Venlafaxine Hydrochloride
(QYRYFNHXARDNFZ-UHFFFAOYSA-N)
Structure
- SMILES
- COc1ccc(cc1)C(C1(O)CCCCC1)CN(C)C.Cl
- Molecular Formula:
- C17H28ClNO2
- Molecular Weight:
- 313.863
- Log P:
- 3.8376
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 2
- TPSA:
- 32.7
- CAS Number(s):
- 99300-78-4
Synonym(s)
1.
Venlafaxine Hydrochloride
2.
1-(2-(dimethylamino)-1-(4-methoxyphenyl)ethyl)cyclohexanol HCl
3.
Cyclohexanol, 1-(2-(dimethylamino)-1-(4-methoxyphenyl)ethyl)-, hydrochloride
4.
Dobupal
5.
Efexor
6.
Effexor
7.
Sila-Venlafaxine
8.
Trevilor
9.
Vandral
10.
Venlafaxine
11.
Wy 45030
12.
Wy-45,030
13.
Wy-45030
14.
Hydrochloride, Venlafaxine
15.
Sila Venlafaxine
16.
Wy 45,030
17.
Wy45,030
18.
Wy45030
External Link(s)
| MeSH | D000069470 |
| PubChem Compound | 62923 25137858 |
| BindingDB | 82072 |
| ChEBI | 9944 |
| CHEMBL | CHEMBL1201066 |
| KEGG | dr:D00821 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug withdrawal syndrome | FAERS: 1658 Canada Vigilance: 33 | Canada Vigilance US FAERS | |
| 2 | Drug ineffective | FAERS: 1465 Canada Vigilance: 144 | Canada Vigilance US FAERS | |
| 3 | Dizziness | FAERS: 963 Canada Vigilance: 79 | 7653704 | CTD Canada Vigilance US FAERS |
| 4 | Nausea | FAERS: 905 Canada Vigilance: 83 | 10732656 15699296 17917556 | CTD Canada Vigilance US FAERS |
| 5 | Feeling abnormal | FAERS: 813 Canada Vigilance: 22 | Canada Vigilance US FAERS | |
| 6 | Headache | FAERS: 809 Canada Vigilance: 53 | 10732656 | CTD Canada Vigilance US FAERS |
| 7 | Anxiety | FAERS: 752 Canada Vigilance: 52 | Canada Vigilance US FAERS | |
| 8 | Malaise | FAERS: 694 Canada Vigilance: 15 | Canada Vigilance US FAERS | |
| 9 | Fatigue | FAERS: 481 Canada Vigilance: 23 | Canada Vigilance US FAERS | |
| 10 | Crying | FAERS: 468 Canada Vigilance: 21 | Canada Vigilance US FAERS | |
| 11 | Drug exposure during pregnancy | FAERS: 446 | US FAERS | |
| 12 | Tremor | FAERS: 404 Canada Vigilance: 38 | 8888541 10435776 | CTD Canada Vigilance US FAERS |
| 13 | Vomiting | FAERS: 383 Canada Vigilance: 27 | Canada Vigilance US FAERS | |
| 14 | Asthenia | FAERS: 335 Canada Vigilance: 14 | 15699296 | CTD Canada Vigilance US FAERS |
| 15 | Drug Dependence | FAERS: 326 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 16 | Pain | FAERS: 302 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 17 | Suicide attempt | FAERS: 280 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 18 | Agitation | FAERS: 269 Canada Vigilance: 17 | Canada Vigilance US FAERS | |
| 19 | Completed Suicide | FAERS: 261 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 20 | Anger | FAERS: 244 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 21 | Nervousness | FAERS: 239 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 22 | Depressed mood | FAERS: 236 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 23 | Tinnitus | FAERS: 236 Canada Vigilance: 19 | Canada Vigilance US FAERS | |
| 24 | Somnolence | FAERS: 227 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 25 | Overdose | FAERS: 225 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 26 | Vertigo | FAERS: 220 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 27 | Palpitations | FAERS: 215 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 28 | Apathy | FAERS: 191 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Restlessness | FAERS: 175 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 30 | Impaired work ability | FAERS: 158 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 31 | Myalgia | FAERS: 156 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 32 | Memory impairment | FAERS: 147 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 33 | Abdominal discomfort | FAERS: 145 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 34 | Emotional disorder | FAERS: 145 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 35 | Activities of daily living impaired | FAERS: 143 | US FAERS | |
| 36 | Amnesia | FAERS: 140 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 37 | Product substitution issue | FAERS: 136 Canada Vigilance: 66 | Canada Vigilance US FAERS | |
| 38 | Unevaluable event | FAERS: 131 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 39 | Drug dose omission | FAERS: 127 | US FAERS | |
| 40 | nervous system disorder | FAERS: 124 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Weight decreased | FAERS: 122 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 42 | Mood swings | FAERS: 118 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 43 | Psychiatric symptom | FAERS: 118 | US FAERS | |
| 44 | Chills | FAERS: 109 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 45 | Constipation | FAERS: 109 Canada Vigilance: 6 | 15699296 17606668 | CTD Canada Vigilance US FAERS |
| 46 | Tension | FAERS: 105 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Tachycardia | FAERS: 102 Canada Vigilance: 9 | 11816261 | CTD Canada Vigilance US FAERS |
| 48 | Disorientation | FAERS: 99 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 49 | Maternal exposure during pregnancy | FAERS: 99 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 50 | Feelings of worthlessness | FAERS: 97 | US FAERS | |
| 51 | Pruritus | FAERS: 96 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 52 | Arthralgia | FAERS: 93 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 53 | Night sweats | FAERS: 90 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 54 | Feeling jittery | FAERS: 87 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 55 | Impaired driving ability | FAERS: 84 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 56 | Negative thoughts | FAERS: 81 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Toxicity to various agents | FAERS: 80 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Serotonin Syndrome | FAERS: 79 Canada Vigilance: 11 | CTD Canada Vigilance US FAERS | |
| 59 | Drug effect incomplete | FAERS: 78 | US FAERS | |
| 60 | Prescribed overdose | FAERS: 77 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Lethargy | FAERS: 76 Canada Vigilance: 6 | 7653704 | CTD Canada Vigilance US FAERS |
| 62 | Visual Impairment | FAERS: 75 Canada Vigilance: 21 | Canada Vigilance US FAERS | |
| 63 | Hypersensitivity | FAERS: 74 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 64 | Product quality issue | FAERS: 74 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Chest Pain | FAERS: 73 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 66 | Myocardial Infarction | FAERS: 73 | US FAERS | |
| 67 | Stress | FAERS: 70 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Mydriasis | FAERS: 69 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 69 | Urticaria | FAERS: 69 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 70 | Cerebrovascular accident | FAERS: 68 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | Drug ineffective for unapproved indication | FAERS: 65 | US FAERS | |
| 72 | Therapeutic response unexpected | FAERS: 65 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 73 | Blood cholesterol increased | FAERS: 64 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 74 | Intentional product misuse | FAERS: 64 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 75 | Personality Change | FAERS: 63 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 76 | Abdominal Pain | FAERS: 62 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 77 | Nonspecific reaction | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Epilepsy | FAERS: 59 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 79 | Mental impairment | FAERS: 58 | US FAERS | |
| 80 | Alopecia | FAERS: 55 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 81 | Visual disturbance | FAERS: 54 | US FAERS | |
| 82 | Intentional drug misuse | FAERS: 53 | US FAERS | |
| 83 | Paranoia | FAERS: 52 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 84 | Maternal exposure timing unspecified | FAERS: 51 | US FAERS | |
| 85 | Cardiac Arrest | FAERS: 50 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 86 | Medication residue | FAERS: 50 | US FAERS | |
| 87 | Hypotension | FAERS: 49 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 88 | Rhabdomyolysis | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 89 | Emotional distress | FAERS: 48 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 90 | Product use in unapproved indication | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 91 | Sexual Dysfunction | FAERS: 48 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 92 | Bedridden | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 93 | Bipolar Disorder | FAERS: 46 | CTD US FAERS | |
| 94 | Influenza | FAERS: 46 | US FAERS | |
| 95 | Intentional self-injury | FAERS: 46 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 96 | Product use issue | FAERS: 45 | US FAERS | |
| 97 | Syncope | FAERS: 45 | US FAERS | |
| 98 | Drug screen false positive | FAERS: 43 | US FAERS | |
| 99 | Photophobia | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 100 | Back Pain | FAERS: 41 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 101 | Cold sweat | FAERS: 41 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 102 | Euphoric mood | FAERS: 40 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 103 | Burning sensation | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 104 | Dehydration | FAERS: 39 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 105 | Erectile dysfunction | FAERS: 39 | US FAERS | |
| 106 | Nasopharyngitis | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 107 | Diabetes Mellitus | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 108 | Intentional product use issue | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 109 | Restless Legs Syndrome | FAERS: 38 | 18468624 | CTD US FAERS |
| 110 | Drug toxicity | FAERS: 37 | US FAERS | |
| 111 | Head discomfort | FAERS: 36 | US FAERS | |
| 112 | Hypersomnia | FAERS: 36 | US FAERS | |
| 113 | Muscle tightness | FAERS: 36 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 114 | Pregnancy | FAERS: 36 | US FAERS | |
| 115 | Hostility | FAERS: 35 | US FAERS | |
| 116 | Pre-existing condition improved | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 117 | Cardiomegaly | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 118 | Discomfort | FAERS: 34 | US FAERS | |
| 119 | Incorrect dose administered | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 120 | Blindness | FAERS: 33 | US FAERS | |
| 121 | Dependence | FAERS: 33 | US FAERS | |
| 122 | Myoclonus | FAERS: 33 Canada Vigilance: 4 | 8888541 | CTD Canada Vigilance US FAERS |
| 123 | Urinary Retention | FAERS: 33 Canada Vigilance: 2 | 9065967 16340381 | CTD Canada Vigilance US FAERS |
| 124 | Anorexia | FAERS: 32 | 15699296 | CTD US FAERS |
| 125 | Dissociation | FAERS: 32 | US FAERS | |
| 126 | Drug abuse | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Drug screen positive | FAERS: 32 | US FAERS | |
