MetaADEDB: Drug

MetaADEDB 2.0 @ LMMD

Phenytoin

(CXOFVDLJLONNDW-UHFFFAOYSA-N)

Structure

SMILES: O=C1NC(=O)NC1(c1ccccc1)c1ccccc1
Type(s): Approved; Vet_approved
ATC code(s): N03AB02; N03AB52
Molecular Formula:: C15H12N2O2
Molecular Weight:: 252.268
Log P:: 2.4272
Hydrogen Bond Acceptor:: 4
Hydrogen Bond Donor:: 2
TPSA:: 58.2
CAS Number(s):: 57-41-0; 630-93-3

Synonym(s)

Phenytoin

Diphenylhydantoin

Fenitoin

5,5-Diphenylhydantoin

5,5-diphenylimidazolidine-2,4-dione

Antisacer

Difenin

Dihydan

Dilantin

10.

Epamin

11.

Epanutin

12.

Hydantol

13.

Phenytoin Sodium

14.

Sodium Diphenylhydantoinate

15.

Diphenylhydantoinate, Sodium

External Link(s)

MeSH	D010672
PubChem Compound	146015336 1775
BindingDB	50003655 50101816
ChEBI	8107
CHEMBL	CHEMBL16
DrugBank	DB00252
DrugCentral	2152
IUPHAR/BPS Guide to PHARMACOLOGY	2624
KEGG	cpd:C07443 dr:D00512
Therapeutic Target Database	D0E4DW
ZINC	2510358

Adverse Drug Event(s)

