Atorvastatin
(FQCKMBLVYCEXJB-MNSAWQCASA-L)
Structure
- SMILES
- O[C@@H](C[C@H](CC(=O)[O-])O)CCn1c(C(C)C)c(c(c1c1ccc(cc1)F)c1ccccc1)C(=O)Nc1ccccc1.O[C@@H](C[C@H](CC(=O)[O-])O)CCn1c(C(C)C)c(c(c1c1ccc(cc1)F)c1ccccc1)C(=O)Nc1ccccc1.[Ca+2]
- Molecular Formula:
- C66H68CaF2N4O10
- Molecular Weight:
- 1155.340
- Log P:
- 10.1038
- Hydrogen Bond Acceptor:
- 14
- Hydrogen Bond Donor:
- 6
- TPSA:
- 229.24
- CAS Number(s):
- 110862-48-1; 134523-03-8; 1316891-47-0
Synonym(s)
1.
Atorvastatin
2.
(3R,5R)-7-(2-(4-Fluorophenyl)-5-isopropyl-3-phenyl-4-(phenylcarbamoyl)-1H-pyrrol-1-yl)-3,5-dihydroxyheptanoic acid
3.
Atorvastatin Calcium
4.
Atorvastatin Calcium Anhydrous
5.
Atorvastatin Calcium Hydrate
6.
Atorvastatin Calcium Trihydrate
7.
Atorvastatin, Calcium Salt
8.
CI 981
9.
CI-981
10.
Lipitor
11.
Liptonorm
12.
CI981
External Link(s)
| MeSH | D031447 D000069059 |
| PubChem Compound | 101610369 60822 15378998 |
| BindingDB | 50442868 |
| ChEBI | 50686 |
| CHEMBL | CHEMBL393220 |
| KEGG | dr:D00887 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Myalgia | FAERS: 3112 Canada Vigilance: 172 | Canada Vigilance US FAERS | |
| 2 | Arthralgia | FAERS: 977 Canada Vigilance: 27 | Canada Vigilance US FAERS | |
| 3 | Pain | FAERS: 879 Canada Vigilance: 33 | Canada Vigilance US FAERS | |
| 4 | Drug ineffective | FAERS: 794 Canada Vigilance: 32 | Canada Vigilance US FAERS | |
| 5 | Fatigue | FAERS: 765 Canada Vigilance: 28 | Canada Vigilance US FAERS | |
| 6 | Asthenia | FAERS: 730 Canada Vigilance: 21 | Canada Vigilance US FAERS | |
| 7 | Amnesia | FAERS: 696 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 8 | Myocardial Infarction | FAERS: 668 Canada Vigilance: 46 | Canada Vigilance US FAERS | |
| 9 | Blood creatine phosphokinase increased | FAERS: 587 Canada Vigilance: 60 | Canada Vigilance US FAERS | |
| 10 | Malaise | FAERS: 586 Canada Vigilance: 26 | Canada Vigilance US FAERS | |
| 11 | Cerebrovascular accident | FAERS: 564 Canada Vigilance: 25 | Canada Vigilance US FAERS | |
| 12 | Blood cholesterol increased | FAERS: 534 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 13 | Rhabdomyolysis | FAERS: 479 Canada Vigilance: 50 | Canada Vigilance US FAERS | |
| 14 | Diabetes Mellitus | FAERS: 393 Canada Vigilance: 29 | Canada Vigilance US FAERS | |
| 15 | Headache | FAERS: 393 Canada Vigilance: 32 | Canada Vigilance US FAERS | |
| 16 | Dizziness | FAERS: 378 Canada Vigilance: 25 | Canada Vigilance US FAERS | |
| 17 | Nausea | FAERS: 377 Canada Vigilance: 49 | Canada Vigilance US FAERS | |
| 18 | Memory impairment | FAERS: 312 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 19 | Back Pain | FAERS: 308 Canada Vigilance: 20 | Canada Vigilance US FAERS | |
| 20 | Feeling abnormal | FAERS: 276 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 21 | Pruritus | FAERS: 274 Canada Vigilance: 17 | Canada Vigilance US FAERS | |
| 22 | Weight decreased | FAERS: 251 Canada Vigilance: 17 | Canada Vigilance US FAERS | |
| 23 | Myopathy | FAERS: 247 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 24 | Alopecia | FAERS: 243 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 25 | No adverse event | FAERS: 221 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 26 | Blood glucose increased | FAERS: 216 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 27 | Musculoskeletal Pain | FAERS: 214 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 28 | Abdominal discomfort | FAERS: 204 Canada Vigilance: 26 | Canada Vigilance US FAERS | |
| 29 | Abasia | FAERS: 199 | US FAERS | |
| 30 | Chest Pain | FAERS: 193 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 31 | Vomiting | FAERS: 175 Canada Vigilance: 19 | Canada Vigilance US FAERS | |
| 32 | Constipation | FAERS: 169 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 33 | Alanine Aminotransferase Increased | FAERS: 167 Canada Vigilance: 18 | Canada Vigilance US FAERS | |
| 34 | Musculoskeletal stiffness | FAERS: 162 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 35 | Respiratory arrest | FAERS: 161 | US FAERS | |
| 36 | Aspartate Aminotransferase Increased | FAERS: 157 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 37 | Hypersensitivity | FAERS: 155 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 38 | Blood triglycerides increased | FAERS: 153 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 39 | Arthritis | FAERS: 149 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 40 | muscle injury | FAERS: 148 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Arthropathy | FAERS: 143 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 42 | Emotional distress | FAERS: 141 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Urticaria | FAERS: 138 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 44 | Disorientation | FAERS: 135 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 45 | Low density lipoprotein increased | FAERS: 135 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 46 | Tremor | FAERS: 133 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 47 | Anxiety | FAERS: 131 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 48 | Cataract | FAERS: 126 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 49 | Abdominal Pain | FAERS: 123 Canada Vigilance: 17 | Canada Vigilance US FAERS | |
| 50 | Wrong technique in drug usage process | FAERS: 121 | US FAERS | |
| 51 | Activities of daily living impaired | FAERS: 120 | US FAERS | |
| 52 | Infarction | FAERS: 115 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 53 | Pneumonia | FAERS: 111 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 54 | Flatulence | FAERS: 110 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 55 | Dyspepsia | FAERS: 109 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 56 | Dysgeusia | FAERS: 107 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Palpitations | FAERS: 104 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 58 | Chromaturia | FAERS: 102 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 59 | Myositis | FAERS: 100 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 60 | Neck Pain | FAERS: 98 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 61 | Deafness | FAERS: 96 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Burning sensation | FAERS: 92 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 63 | Visual Impairment | FAERS: 91 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 64 | Gamma-Glutamyltransferase Increased | FAERS: 89 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 65 | Erectile dysfunction | FAERS: 87 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 66 | Transaminases increased | FAERS: 86 | US FAERS | |
| 67 | Limb discomfort | FAERS: 85 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Nasopharyngitis | FAERS: 85 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Thrombosis | FAERS: 85 | US FAERS | |
| 70 | Tinnitus | FAERS: 82 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 71 | jaundice | FAERS: 82 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 72 | Hepatitis | FAERS: 79 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 73 | Swelling | FAERS: 79 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Somnolence | FAERS: 75 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 75 | Amyotrophic Lateral Sclerosis | FAERS: 74 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 76 | Dementia | FAERS: 74 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 77 | Cardiac Arrest | FAERS: 73 | US FAERS | |
| 78 | Bone pain | FAERS: 72 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 79 | Pancreatitis | FAERS: 72 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 80 | Joint swelling | FAERS: 71 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 81 | Nerve injury | FAERS: 70 | US FAERS | |
| 82 | Blood alkaline phosphatase increased | FAERS: 69 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 83 | Nervousness | FAERS: 63 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 84 | Blindness | FAERS: 62 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 85 | Impaired work ability | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 86 | Erythema | FAERS: 61 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 87 | Product substitution issue | FAERS: 61 Canada Vigilance: 119 | Canada Vigilance US FAERS | |
| 88 | Coronary Artery Disease | FAERS: 60 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 89 | Glaucoma | FAERS: 58 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 90 | Angina Pectoris | FAERS: 54 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 91 | Unevaluable event | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 92 | Aphasia | FAERS: 53 | US FAERS | |
| 93 | Atrial Fibrillation | FAERS: 52 | US FAERS | |
| 94 | Chest discomfort | FAERS: 52 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Nephrolithiasis | FAERS: 52 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | nervous system disorder | FAERS: 51 | US FAERS | |
| 97 | Blood creatinine increased | FAERS: 50 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 98 | Peripheral swelling | FAERS: 50 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 99 | Product quality issue | FAERS: 48 | US FAERS | |
| 100 | Discomfort | FAERS: 47 | US FAERS | |
| 101 | Vertigo | FAERS: 47 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 102 | Back disorder | FAERS: 46 | US FAERS | |
| 103 | Blood cholesterol abnormal | FAERS: 46 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 104 | Diplopia | FAERS: 46 | US FAERS | |
| 105 | Musculoskeletal discomfort | FAERS: 46 | US FAERS | |
| 106 | Neuralgia | FAERS: 45 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 107 | Cholelithiasis | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 108 | Dysarthria | FAERS: 43 | US FAERS | |
| 109 | Fibromyalgia | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 110 | Respiratory Failure | FAERS: 43 | US FAERS | |
| 111 | Influenza | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 112 | Muscle Fatigue | FAERS: 42 | US FAERS | |
| 113 | Muscle tightness | FAERS: 42 | US FAERS | |
| 114 | Blood lactate dehydrogenase increased | FAERS: 41 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 115 | Dermatomyositis | FAERS: 41 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 116 | Infection | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 117 | Urinary tract infection | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 118 | Dehydration | FAERS: 40 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 119 | Dry skin | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 120 | General physical health deterioration | FAERS: 40 | US FAERS | |
| 121 | Product taste abnormal | FAERS: 40 | US FAERS | |
| 122 | Hypothyroidism | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 123 | Syncope | FAERS: 39 | US FAERS | |
| 124 | Intentional product misuse | FAERS: 38 | US FAERS | |
| 125 | Joint stiffness | FAERS: 38 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 126 | Mental impairment | FAERS: 38 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 127 | Polymyositis | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 128 | Tachycardia | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 129 | Asthma | FAERS: 37 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 130 | Cerebral Infarction | FAERS: 37 | US FAERS | |
