Bosentan
(GJPICJJJRGTNOD-UHFFFAOYSA-N)
Structure
- SMILES
- OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1
- Type(s)
- Approved; Investigational
- ATC code(s)
- C02KX01
- Molecular Formula:
- C27H29N5O6S
- Molecular Weight:
- 551.614
- Log P:
- 5.3577
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 2
- TPSA:
- 154.03
- CAS Number(s):
- 147536-97-8; 174227-18-0
Synonym(s)
1.
Bosentan
2.
4-t-Butyl-N-(6-(2-hydroxyethoxy)-5-(2-methoxyphenoxy)-2,2'-bipyrimidin-4-yl)benzenesulfonamide
3.
Bosentan Anhydrous
4.
Bosentan Monohydrate
5.
Ro 47-0203
6.
Ro-47-0203
7.
Tracleer
8.
Ro 47 0203
9.
Ro 470203
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pneumonia | FAERS: 668 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 2 | Pulmonary arterial hypertension | FAERS: 556 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 3 | Aspartate Aminotransferase Increased | FAERS: 347 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 4 | Alanine Aminotransferase Increased | FAERS: 331 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 5 | Respiratory Failure | FAERS: 295 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 6 | Disease Progression | FAERS: 276 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 7 | Fatigue | FAERS: 261 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 8 | Pulmonary Hypertension | FAERS: 258 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 9 | Chest Pain | FAERS: 229 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 10 | Nausea | FAERS: 229 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 11 | Dizziness | FAERS: 227 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 12 | Vomiting | FAERS: 218 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 13 | Sepsis | FAERS: 204 | US FAERS | |
| 14 | Right ventricular failure | FAERS: 203 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 15 | Malaise | FAERS: 201 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 16 | Syncope | FAERS: 201 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 17 | Asthenia | FAERS: 193 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 18 | Myocardial Infarction | FAERS: 178 Canada Vigilance: 4 | 16700825 | CTD SIDER Canada Vigilance US FAERS |
| 19 | Headache | FAERS: 173 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 20 | Blood alkaline phosphatase increased | FAERS: 170 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 21 | Cerebrovascular accident | FAERS: 168 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 22 | Urinary tract infection | FAERS: 166 | SIDER US FAERS | |
| 23 | Atrial Fibrillation | FAERS: 163 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 24 | Drug dose omission | FAERS: 159 | US FAERS | |
| 25 | Hypotension | FAERS: 153 Canada Vigilance: 3 | 10796056 | CTD SIDER Canada Vigilance US FAERS |
| 26 | Pregnancy | FAERS: 146 | US FAERS | |
| 27 | Infection | FAERS: 144 | SIDER US FAERS | |
| 28 | Dehydration | FAERS: 129 | OFFSIDES SIDER US FAERS | |
| 29 | Influenza | FAERS: 125 | SIDER US FAERS | |
| 30 | Cardiac Arrest | FAERS: 124 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 31 | Pain | FAERS: 113 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 32 | Abdominal Pain | FAERS: 108 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 33 | Bronchitis | FAERS: 108 | SIDER US FAERS | |
| 34 | Cellulitis | FAERS: 96 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Drug exposure during pregnancy | FAERS: 96 | OFFSIDES US FAERS | |
| 36 | Pulmonary Fibrosis | FAERS: 94 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Nasopharyngitis | FAERS: 89 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 38 | Hypoxia | FAERS: 88 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 39 | Asthma | FAERS: 86 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 40 | Swelling | FAERS: 86 | US FAERS | |
| 41 | Back Pain | FAERS: 85 | SIDER US FAERS | |
| 42 | Pulmonary Embolism | FAERS: 83 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Scleroderma | FAERS: 83 | OFFSIDES US FAERS | |
| 44 | General physical health deterioration | FAERS: 72 | OFFSIDES US FAERS | |
| 45 | Fluid overload | FAERS: 71 | US FAERS | |
| 46 | No adverse event | FAERS: 69 | US FAERS | |
| 47 | Transplant | FAERS: 69 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Thrombosis | FAERS: 68 | US FAERS | |
| 49 | Chest discomfort | FAERS: 63 | US FAERS | |
| 50 | Pericardial effusion | FAERS: 63 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 51 | Arthralgia | FAERS: 59 | SIDER US FAERS | |
| 52 | Palpitations | FAERS: 59 | SIDER US FAERS | |
| 53 | Sudden death | FAERS: 58 | OFFSIDES US FAERS | |
| 54 | Weight decreased | FAERS: 57 | SIDER US FAERS | |
| 55 | Disease complication | FAERS: 56 | OFFSIDES US FAERS | |
| 56 | Ascites | FAERS: 54 | OFFSIDES SIDER US FAERS | |
| 57 | Epistaxis | FAERS: 54 | OFFSIDES SIDER US FAERS | |
| 58 | Skin Ulcer | FAERS: 54 | SIDER US FAERS | |
| 59 | Respiratory distress | FAERS: 53 | US FAERS | |
| 60 | Concomitant disease aggravated | FAERS: 49 | US FAERS | |
| 61 | Feeling abnormal | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 62 | Peripheral swelling | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 63 | Blood potassium decreased | FAERS: 46 | OFFSIDES US FAERS | |
| 64 | Device related infection | FAERS: 46 | OFFSIDES US FAERS | |
| 65 | Drug ineffective | FAERS: 46 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 66 | Wheezing | FAERS: 45 | SIDER US FAERS | |
| 67 | Acute respiratory failure | FAERS: 43 | US FAERS | |
| 68 | Intestinal Obstruction | FAERS: 43 | SIDER US FAERS | |
| 69 | Productive Cough | FAERS: 43 | OFFSIDES US FAERS | |
| 70 | Pruritus | FAERS: 43 | SIDER US FAERS | |
| 71 | Cystitis | FAERS: 42 | SIDER US FAERS | |
| 72 | Pancreatitis | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 73 | Abdominal discomfort | FAERS: 40 | US FAERS | |
| 74 | Anxiety | FAERS: 40 | SIDER US FAERS | |
| 75 | Cholelithiasis | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 76 | Gamma-Glutamyltransferase Increased | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 77 | Terminal state | FAERS: 37 | OFFSIDES US FAERS | |
| 78 | Septic Shock | FAERS: 36 | US FAERS | |
| 79 | Arthritis | FAERS: 35 | OFFSIDES US FAERS | |
| 80 | Post procedural complication | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 81 | Tachycardia | FAERS: 35 | SIDER US FAERS | |
| 82 | Constipation | FAERS: 34 | SIDER US FAERS | |
| 83 | Diverticulitis | FAERS: 34 | US FAERS | |
| 84 | Mechanical ventilation | FAERS: 34 | US FAERS | |
| 85 | Product dose omission | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 86 | Myalgia | FAERS: 33 | US FAERS | |
| 87 | Sinusitis | FAERS: 33 | OFFSIDES SIDER US FAERS | |
| 88 | Chills | FAERS: 32 | SIDER US FAERS | |
| 89 | Respiratory arrest | FAERS: 32 | US FAERS | |
| 90 | Cyanosis | FAERS: 31 | OFFSIDES US FAERS | |
| 91 | Drug administered to patient of inappropriate age | FAERS: 31 | US FAERS | |
| 92 | Unevaluable event | FAERS: 31 | US FAERS | |
| 93 | jaundice | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 94 | Chemotherapy | FAERS: 29 | US FAERS | |
| 95 | Flushing | FAERS: 29 | SIDER US FAERS | |
| 96 | Pneumothorax | FAERS: 29 | OFFSIDES US FAERS | |
| 97 | Thrombocytopenia | FAERS: 29 | SIDER US FAERS | |
| 98 | Limb injury | FAERS: 28 | OFFSIDES US FAERS | |
| 99 | Tremor | FAERS: 28 | SIDER US FAERS | |
| 100 | Sarcoidosis | FAERS: 26 | US FAERS | |
| 101 | Abasia | FAERS: 25 | US FAERS | |
| 102 | Blood count abnormal | FAERS: 25 | US FAERS | |
| 103 | Blood creatinine increased | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 104 | Blood glucose increased | FAERS: 25 | US FAERS | |
| 105 | Hysterectomy | FAERS: 25 | US FAERS | |
| 106 | Oropharyngeal pain | FAERS: 25 | US FAERS | |
| 107 | Bradycardia | FAERS: 24 | SIDER US FAERS | |
| 108 | Coronary Artery Disease | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 109 | Hypersensitivity | FAERS: 24 | SIDER US FAERS | |
| 110 | Joint injury | FAERS: 24 | US FAERS | |
| 111 | Product use issue | FAERS: 24 | US FAERS | |
| 112 | Amnesia | FAERS: 23 | OFFSIDES US FAERS | |
| 113 | Hepatitis | FAERS: 23 | OFFSIDES SIDER US FAERS | |
| 114 | Pulmonary congestion | FAERS: 23 | US FAERS | |
| 115 | Rhinovirus infection | FAERS: 23 | US FAERS | |
| 116 | Atrial Flutter | FAERS: 22 | US FAERS | |
| 117 | Diabetes Mellitus | FAERS: 22 | US FAERS | |
| 118 | Memory impairment | FAERS: 22 | US FAERS | |
| 119 | Mental status changes | FAERS: 22 | OFFSIDES US FAERS | |
| 120 | Pancytopenia | FAERS: 22 | US FAERS | |
| 121 | Autoimmune hepatitis | FAERS: 21 | OFFSIDES US FAERS | |
| 122 | Cardiomegaly | FAERS: 21 | US FAERS | |
| 123 | Cor pulmonale | FAERS: 21 | US FAERS | |
| 124 | Poor peripheral circulation | FAERS: 21 | OFFSIDES US FAERS | |
| 125 | Presyncope | FAERS: 21 | SIDER US FAERS | |
| 126 | Transaminases increased | FAERS: 21 | OFFSIDES US FAERS | |
| 127 | Blood glucose decreased | FAERS: 20 | US FAERS | |
| 128 | Deep Vein Thrombosis | FAERS: 20 | US FAERS | |
| 129 | Erythema | FAERS: 20 | SIDER US FAERS | |
| 130 | Joint swelling | FAERS: 20 | US FAERS | |
| 131 | Somnolence | FAERS: 20 | SIDER US FAERS | |
| 132 | Hepatomegaly | FAERS: 19 | US FAERS | |
| 133 | Sciatica | FAERS: 19 | US FAERS | |
| 134 | Splenomegaly | FAERS: 19 | US FAERS | |
| 135 | Stress | FAERS: 19 | US FAERS | |
| 136 | White blood cell count decreased | FAERS: 19 | US FAERS | |
| 137 | Ankle Fracture | FAERS: 18 | US FAERS | |
| 138 | Arthropathy | FAERS: 18 | US FAERS | |
| 139 | Cholecystitis | FAERS: 18 | OFFSIDES US FAERS | |
| 140 | Dementia | FAERS: 18 | US FAERS | |
| 141 | Dyspepsia | FAERS: 18 | OFFSIDES SIDER US FAERS | |
| 142 | Gout | FAERS: 18 | SIDER US FAERS | |
| 143 | Inflammation | FAERS: 18 | US FAERS | |
| 144 | Nephrolithiasis | FAERS: 18 | US FAERS | |
| 145 | Blood potassium increased | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 146 | Cardiac ablation | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 147 | Clostridium difficile infection | FAERS: 17 | US FAERS | |
| 148 | Colitis | FAERS: 17 | US FAERS | |
| 149 | Gangrene | FAERS: 17 | US FAERS | |
| 150 | Implantable defibrillator insertion | FAERS: 17 | US FAERS | |
