Bortezomib
(GXJABQQUPOEUTA-RDJZCZTQSA-N)
Structure
- SMILES
- CC(C[C@@H](B(O)O)NC(=O)[C@@H](NC(=O)c1cnccn1)Cc1ccccc1)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XX32
- Molecular Formula:
- C19H25BN4O4
- Molecular Weight:
- 384.237
- Log P:
- 1.5623
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 4
- TPSA:
- 124.44
- CAS Number(s):
- 179324-69-7
Synonym(s)
1.
Bortezomib
2.
LDP-341
3.
PS 341
4.
PS-341
5.
Velcade
6.
341, PS
7.
LDP 341
8.
LDP341
9.
PS341
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Disease Progression | FAERS: 324 Canada Vigilance: 8 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Thrombocytopenia | FAERS: 214 Canada Vigilance: 2 | CTD SIDER Canada Vigilance US FAERS | |
| 3 | No adverse event | FAERS: 197 | US FAERS | |
| 4 | Fatigue | FAERS: 182 Canada Vigilance: 2 | 15953004 17204182 20385792 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 5 | Pneumonia | FAERS: 176 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 6 | Drug ineffective | FAERS: 172 | OFFSIDES US FAERS | |
| 7 | Injection site erythema | FAERS: 159 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 8 | Nausea | FAERS: 156 | 15161691 | CTD OFFSIDES SIDER US FAERS |
| 9 | Multiple Myeloma | FAERS: 151 |
12393500
15045823 15070698 15161691 15203282 15449188 15953004 15964068 16019253 16026741 16118318 16298074 16391799 16397052 16506632 16585204 16617327 16689991 16860177 17204182 17495969 17546639 17626072 17635511 17898295 17898564 18223318 18463870 18534018 18559525 18650177 18696182 18754030 19074855 19100720 19112201 19112817 19192067 19274460 19372569 19695912 19728021 19917281 20001242 20038224 20150504 20188093 20385792 20423566 20433602 20458563 20542572 20807892 20830808 20864405 20874823 20959823 20979938 21124757 21634429 22922937 23063726 23864035 24389365 24673398 24928523 | CTD US FAERS |
| 10 | Asthenia | FAERS: 145 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 11 | Pain | FAERS: 129 Canada Vigilance: 2 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 12 | Vomiting | FAERS: 125 | SIDER US FAERS | |
| 13 | Hypotension | FAERS: 120 | SIDER US FAERS | |
| 14 | Malignant neoplasm progression | FAERS: 101 | US FAERS | |
| 15 | Injection Site Reaction | FAERS: 100 | SIDER US FAERS | |
| 16 | Malaise | FAERS: 99 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 17 | Constipation | FAERS: 94 | 15953004 | CTD SIDER US FAERS |
| 18 | Sepsis | FAERS: 91 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 19 | Product use issue | FAERS: 86 | US FAERS | |
| 20 | Atrial Fibrillation | FAERS: 83 | SIDER US FAERS | |
| 21 | Infection | FAERS: 79 | 24673398 | CTD OFFSIDES SIDER US FAERS |
| 22 | Dizziness | FAERS: 78 | OFFSIDES SIDER US FAERS | |
| 23 | Dehydration | FAERS: 69 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 24 | Adverse event | FAERS: 68 | US FAERS | |
| 25 | Weight decreased | FAERS: 68 | SIDER US FAERS | |
| 26 | Injection site pain | FAERS: 66 | SIDER US FAERS | |
| 27 | General physical health deterioration | FAERS: 61 | OFFSIDES SIDER US FAERS | |
| 28 | Neutropenia | FAERS: 59 | CTD SIDER US FAERS | |
| 29 | Wrong drug administered | FAERS: 59 | OFFSIDES US FAERS | |
| 30 | Respiratory Failure | FAERS: 57 | OFFSIDES SIDER US FAERS | |
| 31 | Syncope | FAERS: 57 | SIDER US FAERS | |
| 32 | Abdominal Pain | FAERS: 56 | OFFSIDES SIDER US FAERS | |
| 33 | Back Pain | FAERS: 54 | SIDER US FAERS | |
| 34 | Myocardial Infarction | FAERS: 53 | SIDER US FAERS | |
| 35 | Pancytopenia | FAERS: 48 | SIDER US FAERS | |
| 36 | Headache | FAERS: 46 | SIDER US FAERS | |
| 37 | Blood creatinine increased | FAERS: 45 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 38 | Chest Pain | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 39 | Neuropathy | FAERS: 44 | SIDER US FAERS | |
| 40 | Arthralgia | FAERS: 42 | SIDER US FAERS | |
| 41 | Septic Shock | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 42 | White blood cell count decreased | FAERS: 42 | US FAERS | |
| 43 | Chills | FAERS: 38 | SIDER US FAERS | |
| 44 | Febrile Neutropenia | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 45 | Injection site pruritus | FAERS: 37 | US FAERS | |
| 46 | Pneumonitis | FAERS: 36 | US FAERS | |
| 47 | Polyneuropathy | FAERS: 36 | OFFSIDES SIDER US FAERS | |
| 48 | Aspartate Aminotransferase Increased | FAERS: 35 | US FAERS | |
| 49 | Blood lactate dehydrogenase increased | FAERS: 34 | OFFSIDES US FAERS | |
| 50 | Drug dose omission | FAERS: 34 | OFFSIDES US FAERS | |
| 51 | Incorrect route of drug administration | FAERS: 32 | OFFSIDES US FAERS | |
| 52 | Pulmonary Embolism | FAERS: 32 | SIDER US FAERS | |
| 53 | Cardiac Arrest | FAERS: 31 | SIDER US FAERS | |
| 54 | Ileus | FAERS: 31 | SIDER US FAERS | |
| 55 | Thrombosis | FAERS: 31 | 20385792 20979938 | CTD US FAERS |
| 56 | Plasma cell myeloma recurrent | FAERS: 30 | US FAERS | |
| 57 | Tachycardia | FAERS: 30 | SIDER US FAERS | |
| 58 | Colitis | FAERS: 29 | OFFSIDES SIDER US FAERS | |
| 59 | Drug dispensing error | FAERS: 29 | OFFSIDES US FAERS | |
| 60 | Leukopenia | FAERS: 27 | SIDER US FAERS | |
| 61 | Myalgia | FAERS: 27 | SIDER US FAERS | |
| 62 | Tremor | FAERS: 27 | SIDER US FAERS | |
| 63 | Nasopharyngitis | FAERS: 26 | SIDER US FAERS | |
| 64 | Cardiotoxicity | FAERS: 25 | OFFSIDES SIDER US FAERS | |
| 65 | Intestinal Obstruction | FAERS: 25 | OFFSIDES SIDER US FAERS | |
| 66 | Plasmacytoma | FAERS: 25 | 19259673 | CTD OFFSIDES SIDER US FAERS |
| 67 | Therapy change | FAERS: 25 | US FAERS | |
| 68 | Toxicity to various agents | FAERS: 25 | US FAERS | |
| 69 | Abasia | FAERS: 24 | US FAERS | |
| 70 | Alanine Aminotransferase Increased | FAERS: 24 | OFFSIDES US FAERS | |
| 71 | Hypoxia | FAERS: 24 | OFFSIDES SIDER US FAERS | |
| 72 | Pruritus | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 73 | Urinary Retention | FAERS: 24 | 20467223 | CTD SIDER US FAERS |
| 74 | Chest discomfort | FAERS: 23 | SIDER US FAERS | |
| 75 | Drug administration error | FAERS: 23 | US FAERS | |
| 76 | Urinary tract infection | FAERS: 23 | SIDER US FAERS | |
| 77 | Amyloidosis | FAERS: 22 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 78 | Bone pain | FAERS: 22 | OFFSIDES SIDER US FAERS | |
| 79 | Cellulitis | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 80 | Epistaxis | FAERS: 22 | OFFSIDES SIDER US FAERS | |
| 81 | Injection site irritation | FAERS: 22 | US FAERS | |
| 82 | Product use in unapproved indication | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | nervous system disorder | FAERS: 22 | SIDER US FAERS | |
| 84 | Anxiety | FAERS: 21 | OFFSIDES SIDER US FAERS | |
| 85 | Influenza | FAERS: 20 | SIDER US FAERS | |
| 86 | Medication Error | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Anorexia | FAERS: 19 | OFFSIDES SIDER US FAERS | |
| 88 | Blindness | FAERS: 19 | SIDER US FAERS | |
| 89 | Guillain-Barre Syndrome | FAERS: 19 | US FAERS | |
| 90 | Haematotoxicity | FAERS: 19 | OFFSIDES US FAERS | |
| 91 | Hepatitis B | FAERS: 19 | OFFSIDES US FAERS | |
| 92 | Injection site bruising | FAERS: 19 | US FAERS | |
| 93 | Injection site urticaria | FAERS: 19 | US FAERS | |
| 94 | Lower respiratory tract infection | FAERS: 19 | SIDER US FAERS | |
| 95 | Mental status changes | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Pulmonary Fibrosis | FAERS: 19 | SIDER US FAERS | |
| 97 | Sudden death | FAERS: 19 | OFFSIDES SIDER US FAERS | |
| 98 | Vasculitis | FAERS: 19 | SIDER US FAERS | |
| 99 | Accidental overdose | FAERS: 18 | OFFSIDES US FAERS | |
| 100 | Bradycardia | FAERS: 18 | SIDER US FAERS | |
| 101 | Diplopia | FAERS: 18 | SIDER US FAERS | |
| 102 | Drug toxicity | FAERS: 18 | OFFSIDES US FAERS | |
| 103 | Erythema | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 104 | Pancreatitis | FAERS: 18 | SIDER US FAERS | |
| 105 | Respiratory distress | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 106 | Atelectasis | FAERS: 17 | OFFSIDES SIDER US FAERS | |
| 107 | Autonomic neuropathy | FAERS: 17 | OFFSIDES SIDER US FAERS | |
| 108 | Cerebrovascular accident | FAERS: 17 | US FAERS | |
| 109 | Deep Vein Thrombosis | FAERS: 17 | SIDER US FAERS | |
| 110 | Neuralgia | FAERS: 17 | 20385792 20467223 | CTD OFFSIDES SIDER US FAERS |
| 111 | Alopecia | FAERS: 16 | US FAERS | |
| 112 | Asthma | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 113 | Cardiomegaly | FAERS: 16 | US FAERS | |
| 114 | Feeling abnormal | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 115 | Gastrointestinal toxicity | FAERS: 16 | OFFSIDES SIDER US FAERS | |
| 116 | Incorrect dose administered | FAERS: 16 | US FAERS | |
| 117 | Shock | FAERS: 16 | SIDER US FAERS | |
| 118 | Urticaria | FAERS: 16 | SIDER US FAERS | |
| 119 | Blood count abnormal | FAERS: 15 | US FAERS | |
| 120 | Deafness | FAERS: 15 | SIDER US FAERS | |
| 121 | Erythema Multiforme | FAERS: 15 | OFFSIDES SIDER US FAERS | |
| 122 | Hypersensitivity | FAERS: 15 | SIDER US FAERS | |
| 123 | Pulmonary Hypertension | FAERS: 15 | OFFSIDES SIDER US FAERS | |
| 124 | Vertigo | FAERS: 15 | SIDER US FAERS | |
| 125 | Blood alkaline phosphatase increased | FAERS: 14 | OFFSIDES US FAERS | |
| 126 | Bronchopneumonia | FAERS: 14 | OFFSIDES SIDER US FAERS | |
| 127 | Dysgeusia | FAERS: 14 | SIDER US FAERS | |
| 128 | Inappropriate schedule of drug administration | FAERS: 14 | US FAERS | |
| 129 | Injection site exfoliation | FAERS: 14 | US FAERS | |
| 130 | Metabolic acidosis | FAERS: 14 | OFFSIDES US FAERS | |
| 131 | Neutrophil count decreased | FAERS: 14 | OFFSIDES US FAERS | |
| 132 | Protein total increased | FAERS: 14 | OFFSIDES US FAERS | |
| 133 | Somnolence | FAERS: 14 | US FAERS | |
| 134 | Acute kidney injury | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 135 | Disease recurrence | FAERS: 13 | OFFSIDES US FAERS | |
| 136 | Palpitations | FAERS: 13 | SIDER US FAERS | |
| 137 | Peripheral motor neuropathy | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 138 | Peripheral swelling | FAERS: 13 | US FAERS | |
| 139 | Angina Pectoris | FAERS: 12 | SIDER US FAERS | |
| 140 | Ascites | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 141 | Capillary Leak Syndrome | FAERS: 12 | 20150504 | CTD OFFSIDES US FAERS |
| 142 | Clostridium difficile colitis | FAERS: 12 | OFFSIDES US FAERS | |
| 143 | Ejection Fraction Decreased | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 144 | Product label issue | FAERS: 12 | US FAERS | |
| 145 | Rhabdomyolysis | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 146 | Accidental exposure | FAERS: 11 | OFFSIDES US FAERS | |
| 147 | Blood potassium increased | FAERS: 11 | OFFSIDES US FAERS | |