| 131 | Choking | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 132 | Joint injury | FAERS: 37 | US FAERS | |
| 133 | Lethargy | FAERS: 37 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 134 | Rheumatoid Arthritis | FAERS: 37 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 135 | Stress | FAERS: 37 | US FAERS | |
| 136 | Drug exposure during pregnancy | FAERS: 36 | US FAERS | |
| 137 | Dysphonia | FAERS: 35 | US FAERS | |
| 138 | Inflammation | FAERS: 35 | US FAERS | |
| 139 | Limb injury | FAERS: 35 | US FAERS | |
| 140 | Chills | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 141 | Myocardial necrosis marker increased | FAERS: 34 | US FAERS | |
| 142 | Myoglobin blood increased | FAERS: 34 | US FAERS | |
| 143 | Osteoporosis | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 144 | Polyneuropathy | FAERS: 34 | US FAERS | |
| 145 | Thrombocytopenia | FAERS: 34 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 146 | Autoimmune hepatitis | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 147 | Gout | FAERS: 33 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 148 | Hypokinesia | FAERS: 33 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 149 | Impaired driving ability | FAERS: 33 | US FAERS | |
| 150 | Monoplegia | FAERS: 33 | US FAERS | |
| 151 | Oropharyngeal pain | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 152 | Polymyalgia Rheumatica | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 153 | Walking aid user | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Cholestasis | FAERS: 30 | US FAERS | |
| 155 | Drug dispensing error | FAERS: 30 | US FAERS | |
| 156 | Global Amnesia | FAERS: 30 | US FAERS | |
| 157 | Muscle enzyme increased | FAERS: 30 | US FAERS | |
| 158 | Middle insomnia | FAERS: 29 | US FAERS | |
| 159 | Neuropathy | FAERS: 29 | US FAERS | |
| 160 | Bedridden | FAERS: 28 | US FAERS | |
| 161 | Bronchitis | FAERS: 28 | US FAERS | |
| 162 | Drug dose omission | FAERS: 28 | US FAERS | |
| 163 | Product size issue | FAERS: 28 | US FAERS | |
| 164 | Anger | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 165 | Carpal Tunnel Syndrome | FAERS: 27 | US FAERS | |
| 166 | Drug effect incomplete | FAERS: 27 | US FAERS | |
| 167 | Medication Error | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 168 | Rotator cuff syndrome | FAERS: 27 | US FAERS | |
| 169 | Arteriosclerosis | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 170 | Pancreatic carcinoma | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 171 | Throat irritation | FAERS: 26 | US FAERS | |
| 172 | Hypotension | FAERS: 25 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 173 | Lip swelling | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 174 | Personality Change | FAERS: 25 | US FAERS | |
| 175 | Renal pain | FAERS: 25 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 176 | Blood creatine phosphokinase MB increased | FAERS: 24 | US FAERS | |
| 177 | Disability | FAERS: 24 | US FAERS | |
| 178 | Flushing | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 179 | White blood cell count decreased | FAERS: 24 | US FAERS | |
| 180 | Epistaxis | FAERS: 23 | US FAERS | |
| 181 | Pharmaceutical product complaint | FAERS: 23 | US FAERS | |
| 182 | Therapeutic response unexpected | FAERS: 23 | US FAERS | |
| 183 | Dysuria | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 184 | Muscle Cramp | FAERS: 22 | US FAERS | |
| 185 | Sinusitis | FAERS: 22 | US FAERS | |
| 186 | Spinal column stenosis | FAERS: 22 | US FAERS | |
| 187 | Ageusia | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 188 | Crying | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 189 | Depressed mood | FAERS: 21 | US FAERS | |
| 190 | Multiple Sclerosis | FAERS: 21 | US FAERS | |
| 191 | Rash erythematous | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 192 | Sepsis | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 193 | Macular degeneration | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 194 | Musculoskeletal chest pain | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 195 | Night sweats | FAERS: 20 | US FAERS | |
| 196 | Poor quality drug administered | FAERS: 20 | US FAERS | |
| 197 | Post procedural complication | FAERS: 20 | US FAERS | |
| 198 | Acute myocardial infarction | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 199 | Blood potassium increased | FAERS: 19 | US FAERS | |
| 200 | Emotional disorder | FAERS: 19 | US FAERS | |
| 201 | Epilepsy | FAERS: 19 | US FAERS | |
| 202 | Eructation | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 203 | Gastritis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 204 | Myasthenia Gravis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 205 | Product use issue | FAERS: 19 | US FAERS | |
| 206 | Pulmonary Fibrosis | FAERS: 19 | US FAERS | |
| 207 | Suspected counterfeit product | FAERS: 19 | US FAERS | |
| 208 | Angioedema | FAERS: 18 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 209 | Gastric ulcer | FAERS: 18 | US FAERS | |
| 210 | Hyperthyroidism | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 211 | Incorrect dose administered | FAERS: 18 | US FAERS | |
| 212 | Overdose | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 213 | Poor quality sleep | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 214 | Postoperative thrombosis | FAERS: 18 | US FAERS | |
| 215 | Pulmonary Embolism | FAERS: 18 | US FAERS | |
| 216 | Reaction to drug excipients | FAERS: 18 | US FAERS | |
| 217 | Skin lesion | FAERS: 18 | US FAERS | |
| 218 | Agitation | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 219 | Blood glucose decreased | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 220 | Cholecystitis | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 221 | Drug administration error | FAERS: 17 | US FAERS | |
| 222 | Dysgraphia | FAERS: 17 | US FAERS | |
| 223 | Expired drug administered | FAERS: 17 | US FAERS | |
| 224 | Hostility | FAERS: 17 | US FAERS | |
| 225 | Muscle strain | FAERS: 17 | US FAERS | |
| 226 | Pharmaceutical product counterfeit | FAERS: 17 | US FAERS | |
| 227 | Restless Legs Syndrome | FAERS: 17 | US FAERS | |
| 228 | Restlessness | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 229 | Anorexia | FAERS: 16 | US FAERS | |
| 230 | Intentional drug misuse | FAERS: 16 | US FAERS | |
| 231 | Intervertebral disc disorder | FAERS: 16 | US FAERS | |
| 232 | Medication residue | FAERS: 16 | US FAERS | |
| 233 | Quality of life decreased | FAERS: 16 | US FAERS | |
| 234 | Urinary Incontinence | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 235 | Visual disturbance | FAERS: 16 | US FAERS | |
| 236 | Wheezing | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 237 | Acute Coronary Syndrome | FAERS: 15 | US FAERS | |
| 238 | Aortic Aneurysm | FAERS: 15 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 239 | Deep Vein Thrombosis | FAERS: 15 | US FAERS | |
| 240 | Frustration | FAERS: 15 | US FAERS | |
| 241 | Gait inability | FAERS: 15 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 242 | Hepatomegaly | FAERS: 15 | US FAERS | |
| 243 | Hypersomnia | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 244 | Irritable Bowel Syndrome | FAERS: 15 | US FAERS | |
| 245 | Loss of personal independence in daily activities | FAERS: 15 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 246 | Mood swings | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 247 | Product use in unapproved indication | FAERS: 15 | US FAERS | |
| 248 | Psoriasis | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 249 | Blood urine present | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 250 | Cataract operation | FAERS: 14 | US FAERS | |
| 251 | Depressed Level of Consciousness | FAERS: 14 | US FAERS | |
| 252 | Eczema | FAERS: 14 | US FAERS | |
| 253 | Enzyme abnormality | FAERS: 14 | US FAERS | |
| 254 | Muscle necrosis | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 255 | Aneurysm | FAERS: 13 | US FAERS | |
| 256 | Anosmia | FAERS: 13 | US FAERS | |
| 257 | Apparent death | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 258 | Blood urea increased | FAERS: 13 | US FAERS | |
| 259 | Completed Suicide | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 260 | Diabetes mellitus inadequate control | FAERS: 13 | US FAERS | |
| 261 | Eye pain | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 262 | Formication | FAERS: 13 | US FAERS | |
| 263 | Hepatitis C | FAERS: 13 | US FAERS | |
| 264 | Hernia | FAERS: 13 | US FAERS | |
| 265 | Lupus-like syndrome | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 266 | Lymphadenopathy | FAERS: 13 | US FAERS | |
| 267 | Multi-organ disorder | FAERS: 13 | US FAERS | |
| 268 | Ocular icterus | FAERS: 13 | US FAERS | |
| 269 | Poisoning | FAERS: 13 | US FAERS | |
| 270 | Sciatica | FAERS: 13 | US FAERS | |
| 271 | Wheelchair user | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 272 | Acute kidney injury | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 273 | Adverse event | FAERS: 12 | US FAERS | |
| 274 | Angioplasty | FAERS: 12 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 275 | Bilirubin conjugated increased | FAERS: 12 | US FAERS | |
| 276 | Blood creatine phosphokinase abnormal | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 277 | Blood pressure fluctuation | FAERS: 12 | US FAERS | |
| 278 | Cellulitis | FAERS: 12 | US FAERS | |
| 279 | Circumstance or information capable of leading to medication error | FAERS: 12 | US FAERS | |
| 280 | Cytolytic hepatitis | FAERS: 12 | US FAERS | |
| 281 | Dental caries | FAERS: 12 | US FAERS | |
| 282 | Dermatitis | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 283 | Diabetic Nephropathy | FAERS: 12 | US FAERS | |
| 284 | Disease recurrence | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 285 | Economic problem | FAERS: 12 | US FAERS | |
| 286 | Eosinophilia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 287 | Feeling Cold | FAERS: 12 | US FAERS | |
| 288 | Grip strength decreased | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 289 | High density lipoprotein increased | FAERS: 12 | US FAERS | |
| 290 | Nephrotic Syndrome | FAERS: 12 | US FAERS | |
| 291 | Poor peripheral circulation | FAERS: 12 | US FAERS | |
| 292 | Product use complaint | FAERS: 12 | US FAERS | |
| 293 | Productive Cough | FAERS: 12 | US FAERS | |
| 294 | Therapy non-responder | FAERS: 12 | US FAERS | |
| 295 | Vascular bypass graft | FAERS: 12 | US FAERS | |
| 296 | Ankle Fracture | FAERS: 11 | US FAERS | |
| 297 | Aphagia | FAERS: 11 | US FAERS | |
| 298 | Ascites | FAERS: 11 | US FAERS | |
| 299 | Blood glucose abnormal | FAERS: 11 | US FAERS | |
| 300 | Blood potassium decreased | FAERS: 11 | US FAERS | |
| 301 | Blood testosterone decreased | FAERS: 11 | US FAERS | |
| 302 | Cystitis | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 303 | Diabetic Foot | FAERS: 11 | US FAERS | |
| 304 | Disease Progression | FAERS: 11 | US FAERS | |
| 305 | Diverticulitis | FAERS: 11 | US FAERS | |
| 306 | Lipase increased | FAERS: 11 | US FAERS | |
| 307 | Sluggishness | FAERS: 11 | US FAERS | |
| 308 | Urinary Retention | FAERS: 11 | US FAERS | |
| 309 | Aphonia | FAERS: 10 | US FAERS | |