| 128 | Medication Error | FAERS: 32 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 129 | Anorgasmia | FAERS: 31 | US FAERS | |
| 130 | Blood creatine phosphokinase increased | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 131 | Disease recurrence | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 132 | Drug exposure via breast milk | FAERS: 31 | US FAERS | |
| 133 | Dysarthria | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 134 | Eye pain | FAERS: 31 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 135 | Poor quality sleep | FAERS: 31 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 136 | Akathisia | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 137 | Dyspepsia | FAERS: 30 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 138 | Fibromyalgia | FAERS: 30 | US FAERS | |
| 139 | Hyperacusis | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 140 | Musculoskeletal stiffness | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 141 | Neonatal disorder | FAERS: 30 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 142 | No adverse event | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 143 | Patent ductus arteriosus | FAERS: 30 | US FAERS | |
| 144 | Feeling Cold | FAERS: 29 | US FAERS | |
| 145 | General physical health deterioration | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 146 | Intentional misuse | FAERS: 29 | US FAERS | |
| 147 | Pneumonia | FAERS: 29 Canada Vigilance: 4 | 12663337 | CTD Canada Vigilance US FAERS |
| 148 | Depressed Level of Consciousness | FAERS: 28 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 149 | Dysgeusia | FAERS: 28 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 150 | Flat affect | FAERS: 28 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 151 | Homicide | FAERS: 28 | US FAERS | |
| 152 | Accidental overdose | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 153 | Inappropriate schedule of drug administration | FAERS: 27 | US FAERS | |
| 154 | Bruxism | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 155 | Pulmonary Valve Stenosis | FAERS: 26 | US FAERS | |
| 156 | Dystonia | FAERS: 25 Canada Vigilance: 1 | 10405494 20014065 | CTD Canada Vigilance US FAERS |
| 157 | Hypomania | FAERS: 25 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 158 | Pancreatitis | FAERS: 25 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 159 | Sinus Tachycardia | FAERS: 25 | US FAERS | |
| 160 | Abasia | FAERS: 24 | US FAERS | |
| 161 | Arthritis | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 162 | Arthropathy | FAERS: 24 | US FAERS | |
| 163 | Atrial Fibrillation | FAERS: 24 Canada Vigilance: 1 | 17116959 | CTD Canada Vigilance US FAERS |
| 164 | Chest discomfort | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 165 | Drug dispensing error | FAERS: 24 | US FAERS | |
| 166 | Feeding disorder neonatal | FAERS: 24 | US FAERS | |
| 167 | Physical assault | FAERS: 24 | US FAERS | |
| 168 | Flatulence | FAERS: 23 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 169 | Thrombosis | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 170 | Hypoplastic Left Heart Syndrome | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 171 | Mental status changes | FAERS: 22 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 172 | Obsessive-Compulsive Disorder | FAERS: 22 Canada Vigilance: 1 | 17503984 | CTD Canada Vigilance US FAERS |
| 173 | Otitis Media | FAERS: 22 | US FAERS | |
| 174 | Pharmaceutical product complaint | FAERS: 22 | US FAERS | |
| 175 | Wrong technique in drug usage process | FAERS: 22 | US FAERS | |
| 176 | Formication | FAERS: 21 | US FAERS | |
| 177 | Loss of personal independence in daily activities | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 178 | Panic Disorder | FAERS: 21 Canada Vigilance: 1 | 17589833 | CTD Canada Vigilance US FAERS |
| 179 | Respiratory distress | FAERS: 21 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 180 | Urinary tract infection | FAERS: 21 | US FAERS | |
| 181 | Yawning | FAERS: 21 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 182 | Asphyxia | FAERS: 20 | US FAERS | |
| 183 | Cataract | FAERS: 20 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 184 | Drug prescribing error | FAERS: 20 | US FAERS | |
| 185 | Hypophagia | FAERS: 20 | US FAERS | |
| 186 | Middle insomnia | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 187 | Muscle Rigidity | FAERS: 20 Canada Vigilance: 4 | 8700462 8888541 | CTD Canada Vigilance US FAERS |
| 188 | Retching | FAERS: 20 | US FAERS | |
| 189 | Screaming | FAERS: 20 | US FAERS | |
| 190 | Alanine Aminotransferase Increased | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 191 | Blood glucose increased | FAERS: 19 | US FAERS | |
| 192 | Bone pain | FAERS: 19 | US FAERS | |
| 193 | Feeling of body temperature change | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 194 | Gamma-Glutamyltransferase Increased | FAERS: 19 | US FAERS | |
| 195 | Neck Pain | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 196 | Presyncope | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 197 | Pyelocaliectasis | FAERS: 19 | US FAERS | |
| 198 | Sepsis | FAERS: 19 | US FAERS | |
| 199 | Violence-related symptom | FAERS: 19 | US FAERS | |
| 200 | Aphasia | FAERS: 18 | US FAERS | |
| 201 | Deafness | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 202 | Flushing | FAERS: 18 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 203 | Fracture | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 204 | Hypertensive crisis | FAERS: 18 | US FAERS | |
| 205 | Infection | FAERS: 18 | US FAERS | |
| 206 | Motion Sickness | FAERS: 18 | US FAERS | |
| 207 | Thirst | FAERS: 18 | US FAERS | |
| 208 | Bradycardia | FAERS: 17 | US FAERS | |
| 209 | Dementia | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 210 | Diplopia | FAERS: 17 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 211 | Dysphemia | FAERS: 17 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 212 | Glaucoma | FAERS: 17 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 213 | Quality of life decreased | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 214 | Talipes | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 215 | Drug abuser | FAERS: 16 | US FAERS | |
| 216 | Electrocardiogram abnormal | FAERS: 16 | US FAERS | |
| 217 | Erythema | FAERS: 16 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 218 | Failure to Thrive | FAERS: 16 | US FAERS | |
| 219 | Hyperreflexia | FAERS: 16 | US FAERS | |
| 220 | Incontinence | FAERS: 16 | US FAERS | |
| 221 | Musculoskeletal Pain | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 222 | Obesity | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 223 | Supraventricular tachycardia | FAERS: 16 | US FAERS | |
| 224 | Asthma | FAERS: 15 | US FAERS | |
| 225 | Bipolar I disorder | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 226 | Dextrocardia | FAERS: 15 | US FAERS | |
| 227 | Economic problem | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 228 | Hunger | FAERS: 15 | US FAERS | |
| 229 | Irritable Bowel Syndrome | FAERS: 15 | US FAERS | |
| 230 | Respiratory Failure | FAERS: 15 | US FAERS | |
| 231 | Swelling | FAERS: 15 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 232 | Urinary Incontinence | FAERS: 15 Canada Vigilance: 2 | 11147747 16239768 | CTD Canada Vigilance US FAERS |
| 233 | Anhedonia | FAERS: 14 | US FAERS | |
| 234 | Antidepressant drug level increased | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 235 | Aspartate Aminotransferase Increased | FAERS: 14 | US FAERS | |
| 236 | Back disorder | FAERS: 14 | US FAERS | |
| 237 | Hypothyroidism | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 238 | Post-Traumatic Stress Disorder | FAERS: 14 | US FAERS | |
| 239 | jaundice | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 240 | Acute kidney injury | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 241 | Angina Pectoris | FAERS: 13 | US FAERS | |
| 242 | Cerebral disorder | FAERS: 13 | US FAERS | |
| 243 | Hypoxia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 244 | Laceration | FAERS: 13 | US FAERS | |
| 245 | Malabsorption | FAERS: 13 | US FAERS | |
| 246 | Skin lesion | FAERS: 13 | US FAERS | |
| 247 | Tachyphrenia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 248 | Tooth Loss | FAERS: 13 | US FAERS | |
| 249 | Ataxia | FAERS: 12 | US FAERS | |
| 250 | Blood prolactin increased | FAERS: 12 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 251 | Bradyphrenia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 252 | Cardiotoxicity | FAERS: 12 | US FAERS | |
| 253 | Chromaturia | FAERS: 12 | US FAERS | |
| 254 | Delirium | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 255 | Double Outlet Right Ventricle | FAERS: 12 | US FAERS | |
| 256 | Dysphonia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 257 | Dysuria | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 258 | Hypokinesia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 259 | Infantile apnoeic attack | FAERS: 12 | US FAERS | |
| 260 | Multiple Sclerosis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 261 | Pallor | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 262 | Rheumatoid Arthritis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 263 | Ventricular hypertrophy | FAERS: 12 | US FAERS | |
| 264 | Altered state of consciousness | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 265 | Atelectasis | FAERS: 11 | US FAERS | |
| 266 | Cleft Palate | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 267 | Conversion disorder | FAERS: 11 | US FAERS | |
| 268 | Cyanosis | FAERS: 11 | US FAERS | |
| 269 | Ear discomfort | FAERS: 11 | US FAERS | |
| 270 | Head titubation | FAERS: 11 | US FAERS | |
| 271 | Hyporeflexia | FAERS: 11 | US FAERS | |
| 272 | Incoherent | FAERS: 11 | US FAERS | |
| 273 | Laryngitis | FAERS: 11 | US FAERS | |
| 274 | Morbid thoughts | FAERS: 11 | US FAERS | |
| 275 | Muscle Spasticity | FAERS: 11 | US FAERS | |
| 276 | Neuralgia | FAERS: 11 | 12187335 | CTD US FAERS |
| 277 | Pre-Eclampsia | FAERS: 11 | US FAERS | |
| 278 | Shock | FAERS: 11 | US FAERS | |
| 279 | Trismus | FAERS: 11 | US FAERS | |
| 280 | treatment failure | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 281 | Acne | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 282 | Bronchiolitis | FAERS: 10 | US FAERS | |
| 283 | Depression suicidal | FAERS: 10 | US FAERS | |
| 284 | Hemiparesis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 285 | Hyperventilation | FAERS: 10 | US FAERS | |
| 286 | Inflammation | FAERS: 10 | US FAERS | |
| 287 | Injury asphyxiation | FAERS: 10 | US FAERS | |
| 288 | Limb injury | FAERS: 10 | US FAERS | |
| 289 | Obsessive thoughts | FAERS: 10 | US FAERS | |
| 290 | Peripheral swelling | FAERS: 10 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 291 | Self Mutilation | FAERS: 10 | US FAERS | |