| 148 | Blood urea increased | FAERS: 11 | OFFSIDES US FAERS | |
| 149 | Conjunctivitis | FAERS: 11 | SIDER US FAERS | |
| 150 | Diverticulitis | FAERS: 11 | US FAERS | |
| 151 | Drug resistance | FAERS: 11 | US FAERS | |
| 152 | Rash erythematous | FAERS: 11 | US FAERS | |
| 153 | Supraventricular tachycardia | FAERS: 11 | OFFSIDES US FAERS | |
| 154 | Unevaluable event | FAERS: 11 | US FAERS | |
| 155 | pseudomembranous colitis | FAERS: 11 | US FAERS | |
| 156 | Burning sensation | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 157 | Delirium | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 158 | Overdose | FAERS: 10 | US FAERS | |
| 159 | Posterior reversible encephalopathy syndrome | FAERS: 10 | SIDER US FAERS | |
| 160 | Proteinuria | FAERS: 10 | SIDER US FAERS | |
| 161 | Sinusitis | FAERS: 10 | SIDER US FAERS | |
| 162 | Transaminases increased | FAERS: 10 | OFFSIDES US FAERS | |
| 163 | Blepharitis | FAERS: 9 | OFFSIDES US FAERS | |
| 164 | Blood potassium decreased | FAERS: 9 | OFFSIDES US FAERS | |
| 165 | Cerebral Infarction | FAERS: 9 | US FAERS | |
| 166 | Cholecystitis | FAERS: 9 | OFFSIDES US FAERS | |
| 167 | Disorientation | FAERS: 9 | US FAERS | |
| 168 | Dyspepsia | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 169 | Fracture | FAERS: 9 | SIDER US FAERS | |
| 170 | Gamma-Glutamyltransferase Increased | FAERS: 9 | OFFSIDES US FAERS | |
| 171 | Gastroenteritis | FAERS: 9 | SIDER US FAERS | |
| 172 | Hordeolum | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 173 | Injection site vesicles | FAERS: 9 | US FAERS | |
| 174 | Lymphopenia | FAERS: 9 | 20385792 | CTD SIDER US FAERS |
| 175 | MYELODYSPLASTIC SYNDROME | FAERS: 9 | US FAERS | |
| 176 | Pericardial effusion | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 177 | Product quality issue | FAERS: 9 | US FAERS | |
| 178 | Skin Ulcer | FAERS: 9 | SIDER US FAERS | |
| 179 | Tinnitus | FAERS: 9 | SIDER US FAERS | |
| 180 | Troponin increased | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 181 | Ventricular hypokinesia | FAERS: 9 | OFFSIDES US FAERS | |
| 182 | Visual disturbance | FAERS: 9 | OFFSIDES US FAERS | |
| 183 | Acute Coronary Syndrome | FAERS: 8 | SIDER US FAERS | |
| 184 | Agitation | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 185 | Agranulocytosis | FAERS: 8 | US FAERS | |
| 186 | Blood sodium decreased | FAERS: 8 | US FAERS | |
| 187 | Bronchitis | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 188 | Compression fracture | FAERS: 8 | OFFSIDES US FAERS | |
| 189 | Diabetes Mellitus | FAERS: 8 | SIDER US FAERS | |
| 190 | Epilepsy | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 191 | Graft loss | FAERS: 8 | US FAERS | |
| 192 | Hypophagia | FAERS: 8 | US FAERS | |
| 193 | Inflammation | FAERS: 8 | SIDER US FAERS | |
| 194 | Injection site nodule | FAERS: 8 | US FAERS | |
| 195 | Lethargy | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 196 | Leukoencephalopathy | FAERS: 8 | OFFSIDES US FAERS | |
| 197 | Lymphadenopathy | FAERS: 8 | SIDER US FAERS | |
| 198 | Lymphoma | FAERS: 8 | 16098063 | CTD SIDER US FAERS |
| 199 | Mantle cell lymphoma | FAERS: 8 | SIDER US FAERS | |
| 200 | Nephrotic Syndrome | FAERS: 8 | US FAERS | |
| 201 | Occupational exposure to product | FAERS: 8 | US FAERS | |
| 202 | Oliguria | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 203 | Oropharyngeal pain | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 204 | Quadriplegia | FAERS: 8 | OFFSIDES US FAERS | |
| 205 | Renal cyst | FAERS: 8 | OFFSIDES US FAERS | |
| 206 | Skin lesion | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 207 | Splenomegaly | FAERS: 8 | 16832816 | CTD US FAERS |
| 208 | Stem cell transplant | FAERS: 8 | OFFSIDES US FAERS | |
| 209 | Tachyarrhythmia | FAERS: 8 | US FAERS | |
| 210 | Therapy non-responder | FAERS: 8 | OFFSIDES US FAERS | |
| 211 | Wrong patient received medication | FAERS: 8 | US FAERS | |
| 212 | Abdominal discomfort | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 213 | Accidental exposure to product | FAERS: 7 | US FAERS | |
| 214 | Activities of daily living impaired | FAERS: 7 | OFFSIDES US FAERS | |
| 215 | Acute myocardial infarction | FAERS: 7 | OFFSIDES US FAERS | |
| 216 | Acute respiratory failure | FAERS: 7 | OFFSIDES US FAERS | |
| 217 | Appendicitis | FAERS: 7 | OFFSIDES US FAERS | |
| 218 | Blood albumin decreased | FAERS: 7 | OFFSIDES US FAERS | |
| 219 | Blood immunoglobulin G increased | FAERS: 7 | OFFSIDES US FAERS | |
| 220 | Bone lesion | FAERS: 7 | US FAERS | |
| 221 | Bronchopulmonary Aspergillosis | FAERS: 7 | US FAERS | |
| 222 | Bronchospasm | FAERS: 7 | SIDER US FAERS | |
| 223 | Cataract | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 224 | Cholelithiasis | FAERS: 7 | SIDER US FAERS | |
| 225 | Dementia | FAERS: 7 | SIDER US FAERS | |
| 226 | Duodenitis | FAERS: 7 | US FAERS | |
| 227 | Dysarthria | FAERS: 7 | SIDER US FAERS | |
| 228 | Dysuria | FAERS: 7 | OFFSIDES US FAERS | |
| 229 | Erectile dysfunction | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 230 | Febrile bone marrow aplasia | FAERS: 7 | OFFSIDES US FAERS | |
| 231 | Fluid overload | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 232 | Gastrointestinal hypomotility | FAERS: 7 | OFFSIDES US FAERS | |
| 233 | Glaucoma | FAERS: 7 | US FAERS | |
| 234 | Hepatic necrosis | FAERS: 7 | OFFSIDES US FAERS | |
| 235 | Hyperviscosity syndrome | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 236 | Injection site cellulitis | FAERS: 7 | US FAERS | |
| 237 | Injection site inflammation | FAERS: 7 | US FAERS | |
| 238 | Injection site warmth | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 239 | Leukocytoclastic vasculitis | FAERS: 7 | SIDER US FAERS | |
| 240 | Light chain analysis increased | FAERS: 7 | OFFSIDES US FAERS | |
| 241 | Memory impairment | FAERS: 7 | US FAERS | |
| 242 | Musculoskeletal Pain | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 243 | Musculoskeletal chest pain | FAERS: 7 | OFFSIDES US FAERS | |
| 244 | Myeloma recurrence | FAERS: 7 | OFFSIDES US FAERS | |
| 245 | Myocarditis | FAERS: 7 | US FAERS | |
| 246 | Optic Neuropathy | FAERS: 7 | OFFSIDES US FAERS | |
| 247 | Pleurisy | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 248 | Restless Legs Syndrome | FAERS: 7 | SIDER US FAERS | |
| 249 | Skin reaction | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 250 | Systemic Inflammatory Response Syndrome | FAERS: 7 | US FAERS | |
| 251 | Urinary Incontinence | FAERS: 7 | SIDER US FAERS | |
| 252 | Wheezing | FAERS: 7 | SIDER US FAERS | |
| 253 | Altered state of consciousness | FAERS: 6 | OFFSIDES US FAERS | |
| 254 | Amnesia | FAERS: 6 | SIDER US FAERS | |
| 255 | Angioedema | FAERS: 6 | SIDER US FAERS | |
| 256 | Atrial Flutter | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 257 | Blood glucose increased | FAERS: 6 | US FAERS | |
| 258 | Completed Suicide | FAERS: 6 | US FAERS | |
| 259 | Dermatitis | FAERS: 6 | SIDER US FAERS | |
| 260 | Disease complication | FAERS: 6 | OFFSIDES US FAERS | |
| 261 | Disseminated Intravascular Coagulation | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 262 | Encephalitis | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 263 | Failure to Thrive | FAERS: 6 | SIDER US FAERS | |
| 264 | Feeling Cold | FAERS: 6 | OFFSIDES US FAERS | |
| 265 | Flatulence | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 266 | Full blood count decreased | FAERS: 6 | US FAERS | |
| 267 | Gastrointestinal motility disorder | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 268 | Hepatitis | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 269 | Hepatomegaly | FAERS: 6 | SIDER US FAERS | |
| 270 | Hyperpyrexia | FAERS: 6 | US FAERS | |
| 271 | Incorrect product storage | FAERS: 6 | US FAERS | |
| 272 | Intestinal Perforation | FAERS: 6 | US FAERS | |
| 273 | Keratitis | FAERS: 6 | US FAERS | |
| 274 | Leukocytosis | FAERS: 6 | SIDER US FAERS | |
| 275 | Nephrolithiasis | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 276 | Nerve injury | FAERS: 6 | US FAERS | |
| 277 | Neuritis | FAERS: 6 | SIDER US FAERS | |
| 278 | Night sweats | FAERS: 6 | SIDER US FAERS | |
| 279 | Optic Neuritis | FAERS: 6 | OFFSIDES US FAERS | |
| 280 | Paresis | FAERS: 6 | SIDER US FAERS | |
| 281 | Pneumothorax | FAERS: 6 | SIDER US FAERS | |
| 282 | Procedural complication | FAERS: 6 | OFFSIDES US FAERS | |
| 283 | Product dose omission | FAERS: 6 | US FAERS | |
| 284 | Productive Cough | FAERS: 6 | OFFSIDES US FAERS | |
| 285 | Swelling | FAERS: 6 | US FAERS | |
| 286 | Thoracic vertebral fracture | FAERS: 6 | OFFSIDES US FAERS | |
| 287 | Toxic Epidermal Necrolysis | FAERS: 6 | SIDER US FAERS | |
| 288 | Acute Lung Injury | FAERS: 5 | US FAERS | |
| 289 | Ageusia | FAERS: 5 | US FAERS | |
| 290 | Cachexia | FAERS: 5 | US FAERS | |
| 291 | Candidiasis | FAERS: 5 | US FAERS | |
| 292 | Cholestasis | FAERS: 5 | SIDER US FAERS | |
| 293 | Coronary Artery Disease | FAERS: 5 | US FAERS | |
| 294 | Depressed Level of Consciousness | FAERS: 5 | OFFSIDES US FAERS | |
| 295 | Diverticular perforation | FAERS: 5 | US FAERS | |
| 296 | Drug prescribing error | FAERS: 5 | OFFSIDES US FAERS | |
| 297 | Endocarditis | FAERS: 5 | OFFSIDES US FAERS | |
| 298 | Eye Infection | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 299 | Eye inflammation | FAERS: 5 | OFFSIDES US FAERS | |
| 300 | Grip strength decreased | FAERS: 5 | US FAERS | |
| 301 | Injection site dryness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 302 | Joint swelling | FAERS: 5 | SIDER US FAERS | |
| 303 | Malnutrition | FAERS: 5 | SIDER US FAERS | |
| 304 | Musculoskeletal stiffness | FAERS: 5 | US FAERS | |
| 305 | Myopathy | FAERS: 5 | SIDER US FAERS | |
| 306 | Neutropenic infection | FAERS: 5 | OFFSIDES US FAERS | |
| 307 | Neutropenic sepsis | FAERS: 5 | OFFSIDES US FAERS | |
| 308 | Osteolysis | FAERS: 5 | US FAERS | |
| 309 | Paraplegia | FAERS: 5 | OFFSIDES US FAERS | |
| 310 | Peritonitis | FAERS: 5 | SIDER US FAERS | |
| 311 | Phlebitis | FAERS: 5 | SIDER US FAERS | |
| 312 | Polyuria | FAERS: 5 | OFFSIDES US FAERS | |
| 313 | Product preparation error | FAERS: 5 | US FAERS | |
| 314 | Pseudomonal sepsis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 315 | Stress | FAERS: 5 | US FAERS | |
| 316 | Subileus | FAERS: 5 | OFFSIDES US FAERS | |
| 317 | Tuberculosis | FAERS: 5 | US FAERS | |
| 318 | Visual Impairment | FAERS: 5 | SIDER US FAERS | |
| 319 | Vocal Cord Paralysis | FAERS: 5 | OFFSIDES US FAERS | |
| 320 | Wheelchair user | FAERS: 5 | US FAERS | |