| 310 | Hepatotoxicity | FAERS: 10 | US FAERS | |
| 311 | High density lipoprotein abnormal | FAERS: 10 | US FAERS | |
| 312 | Inappropriate schedule of drug administration | FAERS: 10 | US FAERS | |
| 313 | Joint Range of Motion Decreased | FAERS: 10 | US FAERS | |
| 314 | MYELODYSPLASTIC SYNDROME | FAERS: 10 | US FAERS | |
| 315 | Pancytopenia | FAERS: 10 | US FAERS | |
| 316 | Paresis | FAERS: 10 | US FAERS | |
| 317 | Polyuria | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 318 | Presyncope | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 319 | Septic Shock | FAERS: 10 | US FAERS | |
| 320 | Sexual Dysfunction | FAERS: 10 | US FAERS | |
| 321 | Skin irritation | FAERS: 10 | US FAERS | |
| 322 | Thirst | FAERS: 10 | US FAERS | |
| 323 | Throat cancer | FAERS: 10 | US FAERS | |
| 324 | Toothache | FAERS: 10 | US FAERS | |
| 325 | Ubiquinone decreased | FAERS: 10 | US FAERS | |
| 326 | Ulcer | FAERS: 10 | US FAERS | |
| 327 | Vasculitis | FAERS: 10 | US FAERS | |
| 328 | Venous occlusion | FAERS: 10 | US FAERS | |
| 329 | Acne | FAERS: 9 | US FAERS | |
| 330 | Aldolase increased | FAERS: 9 | US FAERS | |
| 331 | Asphyxia | FAERS: 9 | US FAERS | |
| 332 | Blood thyroid stimulating hormone increased | FAERS: 9 | US FAERS | |
| 333 | Bursitis | FAERS: 9 | US FAERS | |
| 334 | Cerebral Thrombosis | FAERS: 9 | US FAERS | |
| 335 | Colitis | FAERS: 9 | US FAERS | |
| 336 | Cyst | FAERS: 9 | US FAERS | |
| 337 | Diabetic Retinopathy | FAERS: 9 | US FAERS | |
| 338 | Embolism | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 339 | Executive dysfunction | FAERS: 9 | US FAERS | |
| 340 | Eye irritation | FAERS: 9 | US FAERS | |
| 341 | Fracture | FAERS: 9 | US FAERS | |
| 342 | Intervertebral Disc Degeneration | FAERS: 9 | US FAERS | |
| 343 | Intestinal Obstruction | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 344 | Leukopenia | FAERS: 9 | US FAERS | |
| 345 | Ligament rupture | FAERS: 9 | US FAERS | |
| 346 | Mental status changes | FAERS: 9 | US FAERS | |
| 347 | Onychomycosis | FAERS: 9 | US FAERS | |
| 348 | Overweight | FAERS: 9 | US FAERS | |
| 349 | Periarthritis | FAERS: 9 | US FAERS | |
| 350 | Quadriplegia | FAERS: 9 | US FAERS | |
| 351 | Screaming | FAERS: 9 | US FAERS | |
| 352 | Skin tightness | FAERS: 9 | US FAERS | |
| 353 | Stomatitis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 354 | Sudden death | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 355 | Tension | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 356 | Wrong technique in product usage process | FAERS: 9 | US FAERS | |
| 357 | Acute respiratory failure | FAERS: 8 | US FAERS | |
| 358 | Apathy | FAERS: 8 | US FAERS | |
| 359 | Arterial therapeutic procedure | FAERS: 8 | US FAERS | |
| 360 | Blood amylase increased | FAERS: 8 | US FAERS | |
| 361 | Bradyphrenia | FAERS: 8 | US FAERS | |
| 362 | Breast tenderness | FAERS: 8 | US FAERS | |
| 363 | Cardiac Flutter | FAERS: 8 | US FAERS | |
| 364 | Carotid artery occlusion | FAERS: 8 | US FAERS | |
| 365 | Cold sweat | FAERS: 8 | US FAERS | |
| 366 | Drug ineffective for unapproved indication | FAERS: 8 | US FAERS | |
| 367 | Ecchymosis | FAERS: 8 | US FAERS | |
| 368 | Expired product administered | FAERS: 8 | US FAERS | |
| 369 | Gastrointestinal Pain | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 370 | Head discomfort | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 371 | Hepatic necrosis | FAERS: 8 | US FAERS | |
| 372 | Lipoprotein (a) increased | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 373 | Low density lipoprotein abnormal | FAERS: 8 | US FAERS | |
| 374 | Lymphoma | FAERS: 8 | US FAERS | |
| 375 | Malabsorption | FAERS: 8 | US FAERS | |
| 376 | Necrotising myositis | FAERS: 8 Canada Vigilance: 20 | Canada Vigilance US FAERS | |
| 377 | Osteomyelitis | FAERS: 8 | US FAERS | |
| 378 | Panic Disorder | FAERS: 8 | US FAERS | |
| 379 | Psychiatric symptom | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 380 | Skin Ulcer | FAERS: 8 | US FAERS | |
| 381 | Skin reaction | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 382 | Vascular occlusion | FAERS: 8 | US FAERS | |
| 383 | Vitamin D Deficiency | FAERS: 8 | US FAERS | |
| 384 | Arthropod bite | FAERS: 7 | US FAERS | |
| 385 | Blood sodium decreased | FAERS: 7 | US FAERS | |
| 386 | Blood triglycerides abnormal | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 387 | Bronchopneumonia | FAERS: 7 | US FAERS | |
| 388 | Catheter placement | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 389 | Drug prescribing error | FAERS: 7 | US FAERS | |
| 390 | Drug toxicity | FAERS: 7 | US FAERS | |
| 391 | Ear discomfort | FAERS: 7 | US FAERS | |
| 392 | Gastric Bypass | FAERS: 7 | US FAERS | |
| 393 | Hepatic Encephalopathy | FAERS: 7 | US FAERS | |
| 394 | Labyrinthitis | FAERS: 7 | US FAERS | |
| 395 | Lactose Intolerance | FAERS: 7 | US FAERS | |
| 396 | Lipoma | FAERS: 7 | US FAERS | |
| 397 | Mouth swelling | FAERS: 7 | US FAERS | |
| 398 | Pain of skin | FAERS: 7 | US FAERS | |
| 399 | Petechiae | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 400 | Product contamination physical | FAERS: 7 | US FAERS | |
| 401 | Product dispensing error | FAERS: 7 | US FAERS | |
| 402 | Retinal Detachment | FAERS: 7 | US FAERS | |
| 403 | Shock | FAERS: 7 | US FAERS | |
| 404 | Sinus headache | FAERS: 7 | US FAERS | |
| 405 | Somnambulism | FAERS: 7 | US FAERS | |
| 406 | Thymus enlargement | FAERS: 7 | US FAERS | |
| 407 | Thyroid Neoplasm | FAERS: 7 | US FAERS | |
| 408 | Tooth Loss | FAERS: 7 | US FAERS | |
| 409 | Vitreous floaters | FAERS: 7 | US FAERS | |
| 410 | Amylase increased | FAERS: 6 | US FAERS | |
| 411 | Anhedonia | FAERS: 6 | US FAERS | |
| 412 | Benign Prostatic Hyperplasia | FAERS: 6 | US FAERS | |
| 413 | Blood glucose fluctuation | FAERS: 6 | US FAERS | |
| 414 | Bradycardia | FAERS: 6 | US FAERS | |
| 415 | Carcinoma | FAERS: 6 | US FAERS | |
| 416 | Cardiomegaly | FAERS: 6 | US FAERS | |
| 417 | Cell Death | FAERS: 6 | US FAERS | |
| 418 | Cerebellar Ataxia | FAERS: 6 | US FAERS | |
| 419 | Coronary angioplasty | FAERS: 6 | US FAERS | |
| 420 | Deafness Neurosensory | FAERS: 6 | US FAERS | |
| 421 | Delirium | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 422 | Drug Dependence | FAERS: 6 | US FAERS | |
| 423 | Electrocardiogram abnormal | FAERS: 6 | US FAERS | |
| 424 | Erection increased | FAERS: 6 | US FAERS | |
| 425 | Facial Pain | FAERS: 6 | US FAERS | |
| 426 | Gastrointestinal carcinoma | FAERS: 6 | US FAERS | |
| 427 | Hemiplegia | FAERS: 6 | US FAERS | |
| 428 | Immobile | FAERS: 6 | US FAERS | |
| 429 | Intestinal infarction | FAERS: 6 | US FAERS | |
| 430 | Intracranial Aneurysm | FAERS: 6 | US FAERS | |
| 431 | Laryngitis | FAERS: 6 | US FAERS | |
| 432 | Leukocytosis | FAERS: 6 | US FAERS | |
| 433 | Lichen Planus | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 434 | Lipids abnormal | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 435 | Metastasis | FAERS: 6 | US FAERS | |
| 436 | Metrorrhagia | FAERS: 6 | US FAERS | |
| 437 | Muscle Rigidity | FAERS: 6 | US FAERS | |
| 438 | Myoglobin urine present | FAERS: 6 | US FAERS | |
| 439 | Nodule | FAERS: 6 | US FAERS | |
| 440 | Nonspecific reaction | FAERS: 6 | US FAERS | |
| 441 | Obesity | FAERS: 6 | US FAERS | |
| 442 | Optic Neuritis | FAERS: 6 | US FAERS | |
| 443 | Osteopenia | FAERS: 6 | US FAERS | |
| 444 | Pleurisy | FAERS: 6 | US FAERS | |
| 445 | Product packaging issue | FAERS: 6 | US FAERS | |
| 446 | Protein urine present | FAERS: 6 | US FAERS | |
| 447 | Quadruple vessel bypass graft | FAERS: 6 | US FAERS | |
| 448 | Respiratory distress | FAERS: 6 | US FAERS | |
| 449 | Retching | FAERS: 6 | US FAERS | |
| 450 | Scleroderma | FAERS: 6 | US FAERS | |
| 451 | Shoulder Pain | FAERS: 6 | US FAERS | |
| 452 | Sjogren's Syndrome | FAERS: 6 | US FAERS | |
| 453 | Sneezing | FAERS: 6 | US FAERS | |
| 454 | Splenomegaly | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 455 | Troponin increased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 456 | Agranulocytosis | FAERS: 5 | US FAERS | |
| 457 | Appendicitis | FAERS: 5 | US FAERS | |
| 458 | Atelectasis | FAERS: 5 | US FAERS | |
| 459 | Atrioventricular Block | FAERS: 5 | US FAERS | |
| 460 | Autoimmune thyroiditis | FAERS: 5 | US FAERS | |
| 461 | Bipolar Disorder | FAERS: 5 | US FAERS | |
| 462 | Bladder pain | FAERS: 5 | US FAERS | |
| 463 | Blood creatine increased | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 464 | Breast Cyst | FAERS: 5 | US FAERS | |
| 465 | Bulbar palsy | FAERS: 5 | US FAERS | |
| 466 | Cardiac discomfort | FAERS: 5 | US FAERS | |
| 467 | Cholangitis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 468 | Creatinine renal clearance decreased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 469 | Diplegia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 470 | Feeling jittery | FAERS: 5 | US FAERS | |
| 471 | Flank Pain | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 472 | Food Allergy | FAERS: 5 | US FAERS | |
| 473 | Gallbladder pain | FAERS: 5 | US FAERS | |
| 474 | Gastric infection | FAERS: 5 | US FAERS | |
| 475 | Glossitis | FAERS: 5 | US FAERS | |
| 476 | Hearing disability | FAERS: 5 | US FAERS | |
| 477 | Hypoaesthesia facial | FAERS: 5 | US FAERS | |
| 478 | Hypogonadism | FAERS: 5 | US FAERS | |
| 479 | Hypophagia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 480 | Hypoxia | FAERS: 5 | US FAERS | |
| 481 | Impaired gastric emptying | FAERS: 5 | US FAERS | |
| 482 | Incontinence | FAERS: 5 | US FAERS | |
| 483 | Limb operation | FAERS: 5 | US FAERS | |
| 484 | Metabolic acidosis | FAERS: 5 | US FAERS | |
| 485 | Neutropenia | FAERS: 5 | US FAERS | |
| 486 | No adverse reaction | FAERS: 5 | US FAERS | |
| 487 | Ocular discomfort | FAERS: 5 | US FAERS | |
| 488 | Osteitis | FAERS: 5 | US FAERS | |
| 489 | Pallor | FAERS: 5 | US FAERS | |
| 490 | Pancreatic enzymes increased | FAERS: 5 | US FAERS | |
| 491 | Pericarditis | FAERS: 5 | US FAERS | |
| 492 | Peripheral arterial occlusive disease | FAERS: 5 | US FAERS | |
| 493 | Physical disability | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 494 | Pregnancy | FAERS: 5 | US FAERS | |
| 495 | Procedural complication | FAERS: 5 | US FAERS | |
| 496 | Product physical issue | FAERS: 5 | US FAERS | |
| 497 | Proteinuria | FAERS: 5 | US FAERS | |
| 498 | Renal cyst | FAERS: 5 | US FAERS | |
| 499 | Rosacea | FAERS: 5 | US FAERS | |
| 500 | Stevens-Johnson Syndrome | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 501 | Toxicity to various agents | FAERS: 5 | US FAERS | |
| 502 | Accidental overdose | FAERS: 4 | US FAERS | |
| 503 | Alanine aminotransferase abnormal | FAERS: 4 | US FAERS | |
| 504 | Alcohol abuse | FAERS: 4 | US FAERS | |
| 505 | Altered state of consciousness | FAERS: 4 | US FAERS | |
| 506 | Amputation | FAERS: 4 | US FAERS | |
| 507 | Ankylosing spondylitis | FAERS: 4 | US FAERS | |
| 508 | Arterial bypass operation | FAERS: 4 | US FAERS | |
| 509 | Asthenopia | FAERS: 4 | US FAERS | |
| 510 | Blood immunoglobulin E increased | FAERS: 4 | US FAERS | |
| 511 | Blood iron decreased | FAERS: 4 | US FAERS | |
| 512 | Blood magnesium decreased | FAERS: 4 | US FAERS | |
| 513 | Bowel movement irregularity | FAERS: 4 | US FAERS | |
| 514 | Bronchospasm | FAERS: 4 | US FAERS | |