| 292 | Skin laceration | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 293 | Stevens-Johnson Syndrome | FAERS: 10 | 25811541 | CTD US FAERS |
| 294 | Theft | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 295 | Thrombocytopenia | FAERS: 10 Canada Vigilance: 2 | 8888541 | CTD Canada Vigilance US FAERS |
| 296 | Wrong technique in product usage process | FAERS: 10 | US FAERS | |
| 297 | Adverse event | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 298 | Blood creatinine increased | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 299 | Blood triglycerides increased | FAERS: 9 | US FAERS | |
| 300 | Dental caries | FAERS: 9 | US FAERS | |
| 301 | Drug administration error | FAERS: 9 | US FAERS | |
| 302 | Ejection Fraction Decreased | FAERS: 9 | US FAERS | |
| 303 | Hepatomegaly | FAERS: 9 | US FAERS | |
| 304 | Joint injury | FAERS: 9 | US FAERS | |
| 305 | Nerve injury | FAERS: 9 | US FAERS | |
| 306 | Nystagmus | FAERS: 9 | US FAERS | |
| 307 | Osteoporosis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 308 | Poor sucking reflex | FAERS: 9 | US FAERS | |
| 309 | Pulmonary Embolism | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 310 | Pulmonary Fibrosis | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 311 | Rash erythematous | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 312 | Tardive Dyskinesia | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 313 | Therapeutic response changed | FAERS: 9 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 314 | Therapeutic response unexpected with drug substitution | FAERS: 9 | US FAERS | |
| 315 | Toothache | FAERS: 9 | US FAERS | |
| 316 | Angioedema | FAERS: 8 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 317 | Angle Closure Glaucoma | FAERS: 8 | US FAERS | |
| 318 | Aphagia | FAERS: 8 | US FAERS | |
| 319 | Asthenopia | FAERS: 8 | US FAERS | |
| 320 | Blood potassium decreased | FAERS: 8 | US FAERS | |
| 321 | Drug withdrawal headache | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 322 | Gastric Bypass | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 323 | Gastritis | FAERS: 8 | US FAERS | |
| 324 | Hepatitis C | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 325 | Hyperthyroidism | FAERS: 8 | US FAERS | |
| 326 | Hypoaesthesia facial | FAERS: 8 | US FAERS | |
| 327 | Lymphadenopathy | FAERS: 8 | US FAERS | |
| 328 | Metabolic acidosis | FAERS: 8 | US FAERS | |
| 329 | Microcephaly | FAERS: 8 | US FAERS | |
| 330 | Nephrolithiasis | FAERS: 8 | US FAERS | |
| 331 | Neuroleptic Malignant Syndrome | FAERS: 8 Canada Vigilance: 1 | 10675082 15362259 | CTD Canada Vigilance US FAERS |
| 332 | Pancytopenia | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 333 | Pneumonitis | FAERS: 8 | US FAERS | |
| 334 | Product dose omission | FAERS: 8 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 335 | Respiratory arrest | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 336 | Right Ventricular Hypertrophy | FAERS: 8 | US FAERS | |
| 337 | Therapeutic product effect incomplete | FAERS: 8 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 338 | Therapy cessation | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 339 | White blood cell count decreased | FAERS: 8 | US FAERS | |
| 340 | Wrong drug administered | FAERS: 8 | US FAERS | |
| 341 | Acute Coronary Syndrome | FAERS: 7 | US FAERS | |
| 342 | Alcohol abuse | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 343 | Anaphylactic shock | FAERS: 7 | US FAERS | |
| 344 | Apparent death | FAERS: 7 | US FAERS | |
| 345 | Appendicitis | FAERS: 7 | US FAERS | |
| 346 | Blood sodium decreased | FAERS: 7 | US FAERS | |
| 347 | Blood thyroid stimulating hormone increased | FAERS: 7 | US FAERS | |
| 348 | Blood urine present | FAERS: 7 | US FAERS | |
| 349 | Cardiac Flutter | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 350 | Congenital heart valve disorder | FAERS: 7 | US FAERS | |
| 351 | Disease Progression | FAERS: 7 | US FAERS | |
| 352 | Disseminated Intravascular Coagulation | FAERS: 7 | US FAERS | |
| 353 | Dissociative disorder | FAERS: 7 | US FAERS | |
| 354 | Disturbance in sexual arousal | FAERS: 7 | US FAERS | |
| 355 | Drug Tolerance | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 356 | Drug effective for unapproved indication | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 357 | Ecchymosis | FAERS: 7 | US FAERS | |
| 358 | Emotional poverty | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 359 | Expired product administered | FAERS: 7 | US FAERS | |
| 360 | Eye irritation | FAERS: 7 | US FAERS | |
| 361 | Feeding disorder of infancy OR early childhood | FAERS: 7 | US FAERS | |
| 362 | Gestational Diabetes | FAERS: 7 | US FAERS | |
| 363 | Hallucinations, mixed | FAERS: 7 | US FAERS | |
| 364 | Laziness | FAERS: 7 | US FAERS | |
| 365 | Lipase increased | FAERS: 7 | US FAERS | |
| 366 | Neutropenia | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 367 | Oligohydramnios | FAERS: 7 | US FAERS | |
| 368 | Partner stress | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 369 | Pectus excavatum | FAERS: 7 | US FAERS | |
| 370 | Poisoning | FAERS: 7 | US FAERS | |
| 371 | Poor weight gain neonatal | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 372 | Proteinuria | FAERS: 7 | US FAERS | |
| 373 | Pulmonary Hypertension | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 374 | Sinus bradycardia | FAERS: 7 | US FAERS | |
| 375 | Sluggishness | FAERS: 7 | US FAERS | |
| 376 | Somnambulism | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 377 | Temperature intolerance | FAERS: 7 | US FAERS | |
| 378 | Toxic Epidermal Necrolysis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 379 | Trisomy 21 | FAERS: 7 | US FAERS | |
| 380 | VIIth nerve paralysis | FAERS: 7 | US FAERS | |
| 381 | Vitreous floaters | FAERS: 7 | US FAERS | |
| 382 | Accidental drug intake by child | FAERS: 6 | US FAERS | |
| 383 | Ageusia | FAERS: 6 | US FAERS | |
| 384 | Ankle Fracture | FAERS: 6 | US FAERS | |
| 385 | Atrial tachycardia | FAERS: 6 | US FAERS | |
| 386 | Atrioventricular Block | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 387 | Blood alkaline phosphatase increased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 388 | Circumstance or information capable of leading to medication error | FAERS: 6 | US FAERS | |
| 389 | Deafness Neurosensory | FAERS: 6 | US FAERS | |
| 390 | Diverticulum | FAERS: 6 | US FAERS | |
| 391 | Electroencephalogram abnormal | FAERS: 6 | US FAERS | |
| 392 | Exposure during breast feeding | FAERS: 6 | US FAERS | |
| 393 | Food Allergy | FAERS: 6 | US FAERS | |
| 394 | Food craving | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 395 | Frustration | FAERS: 6 | US FAERS | |
| 396 | Gastroenteritis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 397 | Hepatotoxicity | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 398 | Impatience | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 399 | Inappropriate affect | FAERS: 6 | US FAERS | |
| 400 | Intestinal Obstruction | FAERS: 6 | US FAERS | |
| 401 | Labile blood pressure | FAERS: 6 | US FAERS | |
| 402 | Limb discomfort | FAERS: 6 | US FAERS | |
| 403 | Macular degeneration | FAERS: 6 | US FAERS | |
| 404 | Malnutrition | FAERS: 6 | US FAERS | |
| 405 | Medication residue present | FAERS: 6 | US FAERS | |
| 406 | Metrorrhagia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 407 | Musculoskeletal discomfort | FAERS: 6 | US FAERS | |
| 408 | Narcolepsy | FAERS: 6 | US FAERS | |
| 409 | Poor feeding infant | FAERS: 6 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 410 | Post procedural complication | FAERS: 6 | US FAERS | |
| 411 | Priapism | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 412 | Product formulation issue | FAERS: 6 | US FAERS | |
| 413 | Product taste abnormal | FAERS: 6 | US FAERS | |
| 414 | Reversible cerebral vasoconstriction syndrome | FAERS: 6 | US FAERS | |
| 415 | Stupor | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 416 | Tension Headache | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 417 | Transaminases increased | FAERS: 6 | US FAERS | |
| 418 | Ventricular hypokinesia | FAERS: 6 | US FAERS | |
| 419 | Ventricular hypoplasia | FAERS: 6 | US FAERS | |
| 420 | Vulvovaginal dryness | FAERS: 6 | US FAERS | |
| 421 | Abnormal weight gain | FAERS: 5 | US FAERS | |
| 422 | Agranulocytosis | FAERS: 5 | US FAERS | |
| 423 | Alveolitis | FAERS: 5 | US FAERS | |
| 424 | Anosmia | FAERS: 5 | US FAERS | |
| 425 | Ascites | FAERS: 5 | US FAERS | |
| 426 | Bell's phenomenon | FAERS: 5 | US FAERS | |
| 427 | Blood pressure fluctuation | FAERS: 5 | US FAERS | |
| 428 | Blood testosterone decreased | FAERS: 5 | US FAERS | |
| 429 | Breast Cyst | FAERS: 5 | US FAERS | |
| 430 | Bronchitis | FAERS: 5 | US FAERS | |
| 431 | Carpal Tunnel Syndrome | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 432 | Cerebral Infarction | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 433 | Cerebral ventricle dilatation | FAERS: 5 | US FAERS | |
| 434 | Chylothorax | FAERS: 5 | US FAERS | |
| 435 | Congenital scoliosis | FAERS: 5 | US FAERS | |
| 436 | Cystitis | FAERS: 5 | US FAERS | |
| 437 | Dacryostenosis acquired | FAERS: 5 | US FAERS | |
| 438 | Deep Vein Thrombosis | FAERS: 5 | US FAERS | |
| 439 | Dreamy state | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 440 | Drug effect delayed | FAERS: 5 | US FAERS | |
| 441 | Dry skin | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 442 | Dysgraphia | FAERS: 5 | US FAERS | |
| 443 | Electrocardiogram repolarisation abnormality | FAERS: 5 | US FAERS | |
| 444 | Epistaxis | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 445 | Excoriation | FAERS: 5 | US FAERS | |
| 446 | False positive investigation result | FAERS: 5 | US FAERS | |
| 447 | Frustration tolerance decreased | FAERS: 5 | US FAERS | |
| 448 | Hepatitis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 449 | Hernia | FAERS: 5 | US FAERS | |
| 450 | Hyperphagia | FAERS: 5 | US FAERS | |
| 451 | Impaired gastric emptying | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 452 | Infarction | FAERS: 5 | US FAERS | |
| 453 | Joint swelling | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 454 | Lip swelling | FAERS: 5 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 455 | Low density lipoprotein increased | FAERS: 5 | US FAERS | |
| 456 | Menopause | FAERS: 5 | US FAERS | |
| 457 | Microgenia | FAERS: 5 | US FAERS | |
| 458 | Mitral Valve Stenosis | FAERS: 5 | US FAERS | |
| 459 | Murder | FAERS: 5 | US FAERS | |
| 460 | Negativism | FAERS: 5 | US FAERS | |
| 461 | Neonatal respiratory depression | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 462 | Ocular Hypertension | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 463 | Oropharyngeal pain | FAERS: 5 | US FAERS | |
| 464 | Oropharyngeal swelling | FAERS: 5 | US FAERS | |