| 321 | effusion | FAERS: 5 | US FAERS | |
| 322 | Anaphylactic shock | FAERS: 4 | SIDER US FAERS | |
| 323 | Anuria | FAERS: 4 | OFFSIDES US FAERS | |
| 324 | Aortic Aneurysm | FAERS: 4 | OFFSIDES US FAERS | |
| 325 | Blood creatine increased | FAERS: 4 | OFFSIDES US FAERS | |
| 326 | Catheter related infection | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 327 | Clostridium colitis | FAERS: 4 | OFFSIDES US FAERS | |
| 328 | Coombs test positive | FAERS: 4 | US FAERS | |
| 329 | Dengue Fever | FAERS: 4 | OFFSIDES US FAERS | |
| 330 | Discomfort | FAERS: 4 | SIDER US FAERS | |
| 331 | Dry skin | FAERS: 4 | SIDER US FAERS | |
| 332 | Dysphonia | FAERS: 4 | SIDER US FAERS | |
| 333 | Eczema | FAERS: 4 | OFFSIDES US FAERS | |
| 334 | Emergency Care | FAERS: 4 | US FAERS | |
| 335 | Enteritis | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 336 | Escherichia infection | FAERS: 4 | OFFSIDES US FAERS | |
| 337 | Eye irritation | FAERS: 4 | SIDER US FAERS | |
| 338 | Gastritis | FAERS: 4 | SIDER US FAERS | |
| 339 | Gastrointestinal perforation | FAERS: 4 | US FAERS | |
| 340 | Hepatotoxicity | FAERS: 4 | SIDER US FAERS | |
| 341 | Hydronephrosis | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 342 | Hyperventilation | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 343 | Hypokinesia | FAERS: 4 | US FAERS | |
| 344 | Immunosuppression | FAERS: 4 | OFFSIDES US FAERS | |
| 345 | Infusion site erythema | FAERS: 4 | US FAERS | |
| 346 | Infusion site reaction | FAERS: 4 | US FAERS | |
| 347 | Injection site necrosis | FAERS: 4 | US FAERS | |
| 348 | Injury associated with device | FAERS: 4 | US FAERS | |
| 349 | Iron deficiency | FAERS: 4 | US FAERS | |
| 350 | Lymphocyte count decreased | FAERS: 4 | OFFSIDES US FAERS | |
| 351 | Macrocytosis | FAERS: 4 | OFFSIDES US FAERS | |
| 352 | Myoclonus | FAERS: 4 | US FAERS | |
| 353 | Myositis Ossificans | FAERS: 4 | OFFSIDES US FAERS | |
| 354 | Necrosis | FAERS: 4 | US FAERS | |
| 355 | Neuropathic pain | FAERS: 4 | OFFSIDES US FAERS | |
| 356 | Non-cardiac chest pain | FAERS: 4 | SIDER US FAERS | |
| 357 | Osteomyelitis | FAERS: 4 | US FAERS | |
| 358 | Paraparesis | FAERS: 4 | OFFSIDES US FAERS | |
| 359 | Pathological fracture | FAERS: 4 | US FAERS | |
| 360 | Performance status decreased | FAERS: 4 | OFFSIDES US FAERS | |
| 361 | Plasmacytosis | FAERS: 4 | OFFSIDES US FAERS | |
| 362 | Pneumocystis jiroveci pneumonia | FAERS: 4 | OFFSIDES US FAERS | |
| 363 | Pneumoperitoneum | FAERS: 4 | OFFSIDES US FAERS | |
| 364 | Product dispensing error | FAERS: 4 | US FAERS | |
| 365 | Protein urine present | FAERS: 4 | SIDER US FAERS | |
| 366 | Pulmonary congestion | FAERS: 4 | OFFSIDES US FAERS | |
| 367 | Pulmonary toxicity | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 368 | Radiculopathy | FAERS: 4 | SIDER US FAERS | |
| 369 | Respiratory arrest | FAERS: 4 | US FAERS | |
| 370 | Retinal Detachment | FAERS: 4 | US FAERS | |
| 371 | Sick Sinus Syndrome | FAERS: 4 | OFFSIDES US FAERS | |
| 372 | Sinus bradycardia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 373 | Sputum culture positive | FAERS: 4 | OFFSIDES US FAERS | |
| 374 | Thrombophlebitis | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 375 | Toothache | FAERS: 4 | US FAERS | |
| 376 | jaundice | FAERS: 4 | US FAERS | |
| 377 | Acidosis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 378 | Acquired diaphragmatic eventration | FAERS: 3 | OFFSIDES US FAERS | |
| 379 | Aspartate aminotransferase decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 380 | Aspergillosis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 381 | Ataxia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 382 | Atrioventricular Block | FAERS: 3 | SIDER US FAERS | |
| 383 | Autonomic nervous system imbalance | FAERS: 3 | SIDER US FAERS | |
| 384 | Bedridden | FAERS: 3 | US FAERS | |
| 385 | Blood amylase increased | FAERS: 3 | OFFSIDES US FAERS | |
| 386 | Blood chloride decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 387 | Blood creatine phosphokinase increased | FAERS: 3 | OFFSIDES US FAERS | |
| 388 | Blood magnesium increased | FAERS: 3 | OFFSIDES US FAERS | |
| 389 | Brain Death | FAERS: 3 | OFFSIDES US FAERS | |
| 390 | Brain natriuretic peptide increased | FAERS: 3 | OFFSIDES US FAERS | |
| 391 | Bronchiolitis | FAERS: 3 | OFFSIDES US FAERS | |
| 392 | Budd-Chiari Syndrome | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 393 | Carbon dioxide decreased | FAERS: 3 | SIDER US FAERS | |
| 394 | Cardiovascular insufficiency | FAERS: 3 | OFFSIDES US FAERS | |
| 395 | Central Nervous System Infection | FAERS: 3 | US FAERS | |
| 396 | Clumsiness | FAERS: 3 | US FAERS | |
| 397 | Corneal Opacity | FAERS: 3 | US FAERS | |
| 398 | Culture urine positive | FAERS: 3 | US FAERS | |
| 399 | Cytolytic hepatitis | FAERS: 3 | OFFSIDES US FAERS | |
| 400 | Diplegia | FAERS: 3 | US FAERS | |
| 401 | Drug administered at inappropriate site | FAERS: 3 | US FAERS | |
| 402 | Ear discomfort | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 403 | Embolism | FAERS: 3 | OFFSIDES US FAERS | |
| 404 | Endoscopy small intestine abnormal | FAERS: 3 | OFFSIDES US FAERS | |
| 405 | Enterocolitis | FAERS: 3 | OFFSIDES US FAERS | |
| 406 | Erosive Duodenitis | FAERS: 3 | US FAERS | |
| 407 | Erythema elevatum diutinum | FAERS: 3 | OFFSIDES US FAERS | |
| 408 | Extra dose administered | FAERS: 3 | US FAERS | |
| 409 | Extravasation | FAERS: 3 | SIDER US FAERS | |
| 410 | Gastrointestinal vascular malformation | FAERS: 3 | US FAERS | |
| 411 | Hepatitis C | FAERS: 3 | US FAERS | |
| 412 | Histiocytosis haematophagic | FAERS: 3 | OFFSIDES US FAERS | |
| 413 | Hyperthyroidism | FAERS: 3 | SIDER US FAERS | |
| 414 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 415 | Impaired gastric emptying | FAERS: 3 | US FAERS | |
| 416 | Inappropriate release of product for distribution | FAERS: 3 | US FAERS | |
| 417 | Incorrect drug administration rate | FAERS: 3 | OFFSIDES US FAERS | |
| 418 | Infarction | FAERS: 3 | SIDER US FAERS | |
| 419 | Injection site discomfort | FAERS: 3 | US FAERS | |
| 420 | Injection site extravasation | FAERS: 3 | US FAERS | |
| 421 | Injection site mass | FAERS: 3 | US FAERS | |
| 422 | Injection site phlebitis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 423 | Intentional misuse | FAERS: 3 | US FAERS | |
| 424 | Klebsiella sepsis | FAERS: 3 | US FAERS | |
| 425 | Large intestine perforation | FAERS: 3 | SIDER US FAERS | |
| 426 | Lobar Pneumonia | FAERS: 3 | US FAERS | |
| 427 | Lung Abscess | FAERS: 3 | US FAERS | |
| 428 | Lung Injury | FAERS: 3 | OFFSIDES US FAERS | |
| 429 | Malignant histiocytosis | FAERS: 3 | US FAERS | |
| 430 | Meningitis | FAERS: 3 | SIDER US FAERS | |
| 431 | Mental impairment | FAERS: 3 | US FAERS | |
| 432 | Metastasis | FAERS: 3 | US FAERS | |
| 433 | Monoclonal immunoglobulin present | FAERS: 3 | OFFSIDES US FAERS | |
| 434 | Monocytosis | FAERS: 3 | OFFSIDES US FAERS | |
| 435 | Mononeuropathy Multiplex | FAERS: 3 | US FAERS | |
| 436 | Mycosis Fungoides | FAERS: 3 | SIDER US FAERS | |
| 437 | Neck Pain | FAERS: 3 | US FAERS | |
| 438 | Nervousness | FAERS: 3 | US FAERS | |
| 439 | Occult blood positive | FAERS: 3 | US FAERS | |
| 440 | Oral pain | FAERS: 3 | US FAERS | |
| 441 | Osteosclerosis | FAERS: 3 | US FAERS | |
| 442 | Ototoxicity | FAERS: 3 | US FAERS | |
| 443 | Panniculitis | FAERS: 3 | OFFSIDES US FAERS | |
| 444 | Pericarditis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 445 | Personality Change | FAERS: 3 | US FAERS | |
| 446 | Pharyngolaryngeal Pain | FAERS: 3 | US FAERS | |
| 447 | Polyarteritis Nodosa | FAERS: 3 | US FAERS | |
| 448 | Portal Vein Thrombosis | FAERS: 3 | SIDER US FAERS | |
| 449 | Product administered at inappropriate site | FAERS: 3 | US FAERS | |
| 450 | Product packaging quantity issue | FAERS: 3 | US FAERS | |
| 451 | Product prescribing error | FAERS: 3 | US FAERS | |
| 452 | Psoriasis | FAERS: 3 | SIDER US FAERS | |
| 453 | Pulmonary function test decreased | FAERS: 3 | US FAERS | |
| 454 | Radiation skin injury | FAERS: 3 | US FAERS | |
| 455 | Radiculitis | FAERS: 3 | SIDER US FAERS | |
| 456 | Recall phenomenon | FAERS: 3 | OFFSIDES US FAERS | |
| 457 | Refusal of treatment by relative | FAERS: 3 | OFFSIDES US FAERS | |
| 458 | Renal Cell Carcinoma | FAERS: 3 | SIDER US FAERS | |
| 459 | Restlessness | FAERS: 3 | US FAERS | |
| 460 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 461 | Skin nodule | FAERS: 3 | US FAERS | |
| 462 | Skin toxicity | FAERS: 3 | OFFSIDES US FAERS | |
| 463 | Spinal column stenosis | FAERS: 3 | OFFSIDES US FAERS | |
| 464 | Squamous cell carcinoma of skin | FAERS: 3 | OFFSIDES US FAERS | |
| 465 | Stevens-Johnson Syndrome | FAERS: 3 | 25811541 | CTD OFFSIDES SIDER US FAERS |
| 466 | Stomatitis | FAERS: 3 | SIDER US FAERS | |
| 467 | Therapeutic response changed | FAERS: 3 | US FAERS | |
| 468 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 469 | Unresponsive to stimuli | FAERS: 3 | OFFSIDES US FAERS | |
| 470 | Urinary tract obstruction | FAERS: 3 | US FAERS | |
| 471 | Ventricular Fibrillation | FAERS: 3 | US FAERS | |
| 472 | Vertebroplasty | FAERS: 3 | OFFSIDES US FAERS | |
| 473 | treatment failure | FAERS: 3 | US FAERS | |
| 474 | Abdominal mass | FAERS: 2 | US FAERS | |
| 475 | Abdominal rigidity | FAERS: 2 | OFFSIDES US FAERS | |
| 476 | Abscess | FAERS: 2 | US FAERS | |
| 477 | Acute graft versus host disease in skin | FAERS: 2 | US FAERS | |
| 478 | Ammonia increased | FAERS: 2 | OFFSIDES US FAERS | |
| 479 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 480 | Anoxia | FAERS: 2 | US FAERS | |
| 481 | Apathy | FAERS: 2 | OFFSIDES US FAERS | |
| 482 | Aphagia | FAERS: 2 | US FAERS | |
| 483 | Aphthous Stomatitis | FAERS: 2 | US FAERS | |
| 484 | Application site erythema | FAERS: 2 | US FAERS | |
| 485 | Arteriovenous graft | FAERS: 2 | US FAERS | |
| 486 | Arthritis | FAERS: 2 | SIDER US FAERS | |
| 487 | Atrial thrombosis | FAERS: 2 | OFFSIDES US FAERS | |
| 488 | Autoimmune neuropathy | FAERS: 2 | US FAERS | |
| 489 | BK virus infection | FAERS: 2 | US FAERS | |
| 490 | Bacillus infection | FAERS: 2 | OFFSIDES US FAERS | |
| 491 | Bacterial sepsis | FAERS: 2 | OFFSIDES US FAERS | |
| 492 | Basal cell carcinoma | FAERS: 2 | OFFSIDES US FAERS | |
| 493 | Blood alkaline phosphatase decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 494 | Blood calcium abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 495 | Blood creatinine abnormal | FAERS: 2 | US FAERS | |