| 515 | Carbohydrate antigen 19-9 increased | FAERS: 4 | US FAERS | |
| 516 | Carcinoembryonic antigen increased | FAERS: 4 | US FAERS | |
| 517 | Cardiac ablation | FAERS: 4 | US FAERS | |
| 518 | Cardiac procedure complication | FAERS: 4 | US FAERS | |
| 519 | Cerebral disorder | FAERS: 4 | US FAERS | |
| 520 | Chronic Fatigue Syndrome | FAERS: 4 | US FAERS | |
| 521 | Clumsiness | FAERS: 4 | US FAERS | |
| 522 | Counterfeit drug administered | FAERS: 4 | US FAERS | |
| 523 | Device occlusion | FAERS: 4 | US FAERS | |
| 524 | Diabetic Ketoacidosis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 525 | Drug exposure before pregnancy | FAERS: 4 | US FAERS | |
| 526 | Dysphasia | FAERS: 4 | US FAERS | |
| 527 | Dystonia | FAERS: 4 | US FAERS | |
| 528 | Encephalitis | FAERS: 4 | US FAERS | |
| 529 | Epicondylitis | FAERS: 4 | US FAERS | |
| 530 | Epididymitis | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 531 | Fear of falling | FAERS: 4 | US FAERS | |
| 532 | Gastrointestinal infection | FAERS: 4 | US FAERS | |
| 533 | Gastrointestinal sounds abnormal | FAERS: 4 | US FAERS | |
| 534 | Heart valve calcification | FAERS: 4 | US FAERS | |
| 535 | Hemiparesis | FAERS: 4 | US FAERS | |
| 536 | Hepatic congestion | FAERS: 4 | US FAERS | |
| 537 | Hip surgery | FAERS: 4 | US FAERS | |
| 538 | Hyperkeratosis | FAERS: 4 | US FAERS | |
| 539 | Hyporeflexia | FAERS: 4 | US FAERS | |
| 540 | Increased tendency to bruise | FAERS: 4 | US FAERS | |
| 541 | Increased upper airway secretion | FAERS: 4 | US FAERS | |
| 542 | Initial insomnia | FAERS: 4 | US FAERS | |
| 543 | Intercepted drug dispensing error | FAERS: 4 | US FAERS | |
| 544 | Lip and/or oral cavity cancer | FAERS: 4 | US FAERS | |
| 545 | Liver Abscess | FAERS: 4 | US FAERS | |
| 546 | Loose tooth | FAERS: 4 | US FAERS | |
| 547 | Lower motor neurone lesion | FAERS: 4 | US FAERS | |
| 548 | Lower respiratory tract infection | FAERS: 4 | US FAERS | |
| 549 | Lyme Disease | FAERS: 4 | US FAERS | |
| 550 | Lymphocytic infiltration | FAERS: 4 | US FAERS | |
| 551 | Medical device complication | FAERS: 4 | US FAERS | |
| 552 | Medication residue present | FAERS: 4 | US FAERS | |
| 553 | Meningitis | FAERS: 4 | US FAERS | |
| 554 | Meniscus injury | FAERS: 4 | US FAERS | |
| 555 | Multiple Myeloma | FAERS: 4 | US FAERS | |
| 556 | Myocarditis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 557 | Myoglobinuria | FAERS: 4 | US FAERS | |
| 558 | Myosclerosis | FAERS: 4 | US FAERS | |
| 559 | No adverse effect | FAERS: 4 | US FAERS | |
| 560 | Obsessive thoughts | FAERS: 4 | US FAERS | |
| 561 | Ocular vascular disorder | FAERS: 4 | US FAERS | |
| 562 | Onychoclasis | FAERS: 4 | US FAERS | |
| 563 | Otitis Media | FAERS: 4 | US FAERS | |
| 564 | Pancreatic Cyst | FAERS: 4 | US FAERS | |
| 565 | Paraplegia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 566 | Periodontitis | FAERS: 4 | US FAERS | |
| 567 | Phlebitis | FAERS: 4 | US FAERS | |
| 568 | Pneumothorax | FAERS: 4 | US FAERS | |
| 569 | Pre-existing condition improved | FAERS: 4 | US FAERS | |
| 570 | Prescribed overdose | FAERS: 4 | US FAERS | |
| 571 | Product counterfeit | FAERS: 4 | US FAERS | |
| 572 | Product shape issue | FAERS: 4 | US FAERS | |
| 573 | Profound Mental Retardation | FAERS: 4 | US FAERS | |
| 574 | Pulmonary thrombosis | FAERS: 4 | US FAERS | |
| 575 | Reaction to excipient | FAERS: 4 | US FAERS | |
| 576 | Regurgitation | FAERS: 4 | US FAERS | |
| 577 | Renal tubular necrosis | FAERS: 4 | US FAERS | |
| 578 | Respiratory Depression | FAERS: 4 | US FAERS | |
| 579 | Retrograde amnesia | FAERS: 4 | US FAERS | |
| 580 | Sinus Tachycardia | FAERS: 4 | US FAERS | |
| 581 | Spondylitis | FAERS: 4 | US FAERS | |
| 582 | Suicide attempt | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 583 | Temperature intolerance | FAERS: 4 | US FAERS | |
| 584 | Transmission of drug via semen | FAERS: 4 | US FAERS | |
| 585 | Trigeminal Neuralgia | FAERS: 4 | US FAERS | |
| 586 | Triple vessel bypass graft | FAERS: 4 | US FAERS | |
| 587 | Venous Thrombosis | FAERS: 4 | US FAERS | |
| 588 | Venous thrombosis limb | FAERS: 4 | US FAERS | |
| 589 | Vitreous Detachment | FAERS: 4 | US FAERS | |
| 590 | Abscess | FAERS: 3 | US FAERS | |
| 591 | Amaurosis Fugax | FAERS: 3 | US FAERS | |
| 592 | Animal bite | FAERS: 3 | US FAERS | |
| 593 | Anorgasmia | FAERS: 3 | US FAERS | |
| 594 | Antibody test abnormal | FAERS: 3 | US FAERS | |
| 595 | Ataxia | FAERS: 3 | US FAERS | |
| 596 | Axonal neuropathy | FAERS: 3 | US FAERS | |
| 597 | Basal cell carcinoma | FAERS: 3 | US FAERS | |
| 598 | Biopsy liver abnormal | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 599 | Biopsy muscle abnormal | FAERS: 3 | US FAERS | |
| 600 | Bladder spasm | FAERS: 3 | US FAERS | |
| 601 | Blood count abnormal | FAERS: 3 | US FAERS | |
| 602 | Blood immunoglobulin G increased | FAERS: 3 | US FAERS | |
| 603 | Blood triglycerides decreased | FAERS: 3 | US FAERS | |
| 604 | Bone density decreased | FAERS: 3 | US FAERS | |
| 605 | Bone lesion | FAERS: 3 | US FAERS | |
| 606 | Buccal mucosal roughening | FAERS: 3 | US FAERS | |
| 607 | Cachexia | FAERS: 3 | US FAERS | |
| 608 | Cardiomyopathy acute | FAERS: 3 | US FAERS | |
| 609 | Cubital Tunnel Syndrome | FAERS: 3 | US FAERS | |
| 610 | Cyanosis | FAERS: 3 | US FAERS | |
| 611 | Demyelination | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 612 | Dengue Fever | FAERS: 3 | US FAERS | |
| 613 | Depression suicidal | FAERS: 3 | US FAERS | |
| 614 | Disseminated Intravascular Coagulation | FAERS: 3 | US FAERS | |
| 615 | Drug withdrawal syndrome | FAERS: 3 | US FAERS | |
| 616 | Dysphemia | FAERS: 3 | US FAERS | |
| 617 | Electrocardiogram change | FAERS: 3 | US FAERS | |
| 618 | Enterococcal infection | FAERS: 3 | US FAERS | |
| 619 | Essential Hypertension | FAERS: 3 | US FAERS | |
| 620 | Eye laser surgery | FAERS: 3 | US FAERS | |
| 621 | Failure to Thrive | FAERS: 3 | US FAERS | |
| 622 | Fasting | FAERS: 3 | US FAERS | |
| 623 | Folliculitis | FAERS: 3 | US FAERS | |
| 624 | Foreign body trauma | FAERS: 3 | US FAERS | |
| 625 | Full blood count abnormal | FAERS: 3 | US FAERS | |
| 626 | Gastroenteritis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 627 | Gastrointestinal inflammation | FAERS: 3 | US FAERS | |
| 628 | General physical condition abnormal | FAERS: 3 | US FAERS | |
| 629 | Granulocyte count decreased | FAERS: 3 | US FAERS | |
| 630 | Guillain-Barre Syndrome | FAERS: 3 | US FAERS | |
| 631 | Hydronephrosis | FAERS: 3 | US FAERS | |
| 632 | Hyperparathyroidism | FAERS: 3 | US FAERS | |
| 633 | Hypertensive heart disease | FAERS: 3 | US FAERS | |
| 634 | Hypoventilation | FAERS: 3 | US FAERS | |
| 635 | Infectious peritonitis | FAERS: 3 | US FAERS | |
| 636 | Infertility | FAERS: 3 | US FAERS | |
| 637 | Insulin-requiring type 2 diabetes mellitus | FAERS: 3 | US FAERS | |
| 638 | Intentional dose omission | FAERS: 3 | US FAERS | |
| 639 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 640 | Laceration | FAERS: 3 | US FAERS | |
| 641 | Lymphopenia | FAERS: 3 | US FAERS | |
| 642 | Malignant neoplasm progression | FAERS: 3 | US FAERS | |
| 643 | Menorrhagia | FAERS: 3 | US FAERS | |
| 644 | Multiple System Atrophy | FAERS: 3 | US FAERS | |
| 645 | Multiple allergies | FAERS: 3 | US FAERS | |
| 646 | Nail Infection | FAERS: 3 | US FAERS | |
| 647 | Necrosis | FAERS: 3 | US FAERS | |
| 648 | Neuritis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 649 | Neuroleptic Malignant Syndrome | FAERS: 3 | US FAERS | |
| 650 | Nocturia | FAERS: 3 | US FAERS | |
| 651 | Nuchal Rigidity | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 652 | Ophthalmoplegia | FAERS: 3 | US FAERS | |
| 653 | Optic Atrophy | FAERS: 3 | US FAERS | |
| 654 | Optic Neuropathy | FAERS: 3 | US FAERS | |
| 655 | Oral fungal infection | FAERS: 3 | US FAERS | |
| 656 | Oral pain | FAERS: 3 | US FAERS | |
| 657 | Oropharyngeal blistering | FAERS: 3 | US FAERS | |
| 658 | Oropharyngeal swelling | FAERS: 3 | US FAERS | |
| 659 | Oxygen supplementation | FAERS: 3 | US FAERS | |
| 660 | Pancreatic Insufficiency | FAERS: 3 | US FAERS | |
| 661 | Pancreatic enlargement | FAERS: 3 | US FAERS | |
| 662 | Pelvic Pain | FAERS: 3 | US FAERS | |
| 663 | Penile size reduced | FAERS: 3 | US FAERS | |
| 664 | Peripheral artery occlusion | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 665 | Photophobia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 666 | Platelet count abnormal | FAERS: 3 | US FAERS | |
| 667 | Polyarthritis | FAERS: 3 | US FAERS | |
| 668 | Post-Traumatic Stress Disorder | FAERS: 3 | US FAERS | |
| 669 | Postinfarction angina | FAERS: 3 | US FAERS | |
| 670 | Prescription drug used without a prescription | FAERS: 3 | US FAERS | |
| 671 | Priapism | FAERS: 3 | US FAERS | |
| 672 | Product container seal issue | FAERS: 3 | US FAERS | |
| 673 | Product difficult to swallow | FAERS: 3 | US FAERS | |
| 674 | Prostatic pain | FAERS: 3 | US FAERS | |
| 675 | Pulmonary Hypertension | FAERS: 3 | US FAERS | |
| 676 | Pulmonary Infarction | FAERS: 3 | US FAERS | |
| 677 | Quadriparesis | FAERS: 3 | US FAERS | |
| 678 | Radiculitis | FAERS: 3 | US FAERS | |
| 679 | Radiculopathy | FAERS: 3 | US FAERS | |
| 680 | Retinal Vein Occlusion | FAERS: 3 | US FAERS | |
| 681 | Rhinitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 682 | Senile dementia | FAERS: 3 | US FAERS | |
| 683 | Skeletal injury | FAERS: 3 | US FAERS | |
| 684 | Sleep disorder due to general medical condition, insomnia type | FAERS: 3 | US FAERS | |
| 685 | Spinal column injury | FAERS: 3 | US FAERS | |
| 686 | Spondylolisthesis | FAERS: 3 | US FAERS | |
| 687 | Squamous cell carcinoma | FAERS: 3 | US FAERS | |
| 688 | Sudden Cardiac Death | FAERS: 3 | US FAERS | |
| 689 | Sunburn | FAERS: 3 | US FAERS | |
| 690 | Supraventricular tachycardia | FAERS: 3 | US FAERS | |
| 691 | Synovitis | FAERS: 3 | US FAERS | |
| 692 | Tachyarrhythmia | FAERS: 3 | US FAERS | |
| 693 | Tenosynovitis | FAERS: 3 | US FAERS | |
| 694 | Tetany | FAERS: 3 | US FAERS | |
| 695 | Therapeutic procedure | FAERS: 3 | US FAERS | |
| 696 | Therapy cessation | FAERS: 3 | US FAERS | |
| 697 | Thermal burn | FAERS: 3 | US FAERS | |
| 698 | Thrombophlebitis | FAERS: 3 | US FAERS | |
| 699 | Trichorrhexis | FAERS: 3 | US FAERS | |
| 700 | Tuberculosis | FAERS: 3 | US FAERS | |
| 701 | Urine ketone body present | FAERS: 3 | US FAERS | |
| 702 | Vascular calcification | FAERS: 3 | US FAERS | |
| 703 | Vascular pain | FAERS: 3 | US FAERS | |
| 704 | Venous Injury | FAERS: 3 | US FAERS | |
| 705 | Violence-related symptom | FAERS: 3 | US FAERS | |
| 706 | angiogram | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 707 | furuncle | FAERS: 3 | US FAERS | |
| 708 | prostatitis | FAERS: 3 | US FAERS | |
| 709 | Aborted pregnancy | FAERS: 2 | US FAERS | |
| 710 | Acarodermatitis | FAERS: 2 | US FAERS | |
| 711 | Adenocarcinoma | FAERS: 2 | US FAERS | |
| 712 | Ammonia increased | FAERS: 2 | US FAERS | |
| 713 | Amnestic Disorder | FAERS: 2 | US FAERS | |
| 714 | Anal Fissure | FAERS: 2 | US FAERS | |
| 715 | Anencephaly | FAERS: 2 | US FAERS | |
| 716 | Antinuclear antibody increased | FAERS: 2 | US FAERS | |
| 717 | Anuria | FAERS: 2 | US FAERS | |
| 718 | Aortic occlusion | FAERS: 2 | US FAERS | |