| 465 | Poor peripheral circulation | FAERS: 5 | US FAERS | |
| 466 | Poor quality drug administered | FAERS: 5 | US FAERS | |
| 467 | Product physical issue | FAERS: 5 | US FAERS | |
| 468 | Psychomotor skills impaired | FAERS: 5 | US FAERS | |
| 469 | Purulent discharge | FAERS: 5 | US FAERS | |
| 470 | Sinus Arrhythmia | FAERS: 5 | US FAERS | |
| 471 | Sinusitis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 472 | Stereotypic Movement Disorder | FAERS: 5 | 9798262 | CTD US FAERS |
| 473 | Stillbirth | FAERS: 5 | US FAERS | |
| 474 | Sudden infant death syndrome | FAERS: 5 | US FAERS | |
| 475 | Suspected counterfeit product | FAERS: 5 | US FAERS | |
| 476 | Therapy non-responder | FAERS: 5 | US FAERS | |
| 477 | Throat irritation | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 478 | Tongue biting | FAERS: 5 | US FAERS | |
| 479 | Ulcer | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 480 | Unresponsive to stimuli | FAERS: 5 | US FAERS | |
| 481 | Urinary hesitation | FAERS: 5 | US FAERS | |
| 482 | Ventricular Fibrillation | FAERS: 5 | US FAERS | |
| 483 | Victim of homicide | FAERS: 5 | US FAERS | |
| 484 | Abnormal sleep-related event | FAERS: 4 | US FAERS | |
| 485 | Accidental exposure | FAERS: 4 | US FAERS | |
| 486 | Activation syndrome | FAERS: 4 | US FAERS | |
| 487 | Acute myocardial infarction | FAERS: 4 | US FAERS | |
| 488 | Alcohol interaction | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 489 | Alcohol poisoning | FAERS: 4 | US FAERS | |
| 490 | Altered visual depth perception | FAERS: 4 | US FAERS | |
| 491 | Aneurysm | FAERS: 4 | US FAERS | |
| 492 | Arteriosclerosis | FAERS: 4 | US FAERS | |
| 493 | Bicuspid aortic valve | FAERS: 4 | US FAERS | |
| 494 | Bipolar II disorder | FAERS: 4 | US FAERS | |
| 495 | Bladder spasm | FAERS: 4 | US FAERS | |
| 496 | Blood urea increased | FAERS: 4 | US FAERS | |
| 497 | Blunted affect | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 498 | Bulimia Nervosa | FAERS: 4 | US FAERS | |
| 499 | Cardiac infection | FAERS: 4 | US FAERS | |
| 500 | Cerebral atrophy | FAERS: 4 | US FAERS | |
| 501 | Choking | FAERS: 4 | US FAERS | |
| 502 | Cholelithiasis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 503 | Cholestasis | FAERS: 4 Canada Vigilance: 1 | 10691596 | CTD Canada Vigilance US FAERS |
| 504 | Clumsiness | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 505 | Coma scale abnormal | FAERS: 4 | US FAERS | |
| 506 | Complications of maternal exposure to therapeutic drugs | FAERS: 4 | US FAERS | |
| 507 | Compulsive sexual behaviour | FAERS: 4 | US FAERS | |
| 508 | Congenital choroid plexus cyst | FAERS: 4 | US FAERS | |
| 509 | Deja Vu | FAERS: 4 | US FAERS | |
| 510 | Delayed delivery | FAERS: 4 | US FAERS | |
| 511 | Delusional disorder, unspecified type | FAERS: 4 | US FAERS | |
| 512 | Diabetes mellitus inadequate control | FAERS: 4 | US FAERS | |
| 513 | Diverticulitis | FAERS: 4 | US FAERS | |
| 514 | Eclampsia | FAERS: 4 | US FAERS | |
| 515 | Eczema | FAERS: 4 | US FAERS | |
| 516 | Eructation | FAERS: 4 | US FAERS | |
| 517 | Food Poisoning | FAERS: 4 | US FAERS | |
| 518 | Food aversion | FAERS: 4 | US FAERS | |
| 519 | Gait inability | FAERS: 4 | US FAERS | |
| 520 | Gastrointestinal motility disorder | FAERS: 4 | US FAERS | |
| 521 | Gastroschisis | FAERS: 4 | US FAERS | |
| 522 | Hemiplegia | FAERS: 4 | US FAERS | |
| 523 | Hypertensive emergency | FAERS: 4 | US FAERS | |
| 524 | Inappropriate schedule of product administration | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 525 | Incorrect drug dosage form administered | FAERS: 4 | US FAERS | |
| 526 | Initial insomnia | FAERS: 4 | US FAERS | |
| 527 | Leukocytosis | FAERS: 4 | US FAERS | |
| 528 | Long QT Syndrome | FAERS: 4 | US FAERS | |
| 529 | Lung consolidation | FAERS: 4 | US FAERS | |
| 530 | MYELODYSPLASTIC SYNDROME | FAERS: 4 | US FAERS | |
| 531 | Multiple drug overdose intentional | FAERS: 4 | US FAERS | |
| 532 | Ocular discomfort | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 533 | Oculogyration | FAERS: 4 | US FAERS | |
| 534 | Optic Neuritis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 535 | Osteogenesis Imperfecta | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 536 | Parapsoriasis | FAERS: 4 | US FAERS | |
| 537 | Performance status decreased | FAERS: 4 | US FAERS | |
| 538 | Piloerection | FAERS: 4 | US FAERS | |
| 539 | Polydipsia | FAERS: 4 | US FAERS | |
| 540 | Polyneuropathy | FAERS: 4 | US FAERS | |
| 541 | Product commingling | FAERS: 4 | US FAERS | |
| 542 | Pulmonary Eosinophilia | FAERS: 4 | US FAERS | |
| 543 | Pulmonary congestion | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 544 | Pyloric Stenosis | FAERS: 4 | US FAERS | |
| 545 | Reaction to drug excipients | FAERS: 4 | US FAERS | |
| 546 | Renal pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 547 | Rosacea | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 548 | Sexual abuse | FAERS: 4 | US FAERS | |
| 549 | Snoring | FAERS: 4 | US FAERS | |
| 550 | Sopor | FAERS: 4 | US FAERS | |
| 551 | Status Epilepticus | FAERS: 4 | US FAERS | |
| 552 | Stool analysis abnormal | FAERS: 4 | US FAERS | |
| 553 | Temperature regulation disorder | FAERS: 4 | US FAERS | |
| 554 | Therapy change | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 555 | Tibial torsion | FAERS: 4 | US FAERS | |
| 556 | Tobacco user | FAERS: 4 | US FAERS | |
| 557 | Tooth Erosion | FAERS: 4 | US FAERS | |
| 558 | Upper respiratory tract congestion | FAERS: 4 | US FAERS | |
| 559 | Waxy flexibility | FAERS: 4 | US FAERS | |
| 560 | Wheezing | FAERS: 4 | US FAERS | |
| 561 | Abscess | FAERS: 3 | US FAERS | |
| 562 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 563 | Alcohol Intolerance | FAERS: 3 | US FAERS | |
| 564 | Allergic reaction to excipient | FAERS: 3 | US FAERS | |
| 565 | Anticholinergic Syndrome | FAERS: 3 | US FAERS | |
| 566 | Aortic Aneurysm | FAERS: 3 | US FAERS | |
| 567 | Atrial Flutter | FAERS: 3 | US FAERS | |
| 568 | Atrioventricular Septal Defect | FAERS: 3 | US FAERS | |
| 569 | Benign Prostatic Hyperplasia | FAERS: 3 | US FAERS | |
| 570 | Blood alcohol increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 571 | Blood catecholamines increased | FAERS: 3 | US FAERS | |
| 572 | Blood count abnormal | FAERS: 3 | US FAERS | |
| 573 | Blood glucose abnormal | FAERS: 3 | US FAERS | |
| 574 | Blood glucose fluctuation | FAERS: 3 | US FAERS | |
| 575 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 576 | Body temperature fluctuation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 577 | Bowel movement irregularity | FAERS: 3 | US FAERS | |
| 578 | Breech Presentation | FAERS: 3 | US FAERS | |
| 579 | Brief psychotic disorder with marked stressors | FAERS: 3 | US FAERS | |
| 580 | Carbon Monoxide Poisoning | FAERS: 3 | US FAERS | |
| 581 | Cellulitis | FAERS: 3 | US FAERS | |
| 582 | Central nervous system lesion | FAERS: 3 | US FAERS | |
| 583 | Cerebral Palsy | FAERS: 3 | US FAERS | |
| 584 | Cerebral Thrombosis | FAERS: 3 | US FAERS | |
| 585 | Cerebral atrophy congenital | FAERS: 3 | US FAERS | |
| 586 | Clonus | FAERS: 3 | US FAERS | |
| 587 | Cluster Headache | FAERS: 3 | US FAERS | |
| 588 | Colitis | FAERS: 3 | US FAERS | |
| 589 | Complication of delivery | FAERS: 3 | US FAERS | |
| 590 | Dark circles under eyes | FAERS: 3 | US FAERS | |
| 591 | Delusional disorder, persecutory type | FAERS: 3 | US FAERS | |
| 592 | Demyelination | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 593 | Diaphragmalgia | FAERS: 3 | US FAERS | |
| 594 | Disability | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 595 | Drug administered to patient of inappropriate age | FAERS: 3 | US FAERS | |
| 596 | Drug level decreased | FAERS: 3 | US FAERS | |
| 597 | Drug withdrawal convulsions | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 598 | Drug withdrawal maintenance therapy | FAERS: 3 | US FAERS | |
| 599 | Educational problem | FAERS: 3 | US FAERS | |
| 600 | Electrocardiogram QT interval abnormal | FAERS: 3 | US FAERS | |
| 601 | Enteritis | FAERS: 3 | US FAERS | |
| 602 | Epilepsy congenital | FAERS: 3 | US FAERS | |
| 603 | Exposure via breast milk | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 604 | Gambling | FAERS: 3 | US FAERS | |
| 605 | Gastrointestinal Pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 606 | Gastrointestinal inflammation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 607 | Glasgow coma scale abnormal | FAERS: 3 | US FAERS | |
| 608 | Growth retardation | FAERS: 3 | US FAERS | |
| 609 | Histrionic Personality Disorder | FAERS: 3 | US FAERS | |
| 610 | Hypervigilance | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 611 | Hypospadias | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 612 | Hypoventilation | FAERS: 3 | US FAERS | |
| 613 | Incorrect drug administration rate | FAERS: 3 | US FAERS | |
| 614 | Incorrect storage of drug | FAERS: 3 | US FAERS | |
| 615 | Intracranial Aneurysm | FAERS: 3 | US FAERS | |
| 616 | Joint stiffness | FAERS: 3 | US FAERS | |
| 617 | Lactation Disorder | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 618 | Libido disorder | FAERS: 3 | US FAERS | |
| 619 | Lichen Planus | FAERS: 3 | US FAERS | |
| 620 | Lymphocyte count decreased | FAERS: 3 | US FAERS | |
| 621 | Male Orgasmic Disorder | FAERS: 3 | US FAERS | |
| 622 | Malignant Hypertension | FAERS: 3 | US FAERS | |
| 623 | Maternal exposure during breast feeding | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 624 | Meningomyelocele | FAERS: 3 | US FAERS | |
| 625 | Mouth swelling | FAERS: 3 | US FAERS | |
| 626 | Muscle Fatigue | FAERS: 3 | US FAERS | |
| 627 | Myoclonic Epilepsy | FAERS: 3 | US FAERS | |
| 628 | Myopia | FAERS: 3 | US FAERS | |
| 629 | Myositis | FAERS: 3 | US FAERS | |
| 630 | Neonatal infection | FAERS: 3 | US FAERS | |
| 631 | Neonatal respiratory failure | FAERS: 3 | US FAERS | |
| 632 | Oculogyric crisis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 633 | Onychoclasis | FAERS: 3 | US FAERS | |
| 634 | Orgasmic sensation decreased | FAERS: 3 | US FAERS | |
| 635 | Pain of skin | FAERS: 3 | US FAERS | |
| 636 | Pancreatic carcinoma | FAERS: 3 | US FAERS | |
| 637 | Pancreatic enzymes increased | FAERS: 3 | US FAERS | |
| 638 | Parent-child problem | FAERS: 3 | US FAERS | |
| 639 | Pathological fracture | FAERS: 3 | US FAERS | |
| 640 | Petechiae | FAERS: 3 | US FAERS | |
| 641 | Pneumocystis test positive | FAERS: 3 | US FAERS | |
| 642 | Poor quality product administered | FAERS: 3 | US FAERS | |
| 643 | Premature Menopause | FAERS: 3 | US FAERS | |
| 644 | Pressure of speech | FAERS: 3 | US FAERS | |
| 645 | Product packaging issue | FAERS: 3 | US FAERS | |
| 646 | Product residue present | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 647 | Product size issue | FAERS: 3 | US FAERS | |
| 648 | Product solubility abnormal | FAERS: 3 | US FAERS | |
