Everolimus
(HKVAMNSJSFKALM-GKUWKFKPSA-N)
Structure
- SMILES
- OCCO[C@@H]1CC[C@H](C[C@H]1OC)C[C@H]([C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@]2(O)O[C@@H](CC[C@H]2C)C[C@H](OC)/C(=C/C=C/C=C/[C@H](C[C@H](C(=O)[C@@H]([C@@H](/C(=C/[C@H](C(=O)C1)C)/C)O)OC)C)C)/C)C
- Type(s)
- Approved
- ATC code(s)
- L01XE10; L04AA18
- Molecular Formula:
- C53H83NO14
- Molecular Weight:
- 958.224
- Log P:
- 6.1351
- Hydrogen Bond Acceptor:
- 15
- Hydrogen Bond Donor:
- 3
- TPSA:
- 204.66
- CAS Number(s):
- 159351-69-6
Synonym(s)
1.
Everolimus
2.
40-O-(2-hydroxyethyl)-rapamycin
3.
Afinitor
4.
Certican
5.
RAD 001
6.
RAD001
7.
SDZ RAD
8.
SDZ-RAD
9.
001, RAD
10.
RAD, SDZ
External Link(s)
| MeSH | D000068338 |
| PubChem Compound | 6442177 |
| BindingDB | 50088378 |
| ChEBI | 68478 |
| CHEMBL | CHEMBL1908360 |
| DrugBank | DB01590 |
| DrugCentral | 1118 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 5889 |
| KEGG | dr:D02714 |
| ZINC | 169677008 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Stomatitis | FAERS: 1092 Canada Vigilance: 21 | 19549709 21306238 27169792 | CTD SIDER Canada Vigilance US FAERS |
| 2 | Malignant neoplasm progression | FAERS: 943 Canada Vigilance: 60 | Canada Vigilance US FAERS | |
| 3 | Fatigue | FAERS: 730 Canada Vigilance: 17 | 16951235 19549709 21306238 | CTD SIDER Canada Vigilance US FAERS |
| 4 | Malaise | FAERS: 526 Canada Vigilance: 24 | Canada Vigilance SIDER US FAERS | |
| 5 | Drug ineffective | FAERS: 477 Canada Vigilance: 70 | Canada Vigilance US FAERS | |
| 6 | Nausea | FAERS: 440 Canada Vigilance: 12 | Canada Vigilance SIDER US FAERS | |
| 7 | Pneumonia | FAERS: 386 Canada Vigilance: 31 | 17346627 | CTD SIDER Canada Vigilance US FAERS |
| 8 | Pneumonitis | FAERS: 386 Canada Vigilance: 24 | Canada Vigilance US FAERS | |
| 9 | Asthenia | FAERS: 352 Canada Vigilance: 17 | Canada Vigilance SIDER US FAERS | |
| 10 | Vomiting | FAERS: 317 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 11 | Weight decreased | FAERS: 277 Canada Vigilance: 13 | Canada Vigilance SIDER US FAERS | |
| 12 | Disease Progression | FAERS: 259 Canada Vigilance: 30 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 13 | Pain | FAERS: 243 Canada Vigilance: 11 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 14 | General physical health deterioration | FAERS: 242 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 15 | Oral pain | FAERS: 235 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 16 | Headache | FAERS: 230 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 17 | Blood glucose increased | FAERS: 205 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 18 | Abdominal Pain | FAERS: 194 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 19 | Pruritus | FAERS: 188 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 20 | Epistaxis | FAERS: 169 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 21 | Dehydration | FAERS: 159 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 22 | Peripheral swelling | FAERS: 150 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 23 | Dizziness | FAERS: 148 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 24 | Blood creatinine increased | FAERS: 142 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 25 | Arthralgia | FAERS: 135 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 26 | Product use issue | FAERS: 130 | US FAERS | |
| 27 | Dysgeusia | FAERS: 128 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 28 | Blood cholesterol increased | FAERS: 126 | SIDER US FAERS | |
| 29 | Acne | FAERS: 125 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 30 | Constipation | FAERS: 125 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 31 | Back Pain | FAERS: 122 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 32 | Nasopharyngitis | FAERS: 118 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 33 | Infection | FAERS: 106 Canada Vigilance: 3 | 10551636 | CTD SIDER Canada Vigilance US FAERS |
| 34 | Product use in unapproved indication | FAERS: 106 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 35 | No adverse event | FAERS: 98 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Chest Pain | FAERS: 95 | OFFSIDES SIDER US FAERS | |
| 37 | Thrombocytopenia | FAERS: 94 Canada Vigilance: 4 | 10551636 19549709 | CTD SIDER Canada Vigilance US FAERS |
| 38 | Oropharyngeal pain | FAERS: 87 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 39 | Ascites | FAERS: 86 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 40 | Feeling abnormal | FAERS: 85 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 41 | Diabetes Mellitus | FAERS: 83 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 42 | Hypotension | FAERS: 82 | SIDER US FAERS | |
| 43 | Joint swelling | FAERS: 80 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 44 | Influenza | FAERS: 78 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 45 | Alopecia | FAERS: 77 | SIDER US FAERS | |
| 46 | Respiratory Failure | FAERS: 77 | US FAERS | |
| 47 | Erythema | FAERS: 73 Canada Vigilance: 1 | 17309148 | CTD SIDER Canada Vigilance US FAERS |
| 48 | Urinary tract infection | FAERS: 73 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 49 | Dry skin | FAERS: 72 | SIDER US FAERS | |
| 50 | Sepsis | FAERS: 72 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 51 | Swelling | FAERS: 71 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Hypersensitivity | FAERS: 70 | SIDER US FAERS | |
| 53 | Pericardial effusion | FAERS: 70 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 54 | Abdominal discomfort | FAERS: 66 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 55 | Cerebrovascular accident | FAERS: 66 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 56 | White blood cell count decreased | FAERS: 66 | SIDER US FAERS | |
| 57 | Pulmonary Embolism | FAERS: 65 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 58 | Therapy cessation | FAERS: 65 | US FAERS | |
| 59 | Thrombosis | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 60 | Urticaria | FAERS: 63 | US FAERS | |
| 61 | Gamma-Glutamyltransferase Increased | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Sinusitis | FAERS: 62 | SIDER US FAERS | |
| 63 | Metastasis | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Neutropenia | FAERS: 58 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 65 | Somnolence | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 66 | Blood triglycerides increased | FAERS: 55 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 67 | Toxicity to various agents | FAERS: 55 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 68 | Lethargy | FAERS: 54 | SIDER US FAERS | |
| 69 | Intestinal Obstruction | FAERS: 53 | US FAERS | |
| 70 | Anxiety | FAERS: 52 | SIDER US FAERS | |
| 71 | Memory impairment | FAERS: 51 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 72 | Myocardial Infarction | FAERS: 51 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 73 | Bronchitis | FAERS: 50 | SIDER US FAERS | |
| 74 | Chills | FAERS: 47 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 75 | Blood alkaline phosphatase increased | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 76 | Alanine Aminotransferase Increased | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 77 | Wrong technique in product usage process | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Inflammation | FAERS: 43 | SIDER US FAERS | |
| 79 | Myalgia | FAERS: 43 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 80 | Tremor | FAERS: 43 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 81 | Hypophagia | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 82 | Productive Cough | FAERS: 42 | SIDER US FAERS | |
| 83 | Renal Cell Carcinoma | FAERS: 41 Canada Vigilance: 26 | Canada Vigilance US FAERS | |
| 84 | Aspartate Aminotransferase Increased | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 85 | Concomitant disease progression | FAERS: 40 | OFFSIDES US FAERS | |
| 86 | Bone pain | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Chest discomfort | FAERS: 39 | SIDER US FAERS | |
| 88 | Proteinuria | FAERS: 39 Canada Vigilance: 1 | 24040781 | CTD SIDER Canada Vigilance US FAERS |
| 89 | Blood lactate dehydrogenase increased | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 90 | Blood urea increased | FAERS: 37 | SIDER US FAERS | |
| 91 | Drug level decreased | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 92 | Dysuria | FAERS: 37 | SIDER US FAERS | |
| 93 | Hypoxia | FAERS: 37 | OFFSIDES US FAERS | |
| 94 | Metastatic Renal Cell Carcinoma | FAERS: 36 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 95 | Skin lesion | FAERS: 36 | SIDER US FAERS | |
| 96 | Ageusia | FAERS: 35 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 97 | Lip swelling | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 98 | Skin Ulcer | FAERS: 35 | US FAERS | |
| 99 | Cardiac Arrest | FAERS: 34 | SIDER US FAERS | |
| 100 | Aphthous Stomatitis | FAERS: 33 | SIDER US FAERS | |
| 101 | Respiratory arrest | FAERS: 33 | US FAERS | |
| 102 | Lymphadenopathy | FAERS: 32 | SIDER US FAERS | |
| 103 | Musculoskeletal Pain | FAERS: 32 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 104 | jaundice | FAERS: 32 | SIDER US FAERS | |
| 105 | Acute kidney injury | FAERS: 31 Canada Vigilance: 1 | 19135948 | CTD Canada Vigilance US FAERS |
| 106 | Drug dose omission | FAERS: 31 | US FAERS | |
| 107 | Dysphonia | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 108 | Oncologic complication | FAERS: 31 | US FAERS | |
| 109 | Syncope | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 110 | Ulcer | FAERS: 31 | US FAERS | |
| 111 | Angioedema | FAERS: 30 | 15849555 19006046 | CTD OFFSIDES SIDER US FAERS |
| 112 | Blood potassium decreased | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 113 | Colitis | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 114 | Concomitant disease aggravated | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 115 | Epilepsy | FAERS: 29 | US FAERS | |
| 116 | Pneumothorax | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 117 | Pulmonary Fibrosis | FAERS: 29 | US FAERS | |
