Finasteride
(DBEPLOCGEIEOCV-WSBQPABSSA-N)
Structure
- SMILES
- O=C1C=C[C@]2([C@H](N1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2C(=O)NC(C)(C)C)C)C
- Type(s)
- Approved
- ATC code(s)
- D11AX10; G04CA51; G04CB01
- Molecular Formula:
- C23H36N2O2
- Molecular Weight:
- 372.544
- Log P:
- 4.5342
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 2
- TPSA:
- 58.2
- CAS Number(s):
- 98319-26-7
Synonym(s)
1.
Finasteride
2.
Chibro-Proscar
3.
Eucoprost
4.
MK-906
5.
Propecia
6.
Propeshia
7.
Proscar
8.
Chibro Proscar
9.
MK 906
10.
MK906
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Erectile dysfunction | FAERS: 2293 Canada Vigilance: 36 | 8881946 8911291 11583366 | CTD SIDER Canada Vigilance US FAERS |
| 2 | Sexual Dysfunction | FAERS: 2114 Canada Vigilance: 14 | Canada Vigilance SIDER US FAERS | |
| 3 | Anxiety | FAERS: 1348 Canada Vigilance: 12 | Canada Vigilance OFFSIDES US FAERS | |
| 4 | Fatigue | FAERS: 466 Canada Vigilance: 20 | Canada Vigilance OFFSIDES US FAERS | |
| 5 | Semen volume decreased | FAERS: 347 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 6 | Drug ineffective | FAERS: 307 Canada Vigilance: 39 | Canada Vigilance US FAERS | |
| 7 | Blood testosterone decreased | FAERS: 251 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Asthenia | FAERS: 239 Canada Vigilance: 8 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 9 | Emotional distress | FAERS: 237 | OFFSIDES US FAERS | |
| 10 | Feeling abnormal | FAERS: 218 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 11 | Penile size reduced | FAERS: 208 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 12 | Headache | FAERS: 200 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 13 | Hypogonadism | FAERS: 187 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Alopecia | FAERS: 163 Canada Vigilance: 27 | CTD Canada Vigilance US FAERS | |
| 15 | Adverse event | FAERS: 162 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Amnesia | FAERS: 161 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 17 | Back Pain | FAERS: 150 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 18 | Memory impairment | FAERS: 149 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 19 | Arthralgia | FAERS: 147 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 20 | Hormone level abnormal | FAERS: 145 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Dizziness | FAERS: 125 Canada Vigilance: 9 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 22 | Drug exposure during pregnancy | FAERS: 117 | US FAERS | |
| 23 | Dysuria | FAERS: 111 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 24 | Pain | FAERS: 111 | OFFSIDES SIDER US FAERS | |
| 25 | prostatitis | FAERS: 103 | US FAERS | |
| 26 | Palpitations | FAERS: 98 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Stress | FAERS: 97 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 28 | Benign Prostatic Hyperplasia | FAERS: 93 | OFFSIDES US FAERS | |
| 29 | Myalgia | FAERS: 93 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 30 | Chest Pain | FAERS: 87 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 31 | Malaise | FAERS: 86 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 32 | Tinnitus | FAERS: 86 | OFFSIDES US FAERS | |
| 33 | Emotional disorder | FAERS: 84 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 34 | Dry skin | FAERS: 80 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 35 | Nocturia | FAERS: 77 | US FAERS | |
| 36 | Weight decreased | FAERS: 77 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 37 | Drug administration error | FAERS: 74 | US FAERS | |
| 38 | Anhedonia | FAERS: 72 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 39 | Acne | FAERS: 71 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 40 | Apathy | FAERS: 69 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Completed Suicide | FAERS: 67 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Transmission of drug via semen | FAERS: 67 | US FAERS | |
| 43 | Urinary Retention | FAERS: 64 Canada Vigilance: 3 | 9475762 9610579 9644979 | CTD Canada Vigilance US FAERS |
| 44 | Painful ejaculation | FAERS: 60 | US FAERS | |
| 45 | nervous system disorder | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Dyspepsia | FAERS: 59 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Varicocele | FAERS: 59 | US FAERS | |
| 48 | Physical disability | FAERS: 58 | US FAERS | |
| 49 | Anorgasmia | FAERS: 57 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Sperm concentration decreased | FAERS: 57 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 51 | Wrong technique in drug usage process | FAERS: 57 | US FAERS | |
| 52 | Pruritus | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 53 | Semen analysis abnormal | FAERS: 56 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 54 | Constipation | FAERS: 55 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 55 | Blood cholesterol increased | FAERS: 54 | US FAERS | |
| 56 | Mental impairment | FAERS: 54 | US FAERS | |
| 57 | Depressed mood | FAERS: 52 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 58 | No adverse event | FAERS: 52 | US FAERS | |
| 59 | Epididymitis | FAERS: 51 | US FAERS | |
| 60 | Male sexual dysfunction | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Premature Ejaculation | FAERS: 51 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 62 | Libido disorder | FAERS: 50 | US FAERS | |
| 63 | Quality of life decreased | FAERS: 50 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 64 | Male Orgasmic Disorder | FAERS: 49 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 65 | Asthma | FAERS: 48 | US FAERS | |
| 66 | Infertility | FAERS: 48 | US FAERS | |
| 67 | Nausea | FAERS: 48 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 68 | Urinary tract infection | FAERS: 47 | US FAERS | |
| 69 | Bronchitis | FAERS: 46 | SIDER US FAERS | |
| 70 | Anger | FAERS: 45 | US FAERS | |
| 71 | Hypothyroidism | FAERS: 45 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 72 | Male genital atrophy | FAERS: 45 | US FAERS | |
| 73 | Nephrolithiasis | FAERS: 45 | US FAERS | |
| 74 | Abdominal Pain | FAERS: 44 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 75 | Disturbance in sexual arousal | FAERS: 44 | SIDER US FAERS | |
| 76 | Orgasmic sensation decreased | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Tonsillectomy | FAERS: 44 | US FAERS | |
| 78 | Product quality issue | FAERS: 43 | US FAERS | |
| 79 | Tremor | FAERS: 43 | US FAERS | |
| 80 | Eczema | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Lethargy | FAERS: 42 | US FAERS | |
| 82 | Muscle strain | FAERS: 39 | OFFSIDES US FAERS | |
| 83 | Urticaria | FAERS: 39 | SIDER US FAERS | |
| 84 | Vitamin D Deficiency | FAERS: 39 | US FAERS | |
| 85 | Mood swings | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 86 | Poor quality sleep | FAERS: 37 | US FAERS | |
| 87 | Somnolence | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 88 | Breast tenderness | FAERS: 36 | SIDER US FAERS | |
| 89 | Diabetes Mellitus | FAERS: 36 | US FAERS | |
| 90 | Psychiatric symptom | FAERS: 35 | US FAERS | |
| 91 | Abdominal discomfort | FAERS: 33 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 92 | Cerebrovascular accident | FAERS: 33 | US FAERS | |
| 93 | Hypersensitivity | FAERS: 33 | SIDER US FAERS | |
| 94 | Neck Pain | FAERS: 33 | US FAERS | |
| 95 | Suicide attempt | FAERS: 33 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 96 | Wrong technique in product usage process | FAERS: 33 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 97 | Arthritis | FAERS: 32 | OFFSIDES US FAERS | |
| 98 | Impaired work ability | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 99 | Oropharyngeal pain | FAERS: 32 | OFFSIDES US FAERS | |
| 100 | Chest discomfort | FAERS: 31 | US FAERS | |
| 101 | Dysarthria | FAERS: 31 | US FAERS | |
| 102 | Pelvic Pain | FAERS: 31 | US FAERS | |
| 103 | Visual Impairment | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 104 | Joint injury | FAERS: 30 | US FAERS | |
| 105 | Personality Change | FAERS: 30 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 106 | Prostatic pain | FAERS: 30 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 107 | Vertigo | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 108 | Essential Hypertension | FAERS: 29 | US FAERS | |
| 109 | Irritable Bowel Syndrome | FAERS: 29 | US FAERS | |
| 110 | Myocardial Infarction | FAERS: 29 | US FAERS | |
| 111 | Product use issue | FAERS: 29 | US FAERS | |
| 112 | Vomiting | FAERS: 29 | US FAERS | |
| 113 | Lymphadenopathy | FAERS: 28 | US FAERS | |
| 114 | Product substitution issue | FAERS: 28 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 115 | Azoospermia | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 116 | Hernia | FAERS: 27 | OFFSIDES US FAERS | |
| 117 | Inappropriate schedule of drug administration | FAERS: 27 | US FAERS | |
| 118 | Nipple pain | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 119 | Orchitis | FAERS: 27 | US FAERS | |
