Diclofenac
(DCOPUUMXTXDBNB-UHFFFAOYSA-N)
Structure
- SMILES
- OC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl
- Type(s)
- Approved; Vet_approved
- ATC code(s)
- D11AX18; M01AB05; M01AB55; M02AA15; S01BC03; S01CC01
- Molecular Formula:
- C14H11Cl2NO2
- Molecular Weight:
- 296.149
- Log P:
- 4.4371
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 2
- TPSA:
- 49.33
- CAS Number(s):
- 15307-86-5
Synonym(s)
1.
Diclofenac
2.
Diclophenac
3.
Dichlofenal
4.
Diclofenac Potassium
5.
Diclofenac Sodium
6.
Diclonate P
7.
Dicrofenac
8.
Feloran
9.
GP-45,840
10.
Novapirina
11.
Orthofen
12.
Orthophen
13.
Ortofen
14.
SR-38
15.
Sodium Diclofenac
16.
Voltaren
17.
Voltarol
18.
Diclofenac, Sodium
19.
GP 45,840
20.
GP45,840
21.
SR 38
22.
SR38
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug administered at inappropriate site | FAERS: 1543 | OFFSIDES US FAERS | |
| 2 | Product use issue | FAERS: 935 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 3 | Inappropriate schedule of drug administration | FAERS: 850 | US FAERS | |
| 4 | Wrong technique in product usage process | FAERS: 601 | US FAERS | |
| 5 | Therapeutic response unexpected | FAERS: 600 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Drug ineffective | FAERS: 503 Canada Vigilance: 44 | Canada Vigilance SIDER US FAERS | |
| 7 | Incorrect dose administered | FAERS: 383 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Drug ineffective for unapproved indication | FAERS: 342 | US FAERS | |
| 9 | Product use in unapproved indication | FAERS: 336 | US FAERS | |
| 10 | Expired product administered | FAERS: 271 | US FAERS | |
| 11 | Pruritus | FAERS: 261 Canada Vigilance: 10 | 2033230 9365130 | CTD SIDER Canada Vigilance US FAERS |
| 12 | Pain | FAERS: 246 Canada Vigilance: 4 |
1443979
1778088 2022160 2785813 7735198 7908807 8317681 11051389 12017395 13679232 16187469 16508151 18605234 19617648 19918026 20820150 20863828 22168216 28193520 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 13 | Product administered at inappropriate site | FAERS: 242 | US FAERS | |
| 14 | Product quality issue | FAERS: 209 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Erythema | FAERS: 205 Canada Vigilance: 5 | 1443979 2602249 | CTD SIDER Canada Vigilance US FAERS |
| 16 | Prescription drug used without a prescription | FAERS: 185 | US FAERS | |
| 17 | Dizziness | FAERS: 178 Canada Vigilance: 11 | 1439622 | CTD SIDER Canada Vigilance US FAERS |
| 18 | Nausea | FAERS: 162 Canada Vigilance: 8 | CTD SIDER Canada Vigilance US FAERS | |
| 19 | Hypersensitivity | FAERS: 158 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 20 | Malaise | FAERS: 149 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 21 | Urticaria | FAERS: 146 Canada Vigilance: 3 | 11792017 | CTD SIDER Canada Vigilance US FAERS |
| 22 | Drug effective for unapproved indication | FAERS: 142 | US FAERS | |
| 23 | Drug dispensed to wrong patient | FAERS: 139 | US FAERS | |
| 24 | Angioedema | FAERS: 135 Canada Vigilance: 2 | 15321629 18946239 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 25 | Arthralgia | FAERS: 131 | SIDER US FAERS | |
| 26 | Application site rash | FAERS: 130 | SIDER US FAERS | |
| 27 | Application site pain | FAERS: 123 | US FAERS | |
| 28 | Accidental exposure to product | FAERS: 118 | US FAERS | |
| 29 | Wrong technique in drug usage process | FAERS: 117 | OFFSIDES US FAERS | |
| 30 | Anaphylactic shock | FAERS: 115 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 31 | Vomiting | FAERS: 115 Canada Vigilance: 7 | CTD SIDER Canada Vigilance US FAERS | |
| 32 | Shock | FAERS: 111 | 6833624 | CTD SIDER US FAERS |
| 33 | Abdominal Pain | FAERS: 110 Canada Vigilance: 16 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 34 | Headache | FAERS: 109 Canada Vigilance: 3 | 1439622 16504799 19922878 | CTD SIDER Canada Vigilance US FAERS |
| 35 | Gastric ulcer | FAERS: 99 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 36 | Drug administration error | FAERS: 88 | US FAERS | |
| 37 | Intentional product misuse | FAERS: 88 | US FAERS | |
| 38 | Hypotension | FAERS: 85 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 39 | Arthritis | FAERS: 83 Canada Vigilance: 1 | 24152722 | CTD SIDER Canada Vigilance US FAERS |
| 40 | Burning sensation | FAERS: 83 | SIDER US FAERS | |
| 41 | Application site erythema | FAERS: 82 | SIDER US FAERS | |
| 42 | Circumstance or information capable of leading to medication error | FAERS: 82 | US FAERS | |
| 43 | Overdose | FAERS: 81 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Asthenia | FAERS: 80 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 45 | Drug prescribing error | FAERS: 77 | US FAERS | |
| 46 | Injection site necrosis | FAERS: 74 | SIDER US FAERS | |
| 47 | Application site pruritus | FAERS: 71 | SIDER US FAERS | |
| 48 | Back Pain | FAERS: 71 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 49 | Chest Pain | FAERS: 71 Canada Vigilance: 1 | 15834531 | CTD SIDER Canada Vigilance US FAERS |
| 50 | Abdominal discomfort | FAERS: 68 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 51 | Fatigue | FAERS: 68 Canada Vigilance: 2 | 20361083 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 52 | Feeling abnormal | FAERS: 67 | SIDER US FAERS | |
| 53 | Peripheral swelling | FAERS: 67 | US FAERS | |
| 54 | Swelling | FAERS: 66 | SIDER US FAERS | |
| 55 | Acute kidney injury | FAERS: 64 | CTD US FAERS | |
| 56 | Intentional product use issue | FAERS: 64 | US FAERS | |
| 57 | Sepsis | FAERS: 59 | SIDER US FAERS | |
| 58 | Syncope | FAERS: 58 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 59 | Injection site pain | FAERS: 57 | SIDER US FAERS | |
| 60 | Dry skin | FAERS: 53 | SIDER US FAERS | |
| 61 | Drug exposure during pregnancy | FAERS: 51 | US FAERS | |
| 62 | Joint swelling | FAERS: 51 | US FAERS | |
| 63 | Blood creatinine increased | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 64 | Inflammation | FAERS: 47 Canada Vigilance: 1 | CTD Canada Vigilance US FAERS | |
| 65 | Musculoskeletal Pain | FAERS: 47 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 66 | Application site exfoliation | FAERS: 46 | US FAERS | |
| 67 | Palpitations | FAERS: 46 | SIDER US FAERS | |
| 68 | Kounis Syndrome | FAERS: 45 | US FAERS | |
| 69 | Weight decreased | FAERS: 45 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 70 | Lip swelling | FAERS: 42 | SIDER US FAERS | |
| 71 | Tachycardia | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 72 | Inappropriate schedule of product administration | FAERS: 41 | US FAERS | |
| 73 | Incorrect route of drug administration | FAERS: 40 | US FAERS | |
| 74 | Myocardial Infarction | FAERS: 40 Canada Vigilance: 1 | CTD SIDER Canada Vigilance US FAERS | |
| 75 | Rhabdomyolysis | FAERS: 40 | 8701974 12219272 15856148 | CTD OFFSIDES US FAERS |
| 76 | Soft Tissue Infection | FAERS: 40 | US FAERS | |
| 77 | Contraindicated product administered | FAERS: 39 | US FAERS | |
| 78 | Asthma | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 79 | Dyspepsia | FAERS: 38 Canada Vigilance: 4 | 1439622 | CTD SIDER Canada Vigilance US FAERS |
| 80 | Large intestinal stenosis | FAERS: 38 | US FAERS | |
| 81 | Skin necrosis | FAERS: 38 | US FAERS | |
| 82 | Toxic Epidermal Necrolysis | FAERS: 38 | SIDER US FAERS | |
| 83 | Cardiac Arrest | FAERS: 37 | US FAERS | |
| 84 | Metabolic acidosis | FAERS: 37 | OFFSIDES US FAERS | |
| 85 | Peritonitis | FAERS: 37 | US FAERS | |
| 86 | Application site vesicles | FAERS: 36 | SIDER US FAERS | |
| 87 | Constipation | FAERS: 36 | 1439622 19922878 | CTD SIDER US FAERS |
| 88 | Chills | FAERS: 35 | SIDER US FAERS | |
| 89 | Rash erythematous | FAERS: 35 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 90 | Duodenal Ulcer | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 91 | Aspartate Aminotransferase Increased | FAERS: 33 | SIDER US FAERS | |
| 92 | Dysgeusia | FAERS: 33 | SIDER US FAERS | |
| 93 | Tremor | FAERS: 33 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 94 | Chest discomfort | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Depressed Level of Consciousness | FAERS: 32 | OFFSIDES US FAERS | |
| 96 | Dysphonia | FAERS: 32 | US FAERS | |
| 97 | Medication Error | FAERS: 32 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 98 | Somnolence | FAERS: 32 | SIDER US FAERS | |
| 99 | Alanine Aminotransferase Increased | FAERS: 31 | OFFSIDES SIDER US FAERS | |
| 100 | Drug dose omission | FAERS: 30 | US FAERS | |
| 101 | Intercepted medication error | FAERS: 30 | US FAERS | |
| 102 | Nephrotic Syndrome | FAERS: 30 | CTD OFFSIDES SIDER US FAERS | |
| 103 | Pallor | FAERS: 30 | OFFSIDES US FAERS | |
| 104 | Pneumonia | FAERS: 30 | SIDER US FAERS | |
| 105 | Product complaint | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 106 | Respiratory distress | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 107 | Drug effect incomplete | FAERS: 29 | US FAERS | |
| 108 | Injection site erythema | FAERS: 29 | OFFSIDES US FAERS | |
| 109 | Tinnitus | FAERS: 29 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 110 | Ulcer | FAERS: 29 Canada Vigilance: 1 | 1444695 20668000 | CTD SIDER Canada Vigilance US FAERS |
| 111 | jaundice | FAERS: 29 Canada Vigilance: 2 | CTD SIDER Canada Vigilance US FAERS | |
| 112 | Injection site abscess | FAERS: 28 | SIDER US FAERS | |
| 113 | Blood urea increased | FAERS: 27 | OFFSIDES US FAERS | |
| 114 | Drug Dependence | FAERS: 27 | US FAERS | |
| 115 | Skin reaction | FAERS: 27 | US FAERS | |
| 116 | Stevens-Johnson Syndrome | FAERS: 27 | 25811541 | CTD OFFSIDES SIDER US FAERS |
| 117 | Blood creatine phosphokinase increased | FAERS: 26 | OFFSIDES SIDER US FAERS | |
| 118 | Gastritis | FAERS: 26 Canada Vigilance: 2 | 1439622 16080005 | CTD SIDER Canada Vigilance US FAERS |
| 119 | Myalgia | FAERS: 26 | SIDER US FAERS | |
| 120 | Anxiety | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 121 | Application site reaction | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 122 | Atrial Fibrillation | FAERS: 25 | US FAERS | |
| 123 | Cellulitis | FAERS: 25 | OFFSIDES US FAERS | |
| 124 | Colitis | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 125 | Disseminated Intravascular Coagulation | FAERS: 25 | OFFSIDES US FAERS | |
| 126 | Infection | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 127 | Injection site scar | FAERS: 25 | US FAERS | |
| 128 | Maternal exposure during pregnancy | FAERS: 25 | US FAERS | |
| 129 | Application site burn | FAERS: 24 | US FAERS | |
| 130 | Application site swelling | FAERS: 24 | US FAERS | |