| 151 | Leukopenia | FAERS: 17 | SIDER US FAERS | |
| 152 | Respiratory tract congestion | FAERS: 17 | US FAERS | |
| 153 | Angina Pectoris | FAERS: 16 | SIDER US FAERS | |
| 154 | Cytolytic hepatitis | FAERS: 16 | OFFSIDES US FAERS | |
| 155 | Lethargy | FAERS: 16 | SIDER US FAERS | |
| 156 | Limb discomfort | FAERS: 16 | OFFSIDES US FAERS | |
| 157 | Procedural complication | FAERS: 16 | OFFSIDES US FAERS | |
| 158 | Cataract operation | FAERS: 15 | US FAERS | |
| 159 | Choking | FAERS: 15 | US FAERS | |
| 160 | Hernia | FAERS: 15 | US FAERS | |
| 161 | Hip surgery | FAERS: 15 | US FAERS | |
| 162 | Limb operation | FAERS: 15 | US FAERS | |
| 163 | Acute kidney injury | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 164 | Back disorder | FAERS: 14 | US FAERS | |
| 165 | Blood sodium decreased | FAERS: 14 | US FAERS | |
| 166 | Blood urea increased | FAERS: 14 | OFFSIDES US FAERS | |
| 167 | Chronic respiratory failure | FAERS: 14 | US FAERS | |
| 168 | Disorientation | FAERS: 14 | US FAERS | |
| 169 | Gastritis | FAERS: 14 | US FAERS | |
| 170 | Musculoskeletal Pain | FAERS: 14 | SIDER US FAERS | |
| 171 | Osteomyelitis | FAERS: 14 | US FAERS | |
| 172 | Pleurisy | FAERS: 14 | US FAERS | |
| 173 | Therapy cessation | FAERS: 14 | US FAERS | |
| 174 | Accidental exposure | FAERS: 13 | OFFSIDES US FAERS | |
| 175 | Deafness | FAERS: 13 | US FAERS | |
| 176 | Laceration | FAERS: 13 | US FAERS | |
| 177 | Lower respiratory tract infection | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 178 | Medication Error | FAERS: 13 | US FAERS | |
| 179 | Pulmonary hypertensive crisis | FAERS: 13 | OFFSIDES US FAERS | |
| 180 | Blindness | FAERS: 12 | US FAERS | |
| 181 | Blood creatine phosphokinase increased | FAERS: 12 | OFFSIDES US FAERS | |
| 182 | Cholestasis | FAERS: 12 Canada Vigilance: 1 | 25663337 | CTD Canada Vigilance US FAERS |
| 183 | Concomitant disease progression | FAERS: 12 | US FAERS | |
| 184 | Dysphonia | FAERS: 12 | OFFSIDES US FAERS | |
| 185 | Endocarditis | FAERS: 12 | US FAERS | |
| 186 | Fracture | FAERS: 12 | US FAERS | |
| 187 | Gastroenteritis | FAERS: 12 | SIDER US FAERS | |
| 188 | Medical device complication | FAERS: 12 | US FAERS | |
| 189 | Rhabdomyolysis | FAERS: 12 | OFFSIDES US FAERS | |
| 190 | Visual Impairment | FAERS: 12 | US FAERS | |
| 191 | Adverse event | FAERS: 11 | US FAERS | |
| 192 | Ammonia increased | FAERS: 11 | OFFSIDES US FAERS | |
| 193 | Anuria | FAERS: 11 | OFFSIDES US FAERS | |
| 194 | Appendicitis | FAERS: 11 | OFFSIDES US FAERS | |
| 195 | Blood lactate dehydrogenase increased | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 196 | Electrolyte imbalance | FAERS: 11 | US FAERS | |
| 197 | Gastric ulcer | FAERS: 11 | OFFSIDES US FAERS | |
| 198 | Metabolic acidosis | FAERS: 11 | OFFSIDES US FAERS | |
| 199 | Oxygen consumption increased | FAERS: 11 | OFFSIDES US FAERS | |
| 200 | Pregnancy of partner | FAERS: 11 | OFFSIDES US FAERS | |
| 201 | Pulmonary thrombosis | FAERS: 11 | US FAERS | |
| 202 | Shock | FAERS: 11 | SIDER US FAERS | |
| 203 | Sneezing | FAERS: 11 | US FAERS | |
| 204 | Unresponsive to stimuli | FAERS: 11 | US FAERS | |
| 205 | Vasculitis | FAERS: 11 | US FAERS | |
| 206 | Vertigo | FAERS: 11 | SIDER US FAERS | |
| 207 | Biopsy | FAERS: 10 | US FAERS | |
| 208 | Blood iron decreased | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 209 | Blood urine present | FAERS: 10 | OFFSIDES US FAERS | |
| 210 | Carbon dioxide increased | FAERS: 10 | US FAERS | |
| 211 | Cardiac Tamponade | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 212 | Hospice Care | FAERS: 10 | US FAERS | |
| 213 | Idiopathic Pulmonary Fibrosis | FAERS: 10 | US FAERS | |
| 214 | Lymphadenopathy | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 215 | Musculoskeletal discomfort | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 216 | Overdose | FAERS: 10 | US FAERS | |
| 217 | Rotator cuff syndrome | FAERS: 10 | US FAERS | |
| 218 | Sudden Cardiac Death | FAERS: 10 | OFFSIDES US FAERS | |
| 219 | Therapy non-responder | FAERS: 10 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 220 | Ulcer | FAERS: 10 | US FAERS | |
| 221 | Viral upper respiratory tract infection | FAERS: 10 | US FAERS | |
| 222 | colonoscopy | FAERS: 10 | US FAERS | |
| 223 | Alopecia | FAERS: 9 | US FAERS | |
| 224 | Cardiac Flutter | FAERS: 9 | US FAERS | |
| 225 | Catheter site infection | FAERS: 9 | OFFSIDES US FAERS | |
| 226 | Escherichia infection | FAERS: 9 | OFFSIDES US FAERS | |
| 227 | Hepatic congestion | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 228 | MYELODYSPLASTIC SYNDROME | FAERS: 9 | US FAERS | |
| 229 | Multiple Myeloma | FAERS: 9 | US FAERS | |
| 230 | Pancreatic carcinoma | FAERS: 9 | US FAERS | |
| 231 | Pulmonary arterial pressure increased | FAERS: 9 | US FAERS | |
| 232 | Rheumatoid Arthritis | FAERS: 9 | US FAERS | |
| 233 | Spinal fusion surgery | FAERS: 9 | US FAERS | |
| 234 | Subcutaneous Abscess | FAERS: 9 | OFFSIDES US FAERS | |
| 235 | Supraventricular tachycardia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 236 | Tooth Extraction | FAERS: 9 | US FAERS | |
| 237 | Tooth Infection | FAERS: 9 | US FAERS | |
| 238 | Urticaria | FAERS: 9 | SIDER US FAERS | |
| 239 | nervous system disorder | FAERS: 9 | SIDER US FAERS | |
| 240 | Agitation | FAERS: 8 | US FAERS | |
| 241 | Amputation | FAERS: 8 | OFFSIDES US FAERS | |
| 242 | Bedridden | FAERS: 8 | US FAERS | |
| 243 | Bronchiolitis | FAERS: 8 | US FAERS | |
| 244 | Bronchopulmonary Dysplasia | FAERS: 8 | US FAERS | |
| 245 | Cataract | FAERS: 8 | US FAERS | |
| 246 | Colectomy | FAERS: 8 | US FAERS | |
| 247 | Complication associated with device | FAERS: 8 | US FAERS | |
| 248 | Complications of transplant surgery | FAERS: 8 | OFFSIDES US FAERS | |
| 249 | Dialysis related complication | FAERS: 8 | US FAERS | |
| 250 | Embolism | FAERS: 8 | OFFSIDES US FAERS | |
| 251 | Gastric Bypass | FAERS: 8 | US FAERS | |
| 252 | General physical condition abnormal | FAERS: 8 | US FAERS | |
| 253 | Hemiparesis | FAERS: 8 | SIDER US FAERS | |
| 254 | Metastasis | FAERS: 8 | US FAERS | |
| 255 | Multimorbidity | FAERS: 8 | US FAERS | |
| 256 | Scleroderma renal crisis | FAERS: 8 | OFFSIDES US FAERS | |
| 257 | Secretion discharge | FAERS: 8 | OFFSIDES US FAERS | |
| 258 | Throat irritation | FAERS: 8 | US FAERS | |
| 259 | Tracheitis | FAERS: 8 | OFFSIDES US FAERS | |
| 260 | Tracheostomy malfunction | FAERS: 8 | US FAERS | |
| 261 | Abscess | FAERS: 7 | US FAERS | |
| 262 | Accidental overdose | FAERS: 7 | US FAERS | |
| 263 | Acute myocardial infarction | FAERS: 7 | US FAERS | |
| 264 | Aphasia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 265 | Arthropod bite | FAERS: 7 | OFFSIDES US FAERS | |
| 266 | Atrioventricular Block | FAERS: 7 | OFFSIDES US FAERS | |
| 267 | Brain natriuretic peptide increased | FAERS: 7 | OFFSIDES US FAERS | |
| 268 | CREST Syndrome | FAERS: 7 | US FAERS | |
| 269 | Carotid artery occlusion | FAERS: 7 | OFFSIDES US FAERS | |
| 270 | Choking sensation | FAERS: 7 | US FAERS | |
| 271 | Compression fracture | FAERS: 7 | OFFSIDES US FAERS | |
| 272 | Diastolic dysfunction | FAERS: 7 | US FAERS | |
| 273 | Drug administration error | FAERS: 7 | US FAERS | |
| 274 | Drug ineffective for unapproved indication | FAERS: 7 | US FAERS | |
| 275 | Dysarthria | FAERS: 7 | US FAERS | |
| 276 | Dysuria | FAERS: 7 | SIDER US FAERS | |
| 277 | Gastrointestinal infection | FAERS: 7 | US FAERS | |
| 278 | Hepatotoxicity | FAERS: 7 | OFFSIDES US FAERS | |
| 279 | Hypercapnia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 280 | Incorrect dose administered | FAERS: 7 | US FAERS | |
| 281 | Malnutrition | FAERS: 7 | SIDER US FAERS | |
| 282 | Mass excision | FAERS: 7 | US FAERS | |
| 283 | Maternal exposure during pregnancy | FAERS: 7 | US FAERS | |
| 284 | Meningitis | FAERS: 7 | US FAERS | |
| 285 | Neutropenia | FAERS: 7 | SIDER US FAERS | |
| 286 | Non-cardiac chest pain | FAERS: 7 | US FAERS | |
| 287 | Tonsillectomy | FAERS: 7 | US FAERS | |
| 288 | Transmission of drug via semen | FAERS: 7 | OFFSIDES US FAERS | |
| 289 | Uterine Cancer | FAERS: 7 | OFFSIDES US FAERS | |
| 290 | Wound Infection | FAERS: 7 | US FAERS | |
| 291 | Accidental exposure to product | FAERS: 6 | US FAERS | |
| 292 | Aphonia | FAERS: 6 | US FAERS | |
| 293 | Asphyxia | FAERS: 6 | US FAERS | |
| 294 | Atypical pneumonia | FAERS: 6 | US FAERS | |
| 295 | Blood glucose abnormal | FAERS: 6 | US FAERS | |
| 296 | Blood pressure fluctuation | FAERS: 6 | US FAERS | |
| 297 | Chromaturia | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 298 | Clostridium difficile colitis | FAERS: 6 | US FAERS | |
| 299 | Delirium | FAERS: 6 | US FAERS | |
| 300 | Device malfunction | FAERS: 6 | US FAERS | |
| 301 | Endarterectomy | FAERS: 6 | OFFSIDES US FAERS | |
| 302 | Failure to Thrive | FAERS: 6 | OFFSIDES US FAERS | |
| 303 | Flatulence | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 304 | Gastrointestinal carcinoma | FAERS: 6 | US FAERS | |
| 305 | Glaucoma | FAERS: 6 | US FAERS | |
| 306 | Increased upper airway secretion | FAERS: 6 | US FAERS | |
| 307 | Lymphoma | FAERS: 6 | OFFSIDES US FAERS | |
| 308 | Mastoiditis | FAERS: 6 | OFFSIDES US FAERS | |
| 309 | Medical device removal | FAERS: 6 | OFFSIDES US FAERS | |
| 310 | Metrorrhagia | FAERS: 6 | US FAERS | |
| 311 | Musculoskeletal chest pain | FAERS: 6 | US FAERS | |
| 312 | Nervousness | FAERS: 6 | US FAERS | |
| 313 | Oxygen saturation abnormal | FAERS: 6 | US FAERS | |
| 314 | Paranoia | FAERS: 6 | US FAERS | |
| 315 | Pericarditis | FAERS: 6 | OFFSIDES US FAERS | |
| 316 | Portal Hypertension | FAERS: 6 | OFFSIDES US FAERS | |
| 317 | Post procedural infection | FAERS: 6 | US FAERS | |
| 318 | Renal tubular necrosis | FAERS: 6 | US FAERS | |
| 319 | Retching | FAERS: 6 | US FAERS | |
| 320 | Spinal column injury | FAERS: 6 | US FAERS | |
| 321 | Spinal column stenosis | FAERS: 6 | US FAERS | |
| 322 | Tinnitus | FAERS: 6 | SIDER US FAERS | |
| 323 | Transplant evaluation | FAERS: 6 | US FAERS | |
| 324 | Urinary Retention | FAERS: 6 | US FAERS | |
| 325 | cancer surgery | FAERS: 6 | US FAERS | |
| 326 | Activities of daily living impaired | FAERS: 5 | US FAERS | |
| 327 | Aneurysm | FAERS: 5 | US FAERS | |