	Name	Number of Reports	Reference(s)	Data Source
1	Stevens-Johnson Syndrome	FAERS: 745 Canada Vigilance: 10	View details 6693586 6773400 7283297 20235791 25099164 25811541	CTD OFFSIDES SIDER Canada Vigilance US FAERS
2	Drug ineffective	FAERS: 347 Canada Vigilance: 16		Canada Vigilance US FAERS
3	Toxicity to various agents	FAERS: 274 Canada Vigilance: 7		Canada Vigilance US FAERS
4	Pharmaceutical product complaint	FAERS: 258		US FAERS
5	Dizziness	FAERS: 226 Canada Vigilance: 19	View details 4293820 4329415 5681159 6081207 8369243	CTD OFFSIDES SIDER Canada Vigilance US FAERS
6	Anticonvulsant drug level increased	FAERS: 195 Canada Vigilance: 6		Canada Vigilance OFFSIDES US FAERS
7	Anticonvulsant drug level decreased	FAERS: 139 Canada Vigilance: 5		Canada Vigilance OFFSIDES US FAERS
8	Toxic Epidermal Necrolysis	FAERS: 133 Canada Vigilance: 3		Canada Vigilance SIDER US FAERS
9	Drug toxicity	FAERS: 125		OFFSIDES US FAERS
10	Nystagmus	FAERS: 123 Canada Vigilance: 14		Canada Vigilance OFFSIDES SIDER US FAERS
11	Headache	FAERS: 122 Canada Vigilance: 14	3951721 4124437 5681159	CTD SIDER Canada Vigilance US FAERS
12	Malaise	FAERS: 119 Canada Vigilance: 6		Canada Vigilance SIDER US FAERS
13	Somnolence	FAERS: 118 Canada Vigilance: 12		Canada Vigilance SIDER US FAERS
14	Ataxia	FAERS: 116 Canada Vigilance: 32	View details 49733 109744 188784 453362 1147459 1154062 1602320 2578677 4124437 4151655 4153421 4293820 4406897 4414729 4479423 4734509 4816871 4996854 5363343 5440585 5681159 5818377 6062284 6496340 7340137 7405844 8419804 9658485 11738929 12196060	CTD OFFSIDES SIDER Canada Vigilance US FAERS
15	Tremor	FAERS: 114 Canada Vigilance: 2	View details 973155 3929313 4075309 4235182 6539921 6614878 7370605 7396317 11837377	CTD SIDER Canada Vigilance US FAERS
16	Feeling abnormal	FAERS: 112 Canada Vigilance: 6		Canada Vigilance OFFSIDES SIDER US FAERS
17	Nausea	FAERS: 112 Canada Vigilance: 11	View details 1098684 1147459 6081207 7396317 8369243 9658485	CTD SIDER Canada Vigilance US FAERS
18	Drug level decreased	FAERS: 99 Canada Vigilance: 16		Canada Vigilance US FAERS
19	Overdose	FAERS: 95 Canada Vigilance: 4		Canada Vigilance US FAERS
20	Vomiting	FAERS: 92 Canada Vigilance: 18	View details 1098684 1154062 4996854 5681159 6081207 7396317	CTD SIDER Canada Vigilance US FAERS
21	Therapeutic response unexpected with drug substitution	FAERS: 86		US FAERS
22	Asthenia	FAERS: 80 Canada Vigilance: 6		Canada Vigilance SIDER US FAERS
23	Pruritus	FAERS: 79 Canada Vigilance: 24	3677571	CTD SIDER Canada Vigilance US FAERS
24	Product substitution issue	FAERS: 76 Canada Vigilance: 5		Canada Vigilance US FAERS
25	Mental status changes	FAERS: 72		OFFSIDES US FAERS
26	Anticonvulsant drug level below therapeutic	FAERS: 67 Canada Vigilance: 2		Canada Vigilance OFFSIDES US FAERS
27	Fatigue	FAERS: 66 Canada Vigilance: 2	2530246	CTD OFFSIDES SIDER Canada Vigilance US FAERS
28	Dysarthria	FAERS: 65 Canada Vigilance: 2	View details 49733 1154062 4235182 4414729 4816871 7396317 9658485 11442446 12196060	CTD SIDER Canada Vigilance US FAERS
29	Pain	FAERS: 63 Canada Vigilance: 3	View details 1098684 6823029 8159601 9781525 11108512 11580764 15215642 17451091	CTD Canada Vigilance US FAERS
30	Drug level increased	FAERS: 62 Canada Vigilance: 19		Canada Vigilance US FAERS
31	Hypersensitivity	FAERS: 62 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
32	Lethargy	FAERS: 62 Canada Vigilance: 7	View details 3994321 4734509 7057304 7396317 12196060 14978727	CTD Canada Vigilance US FAERS
33	Anxiety	FAERS: 58 Canada Vigilance: 1		Canada Vigilance US FAERS
34	Anticonvulsant drug level above therapeutic	FAERS: 56		US FAERS
35	Drug level below therapeutic	FAERS: 53 Canada Vigilance: 1		Canada Vigilance US FAERS
36	Urticaria	FAERS: 53 Canada Vigilance: 9		Canada Vigilance SIDER US FAERS
37	Lymphadenopathy	FAERS: 50 Canada Vigilance: 4		Canada Vigilance SIDER US FAERS
38	Memory impairment	FAERS: 50 Canada Vigilance: 3		Canada Vigilance US FAERS
39	Weight decreased	FAERS: 49 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
40	Erythema Multiforme	FAERS: 48 Canada Vigilance: 1	4044332	CTD SIDER Canada Vigilance US FAERS
41	Product quality issue	FAERS: 46		US FAERS
42	Drug level fluctuating	FAERS: 45 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
43	Medication Error	FAERS: 45 Canada Vigilance: 1		Canada Vigilance US FAERS
44	Cerebrovascular accident	FAERS: 44 Canada Vigilance: 2		Canada Vigilance US FAERS
45	Epilepsy	FAERS: 44 Canada Vigilance: 1	View details 176326 188784 403743 724040 821787 1115018 1147459 1246508 1339187 1486836 1644161 1811369 1893664 2289480 2716074 2995024 2998143 3110642 3118226 3142761 3374014 3381246 3579660 3709557 3978571 4128012 4169978 4212019 4235182 4365396 4450153 4734509 4836373 5354845 5472247 5694319 5785298 6122135 6264351 6274215 6288881 6313322 6414095 6415639 6588711 6705322 6830189 7099337 7292204 7294224 7343457 7651448 7715759 7813412 7881227 7910365 8162374 8191881 8444328 8816215 8848816 9003978 9153479 9433424 9627208 9658485 9796746 10219285 10691121 10798073 10838112 10940574 11434505 12823472 12940655 14642999 15491979 15842559 16315636 18281195 18505998 18620500 18725594 19369666 19439856 20417680 23986454 24493665 25099164 25745819	CTD OFFSIDES Canada Vigilance US FAERS
46	Eosinophilia	FAERS: 41 Canada Vigilance: 2	View details 574201 3156084 7280771 10698845 15229826	CTD SIDER Canada Vigilance US FAERS
47	nervous system disorder	FAERS: 41		SIDER US FAERS
48	Hypotension	FAERS: 40 Canada Vigilance: 3	View details 567761 637689 2394103 3361443 3370103 6068646 6823029 7092614 7412270 8768165 10407528 10914260 11240605 19439856	CTD SIDER Canada Vigilance US FAERS
49	Amnesia	FAERS: 38 Canada Vigilance: 1	561405	CTD OFFSIDES SIDER Canada Vigilance US FAERS
50	Depressed Level of Consciousness	FAERS: 37 Canada Vigilance: 1		Canada Vigilance OFFSIDES SIDER US FAERS
51	Hepatitis	FAERS: 37 Canada Vigilance: 3	View details 1147459 1937386 8521225 15229826	CTD Canada Vigilance US FAERS
52	Drug exposure during pregnancy	FAERS: 36		OFFSIDES US FAERS
53	Drug level changed	FAERS: 36 Canada Vigilance: 1		Canada Vigilance US FAERS
54	Activities of daily living impaired	FAERS: 34		US FAERS
55	Pneumonia	FAERS: 34		SIDER US FAERS
56	Tooth Loss	FAERS: 34 Canada Vigilance: 1		Canada Vigilance US FAERS
57	Burning sensation	FAERS: 33 Canada Vigilance: 2		Canada Vigilance US FAERS
58	Diplopia	FAERS: 33 Canada Vigilance: 9	View details 49733 109744 405624 1602320 2578677 4235182 5681159 6035961 6081207 7396317 19302663	CTD OFFSIDES SIDER Canada Vigilance US FAERS
59	Nervousness	FAERS: 32 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
60	Anticonvulsant drug level abnormal	FAERS: 31 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
61	Sepsis	FAERS: 31		SIDER US FAERS
62	Disorientation	FAERS: 29 Canada Vigilance: 2		Canada Vigilance US FAERS
63	Alanine Aminotransferase Increased	FAERS: 28 Canada Vigilance: 2		Canada Vigilance US FAERS
64	Blindness	FAERS: 28		US FAERS
65	Drug dispensing error	FAERS: 28		OFFSIDES US FAERS
66	Osteoporosis	FAERS: 28		OFFSIDES SIDER US FAERS
67	Arthralgia	FAERS: 27 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
68	Maternal exposure during pregnancy	FAERS: 27		US FAERS
69	Agitation	FAERS: 26 Canada Vigilance: 6		Canada Vigilance SIDER US FAERS
70	Aura	FAERS: 26		OFFSIDES US FAERS
71	Constipation	FAERS: 26		SIDER US FAERS
72	Impaired driving ability	FAERS: 26		US FAERS
73	Myocardial Infarction	FAERS: 26		US FAERS
74	Drug level above therapeutic	FAERS: 25		US FAERS
75	Incorrect dose administered	FAERS: 25		OFFSIDES US FAERS
76	Status Epilepticus	FAERS: 25	View details 976216 1563202 3219679 3559817 3582562 4043136 6050800 7813146 8672829 10084426 10691107 10897162 11605780 12200221 12593465 17961958 19500289 20672505 20851280	CTD OFFSIDES US FAERS
77	Aphasia	FAERS: 24 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
78	Aspartate Aminotransferase Increased	FAERS: 24 Canada Vigilance: 3		Canada Vigilance US FAERS
79	Erythema	FAERS: 24 Canada Vigilance: 14	1036571	CTD Canada Vigilance US FAERS
80	Impaired work ability	FAERS: 24		US FAERS
81	Respiratory Failure	FAERS: 24		US FAERS
82	Chest Pain	FAERS: 23 Canada Vigilance: 1		Canada Vigilance OFFSIDES SIDER US FAERS
83	Purple glove syndrome	FAERS: 23 Canada Vigilance: 3		Canada Vigilance SIDER US FAERS
84	Abasia	FAERS: 22		US FAERS
85	Intentional product misuse	FAERS: 22		US FAERS
86	Nasopharyngitis	FAERS: 22 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
87	Cardiac Arrest	FAERS: 21		SIDER US FAERS
88	Cerebellar Ataxia	FAERS: 21 Canada Vigilance: 1	View details 4022349 4235182 4329415 4342796 6504331 7464334 7611955 10367328 10655531 11442446 17075669	CTD Canada Vigilance US FAERS
89	Dysgeusia	FAERS: 21 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
90	Blood albumin decreased	FAERS: 20 Canada Vigilance: 2		Canada Vigilance US FAERS
91	Emotional disorder	FAERS: 20		US FAERS
92	Stress	FAERS: 20		OFFSIDES US FAERS
93	Urinary Incontinence	FAERS: 20 Canada Vigilance: 1	4032590 5681159	CTD SIDER Canada Vigilance US FAERS
94	Diabetes Mellitus	FAERS: 19		US FAERS
95	Rash erythematous	FAERS: 19 Canada Vigilance: 23		Canada Vigilance US FAERS
96	Urinary tract infection	FAERS: 19		US FAERS
97	Blood glucose increased	FAERS: 18		US FAERS
98	Bradycardia	FAERS: 18 Canada Vigilance: 1	View details 731879 1098684 3370103 6068646 7057304 7361796 10407528 11240605 11283972 15803967 17049862 19439856	CTD SIDER Canada Vigilance US FAERS
99	Skin reaction	FAERS: 18 Canada Vigilance: 1		Canada Vigilance US FAERS
100	Swelling	FAERS: 18		US FAERS
101	Syncope	FAERS: 18		SIDER US FAERS
102	jaundice	FAERS: 18 Canada Vigilance: 3	842535 1678417	CTD Canada Vigilance US FAERS
103	Conjunctivitis	FAERS: 17 Canada Vigilance: 4		Canada Vigilance SIDER US FAERS
104	Dehydration	FAERS: 17		SIDER US FAERS