| 719 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 720 | Autonomic nervous system imbalance | FAERS: 2 | US FAERS | |
| 721 | Bacteria blood identified | FAERS: 2 | US FAERS | |
| 722 | Biliary cirrhosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 723 | Blepharospasm | FAERS: 2 | US FAERS | |
| 724 | Blood albumin decreased | FAERS: 2 | US FAERS | |
| 725 | Blood bilirubin abnormal | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 726 | Blood brain barrier defect | FAERS: 2 | US FAERS | |
| 727 | Blood chloride decreased | FAERS: 2 | US FAERS | |
| 728 | Blood creatinine abnormal | FAERS: 2 | US FAERS | |
| 729 | Blood glucose normal | FAERS: 2 | US FAERS | |
| 730 | Blood ketone body increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 731 | Blood lactate dehydrogenase abnormal | FAERS: 2 | US FAERS | |
| 732 | Blood pressure inadequately controlled | FAERS: 2 | US FAERS | |
| 733 | Blood sodium increased | FAERS: 2 | US FAERS | |
| 734 | Blood thyroid stimulating hormone abnormal | FAERS: 2 | US FAERS | |
| 735 | Blood zinc decreased | FAERS: 2 | US FAERS | |
| 736 | Brain scan abnormal | FAERS: 2 | US FAERS | |
| 737 | C-reactive protein decreased | FAERS: 2 | US FAERS | |
| 738 | Calcinosis | FAERS: 2 | US FAERS | |
| 739 | Candidiasis | FAERS: 2 | US FAERS | |
| 740 | Cardiac Hypertrophy | FAERS: 2 | US FAERS | |
| 741 | Carnitine decreased | FAERS: 2 | US FAERS | |
| 742 | Catarrh | FAERS: 2 | US FAERS | |
| 743 | Cerebral Palsy | FAERS: 2 | US FAERS | |
| 744 | Cerebral atrophy | FAERS: 2 | US FAERS | |
| 745 | Cerebral microhaemorrhage | FAERS: 2 | US FAERS | |
| 746 | Cerebral ventricle dilatation | FAERS: 2 | US FAERS | |
| 747 | Cervix carcinoma | FAERS: 2 | US FAERS | |
| 748 | Cholangiectasis acquired | FAERS: 2 | US FAERS | |
| 749 | Cholangiocarcinoma | FAERS: 2 | US FAERS | |
| 750 | Cholecystitis infective | FAERS: 2 | US FAERS | |
| 751 | Chondromatosis | FAERS: 2 | US FAERS | |
| 752 | Chorea | FAERS: 2 | US FAERS | |
| 753 | Cleft Palate | FAERS: 2 | US FAERS | |
| 754 | Colectomy | FAERS: 2 | US FAERS | |
| 755 | Complications of maternal exposure to therapeutic drugs | FAERS: 2 | US FAERS | |
| 756 | Compression fracture | FAERS: 2 | US FAERS | |
| 757 | Conversion disorder | FAERS: 2 | US FAERS | |
| 758 | Denervation atrophy | FAERS: 2 | US FAERS | |
| 759 | Diverticulum | FAERS: 2 | US FAERS | |
| 760 | Dysentery | FAERS: 2 | US FAERS | |
| 761 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 762 | Electromyogram abnormal | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 763 | Empyema | FAERS: 2 | US FAERS | |
| 764 | Enteritis | FAERS: 2 | US FAERS | |
| 765 | Enzyme level increased | FAERS: 2 | US FAERS | |
| 766 | Epididymal infection | FAERS: 2 | US FAERS | |
| 767 | Epigastric discomfort | FAERS: 2 | US FAERS | |
| 768 | Erysipelas | FAERS: 2 | US FAERS | |
| 769 | Erythema Multiforme | FAERS: 2 | US FAERS | |
| 770 | Exposure to toxic agent | FAERS: 2 | US FAERS | |
| 771 | Extra dose administered | FAERS: 2 | US FAERS | |
| 772 | Extranodal marginal zone B-cell lymphoma (MALT type) | FAERS: 2 | US FAERS | |
| 773 | Extraocular Muscle Paresis | FAERS: 2 | US FAERS | |
| 774 | Eye Infection | FAERS: 2 | US FAERS | |
| 775 | Facial paralysis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 776 | Fascial rupture | FAERS: 2 | US FAERS | |
| 777 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 778 | Feelings of worthlessness | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 779 | Femoral artery occlusion | FAERS: 2 | US FAERS | |
| 780 | Fibroadenoma of breast | FAERS: 2 | US FAERS | |
| 781 | Food Poisoning | FAERS: 2 | US FAERS | |
| 782 | Gammopathy | FAERS: 2 | US FAERS | |
| 783 | Gangrene | FAERS: 2 | US FAERS | |
| 784 | Gastric Dilatation | FAERS: 2 | US FAERS | |
| 785 | Gastrointestinal motility disorder | FAERS: 2 | US FAERS | |
| 786 | Genital Herpes | FAERS: 2 | US FAERS | |
| 787 | Gluten sensitivity | FAERS: 2 | US FAERS | |
| 788 | Growth retardation | FAERS: 2 | US FAERS | |
| 789 | Hallucinations, mixed | FAERS: 2 | US FAERS | |
| 790 | Helicobacter test positive | FAERS: 2 | US FAERS | |
| 791 | Hepatitis A | FAERS: 2 | US FAERS | |
| 792 | Hepatitis B positive | FAERS: 2 | US FAERS | |
| 793 | Hepatitis B | FAERS: 2 | US FAERS | |
| 794 | Hepatitis C positive | FAERS: 2 | US FAERS | |
| 795 | Hernia obstructive | FAERS: 2 | US FAERS | |
| 796 | Hoarseness | FAERS: 2 | US FAERS | |
| 797 | Hyperlipasaemia | FAERS: 2 | US FAERS | |
| 798 | Hyperphagia | FAERS: 2 | US FAERS | |
| 799 | Hyperreflexia | FAERS: 2 | US FAERS | |
| 800 | Hysterectomy | FAERS: 2 | US FAERS | |
| 801 | Iatrogenic injury | FAERS: 2 | US FAERS | |
| 802 | Idiosyncratic drug reaction | FAERS: 2 | US FAERS | |
| 803 | Ileus | FAERS: 2 | US FAERS | |
| 804 | Impaired insulin secretion | FAERS: 2 | US FAERS | |
| 805 | Impaired self-care | FAERS: 2 | US FAERS | |
| 806 | Implantable defibrillator insertion | FAERS: 2 | US FAERS | |
| 807 | Incision site pain | FAERS: 2 | US FAERS | |
| 808 | Incoherent | FAERS: 2 | US FAERS | |
| 809 | Infectious Mononucleosis | FAERS: 2 | US FAERS | |
| 810 | Intentional self-injury | FAERS: 2 | US FAERS | |
| 811 | Intermittent Claudication | FAERS: 2 | US FAERS | |
| 812 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 813 | Iron deficiency | FAERS: 2 | US FAERS | |
| 814 | Joint sprain | FAERS: 2 | US FAERS | |
| 815 | Joint warmth | FAERS: 2 | US FAERS | |
| 816 | Keratoconjunctivitis Sicca | FAERS: 2 | US FAERS | |
| 817 | Ketonuria | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 818 | Lack of spontaneous speech | FAERS: 2 | US FAERS | |
| 819 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 820 | Laryngospasm | FAERS: 2 | US FAERS | |
| 821 | Libido disorder | FAERS: 2 | US FAERS | |
| 822 | Limb mass | FAERS: 2 | US FAERS | |
| 823 | Lipoprotein (a) abnormal | FAERS: 2 | US FAERS | |
| 824 | Lymphocyte percentage decreased | FAERS: 2 | US FAERS | |
| 825 | MELAS Syndrome | FAERS: 2 | US FAERS | |
| 826 | Male Orgasmic Disorder | FAERS: 2 | US FAERS | |
| 827 | Malignant neoplasm of ampulla of Vater | FAERS: 2 | US FAERS | |
| 828 | Malocclusion | FAERS: 2 | US FAERS | |
| 829 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 830 | Menopause | FAERS: 2 | US FAERS | |
| 831 | Metamorphopsia | FAERS: 2 | US FAERS | |
| 832 | Metastatic Neoplasm | FAERS: 2 | US FAERS | |
| 833 | Milk Allergy | FAERS: 2 | US FAERS | |
| 834 | Mitochondrial DNA mutation | FAERS: 2 | US FAERS | |
| 835 | Monocyte count increased | FAERS: 2 | US FAERS | |
| 836 | Muscle Spasticity | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 837 | Muscle tone disorder | FAERS: 2 | US FAERS | |
| 838 | Muscular Dystrophy | FAERS: 2 | US FAERS | |
| 839 | Myasthenic Syndrome | FAERS: 2 | US FAERS | |
| 840 | Myelofibrosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 841 | Myoclonus | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 842 | Myoglobinaemia | FAERS: 2 | US FAERS | |
| 843 | Myotonia | FAERS: 2 | US FAERS | |
| 844 | Nasal Polyps | FAERS: 2 | US FAERS | |
| 845 | Nephrectomy | FAERS: 2 | US FAERS | |
| 846 | Nephritis | FAERS: 2 | US FAERS | |
| 847 | Nerve Degeneration | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 848 | Neurodermatitis | FAERS: 2 | US FAERS | |
| 849 | Neuroma | FAERS: 2 | US FAERS | |
| 850 | No reaction on previous exposure to drug | FAERS: 2 | US FAERS | |
| 851 | Nodular rash | FAERS: 2 | US FAERS | |
| 852 | Obesity surgery | FAERS: 2 | US FAERS | |
| 853 | Obstruction | FAERS: 2 | US FAERS | |
| 854 | Occult blood positive | FAERS: 2 | US FAERS | |
| 855 | Onycholysis | FAERS: 2 | US FAERS | |
| 856 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 857 | Oral pruritus | FAERS: 2 | US FAERS | |
| 858 | Orchitis | FAERS: 2 | US FAERS | |
| 859 | Oropharyngeal discomfort | FAERS: 2 | US FAERS | |
| 860 | Oropharyngeal spasm | FAERS: 2 | US FAERS | |
| 861 | Paranasal sinus hypersecretion | FAERS: 2 | US FAERS | |
| 862 | Paranoia | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 863 | Pemphigus | FAERS: 2 | US FAERS | |
| 864 | Penile blister | FAERS: 2 | US FAERS | |
| 865 | Percutaneous Coronary Intervention | FAERS: 2 | US FAERS | |
| 866 | Peripheral paralysis | FAERS: 2 | US FAERS | |
| 867 | Peripheral venous disease | FAERS: 2 | US FAERS | |
| 868 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 869 | Pneumonitis | FAERS: 2 | US FAERS | |
| 870 | Polyarteritis Nodosa | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 871 | Polydipsia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 872 | Poor quality product administered | FAERS: 2 | US FAERS | |
| 873 | Portal fibrosis | FAERS: 2 | US FAERS | |
| 874 | Presbyopia | FAERS: 2 | US FAERS | |
| 875 | Primary Biliary Cholangitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 876 | Procedural site reaction | FAERS: 2 | US FAERS | |
| 877 | Product contamination | FAERS: 2 | US FAERS | |
| 878 | Product label issue | FAERS: 2 | US FAERS | |
| 879 | Product residue present | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 880 | Progressive supranuclear palsy | FAERS: 2 | US FAERS | |
| 881 | Prosthesis Implantation | FAERS: 2 | US FAERS | |
| 882 | Protein total increased | FAERS: 2 | US FAERS | |
| 883 | Pseudocyst | FAERS: 2 | US FAERS | |
| 884 | Pubic pain | FAERS: 2 | US FAERS | |
| 885 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 886 | Purpura | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 887 | Pustular psoriasis | FAERS: 2 | US FAERS | |
| 888 | Renal Cell Carcinoma | FAERS: 2 | US FAERS | |
| 889 | Respiratory muscle weakness | FAERS: 2 | US FAERS | |
| 890 | Reticulocyte count increased | FAERS: 2 | US FAERS | |
| 891 | Rheumatic Fever | FAERS: 2 | US FAERS | |
| 892 | Rheumatoid factor increased | FAERS: 2 | US FAERS | |
| 893 | Saliva altered | FAERS: 2 | US FAERS | |
| 894 | Sinus Arrhythmia | FAERS: 2 | US FAERS | |
| 895 | Sinus bradycardia | FAERS: 2 | US FAERS | |
| 896 | Skin Wrinkling | FAERS: 2 | US FAERS | |
| 897 | Skin discomfort | FAERS: 2 | US FAERS | |
| 898 | Skin hypertrophy | FAERS: 2 | US FAERS | |
| 899 | Skin laceration | FAERS: 2 | US FAERS | |
| 900 | Skin necrosis | FAERS: 2 | US FAERS | |
| 901 | Sputum retention | FAERS: 2 | US FAERS | |
| 902 | Stent occlusion | FAERS: 2 | US FAERS | |
| 903 | Stillbirth | FAERS: 2 | US FAERS | |
| 904 | Stomach scan abnormal | FAERS: 2 | US FAERS | |
| 905 | Stress at work | FAERS: 2 | US FAERS | |
| 906 | Temperature regulation disorder | FAERS: 2 | US FAERS | |
| 907 | Temporal Arteritis | FAERS: 2 | US FAERS | |
| 908 | Terminal state | FAERS: 2 | US FAERS | |
| 909 | Thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 910 | Thyroid cancer metastatic | FAERS: 2 | US FAERS | |
| 911 | Thyroidectomy | FAERS: 2 | US FAERS | |
| 912 | Torticollis | FAERS: 2 | US FAERS | |
| 913 | Trismus | FAERS: 2 | US FAERS | |
| 914 | Unequal Limb Length | FAERS: 2 | US FAERS | |
| 915 | Upper motor neurone lesion | FAERS: 2 | US FAERS | |
| 916 | Upper respiratory tract congestion | FAERS: 2 | US FAERS | |
| 917 | Upper-airway cough syndrome | FAERS: 2 | US FAERS | |
| 918 | Urine bilirubin increased | FAERS: 2 | US FAERS | |
| 919 | Uterine Cancer | FAERS: 2 | US FAERS | |
| 920 | Vascular insufficiency | FAERS: 2 | US FAERS | |