| 328 | Aortic Aneurysm | FAERS: 5 | US FAERS | |
| 329 | Aortic Valve Stenosis | FAERS: 5 | US FAERS | |
| 330 | Arterial therapeutic procedure | FAERS: 5 | US FAERS | |
| 331 | Atelectasis | FAERS: 5 | US FAERS | |
| 332 | Blood magnesium decreased | FAERS: 5 | OFFSIDES US FAERS | |
| 333 | Burning sensation | FAERS: 5 | US FAERS | |
| 334 | Cardiac Death | FAERS: 5 | US FAERS | |
| 335 | Catheter site pain | FAERS: 5 | US FAERS | |
| 336 | Diabetic ulcer | FAERS: 5 | US FAERS | |
| 337 | Discomfort | FAERS: 5 | SIDER US FAERS | |
| 338 | Dry skin | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 339 | Dysgeusia | FAERS: 5 | US FAERS | |
| 340 | Dyspnoea exacerbated | FAERS: 5 | OFFSIDES US FAERS | |
| 341 | Eosinophilia | FAERS: 5 | SIDER US FAERS | |
| 342 | Extra dose administered | FAERS: 5 | US FAERS | |
| 343 | Eye Infection | FAERS: 5 | US FAERS | |
| 344 | Fibromyalgia | FAERS: 5 | US FAERS | |
| 345 | Fibrosis | FAERS: 5 | 8794820 | CTD US FAERS |
| 346 | Food Poisoning | FAERS: 5 | OFFSIDES US FAERS | |
| 347 | Gastrointestinal motility disorder | FAERS: 5 | US FAERS | |
| 348 | Head discomfort | FAERS: 5 | US FAERS | |
| 349 | Hepatitis C | FAERS: 5 | US FAERS | |
| 350 | Hypersomnia | FAERS: 5 | US FAERS | |
| 351 | Lobar Pneumonia | FAERS: 5 | US FAERS | |
| 352 | Mastectomy | FAERS: 5 | US FAERS | |
| 353 | Metastatic Neoplasm | FAERS: 5 | US FAERS | |
| 354 | Multiple Sclerosis | FAERS: 5 | OFFSIDES US FAERS | |
| 355 | Nerve injury | FAERS: 5 | US FAERS | |
| 356 | Ocular icterus | FAERS: 5 | OFFSIDES US FAERS | |
| 357 | Proteinuria | FAERS: 5 | 8604712 | CTD US FAERS |
| 358 | Pulmonary artery therapeutic procedure | FAERS: 5 | US FAERS | |
| 359 | Right Ventricular Dysfunction | FAERS: 5 | OFFSIDES US FAERS | |
| 360 | Seizure like phenomena | FAERS: 5 | US FAERS | |
| 361 | Skeletal injury | FAERS: 5 | US FAERS | |
| 362 | Skin neoplasm excision | FAERS: 5 | US FAERS | |
| 363 | Stem cell transplant | FAERS: 5 | US FAERS | |
| 364 | Suicide attempt | FAERS: 5 | US FAERS | |
| 365 | Tuberculosis | FAERS: 5 | US FAERS | |
| 366 | Urinary Incontinence | FAERS: 5 | US FAERS | |
| 367 | Walking distance test abnormal | FAERS: 5 | US FAERS | |
| 368 | Ageusia | FAERS: 4 | US FAERS | |
| 369 | Altered state of consciousness | FAERS: 4 | OFFSIDES US FAERS | |
| 370 | Angioedema | FAERS: 4 | SIDER US FAERS | |
| 371 | Angioplasty | FAERS: 4 | US FAERS | |
| 372 | Anorexia | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 373 | Anti-neutrophil cytoplasmic antibody positive vasculitis | FAERS: 4 | OFFSIDES US FAERS | |
| 374 | Asbestosis | FAERS: 4 | US FAERS | |
| 375 | Basal cell carcinoma | FAERS: 4 | US FAERS | |
| 376 | Bilirubin conjugated increased | FAERS: 4 | OFFSIDES US FAERS | |
| 377 | Blood albumin decreased | FAERS: 4 | OFFSIDES US FAERS | |
| 378 | Cardiac septal defect repair | FAERS: 4 | US FAERS | |
| 379 | Central nervous system lesion | FAERS: 4 | US FAERS | |
| 380 | Cerebral Infarction | FAERS: 4 | US FAERS | |
| 381 | Cyst | FAERS: 4 | OFFSIDES US FAERS | |
| 382 | Depressed Level of Consciousness | FAERS: 4 | US FAERS | |
| 383 | Device occlusion | FAERS: 4 | US FAERS | |
| 384 | Device related sepsis | FAERS: 4 | US FAERS | |
| 385 | Drug toxicity | FAERS: 4 | OFFSIDES US FAERS | |
| 386 | Electrocardiogram abnormal | FAERS: 4 | US FAERS | |
| 387 | Emotional distress | FAERS: 4 | US FAERS | |
| 388 | Erectile dysfunction | FAERS: 4 | US FAERS | |
| 389 | Euthanasia | FAERS: 4 | OFFSIDES US FAERS | |
| 390 | Flank Pain | FAERS: 4 | US FAERS | |
| 391 | Foaming at mouth | FAERS: 4 | US FAERS | |
| 392 | Gastrointestinal viral infection | FAERS: 4 | US FAERS | |
| 393 | Hypokinesia | FAERS: 4 | US FAERS | |
| 394 | Hypothyroidism | FAERS: 4 | US FAERS | |
| 395 | Impaired gastric emptying | FAERS: 4 | US FAERS | |
| 396 | Intestinal Perforation | FAERS: 4 | US FAERS | |
| 397 | Intestinal resection | FAERS: 4 | US FAERS | |
| 398 | Iron deficiency | FAERS: 4 | US FAERS | |
| 399 | Laparotomy | FAERS: 4 | US FAERS | |
| 400 | Live Birth | FAERS: 4 | US FAERS | |
| 401 | Localised intraabdominal fluid collection | FAERS: 4 | US FAERS | |
| 402 | Loss of personal independence in daily activities | FAERS: 4 | US FAERS | |
| 403 | Lyme Disease | FAERS: 4 | US FAERS | |
| 404 | Multiple allergies | FAERS: 4 | US FAERS | |
| 405 | Muscle strain | FAERS: 4 | US FAERS | |
| 406 | Myositis | FAERS: 4 | US FAERS | |
| 407 | Obesity | FAERS: 4 | US FAERS | |
| 408 | Peripheral arterial occlusive disease | FAERS: 4 | US FAERS | |
| 409 | Product supply issue | FAERS: 4 | US FAERS | |
| 410 | Rales | FAERS: 4 | OFFSIDES US FAERS | |
| 411 | Rash erythematous | FAERS: 4 | US FAERS | |
| 412 | Respiratory tract infection viral | FAERS: 4 | US FAERS | |
| 413 | Right ventricular systolic pressure increased | FAERS: 4 | OFFSIDES US FAERS | |
| 414 | Scrotal Infection | FAERS: 4 | OFFSIDES US FAERS | |
| 415 | Skin lesion | FAERS: 4 | OFFSIDES US FAERS | |
| 416 | Sleep study abnormal | FAERS: 4 | US FAERS | |
| 417 | Spinal cord infection | FAERS: 4 | US FAERS | |
| 418 | Splenic Rupture | FAERS: 4 | US FAERS | |
| 419 | Squamous cell carcinoma | FAERS: 4 | US FAERS | |
| 420 | Staring | FAERS: 4 | US FAERS | |
| 421 | Stridor | FAERS: 4 | US FAERS | |
| 422 | Therapeutic procedure | FAERS: 4 | US FAERS | |
| 423 | Thoracic cavity drainage | FAERS: 4 | US FAERS | |
| 424 | Thyroidectomy | FAERS: 4 | US FAERS | |
| 425 | Toe operation | FAERS: 4 | US FAERS | |
| 426 | Tracheobronchitis | FAERS: 4 | SIDER US FAERS | |
| 427 | Ventricular Fibrillation | FAERS: 4 | US FAERS | |
| 428 | muscle injury | FAERS: 4 | OFFSIDES US FAERS | |
| 429 | Abdominal cavity drainage | FAERS: 3 | US FAERS | |
| 430 | Acute Coronary Syndrome | FAERS: 3 | SIDER US FAERS | |
| 431 | Agranulocytosis | FAERS: 3 | US FAERS | |
| 432 | Arteriosclerosis | FAERS: 3 | US FAERS | |
| 433 | Atrial tachycardia | FAERS: 3 | OFFSIDES US FAERS | |
| 434 | Atrioventricular Septal Defect | FAERS: 3 | US FAERS | |
| 435 | Bacterial sepsis | FAERS: 3 | US FAERS | |
| 436 | Bladder Neoplasm | FAERS: 3 | US FAERS | |
| 437 | Blood carbon monoxide increased | FAERS: 3 | US FAERS | |
| 438 | Blood creatine increased | FAERS: 3 | OFFSIDES US FAERS | |
| 439 | Blood gases abnormal | FAERS: 3 | US FAERS | |
| 440 | Blood glucose fluctuation | FAERS: 3 | US FAERS | |
| 441 | Blood potassium abnormal | FAERS: 3 | US FAERS | |
| 442 | Blood sodium abnormal | FAERS: 3 | US FAERS | |
| 443 | Bone marrow toxicity | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 444 | Brain Abscess | FAERS: 3 | OFFSIDES US FAERS | |
| 445 | Breast Feeding | FAERS: 3 | US FAERS | |
| 446 | Cachexia | FAERS: 3 | US FAERS | |
| 447 | Cancer Pain | FAERS: 3 | US FAERS | |
| 448 | Candidiasis | FAERS: 3 | US FAERS | |
| 449 | Cardiac enzymes increased | FAERS: 3 | OFFSIDES US FAERS | |
| 450 | Cardiac procedure complication | FAERS: 3 | US FAERS | |
| 451 | Cardiovascular insufficiency | FAERS: 3 | US FAERS | |
| 452 | Catheter placement | FAERS: 3 | US FAERS | |
| 453 | Catheter related infection | FAERS: 3 | OFFSIDES US FAERS | |
| 454 | Cholangitis | FAERS: 3 | US FAERS | |
| 455 | Cholecystitis infective | FAERS: 3 | US FAERS | |
| 456 | Coccidioidomycosis | FAERS: 3 | US FAERS | |
| 457 | Completed Suicide | FAERS: 3 | US FAERS | |
| 458 | Cyst removal | FAERS: 3 | US FAERS | |
| 459 | Dengue Fever | FAERS: 3 | US FAERS | |
| 460 | Dermatitis | FAERS: 3 | SIDER US FAERS | |
| 461 | Device breakage | FAERS: 3 | US FAERS | |
| 462 | Diabetes mellitus inadequate control | FAERS: 3 | US FAERS | |
| 463 | Diabetic Ketoacidosis | FAERS: 3 | US FAERS | |
| 464 | Diplopia | FAERS: 3 | US FAERS | |
| 465 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 466 | Drug exposure before pregnancy | FAERS: 3 | OFFSIDES US FAERS | |
| 467 | Eczema | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 468 | Erysipelas | FAERS: 3 | OFFSIDES US FAERS | |
| 469 | Exposure via father | FAERS: 3 | US FAERS | |
| 470 | Feeding tube complication | FAERS: 3 | US FAERS | |
| 471 | Fibrin D dimer increased | FAERS: 3 | US FAERS | |
| 472 | Full blood count decreased | FAERS: 3 | US FAERS | |
| 473 | Gait inability | FAERS: 3 | US FAERS | |
| 474 | Gastrectomy | FAERS: 3 | US FAERS | |
| 475 | Gastrointestinal angiodysplasia | FAERS: 3 | US FAERS | |
| 476 | Genital infection | FAERS: 3 | US FAERS | |
| 477 | Glaucoma surgery | FAERS: 3 | US FAERS | |
| 478 | Groin infection | FAERS: 3 | US FAERS | |
| 479 | Heat Exhaustion | FAERS: 3 | US FAERS | |
| 480 | Heat Stroke | FAERS: 3 | US FAERS | |
| 481 | Human metapneumovirus test positive | FAERS: 3 | US FAERS | |
| 482 | Human rhinovirus test positive | FAERS: 3 | US FAERS | |
| 483 | Hypertensive crisis | FAERS: 3 | US FAERS | |
| 484 | Hyperthyroidism | FAERS: 3 | US FAERS | |
| 485 | Hyperventilation | FAERS: 3 | US FAERS | |
| 486 | Hypophagia | FAERS: 3 | OFFSIDES US FAERS | |
| 487 | Ileus | FAERS: 3 | US FAERS | |
| 488 | Immobile | FAERS: 3 | US FAERS | |
| 489 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 490 | Incision site infection | FAERS: 3 | OFFSIDES US FAERS | |
| 491 | Inflammatory marker increased | FAERS: 3 | US FAERS | |
| 492 | Joint sprain | FAERS: 3 | OFFSIDES US FAERS | |
| 493 | Jugular vein distension | FAERS: 3 | US FAERS | |
| 494 | Klebsiella sepsis | FAERS: 3 | OFFSIDES US FAERS | |
| 495 | Large intestine perforation | FAERS: 3 | US FAERS | |
| 496 | Leukocytosis | FAERS: 3 | US FAERS | |
| 497 | Lipoma | FAERS: 3 | US FAERS | |
| 498 | Low Cardiac Output Syndrome | FAERS: 3 | OFFSIDES US FAERS | |
| 499 | Lupus Nephritis | FAERS: 3 | OFFSIDES US FAERS | |
| 500 | Malignant neoplasm progression | FAERS: 3 | OFFSIDES US FAERS | |
| 501 | Marasmus | FAERS: 3 | US FAERS | |
| 502 | Menorrhagia | FAERS: 3 | US FAERS | |
| 503 | Mineral supplementation | FAERS: 3 | US FAERS | |
| 504 | Mitral Valve Stenosis | FAERS: 3 | US FAERS | |
| 505 | Neck Pain | FAERS: 3 | US FAERS | |
| 506 | Neonatal disorder | FAERS: 3 | US FAERS | |
| 507 | Neuralgia | FAERS: 3 | US FAERS | |
| 508 | Nodular regenerative hyperplasia | FAERS: 3 | OFFSIDES US FAERS | |
| 509 | Obesity surgery | FAERS: 3 | US FAERS | |
| 510 | Occult blood positive | FAERS: 3 | US FAERS | |