| 118 | Tachycardia | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 119 | treatment failure | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 120 | Blood count abnormal | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 121 | Flatulence | FAERS: 28 | SIDER US FAERS | |
| 122 | Leukopenia | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 123 | Deep Vein Thrombosis | FAERS: 26 | SIDER US FAERS | |
| 124 | Neck Pain | FAERS: 26 | US FAERS | |
| 125 | Atrial Fibrillation | FAERS: 25 | SIDER US FAERS | |
| 126 | Cellulitis | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 127 | Cholestasis | FAERS: 25 | 19955336 | CTD US FAERS |
| 128 | Full blood count decreased | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 129 | Septic Shock | FAERS: 25 | US FAERS | |
| 130 | Terminal state | FAERS: 25 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 131 | Dyspepsia | FAERS: 24 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 132 | Rash erythematous | FAERS: 24 | SIDER US FAERS | |
| 133 | Respiratory distress | FAERS: 24 | SIDER US FAERS | |
| 134 | Wheezing | FAERS: 24 | SIDER US FAERS | |
| 135 | Amnesia | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 136 | Burning sensation | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 137 | Pancytopenia | FAERS: 23 | SIDER US FAERS | |
| 138 | furuncle | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 139 | Abasia | FAERS: 22 | US FAERS | |
| 140 | Incorrect dose administered | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 141 | Palpitations | FAERS: 22 | SIDER US FAERS | |
| 142 | Therapy change | FAERS: 22 | US FAERS | |
| 143 | Visual Impairment | FAERS: 22 | US FAERS | |
| 144 | Arthritis | FAERS: 21 | US FAERS | |
| 145 | Cataract | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 146 | Drug level increased | FAERS: 21 | US FAERS | |
| 147 | Nephrotic Syndrome | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 148 | Blood sodium decreased | FAERS: 20 | US FAERS | |
| 149 | Cystitis | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 150 | Disorientation | FAERS: 20 | US FAERS | |
| 151 | Gastroenteritis | FAERS: 20 | SIDER US FAERS | |
| 152 | Aphagia | FAERS: 19 | US FAERS | |
| 153 | Aphasia | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 154 | Diabetic Ketoacidosis | FAERS: 19 | US FAERS | |
| 155 | Hepatotoxicity | FAERS: 19 | US FAERS | |
| 156 | Hypersomnia | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 157 | Ileus | FAERS: 19 | SIDER US FAERS | |
| 158 | Lower respiratory tract infection | FAERS: 19 | SIDER US FAERS | |
| 159 | Onychoclasis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 160 | Pulmonary congestion | FAERS: 19 | US FAERS | |
| 161 | Stress | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 162 | Toothache | FAERS: 19 | US FAERS | |
| 163 | Acute myocardial infarction | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 164 | Asphyxia | FAERS: 18 | US FAERS | |
| 165 | Blood glucose decreased | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 166 | Gastritis | FAERS: 18 | SIDER US FAERS | |
| 167 | Menorrhagia | FAERS: 18 | SIDER US FAERS | |
| 168 | Blood albumin decreased | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 169 | Blood glucose abnormal | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 170 | Blood potassium increased | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 171 | Cheilitis | FAERS: 17 | SIDER US FAERS | |
| 172 | Electrolyte imbalance | FAERS: 17 | US FAERS | |
| 173 | Fracture | FAERS: 17 | US FAERS | |
| 174 | Hypothyroidism | FAERS: 17 | US FAERS | |
| 175 | Neutrophil count decreased | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 176 | Pulmonary toxicity | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 177 | Acute respiratory failure | FAERS: 16 | SIDER US FAERS | |
| 178 | Blood urine present | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 179 | Cholecystitis | FAERS: 16 | SIDER US FAERS | |
| 180 | Febrile Neutropenia | FAERS: 16 | US FAERS | |
| 181 | Flushing | FAERS: 16 | SIDER US FAERS | |
| 182 | Hyperthyroidism | FAERS: 16 | US FAERS | |
| 183 | Inappropriate schedule of drug administration | FAERS: 16 | US FAERS | |
| 184 | Lymphocyte count decreased | FAERS: 16 | SIDER US FAERS | |
| 185 | Pancreatitis | FAERS: 16 | SIDER US FAERS | |
| 186 | Pulmonary Hypertension | FAERS: 16 | US FAERS | |
| 187 | Rales | FAERS: 16 | US FAERS | |
| 188 | Therapy non-responder | FAERS: 16 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 189 | Throat irritation | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 190 | Asthma | FAERS: 15 | US FAERS | |
| 191 | Blood iron decreased | FAERS: 15 | US FAERS | |
| 192 | Cholelithiasis | FAERS: 15 | SIDER US FAERS | |
| 193 | Dermatitis | FAERS: 15 | SIDER US FAERS | |
| 194 | Gastric ulcer | FAERS: 15 | US FAERS | |
| 195 | Gout | FAERS: 15 | SIDER US FAERS | |
| 196 | Hepatitis | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 197 | Leukocytosis | FAERS: 15 | SIDER US FAERS | |
| 198 | Nephrolithiasis | FAERS: 15 | US FAERS | |
| 199 | Osteonecrosis of Jaw | FAERS: 15 | US FAERS | |
| 200 | Performance status decreased | FAERS: 15 | US FAERS | |
| 201 | Polyuria | FAERS: 15 | SIDER US FAERS | |
| 202 | Transaminases increased | FAERS: 15 | SIDER US FAERS | |
| 203 | Agitation | FAERS: 14 | SIDER US FAERS | |
| 204 | Cell marker increased | FAERS: 14 | US FAERS | |
| 205 | Decreased immune responsiveness | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 206 | Dementia | FAERS: 14 | US FAERS | |
| 207 | Depressed Level of Consciousness | FAERS: 14 | US FAERS | |
| 208 | Depressed mood | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 209 | Eczema | FAERS: 14 | US FAERS | |
| 210 | Intestinal Perforation | FAERS: 14 | US FAERS | |
| 211 | Lung consolidation | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 212 | Vertigo | FAERS: 14 | US FAERS | |
| 213 | Atelectasis | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 214 | Blood creatinine decreased | FAERS: 13 | US FAERS | |
| 215 | Bone lesion | FAERS: 13 | US FAERS | |
| 216 | Choking | FAERS: 13 | US FAERS | |
| 217 | Deafness | FAERS: 13 | US FAERS | |
| 218 | Diplopia | FAERS: 13 | US FAERS | |
| 219 | Ejection Fraction Decreased | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 220 | Hepatomegaly | FAERS: 13 | US FAERS | |
| 221 | Joint injury | FAERS: 13 | US FAERS | |
| 222 | Lymphangiosis carcinomatosa | FAERS: 13 | US FAERS | |
| 223 | Metastatic Neoplasm | FAERS: 13 | US FAERS | |
| 224 | Pallor | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 225 | Therapeutic response unexpected | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 226 | Tongue blistering | FAERS: 13 | US FAERS | |
| 227 | Abscess | FAERS: 12 | OFFSIDES US FAERS | |
| 228 | Apparent death | FAERS: 12 | US FAERS | |
| 229 | Arteriosclerosis | FAERS: 12 | US FAERS | |
| 230 | Blood creatine phosphokinase increased | FAERS: 12 | OFFSIDES US FAERS | |
| 231 | Clostridium difficile infection | FAERS: 12 | US FAERS | |
| 232 | Hypokinesia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 233 | Limb discomfort | FAERS: 12 | US FAERS | |
| 234 | Malnutrition | FAERS: 12 | SIDER US FAERS | |
| 235 | Mouth swelling | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 236 | Nervousness | FAERS: 12 | US FAERS | |
| 237 | Renal cyst | FAERS: 12 | US FAERS | |
| 238 | Rhabdomyolysis | FAERS: 12 | SIDER US FAERS | |
| 239 | Anger | FAERS: 11 | US FAERS | |
| 240 | Angina Pectoris | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 241 | Biliary dilatation | FAERS: 11 | US FAERS | |
| 242 | Blindness | FAERS: 11 | US FAERS | |
| 243 | Cachexia | FAERS: 11 | US FAERS | |
| 244 | Conjunctivitis | FAERS: 11 | SIDER US FAERS | |
| 245 | Cyanosis | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 246 | Dermatitis acneiform | FAERS: 11 | SIDER US FAERS | |
| 247 | Discomfort | FAERS: 11 | SIDER US FAERS | |
| 248 | Drug toxicity | FAERS: 11 | US FAERS | |
| 249 | Folliculitis | FAERS: 11 | SIDER US FAERS | |
| 250 | Inappropriate schedule of product administration | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 251 | Laryngitis | FAERS: 11 | US FAERS | |
| 252 | Liver transplant rejection | FAERS: 11 | US FAERS | |
| 253 | Night sweats | FAERS: 11 | SIDER US FAERS | |
| 254 | Nodule | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 255 | Sneezing | FAERS: 11 | US FAERS | |
| 256 | Tumour haemorrhage | FAERS: 11 | US FAERS | |
| 257 | Cerebral Infarction | FAERS: 10 | US FAERS | |
| 258 | Coronary Artery Disease | FAERS: 10 | US FAERS | |
| 259 | Device occlusion | FAERS: 10 | US FAERS | |
| 260 | Disseminated Intravascular Coagulation | FAERS: 10 | US FAERS | |
| 261 | Drug administered to patient of inappropriate age | FAERS: 10 | US FAERS | |
| 262 | Duodenal Ulcer | FAERS: 10 | US FAERS | |
| 263 | Escherichia infection | FAERS: 10 | US FAERS | |
| 264 | Gait inability | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 265 | Mental status changes | FAERS: 10 | US FAERS | |
| 266 | Musculoskeletal chest pain | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 267 | Oropharyngeal blistering | FAERS: 10 | US FAERS | |
| 268 | Pancreatic carcinoma | FAERS: 10 | US FAERS | |
| 269 | Renal mass | FAERS: 10 | US FAERS | |
| 270 | Subileus | FAERS: 10 | US FAERS | |
| 271 | Viral upper respiratory tract infection | FAERS: 10 | US FAERS | |
| 272 | Aphonia | FAERS: 9 | US FAERS | |
| 273 | Appendicitis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 274 | Blood creatine increased | FAERS: 9 | US FAERS | |
| 275 | Candidiasis | FAERS: 9 | US FAERS | |
| 276 | Central nervous system lesion | FAERS: 9 | US FAERS | |
| 277 | Cholangitis | FAERS: 9 | US FAERS | |
| 278 | Dental caries | FAERS: 9 | US FAERS | |
| 279 | Drug level below therapeutic | FAERS: 9 | US FAERS | |
| 280 | Erythema Nodosum | FAERS: 9 | US FAERS | |
| 281 | Gastrointestinal obstruction | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 282 | Gingivitis | FAERS: 9 | SIDER US FAERS | |
| 283 | Hernia | FAERS: 9 | US FAERS | |
| 284 | Liver Abscess | FAERS: 9 | US FAERS | |
| 285 | Low density lipoprotein increased | FAERS: 9 | US FAERS | |
| 286 | Metabolic acidosis | FAERS: 9 | US FAERS | |