| 120 | Skin lesion | FAERS: 27 | US FAERS | |
| 121 | Urine flow decreased | FAERS: 27 | US FAERS | |
| 122 | Genital pain | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 123 | Musculoskeletal Pain | FAERS: 26 | US FAERS | |
| 124 | Exposure via father | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 125 | Sinusitis | FAERS: 25 | SIDER US FAERS | |
| 126 | Blunted affect | FAERS: 24 | US FAERS | |
| 127 | Genital atrophy | FAERS: 24 | US FAERS | |
| 128 | Laceration | FAERS: 24 | US FAERS | |
| 129 | Maternal exposure during pregnancy | FAERS: 24 | US FAERS | |
| 130 | Obsessive-Compulsive Disorder | FAERS: 24 | US FAERS | |
| 131 | Penile curvature | FAERS: 24 | US FAERS | |
| 132 | Alanine Aminotransferase Increased | FAERS: 23 | OFFSIDES US FAERS | |
| 133 | Bipolar Disorder | FAERS: 23 | US FAERS | |
| 134 | Coronary Artery Disease | FAERS: 23 | US FAERS | |
| 135 | Panic Disorder | FAERS: 23 | OFFSIDES US FAERS | |
| 136 | Arthropathy | FAERS: 22 | US FAERS | |
| 137 | Bone pain | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 138 | Emotional poverty | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 139 | Infection | FAERS: 22 | SIDER US FAERS | |
| 140 | Intervertebral Disc Degeneration | FAERS: 22 | US FAERS | |
| 141 | Limb injury | FAERS: 22 | US FAERS | |
| 142 | Limb operation | FAERS: 22 | US FAERS | |
| 143 | Musculoskeletal stiffness | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 144 | Nasopharyngitis | FAERS: 22 | US FAERS | |
| 145 | Testicular mass | FAERS: 22 | US FAERS | |
| 146 | Urethritis | FAERS: 22 | US FAERS | |
| 147 | Depression suicidal | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 148 | Lower Urinary Tract Symptoms | FAERS: 21 | US FAERS | |
| 149 | Skin Papilloma | FAERS: 21 | US FAERS | |
| 150 | Arthroscopy | FAERS: 20 | US FAERS | |
| 151 | Aspartate Aminotransferase Increased | FAERS: 20 | US FAERS | |
| 152 | Atrial Fibrillation | FAERS: 20 | US FAERS | |
| 153 | Musculoskeletal discomfort | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Obesity | FAERS: 20 | US FAERS | |
| 155 | Pharyngitis | FAERS: 20 | SIDER US FAERS | |
| 156 | Rotator cuff syndrome | FAERS: 20 | US FAERS | |
| 157 | Alcohol abuse | FAERS: 19 | US FAERS | |
| 158 | Blood triglycerides increased | FAERS: 19 | OFFSIDES US FAERS | |
| 159 | Cyst | FAERS: 19 | US FAERS | |
| 160 | Deafness | FAERS: 19 | OFFSIDES US FAERS | |
| 161 | Drug dose omission | FAERS: 19 | US FAERS | |
| 162 | Genital burning sensation | FAERS: 19 | US FAERS | |
| 163 | Medication Error | FAERS: 19 | US FAERS | |
| 164 | Photophobia | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 165 | Psoriasis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 166 | Semen viscosity decreased | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 167 | Vitreous floaters | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 168 | Cataract | FAERS: 18 | US FAERS | |
| 169 | Diverticulum | FAERS: 18 | OFFSIDES US FAERS | |
| 170 | Drug withdrawal syndrome | FAERS: 18 | US FAERS | |
| 171 | Erythema | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 172 | Exposure via body fluid | FAERS: 18 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 173 | Gout | FAERS: 18 | US FAERS | |
| 174 | Hypospadias | FAERS: 18 | US FAERS | |
| 175 | Nerve injury | FAERS: 18 | US FAERS | |
| 176 | Renal cyst | FAERS: 18 | US FAERS | |
| 177 | Spermatozoa progressive motility decreased | FAERS: 18 | US FAERS | |
| 178 | Umbilical hernia | FAERS: 18 | US FAERS | |
| 179 | Blood urine present | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 180 | Feeling Cold | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 181 | General physical health deterioration | FAERS: 17 | US FAERS | |
| 182 | Middle insomnia | FAERS: 17 | OFFSIDES US FAERS | |
| 183 | Partner stress | FAERS: 17 | US FAERS | |
| 184 | Tachycardia | FAERS: 17 | US FAERS | |
| 185 | Thirst | FAERS: 17 | US FAERS | |
| 186 | Unevaluable event | FAERS: 17 | US FAERS | |
| 187 | Urinary Incontinence | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 188 | Urinary tract obstruction | FAERS: 17 | US FAERS | |
| 189 | Acute sinusitis | FAERS: 16 | US FAERS | |
| 190 | Chills | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 191 | Crying | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 192 | Disorientation | FAERS: 16 | US FAERS | |
| 193 | Flat affect | FAERS: 16 | US FAERS | |
| 194 | Incorrect dose administered | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 195 | Inflammation | FAERS: 16 | US FAERS | |
| 196 | Lactose Intolerance | FAERS: 16 | US FAERS | |
| 197 | Snoring | FAERS: 16 | US FAERS | |
| 198 | Arterial insufficiency | FAERS: 15 | US FAERS | |
| 199 | Blood follicle stimulating hormone decreased | FAERS: 15 | US FAERS | |
| 200 | Carpal Tunnel Syndrome | FAERS: 15 | US FAERS | |
| 201 | Dark circles under eyes | FAERS: 15 | US FAERS | |
| 202 | Dermatitis | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 203 | Hypotrichosis | FAERS: 15 | US FAERS | |
| 204 | Nervousness | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 205 | Night sweats | FAERS: 15 | US FAERS | |
| 206 | Overdose | FAERS: 15 | US FAERS | |
| 207 | Pregnancy | FAERS: 15 | US FAERS | |
| 208 | Product use in unapproved indication | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 209 | Restless Legs Syndrome | FAERS: 15 | US FAERS | |
| 210 | Skin irritation | FAERS: 15 | US FAERS | |
| 211 | Thrombocytopenia | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 212 | Blood creatine phosphokinase increased | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 213 | Body fat disorder | FAERS: 14 | US FAERS | |
| 214 | Diverticulitis | FAERS: 14 | OFFSIDES US FAERS | |
| 215 | Onychomycosis | FAERS: 14 | US FAERS | |
| 216 | Pancreatitis | FAERS: 14 | US FAERS | |
| 217 | Paranoia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 218 | Pneumonia | FAERS: 14 | US FAERS | |
| 219 | Sciatica | FAERS: 14 | US FAERS | |
| 220 | Sinus operation | FAERS: 14 | US FAERS | |
| 221 | Spermatocele | FAERS: 14 | US FAERS | |
| 222 | Temperature intolerance | FAERS: 14 | US FAERS | |
| 223 | Abnormal weight gain | FAERS: 13 | US FAERS | |
| 224 | Alcohol Intolerance | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 225 | Cerebral Infarction | FAERS: 13 | US FAERS | |
| 226 | Discomfort | FAERS: 13 | US FAERS | |
| 227 | Flushing | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 228 | Hypothalamo-pituitary disorder | FAERS: 13 | US FAERS | |
| 229 | Oligospermia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 230 | Perineal pain | FAERS: 13 | US FAERS | |
| 231 | Post-Traumatic Stress Disorder | FAERS: 13 | US FAERS | |
| 232 | Pulmonary Embolism | FAERS: 13 | US FAERS | |
| 233 | Rhabdomyolysis | FAERS: 13 | US FAERS | |
| 234 | Stress at work | FAERS: 13 | US FAERS | |
| 235 | Vasectomy | FAERS: 13 | US FAERS | |
| 236 | Agitation | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 237 | Angioedema | FAERS: 12 | SIDER US FAERS | |
| 238 | Back disorder | FAERS: 12 | US FAERS | |
| 239 | Blood glucose increased | FAERS: 12 | US FAERS | |
| 240 | Blood thyroid stimulating hormone increased | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 241 | Cellulitis | FAERS: 12 | US FAERS | |
| 242 | Cerebral disorder | FAERS: 12 | US FAERS | |
| 243 | Dehydration | FAERS: 12 | OFFSIDES US FAERS | |
| 244 | Dihydrotestosterone decreased | FAERS: 12 | US FAERS | |
| 245 | Drug dispensing error | FAERS: 12 | US FAERS | |
| 246 | Fat redistribution | FAERS: 12 | US FAERS | |
| 247 | Fibromyalgia | FAERS: 12 | US FAERS | |
| 248 | Lid sulcus deepened | FAERS: 12 | US FAERS | |
| 249 | Lipoma | FAERS: 12 | US FAERS | |
| 250 | Prostatic specific antigen decreased | FAERS: 12 | US FAERS | |
| 251 | Somatic symptom disorder | FAERS: 12 | US FAERS | |
| 252 | Syncope | FAERS: 12 | US FAERS | |
| 253 | Urinary hesitation | FAERS: 12 | US FAERS | |
| 254 | Activities of daily living impaired | FAERS: 11 | US FAERS | |
| 255 | Bipolar I disorder | FAERS: 11 | US FAERS | |
| 256 | Blood testosterone increased | FAERS: 11 | US FAERS | |
| 257 | Chronic Fatigue Syndrome | FAERS: 11 | US FAERS | |
| 258 | Depressed Level of Consciousness | FAERS: 11 | US FAERS | |
| 259 | Erection increased | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 260 | Eye pain | FAERS: 11 | US FAERS | |
| 261 | Folliculitis | FAERS: 11 | US FAERS | |
| 262 | Influenza | FAERS: 11 | SIDER US FAERS | |
| 263 | Intentional drug misuse | FAERS: 11 | US FAERS | |
| 264 | Muscle tightness | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 265 | Radical prostatectomy | FAERS: 11 | US FAERS | |
| 266 | Thrombosis | FAERS: 11 | US FAERS | |
| 267 | Urethral Stenosis | FAERS: 11 | US FAERS | |
| 268 | treatment failure | FAERS: 11 | US FAERS | |
| 269 | Balanoposthitis | FAERS: 10 | US FAERS | |
| 270 | Bradyphrenia | FAERS: 10 | US FAERS | |
| 271 | Burning sensation | FAERS: 10 | US FAERS | |
| 272 | Diplopia | FAERS: 10 | US FAERS | |
| 273 | Food Allergy | FAERS: 10 | OFFSIDES US FAERS | |