| 649 | Psychiatric decompensation | FAERS: 3 | US FAERS | |
| 650 | Pulmonary vascular disorder | FAERS: 3 | US FAERS | |
| 651 | Purpura | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 652 | Reaction to excipient | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 653 | Rebound effect | FAERS: 3 | US FAERS | |
| 654 | Respiratory Depression | FAERS: 3 | US FAERS | |
| 655 | Retinal Detachment | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 656 | Rotator cuff syndrome | FAERS: 3 | US FAERS | |
| 657 | Sarcoidosis | FAERS: 3 | US FAERS | |
| 658 | Schizophrenia | FAERS: 3 | 12380707 | CTD US FAERS |
| 659 | Scotoma | FAERS: 3 | US FAERS | |
| 660 | Serum serotonin decreased | FAERS: 3 | US FAERS | |
| 661 | Sjogren's Syndrome | FAERS: 3 | US FAERS | |
| 662 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 663 | Sleep Paralysis | FAERS: 3 | US FAERS | |
| 664 | Spinal column stenosis | FAERS: 3 | US FAERS | |
| 665 | Stomatitis | FAERS: 3 | US FAERS | |
| 666 | Sudden death | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 667 | Tetany | FAERS: 3 | US FAERS | |
| 668 | Thermal burn | FAERS: 3 | US FAERS | |
| 669 | Toxicologic test abnormal | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 670 | Traumatic Brain Injury | FAERS: 3 | US FAERS | |
| 671 | Umbilical hernia | FAERS: 3 | US FAERS | |
| 672 | Underweight | FAERS: 3 | US FAERS | |
| 673 | Vaginal Discharge | FAERS: 3 | US FAERS | |
| 674 | Ventricular arrhythmia | FAERS: 3 | US FAERS | |
| 675 | Victim of spousal abuse | FAERS: 3 | US FAERS | |
| 676 | Weight decrease neonatal | FAERS: 3 | US FAERS | |
| 677 | effusion | FAERS: 3 | US FAERS | |
| 678 | furuncle | FAERS: 3 | US FAERS | |
| 679 | Accidental exposure to product | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 680 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 681 | Acidosis | FAERS: 2 | US FAERS | |
| 682 | Acute psychosis | FAERS: 2 | US FAERS | |
| 683 | Adactyly | FAERS: 2 | US FAERS | |
| 684 | Adenomatous Polyposis Coli | FAERS: 2 | US FAERS | |
| 685 | Agitated depression | FAERS: 2 | US FAERS | |
| 686 | Agoraphobia | FAERS: 2 | US FAERS | |
| 687 | Alcohol Use Disorder | FAERS: 2 | US FAERS | |
| 688 | Alpha 1 foetoprotein decreased | FAERS: 2 | US FAERS | |
| 689 | Amaurosis Fugax | FAERS: 2 | US FAERS | |
| 690 | Amphetamines positive | FAERS: 2 | US FAERS | |
| 691 | Anal sphincter atony | FAERS: 2 | US FAERS | |
| 692 | Anhidrosis | FAERS: 2 | US FAERS | |
| 693 | Antiphospholipid antibodies positive | FAERS: 2 | US FAERS | |
| 694 | Apallic syndrome | FAERS: 2 | US FAERS | |
| 695 | Aphonia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 696 | Aura | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 697 | Autoimmune hepatitis | FAERS: 2 | US FAERS | |
| 698 | Autonomic nervous system imbalance | FAERS: 2 | US FAERS | |
| 699 | Autoscopy | FAERS: 2 | US FAERS | |
| 700 | Band neutrophil count increased | FAERS: 2 | US FAERS | |
| 701 | Bladder pain | FAERS: 2 | US FAERS | |
| 702 | Bladder prolapse | FAERS: 2 | US FAERS | |
| 703 | Bladder trabeculation | FAERS: 2 | US FAERS | |
| 704 | Blood amylase increased | FAERS: 2 | US FAERS | |
| 705 | Blood cholesterol abnormal | FAERS: 2 | US FAERS | |
| 706 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 707 | Blood pH decreased | FAERS: 2 | US FAERS | |
| 708 | Blood potassium abnormal | FAERS: 2 | US FAERS | |
| 709 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 710 | Brain natriuretic peptide increased | FAERS: 2 | US FAERS | |
| 711 | Bronchiectasis | FAERS: 2 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 712 | Calcinosis | FAERS: 2 | US FAERS | |
| 713 | Candidiasis | FAERS: 2 | US FAERS | |
| 714 | Cataplexy | FAERS: 2 | 15910521 | CTD US FAERS |
| 715 | Catatonia | FAERS: 2 | US FAERS | |
| 716 | Catheter related complication | FAERS: 2 | US FAERS | |
| 717 | Chromatopsia | FAERS: 2 | US FAERS | |
| 718 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 719 | Cogwheel Rigidity | FAERS: 2 | US FAERS | |
| 720 | Colectomy | FAERS: 2 | US FAERS | |
| 721 | Compulsive shopping | FAERS: 2 | US FAERS | |
| 722 | Concomitant disease aggravated | FAERS: 2 | US FAERS | |
| 723 | Congenital aqueductal stenosis | FAERS: 2 | US FAERS | |
| 724 | Congenital pulmonary hypertension | FAERS: 2 | US FAERS | |
| 725 | Craniosynostosis | FAERS: 2 | US FAERS | |
| 726 | Creutzfeldt-Jakob disease | FAERS: 2 | US FAERS | |
| 727 | Death of relative | FAERS: 2 | US FAERS | |
| 728 | Delusional disorder, somatic type | FAERS: 2 | US FAERS | |
| 729 | Dermatitis | FAERS: 2 | US FAERS | |
| 730 | Dermatomyositis | FAERS: 2 | US FAERS | |
| 731 | Device Failure | FAERS: 2 | US FAERS | |
| 732 | Diastolic hypertension | FAERS: 2 | US FAERS | |
| 733 | Drug dispensed to wrong patient | FAERS: 2 | US FAERS | |
| 734 | Drug effect variable | FAERS: 2 | US FAERS | |
| 735 | Drug exposure before pregnancy | FAERS: 2 | US FAERS | |
| 736 | Drug level above therapeutic | FAERS: 2 | US FAERS | |
| 737 | Drug level increased | FAERS: 2 | US FAERS | |
| 738 | Drug resistance | FAERS: 2 | US FAERS | |
| 739 | Duodenitis | FAERS: 2 | US FAERS | |
| 740 | Dyslexia | FAERS: 2 | US FAERS | |
| 741 | Dyspareunia | FAERS: 2 | US FAERS | |
| 742 | Dysphasia | FAERS: 2 | US FAERS | |
| 743 | Ear tube insertion | FAERS: 2 | US FAERS | |
| 744 | Electrocardiogram change | FAERS: 2 | US FAERS | |
| 745 | Elevated mood | FAERS: 2 | US FAERS | |
| 746 | Encephalocele | FAERS: 2 | US FAERS | |
| 747 | Enuresis | FAERS: 2 | US FAERS | |
| 748 | Eosinophilia | FAERS: 2 | US FAERS | |
| 749 | Eosinophilic Pneumonia | FAERS: 2 | US FAERS | |
| 750 | Epigastric discomfort | FAERS: 2 | US FAERS | |
| 751 | Erythema Multiforme | FAERS: 2 | US FAERS | |
| 752 | Erythroblastosis | FAERS: 2 | US FAERS | |
| 753 | Essential Tremor | FAERS: 2 | US FAERS | |
| 754 | Exophthalmos | FAERS: 2 | US FAERS | |
| 755 | Expired drug administered | FAERS: 2 | US FAERS | |
| 756 | Eyelid margin crusting | FAERS: 2 | US FAERS | |
| 757 | Eyelid rash | FAERS: 2 | US FAERS | |
| 758 | Finger hypoplasia | FAERS: 2 | US FAERS | |
| 759 | Foaming at mouth | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 760 | Gait deviation | FAERS: 2 | US FAERS | |
| 761 | Gastrointestinal carcinoma | FAERS: 2 | US FAERS | |
| 762 | Glossitis | FAERS: 2 | US FAERS | |
| 763 | Glossopharyngeal nerve paralysis | FAERS: 2 | US FAERS | |
| 764 | Glycogen storage disease type II | FAERS: 2 | US FAERS | |
| 765 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 766 | Haptoglobin Decreased | FAERS: 2 | US FAERS | |
| 767 | Heat Stroke | FAERS: 2 | US FAERS | |
| 768 | Hepatic infiltration eosinophilic | FAERS: 2 | US FAERS | |
| 769 | Hepatitis A | FAERS: 2 | US FAERS | |
| 770 | Hepatitis B | FAERS: 2 | US FAERS | |
| 771 | Hip Dysplasia | FAERS: 2 | US FAERS | |
| 772 | Histamine level increased | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 773 | Hormone level abnormal | FAERS: 2 | US FAERS | |
| 774 | Hydrocephalus | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 775 | Hydronephrosis | FAERS: 2 | US FAERS | |
| 776 | Hyperchlorhydria | FAERS: 2 | US FAERS | |
| 777 | Hyperemesis Gravidarum | FAERS: 2 | US FAERS | |
| 778 | Hyperkeratosis palmaris and plantaris | FAERS: 2 | US FAERS | |
| 779 | Hyperpyrexia | FAERS: 2 | US FAERS | |
| 780 | Hypertensive Encephalopathy | FAERS: 2 | US FAERS | |
| 781 | Hysterectomy | FAERS: 2 | US FAERS | |
| 782 | Iatrogenic injury | FAERS: 2 | US FAERS | |
| 783 | Ileus | FAERS: 2 | US FAERS | |
| 784 | Immobile | FAERS: 2 | US FAERS | |
| 785 | Impaired quality of life | FAERS: 2 | US FAERS | |
| 786 | Impaired reasoning | FAERS: 2 | US FAERS | |
| 787 | Impaired self-care | FAERS: 2 | US FAERS | |
| 788 | Increased tendency to bruise | FAERS: 2 | US FAERS | |
| 789 | Increased ventricular afterload | FAERS: 2 | US FAERS | |
| 790 | Infantile vomiting | FAERS: 2 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 791 | Infertility | FAERS: 2 | US FAERS | |
| 792 | Insurance issue | FAERS: 2 | US FAERS | |
| 793 | Intellectual Disability | FAERS: 2 | US FAERS | |
| 794 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 795 | Lacrimation decreased | FAERS: 2 | US FAERS | |
| 796 | Laryngospasm | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 797 | Leukopenia | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 798 | Ligament rupture | FAERS: 2 | US FAERS | |
| 799 | Lower Urinary Tract Symptoms | FAERS: 2 | US FAERS | |
| 800 | Lymphocyte count increased | FAERS: 2 | US FAERS | |
| 801 | Maternal exposure before pregnancy | FAERS: 2 | US FAERS | |
| 802 | Megacolon | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 803 | Meningitis | FAERS: 2 | US FAERS | |
| 804 | Menorrhagia | FAERS: 2 | US FAERS | |
| 805 | Microglossia | FAERS: 2 | US FAERS | |
| 806 | Monocyte count decreased | FAERS: 2 | US FAERS | |
| 807 | Multi-organ disorder | FAERS: 2 | US FAERS | |
| 808 | Muscle Cramp | FAERS: 2 | US FAERS | |
| 809 | Muscle necrosis | FAERS: 2 | US FAERS | |
| 810 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 811 | Mutism | FAERS: 2 | US FAERS | |
| 812 | Necrosis | FAERS: 2 | US FAERS | |
| 813 | Neonatal aspiration | FAERS: 2 | US FAERS | |
| 814 | Neonatal hypotension | FAERS: 2 | US FAERS | |
| 815 | Neonatal respiratory arrest | FAERS: 2 | US FAERS | |
| 816 | Neurodermatitis | FAERS: 2 | US FAERS | |
| 817 | Neutrophil percentage increased | FAERS: 2 | US FAERS | |
| 818 | Nicotine Dependence | FAERS: 2 | US FAERS | |
| 819 | Nocturia | FAERS: 2 | US FAERS | |
| 820 | Norepinephrine increased | FAERS: 2 | US FAERS | |
| 821 | Normetanephrine urine increased | FAERS: 2 | US FAERS | |
| 822 | Nuchal Rigidity | FAERS: 2 | US FAERS | |
| 823 | Obesity surgery | FAERS: 2 | US FAERS | |
| 824 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 825 | Overweight | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 826 | Penile size reduced | FAERS: 2 | US FAERS | |
| 827 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 828 | Peripheral embolism | FAERS: 2 | US FAERS | |
| 829 | Peripheral paralysis | FAERS: 2 | US FAERS | |
| 830 | Pneumothorax | FAERS: 2 | US FAERS | |
| 831 | Polydactyly | FAERS: 2 | US FAERS | |
| 832 | Posturing | FAERS: 2 | US FAERS | |
| 833 | Product contamination physical | FAERS: 2 | US FAERS | |
| 834 | Product lot number issue | FAERS: 2 | US FAERS | |
| 835 | Product measured potency issue | FAERS: 2 | US FAERS | |
| 836 | Product packaging quantity issue | FAERS: 2 | US FAERS | |
| 837 | Product storage error | FAERS: 2 | US FAERS | |
| 838 | Progressive multiple sclerosis | FAERS: 2 | US FAERS | |
| 839 | Prolactinoma | FAERS: 2 | US FAERS | |
| 840 | Protein urine present | FAERS: 2 | US FAERS | |
| 841 | Psoriasis | FAERS: 2 | US FAERS | |
| 842 | Renal Colic | FAERS: 2 | US FAERS | |
| 843 | Respiratory tract inflammation | FAERS: 2 | US FAERS | |