| 511 | Occupational exposure to product | FAERS: 3 | US FAERS | |
| 512 | Otitis Externa | FAERS: 3 | US FAERS | |
| 513 | Pancreatic Neoplasm | FAERS: 3 | US FAERS | |
| 514 | Pancreatic enzymes increased | FAERS: 3 | US FAERS | |
| 515 | Paracentesis | FAERS: 3 | US FAERS | |
| 516 | Paranasal sinus hypersecretion | FAERS: 3 | US FAERS | |
| 517 | Parotitis | FAERS: 3 | OFFSIDES US FAERS | |
| 518 | Patent ductus arteriosus | FAERS: 3 | US FAERS | |
| 519 | Peripheral artery occlusion | FAERS: 3 | US FAERS | |
| 520 | Pleuritic pain | FAERS: 3 | US FAERS | |
| 521 | Pneumococcal sepsis | FAERS: 3 | OFFSIDES US FAERS | |
| 522 | Pneumonitis | FAERS: 3 | US FAERS | |
| 523 | Post procedural sepsis | FAERS: 3 | OFFSIDES US FAERS | |
| 524 | Pregnancy on oral contraceptive | FAERS: 3 | OFFSIDES US FAERS | |
| 525 | Protein total increased | FAERS: 3 | OFFSIDES US FAERS | |
| 526 | Psoriasis | FAERS: 3 | US FAERS | |
| 527 | Pulmonary endarterectomy | FAERS: 3 | US FAERS | |
| 528 | Pulmonary granuloma | FAERS: 3 | US FAERS | |
| 529 | Pulmonary pain | FAERS: 3 | US FAERS | |
| 530 | Purpura | FAERS: 3 | US FAERS | |
| 531 | Rebound effect | FAERS: 3 | US FAERS | |
| 532 | Rectal Prolapse | FAERS: 3 | US FAERS | |
| 533 | Red blood cell morphology abnormal | FAERS: 3 | US FAERS | |
| 534 | Restrictive pulmonary disease | FAERS: 3 | US FAERS | |
| 535 | Retinal Detachment | FAERS: 3 | US FAERS | |
| 536 | Sinus operation | FAERS: 3 | US FAERS | |
| 537 | Squamous cell carcinoma of lung | FAERS: 3 | US FAERS | |
| 538 | Staphylococcus test positive | FAERS: 3 | US FAERS | |
| 539 | Surgical failure | FAERS: 3 | US FAERS | |
| 540 | Thrombectomy | FAERS: 3 | US FAERS | |
| 541 | Thromboembolectomy | FAERS: 3 | US FAERS | |
| 542 | Toothache | FAERS: 3 | SIDER US FAERS | |
| 543 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 544 | Troponin increased | FAERS: 3 | OFFSIDES US FAERS | |
| 545 | Umbilical hernia | FAERS: 3 | US FAERS | |
| 546 | Upper airway obstruction | FAERS: 3 | US FAERS | |
| 547 | VIIth nerve paralysis | FAERS: 3 | US FAERS | |
| 548 | Venous occlusion | FAERS: 3 | US FAERS | |
| 549 | Ventricular hypertrophy | FAERS: 3 | US FAERS | |
| 550 | Wound Complication | FAERS: 3 | US FAERS | |
| 551 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 552 | angiogram | FAERS: 3 | US FAERS | |
| 553 | Abdominal Abscess | FAERS: 2 | US FAERS | |
| 554 | Abdominal Infection | FAERS: 2 | US FAERS | |
| 555 | Abdominal adhesions | FAERS: 2 | US FAERS | |
| 556 | Acne | FAERS: 2 | US FAERS | |
| 557 | Adenocarcinoma | FAERS: 2 | OFFSIDES US FAERS | |
| 558 | Administration site infection | FAERS: 2 | US FAERS | |
| 559 | Amyloidosis | FAERS: 2 | US FAERS | |
| 560 | Anisocytosis | FAERS: 2 | US FAERS | |
| 561 | Anti-platelet antibody positive | FAERS: 2 | OFFSIDES US FAERS | |
| 562 | Aortic necrosis | FAERS: 2 | US FAERS | |
| 563 | Application site irritation | FAERS: 2 | US FAERS | |
| 564 | Biliary sepsis | FAERS: 2 | OFFSIDES US FAERS | |
| 565 | Blood electrolytes abnormal | FAERS: 2 | US FAERS | |
| 566 | Blood electrolytes decreased | FAERS: 2 | US FAERS | |
| 567 | Blood immunoglobulin G increased | FAERS: 2 | OFFSIDES US FAERS | |
| 568 | Blood sodium increased | FAERS: 2 | OFFSIDES US FAERS | |
| 569 | Blood thyroid stimulating hormone increased | FAERS: 2 | US FAERS | |
| 570 | Bone pain | FAERS: 2 | US FAERS | |
| 571 | Breast cancer recurrent | FAERS: 2 | OFFSIDES US FAERS | |
| 572 | Bronchospasm | FAERS: 2 | SIDER US FAERS | |
| 573 | Cardiac assistance device user | FAERS: 2 | US FAERS | |
| 574 | Cardiac stress test abnormal | FAERS: 2 | US FAERS | |
| 575 | Cardiopulmonary Bypass | FAERS: 2 | US FAERS | |
| 576 | Carotid Endarterectomy | FAERS: 2 | US FAERS | |
| 577 | Catheter site cellulitis | FAERS: 2 | US FAERS | |
| 578 | Catheter site erythema | FAERS: 2 | US FAERS | |
| 579 | Catheter site swelling | FAERS: 2 | US FAERS | |
| 580 | Cervix carcinoma recurrent | FAERS: 2 | US FAERS | |
| 581 | Cervix carcinoma | FAERS: 2 | US FAERS | |
| 582 | Cholangiocarcinoma | FAERS: 2 | US FAERS | |
| 583 | Citrate toxicity | FAERS: 2 | US FAERS | |
| 584 | Complement factor C3 decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 585 | Complement factor C4 decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 586 | Complications of maternal exposure to therapeutic drugs | FAERS: 2 | OFFSIDES US FAERS | |
| 587 | Congenital diaphragmatic hernia | FAERS: 2 | US FAERS | |
| 588 | Congenital hydronephrosis | FAERS: 2 | US FAERS | |
| 589 | Conjunctivitis | FAERS: 2 | SIDER US FAERS | |
| 590 | Continuous Positive Airway Pressure | FAERS: 2 | US FAERS | |
| 591 | Contrast media allergy | FAERS: 2 | US FAERS | |
| 592 | Contrast media reaction | FAERS: 2 | US FAERS | |
| 593 | Coronary artery insufficiency | FAERS: 2 | US FAERS | |
| 594 | Crying | FAERS: 2 | US FAERS | |
| 595 | Cystic Fibrosis | FAERS: 2 | US FAERS | |
| 596 | Depressed mood | FAERS: 2 | US FAERS | |
| 597 | Device dislocation | FAERS: 2 | US FAERS | |
| 598 | Device electrical finding | FAERS: 2 | OFFSIDES US FAERS | |
| 599 | Dialysis device insertion | FAERS: 2 | US FAERS | |
| 600 | Dissociation | FAERS: 2 | US FAERS | |
| 601 | Drug Dependence | FAERS: 2 | US FAERS | |
| 602 | Drug Tolerance | FAERS: 2 | US FAERS | |
| 603 | Drug abuse | FAERS: 2 | US FAERS | |
| 604 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 605 | Duodenal ulcer perforation | FAERS: 2 | OFFSIDES US FAERS | |
| 606 | Echocardiogram abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 607 | Echography abnormal | FAERS: 2 | US FAERS | |
| 608 | Elbow operation | FAERS: 2 | US FAERS | |
| 609 | Electromechanical dissociation | FAERS: 2 | US FAERS | |
| 610 | Emergency Care | FAERS: 2 | US FAERS | |
| 611 | Extracorporeal Membrane Oxygenation | FAERS: 2 | US FAERS | |
| 612 | Extremity necrosis | FAERS: 2 | OFFSIDES US FAERS | |
| 613 | Feeling Cold | FAERS: 2 | US FAERS | |
| 614 | Feeling jittery | FAERS: 2 | US FAERS | |
| 615 | Folliculitis | FAERS: 2 | US FAERS | |
| 616 | Fracture treatment | FAERS: 2 | US FAERS | |
| 617 | Gammopathy | FAERS: 2 | OFFSIDES US FAERS | |
| 618 | Gastric infection | FAERS: 2 | US FAERS | |
| 619 | Gastrostomy | FAERS: 2 | US FAERS | |
| 620 | Glossectomy | FAERS: 2 | US FAERS | |
| 621 | Graft dysfunction | FAERS: 2 | OFFSIDES US FAERS | |
| 622 | Heart valve calcification | FAERS: 2 | OFFSIDES US FAERS | |
| 623 | Hepatitis B | FAERS: 2 | US FAERS | |
| 624 | Hepatorenal Syndrome | FAERS: 2 | US FAERS | |
| 625 | Hernia perforation | FAERS: 2 | US FAERS | |
| 626 | Humidity intolerance | FAERS: 2 | US FAERS | |
| 627 | Hyperchlorhydria | FAERS: 2 | US FAERS | |
| 628 | Hypersplenism | FAERS: 2 | US FAERS | |
| 629 | Hyperviscosity syndrome | FAERS: 2 | OFFSIDES US FAERS | |
| 630 | Hypoaesthesia facial | FAERS: 2 | US FAERS | |
| 631 | Hypoventilation | FAERS: 2 | US FAERS | |
| 632 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 633 | Incorrect drug administration duration | FAERS: 2 | OFFSIDES US FAERS | |
| 634 | Increased tendency to bruise | FAERS: 2 | US FAERS | |
| 635 | Infected bite | FAERS: 2 | US FAERS | |
| 636 | Infectious Mononucleosis | FAERS: 2 | US FAERS | |
| 637 | Infective aortitis | FAERS: 2 | US FAERS | |
| 638 | Infusion site bruising | FAERS: 2 | US FAERS | |
| 639 | Injection site infection | FAERS: 2 | US FAERS | |
| 640 | Insurance issue | FAERS: 2 | US FAERS | |
| 641 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 642 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 643 | Intervertebral disc disorder | FAERS: 2 | US FAERS | |
| 644 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 645 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 646 | Laryngitis | FAERS: 2 | US FAERS | |
| 647 | Limb crushing injury | FAERS: 2 | US FAERS | |
| 648 | Liver Abscess | FAERS: 2 | OFFSIDES US FAERS | |
| 649 | Liver scan abnormal | FAERS: 2 | US FAERS | |
| 650 | Living in residential institution | FAERS: 2 | US FAERS | |
| 651 | Lung adenocarcinoma recurrent | FAERS: 2 | US FAERS | |
| 652 | Lupus-like syndrome | FAERS: 2 | US FAERS | |
| 653 | Lymphocyte count decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 654 | Macular degeneration | FAERS: 2 | US FAERS | |
| 655 | Malabsorption | FAERS: 2 | OFFSIDES US FAERS | |
| 656 | Markedly reduced dietary intake | FAERS: 2 | US FAERS | |
| 657 | Medical device change | FAERS: 2 | US FAERS | |
| 658 | Meningioma | FAERS: 2 | US FAERS | |
| 659 | Meningorrhagia | FAERS: 2 | US FAERS | |
| 660 | Menopause | FAERS: 2 | US FAERS | |
| 661 | Mental impairment | FAERS: 2 | OFFSIDES US FAERS | |
| 662 | Multiple sclerosis relapse | FAERS: 2 | US FAERS | |
| 663 | Muscle tightness | FAERS: 2 | US FAERS | |
| 664 | Myomectomy | FAERS: 2 | US FAERS | |
| 665 | Myopathy | FAERS: 2 | US FAERS | |
| 666 | Nasal discomfort | FAERS: 2 | OFFSIDES US FAERS | |
| 667 | Nasal inflammation | FAERS: 2 | US FAERS | |
| 668 | Nephrectomy | FAERS: 2 | US FAERS | |
| 669 | Nephritis | FAERS: 2 | US FAERS | |
| 670 | Neutrophil count decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 671 | Onychoclasis | FAERS: 2 | US FAERS | |
| 672 | Oral infection | FAERS: 2 | US FAERS | |
| 673 | Osteoporosis | FAERS: 2 | US FAERS | |
| 674 | Oxygen saturation increased | FAERS: 2 | US FAERS | |
| 675 | Palliative Care | FAERS: 2 | US FAERS | |
| 676 | Pallor | FAERS: 2 | OFFSIDES US FAERS | |
| 677 | Pancreas lipomatosis | FAERS: 2 | US FAERS | |
| 678 | Pancreatic Cyst | FAERS: 2 | US FAERS | |
| 679 | Pathological fracture | FAERS: 2 | US FAERS | |
| 680 | Pelvic Pain | FAERS: 2 | US FAERS | |
| 681 | Percutaneous Coronary Intervention | FAERS: 2 | US FAERS | |
| 682 | Pericarditis malignant | FAERS: 2 | US FAERS | |
| 683 | Peritoneal Dialysis | FAERS: 2 | OFFSIDES US FAERS | |
| 684 | Peritonitis | FAERS: 2 | US FAERS | |
| 685 | Phantom pain | FAERS: 2 | US FAERS | |
| 686 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 687 | Platelet count abnormal | FAERS: 2 | US FAERS | |
| 688 | Pneumonectomy | FAERS: 2 | US FAERS | |
| 689 | Poikilocytosis | FAERS: 2 | OFFSIDES US FAERS | |
| 690 | Polyneuropathy | FAERS: 2 | OFFSIDES US FAERS | |
| 691 | Portal shunt procedure | FAERS: 2 | US FAERS | |