| 274 | Gastritis | FAERS: 10 | US FAERS | |
| 275 | Gastrointestinal inflammation | FAERS: 10 | US FAERS | |
| 276 | Hypersomnia | FAERS: 10 | US FAERS | |
| 277 | Hypohidrosis | FAERS: 10 | US FAERS | |
| 278 | Hypotension | FAERS: 10 | SIDER US FAERS | |
| 279 | Ligament rupture | FAERS: 10 | OFFSIDES US FAERS | |
| 280 | Polyuria | FAERS: 10 | US FAERS | |
| 281 | Restlessness | FAERS: 10 | US FAERS | |
| 282 | Tooth Extraction | FAERS: 10 | OFFSIDES US FAERS | |
| 283 | Accidental exposure to product | FAERS: 9 | US FAERS | |
| 284 | Actinic keratosis | FAERS: 9 | US FAERS | |
| 285 | Basal cell carcinoma | FAERS: 9 | US FAERS | |
| 286 | Bladder pain | FAERS: 9 | US FAERS | |
| 287 | Blood cortisol decreased | FAERS: 9 | US FAERS | |
| 288 | Deep Vein Thrombosis | FAERS: 9 | US FAERS | |
| 289 | Exposure via semen | FAERS: 9 | US FAERS | |
| 290 | Flatulence | FAERS: 9 | OFFSIDES US FAERS | |
| 291 | Floppy iris syndrome | FAERS: 9 | US FAERS | |
| 292 | Gamma-Glutamyltransferase Increased | FAERS: 9 | US FAERS | |
| 293 | Genital Herpes | FAERS: 9 | US FAERS | |
| 294 | Gluten sensitivity | FAERS: 9 | US FAERS | |
| 295 | Myopathy | FAERS: 9 | US FAERS | |
| 296 | Myositis | FAERS: 9 | US FAERS | |
| 297 | Neuralgia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 298 | Phimosis | FAERS: 9 | US FAERS | |
| 299 | Semen viscosity abnormal | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 300 | Seminoma | FAERS: 9 | US FAERS | |
| 301 | Terminal dribbling | FAERS: 9 | US FAERS | |
| 302 | Transaminases increased | FAERS: 9 | US FAERS | |
| 303 | Upper-airway cough syndrome | FAERS: 9 | US FAERS | |
| 304 | Wheezing | FAERS: 9 | US FAERS | |
| 305 | Accidental exposure | FAERS: 8 | US FAERS | |
| 306 | Aphasia | FAERS: 8 | US FAERS | |
| 307 | Arthropod bite | FAERS: 8 | US FAERS | |
| 308 | Benign neoplasm of skin | FAERS: 8 | US FAERS | |
| 309 | Blood testosterone free decreased | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 310 | Cystitis | FAERS: 8 | US FAERS | |
| 311 | Dysbacteriosis | FAERS: 8 | US FAERS | |
| 312 | Dysgeusia | FAERS: 8 | OFFSIDES US FAERS | |
| 313 | Dyspareunia | FAERS: 8 | US FAERS | |
| 314 | Ear discomfort | FAERS: 8 | US FAERS | |
| 315 | Epistaxis | FAERS: 8 | US FAERS | |
| 316 | Fibrosis | FAERS: 8 | US FAERS | |
| 317 | Gastrointestinal bacterial overgrowth | FAERS: 8 | US FAERS | |
| 318 | Hyperthyroidism | FAERS: 8 | US FAERS | |
| 319 | Hypopituitarism | FAERS: 8 | US FAERS | |
| 320 | Incontinence | FAERS: 8 | US FAERS | |
| 321 | Incorrect route of drug administration | FAERS: 8 | US FAERS | |
| 322 | Intervertebral disc disorder | FAERS: 8 | OFFSIDES US FAERS | |
| 323 | Lipoatrophy | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 324 | Meibomian gland dysfunction | FAERS: 8 | US FAERS | |
| 325 | Mole excision | FAERS: 8 | US FAERS | |
| 326 | Multiple Sclerosis | FAERS: 8 | US FAERS | |
| 327 | Musculoskeletal chest pain | FAERS: 8 | US FAERS | |
| 328 | Mydriasis | FAERS: 8 | US FAERS | |
| 329 | Osteoporosis | FAERS: 8 | US FAERS | |
| 330 | Productive Cough | FAERS: 8 | US FAERS | |
| 331 | Semen liquefaction abnormal | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 332 | Tension Headache | FAERS: 8 | US FAERS | |
| 333 | Urinary tract inflammation | FAERS: 8 | US FAERS | |
| 334 | Acute myocardial infarction | FAERS: 7 | OFFSIDES US FAERS | |
| 335 | Adenoidectomy | FAERS: 7 | US FAERS | |
| 336 | Adjustment disorder with mixed anxiety and depressed mood | FAERS: 7 | US FAERS | |
| 337 | Anaphylactic shock | FAERS: 7 | US FAERS | |
| 338 | Angina Pectoris | FAERS: 7 | US FAERS | |
| 339 | Bowel movement irregularity | FAERS: 7 | US FAERS | |
| 340 | Chloasma | FAERS: 7 | US FAERS | |
| 341 | Cholelithiasis | FAERS: 7 | US FAERS | |
| 342 | Cluster Headache | FAERS: 7 | US FAERS | |
| 343 | Diabetes mellitus inadequate control | FAERS: 7 | US FAERS | |
| 344 | Disability | FAERS: 7 | US FAERS | |
| 345 | Drug Dependence | FAERS: 7 | US FAERS | |
| 346 | Dysthymic Disorder | FAERS: 7 | OFFSIDES US FAERS | |
| 347 | Fracture | FAERS: 7 | US FAERS | |
| 348 | Frustration | FAERS: 7 | US FAERS | |
| 349 | Genital rash | FAERS: 7 | US FAERS | |
| 350 | Hordeolum | FAERS: 7 | US FAERS | |
| 351 | Hyperandrogenism | FAERS: 7 | US FAERS | |
| 352 | Joint stiffness | FAERS: 7 | US FAERS | |
| 353 | Lumbar radiculopathy | FAERS: 7 | US FAERS | |
| 354 | Meniscus injury | FAERS: 7 | US FAERS | |
| 355 | Mental status changes | FAERS: 7 | US FAERS | |
| 356 | Metastasis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 357 | Mineral deficiency | FAERS: 7 | US FAERS | |
| 358 | Occupational exposure to product | FAERS: 7 | US FAERS | |
| 359 | Performance status decreased | FAERS: 7 | US FAERS | |
| 360 | Post procedural complication | FAERS: 7 | US FAERS | |
| 361 | Presyncope | FAERS: 7 | US FAERS | |
| 362 | Product taste abnormal | FAERS: 7 | US FAERS | |
| 363 | Psychogenic erectile dysfunction | FAERS: 7 | US FAERS | |
| 364 | Rosacea | FAERS: 7 | US FAERS | |
| 365 | Scrotal mass | FAERS: 7 | US FAERS | |
| 366 | Skin Wrinkling | FAERS: 7 | US FAERS | |
| 367 | Slow speech | FAERS: 7 | US FAERS | |
| 368 | Spermatozoa abnormal | FAERS: 7 | US FAERS | |
| 369 | Tinea Pedis | FAERS: 7 | US FAERS | |
| 370 | Ankle Fracture | FAERS: 6 | US FAERS | |
| 371 | Anti-androgen withdrawal syndrome | FAERS: 6 | US FAERS | |
| 372 | Appendicitis | FAERS: 6 | US FAERS | |
| 373 | Blood alkaline phosphatase increased | FAERS: 6 | US FAERS | |
| 374 | Blood follicle stimulating hormone abnormal | FAERS: 6 | US FAERS | |
| 375 | Blood potassium decreased | FAERS: 6 | US FAERS | |
| 376 | Blood prolactin increased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 377 | Bradycardia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 378 | Chromaturia | FAERS: 6 | US FAERS | |
| 379 | Circumstance or information capable of leading to medication error | FAERS: 6 | US FAERS | |
| 380 | Cold sweat | FAERS: 6 | US FAERS | |
| 381 | Cryotherapy | FAERS: 6 | US FAERS | |
| 382 | Deformity | FAERS: 6 | US FAERS | |
| 383 | Drug prescribing error | FAERS: 6 | US FAERS | |
| 384 | Dysphemia | FAERS: 6 | US FAERS | |
| 385 | Dysphonia | FAERS: 6 | OFFSIDES US FAERS | |
| 386 | Ear tube insertion | FAERS: 6 | US FAERS | |
| 387 | Feeling of body temperature change | FAERS: 6 | US FAERS | |
| 388 | Flank Pain | FAERS: 6 | US FAERS | |
| 389 | Gastroenteritis | FAERS: 6 | US FAERS | |
| 390 | Hepatitis | FAERS: 6 | 17298197 | CTD US FAERS |
| 391 | Joint swelling | FAERS: 6 | US FAERS | |
| 392 | Keratomileusis | FAERS: 6 | US FAERS | |
| 393 | Lip swelling | FAERS: 6 | US FAERS | |
| 394 | Malabsorption | FAERS: 6 | US FAERS | |
| 395 | Myocarditis | FAERS: 6 | US FAERS | |
| 396 | Osteochondrosis | FAERS: 6 | US FAERS | |
| 397 | Pemphigus | FAERS: 6 | US FAERS | |
| 398 | Peripheral swelling | FAERS: 6 | US FAERS | |
| 399 | Phalangeal agenesis | FAERS: 6 | US FAERS | |
| 400 | Physical assault | FAERS: 6 | US FAERS | |
| 401 | Poisoning | FAERS: 6 | US FAERS | |
| 402 | Primary hypogonadism | FAERS: 6 | US FAERS | |
| 403 | Prostatectomy | FAERS: 6 | US FAERS | |
| 404 | Sluggishness | FAERS: 6 | US FAERS | |
| 405 | Squamous cell carcinoma | FAERS: 6 | US FAERS | |
| 406 | Testicular Microlithiasis | FAERS: 6 | US FAERS | |
| 407 | Testicular seminoma (pure) stage I | FAERS: 6 | US FAERS | |
| 408 | Thyroid hormones increased | FAERS: 6 | US FAERS | |
| 409 | Toxicity to various agents | FAERS: 6 | US FAERS | |
| 410 | Trisomy 21 | FAERS: 6 | US FAERS | |
| 411 | Vitiligo | FAERS: 6 | US FAERS | |
| 412 | jaundice | FAERS: 6 | US FAERS | |
| 413 | Anal Fissure | FAERS: 5 | US FAERS | |
| 414 | Animal bite | FAERS: 5 | US FAERS | |
| 415 | Arteriosclerosis | FAERS: 5 | OFFSIDES US FAERS | |
| 416 | Bladder neck obstruction | FAERS: 5 | US FAERS | |
| 417 | Blindness | FAERS: 5 | US FAERS | |
| 418 | Blood cortisol increased | FAERS: 5 | US FAERS | |
| 419 | Blood follicle stimulating hormone increased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 420 | Bruxism | FAERS: 5 | US FAERS | |
| 421 | Callus formation delayed | FAERS: 5 | US FAERS | |
| 422 | Colectomy | FAERS: 5 | US FAERS | |
| 423 | Colon adenoma | FAERS: 5 | US FAERS | |
| 424 | Dehydroepiandrosterone decreased | FAERS: 5 | US FAERS | |
| 425 | Dependence | FAERS: 5 | US FAERS | |
| 426 | Dermoid Cyst | FAERS: 5 | US FAERS | |
| 427 | Drug abuse | FAERS: 5 | US FAERS | |
| 428 | Ecchymosis | FAERS: 5 | US FAERS | |
| 429 | Empty Sella Syndrome | FAERS: 5 | US FAERS | |
| 430 | Epicondylitis | FAERS: 5 | US FAERS | |
| 431 | Epilepsy | FAERS: 5 | US FAERS | |
| 432 | Genital tract inflammation | FAERS: 5 | US FAERS | |
| 433 | Glaucoma | FAERS: 5 | OFFSIDES US FAERS | |
| 434 | Head discomfort | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 435 | Hepatitis C | FAERS: 5 | US FAERS | |
| 436 | Hyperemesis Gravidarum | FAERS: 5 | US FAERS | |
| 437 | Hypospermia | FAERS: 5 | US FAERS | |
| 438 | Infectious Mononucleosis | FAERS: 5 | US FAERS | |