| 496 | Blood electrolytes abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 497 | Blood glucose decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 498 | Blood immunoglobulin A increased | FAERS: 2 | OFFSIDES US FAERS | |
| 499 | Blood immunoglobulin G decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 500 | Blood immunoglobulin M decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 501 | Blood lactate dehydrogenase decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 502 | Blood osmolarity decreased | FAERS: 2 | US FAERS | |
| 503 | Blood phosphorus increased | FAERS: 2 | OFFSIDES US FAERS | |
| 504 | Blood sodium increased | FAERS: 2 | US FAERS | |
| 505 | Brain Abscess | FAERS: 2 | US FAERS | |
| 506 | Bronchial wall thickening | FAERS: 2 | OFFSIDES US FAERS | |
| 507 | Cardiac Death | FAERS: 2 | US FAERS | |
| 508 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 509 | Cardiac asthma | FAERS: 2 | OFFSIDES US FAERS | |
| 510 | Cardiac ventricular disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 511 | Catheter site erythema | FAERS: 2 | US FAERS | |
| 512 | Catheter site infection | FAERS: 2 | OFFSIDES US FAERS | |
| 513 | Cerebral atrophy | FAERS: 2 | US FAERS | |
| 514 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 515 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 516 | Coronary artery insufficiency | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 517 | Counterfeit drug administered | FAERS: 2 | US FAERS | |
| 518 | Cryoglobulins | FAERS: 2 | US FAERS | |
| 519 | Cyanosis | FAERS: 2 | US FAERS | |
| 520 | Cystitis | FAERS: 2 | US FAERS | |
| 521 | Cytopenia | FAERS: 2 | US FAERS | |
| 522 | Demyelination | FAERS: 2 | OFFSIDES US FAERS | |
| 523 | Dental caries | FAERS: 2 | OFFSIDES US FAERS | |
| 524 | Diabetes mellitus inadequate control | FAERS: 2 | OFFSIDES US FAERS | |
| 525 | Dialysis device complication | FAERS: 2 | OFFSIDES US FAERS | |
| 526 | Diffuse Large B-Cell Lymphoma | FAERS: 2 | US FAERS | |
| 527 | Diffuse alveolar damage | FAERS: 2 | OFFSIDES US FAERS | |
| 528 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 529 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 530 | Economic problem | FAERS: 2 | OFFSIDES US FAERS | |
| 531 | Electrolyte imbalance | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 532 | Emphysematous cystitis | FAERS: 2 | US FAERS | |
| 533 | Enterococcal infection | FAERS: 2 | OFFSIDES US FAERS | |
| 534 | Enterocolitis bacterial | FAERS: 2 | OFFSIDES US FAERS | |
| 535 | Erysipelas | FAERS: 2 | OFFSIDES US FAERS | |
| 536 | Escherichia urinary tract infection | FAERS: 2 | OFFSIDES US FAERS | |
| 537 | Eye pain | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 538 | Feeling jittery | FAERS: 2 | US FAERS | |
| 539 | Fibrin D dimer increased | FAERS: 2 | US FAERS | |
| 540 | Food Poisoning | FAERS: 2 | US FAERS | |
| 541 | Full blood count abnormal | FAERS: 2 | US FAERS | |
| 542 | Gastrointestinal carcinoma | FAERS: 2 | US FAERS | |
| 543 | Gastrointestinal ulcer | FAERS: 2 | US FAERS | |
| 544 | Genital pain | FAERS: 2 | SIDER US FAERS | |
| 545 | Gingivitis | FAERS: 2 | US FAERS | |
| 546 | Gout | FAERS: 2 | SIDER US FAERS | |
| 547 | Graft infection | FAERS: 2 | US FAERS | |
| 548 | Hepatic infection fungal | FAERS: 2 | OFFSIDES US FAERS | |
| 549 | High density lipoprotein increased | FAERS: 2 | OFFSIDES US FAERS | |
| 550 | Hospice Care | FAERS: 2 | US FAERS | |
| 551 | Hydrocephalus | FAERS: 2 | US FAERS | |
| 552 | Hydrothorax | FAERS: 2 | OFFSIDES US FAERS | |
| 553 | Hypertensive Encephalopathy | FAERS: 2 | US FAERS | |
| 554 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 555 | Hyporeflexia | FAERS: 2 | OFFSIDES US FAERS | |
| 556 | Impaired work ability | FAERS: 2 | US FAERS | |
| 557 | Inadequate analgesia | FAERS: 2 | US FAERS | |
| 558 | Incoherent | FAERS: 2 | OFFSIDES US FAERS | |
| 559 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 560 | Induration | FAERS: 2 | US FAERS | |
| 561 | Infection in an immunocompromised host | FAERS: 2 | OFFSIDES US FAERS | |
| 562 | Injection site scar | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 563 | Injection site streaking | FAERS: 2 | US FAERS | |
| 564 | Injection site vasculitis | FAERS: 2 | OFFSIDES US FAERS | |
| 565 | Interleukin level increased | FAERS: 2 | OFFSIDES US FAERS | |
| 566 | Irritable Bowel Syndrome | FAERS: 2 | SIDER US FAERS | |
| 567 | Liver Abscess | FAERS: 2 | OFFSIDES US FAERS | |
| 568 | Lyme Disease | FAERS: 2 | US FAERS | |
| 569 | Lymphocyte count abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 570 | Malignant ascites | FAERS: 2 | US FAERS | |
| 571 | Mallory-Weiss Syndrome | FAERS: 2 | OFFSIDES US FAERS | |
| 572 | Mantle cell lymphoma refractory | FAERS: 2 | US FAERS | |
| 573 | Mastoiditis | FAERS: 2 | SIDER US FAERS | |
| 574 | Medical device complication | FAERS: 2 | SIDER US FAERS | |
| 575 | Megakaryocytes decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 576 | Monocyte percentage increased | FAERS: 2 | OFFSIDES US FAERS | |
| 577 | Mood swings | FAERS: 2 | US FAERS | |
| 578 | Muscle tightness | FAERS: 2 | US FAERS | |
| 579 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 580 | Neuroborreliosis | FAERS: 2 | OFFSIDES US FAERS | |
| 581 | Neutropenic colitis | FAERS: 2 | US FAERS | |
| 582 | Neutrophil count abnormal | FAERS: 2 | US FAERS | |
| 583 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 584 | Obsessive-Compulsive Disorder | FAERS: 2 | US FAERS | |
| 585 | Oral fungal infection | FAERS: 2 | US FAERS | |
| 586 | Osteonecrosis of Jaw | FAERS: 2 | US FAERS | |
| 587 | Otitis Media | FAERS: 2 | US FAERS | |
| 588 | Oxygen saturation abnormal | FAERS: 2 | US FAERS | |
| 589 | PCO2 decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 590 | PO2 decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 591 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 592 | Pelvic Pain | FAERS: 2 | SIDER US FAERS | |
| 593 | Pelvic prolapse | FAERS: 2 | OFFSIDES US FAERS | |
| 594 | Peripheral embolism | FAERS: 2 | SIDER US FAERS | |
| 595 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 596 | Physical examination abnormal | FAERS: 2 | US FAERS | |
| 597 | Platelet count abnormal | FAERS: 2 | US FAERS | |
| 598 | Pneumatosis intestinalis | FAERS: 2 | US FAERS | |
| 599 | Pneumococcal sepsis | FAERS: 2 | OFFSIDES US FAERS | |
| 600 | Post procedural complication | FAERS: 2 | US FAERS | |
| 601 | Pulmonary Infarction | FAERS: 2 | OFFSIDES US FAERS | |
| 602 | Pulmonary sepsis | FAERS: 2 | US FAERS | |
| 603 | Pulmonary thrombosis | FAERS: 2 | US FAERS | |
| 604 | Quadriparesis | FAERS: 2 | OFFSIDES US FAERS | |
| 605 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 606 | Rales | FAERS: 2 | OFFSIDES US FAERS | |
| 607 | Renal mass | FAERS: 2 | US FAERS | |
| 608 | Renal tubular necrosis | FAERS: 2 | OFFSIDES US FAERS | |
| 609 | Respiratory tract congestion | FAERS: 2 | SIDER US FAERS | |
| 610 | Retinal Artery Occlusion | FAERS: 2 | US FAERS | |
| 611 | Sensorimotor disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 612 | Serum Sickness | FAERS: 2 | US FAERS | |
| 613 | Sinoatrial Block | FAERS: 2 | OFFSIDES US FAERS | |
| 614 | Skin irritation | FAERS: 2 | US FAERS | |
| 615 | Skin necrosis | FAERS: 2 | US FAERS | |
| 616 | Small intestine carcinoma | FAERS: 2 | US FAERS | |
| 617 | Soft tissue mass | FAERS: 2 | US FAERS | |
| 618 | Splenic Rupture | FAERS: 2 | US FAERS | |
| 619 | Splenic neoplasm malignancy unspecified | FAERS: 2 | US FAERS | |
| 620 | Starvation | FAERS: 2 | US FAERS | |
| 621 | Streptococcus test positive | FAERS: 2 | US FAERS | |
| 622 | Superinfection | FAERS: 2 | US FAERS | |
| 623 | Suspected counterfeit product | FAERS: 2 | US FAERS | |
| 624 | Thermal burn | FAERS: 2 | SIDER US FAERS | |
| 625 | Thrombocytopenic purpura | FAERS: 2 | SIDER US FAERS | |
| 626 | Upper airway obstruction | FAERS: 2 | US FAERS | |
| 627 | Uveitis | FAERS: 2 | US FAERS | |
| 628 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 629 | Vasculitic rash | FAERS: 2 | US FAERS | |
| 630 | Venous occlusion | FAERS: 2 | US FAERS | |
| 631 | Wound Complication | FAERS: 2 | US FAERS | |
| 632 | kyphosis | FAERS: 2 | US FAERS | |
| 633 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 634 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 635 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 636 | Administration site bruise | FAERS: 1 | US FAERS | |
| 637 | Administration site reaction | FAERS: 1 | US FAERS | |
| 638 | Aldolase increased | FAERS: 1 | US FAERS | |
| 639 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 640 | Anal Fissure | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 641 | Aneurysm | FAERS: 1 | US FAERS | |
| 642 | Angiomyolipoma | FAERS: 1 | OFFSIDES US FAERS | |
| 643 | Anisocytosis | FAERS: 1 | OFFSIDES US FAERS | |
| 644 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 645 | Anosmia | FAERS: 1 | US FAERS | |
| 646 | Anoxic Encephalopathy | FAERS: 1 | OFFSIDES US FAERS | |
| 647 | Anti factor VII antibody positive | FAERS: 1 | US FAERS | |
| 648 | Antibody test positive | FAERS: 1 | US FAERS | |
| 649 | Aphasia | FAERS: 1 | 16832816 | CTD US FAERS |
| 650 | Aphonia | FAERS: 1 | US FAERS | |
| 651 | Application site necrosis | FAERS: 1 | US FAERS | |
| 652 | Arthropathy | FAERS: 1 | US FAERS | |
| 653 | Ataxia Telangiectasia | FAERS: 1 | US FAERS | |
| 654 | Autologous bone marrow transplantation therapy | FAERS: 1 | US FAERS | |
| 655 | Autonomic failure syndrome | FAERS: 1 | US FAERS | |
| 656 | Axonal neuropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 657 | Bacteria stool identified | FAERS: 1 | OFFSIDES US FAERS | |
| 658 | Benign Prostatic Hyperplasia | FAERS: 1 | OFFSIDES US FAERS | |
| 659 | Biliary dilatation | FAERS: 1 | OFFSIDES US FAERS | |
| 660 | Biopsy lung abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 661 | Bladder dysfunction | FAERS: 1 | US FAERS | |
| 662 | Bladder spasm | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 663 | Blast cell proliferation | FAERS: 1 | US FAERS | |
| 664 | Blast cells present | FAERS: 1 | US FAERS | |
| 665 | Blood beta-D-glucan increased | FAERS: 1 | OFFSIDES US FAERS | |
| 666 | Blood chloride abnormal | FAERS: 1 | US FAERS | |
| 667 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 668 | Blood creatine phosphokinase MB increased | FAERS: 1 | OFFSIDES US FAERS | |
| 669 | Blood fibrinogen decreased | FAERS: 1 | US FAERS | |
| 670 | Blood fibrinogen increased | FAERS: 1 | US FAERS | |
| 671 | Blood glucose fluctuation | FAERS: 1 | OFFSIDES US FAERS | |