| 692 | Post procedural bile leak | FAERS: 2 | US FAERS | |
| 693 | Post procedural discharge | FAERS: 2 | US FAERS | |
| 694 | Precancerous cells present | FAERS: 2 | US FAERS | |
| 695 | Precancerous skin lesion | FAERS: 2 | US FAERS | |
| 696 | Pregnancy on contraceptive | FAERS: 2 | OFFSIDES US FAERS | |
| 697 | Pregnancy test positive | FAERS: 2 | US FAERS | |
| 698 | Product administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 699 | Product administration error | FAERS: 2 | US FAERS | |
| 700 | Product solubility abnormal | FAERS: 2 | US FAERS | |
| 701 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 702 | Prostatectomy | FAERS: 2 | US FAERS | |
| 703 | Protein-losing gastroenteropathy | FAERS: 2 | US FAERS | |
| 704 | Pulmonary arterial pressure | FAERS: 2 | US FAERS | |
| 705 | Pulmonary vascular resistance abnormality | FAERS: 2 | US FAERS | |
| 706 | Pyelectasia | FAERS: 2 | OFFSIDES US FAERS | |
| 707 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 708 | Renal Artery Stenosis | FAERS: 2 | OFFSIDES US FAERS | |
| 709 | Renal artery stent placement | FAERS: 2 | US FAERS | |
| 710 | Renal artery stent removal | FAERS: 2 | US FAERS | |
| 711 | Respiratory syncytial virus bronchitis | FAERS: 2 | US FAERS | |
| 712 | Restless Legs Syndrome | FAERS: 2 | SIDER US FAERS | |
| 713 | Restlessness | FAERS: 2 | US FAERS | |
| 714 | Right atrial dilatation | FAERS: 2 | US FAERS | |
| 715 | Rosacea | FAERS: 2 | US FAERS | |
| 716 | Scleroderma associated digital ulcer | FAERS: 2 | US FAERS | |
| 717 | Sick Sinus Syndrome | FAERS: 2 | OFFSIDES US FAERS | |
| 718 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 719 | Skin irritation | FAERS: 2 | US FAERS | |
| 720 | Skin laceration | FAERS: 2 | OFFSIDES US FAERS | |
| 721 | Skin necrosis | FAERS: 2 | OFFSIDES US FAERS | |
| 722 | Squamous cell carcinoma of skin | FAERS: 2 | US FAERS | |
| 723 | Stevens-Johnson Syndrome | FAERS: 2 | SIDER US FAERS | |
| 724 | Stomatitis | FAERS: 2 | SIDER US FAERS | |
| 725 | Subclavian artery thrombosis | FAERS: 2 | US FAERS | |
| 726 | Sunburn | FAERS: 2 | US FAERS | |
| 727 | Suture insertion | FAERS: 2 | US FAERS | |
| 728 | Suture rupture | FAERS: 2 | US FAERS | |
| 729 | Sympathectomy | FAERS: 2 | US FAERS | |
| 730 | Systemic Inflammatory Response Syndrome | FAERS: 2 | US FAERS | |
| 731 | Systemic Scleroderma | FAERS: 2 | US FAERS | |
| 732 | Therapy change | FAERS: 2 | US FAERS | |
| 733 | Thoracic vertebral fracture | FAERS: 2 | US FAERS | |
| 734 | Thyroid Neoplasm | FAERS: 2 | US FAERS | |
| 735 | Thyroiditis | FAERS: 2 | US FAERS | |
| 736 | Tongue biting | FAERS: 2 | US FAERS | |
| 737 | Toxic Shock Syndrome | FAERS: 2 | US FAERS | |
| 738 | Tracheal Stenosis | FAERS: 2 | US FAERS | |
| 739 | Tracheostomy infection | FAERS: 2 | US FAERS | |
| 740 | Transfusion Reaction | FAERS: 2 | US FAERS | |
| 741 | Trisomy 21 | FAERS: 2 | US FAERS | |
| 742 | Troponin I increased | FAERS: 2 | OFFSIDES US FAERS | |
| 743 | Type III immune complex mediated reaction | FAERS: 2 | US FAERS | |
| 744 | Urine output increased | FAERS: 2 | US FAERS | |
| 745 | Varicella post vaccine | FAERS: 2 | US FAERS | |
| 746 | Vascular compression | FAERS: 2 | US FAERS | |
| 747 | Vascular device infection | FAERS: 2 | US FAERS | |
| 748 | Vascular procedure complication | FAERS: 2 | US FAERS | |
| 749 | Vena cava filter insertion | FAERS: 2 | US FAERS | |
| 750 | Venoocclusive disease | FAERS: 2 | SIDER US FAERS | |
| 751 | Ventricular Dysfunction | FAERS: 2 | US FAERS | |
| 752 | Viral test positive | FAERS: 2 | US FAERS | |
| 753 | Vulvovaginal swelling | FAERS: 2 | US FAERS | |
| 754 | Wheelchair user | FAERS: 2 | US FAERS | |
| 755 | Wound infection staphylococcal | FAERS: 2 | US FAERS | |
| 756 | X-ray abnormal | FAERS: 2 | US FAERS | |
| 757 | Xanthopsia | FAERS: 2 | US FAERS | |
| 758 | Abdominal incarcerated hernia | FAERS: 1 | US FAERS | |
| 759 | Abdominal mass | FAERS: 1 | US FAERS | |
| 760 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 761 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 762 | Acidosis | FAERS: 1 | OFFSIDES US FAERS | |
| 763 | Activated partial thromboplastin time shortened | FAERS: 1 | US FAERS | |
| 764 | Acute left ventricular failure | FAERS: 1 | US FAERS | |
| 765 | Acute prerenal failure | FAERS: 1 | OFFSIDES US FAERS | |
| 766 | Acute right ventricular failure | FAERS: 1 | US FAERS | |
| 767 | Adams-Stokes Syndrome | FAERS: 1 | US FAERS | |
| 768 | Adenoidal disorder | FAERS: 1 | US FAERS | |
| 769 | Administration related reaction | FAERS: 1 | US FAERS | |
| 770 | Adrenal mass | FAERS: 1 | US FAERS | |
| 771 | Alanine aminotransferase decreased | FAERS: 1 | US FAERS | |
| 772 | Ammonia abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 773 | Amylase increased | FAERS: 1 | US FAERS | |
| 774 | Angiodysplasia | FAERS: 1 | OFFSIDES US FAERS | |
| 775 | Angiotensin converting enzyme increased | FAERS: 1 | US FAERS | |
| 776 | Animal bite | FAERS: 1 | US FAERS | |
| 777 | Anti-SS-A antibody positive | FAERS: 1 | US FAERS | |
| 778 | Anti-cyclic citrullinated peptide antibody positive | FAERS: 1 | US FAERS | |
| 779 | Anticoagulation drug level below therapeutic | FAERS: 1 | US FAERS | |
| 780 | Aortic Injury | FAERS: 1 | US FAERS | |
| 781 | Aortic Rupture | FAERS: 1 | US FAERS | |
| 782 | Aortic aneurysm repair | FAERS: 1 | US FAERS | |
| 783 | Aortic bypass | FAERS: 1 | US FAERS | |
| 784 | Aortic surgery | FAERS: 1 | US FAERS | |
| 785 | Aortic valve calcification | FAERS: 1 | US FAERS | |
| 786 | Apathy | FAERS: 1 | OFFSIDES US FAERS | |
| 787 | Apgar score normal | FAERS: 1 | US FAERS | |
| 788 | Aphagia | FAERS: 1 | US FAERS | |
| 789 | Apparent death | FAERS: 1 | US FAERS | |
| 790 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 791 | Arteriovenous fistula | FAERS: 1 | US FAERS | |
| 792 | Arthropod sting | FAERS: 1 | US FAERS | |
| 793 | Atrial pressure increased | FAERS: 1 | US FAERS | |
| 794 | Axonal neuropathy | FAERS: 1 | US FAERS | |
| 795 | Bacterial disease carrier | FAERS: 1 | US FAERS | |
| 796 | Bed rest | FAERS: 1 | US FAERS | |
| 797 | Benign neoplasm of thyroid gland | FAERS: 1 | US FAERS | |
| 798 | Biliary cirrhosis | FAERS: 1 | OFFSIDES US FAERS | |
| 799 | Biliary tract infection | FAERS: 1 | US FAERS | |
| 800 | Biopsy bone marrow abnormal | FAERS: 1 | US FAERS | |
| 801 | Biopsy lung abnormal | FAERS: 1 | US FAERS | |
| 802 | Biopsy lung normal | FAERS: 1 | US FAERS | |
| 803 | Biopsy skin normal | FAERS: 1 | US FAERS | |
| 804 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 805 | Bladder cancer recurrent | FAERS: 1 | US FAERS | |
| 806 | Bladder dysfunction | FAERS: 1 | US FAERS | |
| 807 | Bladder neck suspension | FAERS: 1 | US FAERS | |
| 808 | Bladder neoplasm surgery | FAERS: 1 | US FAERS | |
| 809 | Bladder prolapse | FAERS: 1 | US FAERS | |
| 810 | Blood albumin increased | FAERS: 1 | OFFSIDES US FAERS | |
| 811 | Blood alkaline phosphatase abnormal | FAERS: 1 | US FAERS | |
| 812 | Blood alkaline phosphatase | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 813 | Blood bilirubin unconjugated increased | FAERS: 1 | OFFSIDES US FAERS | |
| 814 | Blood calcium abnormal | FAERS: 1 | US FAERS | |
| 815 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 816 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 817 | Blood copper decreased | FAERS: 1 | US FAERS | |
| 818 | Blood creatine phosphokinase MB increased | FAERS: 1 | OFFSIDES US FAERS | |
| 819 | Blood immunoglobulin A increased | FAERS: 1 | OFFSIDES US FAERS | |
| 820 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 821 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 822 | Blood viscosity abnormal | FAERS: 1 | US FAERS | |
| 823 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 824 | Brain Death | FAERS: 1 | US FAERS | |
| 825 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 826 | Breast Cyst | FAERS: 1 | US FAERS | |
| 827 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 828 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 829 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 830 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 831 | Bronchopneumopathy | FAERS: 1 | US FAERS | |
| 832 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 833 | Bunion operation | FAERS: 1 | US FAERS | |
| 834 | Butterfly rash | FAERS: 1 | US FAERS | |
| 835 | Calcinosis | FAERS: 1 | OFFSIDES US FAERS | |
| 836 | Capillary Leak Syndrome | FAERS: 1 | US FAERS | |
| 837 | Carbon Monoxide Poisoning | FAERS: 1 | US FAERS | |
| 838 | Carbon dioxide abnormal | FAERS: 1 | US FAERS | |
| 839 | Cardiac Hypertrophy | FAERS: 1 | US FAERS | |
| 840 | Cardiac cirrhosis | FAERS: 1 | OFFSIDES US FAERS | |
| 841 | Cardiac complication associated with device | FAERS: 1 | US FAERS | |
| 842 | Cardiac function disturbance postoperative | FAERS: 1 | US FAERS | |
| 843 | Cardiac imaging procedure | FAERS: 1 | US FAERS | |
| 844 | Cardiac infection | FAERS: 1 | US FAERS | |
| 845 | Cardiac monitoring abnormal | FAERS: 1 | US FAERS | |
| 846 | Cardiac monitoring | FAERS: 1 | US FAERS | |
| 847 | Cardiac pacemaker evaluation | FAERS: 1 | US FAERS | |
| 848 | Cardiac perforation | FAERS: 1 | US FAERS | |
| 849 | Cardiac valve replacement complication | FAERS: 1 | US FAERS | |
| 850 | Cardiac valve rupture | FAERS: 1 | US FAERS | |
| 851 | Cardiovascular Deconditioning | FAERS: 1 | OFFSIDES US FAERS | |
| 852 | Cardiovascular evaluation | FAERS: 1 | US FAERS | |
| 853 | Catheter management | FAERS: 1 | US FAERS | |
| 854 | Catheter related complication | FAERS: 1 | US FAERS | |
| 855 | Catheter sepsis | FAERS: 1 | US FAERS | |
| 856 | Catheter site extravasation | FAERS: 1 | US FAERS | |
| 857 | Central Nervous System Infection | FAERS: 1 | US FAERS | |
| 858 | Cheilitis | FAERS: 1 | US FAERS | |
| 859 | Cholelithiasis obstructive | FAERS: 1 | US FAERS | |
| 860 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 861 | Clubbing | FAERS: 1 | US FAERS | |
| 862 | Cluster Headache | FAERS: 1 | US FAERS | |
| 863 | Coagulation time shortened | FAERS: 1 | OFFSIDES US FAERS | |
| 864 | Cold sweat | FAERS: 1 | US FAERS | |
| 865 | Collateral Circulation | FAERS: 1 | US FAERS | |
| 866 | Combined pulmonary fibrosis and emphysema | FAERS: 1 | US FAERS | |