105	Abdominal discomfort	FAERS: 16 Canada Vigilance: 2		Canada Vigilance US FAERS
106	Blood cholesterol increased	FAERS: 16		US FAERS
107	Hypersomnia	FAERS: 16 Canada Vigilance: 1		Canada Vigilance US FAERS
108	No adverse event	FAERS: 16 Canada Vigilance: 1		Canada Vigilance US FAERS
109	Vertigo	FAERS: 16 Canada Vigilance: 5	1098684 1602320 7396317	CTD SIDER Canada Vigilance US FAERS
110	Abdominal Pain	FAERS: 15 Canada Vigilance: 2	1147459 1154062 6081207	CTD Canada Vigilance US FAERS
111	Disease recurrence	FAERS: 15		OFFSIDES US FAERS
112	Gingival Hyperplasia	FAERS: 15	View details 1246508 3142761 6035961 6773400 8369003 9029455 10655531	CTD SIDER US FAERS
113	Gingival Hypertrophy	FAERS: 15 Canada Vigilance: 8	View details 190707 817892 1147459 3951721 4293820 4329415 4996854	CTD Canada Vigilance US FAERS
114	Lip swelling	FAERS: 15 Canada Vigilance: 1		Canada Vigilance US FAERS
115	Accidental exposure to product by child	FAERS: 14		US FAERS
116	Accidental overdose	FAERS: 14 Canada Vigilance: 2		Canada Vigilance US FAERS
117	Alopecia	FAERS: 14		US FAERS
118	Drug dose omission	FAERS: 14		US FAERS
119	Drug prescribing error	FAERS: 14		OFFSIDES US FAERS
120	Emotional distress	FAERS: 14		US FAERS
121	Palpitations	FAERS: 14		SIDER US FAERS
122	Thrombosis	FAERS: 14		US FAERS
123	Tinnitus	FAERS: 14 Canada Vigilance: 4	6062284 8369243	CTD SIDER Canada Vigilance US FAERS
124	Altered state of consciousness	FAERS: 13		OFFSIDES US FAERS
125	Anorexia	FAERS: 13	4153421 6081207	CTD SIDER US FAERS
126	Craniofacial deformity	FAERS: 13		US FAERS
127	Gamma-Glutamyltransferase Increased	FAERS: 13 Canada Vigilance: 5		Canada Vigilance US FAERS
128	Hepatomegaly	FAERS: 13 Canada Vigilance: 1	1644161 3677571 28108177	CTD Canada Vigilance US FAERS
129	Leukopenia	FAERS: 13 Canada Vigilance: 4	1147459	CTD SIDER Canada Vigilance US FAERS
130	Product taste abnormal	FAERS: 13 Canada Vigilance: 2		Canada Vigilance US FAERS
131	Respiratory arrest	FAERS: 13		US FAERS
132	Respiratory distress	FAERS: 13		US FAERS
133	Tachycardia	FAERS: 13 Canada Vigilance: 1	6047829 12915082	CTD SIDER Canada Vigilance US FAERS
134	Thrombocytopenia	FAERS: 13 Canada Vigilance: 1	1147459 9855327	CTD SIDER Canada Vigilance US FAERS
135	Vitamin D Deficiency	FAERS: 13	20683115	CTD US FAERS
136	Anticonvulsant toxicity	FAERS: 12		US FAERS
137	Cerebral atrophy	FAERS: 12		US FAERS
138	Drug screen positive	FAERS: 12		OFFSIDES US FAERS
139	General physical health deterioration	FAERS: 12		US FAERS
140	Intentional drug misuse	FAERS: 12		US FAERS
141	Poor quality drug administered	FAERS: 12		US FAERS
142	Stomatitis	FAERS: 12 Canada Vigilance: 1	7439205	CTD Canada Vigilance US FAERS
143	Unevaluable event	FAERS: 12		US FAERS
144	Angioedema	FAERS: 11 Canada Vigilance: 3	6071477	CTD OFFSIDES Canada Vigilance US FAERS
145	Drug effect incomplete	FAERS: 11		US FAERS
146	Drug screen false positive	FAERS: 11		US FAERS
147	Drug withdrawal syndrome	FAERS: 11 Canada Vigilance: 1		Canada Vigilance US FAERS
148	Dry skin	FAERS: 11		US FAERS
149	Gangrene	FAERS: 11		US FAERS
150	Limb injury	FAERS: 11		US FAERS
151	Myalgia	FAERS: 11 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
152	Mydriasis	FAERS: 11		SIDER US FAERS
153	Oropharyngeal pain	FAERS: 11		US FAERS
154	Pancytopenia	FAERS: 11 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
155	Product use in unapproved indication	FAERS: 11		US FAERS
156	Unresponsive to stimuli	FAERS: 11 Canada Vigilance: 2		Canada Vigilance US FAERS
157	Wrong technique in drug usage process	FAERS: 11		US FAERS
158	Arthropathy	FAERS: 10 Canada Vigilance: 1		Canada Vigilance US FAERS
159	Back disorder	FAERS: 10		US FAERS
160	Choking	FAERS: 10		US FAERS
161	Drug Dependence	FAERS: 10		US FAERS
162	Epistaxis	FAERS: 10 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
163	Hepatosplenomegaly	FAERS: 10		US FAERS
164	Influenza	FAERS: 10		SIDER US FAERS
165	Myocarditis	FAERS: 10	3421797 8965113	CTD US FAERS
166	Neurological decompensation	FAERS: 10		US FAERS
167	Product use issue	FAERS: 10		US FAERS
168	Rhabdomyolysis	FAERS: 10 Canada Vigilance: 1	2752702	CTD Canada Vigilance US FAERS
169	Anger	FAERS: 9 Canada Vigilance: 1		Canada Vigilance US FAERS
170	Asthma	FAERS: 9		SIDER US FAERS
171	Back Pain	FAERS: 9		SIDER US FAERS
172	Completed Suicide	FAERS: 9 Canada Vigilance: 1		Canada Vigilance US FAERS
173	Dementia	FAERS: 9 Canada Vigilance: 2	9469697	CTD Canada Vigilance US FAERS
174	Dental caries	FAERS: 9		OFFSIDES US FAERS
175	Economic problem	FAERS: 9		US FAERS
176	Infection	FAERS: 9 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
177	Intentional product use issue	FAERS: 9 Canada Vigilance: 2		Canada Vigilance US FAERS
178	Leukocytosis	FAERS: 9 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
179	Mood swings	FAERS: 9		SIDER US FAERS
180	Neutropenia	FAERS: 9 Canada Vigilance: 1	9855327	CTD Canada Vigilance US FAERS
181	Poisoning	FAERS: 9	22634333	CTD US FAERS
182	Symblepharon	FAERS: 9 Canada Vigilance: 1		Canada Vigilance US FAERS
183	Visual Impairment	FAERS: 9 Canada Vigilance: 2		Canada Vigilance US FAERS
184	Agranulocytosis	FAERS: 8 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
185	Apparent death	FAERS: 8		US FAERS
186	Blood alkaline phosphatase increased	FAERS: 8 Canada Vigilance: 5		Canada Vigilance US FAERS
187	Blood triglycerides increased	FAERS: 8		US FAERS
188	Crying	FAERS: 8		US FAERS
189	Deafness	FAERS: 8		SIDER US FAERS
190	Dysphonia	FAERS: 8		OFFSIDES US FAERS
191	Gingivitis	FAERS: 8 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
192	Hepatotoxicity	FAERS: 8		SIDER US FAERS
193	Hyporeflexia	FAERS: 8 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
194	Hypoxia	FAERS: 8		US FAERS
195	Laceration	FAERS: 8		US FAERS
196	Peripheral swelling	FAERS: 8 Canada Vigilance: 1		Canada Vigilance US FAERS
197	Skin lesion	FAERS: 8		OFFSIDES US FAERS
198	Stupor	FAERS: 8 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
199	Therapeutic response unexpected	FAERS: 8 Canada Vigilance: 1		Canada Vigilance US FAERS
200	Thermal burn	FAERS: 8		US FAERS
201	Vasculitis	FAERS: 8		US FAERS
202	Anhedonia	FAERS: 7		OFFSIDES US FAERS
203	Arthritis	FAERS: 7 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
204	Barbiturates positive	FAERS: 7		US FAERS
205	Blood cholesterol abnormal	FAERS: 7		US FAERS
206	Cellulitis	FAERS: 7		US FAERS
207	Delirium	FAERS: 7 Canada Vigilance: 1	View details 1154062 6625283 6795246 17242593 17600176	CTD SIDER Canada Vigilance US FAERS
208	Depressed mood	FAERS: 7		OFFSIDES US FAERS
209	Dermatitis	FAERS: 7 Canada Vigilance: 5		Canada Vigilance SIDER US FAERS
210	Disease Progression	FAERS: 7 Canada Vigilance: 1		Canada Vigilance US FAERS
211	Dysgraphia	FAERS: 7		US FAERS
212	Dyspepsia	FAERS: 7		SIDER US FAERS
213	Dystonia	FAERS: 7	View details 944401 1011032 6439583 6614878 7813146	CTD US FAERS
214	Epileptic aura	FAERS: 7 Canada Vigilance: 1		Canada Vigilance US FAERS
215	Eye pain	FAERS: 7		SIDER US FAERS
216	Granulomatous liver disease	FAERS: 7		US FAERS
217	Hyperreflexia	FAERS: 7		SIDER US FAERS
218	Inappropriate schedule of drug administration	FAERS: 7		US FAERS
219	Loose tooth	FAERS: 7		US FAERS
220	Malabsorption	FAERS: 7		US FAERS
221	Necrosis	FAERS: 7	9796746	CTD SIDER US FAERS
222	Nerve injury	FAERS: 7		US FAERS
223	Poor quality sleep	FAERS: 7		US FAERS
224	Pregnancy	FAERS: 7		US FAERS
225	Prescribed overdose	FAERS: 7		US FAERS
226	Product dispensing error	FAERS: 7		US FAERS
227	Skin Ulcer	FAERS: 7	19596627	CTD US FAERS
228	Staring	FAERS: 7		US FAERS
229	Throat irritation	FAERS: 7		US FAERS
230	Transaminases increased	FAERS: 7		US FAERS
231	Wrong drug administered	FAERS: 7		US FAERS
232	Anaphylactic shock	FAERS: 6		SIDER US FAERS
233	Ankle Fracture	FAERS: 6		US FAERS
234	Blood sodium decreased	FAERS: 6		US FAERS
235	Chemical injury	FAERS: 6		US FAERS
236	Chest discomfort	FAERS: 6		SIDER US FAERS
237	Chills	FAERS: 6 Canada Vigilance: 3		Canada Vigilance SIDER US FAERS
238	Chorea	FAERS: 6	View details 239101 403743 495042 643025 932884 944401 1011032 2084667 2221636 2278444 3118226 3381246 3559817 4151655 4414729 4479423 4846140 6442766 6646926 7292204 7396317 8771085 9120230 10450338 11792164	CTD SIDER US FAERS
239	Drug administration error	FAERS: 6		US FAERS
240	Gingival Recession	FAERS: 6		US FAERS
241	Hemiparesis	FAERS: 6 Canada Vigilance: 1		Canada Vigilance US FAERS
242	Hepatic necrosis	FAERS: 6		US FAERS
243	Hypothyroidism	FAERS: 6 Canada Vigilance: 2	598297 852418	CTD Canada Vigilance US FAERS
244	Inappropriate affect	FAERS: 6		US FAERS
245	Limb discomfort	FAERS: 6		US FAERS
246	Musculoskeletal stiffness	FAERS: 6 Canada Vigilance: 1		Canada Vigilance US FAERS
247	No adverse effect	FAERS: 6		US FAERS
248	Oral pain	FAERS: 6		US FAERS
249	Product dose omission	FAERS: 6 Canada Vigilance: 1		Canada Vigilance US FAERS
250	Product label confusion	FAERS: 6		US FAERS
251	Product physical issue	FAERS: 6		US FAERS
252	Pulmonary vasculitis	FAERS: 6		US FAERS
253	Restlessness	FAERS: 6 Canada Vigilance: 1		Canada Vigilance US FAERS
254	Traumatic Brain Injury	FAERS: 6		US FAERS
255	Ulcer	FAERS: 6 Canada Vigilance: 1		Canada Vigilance US FAERS
256	White blood cell count decreased	FAERS: 6		US FAERS
257	treatment failure	FAERS: 6		US FAERS
258	Bedridden	FAERS: 5		OFFSIDES US FAERS
259	Blood count abnormal	FAERS: 5		US FAERS
260	Choreoathetosis	FAERS: 5 Canada Vigilance: 1		Canada Vigilance US FAERS
261	Compulsive lip biting	FAERS: 5		US FAERS
262	Corneal Infection	FAERS: 5		US FAERS
263	Deep Vein Thrombosis	FAERS: 5		US FAERS
264	Encephalitis	FAERS: 5 Canada Vigilance: 1		Canada Vigilance OFFSIDES SIDER US FAERS
265	Euphoric mood	FAERS: 5 Canada Vigilance: 1		Canada Vigilance US FAERS
266	Expired drug administered	FAERS: 5		US FAERS
267	Frustration	FAERS: 5		US FAERS
268	Incontinence	FAERS: 5		US FAERS
269	Injection site extravasation	FAERS: 5		US FAERS