| 287 | Neuralgia | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 288 | Noninfective gingivitis | FAERS: 9 | US FAERS | |
| 289 | Oral candidiasis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 290 | Personality Change | FAERS: 9 | US FAERS | |
| 291 | Petechiae | FAERS: 9 | US FAERS | |
| 292 | Pharyngitis | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 293 | Post procedural complication | FAERS: 9 | US FAERS | |
| 294 | Renal pain | FAERS: 9 | US FAERS | |
| 295 | Restlessness | FAERS: 9 | US FAERS | |
| 296 | Skin reaction | FAERS: 9 | US FAERS | |
| 297 | Squamous cell carcinoma of skin | FAERS: 9 | OFFSIDES US FAERS | |
| 298 | Urinary Retention | FAERS: 9 | SIDER US FAERS | |
| 299 | Altered state of consciousness | FAERS: 8 | US FAERS | |
| 300 | Astrocytoma, low grade | FAERS: 8 | US FAERS | |
| 301 | Basal cell carcinoma | FAERS: 8 | SIDER US FAERS | |
| 302 | Blood magnesium decreased | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 303 | Bronchopulmonary Aspergillosis | FAERS: 8 | US FAERS | |
| 304 | Chromaturia | FAERS: 8 | US FAERS | |
| 305 | Cytopenia | FAERS: 8 | US FAERS | |
| 306 | Empyema | FAERS: 8 | US FAERS | |
| 307 | Eye pain | FAERS: 8 | US FAERS | |
| 308 | Haematotoxicity | FAERS: 8 | US FAERS | |
| 309 | Lymphocele | FAERS: 8 | SIDER US FAERS | |
| 310 | Metastases to adrenals | FAERS: 8 | US FAERS | |
| 311 | Onycholysis | FAERS: 8 | US FAERS | |
| 312 | Ophthalmoplegia | FAERS: 8 | US FAERS | |
| 313 | Papule | FAERS: 8 | US FAERS | |
| 314 | Product dose omission | FAERS: 8 | US FAERS | |
| 315 | Protein urine present | FAERS: 8 | SIDER US FAERS | |
| 316 | Scab | FAERS: 8 | US FAERS | |
| 317 | Thoracic cavity drainage | FAERS: 8 | US FAERS | |
| 318 | Unevaluable event | FAERS: 8 | US FAERS | |
| 319 | Acute Coronary Syndrome | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 320 | Adverse event | FAERS: 7 | US FAERS | |
| 321 | Angiofibroma | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 322 | Angiomyolipoma | FAERS: 7 | US FAERS | |
| 323 | Arthropod bite | FAERS: 7 | US FAERS | |
| 324 | Bile Duct Stenosis | FAERS: 7 | US FAERS | |
| 325 | Blood chromogranin A increased | FAERS: 7 | US FAERS | |
| 326 | Bowel movement irregularity | FAERS: 7 | US FAERS | |
| 327 | Diverticulitis | FAERS: 7 | US FAERS | |
| 328 | Drug administration error | FAERS: 7 | US FAERS | |
| 329 | Drug prescribing error | FAERS: 7 | US FAERS | |
| 330 | Dysarthria | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 331 | Embolism | FAERS: 7 | SIDER US FAERS | |
| 332 | Eructation | FAERS: 7 | US FAERS | |
| 333 | Flank Pain | FAERS: 7 | US FAERS | |
| 334 | Gastrointestinal perforation | FAERS: 7 | US FAERS | |
| 335 | General physical condition abnormal | FAERS: 7 | US FAERS | |
| 336 | Hordeolum | FAERS: 7 | US FAERS | |
| 337 | Incisional hernia | FAERS: 7 | SIDER US FAERS | |
| 338 | Limb injury | FAERS: 7 | US FAERS | |
| 339 | Lymphopenia | FAERS: 7 | SIDER US FAERS | |
| 340 | Necrosis | FAERS: 7 | US FAERS | |
| 341 | Nocturia | FAERS: 7 | US FAERS | |
| 342 | Osteoporosis | FAERS: 7 | SIDER US FAERS | |
| 343 | Pelvic Pain | FAERS: 7 | US FAERS | |
| 344 | Protein total decreased | FAERS: 7 | US FAERS | |
| 345 | Renal cancer metastatic | FAERS: 7 | US FAERS | |
| 346 | Retching | FAERS: 7 | US FAERS | |
| 347 | Shock | FAERS: 7 | SIDER US FAERS | |
| 348 | Sinus Tachycardia | FAERS: 7 | US FAERS | |
| 349 | Skin toxicity | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 350 | Status Epilepticus | FAERS: 7 | US FAERS | |
| 351 | Thirst | FAERS: 7 | US FAERS | |
| 352 | Tuberculosis | FAERS: 7 | US FAERS | |
| 353 | Urinary Incontinence | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 354 | Wrong technique in drug usage process | FAERS: 7 | US FAERS | |
| 355 | Bilirubin conjugated increased | FAERS: 6 | US FAERS | |
| 356 | Bronchiectasis | FAERS: 6 | US FAERS | |
| 357 | Cardiomegaly | FAERS: 6 | US FAERS | |
| 358 | Cold sweat | FAERS: 6 | US FAERS | |
| 359 | Creatinine renal clearance decreased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 360 | Drug effect incomplete | FAERS: 6 | US FAERS | |
| 361 | Enterococcal infection | FAERS: 6 | US FAERS | |
| 362 | Feeling Cold | FAERS: 6 | US FAERS | |
| 363 | Hospice Care | FAERS: 6 | US FAERS | |
| 364 | Hydrocephalus | FAERS: 6 | US FAERS | |
| 365 | Hydrothorax | FAERS: 6 | US FAERS | |
| 366 | Hypertensive crisis | FAERS: 6 | SIDER US FAERS | |
| 367 | Immunosuppressant drug level increased | FAERS: 6 | US FAERS | |
| 368 | Infarction | FAERS: 6 | US FAERS | |
| 369 | Iron deficiency | FAERS: 6 | SIDER US FAERS | |
| 370 | Localised intraabdominal fluid collection | FAERS: 6 | SIDER US FAERS | |
| 371 | Lymphangioleiomyomatosis | FAERS: 6 | SIDER US FAERS | |
| 372 | Mood swings | FAERS: 6 | US FAERS | |
| 373 | Muscle strain | FAERS: 6 | US FAERS | |
| 374 | Oral mucosal erythema | FAERS: 6 | US FAERS | |
| 375 | Pancreatic Neoplasm | FAERS: 6 | US FAERS | |
| 376 | Pneumocystis jiroveci pneumonia | FAERS: 6 | US FAERS | |
| 377 | Poor quality sleep | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 378 | Pulmonary thrombosis | FAERS: 6 | US FAERS | |
| 379 | Respiratory tract congestion | FAERS: 6 | US FAERS | |
| 380 | Secretion discharge | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 381 | Squamous cell carcinoma | FAERS: 6 | SIDER US FAERS | |
| 382 | Stevens-Johnson Syndrome | FAERS: 6 | US FAERS | |
| 383 | Sudden death | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 384 | Tooth Loss | FAERS: 6 | US FAERS | |
| 385 | Wound Infection | FAERS: 6 | SIDER US FAERS | |
| 386 | Abdominal mass | FAERS: 5 | US FAERS | |
| 387 | Anuria | FAERS: 5 | OFFSIDES US FAERS | |
| 388 | Atrial Flutter | FAERS: 5 | US FAERS | |
| 389 | Blood glucose fluctuation | FAERS: 5 | US FAERS | |
| 390 | Blood phosphorus decreased | FAERS: 5 | SIDER US FAERS | |
| 391 | Bradyphrenia | FAERS: 5 | US FAERS | |
| 392 | Bronchopneumonia | FAERS: 5 | US FAERS | |
| 393 | Carcinoembryonic antigen increased | FAERS: 5 | US FAERS | |
| 394 | Cardiac Tamponade | FAERS: 5 | US FAERS | |
| 395 | Cerebral disorder | FAERS: 5 | US FAERS | |
| 396 | Crying | FAERS: 5 | US FAERS | |
| 397 | Diabetes mellitus inadequate control | FAERS: 5 | US FAERS | |
| 398 | Disease complication | FAERS: 5 | US FAERS | |
| 399 | Disease recurrence | FAERS: 5 | US FAERS | |
| 400 | Erysipelas | FAERS: 5 | US FAERS | |
| 401 | Eye Infection | FAERS: 5 | US FAERS | |
| 402 | Eye irritation | FAERS: 5 | US FAERS | |
| 403 | Gastrointestinal inflammation | FAERS: 5 | US FAERS | |
| 404 | Glossitis | FAERS: 5 | SIDER US FAERS | |
| 405 | Hepatic necrosis | FAERS: 5 | US FAERS | |
| 406 | Hepatitis C | FAERS: 5 | SIDER US FAERS | |
| 407 | Hydronephrosis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 408 | Leukoencephalopathy | FAERS: 5 | US FAERS | |
| 409 | Lymphoma | FAERS: 5 | SIDER US FAERS | |
| 410 | Nasal discomfort | FAERS: 5 | US FAERS | |
| 411 | Nerve injury | FAERS: 5 | US FAERS | |
| 412 | Oliguria | FAERS: 5 | OFFSIDES US FAERS | |
| 413 | Oral fungal infection | FAERS: 5 | US FAERS | |
| 414 | Overdose | FAERS: 5 | US FAERS | |
| 415 | Pain of skin | FAERS: 5 | US FAERS | |
| 416 | Pathological fracture | FAERS: 5 | US FAERS | |
| 417 | Pelvic fluid collection | FAERS: 5 | US FAERS | |
| 418 | Pericarditis | FAERS: 5 | US FAERS | |
| 419 | Peripheral venous disease | FAERS: 5 | US FAERS | |
| 420 | Peritonitis | FAERS: 5 | SIDER US FAERS | |
| 421 | Pleurisy | FAERS: 5 | US FAERS | |
| 422 | Portal Hypertension | FAERS: 5 | US FAERS | |
| 423 | Product physical issue | FAERS: 5 | US FAERS | |
| 424 | Pulmonary function test decreased | FAERS: 5 | US FAERS | |
| 425 | Retinal Detachment | FAERS: 5 | US FAERS | |
| 426 | Sinus headache | FAERS: 5 | US FAERS | |
| 427 | Superinfection | FAERS: 5 | US FAERS | |
| 428 | Tooth Infection | FAERS: 5 | US FAERS | |
| 429 | Unresponsive to stimuli | FAERS: 5 | US FAERS | |
| 430 | Viral myocarditis | FAERS: 5 | US FAERS | |
| 431 | Vocal Cord Paralysis | FAERS: 5 | US FAERS | |
| 432 | nervous system disorder | FAERS: 5 | SIDER US FAERS | |
| 433 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 434 | Anal Fissure | FAERS: 4 | US FAERS | |
| 435 | Anosmia | FAERS: 4 | US FAERS | |
| 436 | Arthropathy | FAERS: 4 | US FAERS | |
| 437 | Atrioventricular Block | FAERS: 4 | US FAERS | |
| 438 | Atypical pneumonia | FAERS: 4 | US FAERS | |
| 439 | Benign Prostatic Hyperplasia | FAERS: 4 | US FAERS | |
| 440 | Blood amylase increased | FAERS: 4 | US FAERS | |
| 441 | Bone marrow toxicity | FAERS: 4 | US FAERS | |
| 442 | Bronchospasm | FAERS: 4 | SIDER US FAERS | |
| 443 | Bursitis | FAERS: 4 | US FAERS | |
| 444 | Colectomy | FAERS: 4 | US FAERS | |
| 445 | Croup infectious | FAERS: 4 | US FAERS | |
| 446 | Cytolytic hepatitis | FAERS: 4 | US FAERS | |
| 447 | Drooling | FAERS: 4 | US FAERS | |
| 448 | Emotional distress | FAERS: 4 | US FAERS | |
| 449 | Endocarditis | FAERS: 4 | US FAERS | |
| 450 | Enuresis | FAERS: 4 | US FAERS | |
| 451 | Erectile dysfunction | FAERS: 4 | SIDER US FAERS | |
| 452 | Escherichia urinary tract infection | FAERS: 4 | OFFSIDES US FAERS | |
| 453 | Facial Pain | FAERS: 4 | US FAERS | |
| 454 | Failure to Thrive | FAERS: 4 | US FAERS | |
| 455 | Gangrene | FAERS: 4 | US FAERS | |
| 456 | Gastric Antral Vascular Ectasia | FAERS: 4 | US FAERS | |
| 457 | Gastrointestinal Pain | FAERS: 4 | SIDER US FAERS | |
| 458 | Gastrointestinal wall thickening | FAERS: 4 | US FAERS | |
| 459 | Head discomfort | FAERS: 4 | US FAERS | |
| 460 | Hepatic artery thrombosis | FAERS: 4 | SIDER US FAERS | |
| 461 | Hepatitis B | FAERS: 4 | SIDER US FAERS | |
| 462 | Hepatorenal Syndrome | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 463 | Hormone level abnormal | FAERS: 4 | US FAERS | |
| 464 | Hyperpyrexia | FAERS: 4 | US FAERS | |
| 465 | Ileectomy | FAERS: 4 | US FAERS | |
| 466 | Immunosuppression | FAERS: 4 | US FAERS | |
| 467 | Impaired insulin secretion | FAERS: 4 | US FAERS | |
| 468 | Intracranial Aneurysm | FAERS: 4 | US FAERS | |
| 469 | Laceration | FAERS: 4 | US FAERS | |
| 470 | Loose tooth | FAERS: 4 | US FAERS | |
| 471 | Lung Abscess | FAERS: 4 | US FAERS | |
| 472 | Lung infiltration malignant | FAERS: 4 | US FAERS | |