| 867 | Complement factor decreased | FAERS: 1 | US FAERS | |
| 868 | Congenital heart valve disorder | FAERS: 1 | US FAERS | |
| 869 | Critical Illness | FAERS: 1 | US FAERS | |
| 870 | Croup infectious | FAERS: 1 | US FAERS | |
| 871 | Cytomegalovirus antigen positive | FAERS: 1 | US FAERS | |
| 872 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 873 | Debridement | FAERS: 1 | US FAERS | |
| 874 | Dental caries | FAERS: 1 | US FAERS | |
| 875 | Dental discomfort | FAERS: 1 | US FAERS | |
| 876 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 877 | Device Failure | FAERS: 1 | US FAERS | |
| 878 | Device connection issue | FAERS: 1 | US FAERS | |
| 879 | Device expulsion | FAERS: 1 | US FAERS | |
| 880 | Device leakage | FAERS: 1 | OFFSIDES US FAERS | |
| 881 | Diabetes Insipidus | FAERS: 1 | OFFSIDES US FAERS | |
| 882 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 883 | Diffuse alveolar damage | FAERS: 1 | US FAERS | |
| 884 | Digital ulcer | FAERS: 1 | US FAERS | |
| 885 | Dilatation intrahepatic duct acquired | FAERS: 1 | OFFSIDES US FAERS | |
| 886 | Disease recurrence | FAERS: 1 | US FAERS | |
| 887 | Disseminated Intravascular Coagulation | FAERS: 1 | OFFSIDES US FAERS | |
| 888 | Drug resistance | FAERS: 1 | US FAERS | |
| 889 | Duodenal Ulcer | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 890 | Duodenal perforation | FAERS: 1 | US FAERS | |
| 891 | Dwarfism | FAERS: 1 | US FAERS | |
| 892 | Dysbacteriosis | FAERS: 1 | US FAERS | |
| 893 | Dysentery | FAERS: 1 | US FAERS | |
| 894 | Dysgraphia | FAERS: 1 | US FAERS | |
| 895 | Dysphemia | FAERS: 1 | US FAERS | |
| 896 | Dystonia | FAERS: 1 | US FAERS | |
| 897 | Ear congestion | FAERS: 1 | US FAERS | |
| 898 | Ear discomfort | FAERS: 1 | US FAERS | |
| 899 | Eating disorder symptom | FAERS: 1 | US FAERS | |
| 900 | Ecchymosis | FAERS: 1 | SIDER US FAERS | |
| 901 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 902 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 903 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 904 | Empyema | FAERS: 1 | US FAERS | |
| 905 | Encephalitis | FAERS: 1 | US FAERS | |
| 906 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 907 | Endometrial Hyperplasia | FAERS: 1 | OFFSIDES US FAERS | |
| 908 | Endoscopy upper gastrointestinal tract normal | FAERS: 1 | US FAERS | |
| 909 | Endotracheal intubation complication | FAERS: 1 | US FAERS | |
| 910 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 911 | Enzyme level abnormal | FAERS: 1 | US FAERS | |
| 912 | Eosinophilic Pneumonia | FAERS: 1 | OFFSIDES US FAERS | |
| 913 | Epiduritis | FAERS: 1 | US FAERS | |
| 914 | Epilepsy | FAERS: 1 | OFFSIDES US FAERS | |
| 915 | Erythema Induratum | FAERS: 1 | OFFSIDES US FAERS | |
| 916 | Escherichia urinary tract infection | FAERS: 1 | OFFSIDES US FAERS | |
| 917 | Essential Tremor | FAERS: 1 | US FAERS | |
| 918 | Excoriation | FAERS: 1 | US FAERS | |
| 919 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 920 | Expired product administered | FAERS: 1 | US FAERS | |
| 921 | Extremity contracture | FAERS: 1 | OFFSIDES US FAERS | |
| 922 | Eye inflammation | FAERS: 1 | US FAERS | |
| 923 | Eye laser surgery | FAERS: 1 | US FAERS | |
| 924 | Eyelid rash | FAERS: 1 | US FAERS | |
| 925 | Feeding intolerance | FAERS: 1 | US FAERS | |
| 926 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 927 | Femoral artery occlusion | FAERS: 1 | US FAERS | |
| 928 | Fistula repair | FAERS: 1 | US FAERS | |
| 929 | Fluid imbalance | FAERS: 1 | OFFSIDES US FAERS | |
| 930 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 931 | Fracture infection | FAERS: 1 | US FAERS | |
| 932 | Frustration | FAERS: 1 | US FAERS | |
| 933 | Gallbladder adenocarcinoma | FAERS: 1 | US FAERS | |
| 934 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 935 | Gamma-glutamyltransferase abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 936 | Gas Poisoning | FAERS: 1 | US FAERS | |
| 937 | Gastric Antral Vascular Ectasia | FAERS: 1 | US FAERS | |
| 938 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 939 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 940 | Gastroenterostomy | FAERS: 1 | US FAERS | |
| 941 | Gastrointestinal cancer metastatic | FAERS: 1 | US FAERS | |
| 942 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 943 | Gastrostomy tube site complication | FAERS: 1 | US FAERS | |
| 944 | General symptom | FAERS: 1 | US FAERS | |
| 945 | Gingivitis | FAERS: 1 | US FAERS | |
| 946 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 947 | Glioblastoma | FAERS: 1 | US FAERS | |
| 948 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 949 | Granulomatosis with polyangiitis | FAERS: 1 | US FAERS | |
| 950 | Granulomatous liver disease | FAERS: 1 | US FAERS | |
| 951 | Granuloma | FAERS: 1 | OFFSIDES US FAERS | |
| 952 | Haematotoxicity | FAERS: 1 | OFFSIDES US FAERS | |
| 953 | Haemoconcentration | FAERS: 1 | US FAERS | |
| 954 | Hemiplegia | FAERS: 1 | US FAERS | |
| 955 | Hepatic Infection | FAERS: 1 | US FAERS | |
| 956 | Hepatic necrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 957 | Hepatitis A virus test positive | FAERS: 1 | US FAERS | |
| 958 | Hepatitis A | FAERS: 1 | US FAERS | |
| 959 | Hepatitis B virus test positive | FAERS: 1 | US FAERS | |
| 960 | Hepatitis E | FAERS: 1 | US FAERS | |
| 961 | Hepatoblastoma | FAERS: 1 | US FAERS | |
| 962 | Hepatosplenomegaly | FAERS: 1 | OFFSIDES US FAERS | |
| 963 | Hereditary spherocytosis | FAERS: 1 | US FAERS | |
| 964 | Hernia obstructive | FAERS: 1 | US FAERS | |
| 965 | Herpes Zoster Oticus | FAERS: 1 | US FAERS | |
| 966 | Histamine intolerance | FAERS: 1 | US FAERS | |
| 967 | Hoarseness | FAERS: 1 | OFFSIDES US FAERS | |
| 968 | Hordeolum | FAERS: 1 | US FAERS | |
| 969 | Human Bite | FAERS: 1 | US FAERS | |
| 970 | Hydrocephalus | FAERS: 1 | SIDER US FAERS | |
| 971 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 972 | Hypertensive cardiomyopathy | FAERS: 1 | US FAERS | |
| 973 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 974 | Hypopharyngeal Cancer | FAERS: 1 | US FAERS | |
| 975 | Hypoplastic Left Heart Syndrome | FAERS: 1 | US FAERS | |
| 976 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 977 | Iatrogenic infection | FAERS: 1 | OFFSIDES US FAERS | |
| 978 | Iatrogenic injury | FAERS: 1 | OFFSIDES US FAERS | |
| 979 | Iliac artery occlusion | FAERS: 1 | US FAERS | |
| 980 | Immunoglobulin Therapy | FAERS: 1 | US FAERS | |
| 981 | Immunosuppression | FAERS: 1 | US FAERS | |
| 982 | In-stent coronary artery restenosis | FAERS: 1 | US FAERS | |
| 983 | Incision site complication | FAERS: 1 | US FAERS | |
| 984 | Incision site pain | FAERS: 1 | US FAERS | |
| 985 | Incorrect product dosage form administered | FAERS: 1 | US FAERS | |
| 986 | Increased viscosity of bronchial secretion | FAERS: 1 | US FAERS | |
| 987 | Infarction | FAERS: 1 | US FAERS | |
| 988 | Infected cyst | FAERS: 1 | US FAERS | |
| 989 | Infective glossitis | FAERS: 1 | US FAERS | |
| 990 | Infusion site swelling | FAERS: 1 | US FAERS | |
| 991 | Initial insomnia | FAERS: 1 | US FAERS | |
| 992 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 993 | Injection site abscess | FAERS: 1 | US FAERS | |
| 994 | Injection site irritation | FAERS: 1 | US FAERS | |
| 995 | Injection site pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 996 | Injury asphyxiation | FAERS: 1 | US FAERS | |
| 997 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 998 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 999 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 1000 | Intestinal adenocarcinoma | FAERS: 1 | US FAERS | |
| 1001 | Intra-aortic balloon placement | FAERS: 1 | US FAERS | |
| 1002 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 1003 | Intrathecal pump insertion | FAERS: 1 | US FAERS | |
| 1004 | Intussusception | FAERS: 1 | US FAERS | |
| 1005 | Irregular breathing | FAERS: 1 | US FAERS | |
| 1006 | Joint fluid drainage | FAERS: 1 | US FAERS | |
| 1007 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 1008 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 1009 | Large intestinal polypectomy | FAERS: 1 | US FAERS | |
| 1010 | Laryngeal cancer recurrent | FAERS: 1 | US FAERS | |
| 1011 | Laryngospasm | FAERS: 1 | US FAERS | |
| 1012 | Left ventricular end-diastolic pressure increased | FAERS: 1 | US FAERS | |
| 1013 | Leishmaniasis | FAERS: 1 | US FAERS | |
| 1014 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 1015 | Ligament injury | FAERS: 1 | US FAERS | |
| 1016 | Ligament rupture | FAERS: 1 | US FAERS | |
| 1017 | Limb fracture | FAERS: 1 | US FAERS | |
| 1018 | Lip swelling | FAERS: 1 | US FAERS | |
| 1019 | Lissencephaly | FAERS: 1 | US FAERS | |
| 1020 | Listeria sepsis | FAERS: 1 | US FAERS | |
| 1021 | Lower respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 1022 | Lung Injury | FAERS: 1 | US FAERS | |
| 1023 | Lung transplant rejection | FAERS: 1 | US FAERS | |
| 1024 | Lupus encephalitis | FAERS: 1 | US FAERS | |
| 1025 | Lymphangiosis carcinomatosa | FAERS: 1 | US FAERS | |
| 1026 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 1027 | Lymphocyte transformation test positive | FAERS: 1 | US FAERS | |
| 1028 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 1029 | Lymphopenia | FAERS: 1 | US FAERS | |
| 1030 | Malignant ascites | FAERS: 1 | US FAERS | |
| 1031 | Malignant tumour excision | FAERS: 1 | US FAERS | |
| 1032 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 1033 | Medical device implantation | FAERS: 1 | US FAERS | |
| 1034 | Medical observation | FAERS: 1 | US FAERS | |
| 1035 | Medical procedure | FAERS: 1 | US FAERS | |
| 1036 | Meniscus injury | FAERS: 1 | US FAERS | |
| 1037 | Mesothelioma | FAERS: 1 | US FAERS | |
| 1038 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 1039 | Metapneumovirus infection | FAERS: 1 | US FAERS | |
| 1040 | Metastatic bronchial carcinoma | FAERS: 1 | US FAERS | |
| 1041 | Micrococcus test positive | FAERS: 1 | US FAERS | |
| 1042 | Microwave Therapy | FAERS: 1 | US FAERS | |
| 1043 | Mixed Connective Tissue Disease | FAERS: 1 | OFFSIDES US FAERS | |
| 1044 | Moaning | FAERS: 1 | US FAERS | |
| 1045 | Monoparesis | FAERS: 1 | US FAERS | |
| 1046 | Mood swings | FAERS: 1 | SIDER US FAERS | |