270	Intestinal Obstruction	FAERS: 5		OFFSIDES US FAERS
271	Joint injury	FAERS: 5		US FAERS
272	Lactose Intolerance	FAERS: 5		US FAERS
273	Lupus-like syndrome	FAERS: 5		US FAERS
274	Mental impairment	FAERS: 5		OFFSIDES US FAERS
275	Pharyngolaryngeal Pain	FAERS: 5		US FAERS
276	Photophobia	FAERS: 5 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
277	Sinusitis	FAERS: 5		SIDER US FAERS
278	Therapy change	FAERS: 5		US FAERS
279	Therapy non-responder	FAERS: 5		US FAERS
280	Visual disturbance	FAERS: 5		US FAERS
281	Wheezing	FAERS: 5		US FAERS
282	Adverse event	FAERS: 4		OFFSIDES US FAERS
283	Asterixis	FAERS: 4		SIDER US FAERS
284	Blood creatine phosphokinase increased	FAERS: 4		OFFSIDES US FAERS
285	Blood testosterone increased	FAERS: 4		US FAERS
286	Central nervous system lesion	FAERS: 4		US FAERS
287	Cholestasis	FAERS: 4 Canada Vigilance: 1	View details 132924 842535 4257821 8521225 12630649	CTD Canada Vigilance US FAERS
288	Clumsiness	FAERS: 4		US FAERS
289	Cystitis	FAERS: 4		US FAERS
290	Depression suicidal	FAERS: 4		US FAERS
291	Discomfort	FAERS: 4		SIDER US FAERS
292	Erectile dysfunction	FAERS: 4		US FAERS
293	Excoriation	FAERS: 4		US FAERS
294	Exfoliative rash	FAERS: 4		US FAERS
295	Extravasation	FAERS: 4		SIDER US FAERS
296	Factor VIII Deficiency	FAERS: 4		US FAERS
297	Feeling jittery	FAERS: 4		US FAERS
298	Fibromyalgia	FAERS: 4		US FAERS
299	Gastric ulcer	FAERS: 4		US FAERS
300	Glaucoma	FAERS: 4		US FAERS
301	Hernia	FAERS: 4 Canada Vigilance: 1		Canada Vigilance US FAERS
302	Hypokinesia	FAERS: 4		SIDER US FAERS
303	Hypospadias	FAERS: 4		US FAERS
304	Incorrect drug administration rate	FAERS: 4		OFFSIDES US FAERS
305	Incorrect route of drug administration	FAERS: 4		US FAERS
306	Infusion site erythema	FAERS: 4		US FAERS
307	Lip and/or oral cavity cancer	FAERS: 4		US FAERS
308	Neuralgia	FAERS: 4		US FAERS
309	Obesity	FAERS: 4		US FAERS
310	Osteopenia	FAERS: 4		OFFSIDES US FAERS
311	Pancreatitis	FAERS: 4		US FAERS
312	Pneumonitis	FAERS: 4		US FAERS
313	Poor quality product administered	FAERS: 4		US FAERS
314	Product formulation issue	FAERS: 4		US FAERS
315	Product label issue	FAERS: 4		US FAERS
316	Pseudolymphoma	FAERS: 4 Canada Vigilance: 2	View details 574201 1186408 1419762 8603615 9003978 12752131	CTD SIDER Canada Vigilance US FAERS
317	Purpura	FAERS: 4 Canada Vigilance: 2	7439205	CTD SIDER Canada Vigilance US FAERS
318	Skin laceration	FAERS: 4		OFFSIDES US FAERS
319	Splenomegaly	FAERS: 4 Canada Vigilance: 1	1644161 1678417	CTD Canada Vigilance US FAERS
320	Suicide attempt	FAERS: 4 Canada Vigilance: 1		Canada Vigilance US FAERS
321	Tardive Dyskinesia	FAERS: 4		US FAERS
322	Therapeutic product ineffective	FAERS: 4		US FAERS
323	Thirst	FAERS: 4		US FAERS
324	Tongue biting	FAERS: 4		US FAERS
325	Tooth Erosion	FAERS: 4		US FAERS
326	Urinary Retention	FAERS: 4	606178 7554689	CTD SIDER US FAERS
327	Ventricular Fibrillation	FAERS: 4	2726785 3704313 6071477	CTD OFFSIDES SIDER US FAERS
328	Vitreous floaters	FAERS: 4		US FAERS
329	Abscess	FAERS: 3		US FAERS
330	Accidental exposure to product	FAERS: 3		US FAERS
331	Acute kidney injury	FAERS: 3	View details 465192 574201 857181 1036571	CTD US FAERS
332	Acute respiratory failure	FAERS: 3		US FAERS
333	Ammonia increased	FAERS: 3		US FAERS
334	Anticoagulation drug level above therapeutic	FAERS: 3 Canada Vigilance: 1		Canada Vigilance US FAERS
335	Atrial Fibrillation	FAERS: 3		US FAERS
336	Autoimmune hepatitis	FAERS: 3		US FAERS
337	Bipolar Disorder	FAERS: 3	2372757 2510921 7782488	CTD US FAERS
338	Blood creatinine increased	FAERS: 3		US FAERS
339	Blood lactate dehydrogenase increased	FAERS: 3 Canada Vigilance: 1		Canada Vigilance US FAERS
340	Blood potassium decreased	FAERS: 3		OFFSIDES US FAERS
341	Blood urea increased	FAERS: 3		US FAERS
342	Bone density decreased	FAERS: 3		OFFSIDES US FAERS
343	Brain stem syndrome	FAERS: 3		US FAERS
344	Cardiomegaly	FAERS: 3		SIDER US FAERS
345	Cataract	FAERS: 3		US FAERS
346	Cerebellar cognitive affective syndrome	FAERS: 3		US FAERS
347	Chorioamnionitis	FAERS: 3		US FAERS
348	Circumstance or information capable of leading to medication error	FAERS: 3		OFFSIDES US FAERS
349	Cleft Palate	FAERS: 3	View details 56626 940034 1687470 2227380 2492459 3877104 4441320 6856622 6862529 7946029 10789828 11283972	CTD US FAERS
350	Clonus	FAERS: 3		US FAERS
351	Cold sweat	FAERS: 3		US FAERS
352	Complex partial seizures	FAERS: 3		OFFSIDES US FAERS
353	Corneal Opacity	FAERS: 3		US FAERS
354	Demyelination	FAERS: 3		OFFSIDES US FAERS
355	Drooling	FAERS: 3		US FAERS
356	Drug ineffective for unapproved indication	FAERS: 3		US FAERS
357	Dyslexia	FAERS: 3		US FAERS
358	Dysphasia	FAERS: 3		OFFSIDES US FAERS
359	Dysphemia	FAERS: 3		SIDER US FAERS
360	Dysuria	FAERS: 3		SIDER US FAERS
361	Eczema	FAERS: 3		US FAERS
362	Enuresis	FAERS: 3		US FAERS
363	False positive investigation result	FAERS: 3		US FAERS
364	Flatulence	FAERS: 3		SIDER US FAERS
365	Flushing	FAERS: 3 Canada Vigilance: 1		Canada Vigilance US FAERS
366	Genital rash	FAERS: 3		US FAERS
367	Glomerulonephritis	FAERS: 3	19644425	CTD US FAERS
368	Granuloma	FAERS: 3	19112234	CTD OFFSIDES US FAERS
369	Growth retardation	FAERS: 3		US FAERS
370	Head titubation	FAERS: 3		US FAERS
371	Heat Stroke	FAERS: 3		US FAERS
372	Hydrocephalus	FAERS: 3		US FAERS
373	Hypophagia	FAERS: 3		US FAERS
374	Incoherent	FAERS: 3		OFFSIDES US FAERS
375	Incorrect drug administration duration	FAERS: 3		US FAERS
376	Incorrect drug dosage form administered	FAERS: 3		US FAERS
377	Infusion Site Extravasation	FAERS: 3		US FAERS
378	Joint swelling	FAERS: 3		US FAERS
379	Lipoma	FAERS: 3		US FAERS
380	Lymphadenitis	FAERS: 3		US FAERS
381	Lymphocytosis	FAERS: 3	1678417	CTD US FAERS
382	Macular degeneration	FAERS: 3		US FAERS
383	Markedly reduced dietary intake	FAERS: 3		US FAERS
384	Meningioma	FAERS: 3		OFFSIDES US FAERS
385	Meningitis	FAERS: 3		SIDER US FAERS
386	Muscle Spasticity	FAERS: 3	109744	CTD US FAERS
387	Musculoskeletal Pain	FAERS: 3		US FAERS
388	Musculoskeletal chest pain	FAERS: 3		US FAERS
389	Musculoskeletal discomfort	FAERS: 3		SIDER US FAERS
390	Mutism	FAERS: 3	7816230	CTD US FAERS
391	Neck Pain	FAERS: 3		US FAERS
392	Nephritis	FAERS: 3		US FAERS
393	Nephrolithiasis	FAERS: 3		US FAERS
394	Osteomalacia	FAERS: 3 Canada Vigilance: 2	View details 188784 4148461 6705322 17016548	CTD SIDER Canada Vigilance US FAERS
395	Overlap syndrome	FAERS: 3		US FAERS
396	Pallor	FAERS: 3		US FAERS
397	Panniculitis	FAERS: 3		US FAERS
398	Paranoia	FAERS: 3 Canada Vigilance: 2		Canada Vigilance US FAERS
399	Pericardial effusion	FAERS: 3 Canada Vigilance: 1		Canada Vigilance US FAERS
400	Periodontitis	FAERS: 3		US FAERS
401	Personality Change	FAERS: 3		US FAERS
402	Physical disability	FAERS: 3		US FAERS
403	Post inflammatory pigmentation change	FAERS: 3		US FAERS
404	Post procedural complication	FAERS: 3		US FAERS
405	Prescription drug used without a prescription	FAERS: 3		US FAERS
406	Product measured potency issue	FAERS: 3		US FAERS
407	Product prescribing error	FAERS: 3		US FAERS
408	Product solubility abnormal	FAERS: 3 Canada Vigilance: 1		Canada Vigilance US FAERS
409	Productive Cough	FAERS: 3		US FAERS
410	Psoriasis	FAERS: 3		US FAERS
411	Pulmonary congestion	FAERS: 3		US FAERS
412	Quality of life decreased	FAERS: 3		US FAERS
413	Rheumatoid Arthritis	FAERS: 3		US FAERS
414	Septic Shock	FAERS: 3		US FAERS
415	Simple Partial Seizures	FAERS: 3		US FAERS
416	Supraventricular tachycardia	FAERS: 3		US FAERS
417	Therapeutic response changed	FAERS: 3		US FAERS
418	Throat cancer	FAERS: 3		OFFSIDES US FAERS
419	Toothache	FAERS: 3		US FAERS
420	Tracheitis	FAERS: 3		US FAERS
421	Tuberculosis	FAERS: 3		US FAERS
422	Abdominal tenderness	FAERS: 2		US FAERS
423	Acanthosis	FAERS: 2		US FAERS
424	Accidental exposure	FAERS: 2		US FAERS
425	Acne	FAERS: 2		OFFSIDES US FAERS
426	Altered visual depth perception	FAERS: 2		US FAERS
427	Anal Fissure	FAERS: 2		US FAERS
428	Aneurysm	FAERS: 2		US FAERS
429	Angina Pectoris	FAERS: 2		US FAERS
430	Angiofibroma	FAERS: 2		US FAERS
431	Anoxic Encephalopathy	FAERS: 2		OFFSIDES US FAERS
432	Aphagia	FAERS: 2		US FAERS
433	Aphthous Stomatitis	FAERS: 2		US FAERS
434	Athetosis	FAERS: 2	View details 239101 403743 835515 932884 944401 1247004 2084667 2221636 2278444 3118226 3381246 4151655 4479423 4846140 6442766 6646926 7292204 7396317 10450338	CTD OFFSIDES US FAERS
435	Axonal neuropathy	FAERS: 2		US FAERS
436	Belligerence	FAERS: 2		OFFSIDES US FAERS
437	Biopsy lymph gland abnormal	FAERS: 2		US FAERS
438	Blood albumin	FAERS: 2		US FAERS
439	Blood calcium abnormal	FAERS: 2		US FAERS
440	Blood glucose decreased	FAERS: 2		US FAERS
441	Blood magnesium decreased	FAERS: 2		OFFSIDES US FAERS
442	Blood magnesium increased	FAERS: 2		US FAERS
443	Blood pressure immeasurable	FAERS: 2		US FAERS
444	Body temperature fluctuation	FAERS: 2		US FAERS
445	Bone pain	FAERS: 2		US FAERS
446	Brain Death	FAERS: 2		US FAERS
447	Bronchiolitis	FAERS: 2		US FAERS
448	Bronchitis	FAERS: 2		SIDER US FAERS
449	Bronchopneumonia	FAERS: 2		US FAERS
450	Bronchospasm	FAERS: 2		US FAERS
451	Calcium deficiency	FAERS: 2		US FAERS
452	Cardiac enzymes increased	FAERS: 2		US FAERS
453	Cerebral Amyloid Angiopathy	FAERS: 2		US FAERS
454	Cerebral Infarction	FAERS: 2	9085079	CTD SIDER US FAERS
455	Cerebral Palsy	FAERS: 2		US FAERS
456	Cerebral Thrombosis	FAERS: 2		US FAERS
457	Cerebral disorder	FAERS: 2		US FAERS
458	Chemotherapy	FAERS: 2		US FAERS
459	Cholangitis	FAERS: 2		US FAERS
460	Conjunctival scar	FAERS: 2		US FAERS
461	Contraindicated drug administered	FAERS: 2		US FAERS
462	Corneal Perforation	FAERS: 2		US FAERS
463	Corneal Scar	FAERS: 2		US FAERS
464	Creatinine renal clearance decreased	FAERS: 2		US FAERS
465	Cyanosis	FAERS: 2 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
466	Deformity	FAERS: 2		US FAERS
467	Device Failure	FAERS: 2		US FAERS