| 439 | Initial insomnia | FAERS: 5 | US FAERS | |
| 440 | Insulin Resistance | FAERS: 5 | US FAERS | |
| 441 | Joint Range of Motion Decreased | FAERS: 5 | US FAERS | |
| 442 | Keratosis pilaris | FAERS: 5 | US FAERS | |
| 443 | Low density lipoprotein increased | FAERS: 5 | US FAERS | |
| 444 | Mastitis | FAERS: 5 | US FAERS | |
| 445 | Medical device removal | FAERS: 5 | US FAERS | |
| 446 | Mental Retardation | FAERS: 5 | US FAERS | |
| 447 | Muscle Rigidity | FAERS: 5 | US FAERS | |
| 448 | Neuritis | FAERS: 5 | US FAERS | |
| 449 | Nodule | FAERS: 5 | US FAERS | |
| 450 | Ocular discomfort | FAERS: 5 | US FAERS | |
| 451 | Osteopenia | FAERS: 5 | US FAERS | |
| 452 | Patellofemoral Pain Syndrome | FAERS: 5 | US FAERS | |
| 453 | Peripheral venous disease | FAERS: 5 | US FAERS | |
| 454 | Polydipsia | FAERS: 5 | US FAERS | |
| 455 | Polyneuropathy | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 456 | Product physical issue | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 457 | Prostate cancer recurrent | FAERS: 5 | US FAERS | |
| 458 | Prostatism | FAERS: 5 | US FAERS | |
| 459 | Pseudoporphyria | FAERS: 5 | US FAERS | |
| 460 | Pudendal canal syndrome | FAERS: 5 | US FAERS | |
| 461 | Rash erythematous | FAERS: 5 | US FAERS | |
| 462 | Retinal Detachment | FAERS: 5 | US FAERS | |
| 463 | Suspected counterfeit product | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 464 | Swelling | FAERS: 5 | SIDER US FAERS | |
| 465 | Therapeutic response unexpected | FAERS: 5 | US FAERS | |
| 466 | Tinea cruris | FAERS: 5 | US FAERS | |
| 467 | furuncle | FAERS: 5 | US FAERS | |
| 468 | skin abrasion | FAERS: 5 | US FAERS | |
| 469 | Abasia | FAERS: 4 | US FAERS | |
| 470 | Abscess | FAERS: 4 | US FAERS | |
| 471 | Abulia | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 472 | Adrenalectomy | FAERS: 4 | US FAERS | |
| 473 | Atrioventricular Block | FAERS: 4 | US FAERS | |
| 474 | Autonomic nervous system imbalance | FAERS: 4 | US FAERS | |
| 475 | Autonomic neuropathy | FAERS: 4 | US FAERS | |
| 476 | Benign breast lump removal | FAERS: 4 | US FAERS | |
| 477 | Blepharitis | FAERS: 4 | US FAERS | |
| 478 | Blood lactate dehydrogenase increased | FAERS: 4 | US FAERS | |
| 479 | Bone fragmentation | FAERS: 4 | US FAERS | |
| 480 | Bronchial Hyperreactivity | FAERS: 4 | US FAERS | |
| 481 | Carbohydrate intolerance | FAERS: 4 | US FAERS | |
| 482 | Cardiac Flutter | FAERS: 4 | US FAERS | |
| 483 | Cardiovascular insufficiency | FAERS: 4 | US FAERS | |
| 484 | Cartilage injury | FAERS: 4 | US FAERS | |
| 485 | Cholestasis | FAERS: 4 | US FAERS | |
| 486 | Colitis | FAERS: 4 | US FAERS | |
| 487 | Complex partial seizures | FAERS: 4 | US FAERS | |
| 488 | Cyst removal | FAERS: 4 | US FAERS | |
| 489 | Diffuse alopecia | FAERS: 4 | US FAERS | |
| 490 | Dissociation | FAERS: 4 | US FAERS | |
| 491 | Drug effect incomplete | FAERS: 4 | US FAERS | |
| 492 | Educational problem | FAERS: 4 | US FAERS | |
| 493 | Electrocardiogram abnormal | FAERS: 4 | US FAERS | |
| 494 | Enuresis | FAERS: 4 | US FAERS | |
| 495 | Erythema Multiforme | FAERS: 4 | US FAERS | |
| 496 | Exposure via partner | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 497 | Eye irritation | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 498 | Fatty acid deficiency | FAERS: 4 | US FAERS | |
| 499 | Feeling jittery | FAERS: 4 | US FAERS | |
| 500 | Gastrointestinal perforation | FAERS: 4 | US FAERS | |
| 501 | Gastrostomy | FAERS: 4 | US FAERS | |
| 502 | General physical condition abnormal | FAERS: 4 | US FAERS | |
| 503 | Genital discomfort | FAERS: 4 | US FAERS | |
| 504 | Hirsutism | FAERS: 4 | US FAERS | |
| 505 | Hydronephrosis | FAERS: 4 | OFFSIDES US FAERS | |
| 506 | Hyperacusis | FAERS: 4 | US FAERS | |
| 507 | Hyperphagia | FAERS: 4 | US FAERS | |
| 508 | Labyrinthitis | FAERS: 4 | US FAERS | |
| 509 | Mastectomy | FAERS: 4 | US FAERS | |
| 510 | Meningioma | FAERS: 4 | US FAERS | |
| 511 | Migraine with Aura | FAERS: 4 | US FAERS | |
| 512 | Muscle Fatigue | FAERS: 4 | US FAERS | |
| 513 | Narcolepsy | FAERS: 4 | US FAERS | |
| 514 | Ophthalmoplegia | FAERS: 4 | US FAERS | |
| 515 | Optic Neuritis | FAERS: 4 | US FAERS | |
| 516 | Pectus excavatum | FAERS: 4 | US FAERS | |
| 517 | Periarthritis | FAERS: 4 | US FAERS | |
| 518 | Polydactyly | FAERS: 4 | US FAERS | |
| 519 | Pregnancy of partner | FAERS: 4 | US FAERS | |
| 520 | Prostatic calcification | FAERS: 4 | US FAERS | |
| 521 | Pterygium | FAERS: 4 | US FAERS | |
| 522 | Renal Colic | FAERS: 4 | US FAERS | |
| 523 | Rhinitis | FAERS: 4 | SIDER US FAERS | |
| 524 | Scrotal cyst | FAERS: 4 | US FAERS | |
| 525 | Semen viscosity | FAERS: 4 | US FAERS | |
| 526 | Spinal column injury | FAERS: 4 | US FAERS | |
| 527 | Spinal fusion surgery | FAERS: 4 | US FAERS | |
| 528 | Spondylolisthesis | FAERS: 4 | US FAERS | |
| 529 | Synovial Cyst | FAERS: 4 | US FAERS | |
| 530 | Tonsillitis | FAERS: 4 | US FAERS | |
| 531 | Total sperm count decreased | FAERS: 4 | US FAERS | |
| 532 | Ulcer | FAERS: 4 | US FAERS | |
| 533 | Urge Incontinence | FAERS: 4 | US FAERS | |
| 534 | Ventricular Fibrillation | FAERS: 4 | US FAERS | |
| 535 | Waist circumference increased | FAERS: 4 | US FAERS | |
| 536 | kyphosis | FAERS: 4 | US FAERS | |
| 537 | Accidental overdose | FAERS: 3 | US FAERS | |
| 538 | Agoraphobia | FAERS: 3 | US FAERS | |
| 539 | Allergy to chemicals | FAERS: 3 | US FAERS | |
| 540 | Allodynia | FAERS: 3 | US FAERS | |
| 541 | Anorectal discomfort | FAERS: 3 | US FAERS | |
| 542 | Anosmia | FAERS: 3 | US FAERS | |
| 543 | Asphyxia | FAERS: 3 | US FAERS | |
| 544 | Atelectasis | FAERS: 3 | US FAERS | |
| 545 | Autoimmune thyroiditis | FAERS: 3 | US FAERS | |
| 546 | Bacterial disease carrier | FAERS: 3 | US FAERS | |
| 547 | Benign neoplasm of thyroid gland | FAERS: 3 | US FAERS | |
| 548 | Blood albumin increased | FAERS: 3 | US FAERS | |
| 549 | Blood creatinine increased | FAERS: 3 | US FAERS | |
| 550 | Blood iron increased | FAERS: 3 | US FAERS | |
| 551 | Breast hyperplasia | FAERS: 3 | US FAERS | |
| 552 | Bursitis | FAERS: 3 | US FAERS | |
| 553 | Capillaritis | FAERS: 3 | US FAERS | |
| 554 | Carcinoembryonic antigen increased | FAERS: 3 | US FAERS | |
| 555 | Cardiac ablation | FAERS: 3 | US FAERS | |
| 556 | Cerebral ventricle dilatation | FAERS: 3 | US FAERS | |
| 557 | Chondroplasty | FAERS: 3 | US FAERS | |
| 558 | Complications of maternal exposure to therapeutic drugs | FAERS: 3 | US FAERS | |
| 559 | Conjunctivitis | FAERS: 3 | US FAERS | |
| 560 | Dehydroepiandrosterone increased | FAERS: 3 | US FAERS | |
| 561 | Dependent Personality Disorder | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 562 | Detachment of retinal pigment epithelium | FAERS: 3 | US FAERS | |
| 563 | Drug exposure before pregnancy | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 564 | Duodenal Ulcer | FAERS: 3 | OFFSIDES US FAERS | |
| 565 | Dyschezia | FAERS: 3 | US FAERS | |
| 566 | Elbow operation | FAERS: 3 | US FAERS | |
| 567 | Electrodesiccation | FAERS: 3 | US FAERS | |
| 568 | Eosinophilia | FAERS: 3 | US FAERS | |
| 569 | Epispadias | FAERS: 3 | US FAERS | |
| 570 | Exposure to body fluid | FAERS: 3 | US FAERS | |
| 571 | Eye Infection | FAERS: 3 | US FAERS | |
| 572 | Eye inflammation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 573 | Facial paralysis | FAERS: 3 | US FAERS | |
| 574 | Facial wasting | FAERS: 3 | US FAERS | |
| 575 | Familial Tremor | FAERS: 3 | US FAERS | |
| 576 | Food Poisoning | FAERS: 3 | US FAERS | |
| 577 | Gastrointestinal ulcer | FAERS: 3 | US FAERS | |
| 578 | Glossitis | FAERS: 3 | US FAERS | |
| 579 | Grief reaction | FAERS: 3 | US FAERS | |
| 580 | Hepatomegaly | FAERS: 3 | US FAERS | |
| 581 | Hypergonadism | FAERS: 3 | US FAERS | |
| 582 | Hyperkeratosis | FAERS: 3 | US FAERS | |
| 583 | Hypertrichosis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 584 | Hypertrophy | FAERS: 3 | US FAERS | |
| 585 | Hypochondriasis | FAERS: 3 | US FAERS | |
| 586 | Hypokinesia | FAERS: 3 | US FAERS | |
| 587 | Hypometabolism | FAERS: 3 | US FAERS | |
| 588 | Incorrect product storage | FAERS: 3 | US FAERS | |
| 589 | Insulin resistance syndrome | FAERS: 3 | US FAERS | |
| 590 | Intentional self-injury | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 591 | Intramedullary rod insertion | FAERS: 3 | US FAERS | |
| 592 | Lesion excision | FAERS: 3 | US FAERS | |
| 593 | Leukopenia | FAERS: 3 | US FAERS | |
| 594 | Ligament injury | FAERS: 3 | US FAERS | |
| 595 | Limb discomfort | FAERS: 3 | US FAERS | |
| 596 | Loss of personal independence in daily activities | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 597 | Lymphoma | FAERS: 3 | US FAERS | |
| 598 | Lymphopenia | FAERS: 3 | US FAERS | |
| 599 | Malaria | FAERS: 3 | US FAERS | |
| 600 | Male genital examination abnormal | FAERS: 3 | US FAERS | |
| 601 | Meniscus operation | FAERS: 3 | US FAERS | |
| 602 | Mental Fatigue | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 603 | Motion Sickness | FAERS: 3 | US FAERS | |