| 672 | Blood lactate dehydrogenase | FAERS: 1 | US FAERS | |
| 673 | Blood pH decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 674 | Blood pH increased | FAERS: 1 | OFFSIDES US FAERS | |
| 675 | Blood parathyroid hormone increased | FAERS: 1 | US FAERS | |
| 676 | Blood pressure fluctuation | FAERS: 1 | OFFSIDES US FAERS | |
| 677 | Blood stem cell transplant failure | FAERS: 1 | US FAERS | |
| 678 | Blood urea abnormal | FAERS: 1 | US FAERS | |
| 679 | Blood urine present | FAERS: 1 | US FAERS | |
| 680 | Bone density decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 681 | Bone erosion | FAERS: 1 | OFFSIDES US FAERS | |
| 682 | Bone fissure | FAERS: 1 | US FAERS | |
| 683 | Bone marrow toxicity | FAERS: 1 | US FAERS | |
| 684 | Bradykinesia | FAERS: 1 | US FAERS | |
| 685 | Bronchial Hyperreactivity | FAERS: 1 | SIDER US FAERS | |
| 686 | Bronchopneumopathy | FAERS: 1 | US FAERS | |
| 687 | Bronchoscopy abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 688 | C-reactive protein decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 689 | Calcinosis | FAERS: 1 | OFFSIDES US FAERS | |
| 690 | Calciphylaxis | FAERS: 1 | US FAERS | |
| 691 | Cancer Pain | FAERS: 1 | US FAERS | |
| 692 | Candida sepsis | FAERS: 1 | US FAERS | |
| 693 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 694 | Cardiac Hypertrophy | FAERS: 1 | OFFSIDES US FAERS | |
| 695 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 696 | Cardiomyopathy acute | FAERS: 1 | US FAERS | |
| 697 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 698 | Cataract operation | FAERS: 1 | US FAERS | |
| 699 | Catatonia | FAERS: 1 | OFFSIDES US FAERS | |
| 700 | Catheter culture positive | FAERS: 1 | US FAERS | |
| 701 | Catheter site cellulitis | FAERS: 1 | OFFSIDES US FAERS | |
| 702 | Cell Death | FAERS: 1 | US FAERS | |
| 703 | Cementoplasty | FAERS: 1 | US FAERS | |
| 704 | Central nervous system mass | FAERS: 1 | US FAERS | |
| 705 | Cervicobrachial syndrome | FAERS: 1 | US FAERS | |
| 706 | Chemical eye injury | FAERS: 1 | US FAERS | |
| 707 | Chemical injury | FAERS: 1 | US FAERS | |
| 708 | Chest wall pain | FAERS: 1 | US FAERS | |
| 709 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 710 | Choreoathetosis | FAERS: 1 | US FAERS | |
| 711 | Clostridium test positive | FAERS: 1 | US FAERS | |
| 712 | Cluster Headache | FAERS: 1 | US FAERS | |
| 713 | Complications of bone marrow transplant | FAERS: 1 | US FAERS | |
| 714 | Concomitant disease progression | FAERS: 1 | US FAERS | |
| 715 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 716 | Congenital varicella infection | FAERS: 1 | US FAERS | |
| 717 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 718 | Cor pulmonale | FAERS: 1 | OFFSIDES US FAERS | |
| 719 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 720 | Coronary angioplasty | FAERS: 1 | US FAERS | |
| 721 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 722 | Critical Illness | FAERS: 1 | US FAERS | |
| 723 | Cryoglobulins present | FAERS: 1 | US FAERS | |
| 724 | Culture positive | FAERS: 1 | OFFSIDES US FAERS | |
| 725 | Cytomegalovirus antigen positive | FAERS: 1 | US FAERS | |
| 726 | Cytomegalovirus hepatitis | FAERS: 1 | SIDER US FAERS | |
| 727 | Dacryoadenitis acquired | FAERS: 1 | SIDER US FAERS | |
| 728 | Death of relative | FAERS: 1 | US FAERS | |
| 729 | Debridement | FAERS: 1 | OFFSIDES US FAERS | |
| 730 | Depressed mood | FAERS: 1 | US FAERS | |
| 731 | Dermo-hypodermitis | FAERS: 1 | US FAERS | |
| 732 | Device occlusion | FAERS: 1 | US FAERS | |
| 733 | Device related infection | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 734 | Diastolic dysfunction | FAERS: 1 | OFFSIDES US FAERS | |
| 735 | Diffuse panbronchiolitis | FAERS: 1 | US FAERS | |
| 736 | Disability | FAERS: 1 | SIDER US FAERS | |
| 737 | Disseminated varicella zoster vaccine virus infection | FAERS: 1 | US FAERS | |
| 738 | Diverticulum | FAERS: 1 | OFFSIDES US FAERS | |
| 739 | Drooling | FAERS: 1 | SIDER US FAERS | |
| 740 | Drowning | FAERS: 1 | OFFSIDES US FAERS | |
| 741 | Drug abuse | FAERS: 1 | US FAERS | |
| 742 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 743 | Drug level increased | FAERS: 1 | US FAERS | |
| 744 | Drug specific antibody present | FAERS: 1 | US FAERS | |
| 745 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 746 | Dysentery | FAERS: 1 | US FAERS | |
| 747 | Dysphasia | FAERS: 1 | OFFSIDES US FAERS | |
| 748 | Dysplasia | FAERS: 1 | US FAERS | |
| 749 | Ecchymosis | FAERS: 1 | SIDER US FAERS | |
| 750 | Electrophoresis abnormal | FAERS: 1 | US FAERS | |
| 751 | Emotional distress | FAERS: 1 | US FAERS | |
| 752 | Endometrial disorder | FAERS: 1 | US FAERS | |
| 753 | Enterocolitis viral | FAERS: 1 | US FAERS | |
| 754 | Epidermolysis Bullosa | FAERS: 1 | US FAERS | |
| 755 | Epiglottitis | FAERS: 1 | US FAERS | |
| 756 | Episcleritis | FAERS: 1 | US FAERS | |
| 757 | Epstein-Barr virus antigen positive | FAERS: 1 | US FAERS | |
| 758 | Erythroblast count increased | FAERS: 1 | OFFSIDES US FAERS | |
| 759 | Escherichia sepsis | FAERS: 1 | OFFSIDES US FAERS | |
| 760 | Euphoric mood | FAERS: 1 | OFFSIDES US FAERS | |
| 761 | Exophthalmos | FAERS: 1 | SIDER US FAERS | |
| 762 | Expired product administered | FAERS: 1 | US FAERS | |
| 763 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 764 | Exposure to body fluid | FAERS: 1 | US FAERS | |
| 765 | Eye ulcer | FAERS: 1 | US FAERS | |
| 766 | Facial Pain | FAERS: 1 | US FAERS | |
| 767 | Facial paralysis | FAERS: 1 | US FAERS | |
| 768 | False positive investigation result | FAERS: 1 | US FAERS | |
| 769 | Fasciitis | FAERS: 1 | US FAERS | |
| 770 | Fat necrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 771 | Febrile infection | FAERS: 1 | OFFSIDES US FAERS | |
| 772 | Foaming at mouth | FAERS: 1 | OFFSIDES US FAERS | |
| 773 | Formication | FAERS: 1 | OFFSIDES US FAERS | |
| 774 | Fracture pain | FAERS: 1 | US FAERS | |
| 775 | Gallop rhythm present | FAERS: 1 | OFFSIDES US FAERS | |
| 776 | Gammopathy | FAERS: 1 | OFFSIDES US FAERS | |
| 777 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 778 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 779 | Gastrointestinal amyloidosis | FAERS: 1 | US FAERS | |
| 780 | Gastrointestinal examination abnormal | FAERS: 1 | US FAERS | |
| 781 | Gastrointestinal mucosal exfoliation | FAERS: 1 | US FAERS | |
| 782 | Genital abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 783 | Gingival hyperpigmentation | FAERS: 1 | US FAERS | |
| 784 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 785 | Glossopharyngeal nerve paralysis | FAERS: 1 | US FAERS | |
| 786 | Graft versus host disease in eye | FAERS: 1 | US FAERS | |
| 787 | Graft versus host disease in lung | FAERS: 1 | US FAERS | |
| 788 | Granuloma | FAERS: 1 | US FAERS | |
| 789 | Hemiplegia | FAERS: 1 | 17204182 | CTD US FAERS |
| 790 | Hepatic cancer metastatic | FAERS: 1 | OFFSIDES US FAERS | |
| 791 | Hepatic cyst infection | FAERS: 1 | US FAERS | |
| 792 | Herpangina | FAERS: 1 | US FAERS | |
| 793 | Herpes zoster infection neurological | FAERS: 1 | US FAERS | |
| 794 | Hip surgery | FAERS: 1 | US FAERS | |
| 795 | Human chorionic gonadotropin increased | FAERS: 1 | US FAERS | |
| 796 | Human chorionic gonadotropin positive | FAERS: 1 | US FAERS | |
| 797 | Hunger | FAERS: 1 | US FAERS | |
| 798 | Hungry bone syndrome | FAERS: 1 | US FAERS | |
| 799 | Hyaluronic acid abnormal | FAERS: 1 | US FAERS | |
| 800 | Hypercapnia | FAERS: 1 | OFFSIDES US FAERS | |
| 801 | Hyperkeratosis | FAERS: 1 | OFFSIDES US FAERS | |
| 802 | Hyperplastic cholecystopathy | FAERS: 1 | OFFSIDES US FAERS | |
| 803 | Hypersomnia | FAERS: 1 | US FAERS | |
| 804 | Hypopyon | FAERS: 1 | US FAERS | |
| 805 | Hypothyroidism | FAERS: 1 | SIDER US FAERS | |
| 806 | Immobile | FAERS: 1 | US FAERS | |
| 807 | Immune-mediated adverse reaction | FAERS: 1 | US FAERS | |
| 808 | Incontinence | FAERS: 1 | US FAERS | |
| 809 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 810 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 811 | Infection reactivation | FAERS: 1 | US FAERS | |
| 812 | Infertility | FAERS: 1 | SIDER US FAERS | |
| 813 | Influenza virus test positive | FAERS: 1 | US FAERS | |
| 814 | Infusion Site Extravasation | FAERS: 1 | OFFSIDES US FAERS | |
| 815 | Infusion site dermatitis | FAERS: 1 | US FAERS | |
| 816 | Infusion site pain | FAERS: 1 | US FAERS | |
| 817 | Infusion site swelling | FAERS: 1 | US FAERS | |
| 818 | Injection site abscess | FAERS: 1 | US FAERS | |
| 819 | Injection site eczema | FAERS: 1 | US FAERS | |
| 820 | Injection site infection | FAERS: 1 | US FAERS | |
| 821 | Injection site ulcer | FAERS: 1 | US FAERS | |
| 822 | Injury asphyxiation | FAERS: 1 | OFFSIDES US FAERS | |
| 823 | Insurance issue | FAERS: 1 | US FAERS | |
| 824 | Intercepted product administration error | FAERS: 1 | US FAERS | |
| 825 | Intervertebral disc compression | FAERS: 1 | OFFSIDES US FAERS | |
| 826 | Intervertebral disc disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 827 | Intestinal infarction | FAERS: 1 | OFFSIDES US FAERS | |
| 828 | Intracranial Hypotension | FAERS: 1 | US FAERS | |
| 829 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 830 | JC virus infection | FAERS: 1 | US FAERS | |
| 831 | JC virus test positive | FAERS: 1 | US FAERS | |
| 832 | Joint injury | FAERS: 1 | SIDER US FAERS | |
| 833 | Laceration | FAERS: 1 | SIDER US FAERS | |
| 834 | Laryngitis | FAERS: 1 | US FAERS | |
| 835 | Left Ventricular Hypertrophy | FAERS: 1 | OFFSIDES US FAERS | |
| 836 | Left atrial dilatation | FAERS: 1 | OFFSIDES US FAERS | |
| 837 | Leukopenia neonatal | FAERS: 1 | OFFSIDES US FAERS | |
| 838 | Light chain analysis decreased | FAERS: 1 | US FAERS | |
| 839 | Limb discomfort | FAERS: 1 | US FAERS | |
| 840 | Lip swelling | FAERS: 1 | SIDER US FAERS | |
| 841 | Livedo Reticularis | FAERS: 1 | SIDER US FAERS | |
| 842 | Local reaction | FAERS: 1 | SIDER US FAERS | |
| 843 | Lung consolidation | FAERS: 1 | OFFSIDES US FAERS | |
| 844 | Lung infiltration malignant | FAERS: 1 | OFFSIDES US FAERS | |
| 845 | Lymphatic system neoplasm | FAERS: 1 | US FAERS | |
| 846 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 847 | Lymphocyte percentage decreased | FAERS: 1 | US FAERS | |
| 848 | Lymphoplasmacytoid lymphoma/immunocytoma | FAERS: 1 | US FAERS | |
| 849 | Macrophages increased | FAERS: 1 | US FAERS | |
| 850 | Malignant transformation | FAERS: 1 | US FAERS | |
| 851 | Mantle cell lymphoma recurrent | FAERS: 1 | US FAERS | |
| 852 | Marasmus | FAERS: 1 | US FAERS | |