468	Device dislocation	FAERS: 2		US FAERS
469	Disability	FAERS: 2		US FAERS
470	Disseminated Intravascular Coagulation	FAERS: 2	1147459 7439205	CTD US FAERS
471	Diverticulum	FAERS: 2		OFFSIDES US FAERS
472	Documented hypersensitivity to administered drug	FAERS: 2		US FAERS
473	Drug abuser	FAERS: 2		US FAERS
474	Drug abuse	FAERS: 2		US FAERS
475	Drug effective for unapproved indication	FAERS: 2		US FAERS
476	Drug label confusion	FAERS: 2		US FAERS
477	Drug-disease interaction	FAERS: 2		US FAERS
478	Dysacusis	FAERS: 2		US FAERS
479	Dyslalia	FAERS: 2		US FAERS
480	Dyslogia	FAERS: 2		US FAERS
481	Early retirement	FAERS: 2		US FAERS
482	Ejection Fraction Decreased	FAERS: 2		US FAERS
483	Electroencephalogram abnormal	FAERS: 2		US FAERS
484	Encephalomalacia	FAERS: 2		US FAERS
485	Epstein-Barr virus antibody positive	FAERS: 2		US FAERS
486	Extra dose administered	FAERS: 2		US FAERS
487	Extremity necrosis	FAERS: 2		US FAERS
488	Eye irritation	FAERS: 2		US FAERS
489	Fear of falling	FAERS: 2		US FAERS
490	Fibrillary glomerulonephritis	FAERS: 2		US FAERS
491	Fluid replacement	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
492	Food craving	FAERS: 2		US FAERS
493	Fracture	FAERS: 2		SIDER US FAERS
494	Full blood count decreased	FAERS: 2		US FAERS
495	Full blood count increased	FAERS: 2		US FAERS
496	Gastrointestinal Pain	FAERS: 2		US FAERS
497	Genital burning sensation	FAERS: 2		US FAERS
498	Glioblastoma	FAERS: 2		US FAERS
499	Gout	FAERS: 2 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
500	Hepatic Encephalopathy	FAERS: 2	View details 814030 1678417 3677571 10915174 21224054	CTD US FAERS
501	Hepatitis C	FAERS: 2		US FAERS
502	Hippus	FAERS: 2		US FAERS
503	Hypertrichosis	FAERS: 2	1147459 6773400	CTD SIDER US FAERS
504	Hypochondriasis	FAERS: 2		US FAERS
505	Idiosyncratic drug reaction	FAERS: 2		US FAERS
506	Ileus	FAERS: 2		SIDER US FAERS
507	Incorrect product storage	FAERS: 2		US FAERS
508	Infection reactivation	FAERS: 2		US FAERS
509	Infusion site reaction	FAERS: 2		US FAERS
510	Injection site movement impairment	FAERS: 2		US FAERS
511	Injection site necrosis	FAERS: 2		US FAERS
512	Intestinal infarction	FAERS: 2		US FAERS
513	Joint Range of Motion Decreased	FAERS: 2		US FAERS
514	Joint stiffness	FAERS: 2		US FAERS
515	Keratoconjunctivitis Sicca	FAERS: 2		US FAERS
516	Laboratory test interference	FAERS: 2		US FAERS
517	Ligament rupture	FAERS: 2		US FAERS
518	Live Birth	FAERS: 2		US FAERS
519	Lymphoma	FAERS: 2 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
520	Macule	FAERS: 2		US FAERS
521	Middle insomnia	FAERS: 2		US FAERS
522	Migraine with Aura	FAERS: 2		US FAERS
523	Moaning	FAERS: 2		US FAERS
524	Mucosal Infection	FAERS: 2		US FAERS
525	Mucosal erosion	FAERS: 2		US FAERS
526	Multi-organ disorder	FAERS: 2		US FAERS
527	Multiple allergies	FAERS: 2		US FAERS
528	Muscle Rigidity	FAERS: 2		US FAERS
529	Myasthenic Syndrome	FAERS: 2		US FAERS
530	Myoclonus	FAERS: 2	View details 3994321 4406897 8704069 8937794 11310291 19448237	CTD SIDER US FAERS
531	Nasal discomfort	FAERS: 2		US FAERS
532	Neuroleptic Malignant Syndrome	FAERS: 2	17156702	CTD US FAERS
533	Neuropathy	FAERS: 2		US FAERS
534	Ophthalmoplegia	FAERS: 2	View details 824568 2638593 2939108 6538026 6695267 15472437	CTD US FAERS
535	Optic Neuritis	FAERS: 2		US FAERS
536	Oral pruritus	FAERS: 2		US FAERS
537	Otitis Media	FAERS: 2		US FAERS
538	Palmar erythema	FAERS: 2		US FAERS
539	Pancreatic carcinoma	FAERS: 2		US FAERS
540	Perivascular dermatitis	FAERS: 2		US FAERS
541	Pharyngitis	FAERS: 2 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
542	Phlebitis	FAERS: 2	8159601	CTD US FAERS
543	Polyarteritis Nodosa	FAERS: 2	6131861	CTD SIDER US FAERS
544	Polyneuropathy	FAERS: 2		SIDER US FAERS
545	Poor peripheral circulation	FAERS: 2		US FAERS
546	Pre-Eclampsia	FAERS: 2	2589455 8369243	CTD US FAERS
547	Pre-existing condition improved	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
548	Product container seal issue	FAERS: 2		US FAERS
549	Product prescribing issue	FAERS: 2		US FAERS
550	Product shape issue	FAERS: 2		US FAERS
551	Product size issue	FAERS: 2		US FAERS
552	Product storage error	FAERS: 2		US FAERS
553	Protein total decreased	FAERS: 2		US FAERS
554	Purulence	FAERS: 2		US FAERS
555	Rash scaly	FAERS: 2		US FAERS
556	Reaction to drug excipients	FAERS: 2		US FAERS
557	Renal cyst	FAERS: 2		US FAERS
558	Respiratory Depression	FAERS: 2		US FAERS
559	Restless Legs Syndrome	FAERS: 2		US FAERS
560	Retching	FAERS: 2		US FAERS
561	Retinal Detachment	FAERS: 2		US FAERS
562	Retinitis Pigmentosa	FAERS: 2		US FAERS
563	Scleritis	FAERS: 2		US FAERS
564	Screaming	FAERS: 2		US FAERS
565	Shock	FAERS: 2		SIDER US FAERS
566	Sinus bradycardia	FAERS: 2		SIDER US FAERS
567	Sinus operation	FAERS: 2		OFFSIDES US FAERS
568	Sneezing	FAERS: 2		US FAERS
569	Soft tissue necrosis	FAERS: 2		US FAERS
570	Spondylolisthesis	FAERS: 2		US FAERS
571	Stillbirth	FAERS: 2		US FAERS
572	Subcutaneous Abscess	FAERS: 2		US FAERS
573	Systemic Inflammatory Response Syndrome	FAERS: 2		US FAERS
574	Teeth brittle	FAERS: 2		US FAERS
575	Therapeutic product effect incomplete	FAERS: 2		US FAERS
576	Thrombocytopenic purpura	FAERS: 2		US FAERS
577	Tonic clonic movements	FAERS: 2		US FAERS
578	Tooth Infection	FAERS: 2		US FAERS
579	Tracheobronchitis	FAERS: 2		US FAERS
580	Trigeminal Neuralgia	FAERS: 2	2027499 14698717	CTD US FAERS
581	VIIth nerve paralysis	FAERS: 2		US FAERS
582	Vagal nerve stimulator implantation	FAERS: 2		US FAERS
583	Venous occlusion	FAERS: 2		US FAERS
584	Wrong technique in product usage process	FAERS: 2		US FAERS
585	oligodendroglioma	FAERS: 2		US FAERS
586	skin abrasion	FAERS: 2		US FAERS
587	Abdominal sepsis	FAERS: 1		US FAERS
588	Abnormal palmar/plantar creases	FAERS: 1		US FAERS
589	Accidental drug intake by child	FAERS: 1		US FAERS
590	Acquired Immunodeficiency Syndrome	FAERS: 1		US FAERS
591	Acute vestibular syndrome	FAERS: 1		US FAERS
592	Administration site extravasation	FAERS: 1		US FAERS
593	Ageusia	FAERS: 1	15563368	CTD SIDER US FAERS
594	Alanine aminotransferase abnormal	FAERS: 1		US FAERS
595	Alcohol abuse	FAERS: 1		US FAERS
596	Alcohol poisoning	FAERS: 1		US FAERS
597	Allergy to arthropod sting	FAERS: 1		US FAERS
598	Allergy to chemicals	FAERS: 1		US FAERS
599	Allodynia	FAERS: 1		US FAERS
600	Amaurosis	FAERS: 1		US FAERS
601	Ammonia abnormal	FAERS: 1		OFFSIDES US FAERS
602	Amnestic Disorder	FAERS: 1		US FAERS
603	Anorexia and bulimia syndrome	FAERS: 1		US FAERS
604	Anti-platelet antibody positive	FAERS: 1		US FAERS
605	Anticonvulsant drug level	FAERS: 1		US FAERS
606	Antidepressant drug level above therapeutic	FAERS: 1		US FAERS
607	Antidepressant drug level below therapeutic	FAERS: 1		US FAERS
608	Antidepressant drug level decreased	FAERS: 1		US FAERS
609	Antiphospholipid Antibodies	FAERS: 1		US FAERS
610	Apallic syndrome	FAERS: 1		US FAERS
611	Apparent life threatening event	FAERS: 1		US FAERS
612	Appendicitis	FAERS: 1		US FAERS
613	Application site swelling	FAERS: 1		US FAERS
614	Arterial thrombosis	FAERS: 1		US FAERS
615	Arteriosclerosis	FAERS: 1		US FAERS
616	Arteritis	FAERS: 1		US FAERS
617	Asbestosis	FAERS: 1		US FAERS
618	Aspartate aminotransferase abnormal	FAERS: 1		US FAERS
619	Aspergillosis	FAERS: 1		US FAERS
620	Atelectasis	FAERS: 1		SIDER US FAERS
621	Atrial Flutter	FAERS: 1	6071476	CTD SIDER US FAERS
622	Auricular swelling	FAERS: 1		US FAERS
623	Autoimmune thyroiditis	FAERS: 1		US FAERS
624	Ballismus	FAERS: 1		US FAERS
625	Bicytopenia	FAERS: 1		OFFSIDES US FAERS
626	Bilirubin conjugated increased	FAERS: 1		US FAERS
627	Biopsy bone marrow abnormal	FAERS: 1		US FAERS
628	Biopsy lung abnormal	FAERS: 1		US FAERS
629	Blebitis	FAERS: 1		US FAERS
630	Blood albumin increased	FAERS: 1		US FAERS
631	Blood alkaline phosphatase abnormal	FAERS: 1		US FAERS
632	Blood arsenic increased	FAERS: 1		US FAERS
633	Blood chloride abnormal	FAERS: 1		US FAERS
634	Blood creatine increased	FAERS: 1		US FAERS
635	Blood folate decreased	FAERS: 1		US FAERS
636	Blood glucose abnormal	FAERS: 1		OFFSIDES US FAERS
637	Blood lactic acid decreased	FAERS: 1		US FAERS
638	Blood magnesium abnormal	FAERS: 1		US FAERS
639	Blood pH decreased	FAERS: 1		US FAERS
640	Blood potassium increased	FAERS: 1		OFFSIDES US FAERS
641	Blood pressure fluctuation	FAERS: 1		US FAERS
642	Blood pressure inadequately controlled	FAERS: 1		US FAERS
643	Blood thyroid stimulating hormone decreased	FAERS: 1		US FAERS
644	Bone fissure	FAERS: 1		US FAERS
645	Bone marrow granuloma	FAERS: 1		US FAERS
646	Bone marrow toxicity	FAERS: 1		US FAERS
647	Bone marrow transplant rejection	FAERS: 1		US FAERS
648	Borrelia test positive	FAERS: 1		US FAERS
649	Bradyphrenia	FAERS: 1		US FAERS
650	Brain Abscess	FAERS: 1		US FAERS
651	Brain scan abnormal	FAERS: 1		US FAERS
652	Breathing-related sleep disorder	FAERS: 1		US FAERS
653	Bronchial secretion retention	FAERS: 1		US FAERS
654	Bronchoalveolar lavage abnormal	FAERS: 1		US FAERS
655	Burkholderia test positive	FAERS: 1		US FAERS
656	Cancer Pain	FAERS: 1		US FAERS
657	Candiduria	FAERS: 1		US FAERS
658	Capillary nail refill test abnormal	FAERS: 1		US FAERS
659	Carbon dioxide abnormal	FAERS: 1		US FAERS
660	Carcinoembryonic antigen increased	FAERS: 1		US FAERS
661	Cardiac perforation	FAERS: 1		US FAERS
662	Carnitine decreased	FAERS: 1		US FAERS
663	Carnitine deficiency	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
664	Carotid Artery Thrombosis	FAERS: 1		US FAERS
665	Carpal Tunnel Syndrome	FAERS: 1		US FAERS
666	Cerebral ventricle dilatation	FAERS: 1		US FAERS
667	Cervix carcinoma	FAERS: 1		US FAERS
668	Cheilitis	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
669	Cheyne-Stokes Respiration	FAERS: 1	5440585	CTD US FAERS
670	Cholangiolitis	FAERS: 1		US FAERS
671	Cholestatic liver injury	FAERS: 1		US FAERS
672	Chromaturia	FAERS: 1		US FAERS
673	Cognitive deterioration	FAERS: 1		US FAERS
674	Colitis	FAERS: 1		US FAERS