| 473 | Lymphocytosis | FAERS: 4 | US FAERS | |
| 474 | Macular degeneration | FAERS: 4 | US FAERS | |
| 475 | Malabsorption | FAERS: 4 | US FAERS | |
| 476 | Malignant tumour excision | FAERS: 4 | US FAERS | |
| 477 | Maternal exposure during pregnancy | FAERS: 4 | US FAERS | |
| 478 | Mechanical ileus | FAERS: 4 | US FAERS | |
| 479 | Musculoskeletal discomfort | FAERS: 4 | SIDER US FAERS | |
| 480 | Musculoskeletal stiffness | FAERS: 4 | US FAERS | |
| 481 | Obstruction | FAERS: 4 | US FAERS | |
| 482 | Ocular icterus | FAERS: 4 | US FAERS | |
| 483 | Oral mucosal exfoliation | FAERS: 4 | US FAERS | |
| 484 | Osteitis | FAERS: 4 | US FAERS | |
| 485 | Osteolysis | FAERS: 4 | US FAERS | |
| 486 | Polydipsia | FAERS: 4 | US FAERS | |
| 487 | Post lumbar puncture syndrome | FAERS: 4 | US FAERS | |
| 488 | Posterior reversible encephalopathy syndrome | FAERS: 4 | US FAERS | |
| 489 | Product quality issue | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 490 | Psoriasis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 491 | Purulence | FAERS: 4 | US FAERS | |
| 492 | Pyelonephritis | FAERS: 4 | SIDER US FAERS | |
| 493 | Renal Colic | FAERS: 4 | US FAERS | |
| 494 | Renal tubular necrosis | FAERS: 4 | SIDER US FAERS | |
| 495 | Restrictive pulmonary disease | FAERS: 4 | US FAERS | |
| 496 | Retinal Vein Occlusion | FAERS: 4 | US FAERS | |
| 497 | Rhinitis | FAERS: 4 | SIDER US FAERS | |
| 498 | Right ventricular failure | FAERS: 4 | US FAERS | |
| 499 | Seroma | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 500 | Skin irritation | FAERS: 4 | US FAERS | |
| 501 | Suture insertion | FAERS: 4 | US FAERS | |
| 502 | Synovial Cyst | FAERS: 4 | US FAERS | |
| 503 | Tongue discomfort | FAERS: 4 | US FAERS | |
| 504 | Tonsillitis | FAERS: 4 | US FAERS | |
| 505 | Umbilical hernia | FAERS: 4 | US FAERS | |
| 506 | Vulvovaginal discomfort | FAERS: 4 | US FAERS | |
| 507 | Wound dehiscence | FAERS: 4 | SIDER US FAERS | |
| 508 | effusion | FAERS: 4 | US FAERS | |
| 509 | Abdominal Abscess | FAERS: 3 | US FAERS | |
| 510 | Abdominal tenderness | FAERS: 3 | US FAERS | |
| 511 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 512 | Acidosis | FAERS: 3 | SIDER US FAERS | |
| 513 | Acute Lung Injury | FAERS: 3 | US FAERS | |
| 514 | Acute prerenal failure | FAERS: 3 | US FAERS | |
| 515 | Allergic cough | FAERS: 3 | US FAERS | |
| 516 | Anal Fistula | FAERS: 3 | OFFSIDES US FAERS | |
| 517 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 518 | Ankle Fracture | FAERS: 3 | US FAERS | |
| 519 | Aortic Aneurysm | FAERS: 3 | US FAERS | |
| 520 | Aspergillosis | FAERS: 3 | SIDER US FAERS | |
| 521 | Asthenopia | FAERS: 3 | US FAERS | |
| 522 | Back disorder | FAERS: 3 | US FAERS | |
| 523 | Bacteriuria | FAERS: 3 | US FAERS | |
| 524 | Bedridden | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 525 | Bipolar Disorder | FAERS: 3 | US FAERS | |
| 526 | Blood creatinine abnormal | FAERS: 3 | US FAERS | |
| 527 | Blood gastrin increased | FAERS: 3 | US FAERS | |
| 528 | Blood thyroid stimulating hormone decreased | FAERS: 3 | US FAERS | |
| 529 | Blood thyroid stimulating hormone increased | FAERS: 3 | US FAERS | |
| 530 | Blood triglycerides abnormal | FAERS: 3 | US FAERS | |
| 531 | Bone density decreased | FAERS: 3 | US FAERS | |
| 532 | Bradycardia | FAERS: 3 | US FAERS | |
| 533 | Brain natriuretic peptide increased | FAERS: 3 | US FAERS | |
| 534 | Breast cancer recurrent | FAERS: 3 | US FAERS | |
| 535 | Bronchial Obstruction | FAERS: 3 | US FAERS | |
| 536 | Bronchial wall thickening | FAERS: 3 | US FAERS | |
| 537 | Cancer Pain | FAERS: 3 | US FAERS | |
| 538 | Carbohydrate antigen 27.29 increased | FAERS: 3 | US FAERS | |
| 539 | Cardiac dysfunction | FAERS: 3 | US FAERS | |
| 540 | Cardiotoxicity | FAERS: 3 | US FAERS | |
| 541 | Chromatopsia | FAERS: 3 | US FAERS | |
| 542 | Colonic fistula | FAERS: 3 | US FAERS | |
| 543 | Complication associated with device | FAERS: 3 | US FAERS | |
| 544 | Diaphragmatic Hernia | FAERS: 3 | US FAERS | |
| 545 | Diffuse alveolar damage | FAERS: 3 | US FAERS | |
| 546 | Drug withdrawal syndrome | FAERS: 3 | US FAERS | |
| 547 | Dysgraphia | FAERS: 3 | US FAERS | |
| 548 | Ecchymosis | FAERS: 3 | US FAERS | |
| 549 | Enteritis | FAERS: 3 | US FAERS | |
| 550 | Enterocolitis | FAERS: 3 | US FAERS | |
| 551 | Epididymitis | FAERS: 3 | US FAERS | |
| 552 | Erythema Multiforme | FAERS: 3 | US FAERS | |
| 553 | Expired product administered | FAERS: 3 | US FAERS | |
| 554 | Extremity necrosis | FAERS: 3 | US FAERS | |
| 555 | Eye inflammation | FAERS: 3 | US FAERS | |
| 556 | Fibrosis | FAERS: 3 | SIDER US FAERS | |
| 557 | Fluid overload | FAERS: 3 | US FAERS | |
| 558 | Foaming at mouth | FAERS: 3 | US FAERS | |
| 559 | Gastric mucosal lesion | FAERS: 3 | US FAERS | |
| 560 | Gastrointestinal infection | FAERS: 3 | US FAERS | |
| 561 | Gastrointestinal toxicity | FAERS: 3 | US FAERS | |
| 562 | Genital pain | FAERS: 3 | US FAERS | |
| 563 | Granuloma | FAERS: 3 | US FAERS | |
| 564 | Hepatic Encephalopathy | FAERS: 3 | US FAERS | |
| 565 | Hernia pain | FAERS: 3 | US FAERS | |
| 566 | Hyper HDL cholesterolaemia | FAERS: 3 | US FAERS | |
| 567 | Idiopathic Pulmonary Fibrosis | FAERS: 3 | US FAERS | |
| 568 | Ileal ulcer | FAERS: 3 | US FAERS | |
| 569 | Impaired work ability | FAERS: 3 | US FAERS | |
| 570 | Incontinence | FAERS: 3 | US FAERS | |
| 571 | Incorrect route of product administration | FAERS: 3 | US FAERS | |
| 572 | Increased upper airway secretion | FAERS: 3 | US FAERS | |
| 573 | Infectious peritonitis | FAERS: 3 | US FAERS | |
| 574 | Insurance issue | FAERS: 3 | US FAERS | |
| 575 | Ketosis | FAERS: 3 | US FAERS | |
| 576 | Large intestine perforation | FAERS: 3 | US FAERS | |
| 577 | Lipase increased | FAERS: 3 | US FAERS | |
| 578 | Lipids abnormal | FAERS: 3 | US FAERS | |
| 579 | Lymphangitis | FAERS: 3 | US FAERS | |
| 580 | Lymphocyte count increased | FAERS: 3 | US FAERS | |
| 581 | Malignant ascites | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 582 | Medication Error | FAERS: 3 | US FAERS | |
| 583 | Mental impairment | FAERS: 3 | US FAERS | |
| 584 | Metastases to pelvis | FAERS: 3 | US FAERS | |
| 585 | Metastases to stomach | FAERS: 3 | US FAERS | |
| 586 | Nephritis | FAERS: 3 | US FAERS | |
| 587 | Non-high-density lipoprotein cholesterol increased | FAERS: 3 | US FAERS | |
| 588 | Onychomycosis | FAERS: 3 | SIDER US FAERS | |
| 589 | Oral infection | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 590 | Oral mucosal eruption | FAERS: 3 | US FAERS | |
| 591 | Oropharyngeal plaque | FAERS: 3 | US FAERS | |
| 592 | Overweight | FAERS: 3 | US FAERS | |
| 593 | Palliative Care | FAERS: 3 | US FAERS | |
| 594 | Pancreatic enzymes increased | FAERS: 3 | US FAERS | |
| 595 | Periodontitis | FAERS: 3 | US FAERS | |
| 596 | Photophobia | FAERS: 3 | US FAERS | |
| 597 | Pleuritic pain | FAERS: 3 | US FAERS | |
| 598 | Polyneuropathy | FAERS: 3 | US FAERS | |
| 599 | Presyncope | FAERS: 3 | US FAERS | |
| 600 | Proctitis | FAERS: 3 | US FAERS | |
| 601 | Product use complaint | FAERS: 3 | US FAERS | |
| 602 | Pulmonary Infarction | FAERS: 3 | US FAERS | |
| 603 | Pulmonary sepsis | FAERS: 3 | US FAERS | |
| 604 | Purulent discharge | FAERS: 3 | US FAERS | |
| 605 | Radiation injury | FAERS: 3 | US FAERS | |
| 606 | Radiation skin injury | FAERS: 3 | US FAERS | |
| 607 | Rectal abscess | FAERS: 3 | US FAERS | |
| 608 | Renal aneurysm | FAERS: 3 | US FAERS | |
| 609 | Renal tubular disorder | FAERS: 3 | US FAERS | |
| 610 | Respiratory fatigue | FAERS: 3 | US FAERS | |
| 611 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 612 | Rotator cuff syndrome | FAERS: 3 | US FAERS | |
| 613 | Sarcoma | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 614 | Sciatica | FAERS: 3 | US FAERS | |
| 615 | Sexual Dysfunction | FAERS: 3 | US FAERS | |
| 616 | Skin Erosion | FAERS: 3 | US FAERS | |
| 617 | Skin Papilloma | FAERS: 3 | SIDER US FAERS | |
| 618 | Skin hypertrophy | FAERS: 3 | US FAERS | |
| 619 | Skin neoplasm excision | FAERS: 3 | US FAERS | |
| 620 | Slow speech | FAERS: 3 | US FAERS | |
| 621 | Sunburn | FAERS: 3 | US FAERS | |
| 622 | Testicular seminoma (pure) stage II | FAERS: 3 | US FAERS | |
| 623 | Throat cancer | FAERS: 3 | US FAERS | |
| 624 | Thyroid Neoplasm | FAERS: 3 | US FAERS | |
| 625 | Total bile acids increased | FAERS: 3 | US FAERS | |
| 626 | Underweight | FAERS: 3 | US FAERS | |
| 627 | Upper airway obstruction | FAERS: 3 | US FAERS | |
| 628 | Upper-airway cough syndrome | FAERS: 3 | US FAERS | |
| 629 | Urinary Tract Pain | FAERS: 3 | US FAERS | |
| 630 | Uterine Cancer | FAERS: 3 | US FAERS | |
| 631 | Vasculitis | FAERS: 3 | US FAERS | |
| 632 | Venous Thrombosis | FAERS: 3 | US FAERS | |
| 633 | Ventricular arrhythmia | FAERS: 3 | US FAERS | |
| 634 | Vitrectomy | FAERS: 3 | US FAERS | |
| 635 | Wound Complication | FAERS: 3 | SIDER US FAERS | |
| 636 | prostatitis | FAERS: 3 | US FAERS | |
| 637 | Abdominal adhesions | FAERS: 2 | US FAERS | |
| 638 | Abdominal cavity drainage | FAERS: 2 | US FAERS | |
| 639 | Abdominal strangulated hernia | FAERS: 2 | US FAERS | |
| 640 | Actinomycosis | FAERS: 2 | US FAERS | |
| 641 | Adrenal mass | FAERS: 2 | US FAERS | |
| 642 | Akinesia | FAERS: 2 | US FAERS | |
| 643 | Albuminuria | FAERS: 2 | US FAERS | |
| 644 | Alveolitis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 645 | Ammonia increased | FAERS: 2 | US FAERS | |
| 646 | Amylase increased | FAERS: 2 | US FAERS | |
| 647 | Amyotrophic Lateral Sclerosis | FAERS: 2 | US FAERS | |
| 648 | Anal abscess | FAERS: 2 | US FAERS | |
| 649 | Anaphylactoid Reaction | FAERS: 2 | US FAERS | |
| 650 | Anorectal discomfort | FAERS: 2 | US FAERS | |
| 651 | Arteritis | FAERS: 2 | US FAERS | |
| 652 | Azoospermia | FAERS: 2 | US FAERS | |
| 653 | Benign neoplasm of prostate | FAERS: 2 | US FAERS | |
| 654 | Bile duct necrosis | FAERS: 2 | US FAERS | |
| 655 | Biloma | FAERS: 2 | US FAERS | |
| 656 | Bladder Diverticulum | FAERS: 2 | US FAERS | |
| 657 | Blood chloride increased | FAERS: 2 | US FAERS | |
| 658 | Blood electrolytes abnormal | FAERS: 2 | US FAERS | |
| 659 | Blood electrolytes decreased | FAERS: 2 | US FAERS | |