| 604 | Multiple allergies | FAERS: 3 | US FAERS | |
| 605 | Mumps | FAERS: 3 | US FAERS | |
| 606 | Muscle hypertrophy | FAERS: 3 | US FAERS | |
| 607 | Myoclonus | FAERS: 3 | US FAERS | |
| 608 | Myopia | FAERS: 3 | US FAERS | |
| 609 | Nasal Polyps | FAERS: 3 | US FAERS | |
| 610 | Necrosis | FAERS: 3 | US FAERS | |
| 611 | Nicotine Dependence | FAERS: 3 | US FAERS | |
| 612 | Non-cardiac chest pain | FAERS: 3 | US FAERS | |
| 613 | Oliguria | FAERS: 3 | US FAERS | |
| 614 | Orchitis noninfective | FAERS: 3 | US FAERS | |
| 615 | Papilloma | FAERS: 3 | US FAERS | |
| 616 | Paraesthesia of genital male | FAERS: 3 | US FAERS | |
| 617 | Penile swelling | FAERS: 3 | US FAERS | |
| 618 | Peptic Ulcer | FAERS: 3 | US FAERS | |
| 619 | Peritonsillar Abscess | FAERS: 3 | US FAERS | |
| 620 | Placental Insufficiency | FAERS: 3 | US FAERS | |
| 621 | Procedural complication | FAERS: 3 | US FAERS | |
| 622 | Psychogenic movement disorder | FAERS: 3 | US FAERS | |
| 623 | Radiculopathy | FAERS: 3 | US FAERS | |
| 624 | Retrograde ejaculation | FAERS: 3 | US FAERS | |
| 625 | Rheumatoid Arthritis | FAERS: 3 | US FAERS | |
| 626 | Sacroiliitis | FAERS: 3 | US FAERS | |
| 627 | Schizophrenia | FAERS: 3 | US FAERS | |
| 628 | Semen viscosity increased | FAERS: 3 | US FAERS | |
| 629 | Sensory level abnormal | FAERS: 3 | US FAERS | |
| 630 | Sepsis | FAERS: 3 | US FAERS | |
| 631 | Sexual relationship change | FAERS: 3 | US FAERS | |
| 632 | Simplex virus test positive | FAERS: 3 | US FAERS | |
| 633 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 634 | Sinus bradycardia | FAERS: 3 | US FAERS | |
| 635 | Sinus headache | FAERS: 3 | US FAERS | |
| 636 | Somatoform Disorder | FAERS: 3 | US FAERS | |
| 637 | Sperm concentration zero | FAERS: 3 | US FAERS | |
| 638 | Sperm count decreased | FAERS: 3 | US FAERS | |
| 639 | Spermatozoa morphology abnormal | FAERS: 3 | US FAERS | |
| 640 | Splenomegaly | FAERS: 3 | US FAERS | |
| 641 | Spontaneous penile erection | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 642 | Stomatitis | FAERS: 3 | US FAERS | |
| 643 | Subcutaneous Abscess | FAERS: 3 | US FAERS | |
| 644 | Sunburn | FAERS: 3 | US FAERS | |
| 645 | Talipes | FAERS: 3 | US FAERS | |
| 646 | Testis discomfort | FAERS: 3 | US FAERS | |
| 647 | Therapy cessation | FAERS: 3 | US FAERS | |
| 648 | Thermal burn | FAERS: 3 | US FAERS | |
| 649 | Thirst decreased | FAERS: 3 | US FAERS | |
| 650 | Throat cancer | FAERS: 3 | US FAERS | |
| 651 | Thyroid Neoplasm | FAERS: 3 | US FAERS | |
| 652 | Underweight | FAERS: 3 | US FAERS | |
| 653 | Ureterolithiasis | FAERS: 3 | US FAERS | |
| 654 | Urethritis noninfective | FAERS: 3 | US FAERS | |
| 655 | Urine output increased | FAERS: 3 | US FAERS | |
| 656 | Urogenital atrophy | FAERS: 3 | US FAERS | |
| 657 | Vascular insufficiency | FAERS: 3 | US FAERS | |
| 658 | White blood cell count decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 659 | Aborted pregnancy | FAERS: 2 | US FAERS | |
| 660 | Adjustment disorder with depressed mood | FAERS: 2 | US FAERS | |
| 661 | Alcohol withdrawal syndrome | FAERS: 2 | US FAERS | |
| 662 | Allergic cough | FAERS: 2 | US FAERS | |
| 663 | Allergic sinusitis | FAERS: 2 | US FAERS | |
| 664 | Alveoloplasty | FAERS: 2 | US FAERS | |
| 665 | Anal Fistula | FAERS: 2 | US FAERS | |
| 666 | Androgenetic Alopecia | FAERS: 2 | SIDER US FAERS | |
| 667 | Androgens decreased | FAERS: 2 | US FAERS | |
| 668 | Andropause | FAERS: 2 | US FAERS | |
| 669 | Angioplasty | FAERS: 2 | US FAERS | |
| 670 | Anhidrosis | FAERS: 2 | US FAERS | |
| 671 | Anti-thyroid antibody positive | FAERS: 2 | US FAERS | |
| 672 | Antiphospholipid Syndrome | FAERS: 2 | US FAERS | |
| 673 | Autoimmune hepatitis | FAERS: 2 | US FAERS | |
| 674 | Biliary cancer metastatic | FAERS: 2 | US FAERS | |
| 675 | Bladder dysfunction | FAERS: 2 | US FAERS | |
| 676 | Blighted ovum | FAERS: 2 | US FAERS | |
| 677 | Blood cortisol abnormal | FAERS: 2 | US FAERS | |
| 678 | Blood pressure inadequately controlled | FAERS: 2 | US FAERS | |
| 679 | Blood testosterone abnormal | FAERS: 2 | US FAERS | |
| 680 | Bone density decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 681 | Bronchoscopy | FAERS: 2 | US FAERS | |
| 682 | Cachexia | FAERS: 2 | US FAERS | |
| 683 | Calcinosis | FAERS: 2 | US FAERS | |
| 684 | Carbohydrate antigen 19-9 increased | FAERS: 2 | US FAERS | |
| 685 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 686 | Cardiac stress test abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 687 | Cardiomegaly | FAERS: 2 | US FAERS | |
| 688 | Cataplexy | FAERS: 2 | US FAERS | |
| 689 | Cataract operation | FAERS: 2 | US FAERS | |
| 690 | Catheter placement | FAERS: 2 | US FAERS | |
| 691 | Cellulitis of male external genital organ | FAERS: 2 | US FAERS | |
| 692 | Cerebral Thrombosis | FAERS: 2 | US FAERS | |
| 693 | Cerebral cyst | FAERS: 2 | US FAERS | |
| 694 | Cervicobrachial syndrome | FAERS: 2 | US FAERS | |
| 695 | Coronary angioplasty | FAERS: 2 | US FAERS | |
| 696 | Counterfeit drug administered | FAERS: 2 | US FAERS | |
| 697 | Counterfeit product administered | FAERS: 2 | US FAERS | |
| 698 | Device occlusion | FAERS: 2 | US FAERS | |
| 699 | Dissociative Identity Disorder | FAERS: 2 | US FAERS | |
| 700 | Diverticular perforation | FAERS: 2 | OFFSIDES US FAERS | |
| 701 | Economic problem | FAERS: 2 | US FAERS | |
| 702 | Electrocardiogram ST-T change | FAERS: 2 | OFFSIDES US FAERS | |
| 703 | Embolism | FAERS: 2 | US FAERS | |
| 704 | Enzyme level abnormal | FAERS: 2 | US FAERS | |
| 705 | Escherichia test positive | FAERS: 2 | US FAERS | |
| 706 | Excessive eye blinking | FAERS: 2 | US FAERS | |
| 707 | Excessive skin | FAERS: 2 | US FAERS | |
| 708 | Exercise tolerance increased | FAERS: 2 | US FAERS | |
| 709 | Expired drug administered | FAERS: 2 | US FAERS | |
| 710 | Eye Redness | FAERS: 2 | US FAERS | |
| 711 | Facial asymmetry | FAERS: 2 | US FAERS | |
| 712 | Fasciitis | FAERS: 2 | US FAERS | |
| 713 | Feelings of worthlessness | FAERS: 2 | US FAERS | |
| 714 | Formication | FAERS: 2 | US FAERS | |
| 715 | Fracture treatment | FAERS: 2 | US FAERS | |
| 716 | Frustration tolerance decreased | FAERS: 2 | US FAERS | |
| 717 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 718 | Gastrointestinal motility disorder | FAERS: 2 | US FAERS | |
| 719 | General symptom | FAERS: 2 | US FAERS | |
| 720 | Genital cyst | FAERS: 2 | US FAERS | |
| 721 | Genital neoplasm malignant male | FAERS: 2 | US FAERS | |
| 722 | Gingivitis | FAERS: 2 | US FAERS | |
| 723 | Glossectomy | FAERS: 2 | US FAERS | |
| 724 | Grip strength decreased | FAERS: 2 | US FAERS | |
| 725 | Head circumference abnormal | FAERS: 2 | US FAERS | |
| 726 | Hermaphroditism | FAERS: 2 | US FAERS | |
| 727 | Hidradenitis | FAERS: 2 | US FAERS | |
| 728 | Histamine intolerance | FAERS: 2 | US FAERS | |
| 729 | Hydrocephalus | FAERS: 2 | US FAERS | |
| 730 | Hyperaldosteronism | FAERS: 2 | US FAERS | |
| 731 | Hypogeusia | FAERS: 2 | US FAERS | |
| 732 | Illogical thinking | FAERS: 2 | US FAERS | |
| 733 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 734 | Impaired quality of life | FAERS: 2 | US FAERS | |
| 735 | Impaired reasoning | FAERS: 2 | US FAERS | |
| 736 | Impatience | FAERS: 2 | US FAERS | |
| 737 | Implant site erosion | FAERS: 2 | US FAERS | |
| 738 | Incisional hernia | FAERS: 2 | US FAERS | |
| 739 | Incoherent | FAERS: 2 | US FAERS | |
| 740 | Increased tendency to bruise | FAERS: 2 | US FAERS | |
| 741 | Injection | FAERS: 2 | US FAERS | |
| 742 | Insulin-like growth factor decreased | FAERS: 2 | US FAERS | |
| 743 | Intentional product misuse | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 744 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 745 | Intervertebral disc annular tear | FAERS: 2 | US FAERS | |
| 746 | Intraocular pressure test | FAERS: 2 | US FAERS | |
| 747 | Invasive Ductal Breast Carcinoma | FAERS: 2 | US FAERS | |
| 748 | Laparotomy | FAERS: 2 | US FAERS | |
| 749 | Laryngitis | FAERS: 2 | US FAERS | |
| 750 | Latent Tuberculosis | FAERS: 2 | US FAERS | |
| 751 | Left Ventricular Hypertrophy | FAERS: 2 | US FAERS | |
| 752 | Lentigo | FAERS: 2 | US FAERS | |
| 753 | Lichen Planus | FAERS: 2 | US FAERS | |
| 754 | Lipase increased | FAERS: 2 | US FAERS | |
| 755 | Lipoma of breast | FAERS: 2 | US FAERS | |
| 756 | Loss of visual contrast sensitivity | FAERS: 2 | US FAERS | |
| 757 | Lung consolidation | FAERS: 2 | US FAERS | |
| 758 | Lung hyperinflation | FAERS: 2 | US FAERS | |
| 759 | Lymphomatoid Papulosis | FAERS: 2 | US FAERS | |
| 760 | Meningocele | FAERS: 2 | US FAERS | |
| 761 | Metastatic Neoplasm | FAERS: 2 | US FAERS | |
| 762 | Metatarsalgia | FAERS: 2 | US FAERS | |
| 763 | Molar abortion | FAERS: 2 | US FAERS | |
| 764 | Mood disorder due to a general medical condition | FAERS: 2 | US FAERS | |
| 765 | Musculoskeletal Deformity | FAERS: 2 | US FAERS | |
| 766 | Myotonic Dystrophy | FAERS: 2 | US FAERS | |
| 767 | Near Drowning | FAERS: 2 | US FAERS | |
| 768 | Negative thoughts | FAERS: 2 | US FAERS | |