| 131 | Eczema | FAERS: 24 | SIDER US FAERS | |
| 132 | Skin irritation | FAERS: 24 | SIDER US FAERS | |
| 133 | Anuria | FAERS: 23 Canada Vigilance: 1 | 9207477 15752411 18274699 | CTD Canada Vigilance US FAERS |
| 134 | Blood lactate dehydrogenase increased | FAERS: 23 | OFFSIDES US FAERS | |
| 135 | Renal tubular necrosis | FAERS: 23 | US FAERS | |
| 136 | Wheezing | FAERS: 23 | SIDER US FAERS | |
| 137 | Cerebrovascular accident | FAERS: 22 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 138 | Drug abuse | FAERS: 22 | US FAERS | |
| 139 | Gamma-Glutamyltransferase Increased | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 140 | Neck Pain | FAERS: 22 | SIDER US FAERS | |
| 141 | Oculomucocutaneous syndrome | FAERS: 22 | US FAERS | |
| 142 | Presyncope | FAERS: 22 | US FAERS | |
| 143 | Arthropathy | FAERS: 21 | OFFSIDES SIDER US FAERS | |
| 144 | Septic Shock | FAERS: 21 | US FAERS | |
| 145 | Suicide attempt | FAERS: 21 | US FAERS | |
| 146 | Urinary Retention | FAERS: 21 | US FAERS | |
| 147 | Chromaturia | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 148 | Dehydration | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 149 | Injection Site Reaction | FAERS: 20 | SIDER US FAERS | |
| 150 | Memory impairment | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 151 | Proteinuria | FAERS: 20 | 1630997 3115369 | CTD SIDER US FAERS |
| 152 | Restlessness | FAERS: 20 | US FAERS | |
| 153 | Therapy cessation | FAERS: 20 | US FAERS | |
| 154 | Transaminases increased | FAERS: 20 | SIDER US FAERS | |
| 155 | Accidental exposure to product by child | FAERS: 19 | US FAERS | |
| 156 | Acute myocardial infarction | FAERS: 19 | OFFSIDES US FAERS | |
| 157 | Dermatitis | FAERS: 19 | SIDER US FAERS | |
| 158 | Diplopia | FAERS: 19 | SIDER US FAERS | |
| 159 | Joint injury | FAERS: 19 | US FAERS | |
| 160 | Respiratory Failure | FAERS: 19 | US FAERS | |
| 161 | Thrombosis | FAERS: 19 Canada Vigilance: 1 | CTD Canada Vigilance US FAERS | |
| 162 | Abasia | FAERS: 18 | US FAERS | |
| 163 | Accidental exposure | FAERS: 18 | US FAERS | |
| 164 | Altered state of consciousness | FAERS: 18 | US FAERS | |
| 165 | Anorexia | FAERS: 18 | CTD OFFSIDES SIDER US FAERS | |
| 166 | Bone pain | FAERS: 18 | OFFSIDES SIDER US FAERS | |
| 167 | Discomfort | FAERS: 18 | SIDER US FAERS | |
| 168 | Disorientation | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 169 | Musculoskeletal stiffness | FAERS: 18 | SIDER US FAERS | |
| 170 | Skin Ulcer | FAERS: 18 | SIDER US FAERS | |
| 171 | Diabetes Mellitus | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 172 | Disease recurrence | FAERS: 17 | US FAERS | |
| 173 | Hypokinesia | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 174 | Inability to afford medication | FAERS: 17 | US FAERS | |
| 175 | Nervousness | FAERS: 17 | SIDER US FAERS | |
| 176 | Urinary tract infection | FAERS: 17 | SIDER US FAERS | |
| 177 | Visual Impairment | FAERS: 17 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 178 | Amnesia | FAERS: 16 Canada Vigilance: 1 | 3586791 | CTD Canada Vigilance US FAERS |
| 179 | Blood alkaline phosphatase increased | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 180 | Bronchospasm | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 181 | Intestinal diaphragm disease | FAERS: 16 | SIDER US FAERS | |
| 182 | Oliguria | FAERS: 16 | CTD SIDER US FAERS | |
| 183 | Product container issue | FAERS: 16 | US FAERS | |
| 184 | Skin lesion | FAERS: 16 | OFFSIDES US FAERS | |
| 185 | Agitation | FAERS: 15 | SIDER US FAERS | |
| 186 | Angina Pectoris | FAERS: 15 | 9220183 | CTD SIDER US FAERS |
| 187 | Application site dryness | FAERS: 15 | SIDER US FAERS | |
| 188 | Ascites | FAERS: 15 | 9365130 | CTD US FAERS |
| 189 | Autoimmune hepatitis | FAERS: 15 | US FAERS | |
| 190 | Cataract | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 191 | Contraindicated drug prescribed | FAERS: 15 | US FAERS | |
| 192 | Cyanosis | FAERS: 15 | US FAERS | |
| 193 | Eosinophilic Pneumonia | FAERS: 15 | US FAERS | |
| 194 | Flushing | FAERS: 15 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 195 | General physical health deterioration | FAERS: 15 | OFFSIDES US FAERS | |
| 196 | Nerve injury | FAERS: 15 | US FAERS | |
| 197 | Respiratory arrest | FAERS: 15 | US FAERS | |
| 198 | Sciatica | FAERS: 15 | US FAERS | |
| 199 | Application site irritation | FAERS: 14 | SIDER US FAERS | |
| 200 | Blood glucose increased | FAERS: 14 | US FAERS | |
| 201 | Bradycardia | FAERS: 14 | 15834531 | CTD OFFSIDES SIDER US FAERS |
| 202 | Concomitant disease aggravated | FAERS: 14 | US FAERS | |
| 203 | Product physical consistency issue | FAERS: 14 | US FAERS | |
| 204 | Subcutaneous Abscess | FAERS: 14 | US FAERS | |
| 205 | Abscess | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 206 | Blindness | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 207 | Bronchitis | FAERS: 13 | SIDER US FAERS | |
| 208 | Deep Vein Thrombosis | FAERS: 13 | US FAERS | |
| 209 | Delirium | FAERS: 13 | 19262967 | CTD US FAERS |
| 210 | Epistaxis | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 211 | Erythema Multiforme | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 212 | Gangrene | FAERS: 13 | US FAERS | |
| 213 | Hepatitis | FAERS: 13 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 214 | Ileal ulcer | FAERS: 13 | US FAERS | |
| 215 | Injection site inflammation | FAERS: 13 | US FAERS | |
| 216 | Laceration | FAERS: 13 | OFFSIDES US FAERS | |
| 217 | Lymphadenopathy | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 218 | Nasopharyngitis | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 219 | Oral pain | FAERS: 13 | US FAERS | |
| 220 | Post procedural complication | FAERS: 13 | US FAERS | |
| 221 | Renal pain | FAERS: 13 | US FAERS | |
| 222 | Therapeutic response changed | FAERS: 13 | US FAERS | |
| 223 | Anal Ulcer | FAERS: 12 | US FAERS | |
| 224 | Apparent death | FAERS: 12 | US FAERS | |
| 225 | Cold sweat | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 226 | Dysuria | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 227 | Eye irritation | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 228 | Glaucoma | FAERS: 12 | US FAERS | |
| 229 | Incorrect drug administration duration | FAERS: 12 | US FAERS | |
| 230 | Injection site extravasation | FAERS: 12 | US FAERS | |
| 231 | Injection site ulcer | FAERS: 12 | US FAERS | |
| 232 | Necrosis | FAERS: 12 | 1443979 15327563 25663337 | CTD US FAERS |
| 233 | Neuralgia | FAERS: 12 Canada Vigilance: 1 | 19268806 | CTD OFFSIDES Canada Vigilance US FAERS |
| 234 | Oropharyngeal pain | FAERS: 12 | OFFSIDES US FAERS | |
| 235 | Pancytopenia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 236 | Abdominal tenderness | FAERS: 11 | OFFSIDES US FAERS | |
| 237 | Alopecia | FAERS: 11 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 238 | Application site warmth | FAERS: 11 | US FAERS | |
| 239 | Cholestasis | FAERS: 11 | CTD US FAERS | |
| 240 | Drug toxicity | FAERS: 11 | OFFSIDES US FAERS | |
| 241 | Ductus arteriosus premature closure | FAERS: 11 | US FAERS | |
| 242 | Erosive Duodenitis | FAERS: 11 | US FAERS | |
| 243 | Hypoxia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 244 | Monoplegia | FAERS: 11 | US FAERS | |
| 245 | Petechiae | FAERS: 11 | US FAERS | |
| 246 | Pulmonary Embolism | FAERS: 11 | US FAERS | |
| 247 | Pulmonary Hypertension | FAERS: 11 | US FAERS | |
| 248 | Scab | FAERS: 11 | SIDER US FAERS | |
| 249 | Sciatic Nerve Palsy | FAERS: 11 | US FAERS | |
| 250 | Throat irritation | FAERS: 11 | US FAERS | |
| 251 | Visual disturbance | FAERS: 11 | SIDER US FAERS | |
| 252 | Adverse event | FAERS: 10 | US FAERS | |
| 253 | Application site papules | FAERS: 10 | SIDER US FAERS | |
| 254 | Blood urine present | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 255 | Cerebral Infarction | FAERS: 10 | US FAERS | |
| 256 | Colonic Stenosis | FAERS: 10 | OFFSIDES US FAERS | |
| 257 | Deafness | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 258 | Debridement | FAERS: 10 | US FAERS | |
| 259 | Drug dispensing error | FAERS: 10 | US FAERS | |
| 260 | Fibrin D dimer increased | FAERS: 10 | US FAERS | |
| 261 | Gout | FAERS: 10 Canada Vigilance: 1 | 18559233 20190479 | CTD SIDER Canada Vigilance US FAERS |
| 262 | Large intestine perforation | FAERS: 10 | OFFSIDES US FAERS | |
| 263 | Lethargy | FAERS: 10 | SIDER US FAERS | |
| 264 | Limb discomfort | FAERS: 10 | US FAERS | |
| 265 | Musculoskeletal discomfort | FAERS: 10 | SIDER US FAERS | |
| 266 | Poor quality sleep | FAERS: 10 | US FAERS | |
| 267 | Pyelonephritis | FAERS: 10 | US FAERS | |
| 268 | Rheumatoid Arthritis | FAERS: 10 | SIDER US FAERS | |
| 269 | Secretion discharge | FAERS: 10 | US FAERS | |
| 270 | Vertigo | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 271 | White blood cell count decreased | FAERS: 10 | US FAERS | |
| 272 | Acidosis | FAERS: 9 | 11123398 | CTD US FAERS |
| 273 | Anaphylactoid Reaction | FAERS: 9 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 274 | Application site necrosis | FAERS: 9 | US FAERS | |
| 275 | Crying | FAERS: 9 | US FAERS | |
| 276 | Eschar | FAERS: 9 | US FAERS | |
| 277 | Fibromyalgia | FAERS: 9 | OFFSIDES US FAERS | |
| 278 | Gastrointestinal ulcer | FAERS: 9 | SIDER US FAERS | |
| 279 | Hemiparesis | FAERS: 9 | OFFSIDES US FAERS | |
| 280 | Ileus | FAERS: 9 | US FAERS | |
| 281 | Influenza | FAERS: 9 | SIDER US FAERS | |
| 282 | Injection site nerve damage | FAERS: 9 | US FAERS | |
| 283 | Insurance issue | FAERS: 9 | US FAERS | |
| 284 | Jejunal ulcer | FAERS: 9 | US FAERS | |
| 285 | Joint stiffness | FAERS: 9 | US FAERS | |
| 286 | Neutropenia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 287 | Oligohydramnios | FAERS: 9 | US FAERS | |
| 288 | Osteoporosis | FAERS: 9 | US FAERS | |
| 289 | Peptic Ulcer | FAERS: 9 | 16897817 | CTD SIDER US FAERS |
| 290 | Post procedural bile leak | FAERS: 9 | US FAERS | |
| 291 | Product substitution issue | FAERS: 9 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 292 | Renal tubular acidosis | FAERS: 9 | US FAERS | |
| 293 | Toxicity to various agents | FAERS: 9 | US FAERS | |
| 294 | Unevaluable event | FAERS: 9 | US FAERS | |
| 295 | Accidental overdose | FAERS: 8 | US FAERS | |
| 296 | Ankle Fracture | FAERS: 8 | US FAERS | |
| 297 | Blood glucose decreased | FAERS: 8 | US FAERS | |
| 298 | Blood potassium decreased | FAERS: 8 | US FAERS | |
| 299 | Cardiomegaly | FAERS: 8 | US FAERS | |
