |
| 1071 | Retinal pigmentation | FAERS: 1 | US FAERS | |
| 1072 | Retinitis Pigmentosa | FAERS: 1 | US FAERS | |
| 1073 | Retinopathy of Prematurity | FAERS: 1 | US FAERS | |
| 1074 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 1075 | Rhinalgia | FAERS: 1 | US FAERS | |
| 1076 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 1077 | Rosacea | FAERS: 1 | US FAERS | |
| 1078 | Rubella antibody positive | FAERS: 1 | US FAERS | |
| 1079 | SUNCT Syndrome | FAERS: 1 | 20656711 | CTD US FAERS |
| 1080 | Salivary gland pain | FAERS: 1 | US FAERS | |
| 1081 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 1082 | Schizoaffective Disorder | FAERS: 1 | US FAERS | |
| 1083 | School refusal | FAERS: 1 | US FAERS | |
| 1084 | Scleroderma | FAERS: 1 | US FAERS | |
| 1085 | Secretion discharge | FAERS: 1 | US FAERS | |
| 1086 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 1087 | Serous retinal detachment | FAERS: 1 | US FAERS | |
| 1088 | Shoplifting | FAERS: 1 | US FAERS | |
| 1089 | Sight disability | FAERS: 1 | US FAERS | |
| 1090 | Sinus pain | FAERS: 1 | US FAERS | |
| 1091 | Skin Erosion | FAERS: 1 | US FAERS | |
| 1092 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 1093 | Skin laceration | FAERS: 1 | US FAERS | |
| 1094 | Sleep Talking | FAERS: 1 | US FAERS | |
| 1095 | Sleep study abnormal | FAERS: 1 | US FAERS | |
| 1096 | Sneezing | FAERS: 1 | US FAERS | |
| 1097 | Soliloquy | FAERS: 1 | OFFSIDES US FAERS | |
| 1098 | Spina Bifida Occulta | FAERS: 1 | US FAERS | |
| 1099 | Spinal column injury | FAERS: 1 | US FAERS | |
| 1100 | Spinal fusion acquired | FAERS: 1 | US FAERS | |
| 1101 | Splenic Rupture | FAERS: 1 | US FAERS | |
| 1102 | Stenosis | FAERS: 1 | US FAERS | |
| 1103 | Streptococcus test negative | FAERS: 1 | US FAERS | |
| 1104 | Stress at work | FAERS: 1 | US FAERS | |
| 1105 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 1106 | Sudden Visual Loss | FAERS: 1 | US FAERS | |
| 1107 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 1108 | Surgical failure | FAERS: 1 | US FAERS | |
| 1109 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 1110 | Syringomyelia | FAERS: 1 | US FAERS | |
| 1111 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 1112 | Systemic lupus erythematosus rash | FAERS: 1 | US FAERS | |
| 1113 | T-cell lymphoma stage IV | FAERS: 1 | US FAERS | |
| 1114 | Tablet issue | FAERS: 1 | US FAERS | |
| 1115 | Tetany | FAERS: 1 | US FAERS | |
| 1116 | Tethered Cord Syndrome | FAERS: 1 | US FAERS | |
| 1117 | Therapeutic product effect decreased | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 1118 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 1119 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 1120 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 1121 | Tongue biting | FAERS: 1 | US FAERS | |
| 1122 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 1123 | Tooth Infection | FAERS: 1 | US FAERS | |