675	Compulsive cheek biting	FAERS: 1		US FAERS
676	Congenital cystic kidney disease	FAERS: 1		US FAERS
677	Conjunctival pallor	FAERS: 1		US FAERS
678	Corneal epithelium defect	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
679	Coronary Artery Disease	FAERS: 1		US FAERS
680	Coronary artery reocclusion	FAERS: 1		US FAERS
681	Craniosynostosis	FAERS: 1		US FAERS
682	Cystic Fibrosis	FAERS: 1		US FAERS
683	Cytomegalovirus antibody positive	FAERS: 1		US FAERS
684	Cytomegalovirus gastroenteritis	FAERS: 1		US FAERS
685	Cytomegalovirus gastrointestinal infection	FAERS: 1		US FAERS
686	Cytomegalovirus mucocutaneous ulcer	FAERS: 1		US FAERS
687	Cytomegalovirus test positive	FAERS: 1		US FAERS
688	Decorticate posture	FAERS: 1		US FAERS
689	Delayed Puberty	FAERS: 1		US FAERS
690	Dental Plaque	FAERS: 1		US FAERS
691	Dental discomfort	FAERS: 1		US FAERS
692	Dependence	FAERS: 1		US FAERS
693	Diabetes mellitus inadequate control	FAERS: 1		US FAERS
694	Diverticulitis	FAERS: 1		OFFSIDES US FAERS
695	Dreamy state	FAERS: 1		US FAERS
696	Drowning	FAERS: 1		US FAERS
697	Drug half-life reduced	FAERS: 1		US FAERS
698	Drug level abnormal	FAERS: 1		US FAERS
699	Drug monitoring procedure not performed	FAERS: 1		US FAERS
700	Drug resistance	FAERS: 1		OFFSIDES US FAERS
701	Drug therapy changed	FAERS: 1		US FAERS
702	Dysmorphism	FAERS: 1		US FAERS
703	Dysplasia	FAERS: 1		US FAERS
704	Ecchymosis	FAERS: 1		SIDER US FAERS
705	Educational problem	FAERS: 1		US FAERS
706	Electrocardiogram QT interval abnormal	FAERS: 1		US FAERS
707	Electrocardiogram abnormal	FAERS: 1		US FAERS
708	Electrocardiogram delta waves abnormal	FAERS: 1		US FAERS
709	Electromechanical dissociation	FAERS: 1		US FAERS
710	Embolism	FAERS: 1		US FAERS
711	Enterobacter test positive	FAERS: 1		US FAERS
712	Eosinophilic Pneumonia	FAERS: 1		US FAERS
713	Epidermolysis	FAERS: 1		US FAERS
714	Expired product administered	FAERS: 1		US FAERS
715	Exposure via ingestion	FAERS: 1		US FAERS
716	Exposure via inhalation	FAERS: 1		US FAERS
717	Exposure via skin contact	FAERS: 1		US FAERS
718	Eye Burns	FAERS: 1		US FAERS
719	Factor II deficiency	FAERS: 1		US FAERS
720	Factor VIII inhibition	FAERS: 1		US FAERS
721	False negative pregnancy test	FAERS: 1		US FAERS
722	Febrile Neutropenia	FAERS: 1		US FAERS
723	Feeding tube complication	FAERS: 1		US FAERS
724	Feeling of body temperature change	FAERS: 1		OFFSIDES US FAERS
725	Fixed drug eruption	FAERS: 1		US FAERS
726	Flank Pain	FAERS: 1		US FAERS
727	Foreign body in respiratory tract	FAERS: 1		US FAERS
728	Foreign body trauma	FAERS: 1		US FAERS
729	Frustration tolerance decreased	FAERS: 1		US FAERS
730	Gait inability	FAERS: 1		US FAERS
731	Gastritis	FAERS: 1		SIDER US FAERS
732	Gastrointestinal hypomotility	FAERS: 1		US FAERS
733	Gastrointestinal inflammation	FAERS: 1		US FAERS
734	Gastrointestinal mucosal disorder	FAERS: 1		US FAERS
735	Gastrointestinal wall thinning	FAERS: 1		US FAERS
736	General physical condition abnormal	FAERS: 1		US FAERS
737	Gingival Atrophy	FAERS: 1		US FAERS
738	Gliosis	FAERS: 1		US FAERS
739	Head Banging	FAERS: 1		US FAERS
740	Head deformity	FAERS: 1		US FAERS
741	Hepatitis A antibody positive	FAERS: 1		US FAERS
742	Hepatorenal Syndrome	FAERS: 1		US FAERS
743	Hilar lymphadenopathy	FAERS: 1		US FAERS
744	Hirsutism	FAERS: 1	190707 3142761	CTD SIDER US FAERS
745	Histiocytosis haematophagic	FAERS: 1		US FAERS
746	Hostility	FAERS: 1		SIDER US FAERS
747	Human herpes virus 6 serology positive	FAERS: 1		US FAERS
748	Humoral immune defect	FAERS: 1		US FAERS
749	Hunger	FAERS: 1		US FAERS
750	Hydronephrosis	FAERS: 1	18620500	CTD US FAERS
751	Hyperacusis	FAERS: 1		SIDER US FAERS
752	Hyperkeratosis	FAERS: 1		US FAERS
753	Hyperparathyroidism	FAERS: 1		US FAERS
754	Hyperplasia	FAERS: 1		SIDER US FAERS
755	Hypogonadism	FAERS: 1		US FAERS
756	Hypoplastic Left Heart Syndrome	FAERS: 1		US FAERS
757	Hysterectomy	FAERS: 1		US FAERS
758	Iatrogenic injury	FAERS: 1		OFFSIDES US FAERS
759	Immobile	FAERS: 1		US FAERS
760	Impaired gastric emptying	FAERS: 1		US FAERS
761	Incorrect storage of drug	FAERS: 1		US FAERS
762	Infarction	FAERS: 1		US FAERS
763	Infectious Mononucleosis	FAERS: 1		US FAERS
764	Inflammation	FAERS: 1		SIDER US FAERS
765	Inflammatory marker increased	FAERS: 1		US FAERS
766	Infusion site inflammation	FAERS: 1		US FAERS
767	Infusion site necrosis	FAERS: 1		US FAERS
768	Infusion site pain	FAERS: 1		US FAERS
769	Infusion site swelling	FAERS: 1		US FAERS
770	Infusion site warmth	FAERS: 1		US FAERS
771	Inhibitory drug interaction	FAERS: 1		US FAERS
772	Injection Site Reaction	FAERS: 1 Canada Vigilance: 4		Canada Vigilance SIDER US FAERS
773	Injection site erythema	FAERS: 1		US FAERS
774	Injection site irritation	FAERS: 1		US FAERS
775	Injection site pain	FAERS: 1 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
776	Injection site phlebitis	FAERS: 1		US FAERS
777	Intellectual Disability	FAERS: 1	View details 7199765 7294529 9212184 10798072	CTD US FAERS
778	Intention tremor	FAERS: 1		OFFSIDES US FAERS
779	Intentional self-injury	FAERS: 1		US FAERS
780	Intercepted drug dispensing error	FAERS: 1		US FAERS
781	Jugular vein distension	FAERS: 1		US FAERS
782	Klebsiella sepsis	FAERS: 1		US FAERS
783	Labile blood pressure	FAERS: 1		US FAERS
784	Labyrinthitis	FAERS: 1		US FAERS
785	Left Ventricular Hypertrophy	FAERS: 1		US FAERS
786	Leukoencephalomyelitis	FAERS: 1		US FAERS
787	Leukoencephalopathy	FAERS: 1		OFFSIDES US FAERS
788	Lichen Planus	FAERS: 1		US FAERS
789	Liquid product physical issue	FAERS: 1		US FAERS
790	Livedo Reticularis	FAERS: 1		US FAERS
791	Lobar Pneumonia	FAERS: 1		US FAERS
792	Loss of personal independence in daily activities	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
793	Loss of proprioception	FAERS: 1		US FAERS
794	Lower respiratory tract infection	FAERS: 1		US FAERS
795	Lung Injury	FAERS: 1		US FAERS
796	Lyme Disease	FAERS: 1		US FAERS
797	Lymphocyte stimulation test positive	FAERS: 1		US FAERS
798	Lymphohistiocytosis	FAERS: 1		US FAERS
799	Lymphoid tissue hyperplasia	FAERS: 1		US FAERS
800	Macrocytosis	FAERS: 1		US FAERS
801	Malnutrition	FAERS: 1		US FAERS
802	Mastication disorder	FAERS: 1		US FAERS
803	Measles	FAERS: 1		SIDER US FAERS
804	Medical diet	FAERS: 1		US FAERS
805	Medication residue	FAERS: 1		US FAERS
806	Mental Retardation	FAERS: 1		US FAERS
807	Metabolic acidosis	FAERS: 1		US FAERS
808	Metastasis	FAERS: 1		US FAERS
809	Microphthalmos	FAERS: 1	4441320	CTD US FAERS
810	Mononucleosis syndrome	FAERS: 1		US FAERS
811	Monoplegia	FAERS: 1		US FAERS
812	Multiple Sclerosis	FAERS: 1		OFFSIDES US FAERS
813	Muscle tightness	FAERS: 1		US FAERS
814	Mycosis Fungoides	FAERS: 1		US FAERS
815	Myoclonic Epilepsy	FAERS: 1		US FAERS
816	Myopericarditis	FAERS: 1		US FAERS
817	Myositis	FAERS: 1	1036571	CTD US FAERS
818	Narcolepsy	FAERS: 1		US FAERS
819	Nephrosclerosis	FAERS: 1		US FAERS
820	Neutrophil count decreased	FAERS: 1		US FAERS
821	Night sweats	FAERS: 1		US FAERS
822	Occult blood positive	FAERS: 1		US FAERS
823	Ocular icterus	FAERS: 1		US FAERS
824	Ocular surface disease	FAERS: 1		US FAERS
825	Oliguria	FAERS: 1		OFFSIDES SIDER US FAERS
826	Opiates positive	FAERS: 1		US FAERS
827	Opisthotonus	FAERS: 1		US FAERS
828	Oral infection	FAERS: 1		OFFSIDES US FAERS
829	Oral mucosal eruption	FAERS: 1		US FAERS
830	Oral mucosal erythema	FAERS: 1		US FAERS
831	Oropharyngeal blistering	FAERS: 1		US FAERS
832	Osteochondritis	FAERS: 1		US FAERS
833	PO2 decreased	FAERS: 1		US FAERS
834	Panic Disorder	FAERS: 1		US FAERS
835	Paradoxical drug reaction	FAERS: 1		US FAERS
836	Paraplegia	FAERS: 1		US FAERS
837	Paresis	FAERS: 1	16376047	CTD US FAERS
838	Pemphigus	FAERS: 1		US FAERS
839	Performance status decreased	FAERS: 1		US FAERS
840	Perseveration	FAERS: 1		US FAERS
841	Petechiae	FAERS: 1 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
842	Phagocytosis	FAERS: 1		US FAERS
843	Pharmaceutical product counterfeit	FAERS: 1		US FAERS
844	Phobia of driving	FAERS: 1		US FAERS
845	Phonophobia	FAERS: 1		US FAERS
846	Physical assault	FAERS: 1		US FAERS
847	Physical product label issue	FAERS: 1		US FAERS
848	Plasmacytosis	FAERS: 1		US FAERS
849	Plasmodium falciparum infection	FAERS: 1		US FAERS
850	Pneumocystis jiroveci pneumonia	FAERS: 1		US FAERS
851	Poliomyelitis	FAERS: 1		US FAERS
852	Polyarthritis	FAERS: 1		US FAERS
853	Polydactyly	FAERS: 1	9212184	CTD US FAERS
854	Post-Traumatic Stress Disorder	FAERS: 1		US FAERS
855	Presyncope	FAERS: 1		US FAERS
856	Priapism	FAERS: 1		US FAERS
857	Product administration error	FAERS: 1		US FAERS
858	Product container issue	FAERS: 1		US FAERS
859	Product contamination	FAERS: 1		US FAERS
860	Product contamination microbial	FAERS: 1		US FAERS
861	Product deposit	FAERS: 1		US FAERS
862	Product dosage form issue	FAERS: 1		US FAERS
863	Product identification number issue	FAERS: 1		US FAERS
864	Product packaging issue	FAERS: 1		US FAERS
865	Proteinuria	FAERS: 1	2496325 7280771 19644425	CTD US FAERS
866	Prothrombin level decreased	FAERS: 1		US FAERS
867	Pseudoepitheliomatous hyperplasia	FAERS: 1		US FAERS
868	Psychiatric symptom	FAERS: 1		US FAERS
869	Psychogenic seizure	FAERS: 1		US FAERS
870	Psychomotor skills impaired	FAERS: 1		US FAERS
871	Pulmonary Embolism	FAERS: 1		SIDER US FAERS
872	Pulmonary Hypertension	FAERS: 1		US FAERS
873	Pulmonary thrombosis	FAERS: 1		US FAERS
874	Puncture site pain	FAERS: 1		US FAERS
875	Puncture site reaction	FAERS: 1		US FAERS
876	Pyomyositis	FAERS: 1		US FAERS
877	Radiation interaction	FAERS: 1		US FAERS
878	Radiation skin injury	FAERS: 1		US FAERS
879	Rales	FAERS: 1		US FAERS
880	Reaction to excipient	FAERS: 1		US FAERS
881	Reaction to food additive	FAERS: 1		US FAERS
882	Refusal of treatment by relative	FAERS: 1		US FAERS
883	Renal mass	FAERS: 1		US FAERS
884	Renal pain	FAERS: 1		US FAERS
885	Renal vasculitis	FAERS: 1		US FAERS
886	Respiratory Paralysis	FAERS: 1		US FAERS