| 300 | Completed Suicide | FAERS: 8 | US FAERS | |
| 301 | Coronary Artery Disease | FAERS: 8 | US FAERS | |
| 302 | Device defective | FAERS: 8 | US FAERS | |
| 303 | Ecthyma | FAERS: 8 | US FAERS | |
| 304 | Emergency care examination | FAERS: 8 | US FAERS | |
| 305 | Flatulence | FAERS: 8 Canada Vigilance: 2 | 1439622 | CTD SIDER Canada Vigilance US FAERS |
| 306 | Gastrointestinal erosion | FAERS: 8 | OFFSIDES US FAERS | |
| 307 | Hyporeflexia | FAERS: 8 | US FAERS | |
| 308 | Injection site pruritus | FAERS: 8 | US FAERS | |
| 309 | Intestinal Perforation | FAERS: 8 | SIDER US FAERS | |
| 310 | Nodule | FAERS: 8 | US FAERS | |
| 311 | Purpura | FAERS: 8 | SIDER US FAERS | |
| 312 | Rotator cuff syndrome | FAERS: 8 | US FAERS | |
| 313 | Spinal column stenosis | FAERS: 8 | US FAERS | |
| 314 | Agranulocytosis | FAERS: 7 | SIDER US FAERS | |
| 315 | Anger | FAERS: 7 | US FAERS | |
| 316 | Aplasia Cutis Congenita | FAERS: 7 | US FAERS | |
| 317 | Bursitis | FAERS: 7 | OFFSIDES US FAERS | |
| 318 | Concomitant disease progression | FAERS: 7 | US FAERS | |
| 319 | Diverticulitis | FAERS: 7 | US FAERS | |
| 320 | Duodenitis | FAERS: 7 | OFFSIDES US FAERS | |
| 321 | Electrocardiogram abnormal | FAERS: 7 | US FAERS | |
| 322 | Electroencephalogram abnormal | FAERS: 7 | US FAERS | |
| 323 | Enterocolitis | FAERS: 7 | OFFSIDES US FAERS | |
| 324 | Eosinophilia | FAERS: 7 | 16943303 | CTD SIDER US FAERS |
| 325 | Epigastric discomfort | FAERS: 7 | US FAERS | |
| 326 | Eye pain | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 327 | Feeling Cold | FAERS: 7 | US FAERS | |
| 328 | Fibrosis | FAERS: 7 | US FAERS | |
| 329 | Fixed eruption | FAERS: 7 | US FAERS | |
| 330 | Gastrointestinal mucosal disorder | FAERS: 7 | US FAERS | |
| 331 | Hypoventilation | FAERS: 7 | US FAERS | |
| 332 | Intentional drug misuse | FAERS: 7 | US FAERS | |
| 333 | Leukocytosis | FAERS: 7 | US FAERS | |
| 334 | Leukopenia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 335 | Limb injury | FAERS: 7 | OFFSIDES US FAERS | |
| 336 | Mixed liver injury | FAERS: 7 | US FAERS | |
| 337 | Muscle tightness | FAERS: 7 | US FAERS | |
| 338 | Occult blood positive | FAERS: 7 | US FAERS | |
| 339 | Pain of skin | FAERS: 7 | US FAERS | |
| 340 | Product storage error | FAERS: 7 | US FAERS | |
| 341 | Pulmonary congestion | FAERS: 7 | US FAERS | |
| 342 | Small Intestinal Stenosis | FAERS: 7 | US FAERS | |
| 343 | Stillbirth | FAERS: 7 | US FAERS | |
| 344 | Thermal burn | FAERS: 7 | US FAERS | |
| 345 | Application site urticaria | FAERS: 6 | US FAERS | |
| 346 | Blood potassium increased | FAERS: 6 | US FAERS | |
| 347 | Blood sodium decreased | FAERS: 6 | US FAERS | |
| 348 | Cystitis | FAERS: 6 | SIDER US FAERS | |
| 349 | Drug screen positive | FAERS: 6 | US FAERS | |
| 350 | Extra dose administered | FAERS: 6 | US FAERS | |
| 351 | Fat necrosis | FAERS: 6 | US FAERS | |
| 352 | Gastric Bypass | FAERS: 6 | OFFSIDES US FAERS | |
| 353 | Gastrointestinal inflammation | FAERS: 6 | US FAERS | |
| 354 | Infertility | FAERS: 6 | US FAERS | |
| 355 | Injection site infection | FAERS: 6 | US FAERS | |
| 356 | Intercepted drug administration error | FAERS: 6 | US FAERS | |
| 357 | Laparotomy | FAERS: 6 | US FAERS | |
| 358 | MYELODYSPLASTIC SYNDROME | FAERS: 6 | US FAERS | |
| 359 | Macular degeneration | FAERS: 6 | US FAERS | |
| 360 | Neuropathy | FAERS: 6 | US FAERS | |
| 361 | Nonspecific reaction | FAERS: 6 | US FAERS | |
| 362 | Oral pruritus | FAERS: 6 | US FAERS | |
| 363 | Paresis | FAERS: 6 | US FAERS | |
| 364 | Patent ductus arteriosus | FAERS: 6 | US FAERS | |
| 365 | Pericardial effusion | FAERS: 6 | US FAERS | |
| 366 | Personality Change | FAERS: 6 | US FAERS | |
| 367 | Poisoning | FAERS: 6 | 28728110 | CTD US FAERS |
| 368 | Polyuria | FAERS: 6 | SIDER US FAERS | |
| 369 | Product package associated injury | FAERS: 6 | US FAERS | |
| 370 | Protein urine present | FAERS: 6 | SIDER US FAERS | |
| 371 | Retinal Degeneration | FAERS: 6 | US FAERS | |
| 372 | Sinusitis | FAERS: 6 | SIDER US FAERS | |
| 373 | Skeletal injury | FAERS: 6 | US FAERS | |
| 374 | Therapeutic product effect incomplete | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 375 | Urinary Incontinence | FAERS: 6 | US FAERS | |
| 376 | furuncle | FAERS: 6 | SIDER US FAERS | |
| 377 | Abdominal symptom | FAERS: 5 | US FAERS | |
| 378 | Acne | FAERS: 5 | SIDER US FAERS | |
| 379 | Actinic keratosis | FAERS: 5 | US FAERS | |
| 380 | Activities of daily living impaired | FAERS: 5 | US FAERS | |
| 381 | Ankylosing spondylitis | FAERS: 5 | US FAERS | |
| 382 | Application site discharge | FAERS: 5 | US FAERS | |
| 383 | Application site inflammation | FAERS: 5 | US FAERS | |
| 384 | Application site scab | FAERS: 5 | US FAERS | |
| 385 | Back disorder | FAERS: 5 | US FAERS | |
| 386 | Blood cholesterol increased | FAERS: 5 | US FAERS | |
| 387 | Blood iron abnormal | FAERS: 5 | US FAERS | |
| 388 | Blood pressure immeasurable | FAERS: 5 | US FAERS | |
| 389 | Blood triglycerides increased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 390 | Colectomy | FAERS: 5 | US FAERS | |
| 391 | Dementia | FAERS: 5 | US FAERS | |
| 392 | Duodenal ulcer perforation | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 393 | Dysarthria | FAERS: 5 Canada Vigilance: 1 | 19262967 | CTD Canada Vigilance US FAERS |
| 394 | Emotional distress | FAERS: 5 | OFFSIDES US FAERS | |
| 395 | Gastrointestinal Pain | FAERS: 5 | SIDER US FAERS | |
| 396 | Hernia | FAERS: 5 | SIDER US FAERS | |
| 397 | Hypersomnia | FAERS: 5 | US FAERS | |
| 398 | Hypophagia | FAERS: 5 | US FAERS | |
| 399 | Ileal Stenosis | FAERS: 5 | US FAERS | |
| 400 | Injection site phlebitis | FAERS: 5 | US FAERS | |
| 401 | Intervertebral Disc Degeneration | FAERS: 5 | US FAERS | |
| 402 | Ligament rupture | FAERS: 5 | US FAERS | |
| 403 | Muscle necrosis | FAERS: 5 | OFFSIDES US FAERS | |
| 404 | Nephrolithiasis | FAERS: 5 | US FAERS | |
| 405 | Neutrophil count decreased | FAERS: 5 | US FAERS | |
| 406 | No adverse event | FAERS: 5 | US FAERS | |
| 407 | Orthostatic intolerance | FAERS: 5 | US FAERS | |
| 408 | Osteomyelitis | FAERS: 5 | 15069333 | CTD US FAERS |
| 409 | Pancreatitis | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 410 | Perforated ulcer | FAERS: 5 | US FAERS | |
| 411 | Periorbital swelling | FAERS: 5 | US FAERS | |
| 412 | Product label confusion | FAERS: 5 | US FAERS | |
| 413 | Psychomotor skills impaired | FAERS: 5 | US FAERS | |
| 414 | Purulent discharge | FAERS: 5 | OFFSIDES US FAERS | |
| 415 | Regurgitation | FAERS: 5 | US FAERS | |
| 416 | Skin Wrinkling | FAERS: 5 | US FAERS | |
| 417 | Skin discomfort | FAERS: 5 | US FAERS | |
| 418 | Sneezing | FAERS: 5 | US FAERS | |
| 419 | Soft tissue necrosis | FAERS: 5 | US FAERS | |
| 420 | Suture rupture | FAERS: 5 | US FAERS | |
| 421 | Thrombocytopenia | FAERS: 5 Canada Vigilance: 1 | 3952461 11051389 14750454 | CTD SIDER Canada Vigilance US FAERS |
| 422 | Wound Debridement | FAERS: 5 | US FAERS | |
| 423 | Acute Coronary Syndrome | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 424 | Acute psychosis | FAERS: 4 | US FAERS | |
| 425 | Acute respiratory failure | FAERS: 4 | US FAERS | |
| 426 | Anorectal discomfort | FAERS: 4 | US FAERS | |
| 427 | Antibody test positive | FAERS: 4 | US FAERS | |
| 428 | Appendicitis | FAERS: 4 | US FAERS | |
| 429 | Application site scar | FAERS: 4 | US FAERS | |
| 430 | Asthenopia | FAERS: 4 | US FAERS | |
| 431 | Blood blister | FAERS: 4 | US FAERS | |
| 432 | Depressed mood | FAERS: 4 | US FAERS | |
| 433 | Device malfunction | FAERS: 4 | US FAERS | |
| 434 | Drug administered to patient of inappropriate age | FAERS: 4 | US FAERS | |
| 435 | Duodenal perforation | FAERS: 4 | US FAERS | |
| 436 | Embolism | FAERS: 4 | US FAERS | |
| 437 | Epilepsy | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 438 | Expired drug administered | FAERS: 4 | US FAERS | |
| 439 | Foreign body sensation in eyes | FAERS: 4 | US FAERS | |
| 440 | Gait inability | FAERS: 4 | US FAERS | |
| 441 | Gastrectomy | FAERS: 4 | US FAERS | |
| 442 | Gastric mucosal lesion | FAERS: 4 | US FAERS | |
| 443 | Hepatotoxicity | FAERS: 4 | US FAERS | |
| 444 | Hip surgery | FAERS: 4 | OFFSIDES US FAERS | |
| 445 | Hyperplasia | FAERS: 4 | US FAERS | |
| 446 | Hyperthyroidism | FAERS: 4 | US FAERS | |
| 447 | Hypochondriasis | FAERS: 4 | US FAERS | |
| 448 | Incorrect product storage | FAERS: 4 | US FAERS | |
| 449 | Infarction | FAERS: 4 | US FAERS | |
| 450 | Injection site mass | FAERS: 4 | US FAERS | |
| 451 | Jejunectomy | FAERS: 4 | US FAERS | |
| 452 | Leukoencephalopathy | FAERS: 4 | OFFSIDES US FAERS | |
| 453 | Lip pruritus | FAERS: 4 | US FAERS | |
| 454 | Lymphopenia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 455 | Malabsorption from application site | FAERS: 4 | US FAERS | |
| 456 | Meniscus injury | FAERS: 4 | US FAERS | |
| 457 | Menopause | FAERS: 4 | US FAERS | |
| 458 | Mucosal erosion | FAERS: 4 | OFFSIDES US FAERS | |
| 459 | Musculoskeletal chest pain | FAERS: 4 | US FAERS | |
| 460 | Myocarditis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 461 | Myoglobin blood increased | FAERS: 4 | US FAERS | |
| 462 | Oropharyngeal discomfort | FAERS: 4 | OFFSIDES US FAERS | |
| 463 | Palmar erythema | FAERS: 4 | US FAERS | |
| 464 | Pneumothorax | FAERS: 4 | US FAERS | |
| 465 | Posterior reversible encephalopathy syndrome | FAERS: 4 | US FAERS | |
| 466 | Procedural complication | FAERS: 4 | US FAERS | |
| 467 | Product label issue | FAERS: 4 | US FAERS | |
| 468 | Product prescribing issue | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 469 | Protein-losing gastroenteropathy | FAERS: 4 | US FAERS | |
| 470 | Pseudoporphyria | FAERS: 4 | US FAERS | |
| 471 | Psoriasis | FAERS: 4 | US FAERS | |
| 472 | Rebound effect | FAERS: 4 | US FAERS | |
| 473 | Renal abscess | FAERS: 4 | US FAERS | |
| 474 | Renal failure neonatal | FAERS: 4 | US FAERS | |
| 475 | Retinal toxicity | FAERS: 4 | US FAERS | |
| 476 | Rhinitis | FAERS: 4 | SIDER US FAERS | |
| 477 | Screaming | FAERS: 4 | US FAERS | |
| 478 | Splenic abscess | FAERS: 4 | US FAERS | |
| 479 | Synovial Cyst | FAERS: 4 | US FAERS | |
| 480 | Tryptase increased | FAERS: 4 | US FAERS | |
| 481 | Urine alcohol test positive | FAERS: 4 | US FAERS | |
| 482 | Vulvovaginal discomfort | FAERS: 4 | US FAERS | |
| 483 | Wheelchair user | FAERS: 4 | US FAERS | |
| 484 | muscle injury | FAERS: 4 | US FAERS | |
| 485 | Accidental drug intake by child | FAERS: 3 | US FAERS | |