| 660 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 661 | Blood product transfusion dependent | FAERS: 2 | OFFSIDES US FAERS | |
| 662 | Blood sodium increased | FAERS: 2 | US FAERS | |
| 663 | Blood testosterone decreased | FAERS: 2 | SIDER US FAERS | |
| 664 | Bone fragmentation | FAERS: 2 | US FAERS | |
| 665 | Bowen's Disease | FAERS: 2 | US FAERS | |
| 666 | Bruxism | FAERS: 2 | US FAERS | |
| 667 | Candida pneumonia | FAERS: 2 | US FAERS | |
| 668 | Capillary Leak Syndrome | FAERS: 2 | US FAERS | |
| 669 | Carbohydrate antigen 15-3 increased | FAERS: 2 | US FAERS | |
| 670 | Cardiac Death | FAERS: 2 | US FAERS | |
| 671 | Cardiac Hypertrophy | FAERS: 2 | US FAERS | |
| 672 | Cardiac enzymes increased | FAERS: 2 | US FAERS | |
| 673 | Cardiac neoplasm unspecified | FAERS: 2 | US FAERS | |
| 674 | Cauda Equina Syndrome | FAERS: 2 | US FAERS | |
| 675 | Cell Death | FAERS: 2 | US FAERS | |
| 676 | Cerebral Thrombosis | FAERS: 2 | US FAERS | |
| 677 | Cerebrospinal fistula | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 678 | Cervix carcinoma | FAERS: 2 | US FAERS | |
| 679 | Chemical burn of gastrointestinal tract | FAERS: 2 | US FAERS | |
| 680 | Choking sensation | FAERS: 2 | OFFSIDES US FAERS | |
| 681 | Cholangiolitis | FAERS: 2 | US FAERS | |
| 682 | Chylothorax | FAERS: 2 | US FAERS | |
| 683 | Clostridium difficile colitis | FAERS: 2 | OFFSIDES US FAERS | |
| 684 | Coagulation test abnormal | FAERS: 2 | US FAERS | |
| 685 | Completed Suicide | FAERS: 2 | US FAERS | |
| 686 | Conjunctival scar | FAERS: 2 | US FAERS | |
| 687 | Craniosynostosis | FAERS: 2 | US FAERS | |
| 688 | Cyst drainage | FAERS: 2 | US FAERS | |
| 689 | Delirium | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 690 | Diet refusal | FAERS: 2 | US FAERS | |
| 691 | Drowning | FAERS: 2 | US FAERS | |
| 692 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 693 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 694 | Drug level changed | FAERS: 2 | US FAERS | |
| 695 | Drug resistance | FAERS: 2 | US FAERS | |
| 696 | Ear congestion | FAERS: 2 | US FAERS | |
| 697 | Ear discomfort | FAERS: 2 | US FAERS | |
| 698 | Early satiety | FAERS: 2 | US FAERS | |
| 699 | Economic problem | FAERS: 2 | US FAERS | |
| 700 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 701 | Emergency Care | FAERS: 2 | US FAERS | |
| 702 | Emotional disorder | FAERS: 2 | US FAERS | |
| 703 | Encephalitis | FAERS: 2 | US FAERS | |
| 704 | Enlarged uvula | FAERS: 2 | US FAERS | |
| 705 | Eosinophilic Pneumonia | FAERS: 2 | US FAERS | |
| 706 | Epileptic psychosis | FAERS: 2 | US FAERS | |
| 707 | Exposed bone in jaw | FAERS: 2 | US FAERS | |
| 708 | Exposure via partner | FAERS: 2 | US FAERS | |
| 709 | Eye ulcer | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 710 | Face and mouth X-ray abnormal | FAERS: 2 | US FAERS | |
| 711 | Facial paralysis | FAERS: 2 | US FAERS | |
| 712 | Fasciitis | FAERS: 2 | US FAERS | |
| 713 | Feeling jittery | FAERS: 2 | US FAERS | |
| 714 | Fibrin D dimer increased | FAERS: 2 | US FAERS | |
| 715 | Fibrin abnormal | FAERS: 2 | US FAERS | |
| 716 | Fluid imbalance | FAERS: 2 | US FAERS | |
| 717 | Fracture pain | FAERS: 2 | US FAERS | |
| 718 | Frustration tolerance decreased | FAERS: 2 | US FAERS | |
| 719 | Full blood count abnormal | FAERS: 2 | US FAERS | |
| 720 | Gastric Dilatation | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 721 | Gastrointestinal ulcer | FAERS: 2 | US FAERS | |
| 722 | Glaucoma | FAERS: 2 | US FAERS | |
| 723 | Glomerulonephritis | FAERS: 2 | 16302997 | CTD OFFSIDES SIDER US FAERS |
| 724 | Glucagonoma | FAERS: 2 | US FAERS | |
| 725 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 726 | Hemiparesis | FAERS: 2 | SIDER US FAERS | |
| 727 | Hepatic Infection | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 728 | Hepatic cancer metastatic | FAERS: 2 | US FAERS | |
| 729 | Hyperchlorhydria | FAERS: 2 | US FAERS | |
| 730 | Hyperkeratosis | FAERS: 2 | US FAERS | |
| 731 | Hypermetabolism | FAERS: 2 | US FAERS | |
| 732 | Hypertensive emergency | FAERS: 2 | US FAERS | |
| 733 | Hyperventilation | FAERS: 2 | US FAERS | |
| 734 | Hypogeusia | FAERS: 2 | US FAERS | |
| 735 | Hypometabolism | FAERS: 2 | US FAERS | |
| 736 | Ileitis | FAERS: 2 | US FAERS | |
| 737 | Impaired gastric emptying | FAERS: 2 | US FAERS | |
| 738 | Impatience | FAERS: 2 | US FAERS | |
| 739 | Implantable pleural catheter insertion | FAERS: 2 | US FAERS | |
| 740 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 741 | Infantile spitting up | FAERS: 2 | US FAERS | |
| 742 | Inflammatory marker increased | FAERS: 2 | US FAERS | |
| 743 | Intellectual Disability | FAERS: 2 | US FAERS | |
| 744 | Joint stiffness | FAERS: 2 | US FAERS | |
| 745 | Karnofsky scale worsened | FAERS: 2 | US FAERS | |
| 746 | Left atrial dilatation | FAERS: 2 | US FAERS | |
| 747 | Limb asymmetry | FAERS: 2 | US FAERS | |
| 748 | Lip and/or oral cavity cancer | FAERS: 2 | US FAERS | |
| 749 | Lipoma | FAERS: 2 | US FAERS | |
| 750 | Lung infection pseudomonal | FAERS: 2 | US FAERS | |
| 751 | Lymphatic obstruction | FAERS: 2 | US FAERS | |
| 752 | Lymphocytic infiltration | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 753 | Macule | FAERS: 2 | US FAERS | |
| 754 | Mastitis | FAERS: 2 | US FAERS | |
| 755 | Maternal exposure before pregnancy | FAERS: 2 | US FAERS | |
| 756 | Mechanical ventilation | FAERS: 2 | US FAERS | |
| 757 | Metaplasia | FAERS: 2 | US FAERS | |
| 758 | Metastases to thorax | FAERS: 2 | US FAERS | |
| 759 | Monocyte count increased | FAERS: 2 | US FAERS | |
| 760 | Multiple Sclerosis | FAERS: 2 | US FAERS | |
| 761 | Myasthenia Gravis | FAERS: 2 | US FAERS | |
| 762 | Myoclonus | FAERS: 2 | US FAERS | |
| 763 | Nail Infection | FAERS: 2 | US FAERS | |
| 764 | Nephrosclerosis | FAERS: 2 | SIDER US FAERS | |
| 765 | Neutropenic sepsis | FAERS: 2 | US FAERS | |
| 766 | Non-cardiac chest pain | FAERS: 2 | SIDER US FAERS | |
| 767 | Obsessive-Compulsive Disorder | FAERS: 2 | US FAERS | |
| 768 | Occult blood positive | FAERS: 2 | US FAERS | |
| 769 | Ocular discomfort | FAERS: 2 | US FAERS | |
| 770 | Oral Cavity Fistula | FAERS: 2 | US FAERS | |
| 771 | Oral pustule | FAERS: 2 | US FAERS | |
| 772 | Oropharyngeal swelling | FAERS: 2 | US FAERS | |
| 773 | Osteomyelitis | FAERS: 2 | SIDER US FAERS | |
| 774 | Ovarian cyst torsion | FAERS: 2 | US FAERS | |
| 775 | Oxygen consumption decreased | FAERS: 2 | US FAERS | |
| 776 | PO2 decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 777 | Parathyroidectomy | FAERS: 2 | US FAERS | |
| 778 | Paresis | FAERS: 2 | US FAERS | |
| 779 | Penile swelling | FAERS: 2 | US FAERS | |
| 780 | Peptic Ulcer | FAERS: 2 | US FAERS | |
| 781 | Peripheral artery thrombosis | FAERS: 2 | US FAERS | |
| 782 | Peripheral embolism | FAERS: 2 | US FAERS | |
| 783 | Platelet count abnormal | FAERS: 2 | US FAERS | |
| 784 | Pleurodesis | FAERS: 2 | US FAERS | |
| 785 | Poisoning | FAERS: 2 | US FAERS | |
| 786 | Portal vein stenosis | FAERS: 2 | US FAERS | |
| 787 | Procalcitonin increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 788 | Product administration error | FAERS: 2 | US FAERS | |
| 789 | Product blister packaging issue | FAERS: 2 | US FAERS | |
| 790 | Product packaging issue | FAERS: 2 | US FAERS | |
| 791 | Prostatic Adenoma | FAERS: 2 | US FAERS | |
| 792 | Prosthesis Implantation | FAERS: 2 | US FAERS | |
| 793 | Protein total increased | FAERS: 2 | US FAERS | |
| 794 | Pulmonary arterial hypertension | FAERS: 2 | US FAERS | |
| 795 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 796 | Recall phenomenon | FAERS: 2 | US FAERS | |
| 797 | Rectal fissure | FAERS: 2 | US FAERS | |
| 798 | Renal abscess | FAERS: 2 | US FAERS | |
| 799 | Renal cell carcinoma recurrent | FAERS: 2 | US FAERS | |
| 800 | Respiratory Depression | FAERS: 2 | US FAERS | |
| 801 | Right atrial pressure increased | FAERS: 2 | US FAERS | |
| 802 | Schizophrenia | FAERS: 2 | US FAERS | |
| 803 | Screaming | FAERS: 2 | US FAERS | |
| 804 | Sense of oppression | FAERS: 2 | US FAERS | |
| 805 | Single functional kidney | FAERS: 2 | US FAERS | |
| 806 | Sluggishness | FAERS: 2 | US FAERS | |
| 807 | Small intestine carcinoma | FAERS: 2 | US FAERS | |
| 808 | Solar lentigo | FAERS: 2 | US FAERS | |
| 809 | Spinal column injury | FAERS: 2 | US FAERS | |
| 810 | Spinal column stenosis | FAERS: 2 | US FAERS | |
| 811 | Spondylolisthesis | FAERS: 2 | US FAERS | |
| 812 | Stent malfunction | FAERS: 2 | US FAERS | |
| 813 | Superficial injury of eye | FAERS: 2 | US FAERS | |
| 814 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 815 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 816 | Temperature intolerance | FAERS: 2 | US FAERS | |
| 817 | Therapeutic product effect decreased | FAERS: 2 | US FAERS | |
| 818 | Therapeutic product ineffective | FAERS: 2 | US FAERS | |
| 819 | Thermal burn | FAERS: 2 | US FAERS | |
| 820 | Tongue pruritus | FAERS: 2 | US FAERS | |
| 821 | Troponin increased | FAERS: 2 | US FAERS | |
| 822 | Tuberous Sclerosis | FAERS: 2 | 18495876 | CTD US FAERS |
| 823 | Urinary tract discomfort | FAERS: 2 | US FAERS | |
| 824 | Urinary tract obstruction | FAERS: 2 | US FAERS | |
| 825 | Vaginal mucosal blistering | FAERS: 2 | US FAERS | |
| 826 | Vascular compression | FAERS: 2 | US FAERS | |
| 827 | Vascular occlusion | FAERS: 2 | US FAERS | |
| 828 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 829 | Vertebral column mass | FAERS: 2 | US FAERS | |
| 830 | Vertebroplasty | FAERS: 2 | US FAERS | |
| 831 | Vitamin A Deficiency | FAERS: 2 | US FAERS | |
| 832 | Vulvovaginal burning sensation | FAERS: 2 | US FAERS | |
| 833 | Vulvovaginal mycotic infection | FAERS: 2 | US FAERS | |
| 834 | Wolff-Parkinson-White Syndrome | FAERS: 2 | US FAERS | |
| 835 | Wound abscess | FAERS: 2 | US FAERS | |
| 836 | Wound infection staphylococcal | FAERS: 2 | US FAERS | |
| 837 | Xerosis | FAERS: 2 | US FAERS | |
| 838 | colonoscopy | FAERS: 2 | US FAERS | |
| 839 | insulinoma | FAERS: 2 | US FAERS | |
| 840 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 841 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 842 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 843 | Acquired diaphragmatic eventration | FAERS: 1 | US FAERS | |