| 853 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 854 | Medical observation | FAERS: 1 | US FAERS | |
| 855 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 856 | Mesenteritis | FAERS: 1 | US FAERS | |
| 857 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 858 | Microcytosis | FAERS: 1 | US FAERS | |
| 859 | Middle insomnia | FAERS: 1 | US FAERS | |
| 860 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 861 | Monoplegia | FAERS: 1 | OFFSIDES US FAERS | |
| 862 | Mucormycosis | FAERS: 1 | OFFSIDES US FAERS | |
| 863 | Multimorbidity | FAERS: 1 | US FAERS | |
| 864 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 865 | Multiple allergies | FAERS: 1 | US FAERS | |
| 866 | Multiple use of single-use product | FAERS: 1 | US FAERS | |
| 867 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 868 | Muscle necrosis | FAERS: 1 | US FAERS | |
| 869 | Musculoskeletal discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 870 | Mutism | FAERS: 1 | US FAERS | |
| 871 | Mycotoxicosis | FAERS: 1 | US FAERS | |
| 872 | Myelitis | FAERS: 1 | US FAERS | |
| 873 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 874 | Myoglobinuria | FAERS: 1 | US FAERS | |
| 875 | Myopia | FAERS: 1 | OFFSIDES US FAERS | |
| 876 | Myositis | FAERS: 1 | US FAERS | |
| 877 | Natural killer-cell lymphoblastic lymphoma | FAERS: 1 | US FAERS | |
| 878 | Nerve Root Compression | FAERS: 1 | OFFSIDES US FAERS | |
| 879 | Neurological examination abnormal | FAERS: 1 | US FAERS | |
| 880 | Neutrophil percentage increased | FAERS: 1 | US FAERS | |
| 881 | No adverse drug reaction | FAERS: 1 | US FAERS | |
| 882 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 883 | Nystagmus | FAERS: 1 | US FAERS | |
| 884 | Obstruction | FAERS: 1 | OFFSIDES US FAERS | |
| 885 | Ocular icterus | FAERS: 1 | US FAERS | |
| 886 | Oncologic complication | FAERS: 1 | US FAERS | |
| 887 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 888 | Oral candidiasis | FAERS: 1 | SIDER US FAERS | |
| 889 | Osteoma | FAERS: 1 | US FAERS | |
| 890 | Osteoporosis | FAERS: 1 | OFFSIDES US FAERS | |
| 891 | PO2 increased | FAERS: 1 | US FAERS | |
| 892 | Pain of skin | FAERS: 1 | US FAERS | |
| 893 | Paranoia | FAERS: 1 | US FAERS | |
| 894 | Paraspinal abscess | FAERS: 1 | US FAERS | |
| 895 | Pelvic abscess | FAERS: 1 | US FAERS | |
| 896 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 897 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 898 | Perineal infection | FAERS: 1 | US FAERS | |
| 899 | Periodontitis | FAERS: 1 | SIDER US FAERS | |
| 900 | Perirectal abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 901 | Peritoneal fluid analysis abnormal | FAERS: 1 | US FAERS | |
| 902 | Pertussis | FAERS: 1 | US FAERS | |
| 903 | Petechiae | FAERS: 1 | SIDER US FAERS | |
| 904 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 905 | Photophobia | FAERS: 1 | SIDER US FAERS | |
| 906 | Phrenic nerve paralysis | FAERS: 1 | US FAERS | |
| 907 | Physical disability | FAERS: 1 | OFFSIDES US FAERS | |
| 908 | Pleocytosis | FAERS: 1 | OFFSIDES US FAERS | |
| 909 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 910 | Poisoning | FAERS: 1 | US FAERS | |
| 911 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 912 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 913 | Portal Hypertension | FAERS: 1 | OFFSIDES US FAERS | |
| 914 | Post procedural cellulitis | FAERS: 1 | US FAERS | |
| 915 | Post procedural pneumonia | FAERS: 1 | US FAERS | |
| 916 | Postoperative wound complication | FAERS: 1 | US FAERS | |
| 917 | Postural reflex impairment | FAERS: 1 | US FAERS | |
| 918 | Pregnancy of partner | FAERS: 1 | US FAERS | |
| 919 | Pregnancy | FAERS: 1 | US FAERS | |
| 920 | Procedural hypotension | FAERS: 1 | US FAERS | |
| 921 | Proctitis | FAERS: 1 | US FAERS | |
| 922 | Product administration error | FAERS: 1 | US FAERS | |
| 923 | Product container issue | FAERS: 1 | US FAERS | |
| 924 | Product contamination | FAERS: 1 | US FAERS | |
| 925 | Product contamination microbial | FAERS: 1 | US FAERS | |
| 926 | Product formulation issue | FAERS: 1 | US FAERS | |
| 927 | Product label confusion | FAERS: 1 | US FAERS | |
| 928 | Product preparation issue | FAERS: 1 | US FAERS | |
| 929 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 930 | Product substitution issue | FAERS: 1 | US FAERS | |
| 931 | Prophylaxis of nausea and vomiting | FAERS: 1 | US FAERS | |
| 932 | Prostate cancer recurrent | FAERS: 1 | US FAERS | |
| 933 | Protein total decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 934 | Psychiatric symptom | FAERS: 1 | OFFSIDES US FAERS | |
| 935 | Pubic pain | FAERS: 1 | US FAERS | |
| 936 | Pulmonary necrosis | FAERS: 1 | US FAERS | |
| 937 | Pulmonary vasculitis | FAERS: 1 | OFFSIDES US FAERS | |
| 938 | Purpura | FAERS: 1 | SIDER US FAERS | |
| 939 | Pyoderma | FAERS: 1 | US FAERS | |
| 940 | QRS axis abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 941 | Radial nerve palsy | FAERS: 1 | US FAERS | |
| 942 | Radiation injury | FAERS: 1 | SIDER US FAERS | |
| 943 | Regurgitation | FAERS: 1 | US FAERS | |
| 944 | Renal pain | FAERS: 1 | US FAERS | |
| 945 | Renal tubular atrophy | FAERS: 1 | US FAERS | |
| 946 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 947 | Respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 948 | Restrictive cardiomyopathy | FAERS: 1 | US FAERS | |
| 949 | Retching | FAERS: 1 | US FAERS | |
| 950 | Scan abdomen abnormal | FAERS: 1 | US FAERS | |
| 951 | Sciatica | FAERS: 1 | SIDER US FAERS | |
| 952 | Screaming | FAERS: 1 | US FAERS | |
| 953 | Septic embolus | FAERS: 1 | OFFSIDES US FAERS | |
| 954 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 955 | Shock symptom | FAERS: 1 | US FAERS | |
| 956 | Shoulder Pain | FAERS: 1 | OFFSIDES US FAERS | |
| 957 | Sigmoiditis | FAERS: 1 | US FAERS | |
| 958 | Sinus cancer metastatic | FAERS: 1 | US FAERS | |
| 959 | Skin neoplasm excision | FAERS: 1 | OFFSIDES US FAERS | |
| 960 | Skin test positive | FAERS: 1 | US FAERS | |
| 961 | Sluggishness | FAERS: 1 | US FAERS | |
| 962 | Sodium retention | FAERS: 1 | US FAERS | |
| 963 | Soft Tissue Infection | FAERS: 1 | US FAERS | |
| 964 | Soft tissue inflammation | FAERS: 1 | US FAERS | |
| 965 | Splenic candidiasis | FAERS: 1 | US FAERS | |
| 966 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 967 | Stridor | FAERS: 1 | OFFSIDES US FAERS | |
| 968 | Strongyloidiasis | FAERS: 1 | US FAERS | |
| 969 | Stupor | FAERS: 1 | US FAERS | |
| 970 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 971 | Sudden Cardiac Death | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 972 | Sunburn | FAERS: 1 | US FAERS | |
| 973 | Suspected transmission of an infectious agent via product | FAERS: 1 | US FAERS | |
| 974 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 975 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 976 | Tenosynovitis | FAERS: 1 | US FAERS | |
| 977 | Terminal state | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 978 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 979 | Therapy cessation | FAERS: 1 | US FAERS | |
| 980 | Thirst | FAERS: 1 | SIDER US FAERS | |
| 981 | Throat irritation | FAERS: 1 | SIDER US FAERS | |
| 982 | Thrombocytosis | FAERS: 1 | SIDER US FAERS | |
| 983 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 984 | Tonsillitis | FAERS: 1 | SIDER US FAERS | |
| 985 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 986 | Tooth Infection | FAERS: 1 | SIDER US FAERS | |
| 987 | Tracheitis | FAERS: 1 | US FAERS | |
| 988 | Tracheobronchitis | FAERS: 1 | US FAERS | |
| 989 | Transcription medication error | FAERS: 1 | US FAERS | |
| 990 | Transfusion Reaction | FAERS: 1 | SIDER US FAERS | |
| 991 | Transplant | FAERS: 1 | US FAERS | |
| 992 | Treatment related secondary malignancy | FAERS: 1 | US FAERS | |
| 993 | Type III immune complex mediated reaction | FAERS: 1 | US FAERS | |
| 994 | Ulcer | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 995 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 996 | Uterine Prolapse | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 997 | Vanishing bile duct syndrome | FAERS: 1 | US FAERS | |
| 998 | Vascular Access Complication | FAERS: 1 | OFFSIDES US FAERS | |
| 999 | Vascular calcification | FAERS: 1 | OFFSIDES US FAERS | |
| 1000 | Ventricular Dysfunction | FAERS: 1 | SIDER US FAERS | |
| 1001 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 1002 | Viral DNA test positive | FAERS: 1 | US FAERS | |
| 1003 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 1004 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 1005 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 1006 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 1007 | Walking aid user | FAERS: 1 | OFFSIDES US FAERS | |
| 1008 | White blood cell count abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 1009 | Wolff-Parkinson-White Syndrome | FAERS: 1 | US FAERS | |
| 1010 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 1011 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 1012 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 1013 | oligodendroglioma | FAERS: 1 | US FAERS | |
| 1014 | prostatitis | FAERS: 1 | SIDER US FAERS | |
| 1015 | Abdominal adhesions | OFFSIDES | ||
| 1016 | Abdominal bruit | OFFSIDES | ||
| 1017 | Abnormal vision | SIDER | ||
| 1018 | Abuse | OFFSIDES | ||
| 1019 | Acid reflux | OFFSIDES | ||
| 1020 | Acne | SIDER | ||
| 1021 | Actinic keratosis | OFFSIDES | ||
| 1022 | Activated partial thromboplastin time abnormal | OFFSIDES | ||
| 1023 | Acute bronchitis | OFFSIDES | ||
| 1024 | Acute glomerulonephritis | OFFSIDES | ||
| 1025 | Acute left ventricular failure | OFFSIDES | ||
| 1026 | Acute otitis media | OFFSIDES | ||
| 1027 | Acute polyneuropathy | OFFSIDES | ||
| 1028 | Acute prerenal failure | OFFSIDES | ||
| 1029 | Acute psychosis | Canada Vigilance: 1 | Canada Vigilance | |
| 1030 | Acute sinusitis | OFFSIDES | ||
| 1031 | Acute vestibular syndrome | OFFSIDES | ||
| 1032 | Adnexa uteri mass | OFFSIDES | ||
| 1033 | Adrenal atrophy | OFFSIDES | ||
| 1034 | Agraphia | OFFSIDES | ||
| 1035 | Alcohol Intolerance | SIDER | ||
| 1036 | Alcohol poisoning | OFFSIDES | ||
| 1037 | Alveolitis | OFFSIDES | ||
| 1038 | Amnestic Disorder | OFFSIDES | ||
| 1039 | Anal polyp | OFFSIDES | ||
| 1040 | Anal sphincter atony | SIDER | ||
| 1041 | Analgesia | OFFSIDES | ||
| 1042 | Anemia, Hemolytic | 16832816 | CTD | |
| 1043 | Anemia | 16763792 18463870 24673398 | CTD | |
| 1044 | Anticoagulation drug level above therapeutic | OFFSIDES | ||