| 769 | Neurodermatitis | FAERS: 2 | US FAERS | |
| 770 | Neurosyphilis | FAERS: 2 | US FAERS | |
| 771 | No adverse effect | FAERS: 2 | US FAERS | |
| 772 | Ocular Hypertension | FAERS: 2 | US FAERS | |
| 773 | Onychoclasis | FAERS: 2 | US FAERS | |
| 774 | Oral pain | FAERS: 2 | US FAERS | |
| 775 | Oropharyngeal swelling | FAERS: 2 | US FAERS | |
| 776 | Otitis Externa | FAERS: 2 | US FAERS | |
| 777 | Otitis Media | FAERS: 2 | US FAERS | |
| 778 | Pallor | FAERS: 2 | US FAERS | |
| 779 | Palmar erythema | FAERS: 2 | US FAERS | |
| 780 | Panic disorder without agoraphobia | FAERS: 2 | US FAERS | |
| 781 | Paradoxical drug reaction | FAERS: 2 | US FAERS | |
| 782 | Paranasal cyst | FAERS: 2 | US FAERS | |
| 783 | Pelvic Floor Muscle Weakness | FAERS: 2 | US FAERS | |
| 784 | Pelvic discomfort | FAERS: 2 | US FAERS | |
| 785 | Penile contusion | FAERS: 2 | US FAERS | |
| 786 | Penile operation | FAERS: 2 | US FAERS | |
| 787 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 788 | Pilonidal Cyst | FAERS: 2 | US FAERS | |
| 789 | Pityriasis Rosea | FAERS: 2 | US FAERS | |
| 790 | Plasmacytoma | FAERS: 2 | US FAERS | |
| 791 | Pleurisy | FAERS: 2 | US FAERS | |
| 792 | Polymyositis | FAERS: 2 | US FAERS | |
| 793 | Portal Vein Thrombosis | FAERS: 2 | OFFSIDES US FAERS | |
| 794 | Post procedural constipation | FAERS: 2 | US FAERS | |
| 795 | Post-Traumatic Headache | FAERS: 2 | US FAERS | |
| 796 | Post-traumatic neck syndrome | FAERS: 2 | US FAERS | |
| 797 | Proctitis | FAERS: 2 | US FAERS | |
| 798 | Proctocolectomy | FAERS: 2 | US FAERS | |
| 799 | Product availability issue | FAERS: 2 | US FAERS | |
| 800 | Product commingling | FAERS: 2 | US FAERS | |
| 801 | Product counterfeit | FAERS: 2 | US FAERS | |
| 802 | Product formulation issue | FAERS: 2 | US FAERS | |
| 803 | Product prescribing error | FAERS: 2 | US FAERS | |
| 804 | Prolactinoma | FAERS: 2 | US FAERS | |
| 805 | Prostate ablation | FAERS: 2 | US FAERS | |
| 806 | Prostatic dysplasia | FAERS: 2 | US FAERS | |
| 807 | Prostatitis Escherichia coli | FAERS: 2 | US FAERS | |
| 808 | Protein total decreased | FAERS: 2 | US FAERS | |
| 809 | Protein urine present | FAERS: 2 | US FAERS | |
| 810 | Psychological Trauma | FAERS: 2 | US FAERS | |
| 811 | Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 812 | Pyuria | FAERS: 2 | US FAERS | |
| 813 | QRS axis abnormal | FAERS: 2 | US FAERS | |
| 814 | Radical Neck Dissection | FAERS: 2 | US FAERS | |
| 815 | Radiculitis | FAERS: 2 | US FAERS | |
| 816 | Radiotherapy to prostate | FAERS: 2 | US FAERS | |
| 817 | Rash follicular | FAERS: 2 | US FAERS | |
| 818 | Rectal polyp | FAERS: 2 | US FAERS | |
| 819 | Removal of inert matter from skin or subcutaneous tissue | FAERS: 2 | US FAERS | |
| 820 | Renal aneurysm | FAERS: 2 | US FAERS | |
| 821 | Respiratory tract infection viral | FAERS: 2 | US FAERS | |
| 822 | Respiratory tract inflammation | FAERS: 2 | US FAERS | |
| 823 | Retinitis | FAERS: 2 | US FAERS | |
| 824 | Salivary gland pain | FAERS: 2 | US FAERS | |
| 825 | Scab | FAERS: 2 | US FAERS | |
| 826 | Schizoaffective Disorder | FAERS: 2 | US FAERS | |
| 827 | Seasonal Affective Disorder | FAERS: 2 | US FAERS | |
| 828 | Semen volume abnormal | FAERS: 2 | US FAERS | |
| 829 | Semen volume increased | FAERS: 2 | US FAERS | |
| 830 | Sex hormone binding globulin decreased | FAERS: 2 | US FAERS | |
| 831 | Skin neoplasm excision | FAERS: 2 | US FAERS | |
| 832 | Skin reaction | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 833 | Solar lentigo | FAERS: 2 | US FAERS | |
| 834 | Sperm concentration abnormal | FAERS: 2 | US FAERS | |
| 835 | Splinter | FAERS: 2 | US FAERS | |
| 836 | Squamous cell carcinoma of skin | FAERS: 2 | US FAERS | |
| 837 | Steroid therapy | FAERS: 2 | US FAERS | |
| 838 | Supraventricular tachycardia | FAERS: 2 | OFFSIDES US FAERS | |
| 839 | Syphilis | FAERS: 2 | US FAERS | |
| 840 | Tachyphrenia | FAERS: 2 | US FAERS | |
| 841 | Tendon discomfort | FAERS: 2 | US FAERS | |
| 842 | Tenosynovitis | FAERS: 2 | OFFSIDES US FAERS | |
| 843 | Thrombocytosis | FAERS: 2 | US FAERS | |
| 844 | Thymoma malignant recurrent | FAERS: 2 | US FAERS | |
| 845 | Toe operation | FAERS: 2 | US FAERS | |
| 846 | Tooth Loss | FAERS: 2 | US FAERS | |
| 847 | Tympanoplasty | FAERS: 2 | US FAERS | |
| 848 | Upper respiratory tract inflammation | FAERS: 2 | OFFSIDES US FAERS | |
| 849 | Urethral Obstruction | FAERS: 2 | US FAERS | |
| 850 | Venoocclusive disease | FAERS: 2 | US FAERS | |
| 851 | Venous thrombosis limb | FAERS: 2 | US FAERS | |
| 852 | Vertebral foraminal stenosis | FAERS: 2 | US FAERS | |
| 853 | Visual disturbance | FAERS: 2 | OFFSIDES US FAERS | |
| 854 | Vitreous loss | FAERS: 2 | US FAERS | |
| 855 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 856 | organ donor | FAERS: 2 | US FAERS | |
| 857 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 858 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 859 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 860 | Acquired Immunodeficiency Syndrome | FAERS: 1 | US FAERS | |
| 861 | Acquired diaphragmatic eventration | FAERS: 1 | US FAERS | |
| 862 | Acromegaly | FAERS: 1 | US FAERS | |
| 863 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 864 | Acute psychosis | FAERS: 1 | US FAERS | |
| 865 | Agnosia | FAERS: 1 | US FAERS | |
| 866 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 867 | Alcohol problem | FAERS: 1 | US FAERS | |
| 868 | Allergic colitis | FAERS: 1 | US FAERS | |
| 869 | Allergy to animal | FAERS: 1 | US FAERS | |
| 870 | Amylase increased | FAERS: 1 | US FAERS | |
| 871 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 872 | Anal cancer stage II | FAERS: 1 | US FAERS | |
| 873 | Anal discomfort | FAERS: 1 | US FAERS | |
| 874 | Anal spasm | FAERS: 1 | US FAERS | |
| 875 | Aneurysm | FAERS: 1 | US FAERS | |
| 876 | Angiogram abnormal | FAERS: 1 | US FAERS | |
| 877 | Ankylosing spondylitis | FAERS: 1 | US FAERS | |
| 878 | Anorectal operation | FAERS: 1 | US FAERS | |
| 879 | Anorexia | FAERS: 1 | US FAERS | |
| 880 | Antiandrogen therapy | FAERS: 1 | US FAERS | |
| 881 | Aortic Aneurysm | FAERS: 1 | OFFSIDES US FAERS | |
| 882 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 883 | Arthropod sting | FAERS: 1 | US FAERS | |
| 884 | Ascites | FAERS: 1 | US FAERS | |
| 885 | Aspartate aminotransferase decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 886 | Asthenopia | FAERS: 1 | US FAERS | |
| 887 | Ataxia | FAERS: 1 | US FAERS | |
| 888 | Auricular swelling | FAERS: 1 | US FAERS | |
| 889 | Basilar artery thrombosis | FAERS: 1 | US FAERS | |
| 890 | Bedridden | FAERS: 1 | US FAERS | |
| 891 | Biopsy site unspecified abnormal | FAERS: 1 | US FAERS | |
| 892 | Bladder discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 893 | Bladder neck suspension | FAERS: 1 | US FAERS | |
| 894 | Bladder neoplasm surgery | FAERS: 1 | US FAERS | |
| 895 | Bladder trabeculation | FAERS: 1 | US FAERS | |
| 896 | Blepharospasm | FAERS: 1 | US FAERS | |
| 897 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 898 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 899 | Blood blister | FAERS: 1 | US FAERS | |
| 900 | Blood caffeine increased | FAERS: 1 | US FAERS | |
| 901 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 902 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 903 | Blood creatine phosphokinase decreased | FAERS: 1 | US FAERS | |
| 904 | Blood glucose abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 905 | Blood gonadotrophin decreased | FAERS: 1 | US FAERS | |
| 906 | Blood growth hormone decreased | FAERS: 1 | US FAERS | |
| 907 | Blood heavy metal increased | FAERS: 1 | US FAERS | |
| 908 | Blood homocysteine increased | FAERS: 1 | US FAERS | |
| 909 | Blood immunoglobulin E abnormal | FAERS: 1 | US FAERS | |
| 910 | Blood magnesium decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 911 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 912 | Blood testosterone free abnormal | FAERS: 1 | US FAERS | |
| 913 | Blood testosterone free increased | FAERS: 1 | US FAERS | |
| 914 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 915 | Blood triglycerides decreased | FAERS: 1 | US FAERS | |
| 916 | Blood zinc decreased | FAERS: 1 | US FAERS | |
| 917 | Borderline Personality Disorder | FAERS: 1 | US FAERS | |
| 918 | Brachydactyly | FAERS: 1 | US FAERS | |
| 919 | Brain Contusion | FAERS: 1 | US FAERS | |
| 920 | Breast Cyst | FAERS: 1 | US FAERS | |
| 921 | Breast cancer stage II | FAERS: 1 | US FAERS | |
| 922 | Breech Presentation | FAERS: 1 | US FAERS | |
| 923 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 924 | Bunion operation | FAERS: 1 | US FAERS | |
| 925 | Canavan Disease | FAERS: 1 | US FAERS | |
| 926 | Cardiac function test abnormal | FAERS: 1 | US FAERS | |
| 927 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 928 | Cauda Equina Syndrome | FAERS: 1 | US FAERS | |
| 929 | Cholera | FAERS: 1 | US FAERS | |