887	Restrictive pulmonary disease	FAERS: 1		US FAERS
888	Rhonchi	FAERS: 1		US FAERS
889	Right atrial dilatation	FAERS: 1		US FAERS
890	Roseolovirus test positive	FAERS: 1		US FAERS
891	Saliva altered	FAERS: 1		US FAERS
892	Salivary gland adenoma	FAERS: 1		US FAERS
893	Scab	FAERS: 1		US FAERS
894	Schizophrenia	FAERS: 1		US FAERS
895	Scleroderma	FAERS: 1		US FAERS
896	Sedation complication	FAERS: 1		US FAERS
897	Senile dementia	FAERS: 1		US FAERS
898	Serum serotonin decreased	FAERS: 1		US FAERS
899	Sexual Dysfunction	FAERS: 1		US FAERS
900	Single umbilical artery	FAERS: 1		US FAERS
901	Skin irritation	FAERS: 1		US FAERS
902	Skin necrosis	FAERS: 1		US FAERS
903	Slow response to stimuli	FAERS: 1		US FAERS
904	Slow speech	FAERS: 1		US FAERS
905	Sluggishness	FAERS: 1		US FAERS
906	Smoker	FAERS: 1		US FAERS
907	Snoring	FAERS: 1		US FAERS
908	Spinal column stenosis	FAERS: 1		US FAERS
909	Spinal fusion surgery	FAERS: 1		US FAERS
910	Splenic Infarction	FAERS: 1		US FAERS
911	Sputum culture positive	FAERS: 1		US FAERS
912	Squamous cell carcinoma	FAERS: 1		US FAERS
913	Staphylococcus test positive	FAERS: 1		US FAERS
914	Strabismus	FAERS: 1		US FAERS
915	Streptococcus test positive	FAERS: 1		US FAERS
916	Stridor	FAERS: 1		US FAERS
917	Sudden death	FAERS: 1		US FAERS
918	Sudden onset of sleep	FAERS: 1		US FAERS
919	Systolic dysfunction	FAERS: 1		US FAERS
920	Talipes	FAERS: 1		US FAERS
921	Temperature intolerance	FAERS: 1		US FAERS
922	Tension	FAERS: 1		SIDER US FAERS
923	Terminal state	FAERS: 1		US FAERS
924	Therapy cessation	FAERS: 1		US FAERS
925	Throat clearing	FAERS: 1		US FAERS
926	Thyroidectomy	FAERS: 1		US FAERS
927	Thyroiditis	FAERS: 1		US FAERS
928	Tongue movement disturbance	FAERS: 1		US FAERS
929	Tongue pruritus	FAERS: 1		US FAERS
930	Tonsillitis	FAERS: 1		US FAERS
931	Tooth Extraction	FAERS: 1		US FAERS
932	Trichiasis	FAERS: 1		US FAERS
933	Trismus	FAERS: 1		US FAERS
934	Trisomy 21	FAERS: 1		US FAERS
935	Tuberous Sclerosis	FAERS: 1		US FAERS
936	Uhthoff's phenomenon	FAERS: 1		US FAERS
937	Unresponsive to verbal stimuli	FAERS: 1		US FAERS
938	Urine arsenic increased	FAERS: 1		US FAERS
939	Urine output increased	FAERS: 1		SIDER US FAERS
940	Uterine Cancer	FAERS: 1		US FAERS
941	Vascular bypass graft	FAERS: 1		US FAERS
942	Ventricle rupture	FAERS: 1		US FAERS
943	Ventricular Dysfunction	FAERS: 1		US FAERS
944	Ventricular arrhythmia	FAERS: 1		US FAERS
945	Viral upper respiratory tract infection	FAERS: 1		US FAERS
946	Walking aid user	FAERS: 1		US FAERS
947	Wheelchair user	FAERS: 1		US FAERS
948	White blood cell count abnormal	FAERS: 1		US FAERS
949	White matter lesion	FAERS: 1		US FAERS
950	X-ray abnormal	FAERS: 1		US FAERS
951	furuncle	FAERS: 1		US FAERS
952	neurofibroma	FAERS: 1		US FAERS
953	Abdominal adhesions			OFFSIDES
954	Abdominal strangulated hernia			OFFSIDES
955	Abnormalities, Drug-Induced		View details 105119 602761 1163515 1893664 3141453 3425630 4441320 6195326 7199765 7294529 8351644 8825076 8986270 9118846 9212184 9677735 10023798 10192272 10563481 10798072 10798073 14666970 15644835 17584909 21252394	CTD
956	Acid reflux			OFFSIDES
957	Acidosis			SIDER
958	Acute intermittent porphyria			OFFSIDES
959	Adrenal insufficiency neonatal			OFFSIDES
960	Adrenogenital Syndrome			OFFSIDES
961	Akathisia, Drug-Induced		20728059	CTD
962	Akathisia			SIDER
963	Albuminuria			SIDER
964	Alcohol Withdrawal Delirium		7220787	CTD
965	Alcohol Withdrawal Seizures		6625283	CTD
966	Alcohol consumption			OFFSIDES
967	Alcoholic Intoxication			OFFSIDES
968	Alkalosis	Canada Vigilance: 1		Canada Vigilance SIDER
969	Amblyopia			SIDER
970	Amyloidosis		2511368	CTD
971	Anaphylactoid Reaction	Canada Vigilance: 1		Canada Vigilance SIDER
972	Anemia, Hemolytic		1147459 9855327	CTD
973	Anemia, Macrocytic		15955964	CTD
974	Anemia, Megaloblastic		1147459 4169978 4627864	CTD
975	Anemia		190707	CTD
976	Angiokeratoma			OFFSIDES
977	Anorectal discomfort			SIDER
978	Anti-Neutrophil Cytoplasmic Antibody-Associated Vasculitis		8671794	CTD
979	Antinuclear antibody increased			OFFSIDES
980	Anus, Imperforate		1163515	CTD
981	Apathy	Canada Vigilance: 1		Canada Vigilance
982	Application site erythema			OFFSIDES
983	Aseptic Meningitis			OFFSIDES
984	Aspiration Pneumonia			OFFSIDES
985	Atherosclerosis		15136057	CTD
986	Atrial tachycardia			OFFSIDES
987	Atrioventricular Block	Canada Vigilance: 1	View details 6068646 7616148 10407528 10914260	CTD OFFSIDES Canada Vigilance
988	Automatism			OFFSIDES
989	Bacterial sepsis			OFFSIDES
990	Basal Ganglia Diseases		4075309 8601557 12940655	CTD
991	Bladder Exstrophy		1163515	CTD
992	Blepharoptosis		6035961 6769289 9046861	CTD OFFSIDES
993	Blepharospasm			OFFSIDES
994	Blood acid phosphatase increased	Canada Vigilance: 1		Canada Vigilance
995	Blood amylase increased			OFFSIDES
996	Blood and lymphatic system disorders			SIDER
997	Blood cholesterol			OFFSIDES
998	Blood fibrinogen abnormal	Canada Vigilance: 1		Canada Vigilance
999	Blood potassium			OFFSIDES
1000	Blood thyroid stimulating hormone abnormal			OFFSIDES
1001	Bone Diseases, Developmental		8825076	CTD
1002	Bone Diseases		946392	CTD
1003	Brain Diseases		View details 495042 891494 1598019 1766287 3104308 3611689 3616367 3922204 4053475 4151655 5681159 6769289 7199508 8406715 8962742 10023798 11093997 11310291	CTD
1004	Brain Edema		15459624	CTD
1005	Brain Infarction		8874891	CTD
1006	Cachexia			SIDER
1007	Cardiac stress test abnormal			OFFSIDES
1008	Cardioactive drug level			OFFSIDES
1009	Cardiomyopathies		7657318	CTD
1010	Catalepsy		7190305	CTD
1011	Cerebellar Diseases		View details 430165 652875 821007 1154062 3374014 4075636 4212949 4816871 5440585 5785298 6543814 7343457 7362207 7425581 11433844 12430712 12589609 18315788	CTD
1012	Cerebral artery occlusion			OFFSIDES
1013	Cerebral hypoperfusion			OFFSIDES
1014	Cervicobrachial syndrome			OFFSIDES
1015	Chemical and Drug Induced Liver Injury		View details 574201 814030 1036571 1147459 1669223 1678417 2752702 3093562 3156084 4024872 4044332 6682525 6693586 8521225 10925722 11100060 12630649 21224054 22331495 23397584 23986454 24493665	CTD
1016	Chemotherapeutic drug level increased			OFFSIDES
1017	Chloasma			OFFSIDES
1018	Choking sensation			OFFSIDES
1019	Cholestasis, Extrahepatic		7283297	CTD
1020	Chronic Obstructive Airway Disease			OFFSIDES
1021	Circumoral paresthesia			SIDER
1022	Coagulation time abnormal			OFFSIDES
1023	Cognition Disorders		View details 2492459 4836373 6588718 7813412 8191881 10776488 10940574 12430712 15662039 16315636 17600176 17969896 19371260 19398681 19507301 19765566	CTD
1024	Complication associated with device	Canada Vigilance: 1		Canada Vigilance
1025	Confabulation			OFFSIDES
1026	Confusion		View details 3611689 4406897 5681159 7396317 8369243 11740344	CTD
1027	Congenital tricuspid valve incompetence			OFFSIDES
1028	Conjunctival erosion	Canada Vigilance: 1		Canada Vigilance
1029	Consciousness Disorders		3611689	CTD
1030	Cramps of lower extremities			SIDER
1031	Craniofacial Abnormalities		View details 3141453 7199765 8986270 9212184 10798072 15644835 19952982	CTD
1032	Cutis marmorata telangiectatica congenita		1163515	CTD
1033	Decreased Libido			OFFSIDES
1034	Delayed engraftment			OFFSIDES
1035	Demyelinating Diseases		3008637	CTD
1036	Dermatomyositis		9853654	CTD
1037	Developmental Disabilities		10798073	CTD
1038	Diabetes			OFFSIDES
1039	Diabetes Insipidus			SIDER
1040	Diastolic dysfunction			OFFSIDES
1041	Disorders of Excessive Somnolence		3085769 4124437	CTD
1042	Down Syndrome		4441320	CTD
1043	Drowsiness			OFFSIDES SIDER
1044	Drug Eruptions		View details 146391 2530246 7439205 11434197 12926190 15024534	CTD
1045	Drug Overdose		View details 430165 4214527 8864707 11108512 19439856	CTD
1046	Drug withdrawal convulsions	Canada Vigilance: 1		Canada Vigilance
1047	Drug withdrawal headache			OFFSIDES
1048	Dyskinesia, Drug-Induced		View details 123156 239101 403743 643025 1011032 2194703 3611689 4414729 4846140 6811702 7396317 7813146 8419804 10450338 12940655	CTD
1049	Dyspnea		16750133	CTD
1050	Ear congestion			OFFSIDES
1051	Eclampsia		2589455 8369243	CTD
1052	Edema		View details 6693586 8159601 9781525 10534289 11108512 11580764 16750133 17451091 19596627	CTD
1053	Encephalocele	Canada Vigilance: 1		Canada Vigilance
1054	Enterococcal infection			OFFSIDES
1055	Eosinophil percentage increased			OFFSIDES
1056	Eosinophilic Granuloma		3753844	CTD
1057	Epidermal necrosis	Canada Vigilance: 1		Canada Vigilance
1058	Epidermolysis Bullosa		1399206 6251365	CTD
1059	Epigastric discomfort			SIDER
1060	Epigastric pain			SIDER
1061	Epilepsia Partialis Continua		817892	CTD
1062	Epilepsies, Partial		View details 405624 4627864 7554689 11558140 15229826 17116037	CTD
1063	Epilepsy, Complex Partial		View details 1797011 2234190 2739918 3085769 7611955 7750514 8041383 8347908 8351644 10343150	CTD
1064	Epilepsy, Generalized		405624 6682525 15242047	CTD
1065	Epilepsy, Temporal Lobe		4032590 7283297 7906364	CTD
1066	Exanthema		View details 132924 574201 817892 1678417 3276852 5108409 6693586 7280771 8521225 10698845 15229826 16750133 16900938	CTD
1067	Exophthalmos			OFFSIDES
1068	Extravasation of Diagnostic and Therapeutic Materials		12915082	CTD
1069	Facial paralysis		11433844	CTD
1070	Facies		7294529	CTD
1071	Fatty Liver			OFFSIDES
1072	Fecal Impaction		5355257	CTD
1073	Fetal Death		10627286	CTD
1074	Fetal Growth Retardation		7294529 8825076	CTD
1075	Fetal hydantoin syndrome		6106127 25726414	CTD
1076	Fever		View details 574201 1036571 1678417 2530246 3276852 6693586 7280771 7439205 15229826 16750133	CTD
1077	Fibrin D dimer increased	Canada Vigilance: 1		Canada Vigilance
1078	Fibrosis		1678417	CTD SIDER
1079	Folic Acid Deficiency		4175396 4627864	CTD
1080	Foreign body aspiration			OFFSIDES
1081	Gait Ataxia		View details 405624 5354845 5355257 6081207 6504331 6769289 7396317 10023798 12940655	CTD
1082	Gait Disorders, Neurologic		1602320 4075309 11442446	CTD