| 844 | Acquired phimosis | FAERS: 1 | US FAERS | |
| 845 | Actinic keratosis | FAERS: 1 | OFFSIDES US FAERS | |
| 846 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 847 | Adnexa uteri pain | FAERS: 1 | US FAERS | |
| 848 | Adrenal cyst | FAERS: 1 | US FAERS | |
| 849 | Albumin globulin ratio decreased | FAERS: 1 | US FAERS | |
| 850 | Amylase decreased | FAERS: 1 | US FAERS | |
| 851 | Anal Ulcer | FAERS: 1 | US FAERS | |
| 852 | Anal inflammation | FAERS: 1 | US FAERS | |
| 853 | Angiodysplasia | FAERS: 1 | US FAERS | |
| 854 | Angular cheilitis | FAERS: 1 | US FAERS | |
| 855 | Antineutrophil cytoplasmic antibody decreased | FAERS: 1 | US FAERS | |
| 856 | Aortic valve calcification | FAERS: 1 | US FAERS | |
| 857 | Application site reaction | FAERS: 1 | US FAERS | |
| 858 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 859 | Aspergilloma | FAERS: 1 | US FAERS | |
| 860 | Astrocytoma | FAERS: 1 | US FAERS | |
| 861 | Atrial pressure increased | FAERS: 1 | US FAERS | |
| 862 | Atrial thrombosis | FAERS: 1 | US FAERS | |
| 863 | Atrophic vulvovaginitis | FAERS: 1 | US FAERS | |
| 864 | Auricular swelling | FAERS: 1 | US FAERS | |
| 865 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 866 | BK virus infection | FAERS: 1 | SIDER US FAERS | |
| 867 | Bacterial pyelonephritis | FAERS: 1 | US FAERS | |
| 868 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 869 | Bicytopenia | FAERS: 1 | US FAERS | |
| 870 | Bile duct stent insertion | FAERS: 1 | US FAERS | |
| 871 | Biliary tract infection | FAERS: 1 | US FAERS | |
| 872 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 873 | Bladder pain | FAERS: 1 | SIDER US FAERS | |
| 874 | Bladder spasm | FAERS: 1 | SIDER US FAERS | |
| 875 | Bladder tamponade | FAERS: 1 | US FAERS | |
| 876 | Blepharitis | FAERS: 1 | US FAERS | |
| 877 | Blepharospasm | FAERS: 1 | US FAERS | |
| 878 | Blood bilirubin decreased | FAERS: 1 | US FAERS | |
| 879 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 880 | Blood copper increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 881 | Blood corticotrophin abnormal | FAERS: 1 | US FAERS | |
| 882 | Blood creatine abnormal | FAERS: 1 | US FAERS | |
| 883 | Blood creatine decreased | FAERS: 1 | US FAERS | |
| 884 | Blood creatine phosphokinase decreased | FAERS: 1 | US FAERS | |
| 885 | Blood insulin decreased | FAERS: 1 | US FAERS | |
| 886 | Blood osmolarity decreased | FAERS: 1 | US FAERS | |
| 887 | Blood pH increased | FAERS: 1 | US FAERS | |
| 888 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 889 | Blood testosterone increased | FAERS: 1 | US FAERS | |
| 890 | Blood thyroid stimulating hormone abnormal | FAERS: 1 | US FAERS | |
| 891 | Blood uric acid decreased | FAERS: 1 | US FAERS | |
| 892 | Blue Toe Syndrome | FAERS: 1 | US FAERS | |
| 893 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 894 | Bone abscess | FAERS: 1 | US FAERS | |
| 895 | Brain Contusion | FAERS: 1 | US FAERS | |
| 896 | Brain Death | FAERS: 1 | US FAERS | |
| 897 | Breast tenderness | FAERS: 1 | US FAERS | |
| 898 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 899 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 900 | Bronchoalveolar lavage abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 901 | Bronchopneumopathy | FAERS: 1 | US FAERS | |
| 902 | Bronchopulmonary disease | FAERS: 1 | US FAERS | |
| 903 | Bronchoscopy | FAERS: 1 | US FAERS | |
| 904 | Budd-Chiari Syndrome | FAERS: 1 | US FAERS | |
| 905 | Bullous lung disease | FAERS: 1 | US FAERS | |
| 906 | Burning feet syndrome | FAERS: 1 | US FAERS | |
| 907 | Candida sepsis | FAERS: 1 | OFFSIDES US FAERS | |
| 908 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 909 | Carcinoid Heart Disease | FAERS: 1 | US FAERS | |
| 910 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 911 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 912 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 913 | Catarrh | FAERS: 1 | US FAERS | |
| 914 | Catheter placement | FAERS: 1 | US FAERS | |
| 915 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 916 | Cerebral congestion | FAERS: 1 | US FAERS | |
| 917 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 918 | Citrobacter infection | FAERS: 1 | OFFSIDES US FAERS | |
| 919 | Coagulation factor V level decreased | FAERS: 1 | US FAERS | |
| 920 | Coagulation factor V level increased | FAERS: 1 | US FAERS | |
| 921 | Collateral Circulation | FAERS: 1 | US FAERS | |
| 922 | Complex partial seizures | FAERS: 1 | US FAERS | |
| 923 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 924 | Contrast media reaction | FAERS: 1 | US FAERS | |
| 925 | Coombs test positive | FAERS: 1 | US FAERS | |
| 926 | Corneal lesion | FAERS: 1 | US FAERS | |
| 927 | Cortisol increased | FAERS: 1 | US FAERS | |
| 928 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 929 | Cystine urine present | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 930 | Cyst | FAERS: 1 | US FAERS | |
| 931 | Cytokine Release Syndrome | FAERS: 1 | US FAERS | |
| 932 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 933 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 934 | Delayed Graft Function | FAERS: 1 | US FAERS | |
| 935 | Delayed Puberty | FAERS: 1 | US FAERS | |
| 936 | Dengue Fever | FAERS: 1 | US FAERS | |
| 937 | Dental discomfort | FAERS: 1 | US FAERS | |
| 938 | Device computer issue | FAERS: 1 | US FAERS | |
| 939 | Device dislocation | FAERS: 1 | US FAERS | |
| 940 | Device related infection | FAERS: 1 | US FAERS | |
| 941 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 942 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 943 | Dialysis related complication | FAERS: 1 | US FAERS | |
| 944 | Dieulafoy's vascular malformation | FAERS: 1 | US FAERS | |
| 945 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 946 | Donor specific antibody present | FAERS: 1 | US FAERS | |
| 947 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 948 | Drug exposure before pregnancy | FAERS: 1 | US FAERS | |
| 949 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 950 | Drug level abnormal | FAERS: 1 | US FAERS | |
| 951 | Drug level above therapeutic | FAERS: 1 | US FAERS | |
| 952 | Duodenal Obstruction | FAERS: 1 | US FAERS | |
| 953 | Duodenal ulcer perforation | FAERS: 1 | US FAERS | |
| 954 | Duodenitis | FAERS: 1 | US FAERS | |
| 955 | Duodenogastric Reflux | FAERS: 1 | US FAERS | |
| 956 | Dyschezia | FAERS: 1 | US FAERS | |
| 957 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 958 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 959 | Elephantiasis | FAERS: 1 | US FAERS | |
| 960 | Embolic cerebral infarction | FAERS: 1 | US FAERS | |
| 961 | Encapsulation reaction | FAERS: 1 | US FAERS | |
| 962 | Endometrial disorder | FAERS: 1 | US FAERS | |
| 963 | Endothelial dysfunction | FAERS: 1 | US FAERS | |
| 964 | Eosinophilia | FAERS: 1 | US FAERS | |
| 965 | Epidermal growth factor receptor decreased | FAERS: 1 | US FAERS | |
| 966 | Epigastric discomfort | FAERS: 1 | SIDER US FAERS | |
| 967 | Epiglottitis | FAERS: 1 | US FAERS | |
| 968 | Erythropenia | FAERS: 1 | SIDER US FAERS | |
| 969 | Escherichia sepsis | FAERS: 1 | OFFSIDES US FAERS | |
| 970 | Eustachian tube disorder | FAERS: 1 | US FAERS | |
| 971 | Exophthalmos | FAERS: 1 | US FAERS | |
| 972 | Exposure to radiation | FAERS: 1 | US FAERS | |
| 973 | Extra dose administered | FAERS: 1 | US FAERS | |
| 974 | Extravasation | FAERS: 1 | US FAERS | |
| 975 | Eye allergy | FAERS: 1 | US FAERS | |
| 976 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 977 | Fanconi Syndrome | FAERS: 1 | US FAERS | |
| 978 | Febrile bone marrow aplasia | FAERS: 1 | US FAERS | |
| 979 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 980 | Filariasis | FAERS: 1 | US FAERS | |
| 981 | Fine motor delay | FAERS: 1 | US FAERS | |
| 982 | Fixed drug eruption | FAERS: 1 | US FAERS | |
| 983 | Fixed eruption | FAERS: 1 | US FAERS | |
| 984 | Flat affect | FAERS: 1 | US FAERS | |
| 985 | Fluid intake restriction | FAERS: 1 | US FAERS | |
| 986 | Food Allergy | FAERS: 1 | US FAERS | |
| 987 | Food Poisoning | FAERS: 1 | US FAERS | |
| 988 | Food craving | FAERS: 1 | US FAERS | |
| 989 | Full blood count increased | FAERS: 1 | US FAERS | |
| 990 | Gastric infection | FAERS: 1 | US FAERS | |
| 991 | Gastrinoma | FAERS: 1 | US FAERS | |
| 992 | Gastritis herpes | FAERS: 1 | US FAERS | |
| 993 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 994 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 995 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 996 | Gastrointestinal viral infection | FAERS: 1 | US FAERS | |
| 997 | Gastrooesophageal cancer | FAERS: 1 | US FAERS | |
| 998 | Gaze palsy | FAERS: 1 | US FAERS | |
| 999 | Genital Herpes | FAERS: 1 | US FAERS | |
| 1000 | Genital erosion | FAERS: 1 | US FAERS | |
| 1001 | Genital infection fungal | FAERS: 1 | US FAERS | |
| 1002 | Gingival Recession | FAERS: 1 | US FAERS | |
| 1003 | Gingival blister | FAERS: 1 | US FAERS | |
| 1004 | Gingival erythema | FAERS: 1 | US FAERS | |
| 1005 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 1006 | Graft dysfunction | FAERS: 1 | OFFSIDES US FAERS | |
| 1007 | Graft loss | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 1008 | Hamartoma | FAERS: 1 | US FAERS | |
| 1009 | Haptoglobin Decreased | FAERS: 1 | US FAERS | |
| 1010 | Head titubation | FAERS: 1 | US FAERS | |
| 1011 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 1012 | Heart valve stenosis | FAERS: 1 | US FAERS | |
| 1013 | Helicobacter test positive | FAERS: 1 | US FAERS | |
| 1014 | Hemiplegia | FAERS: 1 | US FAERS | |
| 1015 | Hepatic artery occlusion | FAERS: 1 | US FAERS | |
| 1016 | Hepatic artery stenosis | FAERS: 1 | US FAERS | |
| 1017 | Hepatic cancer stage IV | FAERS: 1 | US FAERS | |
| 1018 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 1019 | Hepatic infection fungal | FAERS: 1 | US FAERS | |
| 1020 | Hepatic infiltration eosinophilic | FAERS: 1 | US FAERS | |
| 1021 | Hepatopulmonary Syndrome | FAERS: 1 | US FAERS | |
| 1022 | Hidradenitis | FAERS: 1 | US FAERS | |
| 1023 | Human Bite | FAERS: 1 | US FAERS | |
| 1024 | Hunger | FAERS: 1 | US FAERS | |
| 1025 | Hypercapnia | FAERS: 1 | US FAERS | |