| 486 | Administration site necrosis | FAERS: 3 | US FAERS | |
| 487 | Ageusia | FAERS: 3 | US FAERS | |
| 488 | Anastomotic Leak | FAERS: 3 | US FAERS | |
| 489 | Aphasia | FAERS: 3 | SIDER US FAERS | |
| 490 | Aphthous Stomatitis | FAERS: 3 | SIDER US FAERS | |
| 491 | Application site fissure | FAERS: 3 | US FAERS | |
| 492 | Application site induration | FAERS: 3 | SIDER US FAERS | |
| 493 | Application site infection | FAERS: 3 | US FAERS | |
| 494 | Application site perspiration | FAERS: 3 | US FAERS | |
| 495 | Application site ulcer | FAERS: 3 | US FAERS | |
| 496 | Artificial anus | FAERS: 3 | US FAERS | |
| 497 | Bipolar I disorder | FAERS: 3 | US FAERS | |
| 498 | Blood albumin decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 499 | Blood fibrinogen increased | FAERS: 3 | US FAERS | |
| 500 | Blood immunoglobulin E increased | FAERS: 3 | US FAERS | |
| 501 | Blood ketone body increased | FAERS: 3 | US FAERS | |
| 502 | Blood pH decreased | FAERS: 3 | US FAERS | |
| 503 | Blood sodium increased | FAERS: 3 | US FAERS | |
| 504 | Blood thrombin | FAERS: 3 | US FAERS | |
| 505 | Carpal Tunnel Syndrome | FAERS: 3 | US FAERS | |
| 506 | Choking | FAERS: 3 | US FAERS | |
| 507 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 508 | Conjunctivitis | FAERS: 3 | SIDER US FAERS | |
| 509 | Creatinine renal clearance decreased | FAERS: 3 | US FAERS | |
| 510 | Cyst | FAERS: 3 | US FAERS | |
| 511 | Dengue Fever | FAERS: 3 | US FAERS | |
| 512 | Diverticular perforation | FAERS: 3 | US FAERS | |
| 513 | Ecchymosis | FAERS: 3 | SIDER US FAERS | |
| 514 | Emergency Care | FAERS: 3 | US FAERS | |
| 515 | Enlarged uvula | FAERS: 3 | US FAERS | |
| 516 | Enteritis | FAERS: 3 | US FAERS | |
| 517 | Eosinophilic pustular folliculitis | FAERS: 3 | US FAERS | |
| 518 | Erectile dysfunction | FAERS: 3 | SIDER US FAERS | |
| 519 | Eructation | FAERS: 3 | SIDER US FAERS | |
| 520 | Erysipelas | FAERS: 3 | US FAERS | |
| 521 | Feeling jittery | FAERS: 3 | US FAERS | |
| 522 | Flank Pain | FAERS: 3 | US FAERS | |
| 523 | Fluid replacement | FAERS: 3 | US FAERS | |
| 524 | Gastric Dilatation | FAERS: 3 | US FAERS | |
| 525 | Gastroenteritis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 526 | Gastrointestinal infection | FAERS: 3 | US FAERS | |
| 527 | Gastrointestinal mucosal necrosis | FAERS: 3 | US FAERS | |
| 528 | Gastrointestinal perforation | FAERS: 3 | OFFSIDES US FAERS | |
| 529 | Gastrointestinal sounds abnormal | FAERS: 3 | US FAERS | |
| 530 | Head discomfort | FAERS: 3 | US FAERS | |
| 531 | Hemiplegia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 532 | Hepatitis C | FAERS: 3 | US FAERS | |
| 533 | Hepatomegaly | FAERS: 3 | CTD US FAERS | |
| 534 | Hyperreflexia | FAERS: 3 | US FAERS | |
| 535 | Hypertensive crisis | FAERS: 3 | US FAERS | |
| 536 | Hyperventilation | FAERS: 3 | SIDER US FAERS | |
| 537 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 538 | Incontinence | FAERS: 3 | US FAERS | |
| 539 | Incorrect product administration duration | FAERS: 3 | US FAERS | |
| 540 | Incorrect route of product administration | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 541 | Infectious peritonitis | FAERS: 3 | US FAERS | |
| 542 | Injection site calcification | FAERS: 3 | US FAERS | |
| 543 | Internal limiting membrane peeling | FAERS: 3 | US FAERS | |
| 544 | Iron deficiency | FAERS: 3 | US FAERS | |
| 545 | Irritable Bowel Syndrome | FAERS: 3 | US FAERS | |
| 546 | Lactose Intolerance | FAERS: 3 | US FAERS | |
| 547 | Laryngospasm | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 548 | Leukocytoclastic vasculitis | FAERS: 3 | US FAERS | |
| 549 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 550 | Lymphocyte count decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 551 | Lymphocyte stimulation test positive | FAERS: 3 | OFFSIDES US FAERS | |
| 552 | Macular fibrosis | FAERS: 3 | US FAERS | |
| 553 | Malnutrition | FAERS: 3 | SIDER US FAERS | |
| 554 | Melanosis coli | FAERS: 3 | US FAERS | |
| 555 | Meningitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 556 | Menorrhagia | FAERS: 3 | US FAERS | |
| 557 | Mental impairment | FAERS: 3 | US FAERS | |
| 558 | Middle insomnia | FAERS: 3 | US FAERS | |
| 559 | Monocyte count decreased | FAERS: 3 | US FAERS | |
| 560 | Mood swings | FAERS: 3 | US FAERS | |
| 561 | Mydriasis | FAERS: 3 | US FAERS | |
| 562 | Myositis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 563 | Neonatal respiratory failure | FAERS: 3 | US FAERS | |
| 564 | Nephritis | FAERS: 3 | 2505191 | CTD US FAERS |
| 565 | Open wound | FAERS: 3 | US FAERS | |
| 566 | Osteitis Deformans | FAERS: 3 | US FAERS | |
| 567 | Peripheral nerve lesion | FAERS: 3 | US FAERS | |
| 568 | Photophobia | FAERS: 3 | US FAERS | |
| 569 | Placental Insufficiency | FAERS: 3 | US FAERS | |
| 570 | Pleocytosis | FAERS: 3 | US FAERS | |
| 571 | Polyneuropathy | FAERS: 3 | US FAERS | |
| 572 | Prescribed underdose | FAERS: 3 | US FAERS | |
| 573 | Product formulation issue | FAERS: 3 | US FAERS | |
| 574 | Product residue present | FAERS: 3 | US FAERS | |
| 575 | Protein total abnormal | FAERS: 3 | US FAERS | |
| 576 | Prothrombin time ratio increased | FAERS: 3 | US FAERS | |
| 577 | Psychiatric symptom | FAERS: 3 | US FAERS | |
| 578 | Pulmonary Fibrosis | FAERS: 3 | US FAERS | |
| 579 | Pulmonary thrombosis | FAERS: 3 | US FAERS | |
| 580 | Rales | FAERS: 3 | OFFSIDES US FAERS | |
| 581 | Rectal discharge | FAERS: 3 | US FAERS | |
| 582 | Respiratory Depression | FAERS: 3 | SIDER US FAERS | |
| 583 | Retinal Artery Occlusion | FAERS: 3 | US FAERS | |
| 584 | Rheumatic disorder | FAERS: 3 | US FAERS | |
| 585 | Right Ventricular Hypertrophy | FAERS: 3 | US FAERS | |
| 586 | Rosacea | FAERS: 3 | US FAERS | |
| 587 | Sjogren's Syndrome | FAERS: 3 | US FAERS | |
| 588 | Skin Erosion | FAERS: 3 | US FAERS | |
| 589 | Spondylitis | FAERS: 3 | OFFSIDES US FAERS | |
| 590 | Staphylococcal abscess | FAERS: 3 | US FAERS | |
| 591 | Status Epilepticus | FAERS: 3 | US FAERS | |
| 592 | Stomatitis | FAERS: 3 | SIDER US FAERS | |
| 593 | Suprapubic pain | FAERS: 3 | US FAERS | |
| 594 | Systemic Inflammatory Response Syndrome | FAERS: 3 | US FAERS | |
| 595 | Typhoid Fever | FAERS: 3 | US FAERS | |
| 596 | Urine ketone body present | FAERS: 3 | US FAERS | |
| 597 | Urine leukocyte esterase positive | FAERS: 3 | US FAERS | |
| 598 | Vasculitis | FAERS: 3 | SIDER US FAERS | |
| 599 | Ventricular Fibrillation | FAERS: 3 | OFFSIDES US FAERS | |
| 600 | Walking aid user | FAERS: 3 | US FAERS | |
| 601 | Wound Complication | FAERS: 3 | OFFSIDES US FAERS | |
| 602 | nervous system disorder | FAERS: 3 | SIDER US FAERS | |
| 603 | skin abrasion | FAERS: 3 | US FAERS | |
| 604 | Abdominal rigidity | FAERS: 2 | US FAERS | |
| 605 | Accidental underdose | FAERS: 2 | US FAERS | |
| 606 | Adenocarcinoma | FAERS: 2 | US FAERS | |
| 607 | Amyloidosis | FAERS: 2 | US FAERS | |
| 608 | Anal Fissure | FAERS: 2 | US FAERS | |
| 609 | Anal erosion | FAERS: 2 | US FAERS | |
| 610 | Anti-erythrocyte antibody positive | FAERS: 2 | US FAERS | |
| 611 | Antithrombin III decreased | FAERS: 2 | US FAERS | |
| 612 | Aortic Aneurysm | FAERS: 2 | OFFSIDES US FAERS | |
| 613 | Aphonia | FAERS: 2 | US FAERS | |
| 614 | Application site abscess | FAERS: 2 | US FAERS | |
| 615 | Application site discomfort | FAERS: 2 | US FAERS | |
| 616 | Application site movement impairment | FAERS: 2 | US FAERS | |
| 617 | Application site pigmentation changes | FAERS: 2 | US FAERS | |
| 618 | Astigmatism | FAERS: 2 | US FAERS | |
| 619 | Axial spondyloarthritis | FAERS: 2 | US FAERS | |
| 620 | Bedridden | FAERS: 2 | US FAERS | |
| 621 | Beta-2 glycoprotein antibody positive | FAERS: 2 | US FAERS | |
| 622 | Biopsy lung abnormal | FAERS: 2 | US FAERS | |
| 623 | Blood gases abnormal | FAERS: 2 | US FAERS | |
| 624 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 625 | Bone marrow necrosis | FAERS: 2 | US FAERS | |
| 626 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 627 | Cardiac Hypertrophy | FAERS: 2 | US FAERS | |
| 628 | Cardiac discomfort | FAERS: 2 | US FAERS | |
| 629 | Cardiac enzymes increased | FAERS: 2 | US FAERS | |
| 630 | Caustic injury | FAERS: 2 | US FAERS | |
| 631 | Cell Death | FAERS: 2 | US FAERS | |
| 632 | Choking sensation | FAERS: 2 | US FAERS | |
| 633 | Congenital pulmonary hypertension | FAERS: 2 | US FAERS | |
| 634 | Contraindicated drug administered | FAERS: 2 | US FAERS | |
| 635 | Corneal Ulcer | FAERS: 2 | OFFSIDES US FAERS | |
| 636 | Corneal erosion | FAERS: 2 | SIDER US FAERS | |
| 637 | Corneal thinning | FAERS: 2 | SIDER US FAERS | |
| 638 | Creatine urine decreased | FAERS: 2 | US FAERS | |
| 639 | Cryptitis | FAERS: 2 | US FAERS | |
| 640 | Device Failure | FAERS: 2 | US FAERS | |
| 641 | Disease Progression | FAERS: 2 | OFFSIDES US FAERS | |
| 642 | Diverticulum | FAERS: 2 | OFFSIDES US FAERS | |
| 643 | Drug effect variable | FAERS: 2 | US FAERS | |
| 644 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 645 | Drug specific antibody | FAERS: 2 | US FAERS | |
| 646 | Ear congestion | FAERS: 2 | US FAERS | |
| 647 | Ectropion | FAERS: 2 | US FAERS | |
| 648 | Electrophoresis | FAERS: 2 | US FAERS | |
| 649 | Encephalitis | FAERS: 2 | OFFSIDES US FAERS | |
| 650 | Endometriosis | FAERS: 2 | OFFSIDES US FAERS | |
| 651 | Endoscopy abnormal | FAERS: 2 | US FAERS | |
| 652 | Endoscopy upper gastrointestinal tract abnormal | FAERS: 2 | US FAERS | |
| 653 | Endotoxic shock | FAERS: 2 | US FAERS | |
| 654 | Enuresis | FAERS: 2 | US FAERS | |
| 655 | Eosinophilic myocarditis | FAERS: 2 | US FAERS | |
| 656 | Epicondylitis | FAERS: 2 | US FAERS | |
| 657 | Exfoliative rash | FAERS: 2 | US FAERS | |
| 658 | Eye Burns | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 659 | Eye Infection | FAERS: 2 | US FAERS | |
| 660 | Eyelid Function Disorder | FAERS: 2 | US FAERS | |
| 661 | Facial Pain | FAERS: 2 | US FAERS | |
| 662 | Fasciitis | FAERS: 2 | US FAERS | |
| 663 | Fluid overload | FAERS: 2 | US FAERS | |
| 664 | Folliculitis | FAERS: 2 | OFFSIDES US FAERS | |
| 665 | Formication | FAERS: 2 | US FAERS | |
| 666 | Fracture | FAERS: 2 | US FAERS | |
| 667 | Gammopathy | FAERS: 2 | US FAERS | |
| 668 | Gastric Fistula | FAERS: 2 | US FAERS | |
| 669 | Gastric pH decreased | FAERS: 2 | SIDER US FAERS | |
| 670 | Gastrointestinal mucosal exfoliation | FAERS: 2 | US FAERS | |
| 671 | Gastrointestinal obstruction | FAERS: 2 | US FAERS | |
| 672 | Gastrointestinal ulcer perforation | FAERS: 2 | US FAERS | |