| 844 | Retinitis | FAERS: 2 | US FAERS | |
| 845 | Retroperitoneal fibrosis | FAERS: 2 | US FAERS | |
| 846 | Sciatica | FAERS: 2 | US FAERS | |
| 847 | Sclerodactylia | FAERS: 2 | US FAERS | |
| 848 | Scleroderma | FAERS: 2 | US FAERS | |
| 849 | Selective eating disorder | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 850 | Semen volume decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 851 | Shock symptom | FAERS: 2 | US FAERS | |
| 852 | Skeletal injury | FAERS: 2 | US FAERS | |
| 853 | Sleep Talking | FAERS: 2 | US FAERS | |
| 854 | Sneezing | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 855 | Splenomegaly | FAERS: 2 | US FAERS | |
| 856 | Squamous cell carcinoma | FAERS: 2 | US FAERS | |
| 857 | Strabismus | FAERS: 2 | US FAERS | |
| 858 | Sudden Cardiac Death | FAERS: 2 | US FAERS | |
| 859 | Systemic lupus erythematosus rash | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 860 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 861 | Tooth Extraction | FAERS: 2 | US FAERS | |
| 862 | Transmission of drug via semen | FAERS: 2 | US FAERS | |
| 863 | Troponin increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 864 | Tympanic Membrane Perforation | FAERS: 2 | US FAERS | |
| 865 | Urine ketone body present | FAERS: 2 | US FAERS | |
| 866 | Urine output increased | FAERS: 2 | US FAERS | |
| 867 | Vagus nerve paralysis | FAERS: 2 | US FAERS | |
| 868 | Vasculitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 869 | Ventricle rupture | FAERS: 2 | US FAERS | |
| 870 | Vestibular Neuronitis | FAERS: 2 | US FAERS | |
| 871 | Victim of child abuse | FAERS: 2 | US FAERS | |
| 872 | Vocal Cord Paralysis | FAERS: 2 | US FAERS | |
| 873 | Wolff-Parkinson-White Syndrome | FAERS: 2 | US FAERS | |
| 874 | Wrong product administered | FAERS: 2 | US FAERS | |
| 875 | muscle injury | FAERS: 2 | US FAERS | |
| 876 | prostatitis | FAERS: 2 | US FAERS | |
| 877 | 5-hydroxyindolacetic acid in urine increased | FAERS: 1 | US FAERS | |
| 878 | ABO incompatibility | FAERS: 1 | US FAERS | |
| 879 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 880 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 881 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 882 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 883 | Abnormal clotting factor | FAERS: 1 | US FAERS | |
| 884 | Achlorhydria | FAERS: 1 | US FAERS | |
| 885 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 886 | Adrenalitis | FAERS: 1 | US FAERS | |
| 887 | Alcohol problem | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 888 | Aldolase increased | FAERS: 1 | US FAERS | |
| 889 | Alpha 2 globulin increased | FAERS: 1 | US FAERS | |
| 890 | Ammonia increased | FAERS: 1 | US FAERS | |
| 891 | Amniotic fluid volume decreased | FAERS: 1 | US FAERS | |
| 892 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 893 | Anencephaly | FAERS: 1 | US FAERS | |
| 894 | Angiogram abnormal | FAERS: 1 | US FAERS | |
| 895 | Animal bite | FAERS: 1 | US FAERS | |
| 896 | Anorectal agenesis | FAERS: 1 | US FAERS | |
| 897 | Anti-cyclic citrullinated peptide antibody positive | FAERS: 1 | US FAERS | |
| 898 | Antidepressant drug clearance increased | FAERS: 1 | US FAERS | |
| 899 | Anuria | FAERS: 1 | US FAERS | |
| 900 | Apgar score abnormal | FAERS: 1 | US FAERS | |
| 901 | Arteriovenous fistula | FAERS: 1 | US FAERS | |
| 902 | Arthropod sting | FAERS: 1 | US FAERS | |
| 903 | Artificial rupture of membranes | FAERS: 1 | US FAERS | |
| 904 | Atrial conduction time prolongation | FAERS: 1 | US FAERS | |
| 905 | Auricular swelling | FAERS: 1 | US FAERS | |
| 906 | Automatism | FAERS: 1 | US FAERS | |
| 907 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 908 | Autosomal chromosome anomaly | FAERS: 1 | US FAERS | |
| 909 | Bacteria stool identified | FAERS: 1 | US FAERS | |
| 910 | Bankruptcy | FAERS: 1 | US FAERS | |
| 911 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 912 | Belligerence | FAERS: 1 | US FAERS | |
| 913 | Biliary Colic | FAERS: 1 | US FAERS | |
| 914 | Bilirubinuria | FAERS: 1 | US FAERS | |
| 915 | Binge Drinking | FAERS: 1 | US FAERS | |
| 916 | Birth mark | FAERS: 1 | US FAERS | |
| 917 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 918 | Bladder cancer recurrent | FAERS: 1 | US FAERS | |
| 919 | Blepharospasm | FAERS: 1 | US FAERS | |
| 920 | Blighted ovum | FAERS: 1 | US FAERS | |
| 921 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 922 | Blood alcohol abnormal | FAERS: 1 | US FAERS | |
| 923 | Blood blister | FAERS: 1 | US FAERS | |
| 924 | Blood chromogranin A increased | FAERS: 1 | US FAERS | |
| 925 | Blood cortisol increased | FAERS: 1 | US FAERS | |
| 926 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 927 | Blood creatine phosphokinase MB abnormal | FAERS: 1 | US FAERS | |
| 928 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 929 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 930 | Blood electrolytes decreased | FAERS: 1 | US FAERS | |
| 931 | Blood ethanol increased | FAERS: 1 | US FAERS | |
| 932 | Blood folate decreased | FAERS: 1 | US FAERS | |
| 933 | Blood follicle stimulating hormone increased | FAERS: 1 | US FAERS | |
| 934 | Blood insulin decreased | FAERS: 1 | US FAERS | |
| 935 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 936 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 937 | Blood pressure orthostatic abnormal | FAERS: 1 | US FAERS | |
| 938 | Blood smear test abnormal | FAERS: 1 | US FAERS | |
| 939 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 940 | Blood triglycerides decreased | FAERS: 1 | US FAERS | |
| 941 | Bone density decreased | FAERS: 1 | US FAERS | |
| 942 | Bradykinesia | FAERS: 1 | US FAERS | |
| 943 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 944 | Breast tenderness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 945 | Breath alcohol test positive | FAERS: 1 | US FAERS | |
| 946 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 947 | Bursitis | FAERS: 1 | US FAERS | |
| 948 | Cancer Pain | FAERS: 1 | US FAERS | |
| 949 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 950 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 951 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 952 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 953 | Cardiac septal hypertrophy | FAERS: 1 | US FAERS | |
| 954 | Cardiac valve replacement complication | FAERS: 1 | US FAERS | |
| 955 | Cardiac ventriculogram right abnormal | FAERS: 1 | US FAERS | |
| 956 | Carotid artery aneurysm | FAERS: 1 | US FAERS | |
| 957 | Cauda Equina Syndrome | FAERS: 1 | US FAERS | |
| 958 | Central nervous system function test abnormal | FAERS: 1 | US FAERS | |
| 959 | Central nervous system mass | FAERS: 1 | US FAERS | |
| 960 | Cerebral hypoperfusion | FAERS: 1 | US FAERS | |
| 961 | Cerebrospinal fistula | FAERS: 1 | US FAERS | |
| 962 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 963 | Childhood disintegrative disorder | FAERS: 1 | US FAERS | |
| 964 | Chloropsia | FAERS: 1 | US FAERS | |
| 965 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 966 | Chorea | FAERS: 1 | US FAERS | |
| 967 | Choreoathetosis | FAERS: 1 | US FAERS | |
| 968 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 969 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 970 | Clot retraction | FAERS: 1 | US FAERS | |
| 971 | Coagulation factor V level decreased | FAERS: 1 | US FAERS | |
| 972 | Coagulation factor V level increased | FAERS: 1 | US FAERS | |
| 973 | Colon cancer recurrent | FAERS: 1 | US FAERS | |
| 974 | Colonoscopy abnormal | FAERS: 1 | US FAERS | |
| 975 | Combined immunodeficiency | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 976 | Compression fracture | FAERS: 1 | US FAERS | |
| 977 | Concomitant disease progression | FAERS: 1 | US FAERS | |
| 978 | Congenital Hypothyroidism | FAERS: 1 | US FAERS | |
| 979 | Congenital brain damage | FAERS: 1 | US FAERS | |
| 980 | Congenital cerebellar agenesis | FAERS: 1 | US FAERS | |
| 981 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 982 | Congenital cystic lung | FAERS: 1 | US FAERS | |
| 983 | Congenital diaphragmatic hernia | FAERS: 1 | US FAERS | |
| 984 | Congenital neurological disorder | FAERS: 1 | US FAERS | |
| 985 | Congenital renal cyst | FAERS: 1 | US FAERS | |
| 986 | Contact lens intolerance | FAERS: 1 | US FAERS | |
| 987 | Corneal erosion | FAERS: 1 | US FAERS | |
| 988 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 989 | Coronary artery embolism | FAERS: 1 | US FAERS | |
| 990 | Corticobasal degeneration | FAERS: 1 | US FAERS | |
| 991 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 992 | Creatinine urine decreased | FAERS: 1 | US FAERS | |
| 993 | Cyanopsia | FAERS: 1 | US FAERS | |
| 994 | Cyclosporidium infection | FAERS: 1 | US FAERS | |
| 995 | Cystinosis | FAERS: 1 | US FAERS | |
| 996 | Cyst | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 997 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 998 | Dandy-Walker Syndrome | FAERS: 1 | US FAERS | |
| 999 | Deep Brain Stimulation | FAERS: 1 | US FAERS | |
| 1000 | Deformity | FAERS: 1 | US FAERS | |
| 1001 | Delusional perception | FAERS: 1 | US FAERS | |
| 1002 | Dependent rubor | FAERS: 1 | US FAERS | |
| 1003 | Dermatitis Herpetiformis | FAERS: 1 | US FAERS | |
| 1004 | Device related infection | FAERS: 1 | US FAERS | |
| 1005 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 1006 | Dissociative Identity Disorder | FAERS: 1 | US FAERS | |
| 1007 | Dopamine dysregulation syndrome | FAERS: 1 | US FAERS | |
| 1008 | Drooling | FAERS: 1 | US FAERS | |
| 1009 | Drug clearance decreased | FAERS: 1 | US FAERS | |
| 1010 | Dural tear | FAERS: 1 | US FAERS | |
| 1011 | Dyscalculia | FAERS: 1 | US FAERS | |
| 1012 | Dyslalia | FAERS: 1 | US FAERS | |
| 1013 | Dysmorphism | FAERS: 1 | US FAERS | |
| 1014 | Ectopic Pregnancy | FAERS: 1 | US FAERS | |
| 1015 | Electrocardiogram PQ interval prolonged | FAERS: 1 | US FAERS | |
| 1016 | Electrocardiogram ST segment abnormal | FAERS: 1 | US FAERS | |
| 1017 | Electrocardiogram ST-T segment abnormal | FAERS: 1 | US FAERS | |
| 1018 | Electrolyte depletion | FAERS: 1 | US FAERS | |
| 1019 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 1020 | Embolism | FAERS: 1 | US FAERS | |
| 1021 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 1022 | Endolymphatic Hydrops | FAERS: 1 | US FAERS | |
| 1023 | Endometrial Hyperplasia | FAERS: 1 | US FAERS | |
| 1024 | Endometriosis | FAERS: 1 | US FAERS | |
| 1025 | Endoscopy upper gastrointestinal tract abnormal | FAERS: 1 | US FAERS | |
| 1026 | Enlarged uvula | FAERS: 1 | US FAERS | |
| 1027 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 1028 | Epididymitis | FAERS: 1 | US FAERS | |
| 1029 | Exaggerated startle response | FAERS: 1 | US FAERS | |
| 1030 | Excessive masturbation | FAERS: 1 | US FAERS | |
| 1031 | Excitability | FAERS: 1 | US FAERS | |
| 1032 | Exposure via inhalation | FAERS: 1 | US FAERS | |