| 1026 | Hyperosmolar state | FAERS: 1 | US FAERS | |
| 1027 | Hyperparathyroidism | FAERS: 1 | SIDER US FAERS | |
| 1028 | Hyperphagia | FAERS: 1 | US FAERS | |
| 1029 | Hyperplasia | FAERS: 1 | US FAERS | |
| 1030 | Hypertensive Encephalopathy | FAERS: 1 | US FAERS | |
| 1031 | Hypertensive cardiomyopathy | FAERS: 1 | US FAERS | |
| 1032 | Hypertrophy of tongue papillae | FAERS: 1 | US FAERS | |
| 1033 | Hyperviscosity syndrome | FAERS: 1 | US FAERS | |
| 1034 | Hypobarism | FAERS: 1 | US FAERS | |
| 1035 | Hypoglossal nerve paralysis | FAERS: 1 | US FAERS | |
| 1036 | Hypoventilation | FAERS: 1 | US FAERS | |
| 1037 | Hysterectomy | FAERS: 1 | US FAERS | |
| 1038 | Idiosyncratic drug reaction | FAERS: 1 | US FAERS | |
| 1039 | Imaging procedure abnormal | FAERS: 1 | US FAERS | |
| 1040 | Immobile | FAERS: 1 | US FAERS | |
| 1041 | Immunosuppressant drug level decreased | FAERS: 1 | US FAERS | |
| 1042 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 1043 | Implant site effusion | FAERS: 1 | US FAERS | |
| 1044 | In-stent coronary artery restenosis | FAERS: 1 | US FAERS | |
| 1045 | Incision site infection | FAERS: 1 | US FAERS | |
| 1046 | Incoherent | FAERS: 1 | US FAERS | |
| 1047 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 1048 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 1049 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 1050 | Infected cyst | FAERS: 1 | US FAERS | |
| 1051 | Infected fistula | FAERS: 1 | US FAERS | |
| 1052 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 1053 | Infectious pleural effusion | FAERS: 1 | US FAERS | |
| 1054 | Inferior vena cava syndrome | FAERS: 1 | US FAERS | |
| 1055 | Infertility | FAERS: 1 | US FAERS | |
| 1056 | Inflammatory carcinoma of breast stage IV | FAERS: 1 | US FAERS | |
| 1057 | Influenza A virus test positive | FAERS: 1 | US FAERS | |
| 1058 | Initial insomnia | FAERS: 1 | US FAERS | |
| 1059 | Injection site pain | FAERS: 1 | US FAERS | |
| 1060 | Insulin Resistance | FAERS: 1 | US FAERS | |
| 1061 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 1062 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 1063 | Intertrigo | FAERS: 1 | US FAERS | |
| 1064 | Intestinal Fistula | FAERS: 1 | US FAERS | |
| 1065 | Intestinal adenocarcinoma | FAERS: 1 | US FAERS | |
| 1066 | Intestinal gangrene | FAERS: 1 | US FAERS | |
| 1067 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 1068 | Intra-aortic balloon placement | FAERS: 1 | US FAERS | |
| 1069 | Intracranial mass | FAERS: 1 | US FAERS | |
| 1070 | Invasive Ductal Breast Carcinoma | FAERS: 1 | US FAERS | |
| 1071 | Iron Overload | FAERS: 1 | US FAERS | |
| 1072 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 1073 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 1074 | Joint fluid drainage | FAERS: 1 | US FAERS | |
| 1075 | Joint warmth | FAERS: 1 | US FAERS | |
| 1076 | Keratolysis exfoliativa acquired | FAERS: 1 | US FAERS | |
| 1077 | Large intestine anastomosis | FAERS: 1 | US FAERS | |
| 1078 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 1079 | Left ventricle outflow tract obstruction | FAERS: 1 | US FAERS | |
| 1080 | Leukocytoclastic vasculitis | FAERS: 1 | SIDER US FAERS | |
| 1081 | Libido disorder | FAERS: 1 | US FAERS | |
| 1082 | Ligament pain | FAERS: 1 | US FAERS | |
| 1083 | Limb mass | FAERS: 1 | US FAERS | |
| 1084 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 1085 | Loss of proprioception | FAERS: 1 | US FAERS | |
| 1086 | Lower respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 1087 | Lumbar radiculopathy | FAERS: 1 | US FAERS | |
| 1088 | Lung cyst | FAERS: 1 | US FAERS | |
| 1089 | Lung transplant rejection | FAERS: 1 | US FAERS | |
| 1090 | Lymphocyte percentage decreased | FAERS: 1 | US FAERS | |
| 1091 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 1092 | Macroglossia | FAERS: 1 | US FAERS | |
| 1093 | Malignant mesenteric neoplasm | FAERS: 1 | US FAERS | |
| 1094 | Malignant neoplasm of thymus | FAERS: 1 | US FAERS | |
| 1095 | Marasmus | FAERS: 1 | US FAERS | |
| 1096 | Mastication disorder | FAERS: 1 | US FAERS | |
| 1097 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 1098 | Measles | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1099 | Mediastinal mass | FAERS: 1 | US FAERS | |
| 1100 | Medical device pain | FAERS: 1 | US FAERS | |
| 1101 | Medical device site pain | FAERS: 1 | US FAERS | |
| 1102 | Megacolon | FAERS: 1 | US FAERS | |
| 1103 | Meningioma | FAERS: 1 | US FAERS | |
| 1104 | Meningitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1105 | Meniscus injury | FAERS: 1 | US FAERS | |
| 1106 | Mental Retardation | FAERS: 1 | US FAERS | |
| 1107 | Metastases to abdominal cavity | FAERS: 1 | US FAERS | |
| 1108 | Metastases to abdominal wall | FAERS: 1 | US FAERS | |
| 1109 | Metastases to muscle | FAERS: 1 | US FAERS | |
| 1110 | Metastases to peripheral vascular system | FAERS: 1 | US FAERS | |
| 1111 | Metastatic pain | FAERS: 1 | US FAERS | |
| 1112 | Microcytosis | FAERS: 1 | US FAERS | |
| 1113 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 1114 | Middle insomnia | FAERS: 1 | US FAERS | |
| 1115 | Miliaria | FAERS: 1 | US FAERS | |
| 1116 | Monoparesis | FAERS: 1 | US FAERS | |
| 1117 | Monoplegia | FAERS: 1 | US FAERS | |
| 1118 | Motion Sickness | FAERS: 1 | US FAERS | |
| 1119 | Mucosal toxicity | FAERS: 1 | US FAERS | |
| 1120 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 1121 | Multimorbidity | FAERS: 1 | US FAERS | |
| 1122 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 1123 | Mydriasis | FAERS: 1 | US FAERS | |
| 1124 | Myocarditis | FAERS: 1 | US FAERS | |
| 1125 | Nail bed disorder | FAERS: 1 | US FAERS | |
| 1126 | Nasal mucosal disorder | FAERS: 1 | US FAERS | |
| 1127 | Nasal mucosal ulcer | FAERS: 1 | US FAERS | |
| 1128 | Necrolytic Migratory Erythema | FAERS: 1 | US FAERS | |
| 1129 | Negative thoughts | FAERS: 1 | US FAERS | |
| 1130 | Nephroangiosclerosis | FAERS: 1 | US FAERS | |
| 1131 | Neuritis | FAERS: 1 | US FAERS | |
| 1132 | Neurological decompensation | FAERS: 1 | US FAERS | |
| 1133 | Neutropenic infection | FAERS: 1 | US FAERS | |
| 1134 | Neutrophil count abnormal | FAERS: 1 | US FAERS | |
| 1135 | Noninfectious peritonitis | FAERS: 1 | US FAERS | |
| 1136 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 1137 | Obesity | FAERS: 1 | US FAERS | |
| 1138 | Oligospermia | FAERS: 1 | US FAERS | |
| 1139 | Omphalorrhexis | FAERS: 1 | US FAERS | |
| 1140 | Onychalgia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1141 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 1142 | Oral administration complication | FAERS: 1 | US FAERS | |
| 1143 | Oral discharge | FAERS: 1 | US FAERS | |
| 1144 | Orchitis | FAERS: 1 | US FAERS | |
| 1145 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 1146 | Osteocalcin increased | FAERS: 1 | US FAERS | |
| 1147 | Osteopenia | FAERS: 1 | SIDER US FAERS | |
| 1148 | Otitis Externa | FAERS: 1 | US FAERS | |
| 1149 | Overlap syndrome | FAERS: 1 | US FAERS | |
| 1150 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 1151 | Pancreatic cyst rupture | FAERS: 1 | US FAERS | |
| 1152 | Pancreatic duct dilatation | FAERS: 1 | US FAERS | |
| 1153 | Panniculitis | FAERS: 1 | US FAERS | |
| 1154 | Parakeratosis | FAERS: 1 | US FAERS | |
| 1155 | Paraplegia | FAERS: 1 | US FAERS | |
| 1156 | Pelvic mass | FAERS: 1 | US FAERS | |
| 1157 | Perineal infection | FAERS: 1 | US FAERS | |
| 1158 | Perineal rash | FAERS: 1 | US FAERS | |
| 1159 | Perineal ulceration | FAERS: 1 | US FAERS | |
| 1160 | Peripheral artery occlusion | FAERS: 1 | US FAERS | |
| 1161 | Peritonsillar Abscess | FAERS: 1 | US FAERS | |
| 1162 | Pertussis | FAERS: 1 | US FAERS | |
| 1163 | Pharyngeal exudate | FAERS: 1 | US FAERS | |
| 1164 | Pharyngeal swelling | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1165 | Plantar erythema | FAERS: 1 | US FAERS | |
| 1166 | Pneumobilia | FAERS: 1 | US FAERS | |
| 1167 | Polyserositis | FAERS: 1 | US FAERS | |
| 1168 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 1169 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 1170 | Positron emission tomogram abnormal | FAERS: 1 | US FAERS | |
| 1171 | Post procedural fever | FAERS: 1 | US FAERS | |
| 1172 | Post procedural infection | FAERS: 1 | US FAERS | |
| 1173 | Post procedural urine leak | FAERS: 1 | OFFSIDES US FAERS | |
| 1174 | Postoperative adhesion | FAERS: 1 | US FAERS | |
| 1175 | Prerenal failure | FAERS: 1 | US FAERS | |
| 1176 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 1177 | Procedural complication | FAERS: 1 | US FAERS | |
| 1178 | Procedural headache | FAERS: 1 | US FAERS | |
| 1179 | Product dispensing error | FAERS: 1 | US FAERS | |
| 1180 | Product distribution issue | FAERS: 1 | US FAERS | |
| 1181 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 1182 | Product packaging difficult to open | FAERS: 1 | US FAERS | |
| 1183 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 1184 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 1185 | Product storage error | FAERS: 1 | US FAERS | |
| 1186 | Product substitution issue | FAERS: 1 | US FAERS | |
| 1187 | Product supply issue | FAERS: 1 | US FAERS | |
| 1188 | Product tampering | FAERS: 1 | US FAERS | |
| 1189 | Prostatic Obstruction | FAERS: 1 | US FAERS | |
| 1190 | Protein Deficiency | FAERS: 1 | US FAERS | |
| 1191 | Protein-losing gastroenteropathy | FAERS: 1 | US FAERS | |
| 1192 | Prothrombin level decreased | FAERS: 1 | US FAERS | |
| 1193 | Prothrombin time ratio decreased | FAERS: 1 | US FAERS | |
| 1194 | Prurigo | FAERS: 1 | US FAERS | |
| 1195 | Pseudocyst | FAERS: 1 | US FAERS | |
| 1196 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 1197 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 1198 | Pterygium | FAERS: 1 | US FAERS | |
| 1199 | Pulmonary necrosis | FAERS: 1 | US FAERS | |
| 1200 | Purpura | FAERS: 1 | US FAERS | |
| 1201 | Pyelocaliectasis | FAERS: 1 | US FAERS | |
| 1202 | Pyoderma Gangrenosum | FAERS: 1 | US FAERS | |
| 1203 | Pyoderma | FAERS: 1 | US FAERS | |
| 1204 | Pyopneumothorax | FAERS: 1 | US FAERS | |
| 1205 | Radical hysterectomy | FAERS: 1 | US FAERS | |
| 1206 | Rash papulosquamous | FAERS: 1 | US FAERS | |