| 673 | Gastrointestinal wall thickening | FAERS: 2 | US FAERS | |
| 674 | General physical condition decreased | FAERS: 2 | US FAERS | |
| 675 | Glomerulonephritis | FAERS: 2 | 8882757 | CTD US FAERS |
| 676 | Haptoglobin increased | FAERS: 2 | US FAERS | |
| 677 | Hepaplastin decreased | FAERS: 2 | US FAERS | |
| 678 | Hepatectomy | FAERS: 2 | US FAERS | |
| 679 | Hepatic Encephalopathy | FAERS: 2 | 21295044 | CTD US FAERS |
| 680 | Hepatitis B | FAERS: 2 | US FAERS | |
| 681 | Hepatorenal Syndrome | FAERS: 2 | SIDER US FAERS | |
| 682 | Hepatosplenomegaly | FAERS: 2 | US FAERS | |
| 683 | Hypercapnia | FAERS: 2 | US FAERS | |
| 684 | Hypoaesthesia facial | FAERS: 2 | OFFSIDES US FAERS | |
| 685 | Ileectomy | FAERS: 2 | US FAERS | |
| 686 | Immobile | FAERS: 2 | US FAERS | |
| 687 | Influenza serology positive | FAERS: 2 | US FAERS | |
| 688 | Injection site cellulitis | FAERS: 2 | US FAERS | |
| 689 | Injection site irritation | FAERS: 2 | US FAERS | |
| 690 | Injection site plaque | FAERS: 2 | US FAERS | |
| 691 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 692 | Japan coma scale abnormal | FAERS: 2 | US FAERS | |
| 693 | Labyrinthitis | FAERS: 2 | US FAERS | |
| 694 | Laryngitis | FAERS: 2 | SIDER US FAERS | |
| 695 | Left Ventricular Hypertrophy | FAERS: 2 | US FAERS | |
| 696 | Lesion excision | FAERS: 2 | US FAERS | |
| 697 | Lupus-like syndrome | FAERS: 2 | US FAERS | |
| 698 | Lymphadenitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 699 | Macule | FAERS: 2 | US FAERS | |
| 700 | Malignant ascites | FAERS: 2 | US FAERS | |
| 701 | Mallory-Weiss Syndrome | FAERS: 2 | US FAERS | |
| 702 | Maternal exposure before pregnancy | FAERS: 2 | US FAERS | |
| 703 | Medium-chain acyl-coenzyme A dehydrogenase deficiency | FAERS: 2 | US FAERS | |
| 704 | Megakaryocytes decreased | FAERS: 2 | US FAERS | |
| 705 | Miliaria | FAERS: 2 | US FAERS | |
| 706 | Mouth swelling | FAERS: 2 | US FAERS | |
| 707 | Multi-organ disorder | FAERS: 2 | US FAERS | |
| 708 | Multiple sclerosis relapse | FAERS: 2 | US FAERS | |
| 709 | Muscle Fatigue | FAERS: 2 | US FAERS | |
| 710 | Muscle abscess | FAERS: 2 | US FAERS | |
| 711 | Myasthenia Gravis | FAERS: 2 | US FAERS | |
| 712 | Myoclonus | FAERS: 2 | 224483 | CTD US FAERS |
| 713 | Myoglobinuria | FAERS: 2 | 8701974 | CTD US FAERS |
| 714 | Neonatal cardiac failure | FAERS: 2 | US FAERS | |
| 715 | Neonatal disorder | FAERS: 2 | US FAERS | |
| 716 | Nephritis allergic | FAERS: 2 | US FAERS | |
| 717 | Nuchal Rigidity | FAERS: 2 | SIDER US FAERS | |
| 718 | Obesity | FAERS: 2 | US FAERS | |
| 719 | Ophthalmoplegia | FAERS: 2 | US FAERS | |
| 720 | Overweight | FAERS: 2 | US FAERS | |
| 721 | PCO2 decreased | FAERS: 2 | US FAERS | |
| 722 | PO2 increased | FAERS: 2 | US FAERS | |
| 723 | Pancreatic carcinoma | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 724 | Panic Disorder | FAERS: 2 | US FAERS | |
| 725 | Pelvic fluid collection | FAERS: 2 | US FAERS | |
| 726 | Periostitis | FAERS: 2 | US FAERS | |
| 727 | Peripheral venous disease | FAERS: 2 | US FAERS | |
| 728 | Peritoneal Dialysis | FAERS: 2 | US FAERS | |
| 729 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 730 | Pharyngolaryngeal Pain | FAERS: 2 | OFFSIDES US FAERS | |
| 731 | Phlebitis | FAERS: 2 | SIDER US FAERS | |
| 732 | Pleurisy | FAERS: 2 | OFFSIDES US FAERS | |
| 733 | Pneumoperitoneum | FAERS: 2 | US FAERS | |
| 734 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 735 | Portal Hypertension | FAERS: 2 | US FAERS | |
| 736 | Post procedural infection | FAERS: 2 | US FAERS | |
| 737 | Post-Traumatic Stress Disorder | FAERS: 2 | US FAERS | |
| 738 | Product administration error | FAERS: 2 | US FAERS | |
| 739 | Product contamination | FAERS: 2 | US FAERS | |
| 740 | Product contamination microbial | FAERS: 2 | US FAERS | |
| 741 | Product shape issue | FAERS: 2 | US FAERS | |
| 742 | Product supply issue | FAERS: 2 | US FAERS | |
| 743 | Protein total decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 744 | Protein total increased | FAERS: 2 | US FAERS | |
| 745 | Purulence | FAERS: 2 | US FAERS | |
| 746 | Pyomyositis | FAERS: 2 | US FAERS | |
| 747 | Quadriplegia | FAERS: 2 | 11123398 | CTD US FAERS |
| 748 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 749 | Reflux gastritis | FAERS: 2 | US FAERS | |
| 750 | Renal Colic | FAERS: 2 | US FAERS | |
| 751 | Respiratory tract irritation | FAERS: 2 | US FAERS | |
| 752 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 753 | Retching | FAERS: 2 | US FAERS | |
| 754 | Reticulocyte count decreased | FAERS: 2 | US FAERS | |
| 755 | Reticulocyte count increased | FAERS: 2 | US FAERS | |
| 756 | Right Ventricular Dysfunction | FAERS: 2 | US FAERS | |
| 757 | Right atrial dilatation | FAERS: 2 | US FAERS | |
| 758 | Schizophrenia | FAERS: 2 | US FAERS | |
| 759 | Sinus headache | FAERS: 2 | US FAERS | |
| 760 | Skin tightness | FAERS: 2 | US FAERS | |
| 761 | Spinal cord paralysis | FAERS: 2 | US FAERS | |
| 762 | Status Asthmaticus | FAERS: 2 | US FAERS | |
| 763 | Stress | FAERS: 2 | US FAERS | |
| 764 | Stridor | FAERS: 2 | US FAERS | |
| 765 | Subcutaneous Emphysema | FAERS: 2 | US FAERS | |
| 766 | Sunburn | FAERS: 2 | US FAERS | |
| 767 | Suspected counterfeit product | FAERS: 2 | US FAERS | |
| 768 | Temporal Arteritis | FAERS: 2 | US FAERS | |
| 769 | Thirst | FAERS: 2 | SIDER US FAERS | |
| 770 | Thoracic cavity drainage | FAERS: 2 | US FAERS | |
| 771 | Throat cancer | FAERS: 2 | US FAERS | |
| 772 | Tinea Pedis | FAERS: 2 | US FAERS | |
| 773 | Tonic clonic movements | FAERS: 2 | US FAERS | |
| 774 | Transplant | FAERS: 2 | US FAERS | |
| 775 | Trismus | FAERS: 2 | US FAERS | |
| 776 | Tuberculosis | FAERS: 2 | US FAERS | |
| 777 | Type III immune complex mediated reaction | FAERS: 2 | US FAERS | |
| 778 | Urobilin urine present | FAERS: 2 | US FAERS | |
| 779 | Uveitis | FAERS: 2 | US FAERS | |
| 780 | Vaginitis | FAERS: 2 | US FAERS | |
| 781 | Vascular pain | FAERS: 2 | US FAERS | |
| 782 | Ventricular hypokinesia | FAERS: 2 | US FAERS | |
| 783 | Wound Infection | FAERS: 2 | US FAERS | |
| 784 | Wound dehiscence | FAERS: 2 | US FAERS | |
| 785 | Wrong patient received medication | FAERS: 2 | US FAERS | |
| 786 | Wrong technique in device usage process | FAERS: 2 | US FAERS | |
| 787 | treatment failure | FAERS: 2 | US FAERS | |
| 788 | Abdominal rebound tenderness | FAERS: 1 | US FAERS | |
| 789 | Abdominal wound dehiscence | FAERS: 1 | US FAERS | |
| 790 | Administration site rash | FAERS: 1 | US FAERS | |
| 791 | Administration site warmth | FAERS: 1 | US FAERS | |
| 792 | Agitation postoperative | FAERS: 1 | US FAERS | |
| 793 | Albuminuria | FAERS: 1 | US FAERS | |
| 794 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 795 | Allergy to animal | FAERS: 1 | US FAERS | |
| 796 | Alpha 2 globulin decreased | FAERS: 1 | US FAERS | |
| 797 | Alveolitis | FAERS: 1 | US FAERS | |
| 798 | Amniocentesis | FAERS: 1 | US FAERS | |
| 799 | Amylase increased | FAERS: 1 | US FAERS | |
| 800 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 801 | Analgesic asthma syndrome | FAERS: 1 | US FAERS | |
| 802 | Analgesic drug level increased | FAERS: 1 | US FAERS | |
| 803 | Anastomotic ulcer | FAERS: 1 | US FAERS | |
| 804 | Angioplasty | FAERS: 1 | US FAERS | |
| 805 | Anosmia | FAERS: 1 | US FAERS | |
| 806 | Antinuclear antibody increased | FAERS: 1 | US FAERS | |
| 807 | Antiphospholipid Syndrome | FAERS: 1 | US FAERS | |
| 808 | Aortic Rupture | FAERS: 1 | US FAERS | |
| 809 | Aortic aneurysm repair | FAERS: 1 | US FAERS | |
| 810 | Aphagia | FAERS: 1 | OFFSIDES US FAERS | |
| 811 | Application site acne | FAERS: 1 | US FAERS | |
| 812 | Application site erosion | FAERS: 1 | US FAERS | |
| 813 | Application site hypersensitivity | FAERS: 1 | US FAERS | |
| 814 | Application site joint inflammation | FAERS: 1 | US FAERS | |
| 815 | Application site mass | FAERS: 1 | US FAERS | |
| 816 | Application site nodule | FAERS: 1 | US FAERS | |
| 817 | Application site photosensitivity reaction | FAERS: 1 | US FAERS | |
| 818 | Application site pustules | FAERS: 1 | US FAERS | |
| 819 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 820 | Arthropod bite | FAERS: 1 | US FAERS | |
| 821 | Arthropod sting | FAERS: 1 | US FAERS | |
| 822 | Asphyxia | FAERS: 1 | US FAERS | |
| 823 | Asterixis | FAERS: 1 | OFFSIDES US FAERS | |
| 824 | Atopy | FAERS: 1 | US FAERS | |
| 825 | Atrial Flutter | FAERS: 1 | OFFSIDES US FAERS | |
| 826 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 827 | Autoantibody positive | FAERS: 1 | US FAERS | |
| 828 | Autoimmune thrombocytopenia | FAERS: 1 | US FAERS | |
| 829 | Autologous bone marrow transplantation therapy | FAERS: 1 | US FAERS | |
| 830 | Bacterial disease carrier | FAERS: 1 | US FAERS | |
| 831 | Bacterial food poisoning | FAERS: 1 | US FAERS | |
| 832 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 833 | Benign bone neoplasm | FAERS: 1 | US FAERS | |
| 834 | Biliary cirrhosis | FAERS: 1 | US FAERS | |
| 835 | Biopsy bone marrow abnormal | FAERS: 1 | US FAERS | |
| 836 | Biopsy chorionic villous abnormal | FAERS: 1 | US FAERS | |
| 837 | Biopsy colon abnormal | FAERS: 1 | US FAERS | |
| 838 | Biopsy kidney abnormal | FAERS: 1 | US FAERS | |
| 839 | Biopsy pleura abnormal | FAERS: 1 | US FAERS | |
| 840 | Bladder spasm | FAERS: 1 | US FAERS | |
| 841 | Blepharitis | FAERS: 1 | US FAERS | |
| 842 | Blister rupture | FAERS: 1 | US FAERS | |
| 843 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 844 | Blood alcohol | FAERS: 1 | US FAERS | |
| 845 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 846 | Blood cholinesterase increased | FAERS: 1 | US FAERS | |
| 847 | Blood corticotrophin abnormal | FAERS: 1 | US FAERS | |
| 848 | Blood cortisol decreased | FAERS: 1 | US FAERS | |
| 849 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 850 | Blood gastrin increased | FAERS: 1 | US FAERS | |
| 851 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 852 | Blood parathyroid hormone increased | FAERS: 1 | US FAERS | |
| 853 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 854 | Blood uric acid decreased | FAERS: 1 | US FAERS | |
| 855 | Bone contusion | FAERS: 1 | US FAERS | |
| 856 | Bone density decreased | FAERS: 1 | US FAERS | |
| 857 | Bone erosion | FAERS: 1 | US FAERS | |
| 858 | Bone swelling | FAERS: 1 | US FAERS | |
| 859 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 860 | Brain scan abnormal | FAERS: 1 | US FAERS | |
| 861 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 862 | Calcinosis | FAERS: 1 | US FAERS | |