| 1124 | Tracheitis | FAERS: 1 | US FAERS | |
| 1125 | Transcription medication error | FAERS: 1 | US FAERS | |
| 1126 | Trichomegaly | FAERS: 1 | US FAERS | |
| 1127 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 1128 | Trismus | FAERS: 1 | US FAERS | |
| 1129 | Ultrasound scan abnormal | FAERS: 1 | US FAERS | |
| 1130 | Upper airway obstruction | FAERS: 1 | US FAERS | |
| 1131 | Ureteritis | FAERS: 1 | US FAERS | |
| 1132 | Ureterocele | FAERS: 1 | US FAERS | |
| 1133 | Urinary sediment present | FAERS: 1 | US FAERS | |
| 1134 | Urinary tract inflammation | FAERS: 1 | US FAERS | |
| 1135 | Urine ketone body present | FAERS: 1 | US FAERS | |
| 1136 | Urine potassium increased | FAERS: 1 | US FAERS | |
| 1137 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 1138 | Vaginal mucosal blistering | FAERS: 1 | US FAERS | |
| 1139 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 1140 | Vasodilation procedure | FAERS: 1 | SIDER US FAERS | |
| 1141 | Vasospasm | FAERS: 1 | SIDER US FAERS | |
| 1142 | Viral test positive | FAERS: 1 | US FAERS | |
| 1143 | Visual brightness | FAERS: 1 | US FAERS | |
| 1144 | Visual snow syndrome | FAERS: 1 | US FAERS | |
| 1145 | Vitritis | FAERS: 1 | US FAERS | |
| 1146 | Weight above normal | FAERS: 1 | US FAERS | |
| 1147 | Weight decrease neonatal | FAERS: 1 | US FAERS | |
| 1148 | Wheelchair user | FAERS: 1 | US FAERS | |
| 1149 | colonoscopy | FAERS: 1 | OFFSIDES US FAERS | |
| 1150 | effusion | FAERS: 1 | SIDER US FAERS | |
| 1151 | fibroma | FAERS: 1 | US FAERS | |
| 1152 | furuncle | FAERS: 1 | US FAERS | |
| 1153 | prostatitis | FAERS: 1 | US FAERS | |
| 1154 | skin abrasion | FAERS: 1 | US FAERS | |
| 1155 | Abdominal tenderness | SIDER | ||
| 1156 | Abnormal vision | OFFSIDES SIDER | ||
| 1157 | Abuse | OFFSIDES | ||
| 1158 | Action Tremor | SIDER | ||
| 1159 | Acute bronchitis | OFFSIDES | ||
| 1160 | Administration site reaction | SIDER | ||
| 1161 | Aggressive reaction | SIDER | ||
| 1162 | Agraphia | OFFSIDES | ||
| 1163 | Albuminuria | SIDER | ||
| 1164 | Alkaline phosphatase serum increased | SIDER | ||
| 1165 | Altered bowel function | OFFSIDES | ||
| 1166 | Amenorrhea | OFFSIDES | ||
| 1167 | Amphetamine-Related Disorders | 16176341 | CTD | |
| 1168 | Analgesia | OFFSIDES | ||
| 1169 | Antiphospholipid antibodies positive | OFFSIDES | ||
| 1170 | Anxiety Disorders | 12068361 29753867 | CTD | |
| 1171 | Aortic Aneurysm | OFFSIDES | ||
| 1172 | Application site vesicles | OFFSIDES | ||
| 1173 | Arterial therapeutic procedure | OFFSIDES | ||
| 1174 | Attention concentration difficulty | SIDER | ||
| 1175 | Autoimmune inner ear disease | OFFSIDES | ||
| 1176 | BREAST PAIN FEMALE | SIDER | ||
| 1177 | Bile Duct Stenosis | OFFSIDES | ||
| 1178 | Biliary Dyskinesia | OFFSIDES | ||
| 1179 | Biliary cirrhosis | OFFSIDES | ||
| 1180 | Blood Coagulation Disorders | 17923349 | CTD | |
| 1181 | Blood and lymphatic system disorders | SIDER | ||