| 1045 | Antinuclear antibody increased | OFFSIDES | ||
| 1046 | Apnea | OFFSIDES | ||
| 1047 | Application site reaction | Canada Vigilance: 1 | Canada Vigilance | |
| 1048 | Arterial Injury | OFFSIDES | ||
| 1049 | Arthroscopy | OFFSIDES | ||
| 1050 | Asbestosis | OFFSIDES | ||
| 1051 | Aspiration Pneumonia | OFFSIDES | ||
| 1052 | Aspiration pleural cavity abnormal | OFFSIDES | ||
| 1053 | Asthenic conditions | SIDER | ||
| 1054 | Astigmatism | OFFSIDES | ||
| 1055 | Athetosis | OFFSIDES | ||
| 1056 | Atrial tachycardia | OFFSIDES | ||
| 1057 | Aura | OFFSIDES | ||
| 1058 | Auricular swelling | OFFSIDES | ||
| 1059 | Bacteria sputum identified | OFFSIDES | ||
| 1060 | Bacteria urine identified | OFFSIDES | ||
| 1061 | Bacterial test positive | OFFSIDES | ||
| 1062 | Band neutrophil percentage increased | OFFSIDES | ||
| 1063 | Base excess increased | OFFSIDES | ||
| 1064 | Bicytopenia | OFFSIDES | ||
| 1065 | Bilateral hydronephrosis | SIDER | ||
| 1066 | Bladder cyst | OFFSIDES | ||
| 1067 | Bladder pain | SIDER | ||
| 1068 | Blepharoptosis | OFFSIDES | ||
| 1069 | Blood Glucose | OFFSIDES | ||
| 1070 | Blood albumin increased | OFFSIDES | ||
| 1071 | Blood alkaline phosphatase | OFFSIDES | ||
| 1072 | Blood amylase decreased | OFFSIDES | ||
| 1073 | Blood and lymphatic system disorders | SIDER | ||
| 1074 | Blood bicarbonate | OFFSIDES | ||
| 1075 | Blood bilirubin abnormal | OFFSIDES | ||
| 1076 | Blood blister | OFFSIDES | ||
| 1077 | Blood chloride increased | OFFSIDES | ||
| 1078 | Blood copper decreased | OFFSIDES | ||
| 1079 | Blood creatine phosphokinase MB abnormal | OFFSIDES | ||
| 1080 | Blood creatine phosphokinase abnormal | OFFSIDES | ||
| 1081 | Blood creatine phosphokinase decreased | OFFSIDES | ||
| 1082 | Blood creatinine decreased | OFFSIDES | ||
| 1083 | Blood gases abnormal | OFFSIDES SIDER | ||
| 1084 | Blood glucose abnormal | SIDER | ||
| 1085 | Blood immunoglobulin A decreased | OFFSIDES | ||
| 1086 | Blood lactate dehydrogenase abnormal | OFFSIDES | ||
| 1087 | Blood phosphorus decreased | OFFSIDES | ||
| 1088 | Blood phosphorus | OFFSIDES | ||
| 1089 | Blood pressure orthostatic decreased | OFFSIDES | ||
| 1090 | Blood product transfusion dependent | OFFSIDES | ||
| 1091 | Blood sodium | OFFSIDES | ||
| 1092 | Blood uric acid abnormal | OFFSIDES SIDER | ||
| 1093 | Blood uric acid | OFFSIDES | ||
| 1094 | Blurred vision | OFFSIDES | ||
| 1095 | Body Temperature | OFFSIDES | ||
| 1096 | Bone fistula | OFFSIDES | ||
| 1097 | Bowen's Disease | OFFSIDES | ||
| 1098 | Brain scan abnormal | OFFSIDES | ||
| 1099 | Brain stem syndrome | SIDER | ||
| 1100 | Bronchiectasis | OFFSIDES | ||
| 1101 | Bronchoalveolar Lavage | OFFSIDES | ||
| 1102 | Bronchoalveolar lavage abnormal | OFFSIDES | ||
| 1103 | Bulbar palsy | OFFSIDES | ||
| 1104 | Bulimia | OFFSIDES | ||
| 1105 | Bullous lung disease | OFFSIDES | ||
| 1106 | Bursitis | OFFSIDES | ||
| 1107 | COPD exacerbation | SIDER | ||
| 1108 | CYTOMEGALOVIRUS ANTIGEN | OFFSIDES | ||
| 1109 | Carcinoma, Transitional Cell | 17172406 | CTD | |
| 1110 | Cardiac Tamponade | OFFSIDES SIDER | ||
| 1111 | Cardiac enzymes increased | OFFSIDES | ||
| 1112 | Cardiovascular Deconditioning | OFFSIDES | ||
| 1113 | Carotid artery insufficiency | OFFSIDES | ||
| 1114 | Catheter placement | OFFSIDES | ||
| 1115 | Catheter related complication | OFFSIDES SIDER | ||
| 1116 | Catheter site pain | SIDER | ||
| 1117 | Catheter site related reaction | OFFSIDES | ||
| 1118 | Catheter site swelling | OFFSIDES | ||
| 1119 | Central line infection | OFFSIDES | ||
| 1120 | Central nervous system lesion | OFFSIDES | ||
| 1121 | Cerebral aspergillosis | OFFSIDES | ||
| 1122 | Cerebral calcification | OFFSIDES | ||
| 1123 | Cerebral hypoperfusion | OFFSIDES | ||
| 1124 | Cervical laser therapy | OFFSIDES | ||
| 1125 | Cheilitis | SIDER | ||
| 1126 | Chemical and Drug Induced Liver Injury | 15738379 | CTD | |
| 1127 | Choking sensation | OFFSIDES | ||
| 1128 | Chordoma | 24223206 | CTD | |
| 1129 | Chronic Fatigue Syndrome | SIDER | ||
| 1130 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 1131 | Chronic left ventricular failure | OFFSIDES | ||
| 1132 | Circumstance or information capable of leading to medication error | OFFSIDES | ||
| 1133 | Cirrhosis | OFFSIDES | ||
| 1134 | Clonus | OFFSIDES | ||
| 1135 | Coagulation factor V level decreased | OFFSIDES | ||
| 1136 | Coagulation test abnormal | OFFSIDES | ||
| 1137 | Cold sweat | OFFSIDES SIDER | ||
| 1138 | Color blindness | OFFSIDES | ||
| 1139 | Confabulation | OFFSIDES | ||
| 1140 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 1141 | Conjunctival deposit | OFFSIDES | ||
| 1142 | Contact Dermatitis | OFFSIDES | ||
| 1143 | Corneal lesion | SIDER | ||
| 1144 | Cutaneous Candidiasis | OFFSIDES | ||
| 1145 | Cutis Laxa | OFFSIDES | ||
| 1146 | Cyst removal | OFFSIDES | ||
| 1147 | Cyst | SIDER | ||
| 1148 | Cytokine Release Syndrome | OFFSIDES | ||
| 1149 | Denervation atrophy | OFFSIDES | ||
| 1150 | Dental prosthesis user | OFFSIDES | ||
| 1151 | Dentofacial anomaly | OFFSIDES | ||
| 1152 | Depression suicidal | OFFSIDES | ||
| 1153 | Diabetes | OFFSIDES | ||
| 1154 | Diabetes with hyperosmolarity | OFFSIDES | ||
| 1155 | Diabetic Foot | OFFSIDES | ||
| 1156 | Diaphragmatic Hernia | OFFSIDES | ||
| 1157 | Diarrhea | 15161691 17204182 | CTD OFFSIDES | |
| 1158 | Difficult to wean from ventilator | OFFSIDES | ||
| 1159 | Disturbance in sexual arousal | SIDER | ||
| 1160 | Diverticulosis | OFFSIDES | ||
| 1161 | Drowsiness | OFFSIDES | ||
| 1162 | Drug addict | OFFSIDES | ||
| 1163 | Drug withdrawal headache | OFFSIDES | ||
| 1164 | Dysacusis | SIDER | ||
| 1165 | Dysautonomia | SIDER | ||
| 1166 | Dysgraphia | OFFSIDES | ||
| 1167 | Dysphemia | OFFSIDES | ||
| 1168 | Dyspnoea exacerbated | OFFSIDES | ||
| 1169 | Dysthymic Disorder | OFFSIDES | ||
| 1170 | Ear and labyrinth disorders | SIDER | ||
| 1171 | Ear congestion | OFFSIDES | ||
| 1172 | Echocardiogram abnormal | OFFSIDES | ||
| 1173 | Ectropion | OFFSIDES | ||
| 1174 | Ejection fraction abnormal | OFFSIDES | ||
| 1175 | Electrocardiogram ST-T change | OFFSIDES | ||
| 1176 | Electrocardiogram ST-T segment elevation | OFFSIDES | ||
| 1177 | Electrocardiogram T wave biphasic | OFFSIDES | ||
| 1178 | Electrocardiogram poor R-wave progression | OFFSIDES | ||
| 1179 | Electrolyte depletion | OFFSIDES | ||
| 1180 | Embolic cerebral infarction | OFFSIDES | ||
| 1181 | Empyema | OFFSIDES | ||
| 1182 | Endarterectomy | OFFSIDES | ||
| 1183 | Endophthalmitis | SIDER | ||
| 1184 | Enterococcal sepsis | OFFSIDES | ||
| 1185 | Enterocutaneous Fistula | OFFSIDES | ||
| 1186 | Enzyme abnormality | SIDER | ||
| 1187 | Eosinophilic Pneumonia | OFFSIDES | ||
| 1188 | Eosinophilic myocarditis | OFFSIDES | ||
| 1189 | Epicondylitis | OFFSIDES | ||
| 1190 | Epidermolysis | OFFSIDES | ||
| 1191 | Epididymal tenderness | SIDER | ||
| 1192 | Epididymitis | SIDER | ||
| 1193 | Epidural Abscess | OFFSIDES | ||
| 1194 | Epstein-Barr Virus Infections | 17626072 | CTD | |
| 1195 | Erosive gastritis | OFFSIDES | ||
| 1196 | Erythromelalgia | SIDER | ||
| 1197 | Erythrosis | SIDER | ||
| 1198 | Esophageal Neoplasms | 18790767 | CTD | |
| 1199 | Esophageal Stenosis | OFFSIDES | ||
| 1200 | Eustachian tube disorder | OFFSIDES | ||
| 1201 | Excoriation | OFFSIDES | ||
| 1202 | Exfoliative rash | OFFSIDES | ||
| 1203 | Eyelid infection | SIDER | ||
| 1204 | Fatty Liver | OFFSIDES | ||
| 1205 | Feeling of body temperature change | SIDER | ||
| 1206 | Fibrillation atrial aggravated | SIDER | ||
| 1207 | Fibrin | OFFSIDES | ||
| 1208 | Fistula repair | OFFSIDES | ||
| 1209 | Flank Pain | OFFSIDES | ||
| 1210 | Flat affect | OFFSIDES | ||
| 1211 | Fluid intake restriction | OFFSIDES | ||
| 1212 | Flushing | SIDER | ||
| 1213 | Focal Nodular Hyperplasia | OFFSIDES | ||
| 1214 | Fungal DNA test positive | OFFSIDES | ||
| 1215 | Fungus culture positive | OFFSIDES | ||
| 1216 | Fungus serology test positive | OFFSIDES | ||
| 1217 | Gastric Antral Vascular Ectasia | OFFSIDES | ||
| 1218 | Gastric pH decreased | SIDER | ||
| 1219 | Gastric ulcer | OFFSIDES | ||
| 1220 | Gastrointestinal Diseases | CTD | ||
| 1221 | Gastrointestinal inflammation | OFFSIDES SIDER | ||
| 1222 | Gastrointestinal obstruction | SIDER | ||
| 1223 | Gastrointestinal sounds abnormal | OFFSIDES | ||
| 1224 | Gastrointestinal ulcer perforation | SIDER | ||
| 1225 | General physical condition | OFFSIDES | ||
| 1226 | Genital Herpes | OFFSIDES SIDER | ||
| 1227 | Gingival Hypertrophy | SIDER | ||
| 1228 | Gingival graft | OFFSIDES | ||
| 1229 | Glioblastoma | 18771084 | CTD | |
| 1230 | Glioma | 21346220 | CTD | |
| 1231 | Globulinuria | OFFSIDES | ||
| 1232 | Granulocytosis | OFFSIDES | ||
| 1233 | Grip strength | OFFSIDES | ||
| 1234 | Head and Neck Neoplasms | 15509775 | CTD | |
| 1235 | Hearing Loss, Bilateral | 15772697 | CTD | |
| 1236 | Heart failure | 16689991 | CTD | |
| 1237 | Heart sounds abnormal | OFFSIDES | ||
| 1238 | Hepatic Infarction | OFFSIDES | ||
| 1239 | Hepatic congestion | OFFSIDES | ||
| 1240 | Hepatic vein occlusion | OFFSIDES SIDER | ||
| 1241 | Hepatosplenic candidiasis | OFFSIDES | ||
| 1242 | Hepatosplenomegaly | OFFSIDES | ||
| 1243 | Hernia | SIDER | ||
| 1244 | Herpes NOS | SIDER | ||
| 1245 | Hiccough | OFFSIDES | ||
| 1246 | Hidradenitis | OFFSIDES | ||
| 1247 | Hyperalgesia | 19695912 30552955 | CTD | |
| 1248 | Hypercalcemia | 18089816 | CTD | |
| 1249 | Hypercreatininaemia | OFFSIDES | ||
| 1250 | Hypersplenism | OFFSIDES | ||
| 1251 | Hypertrophic Cardiomyopathy | OFFSIDES | ||
| 1252 | Hypesthesia | 17204182 20467223 | CTD | |
| 1253 | Hypocapnia | SIDER | ||
| 1254 | Hypogeusia | OFFSIDES | ||
| 1255 | Hypotension, Orthostatic | 15161691 20467223 | CTD | |
| 1256 | Hypoxemia | SIDER | ||
| 1257 | Iatrogenic injury | OFFSIDES | ||
| 1258 | Iliac artery stenosis | OFFSIDES | ||
| 1259 | Implant site induration | OFFSIDES | ||
| 1260 | Increased upper airway secretion | SIDER | ||
| 1261 | Infective exacerbation of chronic obstructive airways disease | OFFSIDES | ||
| 1262 | Infective tenosynovitis | OFFSIDES | ||
| 1263 | Infestation | SIDER | ||
| 1264 | Initial insomnia | OFFSIDES | ||
| 1265 | Injection site burning | OFFSIDES | ||
| 1266 | Injection site dermatitis | OFFSIDES | ||
| 1267 | Inspiratory capacity decreased | OFFSIDES | ||
| 1268 | Intercostal neuralgia | OFFSIDES | ||
| 1269 | Intermittent Claudication | OFFSIDES | ||
| 1270 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 1271 | Intestinal adenocarcinoma | OFFSIDES | ||