| 863 | Capillaritis | FAERS: 1 | US FAERS | |
| 864 | Carcinoma | FAERS: 1 | SIDER US FAERS | |
| 865 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 866 | Carotid pulse decreased | FAERS: 1 | US FAERS | |
| 867 | Cataract operation | FAERS: 1 | OFFSIDES US FAERS | |
| 868 | Cerebellar infarction | FAERS: 1 | OFFSIDES US FAERS | |
| 869 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 870 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 871 | Chemical burn of skin | FAERS: 1 | US FAERS | |
| 872 | Chemical injury | FAERS: 1 | US FAERS | |
| 873 | Chloropsia | FAERS: 1 | US FAERS | |
| 874 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 875 | Chronic respiratory failure | FAERS: 1 | US FAERS | |
| 876 | Circumstance or information capable of leading to device use error | FAERS: 1 | US FAERS | |
| 877 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 878 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 879 | Clumsiness | FAERS: 1 | US FAERS | |
| 880 | Colon adenoma | FAERS: 1 | US FAERS | |
| 881 | Colonic fistula | FAERS: 1 | US FAERS | |
| 882 | Colonoscopy abnormal | FAERS: 1 | US FAERS | |
| 883 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 884 | Compression fracture | FAERS: 1 | US FAERS | |
| 885 | Congenital Hydrocephalus | FAERS: 1 | US FAERS | |
| 886 | Conjunctival pallor | FAERS: 1 | US FAERS | |
| 887 | Contraceptive device complication | FAERS: 1 | US FAERS | |
| 888 | Contraindicated product prescribed | FAERS: 1 | US FAERS | |
| 889 | Corneal Perforation | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 890 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 891 | Culture urine positive | FAERS: 1 | US FAERS | |
| 892 | Culture wound positive | FAERS: 1 | US FAERS | |
| 893 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 894 | Degenerative bone disease | FAERS: 1 | US FAERS | |
| 895 | Dependence | FAERS: 1 | US FAERS | |
| 896 | Dermatomyositis | FAERS: 1 | 2917682 | CTD US FAERS |
| 897 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 898 | Diet refusal | FAERS: 1 | US FAERS | |
| 899 | Diplegia | FAERS: 1 | US FAERS | |
| 900 | Dissociation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 901 | Documented hypersensitivity to administered product | FAERS: 1 | US FAERS | |
| 902 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 903 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 904 | Drug label confusion | FAERS: 1 | US FAERS | |
| 905 | Drug level increased | FAERS: 1 | US FAERS | |
| 906 | Drug resistance | FAERS: 1 | US FAERS | |
| 907 | Drug specific antibody present | FAERS: 1 | US FAERS | |
| 908 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 909 | Duodenal Obstruction | FAERS: 1 | US FAERS | |
| 910 | Dysentery | FAERS: 1 | US FAERS | |
| 911 | Dysgraphia | FAERS: 1 | US FAERS | |
| 912 | Dystonia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 913 | Early satiety | FAERS: 1 | US FAERS | |
| 914 | Echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 915 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 916 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 917 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 918 | Emotional disorder | FAERS: 1 | US FAERS | |
| 919 | Endothelial dysfunction | FAERS: 1 | US FAERS | |
| 920 | Epididymitis | FAERS: 1 | US FAERS | |
| 921 | Erythema Induratum | FAERS: 1 | US FAERS | |
| 922 | Erythrodermic psoriasis | FAERS: 1 | US FAERS | |
| 923 | Erythrosis | FAERS: 1 | US FAERS | |
| 924 | Escherichia infection | FAERS: 1 | US FAERS | |
| 925 | Escherichia test positive | FAERS: 1 | US FAERS | |
| 926 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 927 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 928 | Excoriation | FAERS: 1 | SIDER US FAERS | |
| 929 | Exploratory operation | FAERS: 1 | US FAERS | |
| 930 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 931 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 932 | Eye inflammation | FAERS: 1 | US FAERS | |
| 933 | Eye laser surgery | FAERS: 1 | US FAERS | |
| 934 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 935 | Fasciotomy | FAERS: 1 | US FAERS | |
| 936 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 937 | Feeding disorder of infancy OR early childhood | FAERS: 1 | US FAERS | |
| 938 | Female sexual dysfunction | FAERS: 1 | US FAERS | |
| 939 | Fistula of small intestine | FAERS: 1 | US FAERS | |
| 940 | Flight of ideas | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 941 | Food craving | FAERS: 1 | US FAERS | |
| 942 | Fragile X Syndrome | FAERS: 1 | US FAERS | |
| 943 | Frostbite | FAERS: 1 | US FAERS | |
| 944 | Frustration | FAERS: 1 | US FAERS | |
| 945 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 946 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 947 | Gamma-glutamyltransferase decreased | FAERS: 1 | US FAERS | |
| 948 | Gas Gangrene | FAERS: 1 | US FAERS | |
| 949 | Gastric mucosa erythema | FAERS: 1 | US FAERS | |
| 950 | Gastrinoma | FAERS: 1 | US FAERS | |
| 951 | Gastrointestinal amyloidosis | FAERS: 1 | US FAERS | |
| 952 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 953 | Gastrointestinal endoscopic therapy | FAERS: 1 | US FAERS | |
| 954 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 955 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 956 | Gastrointestinal stenosis | FAERS: 1 | US FAERS | |
| 957 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 958 | Gingival Hypertrophy | FAERS: 1 | US FAERS | |
| 959 | Gingival blister | FAERS: 1 | US FAERS | |
| 960 | Gingivitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 961 | Glasgow coma scale abnormal | FAERS: 1 | US FAERS | |
| 962 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 963 | Glossitis | FAERS: 1 | SIDER US FAERS | |
| 964 | Glycosuria | FAERS: 1 | US FAERS | |
| 965 | Granulocyte count decreased | FAERS: 1 | US FAERS | |
| 966 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 967 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 968 | Hand-eye coordination impaired | FAERS: 1 | US FAERS | |
| 969 | Haptoglobin Decreased | FAERS: 1 | US FAERS | |
| 970 | Head and neck cancer metastatic | FAERS: 1 | US FAERS | |
| 971 | Heart valve calcification | FAERS: 1 | US FAERS | |
| 972 | Henoch-Schonlein purpura nephritis | FAERS: 1 | US FAERS | |
| 973 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 974 | Hepatic necrosis | FAERS: 1 | SIDER US FAERS | |
| 975 | Hepatitis B positive | FAERS: 1 | OFFSIDES US FAERS | |
| 976 | Histiocytosis haematophagic | FAERS: 1 | US FAERS | |
| 977 | Hunger | FAERS: 1 | US FAERS | |
| 978 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 979 | Hyperkeratosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 980 | Hyperkinesia | FAERS: 1 | SIDER US FAERS | |
| 981 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 982 | Hypoaldosteronism | FAERS: 1 | US FAERS | |
| 983 | Hypoperfusion | FAERS: 1 | US FAERS | |
| 984 | Iatrogenic infection | FAERS: 1 | US FAERS | |
| 985 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 986 | Ileal ulcer perforation | FAERS: 1 | US FAERS | |
| 987 | Impaired work ability | FAERS: 1 | US FAERS | |
| 988 | Incision site inflammation | FAERS: 1 | US FAERS | |
| 989 | Incorrect dose administered by device | FAERS: 1 | US FAERS | |
| 990 | Incubator therapy | FAERS: 1 | US FAERS | |
| 991 | Induration | FAERS: 1 | SIDER US FAERS | |
| 992 | Infantile vomiting | FAERS: 1 | US FAERS | |
| 993 | Inflammatory pain | FAERS: 1 | US FAERS | |
| 994 | Inguinal mass | FAERS: 1 | US FAERS | |
| 995 | Injection site atrophy | FAERS: 1 | US FAERS | |
| 996 | Injection site discomfort | FAERS: 1 | US FAERS | |
| 997 | Injection site dryness | FAERS: 1 | US FAERS | |
| 998 | Injection site granuloma | FAERS: 1 | US FAERS | |
| 999 | Injection site movement impairment | FAERS: 1 | US FAERS | |
| 1000 | Injection site nodule | FAERS: 1 | OFFSIDES US FAERS | |
| 1001 | Injection site scab | FAERS: 1 | US FAERS | |
| 1002 | Injection site vesicles | FAERS: 1 | US FAERS | |
| 1003 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 1004 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 1005 | Intermediate density lipoprotein increased | FAERS: 1 | US FAERS | |
| 1006 | Intervertebral disc compression | FAERS: 1 | US FAERS | |
| 1007 | Intestinal infarction | FAERS: 1 | US FAERS | |
| 1008 | Intestinal ulcer perforation | FAERS: 1 | US FAERS | |
| 1009 | Intestinal villi atrophy | FAERS: 1 | US FAERS | |
| 1010 | Intra-abdominal pressure increased | FAERS: 1 | US FAERS | |
| 1011 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 1012 | Iris vascular disorder | FAERS: 1 | US FAERS | |
| 1013 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 1014 | Joint abscess | FAERS: 1 | US FAERS | |
| 1015 | Joint warmth | FAERS: 1 | US FAERS | |
| 1016 | Jugular vein distension | FAERS: 1 | US FAERS | |
| 1017 | Keratitis | FAERS: 1 | SIDER US FAERS | |
| 1018 | Laparoscopy | FAERS: 1 | US FAERS | |
| 1019 | Large intestine erosion | FAERS: 1 | US FAERS | |
| 1020 | Laryngeal Obstruction | FAERS: 1 | US FAERS | |
| 1021 | Laryngeal Squamous Cell Carcinoma | FAERS: 1 | US FAERS | |
| 1022 | Left atrial hypertrophy | FAERS: 1 | US FAERS | |
| 1023 | Lesion of Sciatic Nerve | FAERS: 1 | US FAERS | |
| 1024 | Libido disorder | FAERS: 1 | US FAERS | |
| 1025 | Lichen Planus | FAERS: 1 | US FAERS | |
| 1026 | Lichenification | FAERS: 1 | US FAERS | |
| 1027 | Limb asymmetry | FAERS: 1 | US FAERS | |
| 1028 | Lipase increased | FAERS: 1 | US FAERS | |
| 1029 | Lipoatrophy | FAERS: 1 | US FAERS | |
| 1030 | Liquid product physical issue | FAERS: 1 | US FAERS | |
| 1031 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 1032 | Lividity | FAERS: 1 | US FAERS | |
| 1033 | Living in residential institution | FAERS: 1 | US FAERS | |
| 1034 | Local reaction | FAERS: 1 | US FAERS | |
| 1035 | Loose tooth | FAERS: 1 | US FAERS | |
| 1036 | Lymph node palpable | FAERS: 1 | US FAERS | |
| 1037 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 1038 | Lymphoid tissue hyperplasia | FAERS: 1 | US FAERS | |
| 1039 | Lymphoma | FAERS: 1 | US FAERS | |
| 1040 | Male sexual dysfunction | FAERS: 1 | US FAERS | |
| 1041 | Marasmus | FAERS: 1 | US FAERS | |
| 1042 | Mastocytosis | FAERS: 1 | US FAERS | |
| 1043 | Mechanical urticaria | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1044 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 1045 | Medical device implantation | FAERS: 1 | US FAERS | |