1083	Ganglioneuroblastoma		6106127	CTD
1084	Gastric irritation			SIDER
1085	Gaze palsy			OFFSIDES
1086	Gingival Overgrowth		14659971 16390469	CTD
1087	Glomerulonephritis, Membranoproliferative		7099337	CTD
1088	Glycosuria		6062284	CTD
1089	Granulocyte count decreased			OFFSIDES
1090	Growth Disorders		View details 6195326 7199765 9212184 10798072	CTD
1091	Hallucinations		View details 5681159 8432072 12189261 17600176 20728059	CTD
1092	Hay fever			OFFSIDES
1093	Head and Neck Neoplasms		1186408	CTD
1094	Heart Block		5440585 5548842	CTD
1095	Heart Diseases		5533643 24323366	CTD
1096	Heart failure		1098684 1147459	CTD
1097	Hemiplegia		View details 430165 3117426 6414095 6415639 7813146	CTD OFFSIDES SIDER
1098	Hemorrhage		190707 2057444 11283972	CTD
1099	Hemorrhagic Disorders		190707	CTD
1100	Heparin-induced thrombocytopenia			OFFSIDES
1101	Hepatic Insufficiency		6698876	CTD
1102	Hepatitis, Chronic		8462373	CTD
1103	Hepatoblastoma		8242847	CTD
1104	Hepatolenticular Degeneration		5421930	CTD
1105	Hereditary Angioedema Types I and II		1644161	CTD
1106	Hodgkin Disease		7336147	CTD
1107	Holoprosencephaly		8351644	CTD
1108	Hypercapnia			OFFSIDES
1109	Hyperglycemia		5763660 6062284	CTD
1110	Hyperhomocysteinemia		10459572	CTD
1111	Hyperkinesia			SIDER
1112	Hyperparathyroidism, Secondary		20683115	CTD
1113	Hypersensitive syndrome			SIDER
1114	Hypertensive Encephalopathy		11836887	CTD
1115	Hyperventilation			SIDER
1116	Hypervitaminosis A		946392	CTD
1117	Hypesthesia		2998143	CTD
1118	Hypocalcemia		849004	CTD
1119	Hypophosphatemia		6069279	CTD
1120	Hypotension, Orthostatic		12915082	CTD
1121	Incision site pain			OFFSIDES
1122	Incorrect product dosage form administered	Canada Vigilance: 1		Canada Vigilance
1123	Increased bronchial secretion			OFFSIDES SIDER
1124	Injection site dermatitis			OFFSIDES
1125	Injection site discomfort			OFFSIDES
1126	Injection site inflammation			SIDER
1127	Intracranial Aneurysm			OFFSIDES
1128	Intracranial Embolism and Thrombosis		7482654 8977375	CTD
1129	Intracranial Hypertension		15459624	CTD
1130	Intraoperative Complications		10407528 17049862	CTD
1131	Isaacs syndrome		466063	CTD
1132	Jaundice, Obstructive		6721716	CTD
1133	Ketosis			SIDER
1134	Kidney Calculi		18620500	CTD
1135	Kidney Diseases		1669223 4044332	CTD
1136	Limb Deformities, Congenital		2492459 7294529 15644835	CTD
1137	Lipomyelomeningocele		2492459	CTD
1138	Liver Failure, Acute		View details 10915174 10925722 15390328 16187183	CTD
1139	Liver Failure		2818777 10823022	CTD
1140	Liver Neoplasms, Experimental		8242847 8405780	CTD
1141	Liver diseases		14986274	CTD
1142	Liver neoplasms		25058030	CTD
1143	Long QT Syndrome		832494 5021502 21158687	CTD
1144	Lupus Erythematosus			SIDER
1145	Lymphatic Diseases		View details 146391 574201 814030 1036571 1147459 1678417 3156084 7283297	CTD
1146	Lymphedema			OFFSIDES
1147	Lymphoma, Non-Hodgkin		7336147	CTD
1148	Massive Hepatic Necrosis		View details 814030 3093562 11100060 21224054	CTD
1149	Mastoiditis			OFFSIDES
1150	Median Neuropathy		4365396 6274215	CTD
1151	Megacolon			OFFSIDES
1152	Memory Disorders		View details 6588711 7396317 8191881 11740344	CTD
1153	Mental disorders		9315984 11549407	CTD
1154	Mesenchymoma		3978571	CTD
1155	Metabolic alkalosis	Canada Vigilance: 1		Canada Vigilance
1156	Microcephaly		8351644 10798072	CTD
1157	Micrognathism		2492459	CTD
1158	Mixed liver injury			OFFSIDES
1159	Motor Disorders		27413119	CTD
1160	Motor Neuron Disease		856594	CTD
1161	Motor Skills Disorders		6195326	CTD
1162	Mouth Abnormalities		17328645	CTD
1163	Movement Disorders		View details 3219679 3975247 4075309 10023798 22107891	CTD
1164	Mucocutaneous Lymph Node Syndrome		428254	CTD
1165	Mucoepidermoid Carcinoma			OFFSIDES
1166	Multiple Myeloma		8727349	CTD
1167	Muscle Hypertonia		3994321	CTD
1168	Muscle Weakness		View details 6682525 9046861 10219285 12196060 19302663 20683115	CTD OFFSIDES
1169	Muscle relaxant therapy			SIDER
1170	Myasthenia Gravis		9046861	CTD
1171	Myocardial Ischemia		14666970	CTD
1172	Myoclonic Epilepsies, Progressive		17484760	CTD
1173	Myopathy			SIDER
1174	Myotonia Congenita		1896199	CTD
1175	Myotonic Dystrophy		4051836	CTD
1176	Nails, Malformed		10798072	CTD
1177	Neoplasms, Experimental		508562	CTD
1178	Nephritis, Interstitial		View details 465192 660357 894414 1614700 3156084 6693586 7280771 19112234	CTD
1179	Nephrotic Syndrome		2496325 7099337	CTD
1180	Nerve Degeneration		View details 821007 12192617 12430712 17636003 19371260	CTD
1181	Nervous System Neoplasms		1623454	CTD
1182	Nervous tension			OFFSIDES
1183	Neural Tube Defects		3141453 9118846 23458687	CTD
1184	Neuroaxonal Dystrophies		6543814	CTD
1185	Neuroblastoma		1623454	CTD
1186	Neuroectodermal Tumor, Melanotic		3978571	CTD
1187	Neurogenic Bowel		2492459	CTD
1188	Neurologic Manifestations		3142761 19713257	CTD
1189	Neuromuscular Diseases		19302663	CTD
1190	Nodule			OFFSIDES
1191	Ocular Motility Disorders		3827233 6504331	CTD
1192	Oral mucosal exfoliation	Canada Vigilance: 1		Canada Vigilance
1193	Pain, Postoperative		1519714	CTD
1194	Papilledema		3951721	CTD
1195	Paraproteinemias		2511368	CTD
1196	Paresthesia		190987 10219285	CTD
1197	Pathological fracture	Canada Vigilance: 1		Canada Vigilance
1198	Pelvic Pain			SIDER
1199	Peripheral Nervous System Diseases		View details 190707 190987 1339187 2998143 3008637 4293820 4329415 4342796 4363815 6260604 6266823 6313322 10219285	CTD
1200	Peroneal Neuropathies		4365396 6274215	CTD
1201	Personality Disorders		4836373	CTD
1202	Pneumothorax			SIDER
1203	Polymyositis		574201	CTD
1204	Polyuria		7370605	CTD SIDER
1205	Porphyria Cutanea Tarda		11586030	CTD
1206	Porphyrins urine abnormal			OFFSIDES
1207	Posterior Leukoencephalopathy Syndrome		11862771	CTD
1208	Pregnancy Complications, Hematologic		6069279	CTD
1209	Prenatal Exposure Delayed Effects		View details 849004 1893664 2234544 3627087 3978571 4080065 7509419 8822699 9661711 10023798 14666970 19398681 19507301	CTD
1210	Prenatal Injuries		23458687 24323366	CTD
1211	Product complaint	Canada Vigilance: 1		Canada Vigilance
1212	Pseudotumor Cerebri		3951721	CTD
1213	Psychomotor Agitation		7340137 8590611	CTD
1214	Psychomotor Disorders		495042 4836373 10023798	CTD
1215	Psychoses, Substance-Induced		View details 453362 1172795 6062284 8432072 14698717	CTD
1216	Pulmonary radiation injury			OFFSIDES
1217	Purpura Fulminans		1147459	CTD
1218	Purpuric rash			SIDER
1219	Quadriplegia			OFFSIDES
1220	Rectal tenesmus			SIDER
1221	Reflex, Abnormal		View details 109744 190987 4293820 4329415 5681159 6266823 10219285 10655531	CTD
1222	Renal Insufficiency		2752702 3156084	CTD
1223	Renal abscess			OFFSIDES
1224	Rhinitis	Canada Vigilance: 1		Canada Vigilance SIDER
1225	Risus sardonicus			OFFSIDES
1226	Scotoma			SIDER
1227	Seizures		View details 1803 100809 190987 405624 500438 519576 567761 637689 743650 814030 817891 817892 835515 841172 976216 1110371 1154062 1242663 1348065 1563341 1606341 1650829 1678417 1914160 2057444 2219888 2343592 2394103 2452150 2498296 2905779 2924747 2978064 3093562 3137016 3177989 3276852 3370103 3571942 3590391 3691417 3709079 3975247 3994321 4069321 4069370 4124437 4212949 4293820 4329415 4406897 4414729 4479423 4685246 4719784 4740029 4996854 5355257 5363343 5451364 5681159 5818377 6069279 6126705 6405441 6442397 6496340 6504331 6614878 6710222 6769734 6823029 6860385 7057304 7212335 7396317 7425581 7554689 7616148 7813146 7870991 8058587 8138671 8149357 8369243 8419804 8432072 8645877 8704069 8768165 9533108 9662735 9781525 9844417 10022661 10029267 10084426 10367328 10407528 10456426 10487084 10507379 10698845 10728915 10838112 10860128 10914260 11044598 11108512 11197575 11586030 11737171 11738929 11740632 11836887 11948390 12028229 12078977 12098063 12189261 12218544 12461152 14704477 14978727 15143958 15662039 15857624 15946322 16876388 16908754 17049862 17074045 17156702 19637953 19919933 22107891 28032682	CTD
1228	Semen analysis abnormal	Canada Vigilance: 1		Canada Vigilance
1229	Serum Sickness		574201	CTD
1230	Shallow breathing			SIDER
1231	Sinus Arrest, Cardiac		7148661 9890385 10914260	CTD
1232	Skin Diseases, Papulosquamous		3677571	CTD
1233	Skin nodule			SIDER
1234	Sleep Wake Disorders		17600176	CTD
1235	Slurred speech			SIDER
1236	Speech Disorders		View details 2492459 2578677 4124437 4406897 5355257 5681159 11442446 11740344 12940655	CTD
1237	Stuttering			SIDER
1238	Subacute endocarditis			OFFSIDES
1239	Subarachnoid Hemorrhage		9533108	CTD
1240	Substance Withdrawal Syndrome		View details 1369509 2498296 6686073 7224382 8590611	CTD
1241	Supraventricular tachyarrhythmia			OFFSIDES
1242	Sweating			SIDER
1243	Systemic Vasculitis		10210297	CTD
1244	Systemic necrotizing angiitis		3753844	CTD
1245	Tachycardia, Ectopic Junctional		10914260	CTD
1246	Tachycardia, Ventricular		View details 2767010 3276970 3361443 4051836 6150094 6193348 13172862	CTD
1247	Tetany		849004	CTD
1248	Therapeutic product effect decreased	Canada Vigilance: 1		Canada Vigilance
1249	Therapeutic product effect increased	Canada Vigilance: 1		Canada Vigilance
1250	Thrombophlebitis			SIDER
1251	Thymus Hyperplasia		9046861	CTD
1252	Tibial Neuropathy		176326 4365396 6274215	CTD
1253	Tracheal Stenosis			OFFSIDES
1254	Traumatic liver injury			SIDER
1255	Trembling			SIDER
1256	Troponin increased			OFFSIDES
1257	Ulnar Neuropathies		4365396 6274215	CTD
1258	Vasculitis, Leukocytoclastic, Cutaneous		1147459	CTD
1259	Vasospasm, Intracranial		16376047	CTD
1260	Venous Thrombosis		16750133 19596627	CTD
1261	Vestibular Diseases		11433844	CTD
1262	Vision Disorders		View details 3374014 3951721 4151655 12189261	CTD
1263	Vitamin B 12 Deficiency		188784 4627864	CTD
1264	Vocal Cord Paralysis		1186408	CTD
1265	Vulvovaginal mycotic infection			SIDER
1266	Vulvovaginal pain			OFFSIDES
1267	muscle injury			OFFSIDES

Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141