| 1182 | Blood bicarbonate | SIDER | ||
| 1183 | Blood cholesterol | OFFSIDES | ||
| 1184 | Blurred vision | OFFSIDES | ||
| 1185 | Body odor | SIDER | ||
| 1186 | Bone infarction | OFFSIDES | ||
| 1187 | Bone marrow depression | SIDER | ||
| 1188 | Brain Diseases, Metabolic | 16010067 | CTD | |
| 1189 | Brain Diseases | 10636156 | CTD | |
| 1190 | Brain Injuries | 17084066 | CTD | |
| 1191 | Brain Ischemia | 15128855 | CTD | |
| 1192 | Bursitis | OFFSIDES | ||
| 1193 | Cardioactive drug level | OFFSIDES | ||
| 1194 | Catheter placement | OFFSIDES | ||
| 1195 | Cerebral Arteriosclerosis | OFFSIDES | ||
| 1196 | Cerebral Thrombosis | OFFSIDES | ||
| 1197 | Cervicobrachial syndrome | OFFSIDES | ||
| 1198 | Child Development Disorders, Pervasive | 15650499 | CTD | |
| 1199 | Chloasma | SIDER | ||
| 1200 | Chondromalacia | OFFSIDES | ||
| 1201 | Cirrhosis | OFFSIDES | ||
| 1202 | Citric acid urine decreased | OFFSIDES | ||
| 1203 | Coagulation factor VIII level increased | OFFSIDES | ||
| 1204 | Cocaine-Related Disorders | CTD | ||
| 1205 | Cognition Disorders | CTD | ||
| 1206 | Color blindness | OFFSIDES | ||
| 1207 | Confabulation | OFFSIDES | ||
| 1208 | Contact Dermatitis | OFFSIDES | ||
| 1209 | Convulsions aggravated | SIDER | ||
| 1210 | Cramps of lower extremities | SIDER | ||
| 1211 | Creatinine increased | SIDER | ||
| 1212 | Delusion of reference | OFFSIDES | ||
| 1213 | Dental abscess | OFFSIDES | ||
| 1214 | Depression aggravated | SIDER | ||
| 1215 | Depressive disorder | 17987732 18620801 | CTD | |
| 1216 | Device occlusion | OFFSIDES | ||
| 1217 | Diabetes | OFFSIDES | ||
| 1218 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 1219 | Diabetic Nephropathy | OFFSIDES | ||
| 1220 | Diabetic peripheral neuropathy | SIDER | ||
| 1221 | Diabetic | SIDER | ||
| 1222 | Diarrhea | 21849664 | CTD OFFSIDES | |
| 1223 | Diplegia | Canada Vigilance: 1 | Canada Vigilance | |
| 1224 | Disorders of Excessive Somnolence | 15794187 | CTD | |
| 1225 | Disturbance in sexual arousal | SIDER | ||
| 1226 | Diverticulum | OFFSIDES | ||
| 1227 | Drug addict | OFFSIDES | ||
| 1228 | Dyskinesia, Drug-Induced | 15561468 15593312 | CTD | |
| 1229 | Ear and labyrinth disorders | SIDER | ||
| 1230 | Edema | 17923349 | CTD | |
| 1231 | Embolism | SIDER | ||
| 1232 | Enlargement abdomen | SIDER | ||
| 1233 | Eosinophilia | SIDER | ||
| 1234 | Epigastric discomfort | SIDER | ||
| 1235 | Epilepsies, Partial | 15642451 | CTD | |
| 1236 | Epilepsy, Complex Partial | 10880283 14733874 | CTD | |
| 1237 | Epilepsy, Rolandic | 17561952 | CTD | |
| 1238 | Epilepsy, Temporal Lobe | 12859294 16499746 | CTD | |
| 1239 | Escherichia urinary tract infection | OFFSIDES | ||
| 1240 | Esophageal Stenosis | OFFSIDES | ||
| 1241 | Extremity contracture | OFFSIDES | ||
| 1242 | Familial Tremor | SIDER | ||
| 1243 | Fatty Liver | OFFSIDES | ||
| 1244 | Febrile Neutropenia | OFFSIDES | ||
| 1245 | Gait Ataxia | 16496496 | CTD | |
| 1246 | Gambling | OFFSIDES | ||