| 1046 | Medication residue present | FAERS: 1 | US FAERS | |
| 1047 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 1048 | Meningism | FAERS: 1 | US FAERS | |
| 1049 | Mental Retardation | FAERS: 1 | US FAERS | |
| 1050 | Mental status changes | FAERS: 1 | US FAERS | |
| 1051 | Metastasis | FAERS: 1 | US FAERS | |
| 1052 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 1053 | Morganella infection | FAERS: 1 | US FAERS | |
| 1054 | Motion Sickness | FAERS: 1 | US FAERS | |
| 1055 | Multiple Myeloma | FAERS: 1 | US FAERS | |
| 1056 | Multiple allergies | FAERS: 1 | US FAERS | |
| 1057 | Multiple drug overdose intentional | FAERS: 1 | US FAERS | |
| 1058 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 1059 | Muscle Spasticity | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1060 | Muscle strain | FAERS: 1 | US FAERS | |
| 1061 | Muscular Dystrophy | FAERS: 1 | US FAERS | |
| 1062 | Mutism | FAERS: 1 | US FAERS | |
| 1063 | Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 1064 | Nasal Polyps | FAERS: 1 | US FAERS | |
| 1065 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 1066 | Neonatal anuria | FAERS: 1 | US FAERS | |
| 1067 | Neonatal aspiration | FAERS: 1 | US FAERS | |
| 1068 | Neonatal hepatomegaly | FAERS: 1 | US FAERS | |
| 1069 | Nephrectomy | FAERS: 1 | US FAERS | |
| 1070 | Nerve Degeneration | FAERS: 1 | US FAERS | |
| 1071 | Neuritis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 1072 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 1073 | Night sweats | FAERS: 1 | US FAERS | |
| 1074 | No adverse effect | FAERS: 1 | US FAERS | |
| 1075 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 1076 | Nystagmus | FAERS: 1 | US FAERS | |
| 1077 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 1078 | Ocular icterus | FAERS: 1 | US FAERS | |
| 1079 | Oculogyric crisis | FAERS: 1 | US FAERS | |
| 1080 | Oculomotor study abnormal | FAERS: 1 | US FAERS | |
| 1081 | Oral administration complication | FAERS: 1 | US FAERS | |
| 1082 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 1083 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 1084 | PO2 decreased | FAERS: 1 | US FAERS | |
| 1085 | Pachymeningitis | FAERS: 1 | US FAERS | |
| 1086 | Palatal swelling | FAERS: 1 | US FAERS | |
| 1087 | Pancreatic duct dilatation | FAERS: 1 | US FAERS | |
| 1088 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 1089 | Papule | FAERS: 1 | US FAERS | |
| 1090 | Paraplegia | FAERS: 1 | US FAERS | |
| 1091 | Paresis anal sphincter | FAERS: 1 | US FAERS | |
| 1092 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 1093 | Penile plaque | FAERS: 1 | US FAERS | |
| 1094 | Pericarditis | FAERS: 1 | US FAERS | |
| 1095 | Phantom pain | FAERS: 1 | US FAERS | |
| 1096 | Phlebosclerosis | FAERS: 1 | US FAERS | |
| 1097 | Physical product label issue | FAERS: 1 | US FAERS | |
| 1098 | Plasmapheresis | FAERS: 1 | US FAERS | |
| 1099 | Platelet aggregation abnormal | FAERS: 1 | US FAERS | |
| 1100 | Platelet function test abnormal | FAERS: 1 | US FAERS | |
| 1101 | Podagra | FAERS: 1 | US FAERS | |
| 1102 | Polyarthritis | FAERS: 1 | US FAERS | |
| 1103 | Polyhydramnios | FAERS: 1 | US FAERS | |
| 1104 | Poriomania | FAERS: 1 | US FAERS | |
| 1105 | Potassium wasting nephropathy | FAERS: 1 | US FAERS | |
| 1106 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 1107 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 1108 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 1109 | Product availability issue | FAERS: 1 | US FAERS | |
| 1110 | Product dispensing error | FAERS: 1 | US FAERS | |
| 1111 | Product physical issue | FAERS: 1 | US FAERS | |
| 1112 | Product preparation error | FAERS: 1 | US FAERS | |
| 1113 | Product prescribing error | FAERS: 1 | US FAERS | |
| 1114 | Product tampering | FAERS: 1 | US FAERS | |
| 1115 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 1116 | Prostatic pain | FAERS: 1 | US FAERS | |
| 1117 | Protein albumin ratio | FAERS: 1 | US FAERS | |
| 1118 | Prurigo | FAERS: 1 | US FAERS | |
| 1119 | Pseudomonas test positive | FAERS: 1 | US FAERS | |
| 1120 | Pterygium | FAERS: 1 | US FAERS | |
| 1121 | Pulmonary Eosinophilia | FAERS: 1 | US FAERS | |
| 1122 | Pulmonary arterial pressure increased | FAERS: 1 | US FAERS | |
| 1123 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 1124 | Pustular psoriasis | FAERS: 1 | US FAERS | |
| 1125 | Pyloric Stenosis | FAERS: 1 | US FAERS | |
| 1126 | Pyloroplasty | FAERS: 1 | US FAERS | |
| 1127 | QRS axis abnormal | FAERS: 1 | US FAERS | |
| 1128 | Radial pulse decreased | FAERS: 1 | US FAERS | |
| 1129 | Radiculopathy | FAERS: 1 | US FAERS | |
| 1130 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 1131 | Renal cyst | FAERS: 1 | OFFSIDES US FAERS | |
| 1132 | Respiratory fume inhalation disorder | FAERS: 1 | US FAERS | |
| 1133 | Reticulocyte count abnormal | FAERS: 1 | US FAERS | |
| 1134 | Reticulocytosis | FAERS: 1 | US FAERS | |
| 1135 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 1136 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 1137 | Rheumatoid factor increased | FAERS: 1 | US FAERS | |
| 1138 | Rhonchi | FAERS: 1 | OFFSIDES US FAERS | |
| 1139 | Sarcoma | FAERS: 1 | US FAERS | |
| 1140 | Scleroderma | FAERS: 1 | OFFSIDES US FAERS | |
| 1141 | Scotoma | FAERS: 1 | SIDER US FAERS | |
| 1142 | Selenium deficiency | FAERS: 1 | US FAERS | |
| 1143 | Sense of oppression | FAERS: 1 | US FAERS | |
| 1144 | Septic arthritis staphylococcal | FAERS: 1 | OFFSIDES US FAERS | |
| 1145 | Seronegative arthritis | FAERS: 1 | US FAERS | |
| 1146 | Serum Sickness | FAERS: 1 | US FAERS | |
| 1147 | Shoulder deformity | FAERS: 1 | US FAERS | |
| 1148 | Sinoatrial Block | FAERS: 1 | OFFSIDES US FAERS | |
| 1149 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 1150 | Skin Induration | FAERS: 1 | US FAERS | |
| 1151 | Skin hypertrophy | FAERS: 1 | SIDER US FAERS | |
| 1152 | Skin test positive | FAERS: 1 | US FAERS | |
| 1153 | Skin texture abnormal | FAERS: 1 | US FAERS | |
| 1154 | Sluggishness | FAERS: 1 | US FAERS | |
| 1155 | Small intestine carcinoma | FAERS: 1 | US FAERS | |
| 1156 | Sopor | FAERS: 1 | US FAERS | |
| 1157 | Splenomegaly | FAERS: 1 | US FAERS | |
| 1158 | Spondylolisthesis | FAERS: 1 | US FAERS | |
| 1159 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 1160 | Stent occlusion | FAERS: 1 | US FAERS | |
| 1161 | Strabismus | FAERS: 1 | US FAERS | |
| 1162 | Stress ulcer | FAERS: 1 | US FAERS | |
| 1163 | Sudden death | FAERS: 1 | OFFSIDES US FAERS | |
| 1164 | Superficial injury of eye | FAERS: 1 | US FAERS | |
| 1165 | Superficial vein prominence | FAERS: 1 | US FAERS | |
| 1166 | Suppressed lactation | FAERS: 1 | US FAERS | |
| 1167 | Swelling of eyelid | FAERS: 1 | SIDER US FAERS | |
| 1168 | Synovitis | FAERS: 1 | US FAERS | |
| 1169 | Syphilis test positive | FAERS: 1 | US FAERS | |
| 1170 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 1171 | Tendon discomfort | FAERS: 1 | US FAERS | |
| 1172 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 1173 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 1174 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 1175 | Thrombectomy | FAERS: 1 | US FAERS | |
| 1176 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 1177 | Toe operation | FAERS: 1 | US FAERS | |
| 1178 | Toothache | FAERS: 1 | SIDER US FAERS | |
| 1179 | Toxic Shock Syndrome | FAERS: 1 | SIDER US FAERS | |
| 1180 | Toxocariasis | FAERS: 1 | US FAERS | |
| 1181 | Tracheal fistula | FAERS: 1 | US FAERS | |
| 1182 | Transcription medication error | FAERS: 1 | US FAERS | |
| 1183 | Tri-iodothyronine free increased | FAERS: 1 | US FAERS | |
| 1184 | Troponin T increased | FAERS: 1 | US FAERS | |
| 1185 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 1186 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 1187 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 1188 | Unexpected therapeutic drug effect | FAERS: 1 | US FAERS | |
| 1189 | Unintentional use for unapproved indication | FAERS: 1 | US FAERS | |
| 1190 | Upper respiratory tract inflammation | FAERS: 1 | OFFSIDES US FAERS | |
| 1191 | Urethral caruncle | FAERS: 1 | US FAERS | |
| 1192 | Urine output increased | FAERS: 1 | SIDER US FAERS | |
| 1193 | Vanishing bile duct syndrome | FAERS: 1 | US FAERS | |
| 1194 | Vascular insufficiency | FAERS: 1 | US FAERS | |
| 1195 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 1196 | Vascular purpura | FAERS: 1 | SIDER US FAERS | |
| 1197 | Vascular stenosis | FAERS: 1 | US FAERS | |
| 1198 | Vasospasm | FAERS: 1 | US FAERS | |
| 1199 | Vein wall hypertrophy | FAERS: 1 | US FAERS | |
| 1200 | Venous occlusion | FAERS: 1 | US FAERS | |
| 1201 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 1202 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 1203 | Vertebral abscess | FAERS: 1 | US FAERS | |
| 1204 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 1205 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 1206 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 1207 | Vulvovaginal erythema | FAERS: 1 | US FAERS | |
| 1208 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 1209 | Water Intoxication | FAERS: 1 | US FAERS | |
| 1210 | Wound closure | FAERS: 1 | US FAERS | |
| 1211 | Wound evisceration | FAERS: 1 | US FAERS | |
| 1212 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 1213 | Wound necrosis | FAERS: 1 | US FAERS | |
| 1214 | X-ray with contrast upper gastrointestinal tract | FAERS: 1 | US FAERS | |
| 1215 | colonoscopy | FAERS: 1 | US FAERS | |
| 1216 | effusion | FAERS: 1 | US FAERS | |
| 1217 | heart rate | FAERS: 1 | US FAERS | |
| 1218 | intensive care | FAERS: 1 | US FAERS | |
| 1219 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 1220 | Abdominal Cramps | SIDER | ||
| 1221 | Abdominal adhesions | OFFSIDES | ||
| 1222 | Abnormal vision | OFFSIDES SIDER | ||
| 1223 | Acholia | OFFSIDES | ||
| 1224 | Actinomycosis | OFFSIDES | ||
| 1225 | Acute left ventricular failure | OFFSIDES | ||
| 1226 | Adenoma | OFFSIDES | ||
| 1227 | Agraphia | OFFSIDES | ||
| 1228 | Allergic skin reaction | SIDER | ||
| 1229 | Amblyopia | SIDER | ||
| 1230 | Amphetamine-Related Disorders | 15085091 | CTD | |
| 1231 | Anemia, Hemolytic | CTD | ||
| 1232 | Anticholinergic Syndrome | OFFSIDES | ||
| 1233 | Antiviral drug level above therapeutic | OFFSIDES | ||
| 1234 | Apathy | OFFSIDES | ||
| 1235 | Arteriosclerosis Obliterans | OFFSIDES | ||
| 1236 | Arteriosclerosis | SIDER | ||