| 1033 | Exsanguination | FAERS: 1 | US FAERS | |
| 1034 | Eye Infection | FAERS: 1 | US FAERS | |
| 1035 | Eye Redness | FAERS: 1 | US FAERS | |
| 1036 | Eye inflammation | FAERS: 1 | US FAERS | |
| 1037 | Eyelid Function Disorder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1038 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 1039 | Facial Pain | FAERS: 1 | US FAERS | |
| 1040 | Factor VII Deficiency | FAERS: 1 | US FAERS | |
| 1041 | Failure of child resistant mechanism for pharmaceutical product | FAERS: 1 | US FAERS | |
| 1042 | Feeding problem in child | FAERS: 1 | US FAERS | |
| 1043 | Feeding tube complication | FAERS: 1 | US FAERS | |
| 1044 | Female sexual arousal disorder | FAERS: 1 | US FAERS | |
| 1045 | Flank Pain | FAERS: 1 | US FAERS | |
| 1046 | Focal Nodular Hyperplasia | FAERS: 1 | US FAERS | |
| 1047 | Focal dyscognitive seizures | FAERS: 1 | US FAERS | |
| 1048 | Foreign body aspiration | FAERS: 1 | US FAERS | |
| 1049 | Frontotemporal dementia | FAERS: 1 | US FAERS | |
| 1050 | Gammopathy | FAERS: 1 | US FAERS | |
| 1051 | Gastrectomy | FAERS: 1 | US FAERS | |
| 1052 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 1053 | Gastrocardiac syndrome | FAERS: 1 | US FAERS | |
| 1054 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 1055 | Gastrointestinal mucosal necrosis | FAERS: 1 | US FAERS | |
| 1056 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 1057 | Gaze palsy | FAERS: 1 | US FAERS | |
| 1058 | Gene mutation identification test positive | FAERS: 1 | US FAERS | |
| 1059 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 1060 | General physical condition decreased | FAERS: 1 | US FAERS | |
| 1061 | Genital abscess | FAERS: 1 | US FAERS | |
| 1062 | Genital pain | FAERS: 1 | US FAERS | |
| 1063 | Gingival Recession | FAERS: 1 | US FAERS | |
| 1064 | Global Amnesia | FAERS: 1 | US FAERS | |
| 1065 | Glycosuria | FAERS: 1 | US FAERS | |
| 1066 | Granulocyte count increased | FAERS: 1 | US FAERS | |
| 1067 | Granulocytes abnormal | FAERS: 1 | US FAERS | |
| 1068 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 1069 | Halitosis | FAERS: 1 | US FAERS | |
| 1070 | Head Banging | FAERS: 1 | US FAERS | |
| 1071 | Head deformity | FAERS: 1 | US FAERS | |
| 1072 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 1073 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 1074 | Hepatitis B surface antigen positive | FAERS: 1 | US FAERS | |
| 1075 | Herbal interaction | FAERS: 1 | US FAERS | |
| 1076 | High density lipoprotein increased | FAERS: 1 | US FAERS | |
| 1077 | Hip surgery | FAERS: 1 | US FAERS | |
| 1078 | Histone antibody positive | FAERS: 1 | US FAERS | |
| 1079 | Holoprosencephaly | FAERS: 1 | US FAERS | |
| 1080 | Hyperexplexia | FAERS: 1 | US FAERS | |
| 1081 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 1082 | Hypermetabolism | FAERS: 1 | US FAERS | |
| 1083 | Hyperparathyroidism | FAERS: 1 | US FAERS | |
| 1084 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 1085 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 1086 | Hypertrophy | FAERS: 1 | US FAERS | |
| 1087 | Hypochondriasis | FAERS: 1 | US FAERS | |
| 1088 | Hypometabolism | FAERS: 1 | US FAERS | |
| 1089 | Hypothermia neonatal | FAERS: 1 | US FAERS | |
| 1090 | Hypotonic urinary bladder | FAERS: 1 | US FAERS | |
| 1091 | Hypotonic-hyporesponsive episode | FAERS: 1 | US FAERS | |
| 1092 | Ideas of reference | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1093 | Idiopathic urticaria | FAERS: 1 | US FAERS | |
| 1094 | Iliac artery occlusion | FAERS: 1 | US FAERS | |
| 1095 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 1096 | Implant site infection | FAERS: 1 | US FAERS | |
| 1097 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 1098 | Inadequate lubrication | FAERS: 1 | US FAERS | |
| 1099 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 1100 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 1101 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 1102 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 1103 | Infectious peritonitis | FAERS: 1 | US FAERS | |
| 1104 | Inferiority complex | FAERS: 1 | US FAERS | |
| 1105 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 1106 | Insulin C-peptide increased | FAERS: 1 | US FAERS | |
| 1107 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 1108 | Intercepted wrong patient selected | FAERS: 1 | US FAERS | |
| 1109 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 1110 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 1111 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 1112 | Intestinal infarction | FAERS: 1 | US FAERS | |
| 1113 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 1114 | Intrauterine infection | FAERS: 1 | US FAERS | |
| 1115 | Irregular breathing | FAERS: 1 | US FAERS | |
| 1116 | Jealous delusion | FAERS: 1 | US FAERS | |
| 1117 | Keratoconjunctivitis Sicca | FAERS: 1 | US FAERS | |
| 1118 | Ketonuria | FAERS: 1 | US FAERS | |
| 1119 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 1120 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 1121 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 1122 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 1123 | Laryngomalacia | FAERS: 1 | US FAERS | |
| 1124 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 1125 | Left atrial dilatation | FAERS: 1 | US FAERS | |
| 1126 | Left ventricular end-diastolic pressure increased | FAERS: 1 | US FAERS | |
| 1127 | Limb mass | FAERS: 1 | US FAERS | |
| 1128 | Lipoatrophy | FAERS: 1 | US FAERS | |
| 1129 | Liver Abscess | FAERS: 1 | US FAERS | |
| 1130 | Locked-In Syndrome | FAERS: 1 | US FAERS | |
| 1131 | Lordosis | FAERS: 1 | US FAERS | |
| 1132 | Low Cardiac Output Syndrome | FAERS: 1 | US FAERS | |
| 1133 | Low birth weight baby | FAERS: 1 | US FAERS | |
| 1134 | Low set ears | FAERS: 1 | US FAERS | |
| 1135 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 1136 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 1137 | Lyme Disease | FAERS: 1 | US FAERS | |
| 1138 | Lymphocyte percentage decreased | FAERS: 1 | US FAERS | |
| 1139 | Lymphopenia | FAERS: 1 | US FAERS | |
| 1140 | Male sexual dysfunction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1141 | Malocclusion | FAERS: 1 | US FAERS | |
| 1142 | Manufacturing materials issue | FAERS: 1 | US FAERS | |
| 1143 | Marasmus | FAERS: 1 | US FAERS | |
| 1144 | Mastocytosis | FAERS: 1 | US FAERS | |
| 1145 | Mechanical ventilation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1146 | Meningocele | FAERS: 1 | US FAERS | |
| 1147 | Meningorrhagia | FAERS: 1 | US FAERS | |
| 1148 | Merycism | FAERS: 1 | US FAERS | |
| 1149 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 1150 | Metanephrine urine increased | FAERS: 1 | US FAERS | |
| 1151 | Metastases to stomach | FAERS: 1 | US FAERS | |
| 1152 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 1153 | Micrographia | FAERS: 1 | US FAERS | |
| 1154 | Microphthalmos | FAERS: 1 | US FAERS | |
| 1155 | Microstomia | FAERS: 1 | US FAERS | |
| 1156 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 1157 | Miliaria | FAERS: 1 | US FAERS | |
| 1158 | Moaning | FAERS: 1 | US FAERS | |
| 1159 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 1160 | Monocyte percentage increased | FAERS: 1 | US FAERS | |
| 1161 | Mononeuritis | FAERS: 1 | US FAERS | |
| 1162 | Mononeuropathy Multiplex | FAERS: 1 | US FAERS | |
| 1163 | Morose | FAERS: 1 | US FAERS | |
| 1164 | Multiple Chemical Sensitivity | FAERS: 1 | US FAERS | |
| 1165 | Multiple drug overdose | FAERS: 1 | US FAERS | |
| 1166 | Multiple drug therapy | FAERS: 1 | US FAERS | |
| 1167 | Muscle strain | FAERS: 1 | US FAERS | |
| 1168 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 1169 | Myocarditis post infection | FAERS: 1 | US FAERS | |
| 1170 | Myocarditis | FAERS: 1 | US FAERS | |
| 1171 | Myopathy | FAERS: 1 | US FAERS | |
| 1172 | Myotonia | FAERS: 1 | US FAERS | |
| 1173 | Neonatal hepatomegaly | FAERS: 1 | US FAERS | |
| 1174 | Neonatal multi-organ failure | FAERS: 1 | US FAERS | |
| 1175 | Neonatal respiratory acidosis | FAERS: 1 | US FAERS | |
| 1176 | Neonatal tachycardia | FAERS: 1 | US FAERS | |
| 1177 | Neonatal testicular torsion | FAERS: 1 | US FAERS | |
| 1178 | Nerve Block | FAERS: 1 | US FAERS | |
| 1179 | Neurological examination abnormal | FAERS: 1 | US FAERS | |
| 1180 | Neuropathy | FAERS: 1 | US FAERS | |
| 1181 | Neurotransmitter level altered | FAERS: 1 | US FAERS | |
| 1182 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 1183 | Nipple pain | FAERS: 1 | US FAERS | |
| 1184 | Occult blood positive | FAERS: 1 | US FAERS | |
| 1185 | Ophthalmoplegia | FAERS: 1 | US FAERS | |
| 1186 | Oral pruritus | FAERS: 1 | US FAERS | |
| 1187 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 1188 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 1189 | Osteopenia | FAERS: 1 | US FAERS | |
| 1190 | Osteosarcoma | FAERS: 1 | US FAERS | |
| 1191 | Ovarian adenoma | FAERS: 1 | US FAERS | |
| 1192 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 1193 | Paresis | FAERS: 1 | US FAERS | |
| 1194 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 1195 | Periodontitis | FAERS: 1 | US FAERS | |
| 1196 | Peritonitis | FAERS: 1 | US FAERS | |
| 1197 | Perivascular dermatitis | FAERS: 1 | US FAERS | |
| 1198 | Personality change due to a general medical condition | FAERS: 1 | US FAERS | |
| 1199 | Phantom pain | FAERS: 1 | US FAERS | |
| 1200 | Pharyngitis | FAERS: 1 | US FAERS | |
| 1201 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 1202 | Phobia of driving | FAERS: 1 | US FAERS | |
| 1203 | Physical product label issue | FAERS: 1 | US FAERS | |
| 1204 | Placental Insufficiency | FAERS: 1 | US FAERS | |
| 1205 | Plasmapheresis | FAERS: 1 | US FAERS | |
| 1206 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 1207 | Pneumatosis Cystoides Intestinalis | FAERS: 1 | US FAERS | |
| 1208 | Pneumatosis intestinalis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1209 | Pneumococcal sepsis | FAERS: 1 | US FAERS | |
| 1210 | Polychondritis | FAERS: 1 | US FAERS | |
| 1211 | Polyuria | FAERS: 1 | US FAERS | |
| 1212 | Poriomania | FAERS: 1 | US FAERS | |
| 1213 | Post-traumatic neck syndrome | FAERS: 1 | US FAERS | |
| 1214 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 1215 | Postoperative infection | FAERS: 1 | US FAERS | |
| 1216 | Pregnancy of partner | FAERS: 1 | US FAERS | |
| 1217 | Premature Ejaculation | FAERS: 1 | US FAERS | |
| 1218 | Premenstrual syndrome | FAERS: 1 | US FAERS | |
| 1219 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 1220 | Procedural complication | FAERS: 1 | US FAERS | |
| 1221 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 1222 | Product compounding quality issue | FAERS: 1 | US FAERS | |
| 1223 | Product contamination | FAERS: 1 | US FAERS | |