| 921 | Vascular stenosis | FAERS: 2 | US FAERS | |
| 922 | Vasculitic rash | FAERS: 2 | US FAERS | |
| 923 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 924 | Ventricular failure | FAERS: 2 | US FAERS | |
| 925 | Ventricular hypokinesia | FAERS: 2 | US FAERS | |
| 926 | Viral upper respiratory tract infection | FAERS: 2 | US FAERS | |
| 927 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 928 | White blood cell count abnormal | FAERS: 2 | US FAERS | |
| 929 | effusion | FAERS: 2 | US FAERS | |
| 930 | treatment failure | FAERS: 2 | US FAERS | |
| 931 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 932 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 933 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 934 | Accidental death | FAERS: 1 | US FAERS | |
| 935 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 936 | Accidental exposure | FAERS: 1 | US FAERS | |
| 937 | Accidental underdose | FAERS: 1 | US FAERS | |
| 938 | Acidosis | FAERS: 1 | US FAERS | |
| 939 | Actinic keratosis | FAERS: 1 | US FAERS | |
| 940 | Adjustment disorder with depressed mood | FAERS: 1 | US FAERS | |
| 941 | Adrenalectomy | FAERS: 1 | US FAERS | |
| 942 | Agoraphobia | FAERS: 1 | US FAERS | |
| 943 | Akinesia | FAERS: 1 | US FAERS | |
| 944 | Albumin globulin ratio decreased | FAERS: 1 | US FAERS | |
| 945 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 946 | Alcohol withdrawal syndrome | FAERS: 1 | US FAERS | |
| 947 | Aldolase abnormal | FAERS: 1 | US FAERS | |
| 948 | Aldolase decreased | FAERS: 1 | US FAERS | |
| 949 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 950 | Allodynia | FAERS: 1 | US FAERS | |
| 951 | Alpha hydroxybutyrate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 952 | Alpha-1 anti-trypsin increased | FAERS: 1 | US FAERS | |
| 953 | Amino acid level decreased | FAERS: 1 | US FAERS | |
| 954 | Amyloidosis | FAERS: 1 | US FAERS | |
| 955 | Anal abscess | FAERS: 1 | US FAERS | |
| 956 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 957 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 958 | Antiacetylcholine receptor antibody positive | FAERS: 1 | US FAERS | |
| 959 | Antisocial Personality Disorder | FAERS: 1 | US FAERS | |
| 960 | Aortic embolus | FAERS: 1 | US FAERS | |
| 961 | Apolipoprotein A-I increased | FAERS: 1 | US FAERS | |
| 962 | Apolipoprotein abnormal | FAERS: 1 | US FAERS | |
| 963 | Apoptosis | FAERS: 1 | US FAERS | |
| 964 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 965 | Arterial stenosis limb | FAERS: 1 | US FAERS | |
| 966 | Aspartate aminotransferase abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 967 | Atrioventricular Septal Defect | FAERS: 1 | US FAERS | |
| 968 | Atrophic vulvovaginitis | FAERS: 1 | US FAERS | |
| 969 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 970 | Bacteriuria | FAERS: 1 | US FAERS | |
| 971 | Basal ganglion degeneration | FAERS: 1 | US FAERS | |
| 972 | Bile Duct Stenosis | FAERS: 1 | US FAERS | |
| 973 | Bile duct necrosis | FAERS: 1 | US FAERS | |
| 974 | Biliary Colic | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 975 | Biliary Dyskinesia | FAERS: 1 | US FAERS | |
| 976 | Biliary polyp | FAERS: 1 | US FAERS | |
| 977 | Biopsy bone abnormal | FAERS: 1 | US FAERS | |
| 978 | Biopsy brain abnormal | FAERS: 1 | US FAERS | |
| 979 | Biopsy skin abnormal | FAERS: 1 | US FAERS | |
| 980 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 981 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 982 | Bladder cancer recurrent | FAERS: 1 | US FAERS | |
| 983 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 984 | Bladder prolapse | FAERS: 1 | US FAERS | |
| 985 | Blepharitis | FAERS: 1 | US FAERS | |
| 986 | Blood Pressure | FAERS: 1 | US FAERS | |
| 987 | Blood acid phosphatase decreased | FAERS: 1 | US FAERS | |
| 988 | Blood albumin abnormal | FAERS: 1 | US FAERS | |
| 989 | Blood albumin increased | FAERS: 1 | US FAERS | |
| 990 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 991 | Blood alkaline phosphatase abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 992 | Blood alkaline phosphatase | FAERS: 1 | US FAERS | |
| 993 | Blood bilirubin decreased | FAERS: 1 | US FAERS | |
| 994 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 995 | Blood calcitonin increased | FAERS: 1 | US FAERS | |
| 996 | Blood chloride abnormal | FAERS: 1 | US FAERS | |
| 997 | Blood cholesterol esterase increased | FAERS: 1 | US FAERS | |
| 998 | Blood cholesterol | FAERS: 1 | US FAERS | |
| 999 | Blood copper increased | FAERS: 1 | US FAERS | |
| 1000 | Blood creatine abnormal | FAERS: 1 | US FAERS | |
| 1001 | Blood creatine phosphokinase decreased | FAERS: 1 | US FAERS | |
| 1002 | Blood creatine | FAERS: 1 | US FAERS | |
| 1003 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 1004 | Blood electrolytes increased | FAERS: 1 | US FAERS | |
| 1005 | Blood homocysteine increased | FAERS: 1 | US FAERS | |
| 1006 | Blood immunoglobulin M increased | FAERS: 1 | US FAERS | |
| 1007 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 1008 | Blood parathyroid hormone decreased | FAERS: 1 | US FAERS | |
| 1009 | Blood parathyroid hormone increased | FAERS: 1 | US FAERS | |
| 1010 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 1011 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 1012 | Blood urea abnormal | FAERS: 1 | US FAERS | |
| 1013 | Blue Toe Syndrome | FAERS: 1 | US FAERS | |
| 1014 | Body fat disorder | FAERS: 1 | US FAERS | |
| 1015 | Bone density abnormal | FAERS: 1 | US FAERS | |
| 1016 | Bone fissure | FAERS: 1 | US FAERS | |
| 1017 | Bone marrow depression | FAERS: 1 | US FAERS | |
| 1018 | Brain Contusion | FAERS: 1 | US FAERS | |
| 1019 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 1020 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 1021 | Breakthrough Pain | FAERS: 1 | US FAERS | |
| 1022 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 1023 | Breath alcohol test positive | FAERS: 1 | US FAERS | |
| 1024 | Breathing-related sleep disorder | FAERS: 1 | US FAERS | |
| 1025 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 1026 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 1027 | Bronchopulmonary disease | FAERS: 1 | US FAERS | |
| 1028 | Bunion operation | FAERS: 1 | US FAERS | |
| 1029 | Bunion | FAERS: 1 | US FAERS | |
| 1030 | Burning Mouth Syndrome | FAERS: 1 | US FAERS | |
| 1031 | CD30 expression | FAERS: 1 | US FAERS | |
| 1032 | Calcium deficiency | FAERS: 1 | US FAERS | |
| 1033 | Cancer Pain | FAERS: 1 | US FAERS | |
| 1034 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 1035 | Cardiac infection | FAERS: 1 | US FAERS | |
| 1036 | Cardiac monitoring abnormal | FAERS: 1 | US FAERS | |
| 1037 | Cardioactive drug level decreased | FAERS: 1 | US FAERS | |
| 1038 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 1039 | Carditis | FAERS: 1 | US FAERS | |
| 1040 | Carotid bruit | FAERS: 1 | US FAERS | |
| 1041 | Cartilage atrophy | FAERS: 1 | US FAERS | |
| 1042 | Cartilage injury | FAERS: 1 | US FAERS | |
| 1043 | Cataract operation complication | FAERS: 1 | US FAERS | |
| 1044 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 1045 | Cerebrovascular Insufficiency | FAERS: 1 | US FAERS | |
| 1046 | Cervicectomy | FAERS: 1 | US FAERS | |
| 1047 | Cheilitis | FAERS: 1 | US FAERS | |
| 1048 | Chest wall pain | FAERS: 1 | US FAERS | |
| 1049 | Choking sensation | FAERS: 1 | US FAERS | |
| 1050 | Cholecystostomy | FAERS: 1 | US FAERS | |
| 1051 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 1052 | Chorioretinitis | FAERS: 1 | US FAERS | |
| 1053 | Chromatopsia | FAERS: 1 | US FAERS | |
| 1054 | Chromosomal mutation | FAERS: 1 | US FAERS | |
| 1055 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 1056 | Circumstance or information capable of leading to device use error | FAERS: 1 | US FAERS | |
| 1057 | Claustrophobia | FAERS: 1 | US FAERS | |
| 1058 | Clostridium difficile sepsis | FAERS: 1 | US FAERS | |
| 1059 | Clubbing | FAERS: 1 | US FAERS | |
| 1060 | Coagulation factor V level decreased | FAERS: 1 | US FAERS | |
| 1061 | Coagulation test abnormal | FAERS: 1 | US FAERS | |
| 1062 | Coating in mouth | FAERS: 1 | US FAERS | |
| 1063 | Collagen-vascular disease | FAERS: 1 | US FAERS | |
| 1064 | Collateral Circulation | FAERS: 1 | US FAERS | |
| 1065 | Colon adenoma | FAERS: 1 | US FAERS | |
| 1066 | Congenital brain damage | FAERS: 1 | US FAERS | |
| 1067 | Congenital diaphragmatic hernia | FAERS: 1 | US FAERS | |
| 1068 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 1069 | Craniorachischisis | FAERS: 1 | US FAERS | |
| 1070 | Craniosynostosis | FAERS: 1 | US FAERS | |
| 1071 | Creatine phosphokinase decreased | FAERS: 1 | US FAERS | |
| 1072 | Creatine urine increased | FAERS: 1 | US FAERS | |
| 1073 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 1074 | Cyst removal | FAERS: 1 | US FAERS | |
| 1075 | Cytomegalovirus test positive | FAERS: 1 | US FAERS | |
| 1076 | Cytopenia | FAERS: 1 | US FAERS | |
| 1077 | Deafness Permanent | FAERS: 1 | US FAERS | |
| 1078 | Death of relative | FAERS: 1 | US FAERS | |
| 1079 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 1080 | Decreased vibratory sense | FAERS: 1 | US FAERS | |
| 1081 | Dental examination abnormal | FAERS: 1 | US FAERS | |
| 1082 | Dental prosthesis placement | FAERS: 1 | US FAERS | |
| 1083 | Denture wearer | FAERS: 1 | US FAERS | |
| 1084 | Dependence | FAERS: 1 | US FAERS | |
| 1085 | Dermatitis Herpetiformis | FAERS: 1 | US FAERS | |
| 1086 | Detachment of retinal pigment epithelium | FAERS: 1 | US FAERS | |
| 1087 | Device dislocation | FAERS: 1 | US FAERS | |
| 1088 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 1089 | Diabetic glaucoma | FAERS: 1 | US FAERS | |
| 1090 | Diabetic metabolic decompensation | FAERS: 1 | US FAERS | |
| 1091 | Diaphragmatic Hernia | FAERS: 1 | US FAERS | |
| 1092 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 1093 | Disease complication | FAERS: 1 | US FAERS | |
| 1094 | Dissociative disorder | FAERS: 1 | US FAERS | |
| 1095 | Disturbance in sexual arousal | FAERS: 1 | US FAERS | |
| 1096 | Double vessel bypass graft | FAERS: 1 | US FAERS | |
| 1097 | Drug label confusion | FAERS: 1 | US FAERS | |
| 1098 | Drug level increased | FAERS: 1 | US FAERS | |
| 1099 | Drug resistance | FAERS: 1 | US FAERS | |
| 1100 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 1101 | Drug screen positive | FAERS: 1 | US FAERS | |
| 1102 | Drug therapy changed | FAERS: 1 | US FAERS | |
| 1103 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 1104 | Duodenal papillitis | FAERS: 1 | US FAERS | |
| 1105 | Duodenogastric Reflux | FAERS: 1 | US FAERS | |
| 1106 | Dyslexia | FAERS: 1 | US FAERS | |
| 1107 | Dysmorphism | FAERS: 1 | US FAERS | |
| 1108 | Eating disorder symptom | FAERS: 1 | US FAERS | |
| 1109 | Echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 1110 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 1111 | Electrocardiogram ST segment abnormal | FAERS: 1 | US FAERS | |
| 1112 | Electrocardiogram ST-T segment abnormal | FAERS: 1 | US FAERS | |
| 1113 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 1114 | Endarterectomy | FAERS: 1 | US FAERS | |
| 1115 | Endocarditis | FAERS: 1 | US FAERS | |
| 1116 | Endocrine test abnormal | FAERS: 1 | US FAERS | |