| 1237 | Arthritis, Experimental | 25450234 25935278 | CTD | |
| 1238 | Arthritis, Gouty | 15975301 | CTD | |
| 1239 | Arthritis, Psoriatic | 7487376 | CTD | |
| 1240 | Arthrodesis | OFFSIDES | ||
| 1241 | Aspiration Pneumonia | OFFSIDES | ||
| 1242 | Ataxia | Canada Vigilance: 1 | Canada Vigilance | |
| 1243 | Atelectasis | OFFSIDES | ||
| 1244 | Atherosclerosis obliterans | OFFSIDES | ||
| 1245 | Atherosclerosis | OFFSIDES | ||
| 1246 | Atrial tachycardia | OFFSIDES | ||
| 1247 | Azotemia | 18274699 | CTD | |
| 1248 | Bacterial Infections | 12669766 | CTD | |
| 1249 | Band neutrophil percentage decreased | OFFSIDES | ||
| 1250 | Benign biliary neoplasm | OFFSIDES | ||
| 1251 | Benign neoplasm of thyroid gland | OFFSIDES | ||
| 1252 | Bicytopenia | OFFSIDES | ||
| 1253 | Bile duct cancer stage III | OFFSIDES | ||
| 1254 | Biopsy | OFFSIDES | ||
| 1255 | Bladder pain | SIDER | ||
| 1256 | Blood and lymphatic system disorders | SIDER | ||
| 1257 | Blood cholesterol abnormal | OFFSIDES | ||
| 1258 | Blood cholesterol | OFFSIDES | ||
| 1259 | Blood creatinine abnormal | SIDER | ||
| 1260 | Blood immunoglobulin E | OFFSIDES | ||
| 1261 | Blood thyroid stimulating hormone | OFFSIDES | ||
| 1262 | Body odor | SIDER | ||
| 1263 | Borderline Personality Disorder | OFFSIDES | ||
| 1264 | Brain Diseases | 21295044 | CTD | |
| 1265 | Bullous eruption | SIDER | ||
| 1266 | CYTOMEGALOVIRUS ANTIGEN | OFFSIDES | ||
| 1267 | Candidiasis of vagina | OFFSIDES | ||
| 1268 | Candidiasis | 2022160 | CTD | |
| 1269 | Cardiac procedure complication | OFFSIDES | ||
| 1270 | Cardiomyopathies | 19920767 | CTD | |
| 1271 | Cardiovascular Diseases | 16968831 20092437 | CTD | |
| 1272 | Cerebrosclerosis | OFFSIDES | ||
| 1273 | Cheilitis | Canada Vigilance: 1 | Canada Vigilance | |
| 1274 | Chemical and Drug Induced Liver Injury |
1582111
1752473 1872757 2033230 2307831 2602249 6236451 6805622 6852419 7612373 8014443 8024621 8196514 8290850 8462374 8511777 9162541 9365130 9654706 10414481 10916496 11394653 12763371 15066135 15122773 15674093 16165719 18524759 18818036 19000659 21295044 22285467 22331495 22841776 23152190 23397584 23506792 23939143 24014644 24085192 24185126 24552538 24747151 24752500 25663337 25772430 25934330 26609140 26921665 27130197 27183920 27313093 27485346 27671914 28069987 28138970 28437613 28762043 29203276 30925002 | CTD | |
| 1275 | Chemical and Drug Induced Liver Injury, Chronic | 2611118 | CTD | |
| 1276 | Chemical eye injury | OFFSIDES | ||
| 1277 | Chemotherapeutic drug level increased | OFFSIDES | ||
| 1278 | Cholangiolitis | OFFSIDES | ||
| 1279 | Cholecystolithiasis | 15752411 | CTD | |
| 1280 | Colonic Neoplasms | 12894507 21427588 | CTD | |
| 1281 | Color blindness | OFFSIDES | ||
| 1282 | Confabulation | OFFSIDES | ||
| 1283 | Congenital cystic kidney disease | OFFSIDES | ||
| 1284 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 1285 | Corneal Opacity | SIDER | ||
| 1286 | Corneal Scar | OFFSIDES | ||
| 1287 | Corneal epithelium defect | OFFSIDES | ||
| 1288 | Corneal pigmentation | OFFSIDES | ||
| 1289 | Cramps of lower extremities | SIDER | ||
| 1290 | Creatine Phosphokinase Increased | SIDER | ||
| 1291 | Creatinine abnormal NOS | SIDER | ||
| 1292 | Creatinine increased | SIDER | ||
| 1293 | Culture positive | OFFSIDES | ||
| 1294 | Cystocele | OFFSIDES | ||
| 1295 | Cytomegalovirus enterocolitis | OFFSIDES | ||
| 1296 | Demyelinating Diseases | 18678241 | CTD | |
| 1297 | Dental abscess | OFFSIDES | ||
| 1298 | Dental caries | SIDER | ||
| 1299 | Dermatitis, Irritant | 21319177 | CTD | |
| 1300 | Diabetes | OFFSIDES | ||
| 1301 | Diarrhea | 1439622 20361083 | CTD OFFSIDES | |
| 1302 | Discitis | 9654706 | CTD | |
| 1303 | Drowsiness | SIDER | ||
| 1304 | Drug Eruptions | 11792017 | CTD | |
| 1305 | Drug abuser | OFFSIDES | ||
| 1306 | Drug delivery system malfunction | OFFSIDES | ||
| 1307 | Drug diversion | OFFSIDES | ||
| 1308 | Dysmenorrhea | 9742877 11915580 | CTD OFFSIDES | |
| 1309 | Dyspnea | 20361083 | CTD | |
| 1310 | Dysthymic Disorder | SIDER | ||
| 1311 | Ear and labyrinth disorders | SIDER | ||
| 1312 | Edema | CTD | ||
| 1313 | Endocarditis | 15069333 | CTD | |
| 1314 | Endophthalmitis | OFFSIDES SIDER | ||
| 1315 | Endoscopy gastrointestinal abnormal | OFFSIDES | ||
| 1316 | Enterocolitis bacterial | OFFSIDES | ||
| 1317 | Epidermolysis | OFFSIDES SIDER | ||
| 1318 | Epigastric pain | SIDER | ||
| 1319 | Erosive balanitis | OFFSIDES | ||
| 1320 | Erosive gastritis | OFFSIDES | ||
| 1321 | Escherichia urinary tract infection | OFFSIDES | ||
| 1322 | Esophageal Diseases | 2022160 | CTD | |
| 1323 | Exacerbation of asthma | SIDER | ||
| 1324 | Exanthema | 2033230 | CTD | |
| 1325 | Exposure to toxic agent | OFFSIDES | ||
| 1326 | Eye Injuries | 10389123 | CTD | |
| 1327 | Eye allergy | SIDER | ||
| 1328 | Eyelids pruritus | SIDER | ||
| 1329 | Facial paralysis | Canada Vigilance: 1 | Canada Vigilance | |
| 1330 | Fatty Liver | 25820915 | CTD | |
| 1331 | Fever | 2033230 14750454 17345100 | CTD | |
| 1332 | Furunculosis | SIDER | ||
| 1333 | Gambling | OFFSIDES | ||
| 1334 | Gastrointestinal Diseases | CTD | ||
| 1335 | Gastrointestinal Hemorrhage | CTD | ||
| 1336 | Genital erosion | OFFSIDES | ||
| 1337 | Glaucoma, Open-Angle | 12446362 | CTD | |
| 1338 | Granulocytosis | OFFSIDES | ||
| 1339 | Gum neoplasm malignant stage unspecified | OFFSIDES | ||
| 1340 | Heart failure | 15834531 19268806 | CTD | |
| 1341 | Heartburn | SIDER | ||
| 1342 | Hemoglobinuria | 9207477 | CTD | |
| 1343 | Hemorrhagic colitis | SIDER | ||
| 1344 | Hemorrhoids aggravated | SIDER | ||
| 1345 | Hepatic Insufficiency | 25820915 | CTD | |
| 1346 | Hepatic congestion | OFFSIDES | ||
| 1347 | Hepatitis, Chronic | 2611118 14986274 | CTD | |
| 1348 | Hyperalgesia | CTD | ||
| 1349 | Hyperchlorhydria | SIDER | ||
| 1350 | Hyperkalemia | 11123398 15752411 | CTD | |
| 1351 | Immune reconstitution syndrome | OFFSIDES | ||
| 1352 | Incision site infection | OFFSIDES | ||
| 1353 | Infestation | SIDER | ||
| 1354 | Intervertebral disc disorder | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 1355 | Intestinal Diseases | 16944022 20668000 28400101 | CTD | |
| 1356 | Intracranial Aneurysm | OFFSIDES | ||
| 1357 | Intubation | OFFSIDES | ||
| 1358 | Iritis | SIDER | ||
| 1359 | Jejunal Diseases | 24770551 | CTD | |
| 1360 | Kidney Diseases | 12861172 15976495 23506792 | CTD | |
| 1361 | Kidney Failure | OFFSIDES | ||
| 1362 | Lacrimal structural disorder | SIDER | ||
| 1363 | Lacrimation | SIDER | ||
| 1364 | Legionella | OFFSIDES | ||
| 1365 | Lightheadedness | SIDER | ||
| 1366 | Liver Cirrhosis | 1582111 | CTD | |
| 1367 | Liver Failure, Acute | 9474998 11204815 | CTD | |
| 1368 | Liver diseases | 14566034 15834531 16867024 | CTD | |
| 1369 | Low Back Pain | 11915580 17163260 18084859 | CTD | |
| 1370 | Lupus Erythematosus, Systemic | 1930326 | CTD | |
| 1371 | Lymphangioma | OFFSIDES | ||
| 1372 | Malignant neoplasm progression | OFFSIDES | ||
| 1373 | Mastoiditis | OFFSIDES | ||
| 1374 | Metamorphopsia | OFFSIDES | ||
| 1375 | Metaplasia | OFFSIDES | ||
| 1376 | Miller Fisher Syndrome | OFFSIDES | ||
| 1377 | Mixed hepatocellular-cholestatic injury | OFFSIDES | ||
| 1378 | Multiple Organ Failure | 9379106 | CTD | |
| 1379 | Narcotic intoxication | OFFSIDES | ||
| 1380 | Nasal discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 1381 | Neck stiffness | SIDER | ||
| 1382 | Nephritis, Interstitial | CTD | ||
| 1383 | Neuroblastoma | 15492235 | CTD | |
| 1384 | Neutropenic sepsis | OFFSIDES | ||
| 1385 | Neutrophil count abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 1386 | Nocturia | SIDER | ||
| 1387 | Ocular Hypertension | 14609909 | CTD | |
| 1388 | Oligospermia | Canada Vigilance: 1 | Canada Vigilance | |
| 1389 | Open reduction of fracture | OFFSIDES | ||
| 1390 | Oral polypectomy | OFFSIDES | ||
| 1391 | Oxygen supplementation | OFFSIDES | ||
| 1392 | Pain, Postoperative | CTD | ||
| 1393 | Pelvic prolapse | OFFSIDES | ||
| 1394 | Peptic Ulcer Perforation | Canada Vigilance: 1 | Canada Vigilance | |
| 1395 | Peripheral paralysis | OFFSIDES | ||
| 1396 | Pharyngitis | SIDER | ||
| 1397 | Piloerection | OFFSIDES | ||
| 1398 | Post procedural pain | OFFSIDES | ||
| 1399 | Postoperative Hemorrhage | 16146476 | CTD | |
| 1400 | Postoperative wound complication | OFFSIDES | ||
| 1401 | Prenatal Exposure Delayed Effects | 17123485 18678241 | CTD | |
| 1402 | Prenatal Injuries | 24788080 | CTD | |
| 1403 | Proctitis | SIDER | ||
| 1404 | Proctocolitis | OFFSIDES SIDER | ||
| 1405 | Pulmonary function test decreased | SIDER | ||
| 1406 | Punctate keratitis | SIDER | ||
| 1407 | Purpura Fulminans | 12219272 | CTD | |
| 1408 | Purpuric rash | SIDER | ||
| 1409 | Pyoderma Gangrenosum | Canada Vigilance: 1 | Canada Vigilance | |
| 1410 | Rectal polyp | OFFSIDES | ||
| 1411 | Redness | SIDER | ||
| 1412 | Renal Insufficiency | CTD | ||
| 1413 | Retinal infarction | OFFSIDES | ||
| 1414 | Retinogram abnormal | OFFSIDES | ||
| 1415 | Reye Syndrome | 9379106 9742877 | CTD | |
| 1416 | Rhinorrhea | OFFSIDES | ||
| 1417 | Sacroiliitis | OFFSIDES | ||
| 1418 | Seizures | 9142563 16504799 | CTD | |
| 1419 | Sinus polyp | OFFSIDES | ||
| 1420 | Skin carcinoma | SIDER | ||
| 1421 | Skin nodule | SIDER | ||
| 1422 | Sleep Talking | Canada Vigilance: 1 | Canada Vigilance | |
| 1423 | Stomach Diseases | 12861172 15996031 28400101 | CTD | |
| 1424 | Stomach ache | SIDER | ||
| 1425 | Sweating | SIDER | ||
| 1426 | Taste Disorders | SIDER | ||
| 1427 | Tension | SIDER | ||
| 1428 | Thalamic infarction | OFFSIDES | ||
| 1429 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 1430 | Thromboembolism | 15234645 | CTD | |
| 1431 | Thrombotic Microangiopathies | 2716392 | CTD | |
| 1432 | Tooth Erosion | OFFSIDES | ||
| 1433 | Triple vessel bypass graft | OFFSIDES | ||
| 1434 | Ulcerative stomatitis | SIDER | ||
| 1435 | Urea urine increased | OFFSIDES | ||
| 1436 | Urinary abnormalities | SIDER | ||
| 1437 | Urination Disorders | CTD | ||
| 1438 | Vaginal Discharge | Canada Vigilance: 1 | Canada Vigilance | |
| 1439 | Vaginal Prolapse | OFFSIDES | ||
| 1440 | Vasodilation procedure | SIDER | ||
| 1441 | Vasodilation | SIDER | ||
| 1442 | Venous Thrombosis | 2730826 | CTD | |
| 1443 | Vesiculobullous rash | SIDER | ||
| 1444 | Vitreous floaters | SIDER | ||
| 1445 | Weight Gain | OFFSIDES | ||
| 1446 | White blood cell count abnormal | OFFSIDES | ||
| 1447 | anaphylaxis | 9220183 12975044 | CTD | |
| 1448 | bad taste | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.