| 1207 | Refeeding Syndrome | FAERS: 1 | US FAERS | |
| 1208 | Regurgitation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1209 | Removal of transplanted organ | FAERS: 1 | US FAERS | |
| 1210 | Renal Artery Stenosis | FAERS: 1 | US FAERS | |
| 1211 | Renal transplant failure | FAERS: 1 | US FAERS | |
| 1212 | Renal tubular atrophy | FAERS: 1 | US FAERS | |
| 1213 | Respiratory tract inflammation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1214 | Respiratory tract ulceration | FAERS: 1 | US FAERS | |
| 1215 | Reticulocyte count increased | FAERS: 1 | US FAERS | |
| 1216 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 1217 | Retroperitoneal lymphadenopathy | FAERS: 1 | US FAERS | |
| 1218 | Rhabdomyoma | FAERS: 1 | US FAERS | |
| 1219 | Rhabdomyosarcoma | FAERS: 1 | US FAERS | |
| 1220 | Rheumatoid Nodule | FAERS: 1 | US FAERS | |
| 1221 | Rhinalgia | FAERS: 1 | US FAERS | |
| 1222 | Rift Valley Fever | FAERS: 1 | US FAERS | |
| 1223 | Right Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 1224 | Root canal infection | FAERS: 1 | US FAERS | |
| 1225 | Rosacea | FAERS: 1 | US FAERS | |
| 1226 | Saliva altered | FAERS: 1 | US FAERS | |
| 1227 | Salivary Duct Inflammation | FAERS: 1 | US FAERS | |
| 1228 | Scan abnormal | FAERS: 1 | US FAERS | |
| 1229 | Sclerema | FAERS: 1 | US FAERS | |
| 1230 | Senile dementia | FAERS: 1 | US FAERS | |
| 1231 | Sensitivity to weather change | FAERS: 1 | US FAERS | |
| 1232 | Serum procollagen type I N-terminal propeptide increased | FAERS: 1 | US FAERS | |
| 1233 | Severe Acute Respiratory Syndrome | FAERS: 1 | US FAERS | |
| 1234 | Sinus pain | FAERS: 1 | US FAERS | |
| 1235 | Sinus polyp | FAERS: 1 | US FAERS | |
| 1236 | Skeletal injury | FAERS: 1 | US FAERS | |
| 1237 | Skin discomfort | FAERS: 1 | US FAERS | |
| 1238 | Skin necrosis | FAERS: 1 | US FAERS | |
| 1239 | Skin tightness | FAERS: 1 | US FAERS | |
| 1240 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 1241 | Small intestine carcinoma metastatic | FAERS: 1 | US FAERS | |
| 1242 | Snoring | FAERS: 1 | US FAERS | |
| 1243 | Soft Tissue Infection | FAERS: 1 | OFFSIDES US FAERS | |
| 1244 | Somatic symptom disorder | FAERS: 1 | US FAERS | |
| 1245 | Splenic neoplasm malignancy unspecified | FAERS: 1 | US FAERS | |
| 1246 | Sputum retention | FAERS: 1 | US FAERS | |
| 1247 | Starvation | FAERS: 1 | US FAERS | |
| 1248 | Stoma site pain | FAERS: 1 | US FAERS | |
| 1249 | Stridor | FAERS: 1 | US FAERS | |
| 1250 | Stubbornness | FAERS: 1 | US FAERS | |
| 1251 | Stupor | FAERS: 1 | US FAERS | |
| 1252 | Subcutaneous Emphysema | FAERS: 1 | US FAERS | |
| 1253 | Subcutaneous nodule | FAERS: 1 | US FAERS | |
| 1254 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 1255 | Suicide attempt | FAERS: 1 | US FAERS | |
| 1256 | Superior Vena Cava Syndrome | FAERS: 1 | US FAERS | |
| 1257 | Suture rupture | FAERS: 1 | US FAERS | |
| 1258 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 1259 | Synovitis | FAERS: 1 | OFFSIDES US FAERS | |
| 1260 | Systemic leakage | FAERS: 1 | US FAERS | |
| 1261 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 1262 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 1263 | Teeth brittle | FAERS: 1 | US FAERS | |
| 1264 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 1265 | Thoracotomy | FAERS: 1 | US FAERS | |
| 1266 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 1267 | Thyroglobulin increased | FAERS: 1 | US FAERS | |
| 1268 | Thyroid cancer metastatic | FAERS: 1 | US FAERS | |
| 1269 | Thyroid hormones decreased | FAERS: 1 | US FAERS | |
| 1270 | Thyroid hormones increased | FAERS: 1 | US FAERS | |
| 1271 | Thyroiditis | FAERS: 1 | US FAERS | |
| 1272 | Thyroxine free abnormal | FAERS: 1 | US FAERS | |
| 1273 | Tinnitus | FAERS: 1 | US FAERS | |
| 1274 | Tongue erythema | FAERS: 1 | US FAERS | |
| 1275 | Tongue exfoliation | FAERS: 1 | US FAERS | |
| 1276 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 1277 | Torticollis | FAERS: 1 | US FAERS | |
| 1278 | Toxoplasmosis | FAERS: 1 | US FAERS | |
| 1279 | Tracheal fistula | FAERS: 1 | US FAERS | |
| 1280 | Tri-iodothyronine free decreased | FAERS: 1 | US FAERS | |
| 1281 | Troponin T increased | FAERS: 1 | US FAERS | |
| 1282 | Type III immune complex mediated reaction | FAERS: 1 | US FAERS | |
| 1283 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 1284 | Urinary tract infection enterococcal | FAERS: 1 | US FAERS | |
| 1285 | Urinary tract infection fungal | FAERS: 1 | US FAERS | |
| 1286 | Urine albumin/creatinine ratio decreased | FAERS: 1 | US FAERS | |
| 1287 | Urine ketone body present | FAERS: 1 | US FAERS | |
| 1288 | Uveitis | FAERS: 1 | US FAERS | |
| 1289 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 1290 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 1291 | Vaginal abscess | FAERS: 1 | US FAERS | |
| 1292 | Vascular insufficiency | FAERS: 1 | US FAERS | |
| 1293 | Vascular rupture | FAERS: 1 | US FAERS | |
| 1294 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 1295 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 1296 | Vertebral lesion | FAERS: 1 | US FAERS | |
| 1297 | Vertebral wedging | FAERS: 1 | US FAERS | |
| 1298 | Vestibular Neuronitis | FAERS: 1 | US FAERS | |
| 1299 | Vipoma | FAERS: 1 | US FAERS | |
| 1300 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 1301 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 1302 | Vitello-intestinal duct remnant | FAERS: 1 | US FAERS | |
| 1303 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 1304 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 1305 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 1306 | White matter lesion | FAERS: 1 | US FAERS | |
| 1307 | Wound evisceration | FAERS: 1 | US FAERS | |
| 1308 | Wound infection bacterial | FAERS: 1 | US FAERS | |
| 1309 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 1310 | Wrong product stored | FAERS: 1 | US FAERS | |
| 1311 | Wrong schedule | FAERS: 1 | US FAERS | |
| 1312 | jejunitis | FAERS: 1 | US FAERS | |
| 1313 | kyphosis | FAERS: 1 | US FAERS | |
| 1314 | liposarcoma | FAERS: 1 | US FAERS | |
| 1315 | oligodendroglioma | FAERS: 1 | US FAERS | |
| 1316 | Abnormal weight gain | OFFSIDES | ||
| 1317 | Alternaria infection | OFFSIDES | ||
| 1318 | Amyloidosis | 24040781 | CTD | |
| 1319 | Anemia | 17889151 18675097 19549709 | CTD | |
| 1320 | Aneurysm | 16302997 | CTD | |
| 1321 | Anorexia | 16951235 | CTD SIDER | |
| 1322 | Benign Neoplasm | SIDER | ||
| 1323 | Blood amylase | OFFSIDES | ||
| 1324 | Blood and lymphatic system disorders | SIDER | ||
| 1325 | Blood follicle stimulating hormone increased | SIDER | ||
| 1326 | Bronchoalveolar Lavage | OFFSIDES | ||
| 1327 | Calcium low | SIDER | ||
| 1328 | Carpal collapse | Canada Vigilance: 1 | Canada Vigilance | |
| 1329 | Cervicobrachial syndrome | SIDER | ||
| 1330 | Complement factor C3 decreased | OFFSIDES | ||
| 1331 | Creatinine increased | SIDER | ||
| 1332 | Diarrhea | 16951235 21306238 | CTD OFFSIDES | |
| 1333 | Dyslipidemias | 19955336 | CTD | |
| 1334 | Dyspnea | 19549709 | CTD | |
| 1335 | End Stage Liver Disease | SIDER | ||
| 1336 | Enterovesical Fistula | OFFSIDES | ||
| 1337 | Epidural lipomatosis | OFFSIDES | ||
| 1338 | Exanthema | 21306238 | CTD | |
| 1339 | Fasting hyperglycaemia | SIDER | ||
| 1340 | Fever of Unknown Origin | 17346627 | CTD | |
| 1341 | Gingival Hypertrophy | SIDER | ||
| 1342 | Glioblastoma | SIDER | ||
| 1343 | Globulinuria | OFFSIDES | ||
| 1344 | Glucose increased | SIDER | ||
| 1345 | Gonadotropic luteinizing hormone increased | SIDER | ||
| 1346 | Graft thrombosis | SIDER | ||
| 1347 | Hemolytic-Uremic Syndrome | 17951952 | CTD | |
| 1348 | Hepatic Veno-Occlusive Disease | 19135948 | CTD | |
| 1349 | Hepatitis B, Chronic | 17346627 | CTD | |
| 1350 | Hirsutism | SIDER | ||
| 1351 | Histiocytosis | SIDER | ||
| 1352 | Human herpesvirus 8 infection | OFFSIDES | ||
| 1353 | Hypercholesterolemia | 10551636 | CTD | |
| 1354 | Hyperglycemia | 16951235 | CTD | |
| 1355 | Hypertrichosis | OFFSIDES SIDER | ||
| 1356 | Hypertriglyceridemia | 10551636 | CTD | |
| 1357 | Hypophosphatemia | 16951235 | CTD | |
| 1358 | Implantable defibrillator insertion | OFFSIDES | ||
| 1359 | Incision site pain | SIDER | ||
| 1360 | Infection reactivation | SIDER | ||
| 1361 | Infectious pneumonitis | SIDER | ||
| 1362 | Infestation | SIDER | ||
| 1363 | Kidney Diseases | 17430485 | CTD | |
| 1364 | Lipase | OFFSIDES | ||
| 1365 | Lung Diseases, Interstitial | 17346627 | CTD | |
| 1366 | Metastases to larynx | Canada Vigilance: 1 | Canada Vigilance | |
| 1367 | Metastatic melanoma | SIDER | ||
| 1368 | Metrorrhagia | SIDER | ||
| 1369 | Mononeuritis | OFFSIDES | ||
| 1370 | Muscle necrosis | OFFSIDES | ||
| 1371 | Neoplasm Metastasis | 28258630 | CTD | |
| 1372 | Neoplasms, Experimental | 28258630 | CTD | |
| 1373 | Neoplasms | 17309148 | CTD | |
| 1374 | Neuroendocrine Tumors | 21306238 | CTD | |
| 1375 | Otitis Media | SIDER | ||
| 1376 | Percutaneous Coronary Intervention | OFFSIDES | ||
| 1377 | Perianal abscess | OFFSIDES | ||
| 1378 | Perinephric collection | SIDER | ||
| 1379 | Perirectal abscess | OFFSIDES | ||
| 1380 | Pharyngolaryngeal Pain | SIDER | ||
| 1381 | Phosphate low | SIDER | ||
| 1382 | Pityriasis | OFFSIDES | ||
| 1383 | Pneumatic compression therapy | OFFSIDES | ||
| 1384 | Polyomavirus Infections | SIDER | ||
| 1385 | Postrenal failure | OFFSIDES | ||
| 1386 | Potassium increased | SIDER | ||
| 1387 | Potassium low | SIDER | ||
| 1388 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 1389 | Pyuria | OFFSIDES SIDER | ||
| 1390 | Recurrence | 17346627 | CTD | |
| 1391 | Reflex Sympathetic Dystrophy | SIDER | ||
| 1392 | Sodium decreased | SIDER | ||
| 1393 | Spondylitis | SIDER | ||
| 1394 | Thrombocytosis | SIDER | ||
| 1395 | Tinea Pedis | SIDER | ||
| 1396 | Urethritis noninfective | SIDER | ||
| 1397 | Urethritis | SIDER | ||
| 1398 | Urine output increased | SIDER | ||
| 1399 | Vascular Diseases | 19135948 | CTD | |
| 1400 | Vasculitis, Leukocytoclastic, Cutaneous | 16753882 16951235 | CTD | |
| 1401 | Venous Thromboembolism | SIDER | ||
| 1402 | Vesicoureteral reflux surgery | OFFSIDES | ||
| 1403 | Xeroderma | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.