| 1272 | Intraductal papilloma of breast | OFFSIDES | ||
| 1273 | Joint Instability | OFFSIDES | ||
| 1274 | Joint stiffness | SIDER | ||
| 1275 | Jugular vein distension | OFFSIDES | ||
| 1276 | Labile blood pressure | OFFSIDES | ||
| 1277 | Laryngeal Obstruction | OFFSIDES | ||
| 1278 | Laziness | OFFSIDES | ||
| 1279 | Left ventricular ejection fraction decreased | SIDER | ||
| 1280 | Legionella serology positive | OFFSIDES | ||
| 1281 | Leriche Syndrome | OFFSIDES | ||
| 1282 | Leukemia, Plasma Cell | 17396042 | CTD | |
| 1283 | Leukoaraiosis | OFFSIDES | ||
| 1284 | Ligament rupture | OFFSIDES | ||
| 1285 | Limb crushing injury | OFFSIDES | ||
| 1286 | Listeriosis | OFFSIDES SIDER | ||
| 1287 | Lithotripsy | OFFSIDES | ||
| 1288 | Localised intraabdominal fluid collection | OFFSIDES | ||
| 1289 | Long QT Syndrome | OFFSIDES | ||
| 1290 | Loose tooth | OFFSIDES | ||
| 1291 | Loss of proprioception | OFFSIDES | ||
| 1292 | Lower respiratory tract inflammation | OFFSIDES | ||
| 1293 | Lumbar puncture abnormal | OFFSIDES | ||
| 1294 | Lymphatic Diseases | 16832816 | CTD | |
| 1295 | Lymphedema | OFFSIDES | ||
| 1296 | Lymphocytic infiltration | SIDER | ||
| 1297 | Lymphocytosis | 16832816 | CTD | |
| 1298 | Lymphoma transformation | OFFSIDES | ||
| 1299 | Malignant Hypertension | OFFSIDES | ||
| 1300 | Mammary duct ectasia | OFFSIDES | ||
| 1301 | Mass excision | OFFSIDES | ||
| 1302 | Mastication disorder | OFFSIDES | ||
| 1303 | Mediastinal Fibrosis | OFFSIDES | ||
| 1304 | Mediastinal shift | OFFSIDES | ||
| 1305 | Medulloblastoma | 19213072 | CTD | |
| 1306 | Megacolon | SIDER | ||
| 1307 | Meibomianitis | OFFSIDES | ||
| 1308 | Memory Loss | SIDER | ||
| 1309 | Meningoencephalitis | SIDER | ||
| 1310 | Metamyelocyte percentage increased | OFFSIDES | ||
| 1311 | Metaplasia | OFFSIDES | ||
| 1312 | Metastases to abdominal cavity | OFFSIDES | ||
| 1313 | Metastatic Neoplasm | OFFSIDES | ||
| 1314 | Mitral Valve Stenosis | OFFSIDES | ||
| 1315 | Mononeuritis | OFFSIDES | ||
| 1316 | Monoparesis | OFFSIDES | ||
| 1317 | Morganella infection | OFFSIDES | ||
| 1318 | Motor retardation | OFFSIDES | ||
| 1319 | Mouth cyst | OFFSIDES | ||
| 1320 | Mouth plaque | OFFSIDES | ||
| 1321 | Mucocutaneous rash | OFFSIDES | ||
| 1322 | Muscle Weakness | OFFSIDES | ||
| 1323 | Muscle abscess | OFFSIDES | ||
| 1324 | Muscle relaxant therapy | SIDER | ||
| 1325 | Muscle strain | OFFSIDES | ||
| 1326 | Myelocyte percentage increased | OFFSIDES | ||
| 1327 | Myelocytosis | OFFSIDES | ||
| 1328 | Myocardial Ischemia | 20458563 | CTD | |
| 1329 | Neoplasms, Experimental | 19282831 | CTD | |
| 1330 | Neoplasms | 16763792 | CTD | |
| 1331 | Nephritis | SIDER | ||
| 1332 | Nerve Block | OFFSIDES | ||
| 1333 | Nerve root lesion | SIDER | ||
| 1334 | Nervous tension | OFFSIDES | ||
| 1335 | Neuroblastoma | 18534018 | CTD | |
| 1336 | Neurodermatitis | OFFSIDES | ||
| 1337 | Neurologic Manifestations | 15738379 | CTD | |
| 1338 | Neutrophil hypersegmented morphology present | OFFSIDES | ||
| 1339 | Nocturia | OFFSIDES | ||
| 1340 | Nodule on extremity | OFFSIDES | ||
| 1341 | Numbness | SIDER | ||
| 1342 | Optic Disc Edema | OFFSIDES | ||
| 1343 | Optic nerve cupping | OFFSIDES | ||
| 1344 | Oral Cavity Fistula | OFFSIDES | ||
| 1345 | Oral discharge | OFFSIDES | ||
| 1346 | Oral mucosa atrophy | OFFSIDES | ||
| 1347 | Oral mucosal petechiae | SIDER | ||
| 1348 | Orchitis | OFFSIDES | ||
| 1349 | Oropharyngeal blistering | SIDER | ||
| 1350 | Orthopnea | OFFSIDES | ||
| 1351 | Osteochondrosis | OFFSIDES | ||
| 1352 | Osteomyelitis drainage | OFFSIDES | ||
| 1353 | Osteoradionecrosis | OFFSIDES | ||
| 1354 | Osteosarcoma | 19894220 | CTD | |
| 1355 | Ovarian failure | OFFSIDES | ||
| 1356 | Oxygen supplementation | OFFSIDES | ||
| 1357 | PCO2 increased | OFFSIDES | ||
| 1358 | Pallor | OFFSIDES SIDER | ||
| 1359 | Pancreas lipomatosis | OFFSIDES | ||
| 1360 | Pancreatic Cyst | OFFSIDES | ||
| 1361 | Pancreatic duct dilatation | OFFSIDES | ||
| 1362 | Panophthalmitis | SIDER | ||
| 1363 | Papilloma | OFFSIDES | ||
| 1364 | Papule | SIDER | ||
| 1365 | Paranasal sinus hypersecretion | OFFSIDES | ||
| 1366 | Paresthesia | 19259673 | CTD | |
| 1367 | Paroxysmal arrhythmia | OFFSIDES | ||
| 1368 | Patellofemoral Pain Syndrome | OFFSIDES | ||
| 1369 | Pelvic discomfort | OFFSIDES | ||
| 1370 | Pelvic mass | OFFSIDES | ||
| 1371 | Periarthritis | OFFSIDES | ||
| 1372 | Pericoronitis | OFFSIDES | ||
| 1373 | Peridiverticulitis | OFFSIDES | ||
| 1374 | Peripheral Nervous System Diseases |
15953004
16298074 16832816 18650177 19192066 19192067 19259673 20038224 20150504 20385792 20433602 20467223 20575631 20807892 20830808 20864405 20874823 20959823 21228734 21290160 21634429 22079976 23864035 24673398 24928523 30552955 | CTD | |
| 1375 | Peripheral arterial occlusive disease | OFFSIDES | ||
| 1376 | Peripheral neuropathy aggravated | SIDER | ||
| 1377 | Peroneal nerve injury | OFFSIDES | ||
| 1378 | Piloerection | OFFSIDES | ||
| 1379 | Pinguecula | OFFSIDES | ||
| 1380 | Platelet Transfusion | OFFSIDES | ||
| 1381 | Pleural decortication | OFFSIDES | ||
| 1382 | Pneumoconiosis | OFFSIDES | ||
| 1383 | Poor dental condition | OFFSIDES | ||
| 1384 | Poor peripheral circulation | SIDER | ||
| 1385 | Poor personal hygiene | OFFSIDES | ||
| 1386 | Posterior Capsulotomy | OFFSIDES | ||
| 1387 | Posterior capsule opacification | OFFSIDES | ||
| 1388 | Postmenopausal bleeding | OFFSIDES | ||
| 1389 | Poverty | OFFSIDES | ||
| 1390 | Presyncope | SIDER | ||
| 1391 | Product counterfeit | OFFSIDES | ||
| 1392 | Progressive supranuclear palsy | OFFSIDES | ||
| 1393 | Prostate examination abnormal | OFFSIDES | ||
| 1394 | Prostatic calcification | OFFSIDES | ||
| 1395 | Prothrombin time abnormal | OFFSIDES | ||
| 1396 | Psoas Abscess | OFFSIDES | ||
| 1397 | Pterygium | OFFSIDES | ||
| 1398 | Pulmonary Valve Stenosis | OFFSIDES | ||
| 1399 | Pulmonary arterial pressure increased | OFFSIDES | ||
| 1400 | Pulmonary artery thrombosis | OFFSIDES | ||
| 1401 | Pyelonephritis | OFFSIDES | ||
| 1402 | Pyoderma Gangrenosum | OFFSIDES | ||
| 1403 | Radiation Pneumonitis | OFFSIDES | ||
| 1404 | Rectal discharge | SIDER | ||
| 1405 | Rectal polyp | OFFSIDES | ||
| 1406 | Redness | SIDER | ||
| 1407 | Refractory cytopenia with multilineage dysplasia | OFFSIDES | ||
| 1408 | Renal Artery Stenosis | OFFSIDES | ||
| 1409 | Renal Insufficiency | 16860177 20351701 | CTD | |
| 1410 | Renal tubular disorder | OFFSIDES | ||
| 1411 | Respiratory Insufficiency | SIDER | ||
| 1412 | Respiratory Syncytial Virus Infections | 19931343 | CTD | |
| 1413 | Respiratory tract infection fungal | OFFSIDES | ||
| 1414 | Restrictive pulmonary disease | OFFSIDES | ||
| 1415 | Retinitis | SIDER | ||
| 1416 | Rhabdomyosarcoma | 18342500 | CTD | |
| 1417 | Rhonchi | OFFSIDES | ||
| 1418 | Right Ventricular Dysfunction | OFFSIDES | ||
| 1419 | Right ventricular systolic pressure decreased | OFFSIDES | ||
| 1420 | Right ventricular systolic pressure increased | OFFSIDES | ||
| 1421 | Salmonella | OFFSIDES | ||
| 1422 | Scleromalacia | OFFSIDES | ||
| 1423 | Scotoma | SIDER | ||
| 1424 | Secondary hyperthyroidism | OFFSIDES | ||
| 1425 | Sensation Disorders | 16832816 | CTD | |
| 1426 | Seroma | OFFSIDES | ||
| 1427 | Serositis | OFFSIDES | ||
| 1428 | Shoulder deformity | OFFSIDES | ||
| 1429 | Sinus headache | OFFSIDES | ||
| 1430 | Sinus polyp | OFFSIDES | ||
| 1431 | Skin Induration | SIDER | ||
| 1432 | Sleep disorder due to a general medical condition | OFFSIDES | ||
| 1433 | Small bowel angioedema | OFFSIDES | ||
| 1434 | Snoring | OFFSIDES | ||
| 1435 | Spinal cord infection | Canada Vigilance: 1 | Canada Vigilance | |
| 1436 | Spinal corpectomy | OFFSIDES | ||
| 1437 | Spinal fusion surgery | OFFSIDES | ||
| 1438 | Spinal shock | OFFSIDES | ||
| 1439 | Splenic Infarction | OFFSIDES | ||
| 1440 | Splenic granuloma | OFFSIDES | ||
| 1441 | Spondylitic myelopathy | OFFSIDES | ||
| 1442 | Spondylolisthesis | OFFSIDES | ||
| 1443 | Spondylolysis | OFFSIDES | ||
| 1444 | Staphylococcal abscess | OFFSIDES | ||
| 1445 | Status Epilepticus | OFFSIDES | ||
| 1446 | Stenotrophomonas sepsis | OFFSIDES | ||
| 1447 | Subcutaneous Emphysema | OFFSIDES | ||
| 1448 | Submandibular mass | OFFSIDES | ||
| 1449 | Superinfection bacterial | OFFSIDES | ||
| 1450 | Superinfection lung | OFFSIDES | ||
| 1451 | Sweat gland infection | OFFSIDES | ||
| 1452 | Synovial Cyst | SIDER | ||
| 1453 | T-cell lymphoma recurrent | OFFSIDES | ||
| 1454 | Teeth brittle | OFFSIDES | ||
| 1455 | Tendinitis | OFFSIDES | ||
| 1456 | Therapy responder | OFFSIDES | ||
| 1457 | Thrombosis in device | OFFSIDES | ||
| 1458 | Thyroidectomy | OFFSIDES | ||
| 1459 | Tinea cruris | OFFSIDES | ||
| 1460 | Tooth Erosion | OFFSIDES | ||
| 1461 | Toxoplasmosis | SIDER | ||
| 1462 | Tracheostomy malfunction | OFFSIDES | ||
| 1463 | Troponin I increased | OFFSIDES SIDER | ||
| 1464 | Tumor Lysis Syndrome | 15449188 18463870 | CTD | |
| 1465 | Upper respiratory tract infection bacterial | OFFSIDES | ||
| 1466 | Upper respiratory tract inflammation | OFFSIDES | ||
| 1467 | Upper-airway cough syndrome | SIDER | ||
| 1468 | Ureteral stent insertion | OFFSIDES | ||
| 1469 | Uric acid abnormal | SIDER | ||
| 1470 | Urinary tract infection enterococcal | OFFSIDES | ||
| 1471 | Urinary tract signs and symptoms | SIDER | ||
| 1472 | Urine ketone body present | OFFSIDES | ||
| 1473 | Uterine inflammation | OFFSIDES | ||
| 1474 | Uterovaginal prolapse | OFFSIDES | ||
| 1475 | Vascular insufficiency | OFFSIDES | ||
| 1476 | Vascular purpura | SIDER | ||
| 1477 | Vasculitis gastrointestinal | OFFSIDES | ||
| 1478 | Vasculitis, Leukocytoclastic, Cutaneous | 17635511 | CTD | |
| 1479 | Venous Insufficiency | SIDER | ||
| 1480 | Venous thrombosis limb | OFFSIDES | ||
| 1481 | Vertebral wedging | OFFSIDES | ||
| 1482 | Vestibular Neuronitis | SIDER | ||
| 1483 | Viral upper respiratory tract infection | OFFSIDES | ||
| 1484 | Vitamin A Deficiency | OFFSIDES | ||
| 1485 | Vitamin B 12 Deficiency | OFFSIDES | ||
| 1486 | Vitamin K Deficiency | OFFSIDES | ||
| 1487 | Vulvitis | SIDER | ||
| 1488 | Waldenstrom Macroglobulinemia | 18347188 | CTD | |
| 1489 | Weight Gain | OFFSIDES | ||
| 1490 | West Nile viral infection | OFFSIDES | ||
| 1491 | Whole blood transfusion | OFFSIDES | ||
| 1492 | Wound decomposition | OFFSIDES | ||
| 1493 | Wound dehiscence | OFFSIDES | ||
| 1494 | Xerosis | OFFSIDES | ||
| 1495 | fibroma | OFFSIDES | ||
| 1496 | jejunitis | OFFSIDES | ||
| 1497 | leukemia | 15039284 16481037 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.