| 1117 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 1118 | Endotracheal intubation complication | FAERS: 1 | US FAERS | |
| 1119 | Eosinophil percentage increased | FAERS: 1 | US FAERS | |
| 1120 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 1121 | Epidermal necrosis | FAERS: 1 | US FAERS | |
| 1122 | Epiglottitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1123 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 1124 | Essential Tremor | FAERS: 1 | US FAERS | |
| 1125 | Euthanasia | FAERS: 1 | US FAERS | |
| 1126 | Exercise capacity decreased | FAERS: 1 | US FAERS | |
| 1127 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 1128 | Exposure via partner | FAERS: 1 | US FAERS | |
| 1129 | Eye allergy | FAERS: 1 | US FAERS | |
| 1130 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 1131 | Eyelid pain | FAERS: 1 | US FAERS | |
| 1132 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 1133 | Fasciitis | FAERS: 1 | US FAERS | |
| 1134 | Fasciotomy | FAERS: 1 | US FAERS | |
| 1135 | Fat necrosis | FAERS: 1 | US FAERS | |
| 1136 | Fat redistribution | FAERS: 1 | US FAERS | |
| 1137 | Femoral arterial stenosis | FAERS: 1 | US FAERS | |
| 1138 | Fingerprint loss | FAERS: 1 | US FAERS | |
| 1139 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 1140 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 1141 | Food aversion | FAERS: 1 | US FAERS | |
| 1142 | Food craving | FAERS: 1 | US FAERS | |
| 1143 | Foreign body aspiration | FAERS: 1 | US FAERS | |
| 1144 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 1145 | Frontotemporal dementia | FAERS: 1 | US FAERS | |
| 1146 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 1147 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 1148 | Full blood count increased | FAERS: 1 | US FAERS | |
| 1149 | Galactostasis | FAERS: 1 | US FAERS | |
| 1150 | Gastrectomy | FAERS: 1 | US FAERS | |
| 1151 | Gastrointestinal bacterial infection | FAERS: 1 | US FAERS | |
| 1152 | Gastrointestinal hypermotility | FAERS: 1 | US FAERS | |
| 1153 | Gastrointestinal mucosal disorder | FAERS: 1 | US FAERS | |
| 1154 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 1155 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 1156 | Genital pain | FAERS: 1 | US FAERS | |
| 1157 | Genital rash | FAERS: 1 | US FAERS | |
| 1158 | Gestational Diabetes | FAERS: 1 | US FAERS | |
| 1159 | Giardiasis | FAERS: 1 | US FAERS | |
| 1160 | Gingival Recession | FAERS: 1 | US FAERS | |
| 1161 | Gingivitis | FAERS: 1 | US FAERS | |
| 1162 | Glaucoma surgery | FAERS: 1 | US FAERS | |
| 1163 | Glycosuria | FAERS: 1 | US FAERS | |
| 1164 | Granuloma Annulare | FAERS: 1 | US FAERS | |
| 1165 | Granulomatosis with polyangiitis | FAERS: 1 | US FAERS | |
| 1166 | Granuloma | FAERS: 1 | US FAERS | |
| 1167 | Growth failure | FAERS: 1 | US FAERS | |
| 1168 | Haematotoxicity | FAERS: 1 | US FAERS | |
| 1169 | Hearing aid user | FAERS: 1 | US FAERS | |
| 1170 | Heart valve stenosis | FAERS: 1 | US FAERS | |
| 1171 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 1172 | Hepatic Infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1173 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 1174 | Hepatic cancer stage IV | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1175 | Hepatitis B antibody positive | FAERS: 1 | US FAERS | |
| 1176 | Hepatitis B virus test positive | FAERS: 1 | US FAERS | |
| 1177 | Hepatitis viral test positive | FAERS: 1 | US FAERS | |
| 1178 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 1179 | Histiocytosis haematophagic | FAERS: 1 | US FAERS | |
| 1180 | Human Ehrlichiosis | FAERS: 1 | US FAERS | |
| 1181 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 1182 | Hydrometra | FAERS: 1 | US FAERS | |
| 1183 | Hyperacusis | FAERS: 1 | US FAERS | |
| 1184 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 1185 | Hyperkinesia | FAERS: 1 | US FAERS | |
| 1186 | Hypermobility syndrome | FAERS: 1 | US FAERS | |
| 1187 | Hyperplastic cholecystopathy | FAERS: 1 | US FAERS | |
| 1188 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 1189 | Hypertensive emergency | FAERS: 1 | US FAERS | |
| 1190 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 1191 | Hypertrophy | FAERS: 1 | US FAERS | |
| 1192 | Hypoaesthesia of genital male | FAERS: 1 | US FAERS | |
| 1193 | Hypoplastic Left Heart Syndrome | FAERS: 1 | US FAERS | |
| 1194 | Hypospadias | FAERS: 1 | US FAERS | |
| 1195 | Hypotrichosis | FAERS: 1 | US FAERS | |
| 1196 | Idiopathic urticaria | FAERS: 1 | US FAERS | |
| 1197 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 1198 | Immunosuppression | FAERS: 1 | US FAERS | |
| 1199 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 1200 | Impatience | FAERS: 1 | US FAERS | |
| 1201 | Incision site complication | FAERS: 1 | US FAERS | |
| 1202 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 1203 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 1204 | Infectious pleural effusion | FAERS: 1 | US FAERS | |
| 1205 | Infective tenosynovitis | FAERS: 1 | US FAERS | |
| 1206 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 1207 | Inhibitory drug interaction | FAERS: 1 | US FAERS | |
| 1208 | Insulin Resistance | FAERS: 1 | US FAERS | |
| 1209 | Intervertebral disc compression | FAERS: 1 | US FAERS | |
| 1210 | Intervertebral disc injury | FAERS: 1 | US FAERS | |
| 1211 | Intestinal adenocarcinoma | FAERS: 1 | US FAERS | |
| 1212 | Intestinal cyst | FAERS: 1 | US FAERS | |
| 1213 | Intestinal gangrene | FAERS: 1 | US FAERS | |
| 1214 | Intestinal resection | FAERS: 1 | US FAERS | |
| 1215 | Intracranial mass | FAERS: 1 | US FAERS | |
| 1216 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 1217 | Joint abscess | FAERS: 1 | US FAERS | |
| 1218 | Keratitis | FAERS: 1 | US FAERS | |
| 1219 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 1220 | Lacrimal duct procedure | FAERS: 1 | US FAERS | |
| 1221 | Lacrimal structure injury | FAERS: 1 | US FAERS | |
| 1222 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 1223 | Large intestine anastomosis | FAERS: 1 | US FAERS | |
| 1224 | Laziness | FAERS: 1 | US FAERS | |
| 1225 | Lentigo | FAERS: 1 | US FAERS | |
| 1226 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 1227 | Leukoplakia | FAERS: 1 | US FAERS | |
| 1228 | Life expectancy shortened | FAERS: 1 | US FAERS | |
| 1229 | Ligament pain | FAERS: 1 | US FAERS | |
| 1230 | Limb fracture | FAERS: 1 | US FAERS | |
| 1231 | Lip neoplasm malignant stage unspecified | FAERS: 1 | US FAERS | |
| 1232 | Loss of proprioception | FAERS: 1 | US FAERS | |
| 1233 | Lumbar radiculopathy | FAERS: 1 | US FAERS | |
| 1234 | Lupus Nephritis | FAERS: 1 | US FAERS | |
| 1235 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 1236 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 1237 | Lymphocyte stimulation test negative | FAERS: 1 | US FAERS | |
| 1238 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 1239 | Lymphoma operation | FAERS: 1 | US FAERS | |
| 1240 | Lymphomatoid Papulosis | FAERS: 1 | US FAERS | |
| 1241 | Macroglossia | FAERS: 1 | US FAERS | |
| 1242 | Malignant Fibrous Histiocytoma | FAERS: 1 | US FAERS | |
| 1243 | Malignant neoplasm of thorax | FAERS: 1 | US FAERS | |
| 1244 | Malignant tumour excision | FAERS: 1 | US FAERS | |
| 1245 | Malnutrition | FAERS: 1 | US FAERS | |
| 1246 | Mass excision | FAERS: 1 | US FAERS | |
| 1247 | Mastication disorder | FAERS: 1 | US FAERS | |
| 1248 | Mastitis | FAERS: 1 | US FAERS | |
| 1249 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 1250 | Medial Tibial Stress Syndrome | FAERS: 1 | US FAERS | |
| 1251 | Medical device implantation | FAERS: 1 | US FAERS | |
| 1252 | Meningioma | FAERS: 1 | US FAERS | |
| 1253 | Meningocele | FAERS: 1 | US FAERS | |
| 1254 | Meniscus removal | FAERS: 1 | US FAERS | |
| 1255 | Mental Retardation | FAERS: 1 | US FAERS | |
| 1256 | Metastases to abdominal cavity | FAERS: 1 | US FAERS | |
| 1257 | Metastases to larynx | FAERS: 1 | US FAERS | |
| 1258 | Metastases to thorax | FAERS: 1 | US FAERS | |
| 1259 | Metastatic Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 1260 | Metatarsalgia | FAERS: 1 | US FAERS | |
| 1261 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 1262 | Miscarriage of partner | FAERS: 1 | US FAERS | |
| 1263 | Mitochondrial cytopathy | FAERS: 1 | US FAERS | |
| 1264 | Mitochondrial myopathy acquired | FAERS: 1 | US FAERS | |
| 1265 | Mixed liver injury | FAERS: 1 | US FAERS | |
| 1266 | Moaning | FAERS: 1 | US FAERS | |
| 1267 | Monocyte count decreased | FAERS: 1 | US FAERS | |
| 1268 | Monoparesis | FAERS: 1 | US FAERS | |
| 1269 | Motion Sickness | FAERS: 1 | US FAERS | |
| 1270 | Mutism | FAERS: 1 | US FAERS | |
| 1271 | Myelitis | FAERS: 1 | US FAERS | |
| 1272 | Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 1273 | Myoglobin blood present | FAERS: 1 | US FAERS | |
| 1274 | Myositis Ossificans | FAERS: 1 | US FAERS | |
| 1275 | Nasal inflammation | FAERS: 1 | US FAERS | |
| 1276 | Negative thoughts | FAERS: 1 | US FAERS | |
| 1277 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 1278 | Nerve Root Compression | FAERS: 1 | US FAERS | |
| 1279 | Nerve root lesion | FAERS: 1 | US FAERS | |
| 1280 | Neutrophil percentage increased | FAERS: 1 | US FAERS | |
| 1281 | Nipple pain | FAERS: 1 | US FAERS | |
| 1282 | Nystagmus | FAERS: 1 | US FAERS | |
| 1283 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 1284 | Oculomucocutaneous syndrome | FAERS: 1 | US FAERS | |
| 1285 | Oliguria | FAERS: 1 | US FAERS | |
| 1286 | Open wound | FAERS: 1 | US FAERS | |
| 1287 | Optic disc vascular disorder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1288 | Oral infection | FAERS: 1 | US FAERS | |
| 1289 | Oxygen Consumption | FAERS: 1 | US FAERS | |
| 1290 | PO2 decreased | FAERS: 1 | US FAERS | |
| 1291 | Painful ejaculation | FAERS: 1 | US FAERS | |
| 1292 | Palmar erythema | FAERS: 1 | US FAERS | |
| 1293 | Pancreatic Fistula | FAERS: 1 | US FAERS | |
| 1294 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 1295 | Pancreatic Pseudocyst | FAERS: 1 | US FAERS | |
| 1296 | Paramnesia | FAERS: 1 | US FAERS | |
| 1297 | Patent ductus arteriosus | FAERS: 1 | US FAERS | |
| 1298 | Pelvic kidney | FAERS: 1 | US FAERS | |
| 1299 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 1300 | Performance status decreased | FAERS: 1 | US FAERS | |
| 1301 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 1302 | Perineal pain | FAERS: 1 | US FAERS | |
| 1303 | Peripheral motor neuropathy | FAERS: 1 | US FAERS | |
| 1304 | Peripheral nerve palsy | FAERS: 1 | US FAERS | |
| 1305 | Peripheral occlusive disease | FAERS: 1 | US FAERS | |
| 1306 | Peritoneal Dialysis | FAERS: 1 | US FAERS | |
| 1307 | Phantom Limb Syndrome | FAERS: 1 | US FAERS | |
| 1308 | Pharyngeal Stenosis | FAERS: 1 | US FAERS | |
| 1309 | Pharyngeal swelling | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1310 | Pharyngitis | FAERS: 1 | US FAERS | |
| 1311 | Pityriasis | FAERS: 1 | US FAERS | |
| 1312 | Plague | FAERS: 1 | US FAERS | |
| 1313 | Pleural Infection | FAERS: 1 | US FAERS | |
| 1314 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 1315 | Pleuropericarditis | FAERS: 1 | US FAERS | |
| 1316 | Pocket erosion | FAERS: 1 | US FAERS | |
| 1317 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 1318 | Portal tract inflammation | FAERS: 1 | US FAERS | |