| 1047 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 1048 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 1049 | Mycobacterium tuberculosis complex test positive | FAERS: 1 | US FAERS | |
| 1050 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 1051 | Mydriasis | FAERS: 1 | US FAERS | |
| 1052 | Myocardial Reperfusion Injury | FAERS: 1 | 16700825 | CTD US FAERS |
| 1053 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 1054 | N-terminal prohormone brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 1055 | Necrosis | FAERS: 1 | US FAERS | |
| 1056 | Neonatal respiratory failure | FAERS: 1 | US FAERS | |
| 1057 | Nephrosclerosis | FAERS: 1 | US FAERS | |
| 1058 | Nerve Degeneration | FAERS: 1 | US FAERS | |
| 1059 | Neuroblastoma | FAERS: 1 | US FAERS | |
| 1060 | Neurological examination abnormal | FAERS: 1 | US FAERS | |
| 1061 | Neuromyelitis Optica | FAERS: 1 | US FAERS | |
| 1062 | Neurostimulator removal | FAERS: 1 | US FAERS | |
| 1063 | Night sweats | FAERS: 1 | US FAERS | |
| 1064 | No adverse reaction | FAERS: 1 | US FAERS | |
| 1065 | Nocturia | FAERS: 1 | OFFSIDES US FAERS | |
| 1066 | Nodule | FAERS: 1 | US FAERS | |
| 1067 | Non-small cell lung cancer stage IIIB | FAERS: 1 | US FAERS | |
| 1068 | Nuchal Rigidity | FAERS: 1 | US FAERS | |
| 1069 | Nutritional Support | FAERS: 1 | US FAERS | |
| 1070 | Occupational exposure to drug | FAERS: 1 | US FAERS | |
| 1071 | Oliguria | FAERS: 1 | OFFSIDES US FAERS | |
| 1072 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 1073 | Oral cavity neoplasm surgery | FAERS: 1 | US FAERS | |
| 1074 | Oral fungal infection | FAERS: 1 | OFFSIDES US FAERS | |
| 1075 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 1076 | Oral pain | FAERS: 1 | US FAERS | |
| 1077 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 1078 | Oropharyngitis fungal | FAERS: 1 | US FAERS | |
| 1079 | Osteolysis | FAERS: 1 | US FAERS | |
| 1080 | Osteomyelitis drainage | FAERS: 1 | US FAERS | |
| 1081 | Osteotomy | FAERS: 1 | US FAERS | |
| 1082 | Otitis Media | FAERS: 1 | US FAERS | |
| 1083 | Oxygen Consumption | FAERS: 1 | US FAERS | |
| 1084 | Oxygen consumption decreased | FAERS: 1 | US FAERS | |
| 1085 | PCO2 increased | FAERS: 1 | US FAERS | |
| 1086 | PO2 increased | FAERS: 1 | US FAERS | |
| 1087 | Panniculitis | FAERS: 1 | US FAERS | |
| 1088 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 1089 | Partial lung resection | FAERS: 1 | US FAERS | |
| 1090 | Patient Isolation | FAERS: 1 | US FAERS | |
| 1091 | Pelvic cyst | FAERS: 1 | US FAERS | |
| 1092 | Pelvic mass | FAERS: 1 | OFFSIDES US FAERS | |
| 1093 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 1094 | Performance status decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 1095 | Peripheral artery angioplasty | FAERS: 1 | US FAERS | |
| 1096 | Peripheral artery bypass | FAERS: 1 | US FAERS | |
| 1097 | Peripheral artery stent insertion | FAERS: 1 | US FAERS | |
| 1098 | Peripheral motor neuropathy | FAERS: 1 | US FAERS | |
| 1099 | Peritoneal Infection | FAERS: 1 | US FAERS | |
| 1100 | Pertussis | FAERS: 1 | US FAERS | |
| 1101 | Petechiae | FAERS: 1 | US FAERS | |
| 1102 | Pharyngitis | FAERS: 1 | US FAERS | |
| 1103 | Philadelphia chromosome positive | FAERS: 1 | US FAERS | |
| 1104 | Phlebitis | FAERS: 1 | US FAERS | |
| 1105 | Phlebosclerosis | FAERS: 1 | US FAERS | |
| 1106 | Photophobia | FAERS: 1 | SIDER US FAERS | |
| 1107 | Phrenic nerve paralysis | FAERS: 1 | US FAERS | |
| 1108 | Physical disability | FAERS: 1 | US FAERS | |
| 1109 | Plasma Exchange | FAERS: 1 | US FAERS | |
| 1110 | Platelet Transfusion | FAERS: 1 | OFFSIDES US FAERS | |
| 1111 | Poisoning | FAERS: 1 | US FAERS | |
| 1112 | Polyarteritis Nodosa | FAERS: 1 | US FAERS | |
| 1113 | Polyarthritis | FAERS: 1 | US FAERS | |
| 1114 | Polydipsia | FAERS: 1 | US FAERS | |
| 1115 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 1116 | Polymyositis | FAERS: 1 | US FAERS | |
| 1117 | Polyserositis | FAERS: 1 | US FAERS | |
| 1118 | Poor quality sleep | FAERS: 1 | OFFSIDES US FAERS | |
| 1119 | Portal vein flow decreased | FAERS: 1 | US FAERS | |
| 1120 | Post procedural fistula | FAERS: 1 | OFFSIDES US FAERS | |
| 1121 | Post-Traumatic Headache | FAERS: 1 | US FAERS | |
| 1122 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 1123 | Postoperative Care | FAERS: 1 | US FAERS | |
| 1124 | Postoperative abscess | FAERS: 1 | US FAERS | |
| 1125 | Postoperative renal failure | FAERS: 1 | US FAERS | |
| 1126 | Postoperative thrombosis | FAERS: 1 | US FAERS | |
| 1127 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 1128 | Pregnancy with contraceptive device | FAERS: 1 | OFFSIDES US FAERS | |
| 1129 | Premature baby death | FAERS: 1 | US FAERS | |
| 1130 | Preoperative Care | FAERS: 1 | US FAERS | |
| 1131 | Primary Biliary Cholangitis | FAERS: 1 | US FAERS | |
| 1132 | Procedural hypertension | FAERS: 1 | US FAERS | |
| 1133 | Product packaging issue | FAERS: 1 | US FAERS | |
| 1134 | Product substitution issue | FAERS: 1 | US FAERS | |
| 1135 | Propionibacterium infection | FAERS: 1 | US FAERS | |
| 1136 | Prostate examination abnormal | FAERS: 1 | US FAERS | |
| 1137 | Prosthesis user | FAERS: 1 | US FAERS | |
| 1138 | Protein total abnormal | FAERS: 1 | US FAERS | |
| 1139 | Protein total decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 1140 | Psoas Abscess | FAERS: 1 | US FAERS | |
| 1141 | Psychiatric decompensation | FAERS: 1 | US FAERS | |
| 1142 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 1143 | Pulmonary arterial pressure abnormal | FAERS: 1 | US FAERS | |
| 1144 | Pulmonary artery aneurysm | FAERS: 1 | US FAERS | |
| 1145 | Pulmonary artery stenosis | FAERS: 1 | US FAERS | |
| 1146 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 1147 | Pulmonary sepsis | FAERS: 1 | OFFSIDES US FAERS | |
| 1148 | Pulmonary vascular disorder | FAERS: 1 | US FAERS | |
| 1149 | Purulent discharge | FAERS: 1 | US FAERS | |
| 1150 | Pyloric Stenosis | FAERS: 1 | US FAERS | |
| 1151 | Pyoderma Gangrenosum | FAERS: 1 | US FAERS | |
| 1152 | QRS axis abnormal | FAERS: 1 | US FAERS | |
| 1153 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 1154 | Radiation mucositis | FAERS: 1 | US FAERS | |
| 1155 | Radiation necrosis | FAERS: 1 | US FAERS | |
| 1156 | Radiation prostatitis | FAERS: 1 | US FAERS | |
| 1157 | Radiotherapy to breast | FAERS: 1 | US FAERS | |
| 1158 | Rectal fissure | FAERS: 1 | US FAERS | |
| 1159 | Rectal polyp | FAERS: 1 | US FAERS | |
| 1160 | Rectosigmoid cancer | FAERS: 1 | US FAERS | |
| 1161 | Reflux gastritis | FAERS: 1 | US FAERS | |
| 1162 | Regurgitation of food | FAERS: 1 | US FAERS | |
| 1163 | Regurgitation | FAERS: 1 | US FAERS | |
| 1164 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 1165 | Removal of transplanted organ | FAERS: 1 | US FAERS | |
| 1166 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 1167 | Renal Colic | FAERS: 1 | US FAERS | |
| 1168 | Renal artery occlusion | FAERS: 1 | US FAERS | |
| 1169 | Renal cancer metastatic | FAERS: 1 | US FAERS | |
| 1170 | Renal cyst | FAERS: 1 | OFFSIDES US FAERS | |
| 1171 | Renal dysplasia | FAERS: 1 | US FAERS | |
| 1172 | Renal mass | FAERS: 1 | US FAERS | |
| 1173 | Renal pain | FAERS: 1 | US FAERS | |
| 1174 | Reperfusion Injury | FAERS: 1 | US FAERS | |
| 1175 | Respiratory syncytial virus test positive | FAERS: 1 | US FAERS | |
| 1176 | Respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 1177 | Respirovirus test positive | FAERS: 1 | US FAERS | |
| 1178 | Retinopathy of Prematurity | FAERS: 1 | US FAERS | |
| 1179 | Retrograde portal vein flow | FAERS: 1 | US FAERS | |
| 1180 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 1181 | Rhinitis | FAERS: 1 | US FAERS | |
| 1182 | Rickets | FAERS: 1 | US FAERS | |
| 1183 | Right Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 1184 | Rocky Mountain Spotted Fever | FAERS: 1 | US FAERS | |
| 1185 | Salpingectomy | FAERS: 1 | US FAERS | |
| 1186 | Scoliosis surgery | FAERS: 1 | US FAERS | |
| 1187 | Senile dementia | FAERS: 1 | US FAERS | |
| 1188 | Septic embolus | FAERS: 1 | US FAERS | |
| 1189 | Seroma | FAERS: 1 | US FAERS | |
| 1190 | Serositis | FAERS: 1 | US FAERS | |
| 1191 | Shunt occlusion | FAERS: 1 | US FAERS | |
| 1192 | Sinoatrial Block | FAERS: 1 | US FAERS | |
| 1193 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 1194 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 1195 | Sinus pain | FAERS: 1 | US FAERS | |
| 1196 | Sjogren's Syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 1197 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 1198 | Skin hypertrophy | FAERS: 1 | OFFSIDES US FAERS | |
| 1199 | Skin tightness | FAERS: 1 | OFFSIDES US FAERS | |
| 1200 | Small cell lung cancer extensive stage | FAERS: 1 | US FAERS | |
| 1201 | Small cell lung cancer metastatic | FAERS: 1 | US FAERS | |
| 1202 | Soft Tissue Infection | FAERS: 1 | US FAERS | |
| 1203 | Somnambulism | FAERS: 1 | US FAERS | |
| 1204 | Spinal rod insertion | FAERS: 1 | US FAERS | |
| 1205 | Splenectomy | FAERS: 1 | US FAERS | |
| 1206 | Sputum culture positive | FAERS: 1 | OFFSIDES US FAERS | |
| 1207 | Staphylococcal osteomyelitis | FAERS: 1 | US FAERS | |
| 1208 | Streptococcus test positive | FAERS: 1 | US FAERS | |
| 1209 | Stupor | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1210 | Subacute hepatic failure | FAERS: 1 | US FAERS | |
| 1211 | Sudden infant death syndrome | FAERS: 1 | US FAERS | |
| 1212 | Superinfection | FAERS: 1 | US FAERS | |
| 1213 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 1214 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 1215 | Thermal burn | FAERS: 1 | US FAERS | |
| 1216 | Thirst | FAERS: 1 | SIDER US FAERS | |
| 1217 | Thromboangiitis Obliterans | FAERS: 1 | US FAERS | |
| 1218 | Thromboendarterectomy | FAERS: 1 | OFFSIDES US FAERS | |
| 1219 | Thrombophlebitis | FAERS: 1 | OFFSIDES US FAERS | |
| 1220 | Tonsillitis | FAERS: 1 | US FAERS | |
| 1221 | Trabeculectomy | FAERS: 1 | US FAERS | |
| 1222 | Transaminases abnormal | FAERS: 1 | US FAERS | |
| 1223 | Traumatic liver injury | FAERS: 1 | SIDER US FAERS | |
| 1224 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 1225 | Ultrasound scan abnormal | FAERS: 1 | US FAERS | |