| 1224 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 1225 | Product dispensing error | FAERS: 1 | US FAERS | |
| 1226 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 1227 | Product label issue | FAERS: 1 | US FAERS | |
| 1228 | Product label on wrong product | FAERS: 1 | US FAERS | |
| 1229 | Product origin unknown | FAERS: 1 | US FAERS | |
| 1230 | Product package associated injury | FAERS: 1 | US FAERS | |
| 1231 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 1232 | Product use complaint | FAERS: 1 | US FAERS | |
| 1233 | Productive Cough | FAERS: 1 | US FAERS | |
| 1234 | Prostatism | FAERS: 1 | US FAERS | |
| 1235 | Protein total decreased | FAERS: 1 | US FAERS | |
| 1236 | Prurigo | FAERS: 1 | US FAERS | |
| 1237 | Pseudarthrosis | FAERS: 1 | US FAERS | |
| 1238 | Psychogenic seizure | FAERS: 1 | US FAERS | |
| 1239 | Pulmonary artery stenosis | FAERS: 1 | US FAERS | |
| 1240 | Pulmonary malformation | FAERS: 1 | US FAERS | |
| 1241 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 1242 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 1243 | Purging | FAERS: 1 | US FAERS | |
| 1244 | Purulence | FAERS: 1 | US FAERS | |
| 1245 | Pyelectasia | FAERS: 1 | US FAERS | |
| 1246 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 1247 | Pyoderma | FAERS: 1 | US FAERS | |
| 1248 | QRS axis abnormal | FAERS: 1 | US FAERS | |
| 1249 | Quadriplegia | FAERS: 1 | US FAERS | |
| 1250 | Radiculopathy | FAERS: 1 | US FAERS | |
| 1251 | Regurgitation | FAERS: 1 | US FAERS | |
| 1252 | Relapsing Fever | FAERS: 1 | US FAERS | |
| 1253 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 1254 | Residual urine | FAERS: 1 | US FAERS | |
| 1255 | Respiratory fume inhalation disorder | FAERS: 1 | US FAERS | |
| 1256 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 1257 | Retinal depigmentation | FAERS: 1 | US FAERS | |
| 1258 | Retinal exudates | FAERS: 1 | US FAERS | |
| 1259 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 1260 | Rheumatoid factor increased | FAERS: 1 | US FAERS | |
| 1261 | Right atrial dilatation | FAERS: 1 | US FAERS | |
| 1262 | Rocky Mountain Spotted Fever | FAERS: 1 | US FAERS | |
| 1263 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 1264 | Scab | FAERS: 1 | US FAERS | |
| 1265 | Schizoaffective Disorder | FAERS: 1 | US FAERS | |
| 1266 | Schizoid Personality Disorder | FAERS: 1 | US FAERS | |
| 1267 | Sciatic Nerve Palsy | FAERS: 1 | US FAERS | |
| 1268 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 1269 | Selenium deficiency | FAERS: 1 | US FAERS | |
| 1270 | Self-induced vomiting | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1271 | Senile dementia | FAERS: 1 | US FAERS | |
| 1272 | Sensory integrative dysfunction | FAERS: 1 | US FAERS | |
| 1273 | Septic Shock | FAERS: 1 | US FAERS | |
| 1274 | Sexual activity increased | FAERS: 1 | US FAERS | |
| 1275 | Shoulder Dystocia | FAERS: 1 | US FAERS | |
| 1276 | Shoulder Pain | FAERS: 1 | US FAERS | |
| 1277 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 1278 | Skin hypoplasia | FAERS: 1 | US FAERS | |
| 1279 | Skin reaction | FAERS: 1 | US FAERS | |
| 1280 | Sleep-related eating disorder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1281 | Sperm concentration decreased | FAERS: 1 | US FAERS | |
| 1282 | Sperm count decreased | FAERS: 1 | US FAERS | |
| 1283 | Spermatozoa morphology abnormal | FAERS: 1 | US FAERS | |
| 1284 | Spermatozoa progressive motility decreased | FAERS: 1 | US FAERS | |
| 1285 | Spina Bifida | FAERS: 1 | US FAERS | |
| 1286 | Spinal column injury | FAERS: 1 | US FAERS | |
| 1287 | Splinter | FAERS: 1 | US FAERS | |
| 1288 | Spondylitis | FAERS: 1 | US FAERS | |
| 1289 | Staring | FAERS: 1 | US FAERS | |
| 1290 | Stenotrophomonas infection | FAERS: 1 | US FAERS | |
| 1291 | Stoma obstruction | FAERS: 1 | US FAERS | |
| 1292 | Stubbornness | FAERS: 1 | US FAERS | |
| 1293 | Subileus | FAERS: 1 | US FAERS | |
| 1294 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 1295 | Sunburn | FAERS: 1 | US FAERS | |
| 1296 | Superinfection lung | FAERS: 1 | US FAERS | |
| 1297 | Surgical failure | FAERS: 1 | US FAERS | |
| 1298 | Syndactyly | FAERS: 1 | US FAERS | |
| 1299 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 1300 | Teeth brittle | FAERS: 1 | US FAERS | |
| 1301 | Therapeutic product effect decreased | FAERS: 1 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 1302 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 1303 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 1304 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 1305 | Thoracic Outlet Syndrome | FAERS: 1 | US FAERS | |
| 1306 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 1307 | Thought withdrawal | FAERS: 1 | US FAERS | |
| 1308 | Throat cancer | FAERS: 1 | US FAERS | |
| 1309 | Thromboangiitis Obliterans | FAERS: 1 | US FAERS | |
| 1310 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 1311 | Thyroiditis | FAERS: 1 | US FAERS | |
| 1312 | Tongue exfoliation | FAERS: 1 | US FAERS | |
| 1313 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 1314 | Tonsillitis | FAERS: 1 | US FAERS | |
| 1315 | Tooth Infection | FAERS: 1 | US FAERS | |
| 1316 | Torticollis | FAERS: 1 | US FAERS | |
| 1317 | Tracheomalacia | FAERS: 1 | US FAERS | |
| 1318 | Transfusion-Related Acute Lung Injury | FAERS: 1 | US FAERS | |
| 1319 | Transplant | FAERS: 1 | US FAERS | |
| 1320 | Trigeminal Neuralgia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1321 | Troponin I increased | FAERS: 1 | US FAERS | |
| 1322 | Truancy | FAERS: 1 | US FAERS | |
| 1323 | Ulnar Nerve Palsy | FAERS: 1 | US FAERS | |
| 1324 | Urethritis noninfective | FAERS: 1 | US FAERS | |
| 1325 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 1326 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 1327 | Uterine Polyp | FAERS: 1 | US FAERS | |
| 1328 | Uterine contractions during pregnancy | FAERS: 1 | US FAERS | |
| 1329 | VIth nerve paresis | FAERS: 1 | US FAERS | |
| 1330 | Vascular resistance systemic decreased | FAERS: 1 | US FAERS | |
| 1331 | Vascular rupture | FAERS: 1 | US FAERS | |
| 1332 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 1333 | Venous occlusion | FAERS: 1 | US FAERS | |
| 1334 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 1335 | Ventricular enlargement | FAERS: 1 | US FAERS | |
| 1336 | Ventricular internal diameter abnormal | FAERS: 1 | US FAERS | |
| 1337 | Violent ideation | FAERS: 1 | US FAERS | |
| 1338 | Viral myocarditis | FAERS: 1 | US FAERS | |
| 1339 | Viral pericarditis | FAERS: 1 | US FAERS | |
| 1340 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 1341 | Vitamin E Deficiency | FAERS: 1 | US FAERS | |
| 1342 | Vitrectomy | FAERS: 1 | US FAERS | |
| 1343 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 1344 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 1345 | Water Intoxication | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1346 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 1347 | Withdrawal arrhythmia | FAERS: 1 | US FAERS | |
| 1348 | Wound Infection | FAERS: 1 | US FAERS | |
| 1349 | Wound decomposition | FAERS: 1 | US FAERS | |
| 1350 | Zinc deficiency | FAERS: 1 | US FAERS | |
| 1351 | colonoscopy | FAERS: 1 | US FAERS | |
| 1352 | kyphosis | FAERS: 1 | US FAERS | |
| 1353 | pH urine increased | FAERS: 1 | US FAERS | |
| 1354 | skin abrasion | FAERS: 1 | US FAERS | |
| 1355 | Allergic sinusitis | Canada Vigilance: 1 | Canada Vigilance | |
| 1356 | Amenorrhea | 19303910 | CTD | |
| 1357 | Anxiety Disorders | 17284507 | CTD | |
| 1358 | Basal Ganglia Diseases | 10435776 | CTD | |
| 1359 | Chemical and Drug Induced Liver Injury | 10375350 10691596 15930079 | CTD | |
| 1360 | Cocaine-Related Disorders | 10718161 | CTD | |
| 1361 | Confusion | 8888541 11816261 | CTD | |
| 1362 | Depressive disorder |
8700462
10405494 10675082 10718161 10770471 11816261 12586234 12724513 14870959 15367045 15610935 15910521 16239768 16340381 16880481 16974189 17110836 17189754 17191266 17414231 19377026 19996237 20022345 20305041 25423262 | CTD | |
| 1363 | Disorders of Excessive Somnolence | 15699296 | CTD | |
| 1364 | Disruptive, Impulse Control, and Conduct Disorders | 12680750 | CTD | |
| 1365 | Drug Overdose | 9034419 19131198 | CTD | |
| 1366 | Dysthymic Disorder | 17606668 | CTD | |
| 1367 | Excessive eye blinking | Canada Vigilance: 1 | Canada Vigilance | |
| 1368 | Facial paralysis | Canada Vigilance: 2 | Canada Vigilance | |
| 1369 | Female Orgasmic Disorder | Canada Vigilance: 1 | Canada Vigilance | |
| 1370 | Fever | 8700462 8888541 11816261 | CTD | |
| 1371 | Galactorrhea-Hyperprolactinemia | 17606668 | CTD | |
| 1372 | Galactorrhea | 19303910 | CTD | |
| 1373 | Hallucinations | 18303146 | CTD | |
| 1374 | Heart failure | 12663337 | CTD | |
| 1375 | Hyperalgesia | 12865165 | CTD | |
| 1376 | Hyperkinesia | Canada Vigilance: 1 | Canada Vigilance | |
| 1377 | Hyperprolactinemia | 19303910 | CTD | |
| 1378 | Hypogeusia | Canada Vigilance: 1 | Canada Vigilance | |
| 1379 | Hyponatremia | 17189754 | CTD | |
| 1380 | Illogical thinking | Canada Vigilance: 1 | Canada Vigilance | |
| 1381 | Intestinal Fistula | Canada Vigilance: 1 | Canada Vigilance | |
| 1382 | Intestinal transit time abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 1383 | Lactose Intolerance | Canada Vigilance: 1 | Canada Vigilance | |
| 1384 | Liver Failure, Acute | 19857765 | CTD | |
| 1385 | Lymphoma | Canada Vigilance: 1 | Canada Vigilance | |
| 1386 | Mental disorders | 16856516 | CTD | |
| 1387 | Migraine Disorders | 9674820 18803445 | CTD | |
| 1388 | Mood Disorders | 15610935 | CTD | |
| 1389 | Motor Disorders | 25423262 | CTD | |
| 1390 | Movement Disorders | 11816261 | CTD | |
| 1391 | Neonatal respiratory distress | Canada Vigilance: 5 | Canada Vigilance | |
| 1392 | Nephritis, Interstitial | 10513719 | CTD | |
| 1393 | Neurobehavioral Manifestations | 10367559 | CTD | |
| 1394 | Neurotoxicity Syndromes | 12187335 | CTD | |
| 1395 | Oliguria | Canada Vigilance: 1 | Canada Vigilance | |
| 1396 | Oral mucosal eruption | Canada Vigilance: 1 | Canada Vigilance | |
| 1397 | Paresthesia | 12187335 | CTD | |
| 1398 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 1399 | Product administration error | Canada Vigilance: 1 | Canada Vigilance | |
| 1400 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 1401 | Product tampering | Canada Vigilance: 1 | Canada Vigilance | |
| 1402 | Psychomotor Agitation | 18303146 | CTD | |
| 1403 | Psychoses, Substance-Induced | 11949740 | CTD | |
| 1404 | Seizures | CTD | ||
| 1405 | Sialorrhea | 8888541 | CTD | |
| 1406 | Sleep Bruxism | 11157444 | CTD | |
| 1407 | Sleep Initiation and Maintenance Disorders | 15699296 | CTD | |
| 1408 | Substance Withdrawal Syndrome | CTD | ||
| 1409 | Tobacco Use Disorder | 16366758 | CTD | |
| 1410 | Vasculitic rash | Canada Vigilance: 1 | Canada Vigilance | |
| 1411 | Xerostomia | 15699296 17606668 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.