| 1247 | Gastroenteritis | SIDER | ||
| 1248 | Genitourinary tract infection | OFFSIDES | ||
| 1249 | Gingival Hypertrophy | Canada Vigilance: 1 | Canada Vigilance | |
| 1250 | Hallucinations | 10452922 12068361 16496496 | CTD | |
| 1251 | Hearing aid user | OFFSIDES | ||
| 1252 | Hemianopsia | 16804780 | CTD | |
| 1253 | Hirsutism | Canada Vigilance: 1 | Canada Vigilance | |
| 1254 | Hyperalgesia | 18777607 | CTD | |
| 1255 | Hyperammonemia | 10636156 15794187 16010067 | CTD | |
| 1256 | Hyperkeratosis | OFFSIDES | ||
| 1257 | Hyperplasia | SIDER | ||
| 1258 | Hypertrichosis | SIDER | ||
| 1259 | Hypogeusia | SIDER | ||
| 1260 | Infestation | SIDER | ||
| 1261 | Influenza-like symptoms | SIDER | ||
| 1262 | Infusion site mobility decreased | OFFSIDES | ||
| 1263 | Insulin-requiring type 2 diabetes mellitus | OFFSIDES | ||
| 1264 | Intermittent Explosive Disorder | OFFSIDES | ||
| 1265 | Intraocular inflammation | OFFSIDES | ||
| 1266 | Intubation | OFFSIDES | ||
| 1267 | Joint Range of Motion Decreased | OFFSIDES | ||
| 1268 | Joint sprain | OFFSIDES | ||
| 1269 | Ketogenic Diet | SIDER | ||
| 1270 | Lacrimation abnormal NOS | SIDER | ||
| 1271 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 1272 | Leukorrhea | SIDER | ||
| 1273 | Ligament rupture | OFFSIDES | ||
| 1274 | Liver Failure, Acute | 10915174 17923349 | CTD | |
| 1275 | Lower respiratory tract inflammation | OFFSIDES | ||
| 1276 | Lung consolidation | OFFSIDES | ||
| 1277 | Lymphocytosis | SIDER | ||
| 1278 | Manic psychosis | SIDER | ||
| 1279 | Mastitis | SIDER | ||
| 1280 | Maternal exposure during breast feeding | Canada Vigilance: 1 | Canada Vigilance | |
| 1281 | Mechanical urticaria | OFFSIDES | ||
| 1282 | Memory Disorders | 17084066 20477932 | CTD | |
| 1283 | Mental Retardation | SIDER | ||
| 1284 | Mental disorders | 17363756 | CTD | |
| 1285 | Metatarsalgia | OFFSIDES | ||
| 1286 | Migraine Disorders | CTD | ||
| 1287 | Migraine aggravated | SIDER | ||
| 1288 | Mixed hepatocellular-cholestatic injury | OFFSIDES | ||
| 1289 | Mononeuritis | OFFSIDES | ||
| 1290 | Mood Disorders | 10880283 | CTD | |
| 1291 | Movement Disorders | 22107891 | CTD | |
| 1292 | Muscle Weakness | OFFSIDES | ||
| 1293 | Musculoskeletal discomfort | SIDER | ||
| 1294 | Nephrotic Syndrome | OFFSIDES | ||
| 1295 | Nerve Degeneration | 17636003 29753867 | CTD | |
| 1296 | Neurobehavioral Manifestations | 29753867 | CTD | |
| 1297 | Neuropathy | SIDER | ||
| 1298 | Noninfective gingivitis | Canada Vigilance: 1 | Canada Vigilance | |
| 1299 | Oppositional Defiant Disorder | OFFSIDES | ||
| 1300 | Optic Disc Edema | OFFSIDES | ||
| 1301 | Oral mucosal petechiae | OFFSIDES | ||
| 1302 | Orgasmic sensation decreased | SIDER | ||
| 1303 | Overweight | OFFSIDES | ||
| 1304 | Pancreatic Duct Stenosis | OFFSIDES | ||
| 1305 | Paranasal sinus hypersecretion | SIDER | ||
| 1306 | Paranoid reaction | SIDER | ||
| 1307 | Paraparesis | OFFSIDES | ||