| 1226 | Unexpected therapeutic drug effect | FAERS: 1 | US FAERS | |
| 1227 | Ureteral stent insertion | FAERS: 1 | US FAERS | |
| 1228 | Urinary tract infection pseudomonal | FAERS: 1 | US FAERS | |
| 1229 | Urinary tract inflammation | FAERS: 1 | US FAERS | |
| 1230 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 1231 | Uterine Prolapse | FAERS: 1 | US FAERS | |
| 1232 | Uterine dilation and evacuation | FAERS: 1 | US FAERS | |
| 1233 | Varicose vein operation | FAERS: 1 | US FAERS | |
| 1234 | Vascular fragility | FAERS: 1 | US FAERS | |
| 1235 | Vascular graft thrombosis | FAERS: 1 | US FAERS | |
| 1236 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 1237 | Vascular stent occlusion | FAERS: 1 | US FAERS | |
| 1238 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 1239 | Ventricle rupture | FAERS: 1 | US FAERS | |
| 1240 | Ventricular hyperkinesia | FAERS: 1 | US FAERS | |
| 1241 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 1242 | Vessel perforation | FAERS: 1 | US FAERS | |
| 1243 | Visual brightness | FAERS: 1 | US FAERS | |
| 1244 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 1245 | Von Willebrand's factor activity abnormal | FAERS: 1 | US FAERS | |
| 1246 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 1247 | Walking aid user | FAERS: 1 | US FAERS | |
| 1248 | Withdrawal of life support | FAERS: 1 | US FAERS | |
| 1249 | Wound necrosis | FAERS: 1 | US FAERS | |
| 1250 | Wound sepsis | FAERS: 1 | US FAERS | |
| 1251 | Wrong schedule | FAERS: 1 | US FAERS | |
| 1252 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 1253 | diagnostic procedure | FAERS: 1 | US FAERS | |
| 1254 | ovarian neoplasm | FAERS: 1 | US FAERS | |
| 1255 | treatment failure | FAERS: 1 | US FAERS | |
| 1256 | 5'nucleotidase increased | OFFSIDES | ||
| 1257 | Acid reflux | OFFSIDES | ||
| 1258 | Acute bronchitis | SIDER | ||
| 1259 | Acute psychosis | OFFSIDES | ||
| 1260 | Agraphia | OFFSIDES | ||
| 1261 | Air Embolism | OFFSIDES | ||
| 1262 | Amphetamines | OFFSIDES | ||
| 1263 | Anaphylactic shock | SIDER | ||
| 1264 | Aphthous Stomatitis | OFFSIDES | ||
| 1265 | Apparent life threatening event | OFFSIDES | ||
| 1266 | Appendectomy | OFFSIDES | ||
| 1267 | Atrial thrombosis | OFFSIDES | ||
| 1268 | Autoimmune thrombocytopenia | OFFSIDES | ||
| 1269 | Autoimmune thyroiditis | OFFSIDES | ||
| 1270 | Automatism | OFFSIDES | ||
| 1271 | Azoospermia | SIDER | ||
| 1272 | Bacteria urine identified | OFFSIDES | ||
| 1273 | Biliary dilatation | OFFSIDES | ||
| 1274 | Bilirubinuria | OFFSIDES | ||
| 1275 | Biopsy liver abnormal | OFFSIDES | ||
| 1276 | Bladder pain | SIDER | ||
| 1277 | Blepharitis | OFFSIDES | ||
| 1278 | Blood Glucose | OFFSIDES | ||
| 1279 | Blood alcohol increased | OFFSIDES | ||
| 1280 | Blood and lymphatic system disorders | SIDER | ||
| 1281 | Blood bicarbonate | OFFSIDES | ||
| 1282 | Blood corticotrophin | OFFSIDES | ||
| 1283 | Blood cortisol decreased | OFFSIDES | ||
| 1284 | Blood creatinine decreased | OFFSIDES | ||
| 1285 | Blood fibrinogen increased | OFFSIDES | ||
| 1286 | Blood homocysteine | OFFSIDES | ||
| 1287 | Blood immunoglobulin E | OFFSIDES | ||
| 1288 | Blood immunoglobulin M | OFFSIDES | ||
| 1289 | Blood lactate dehydrogenase decreased | OFFSIDES | ||
| 1290 | Blood sodium | OFFSIDES | ||
| 1291 | Blunted affect | OFFSIDES | ||
| 1292 | Bone erosion | OFFSIDES | ||
| 1293 | Breathing-related sleep disorder | OFFSIDES | ||
| 1294 | Bronchoalveolar Lavage | OFFSIDES | ||
| 1295 | Bruxism | OFFSIDES | ||
| 1296 | Candidiasis of vagina | OFFSIDES | ||
| 1297 | Cardioactive drug level | OFFSIDES | ||
| 1298 | Cardioactive drug level above therapeutic | OFFSIDES | ||
| 1299 | Catheter site discharge | OFFSIDES | ||
| 1300 | Cavernous Sinus Thrombosis | OFFSIDES | ||
| 1301 | Cerebral disorder | OFFSIDES | ||
| 1302 | Cerebral hypoperfusion | OFFSIDES | ||
| 1303 | Chemical and Drug Induced Liver Injury | CTD | ||
| 1304 | Cholangiolitis | OFFSIDES | ||
| 1305 | Chronic active hepatitis | OFFSIDES | ||
| 1306 | Chronic left ventricular failure | OFFSIDES | ||
| 1307 | Cirrhosis | OFFSIDES | ||
| 1308 | Coagulation factor V level decreased | OFFSIDES | ||
| 1309 | Coagulation factor VIII level increased | OFFSIDES | ||
| 1310 | Coagulation test abnormal | OFFSIDES | ||
| 1311 | Collagen-vascular disease | OFFSIDES | ||
| 1312 | Confabulation | OFFSIDES | ||
| 1313 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 1314 | Contact Dermatitis | OFFSIDES | ||
| 1315 | Coxsackievirus Infections | 20392896 | CTD | |
| 1316 | Creatinine renal clearance decreased | OFFSIDES | ||
| 1317 | Cytomegalovirus antibody positive | OFFSIDES | ||
| 1318 | Cytomegalovirus test positive | OFFSIDES | ||
| 1319 | Dark circles under eyes | OFFSIDES | ||
| 1320 | Dermoid Cyst | OFFSIDES | ||
| 1321 | Diarrhea | OFFSIDES | ||
| 1322 | Dieulafoy's vascular malformation | OFFSIDES | ||
| 1323 | Disturbance in sexual arousal | SIDER | ||
| 1324 | Diverticulum | OFFSIDES | ||
| 1325 | Drowsiness | OFFSIDES | ||
| 1326 | Drug level below therapeutic | OFFSIDES | ||
| 1327 | Drug level changed | OFFSIDES | ||
| 1328 | Drug withdrawal headache | OFFSIDES | ||
| 1329 | Duodenitis | OFFSIDES | ||
| 1330 | Dysthymic Disorder | OFFSIDES | ||
| 1331 | Economic problem | OFFSIDES | ||
| 1332 | Electrocardiogram change | SIDER | ||
| 1333 | Emotional disorder | OFFSIDES | ||
| 1334 | Endophthalmitis | SIDER | ||
| 1335 | Enterococcal sepsis | OFFSIDES | ||
| 1336 | Eosinophilic myocarditis | OFFSIDES | ||
| 1337 | Epstein-Barr virus antibody positive | OFFSIDES | ||
| 1338 | Erosive gastritis | OFFSIDES | ||
| 1339 | Erythema Multiforme | SIDER | ||
| 1340 | Exercise capacity decreased | OFFSIDES | ||
| 1341 | Eye irritation | SIDER | ||
| 1342 | Factor V deficiency | OFFSIDES | ||
| 1343 | Familial Mediterranean Fever | OFFSIDES | ||
| 1344 | Fatty Liver | OFFSIDES | ||
| 1345 | Gastrointestinal Pain | SIDER | ||
| 1346 | Gastrointestinal hypomotility | OFFSIDES | ||
| 1347 | Gastrointestinal stenosis | Canada Vigilance: 1 | Canada Vigilance | |
| 1348 | Gastrointestinal ulcer | OFFSIDES | ||
| 1349 | General physical condition | OFFSIDES | ||
| 1350 | Heart failure | 9861300 10353441 | CTD | |
| 1351 | Heart sounds abnormal | OFFSIDES | ||
| 1352 | Hepatic Infarction | OFFSIDES | ||
| 1353 | Hepatic cancer metastatic | OFFSIDES | ||
| 1354 | Hepatitis B Virus | OFFSIDES | ||
| 1355 | Hepatitis B core antigen positive | OFFSIDES | ||
| 1356 | Hepatitis B positive | OFFSIDES | ||
| 1357 | Hepatitis B surface antigen positive | OFFSIDES | ||
| 1358 | Hepatojugular reflux | OFFSIDES | ||
| 1359 | Hilar lymphadenopathy | OFFSIDES | ||
| 1360 | Histiocytosis haematophagic | OFFSIDES | ||
| 1361 | Hypercholesterolemia | 15486036 | CTD | |
| 1362 | Hyperpigmentation | OFFSIDES | ||
| 1363 | Hypertransaminasaemia | OFFSIDES | ||
| 1364 | Hypertrophy | 7721389 | CTD | |
| 1365 | Hypomania | OFFSIDES | ||
| 1366 | Hypopituitarism | OFFSIDES | ||
| 1367 | Iliac artery stenosis | OFFSIDES | ||
| 1368 | Implant site infection | OFFSIDES | ||
| 1369 | Infestation | SIDER | ||
| 1370 | Infrequent bowel movements | OFFSIDES | ||
| 1371 | Infusion site mobility decreased | OFFSIDES | ||
| 1372 | Intention tremor | OFFSIDES | ||
| 1373 | Intermittent Claudication | OFFSIDES | ||
| 1374 | Intraocular inflammation | OFFSIDES | ||
| 1375 | Iritis | OFFSIDES | ||
| 1376 | Kidney Diseases | 8794820 | CTD | |
| 1377 | Labile blood pressure | OFFSIDES | ||
| 1378 | Lactose Intolerance | OFFSIDES | ||
| 1379 | Laryngomalacia | OFFSIDES | ||
| 1380 | Leg edema | SIDER | ||
| 1381 | Leukopenia neonatal | OFFSIDES | ||
| 1382 | Lipase | OFFSIDES | ||
| 1383 | Lung infection pseudomonal | OFFSIDES | ||
| 1384 | Lupus vasculitis | OFFSIDES | ||
| 1385 | Malignant neoplasm of ampulla of Vater | OFFSIDES | ||
| 1386 | Meningeal disorder | OFFSIDES | ||
| 1387 | Metaplasia | OFFSIDES | ||
| 1388 | Mitral valve sclerosis | OFFSIDES | ||
| 1389 | Mononeuritis | OFFSIDES | ||
| 1390 | Morphea | OFFSIDES | ||
| 1391 | Multiple drug overdose intentional | OFFSIDES | ||
| 1392 | Muscle Weakness | OFFSIDES | ||
| 1393 | Myelodysplasia | OFFSIDES | ||
| 1394 | Nephrotic Syndrome | OFFSIDES | ||
| 1395 | Nervous tension | OFFSIDES | ||
| 1396 | Nutritional condition abnormal | OFFSIDES | ||
| 1397 | Oddi's sphincter constriction | OFFSIDES | ||
| 1398 | Oligospermia | SIDER | ||
| 1399 | Oropharyngeal spasm | OFFSIDES | ||
| 1400 | PO2 decreased | OFFSIDES | ||
| 1401 | Pacemaker complication | OFFSIDES | ||
| 1402 | Palmar erythema | OFFSIDES | ||
| 1403 | Panophthalmitis | SIDER | ||
| 1404 | Pericardiotomy | OFFSIDES | ||
| 1405 | Portal Vein Thrombosis | OFFSIDES | ||
| 1406 | Portal hypertensive gastropathy | OFFSIDES | ||
| 1407 | Post vaccination syndrome | OFFSIDES | ||
| 1408 | Procedural site reaction | OFFSIDES | ||
| 1409 | Pulmonary function test decreased | SIDER | ||
| 1410 | Renal Insufficiency | 10353441 | CTD | |
| 1411 | Renal abscess | OFFSIDES | ||
| 1412 | Renal tubular acidosis | OFFSIDES | ||
| 1413 | Respiratory Depression | SIDER | ||
| 1414 | Respiratory syncytial virus bronchiolitis | OFFSIDES | ||
| 1415 | Respiratory tract irritation | OFFSIDES | ||
| 1416 | Salmonella | OFFSIDES | ||
| 1417 | Sclerodactylia | OFFSIDES | ||
| 1418 | Shivering | SIDER | ||
| 1419 | Skin Induration | OFFSIDES | ||
| 1420 | Snoring | OFFSIDES | ||
| 1421 | Spondylitis | OFFSIDES | ||
| 1422 | Subarachnoid Hemorrhage | 10353441 | CTD | |
| 1423 | Subcutaneous nodule | OFFSIDES | ||
| 1424 | Subileus | OFFSIDES | ||
| 1425 | Surgical vascular shunt | OFFSIDES | ||
| 1426 | Therapeutic product ineffective | Canada Vigilance: 1 | Canada Vigilance | |
| 1427 | Toxoplasmosis | OFFSIDES | ||
| 1428 | Urinary tract infection enterococcal | OFFSIDES | ||
| 1429 | Vasospasm, Intracranial | 8587695 10353441 | CTD | |
| 1430 | Venous Insufficiency | OFFSIDES | ||
| 1431 | Ventricular Dysfunction, Left | 9861300 10353441 | CTD | |
| 1432 | Ventricular arrhythmia | SIDER | ||
| 1433 | Visual disturbance | OFFSIDES | ||
| 1434 | Weight Gain | OFFSIDES | ||
| 1435 | Xerophthalmia | SIDER | ||
| 1436 | effusion | OFFSIDES | ||
| 1437 | melanoma | 16741059 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.