| 930 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 931 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 932 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 933 | Clumsiness | FAERS: 1 | US FAERS | |
| 934 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 935 | Cortisol decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 936 | Cortisol free urine abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 937 | Cortisol increased | FAERS: 1 | US FAERS | |
| 938 | Cutis Laxa | FAERS: 1 | US FAERS | |
| 939 | Cyclothymic Disorder | FAERS: 1 | US FAERS | |
| 940 | Cystitis glandularis | FAERS: 1 | US FAERS | |
| 941 | Cytolytic hepatitis | FAERS: 1 | OFFSIDES US FAERS | |
| 942 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 943 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 944 | Deja Vu | FAERS: 1 | US FAERS | |
| 945 | Delirium | FAERS: 1 | US FAERS | |
| 946 | Dementia | FAERS: 1 | US FAERS | |
| 947 | Demyelination | FAERS: 1 | US FAERS | |
| 948 | Dermatofibroma removal | FAERS: 1 | US FAERS | |
| 949 | Dermatofibrosarcoma Protuberans | FAERS: 1 | US FAERS | |
| 950 | Dermatophytosis | FAERS: 1 | US FAERS | |
| 951 | Device Failure | FAERS: 1 | US FAERS | |
| 952 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 953 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 954 | Disease recurrence | FAERS: 1 | US FAERS | |
| 955 | Dissociative disorder | FAERS: 1 | US FAERS | |
| 956 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 957 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 958 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 959 | Drug level increased | FAERS: 1 | US FAERS | |
| 960 | Drug resistance | FAERS: 1 | US FAERS | |
| 961 | Drug screen positive | FAERS: 1 | US FAERS | |
| 962 | Dural tear | FAERS: 1 | US FAERS | |
| 963 | Dysgraphia | FAERS: 1 | US FAERS | |
| 964 | Dystonia | FAERS: 1 | US FAERS | |
| 965 | Early retirement | FAERS: 1 | US FAERS | |
| 966 | Elevated mood | FAERS: 1 | US FAERS | |
| 967 | Embolic stroke | FAERS: 1 | US FAERS | |
| 968 | Encephalitis | FAERS: 1 | US FAERS | |
| 969 | Endarterectomy | FAERS: 1 | US FAERS | |
| 970 | Endodontic procedure | FAERS: 1 | OFFSIDES US FAERS | |
| 971 | Endometrial hypertrophy | FAERS: 1 | US FAERS | |
| 972 | Endothelial dysfunction | FAERS: 1 | US FAERS | |
| 973 | Epididymal enlargement | FAERS: 1 | US FAERS | |
| 974 | Epididymal tenderness | FAERS: 1 | US FAERS | |
| 975 | Erosive Duodenitis | FAERS: 1 | US FAERS | |
| 976 | Escherichia infection | FAERS: 1 | US FAERS | |
| 977 | Essential Tremor | FAERS: 1 | US FAERS | |
| 978 | Eustachian tube disorder | FAERS: 1 | US FAERS | |
| 979 | Excessive masturbation | FAERS: 1 | US FAERS | |
| 980 | Expired product administered | FAERS: 1 | US FAERS | |
| 981 | Exploding head syndrome | FAERS: 1 | US FAERS | |
| 982 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 983 | Exposure via blood | FAERS: 1 | US FAERS | |
| 984 | Extra dose administered | FAERS: 1 | US FAERS | |
| 985 | Eye complication associated with device | FAERS: 1 | US FAERS | |
| 986 | Eye laser surgery | FAERS: 1 | US FAERS | |
| 987 | Facial Pain | FAERS: 1 | US FAERS | |
| 988 | Facial lesion excision | FAERS: 1 | US FAERS | |
| 989 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 990 | Finger hypoplasia | FAERS: 1 | US FAERS | |
| 991 | Focal Nodular Hyperplasia | FAERS: 1 | US FAERS | |
| 992 | Food craving | FAERS: 1 | US FAERS | |
| 993 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 994 | Frenulum breve | FAERS: 1 | US FAERS | |
| 995 | Frostbite | FAERS: 1 | US FAERS | |
| 996 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 997 | Gastrectomy | FAERS: 1 | US FAERS | |
| 998 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 999 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 1000 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 1001 | Gastrointestinal candidiasis | FAERS: 1 | US FAERS | |
| 1002 | Gastrointestinal tract adenoma | FAERS: 1 | US FAERS | |
| 1003 | Genital swelling | FAERS: 1 | US FAERS | |
| 1004 | Gestational Diabetes | FAERS: 1 | US FAERS | |
| 1005 | Gingival Hyperplasia | FAERS: 1 | US FAERS | |
| 1006 | Gingival Recession | FAERS: 1 | US FAERS | |
| 1007 | Glycosuria | FAERS: 1 | US FAERS | |
| 1008 | Hair injury | FAERS: 1 | US FAERS | |
| 1009 | Heart Sounds | FAERS: 1 | US FAERS | |
| 1010 | Heat Stroke | FAERS: 1 | US FAERS | |
| 1011 | Hepatitis A | FAERS: 1 | US FAERS | |
| 1012 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 1013 | Homosexuality | FAERS: 1 | US FAERS | |
| 1014 | Hydrocele operation | FAERS: 1 | US FAERS | |
| 1015 | Hypertensive heart disease | FAERS: 1 | US FAERS | |
| 1016 | Hyperventilation | FAERS: 1 | US FAERS | |
| 1017 | Hypoaesthesia of genital male | FAERS: 1 | US FAERS | |
| 1018 | Hypomania | FAERS: 1 | US FAERS | |
| 1019 | Hypothalamic pituitary adrenal axis suppression | FAERS: 1 | US FAERS | |
| 1020 | Hypotonic urinary bladder | FAERS: 1 | US FAERS | |
| 1021 | Hypoventilation | FAERS: 1 | US FAERS | |
| 1022 | Hypoxia | FAERS: 1 | OFFSIDES US FAERS | |
| 1023 | Illiteracy | FAERS: 1 | US FAERS | |
| 1024 | Illness anxiety disorder | FAERS: 1 | US FAERS | |
| 1025 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 1026 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 1027 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 1028 | Incision site complication | FAERS: 1 | US FAERS | |
| 1029 | Incision site pain | FAERS: 1 | US FAERS | |
| 1030 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 1031 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 1032 | Increased viscosity of nasal secretion | FAERS: 1 | US FAERS | |
| 1033 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 1034 | Intraductal papillary breast neoplasm | FAERS: 1 | US FAERS | |
| 1035 | Joint Instability | FAERS: 1 | US FAERS | |
| 1036 | LDL/HDL ratio increased | FAERS: 1 | US FAERS | |
| 1037 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 1038 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 1039 | Laser Therapy | FAERS: 1 | US FAERS | |
| 1040 | Laziness | FAERS: 1 | US FAERS | |
| 1041 | Lens dislocation | FAERS: 1 | US FAERS | |
| 1042 | Life expectancy shortened | FAERS: 1 | US FAERS | |
| 1043 | Ligament pain | FAERS: 1 | US FAERS | |
| 1044 | Light chain disease | FAERS: 1 | US FAERS | |
| 1045 | Limb asymmetry | FAERS: 1 | US FAERS | |
| 1046 | Lipids abnormal | FAERS: 1 | US FAERS | |
| 1047 | Lipodystrophy acquired | FAERS: 1 | US FAERS | |
| 1048 | Loose tooth | FAERS: 1 | OFFSIDES US FAERS | |
| 1049 | Loss of bladder sensation | FAERS: 1 | US FAERS | |
| 1050 | Lumbar spine flattening | FAERS: 1 | US FAERS | |
| 1051 | Lymph nodes scan abnormal | FAERS: 1 | US FAERS | |
| 1052 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 1053 | Lymphocyte transformation test positive | FAERS: 1 | US FAERS | |
| 1054 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 1055 | Lymphoid tissue hyperplasia | FAERS: 1 | US FAERS | |
| 1056 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 1057 | Macular degeneration | FAERS: 1 | US FAERS | |
| 1058 | Magnesium Deficiency | FAERS: 1 | US FAERS | |
| 1059 | Malignant melanoma in situ | FAERS: 1 | US FAERS | |
| 1060 | Malignant transformation | FAERS: 1 | US FAERS | |
| 1061 | Malnutrition | FAERS: 1 | US FAERS | |
| 1062 | Mammary duct ectasia | FAERS: 1 | US FAERS | |
| 1063 | Mass excision | FAERS: 1 | US FAERS | |
| 1064 | Mastication disorder | FAERS: 1 | US FAERS | |
| 1065 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 1066 | Measles | FAERS: 1 | US FAERS | |
| 1067 | Medication residue present | FAERS: 1 | US FAERS | |
| 1068 | Melanosis coli | FAERS: 1 | US FAERS | |
| 1069 | Meningitis | FAERS: 1 | US FAERS | |
| 1070 | Meniscus removal | FAERS: 1 | US FAERS | |
| 1071 | Menorrhagia | FAERS: 1 | US FAERS | |
| 1072 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 1073 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 1074 | Metaplasia | FAERS: 1 | US FAERS | |
| 1075 | Microalbuminuria | FAERS: 1 | US FAERS | |
| 1076 | Microcephaly | FAERS: 1 | US FAERS | |
| 1077 | Microcytosis | FAERS: 1 | US FAERS | |
| 1078 | Murder | FAERS: 1 | US FAERS | |
| 1079 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 1080 | Mycobacterium tuberculosis complex test positive | FAERS: 1 | US FAERS | |
| 1081 | Myofascitis | FAERS: 1 | US FAERS | |
| 1082 | Narcissistic Personality Disorder | FAERS: 1 | US FAERS | |
| 1083 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 1084 | Nephritis | FAERS: 1 | US FAERS | |
| 1085 | Nephroptosis | FAERS: 1 | US FAERS | |
| 1086 | Nerve Root Compression | FAERS: 1 | US FAERS | |
| 1087 | Neutropenia | FAERS: 1 | US FAERS | |
| 1088 | Neutrophil count decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1089 | No adverse reaction | FAERS: 1 | US FAERS | |
| 1090 | Noninfective gingivitis | FAERS: 1 | US FAERS | |
| 1091 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 1092 | Nutritional condition abnormal | FAERS: 1 | US FAERS | |
| 1093 | Nystagmus | FAERS: 1 | US FAERS | |