| 1308 | Partner stress | OFFSIDES | ||
| 1309 | Pemphigus | SIDER | ||
| 1310 | Peripheral Nervous System Diseases | 17363756 | CTD | |
| 1311 | Phlebitis | SIDER | ||
| 1312 | Postmenopausal bleeding | OFFSIDES | ||
| 1313 | Potassium low | SIDER | ||
| 1314 | Presbyopia | SIDER | ||
| 1315 | Primary sequestrum | OFFSIDES | ||
| 1316 | Product coating issue | Canada Vigilance: 1 | Canada Vigilance | |
| 1317 | Propofol Infusion Syndrome | OFFSIDES | ||
| 1318 | Protein total increased | OFFSIDES | ||
| 1319 | Pseudotumor Cerebri | 14520163 | CTD | |
| 1320 | Psychomotor Agitation | 12068361 | CTD | |
| 1321 | Psychoses, Substance-Induced | 10452922 12068361 12448965 | CTD | |
| 1322 | Psychotic Disorders | 10880283 14658980 19854620 | CTD | |
| 1323 | Pulmonary artery thrombosis | OFFSIDES | ||
| 1324 | Pulmonary radiation injury | OFFSIDES | ||
| 1325 | Purpura | SIDER | ||
| 1326 | Radical hysterectomy | OFFSIDES | ||
| 1327 | Rectal Prolapse | OFFSIDES | ||
| 1328 | Redness | SIDER | ||
| 1329 | Respiratory tract irritation | Canada Vigilance: 1 | Canada Vigilance | |
| 1330 | Retinal Diseases | 16804780 | CTD | |
| 1331 | Rhinitis | OFFSIDES SIDER | ||
| 1332 | Rhonchi | OFFSIDES | ||
| 1333 | Rickets | SIDER | ||
| 1334 | Seizures |
10863142
11738929 12237075 14520163 14704477 15707510 15794187 16499746 16981869 17364644 18253065 19417176 20015615 22107891 22264704 24777117 | CTD | |
| 1335 | Self Mutilation | OFFSIDES | ||
| 1336 | Serum potassium decreased | SIDER | ||
| 1337 | Skin Induration | OFFSIDES | ||
| 1338 | Skin hypertrophy | OFFSIDES | ||
| 1339 | Sphincter of Oddi Dysfunction | OFFSIDES | ||
| 1340 | Sputum culture positive | OFFSIDES | ||
| 1341 | Subcutaneous Abscess | OFFSIDES | ||
| 1342 | Substance Withdrawal Syndrome | 22017514 | CTD | |
| 1343 | Suicide | SIDER | ||
| 1344 | Taste Disorders | SIDER | ||
| 1345 | Tendinitis | OFFSIDES | ||
| 1346 | Tenosynovitis | OFFSIDES | ||
| 1347 | Tension | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 1348 | Thrombocytosis | SIDER | ||
| 1349 | Tinea Versicolor | OFFSIDES | ||
| 1350 | Ulcerative stomatitis | SIDER | ||
| 1351 | Unverricht-Lundborg Syndrome | 24777117 | CTD | |
| 1352 | Upper motor neurone lesion | SIDER | ||
| 1353 | Upset stomach | SIDER | ||
| 1354 | Ureteral stent insertion | OFFSIDES | ||
| 1355 | Urine calcium decreased | OFFSIDES | ||
| 1356 | Urine output increased | SIDER | ||
| 1357 | Urolithiasis | 15707510 | CTD | |
| 1358 | Urticaria localised | SIDER | ||
| 1359 | Vaginal Discharge | SIDER | ||
| 1360 | Vascular purpura | SIDER | ||
| 1361 | Vasodilation | SIDER | ||
| 1362 | Vital functions abnormal | OFFSIDES | ||
| 1363 | Vulvovaginal pain | OFFSIDES | ||
| 1364 | Weight Gain | OFFSIDES | ||
| 1365 | Wound abscess | OFFSIDES | ||
| 1366 | Wound infection bacterial | OFFSIDES | ||
| 1367 | Xerophthalmia | SIDER | ||
| 1368 | Xerosis | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.