| 1319 | Post procedural infection | FAERS: 1 | US FAERS | |
| 1320 | Post procedural pain | FAERS: 1 | US FAERS | |
| 1321 | Postoperative adhesion | FAERS: 1 | US FAERS | |
| 1322 | Postoperative infection | FAERS: 1 | US FAERS | |
| 1323 | Potentiating drug interaction | FAERS: 1 | US FAERS | |
| 1324 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 1325 | Presenile dementia | FAERS: 1 | US FAERS | |
| 1326 | Primary Hypothyroidism | FAERS: 1 | US FAERS | |
| 1327 | Procalcitonin increased | FAERS: 1 | US FAERS | |
| 1328 | Product administration error | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1329 | Product appearance confusion | FAERS: 1 | US FAERS | |
| 1330 | Product availability issue | FAERS: 1 | US FAERS | |
| 1331 | Product blister packaging issue | FAERS: 1 | US FAERS | |
| 1332 | Product coating issue | FAERS: 1 | US FAERS | |
| 1333 | Product commingling | FAERS: 1 | US FAERS | |
| 1334 | Product complaint | FAERS: 1 | US FAERS | |
| 1335 | Product dose omission | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1336 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 1337 | Product formulation issue | FAERS: 1 | US FAERS | |
| 1338 | Product label confusion | FAERS: 1 | US FAERS | |
| 1339 | Product name confusion | FAERS: 1 | US FAERS | |
| 1340 | Product package associated injury | FAERS: 1 | US FAERS | |
| 1341 | Product prescribing error | FAERS: 1 | US FAERS | |
| 1342 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 1343 | Product tampering | FAERS: 1 | US FAERS | |
| 1344 | Progressive Muscular Atrophy | FAERS: 1 | US FAERS | |
| 1345 | Prothrombin time ratio decreased | FAERS: 1 | US FAERS | |
| 1346 | Pseudolymphoma | FAERS: 1 | US FAERS | |
| 1347 | Pseudoparalysis | FAERS: 1 | US FAERS | |
| 1348 | Pseudoradicular syndrome | FAERS: 1 | US FAERS | |
| 1349 | Psychological Trauma | FAERS: 1 | US FAERS | |
| 1350 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 1351 | Pulmonary Valve Stenosis | FAERS: 1 | US FAERS | |
| 1352 | Purulence | FAERS: 1 | US FAERS | |
| 1353 | Purulent discharge | FAERS: 1 | US FAERS | |
| 1354 | Pyuria | FAERS: 1 | US FAERS | |
| 1355 | Radiation dysphagia | FAERS: 1 | US FAERS | |
| 1356 | Radiation necrosis | FAERS: 1 | US FAERS | |
| 1357 | Rales | FAERS: 1 | US FAERS | |
| 1358 | Recalled product administered | FAERS: 1 | US FAERS | |
| 1359 | Refusal of treatment by relative | FAERS: 1 | US FAERS | |
| 1360 | Renal Osteodystrophy | FAERS: 1 | US FAERS | |
| 1361 | Renal artery occlusion | FAERS: 1 | US FAERS | |
| 1362 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 1363 | Respiratory tract congestion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1364 | Restrictive pulmonary disease | FAERS: 1 | US FAERS | |
| 1365 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 1366 | Rhinalgia | FAERS: 1 | US FAERS | |
| 1367 | Sacroiliitis | FAERS: 1 | US FAERS | |
| 1368 | Sarcoma | FAERS: 1 | US FAERS | |
| 1369 | Scab | FAERS: 1 | US FAERS | |
| 1370 | Schizophrenia | FAERS: 1 | US FAERS | |
| 1371 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 1372 | Semen abnormal | FAERS: 1 | US FAERS | |
| 1373 | Semen volume abnormal | FAERS: 1 | US FAERS | |
| 1374 | Semen volume increased | FAERS: 1 | US FAERS | |
| 1375 | Sinus polyp | FAERS: 1 | US FAERS | |
| 1376 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 1377 | Sleep Talking | FAERS: 1 | US FAERS | |
| 1378 | Sleep disorder due to general medical condition, mixed type | FAERS: 1 | US FAERS | |
| 1379 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 1380 | Small intestine carcinoma | FAERS: 1 | US FAERS | |
| 1381 | Snoring | FAERS: 1 | US FAERS | |
| 1382 | Soliloquy | FAERS: 1 | US FAERS | |
| 1383 | Sperm count decreased | FAERS: 1 | US FAERS | |
| 1384 | Spermatozoa abnormal | FAERS: 1 | US FAERS | |
| 1385 | Spina Bifida Occulta | FAERS: 1 | US FAERS | |
| 1386 | Spina Bifida | FAERS: 1 | US FAERS | |
| 1387 | Spinal Muscular Atrophy | FAERS: 1 | US FAERS | |
| 1388 | Spinal claudication | FAERS: 1 | US FAERS | |
| 1389 | Spondylolysis | FAERS: 1 | US FAERS | |
| 1390 | Spondylosis | FAERS: 1 | US FAERS | |
| 1391 | Starvation | FAERS: 1 | US FAERS | |
| 1392 | Stool analysis abnormal | FAERS: 1 | US FAERS | |
| 1393 | Strabismus | FAERS: 1 | US FAERS | |
| 1394 | Stroke in evolution | FAERS: 1 | US FAERS | |
| 1395 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 1396 | Sudden onset of sleep | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1397 | Symptom masked | FAERS: 1 | US FAERS | |
| 1398 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 1399 | Systemic lupus erythematosus rash | FAERS: 1 | US FAERS | |
| 1400 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 1401 | Tachyphylaxis | FAERS: 1 | US FAERS | |
| 1402 | Tarsal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 1403 | Tendon discomfort | FAERS: 1 | US FAERS | |
| 1404 | Tendon necrosis | FAERS: 1 | US FAERS | |
| 1405 | Tetanus | FAERS: 1 | US FAERS | |
| 1406 | Therapeutic product effect incomplete | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1407 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 1408 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 1409 | Thromboangiitis Obliterans | FAERS: 1 | US FAERS | |
| 1410 | Thromboembolectomy | FAERS: 1 | US FAERS | |
| 1411 | Thyroiditis | FAERS: 1 | US FAERS | |
| 1412 | Tinea Pedis | FAERS: 1 | US FAERS | |
| 1413 | Tongue cancer recurrent | FAERS: 1 | US FAERS | |
| 1414 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 1415 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 1416 | Tooth Avulsion | FAERS: 1 | US FAERS | |
| 1417 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 1418 | Tooth Infection | FAERS: 1 | US FAERS | |
| 1419 | Total bile acids increased | FAERS: 1 | US FAERS | |
| 1420 | Total cholesterol/HDL ratio decreased | FAERS: 1 | US FAERS | |
| 1421 | Toxic Epidermal Necrolysis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1422 | Transaminases abnormal | FAERS: 1 | US FAERS | |
| 1423 | Transcription medication error | FAERS: 1 | US FAERS | |
| 1424 | Transferrin increased | FAERS: 1 | US FAERS | |
| 1425 | Traumatic Brain Injury | FAERS: 1 | US FAERS | |
| 1426 | Traumatic liver injury | FAERS: 1 | US FAERS | |
| 1427 | Troponin I increased | FAERS: 1 | US FAERS | |
| 1428 | Troponin T increased | FAERS: 1 | US FAERS | |
| 1429 | Ultrasound Doppler abnormal | FAERS: 1 | US FAERS | |
| 1430 | Underweight | FAERS: 1 | US FAERS | |
| 1431 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 1432 | Urea renal clearance decreased | FAERS: 1 | US FAERS | |
| 1433 | Urinary occult blood positive | FAERS: 1 | US FAERS | |
| 1434 | Urinary sediment present | FAERS: 1 | US FAERS | |
| 1435 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 1436 | Urine albumin/creatinine ratio increased | FAERS: 1 | US FAERS | |
| 1437 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 1438 | Urine leukocyte esterase positive | FAERS: 1 | US FAERS | |
| 1439 | Urine output increased | FAERS: 1 | US FAERS | |
| 1440 | Urobilin urine present | FAERS: 1 | US FAERS | |
| 1441 | Uveitis | FAERS: 1 | US FAERS | |
| 1442 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 1443 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 1444 | Vagus Nerve Disorder | FAERS: 1 | US FAERS | |
| 1445 | Vascular bypass dysfunction | FAERS: 1 | US FAERS | |
| 1446 | Vascular rupture | FAERS: 1 | US FAERS | |
| 1447 | Venous stasis | FAERS: 1 | US FAERS | |
| 1448 | Ventricle rupture | FAERS: 1 | US FAERS | |
| 1449 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 1450 | Very low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 1451 | Viral myocarditis | FAERS: 1 | US FAERS | |
| 1452 | Viral pericarditis | FAERS: 1 | US FAERS | |
| 1453 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 1454 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 1455 | Vulvovaginal erythema | FAERS: 1 | US FAERS | |
| 1456 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 1457 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 1458 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 1459 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 1460 | Water Intoxication | FAERS: 1 | US FAERS | |
| 1461 | Whole blood transfusion | FAERS: 1 | US FAERS | |
| 1462 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 1463 | Wrong product administered | FAERS: 1 | US FAERS | |
| 1464 | X-ray abnormal | FAERS: 1 | US FAERS | |
| 1465 | Xerophthalmia | FAERS: 1 | US FAERS | |
| 1466 | Xerosis | FAERS: 1 | US FAERS | |
| 1467 | Yawning | FAERS: 1 | US FAERS | |
| 1468 | colonoscopy | FAERS: 1 | US FAERS | |
| 1469 | liposarcoma | FAERS: 1 | US FAERS | |
| 1470 | ovarian neoplasm | FAERS: 1 | US FAERS | |
| 1471 | Angiogram abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 1472 | Aortic bypass | Canada Vigilance: 1 | Canada Vigilance | |
| 1473 | Asterixis | Canada Vigilance: 1 | Canada Vigilance | |
| 1474 | Bilirubin conjugated abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 1475 | Carotid Endarterectomy | Canada Vigilance: 1 | Canada Vigilance | |
| 1476 | Choledocholithotomy | Canada Vigilance: 1 | Canada Vigilance | |
| 1477 | Clostridium difficile colitis | Canada Vigilance: 1 | Canada Vigilance | |
| 1478 | Colitis psychogenic | Canada Vigilance: 1 | Canada Vigilance | |
| 1479 | Corneal Opacity | Canada Vigilance: 1 | Canada Vigilance | |
| 1480 | Corneal lesion | Canada Vigilance: 1 | Canada Vigilance | |
| 1481 | Counterfeit product administered | Canada Vigilance: 1 | Canada Vigilance | |
| 1482 | Delusional disorder, persecutory type | Canada Vigilance: 1 | Canada Vigilance | |
| 1483 | Endometrial adenocarcinoma | Canada Vigilance: 1 | Canada Vigilance | |
| 1484 | Euphoric mood | Canada Vigilance: 1 | Canada Vigilance | |
| 1485 | Gamma-glutamyltransferase abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 1486 | Gastric pH decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 1487 | Gastrointestinal ulcer | Canada Vigilance: 1 | Canada Vigilance | |
| 1488 | Hunger | Canada Vigilance: 1 | Canada Vigilance | |
| 1489 | Migraine with Aura | Canada Vigilance: 1 | Canada Vigilance | |
| 1490 | Muscle enzyme decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 1491 | Product used for unknown indication | Canada Vigilance: 1 | Canada Vigilance | |
| 1492 | Rectal Prolapse | Canada Vigilance: 1 | Canada Vigilance | |
| 1493 | Renal Colic | Canada Vigilance: 1 | Canada Vigilance | |
| 1494 | Semen analysis abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 1495 | Serum Sickness | Canada Vigilance: 1 | Canada Vigilance | |
| 1496 | Sinonasal obstruction | Canada Vigilance: 1 | Canada Vigilance | |
| 1497 | Talipes | Canada Vigilance: 1 | Canada Vigilance | |
| 1498 | Testis discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 1499 | Therapeutic response changed | Canada Vigilance: 1 | Canada Vigilance | |
| 1500 | Therapy change | Canada Vigilance: 2 | Canada Vigilance | |
| 1501 | Total cholesterol/HDL ratio abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 1502 | Total cholesterol/HDL ratio increased | Canada Vigilance: 1 | Canada Vigilance | |
| 1503 | Trisomy 21 | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.