| 1094 | Obesity surgery | FAERS: 1 | US FAERS | |
| 1095 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 1096 | Open reduction of fracture | FAERS: 1 | US FAERS | |
| 1097 | Ophthalmoplegic Migraine | FAERS: 1 | US FAERS | |
| 1098 | Oral viral infection | FAERS: 1 | US FAERS | |
| 1099 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 1100 | POEMS Syndrome | FAERS: 1 | US FAERS | |
| 1101 | Pancreatic enlargement | FAERS: 1 | US FAERS | |
| 1102 | Papule | FAERS: 1 | US FAERS | |
| 1103 | Parotitis | FAERS: 1 | US FAERS | |
| 1104 | Patient Isolation | FAERS: 1 | US FAERS | |
| 1105 | Pelvic abscess | FAERS: 1 | US FAERS | |
| 1106 | Penile blister | FAERS: 1 | US FAERS | |
| 1107 | Perennial allergy | FAERS: 1 | US FAERS | |
| 1108 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 1109 | Perineal cyst | FAERS: 1 | US FAERS | |
| 1110 | Perineal disorder | FAERS: 1 | US FAERS | |
| 1111 | Periorbital disorder | FAERS: 1 | US FAERS | |
| 1112 | Peripheral nerve lesion | FAERS: 1 | US FAERS | |
| 1113 | Peripheral paralysis | FAERS: 1 | US FAERS | |
| 1114 | Perirectal abscess | FAERS: 1 | US FAERS | |
| 1115 | Persistent depressive disorder | FAERS: 1 | US FAERS | |
| 1116 | Personal relationship issue | FAERS: 1 | US FAERS | |
| 1117 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 1118 | Phlebitis | FAERS: 1 | US FAERS | |
| 1119 | Phonophobia | FAERS: 1 | US FAERS | |
| 1120 | Plastic surgery to the face | FAERS: 1 | US FAERS | |
| 1121 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 1122 | Poikiloderma | FAERS: 1 | US FAERS | |
| 1123 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 1124 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 1125 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 1126 | Post lumbar puncture syndrome | FAERS: 1 | US FAERS | |
| 1127 | Posthitis | FAERS: 1 | US FAERS | |
| 1128 | Postmortem blood drug level abnormal | FAERS: 1 | US FAERS | |
| 1129 | Postoperative ileus | FAERS: 1 | US FAERS | |
| 1130 | Prader-Willi Syndrome | FAERS: 1 | US FAERS | |
| 1131 | Prehypertension | FAERS: 1 | US FAERS | |
| 1132 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 1133 | Procedural vomiting | FAERS: 1 | US FAERS | |
| 1134 | Product complaint | FAERS: 1 | US FAERS | |
| 1135 | Product container issue | FAERS: 1 | US FAERS | |
| 1136 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 1137 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 1138 | Product package associated injury | FAERS: 1 | US FAERS | |
| 1139 | Product packaging counterfeit | FAERS: 1 | US FAERS | |
| 1140 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 1141 | Product preparation error | FAERS: 1 | US FAERS | |
| 1142 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 1143 | Product storage error | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1144 | Product tampering | FAERS: 1 | US FAERS | |
| 1145 | Progesterone increased | FAERS: 1 | US FAERS | |
| 1146 | Prostatic Obstruction | FAERS: 1 | US FAERS | |
| 1147 | Prostatic fibrosis | FAERS: 1 | US FAERS | |
| 1148 | Proteinuria | FAERS: 1 | US FAERS | |
| 1149 | Pudendal nerve terminal motor latency test abnormal | FAERS: 1 | US FAERS | |
| 1150 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 1151 | Pyoderma | FAERS: 1 | US FAERS | |
| 1152 | Radiation injury | FAERS: 1 | US FAERS | |
| 1153 | Radiation skin injury | FAERS: 1 | US FAERS | |
| 1154 | Reaction to azo-dyes | FAERS: 1 | US FAERS | |
| 1155 | Rectal fissure | FAERS: 1 | OFFSIDES US FAERS | |
| 1156 | Rectal spasm | FAERS: 1 | US FAERS | |
| 1157 | Renal Artery Stenosis | FAERS: 1 | US FAERS | |
| 1158 | Renal artery stent placement | FAERS: 1 | US FAERS | |
| 1159 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 1160 | Respiratory distress | FAERS: 1 | US FAERS | |
| 1161 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 1162 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 1163 | Retinal Degeneration | FAERS: 1 | US FAERS | |
| 1164 | Retinal Drusen | FAERS: 1 | US FAERS | |
| 1165 | Retinal vascular thrombosis | FAERS: 1 | US FAERS | |
| 1166 | Rhinalgia | FAERS: 1 | US FAERS | |
| 1167 | Romberg test positive | FAERS: 1 | US FAERS | |
| 1168 | Scan with contrast abnormal | FAERS: 1 | US FAERS | |
| 1169 | Screaming | FAERS: 1 | US FAERS | |
| 1170 | Scrotal erythema | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1171 | Sebaceous adenoma | FAERS: 1 | US FAERS | |
| 1172 | Sebaceous hyperplasia | FAERS: 1 | US FAERS | |
| 1173 | Secondary hypertension | FAERS: 1 | US FAERS | |
| 1174 | Secretion discharge | FAERS: 1 | US FAERS | |
| 1175 | Semen abnormal | FAERS: 1 | US FAERS | |
| 1176 | Seminal vesicular cyst | FAERS: 1 | US FAERS | |
| 1177 | Sex hormone binding globulin increased | FAERS: 1 | US FAERS | |
| 1178 | Simple mastectomy | FAERS: 1 | US FAERS | |
| 1179 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 1180 | Skin Induration | FAERS: 1 | US FAERS | |
| 1181 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 1182 | Small intestinal bacterial overgrowth | FAERS: 1 | US FAERS | |
| 1183 | Soft tissue atrophy | FAERS: 1 | US FAERS | |
| 1184 | Soft tissue mass | FAERS: 1 | US FAERS | |
| 1185 | Soft tissue necrosis | FAERS: 1 | US FAERS | |
| 1186 | Spermatic cord obstruction | FAERS: 1 | US FAERS | |
| 1187 | Spermatozoa progressive motility abnormal | FAERS: 1 | US FAERS | |
| 1188 | Spina Bifida | FAERS: 1 | US FAERS | |
| 1189 | Spinal flattening | FAERS: 1 | US FAERS | |
| 1190 | Splenectomy | FAERS: 1 | OFFSIDES US FAERS | |
| 1191 | Splenosis | FAERS: 1 | US FAERS | |
| 1192 | Suprapubic pain | FAERS: 1 | US FAERS | |
| 1193 | Tension | FAERS: 1 | US FAERS | |
| 1194 | Teratoma | FAERS: 1 | US FAERS | |
| 1195 | Testicular embryonal carcinoma | FAERS: 1 | US FAERS | |
| 1196 | Tetany | FAERS: 1 | US FAERS | |
| 1197 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 1198 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 1199 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 1200 | Thermophobia | FAERS: 1 | US FAERS | |
| 1201 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 1202 | Thymoma | FAERS: 1 | US FAERS | |
| 1203 | Tissue polypeptide antigen increased | FAERS: 1 | US FAERS | |
| 1204 | Tobacco user | FAERS: 1 | US FAERS | |
| 1205 | Toothache | FAERS: 1 | US FAERS | |
| 1206 | Transfusion Reaction | FAERS: 1 | US FAERS | |
| 1207 | Traumatic renal injury | FAERS: 1 | US FAERS | |
| 1208 | Tri-iodothyronine abnormal | FAERS: 1 | US FAERS | |
| 1209 | Tri-iodothyronine free decreased | FAERS: 1 | US FAERS | |
| 1210 | Tri-iodothyronine uptake increased | FAERS: 1 | US FAERS | |
| 1211 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 1212 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 1213 | Ultrasound scan abnormal | FAERS: 1 | US FAERS | |
| 1214 | Unemployment | FAERS: 1 | US FAERS | |
| 1215 | Urethral discharge | FAERS: 1 | US FAERS | |
| 1216 | Urethral perforation | FAERS: 1 | US FAERS | |
| 1217 | Urethral syndrome | FAERS: 1 | US FAERS | |
| 1218 | Urinary straining | FAERS: 1 | US FAERS | |
| 1219 | Urine leukocyte esterase positive | FAERS: 1 | US FAERS | |
| 1220 | Uterine cervix stenosis | FAERS: 1 | US FAERS | |
| 1221 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 1222 | Varicose vein operation | FAERS: 1 | US FAERS | |
| 1223 | Vascular calcification | FAERS: 1 | US FAERS | |
| 1224 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 1225 | Vascular pain | FAERS: 1 | US FAERS | |
| 1226 | Vasospasm | FAERS: 1 | US FAERS | |
| 1227 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 1228 | Very low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 1229 | Victim of sexual abuse | FAERS: 1 | US FAERS | |
| 1230 | Viral acanthoma | FAERS: 1 | US FAERS | |
| 1231 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 1232 | Vitreous haze | FAERS: 1 | US FAERS | |
| 1233 | Wound healing normal | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1234 | Xerophthalmia | FAERS: 1 | US FAERS | |
| 1235 | Zinc deficiency | FAERS: 1 | US FAERS | |
| 1236 | cancer surgery | FAERS: 1 | US FAERS | |
| 1237 | colonoscopy | FAERS: 1 | US FAERS | |
| 1238 | hypertensive nephropathy | FAERS: 1 | US FAERS | |
| 1239 | muscle injury | FAERS: 1 | US FAERS | |
| 1240 | rhinoplasty | FAERS: 1 | US FAERS | |
| 1241 | Abnormal ejaculation | SIDER | ||
| 1242 | Acute Coronary Syndrome | OFFSIDES | ||
| 1243 | Alopecia Areata | Canada Vigilance: 1 | Canada Vigilance | |
| 1244 | Anemia | 10233450 | CTD | |
| 1245 | Apnea | OFFSIDES | ||
| 1246 | Arterial Injury | OFFSIDES | ||
| 1247 | Aura | OFFSIDES | ||
| 1248 | Automatism | OFFSIDES | ||
| 1249 | Belligerence | OFFSIDES | ||
| 1250 | Benign biliary neoplasm | OFFSIDES | ||
| 1251 | Bladder Exstrophy | 15530334 | CTD | |
| 1252 | Bladder spasm | OFFSIDES | ||
| 1253 | Blepharoptosis | OFFSIDES | ||
| 1254 | Blood Glucose | OFFSIDES | ||
| 1255 | Blood cholesterol | OFFSIDES | ||
| 1256 | Blood creatine increased | OFFSIDES | ||
| 1257 | Blood iron abnormal | OFFSIDES | ||
| 1258 | Blood ketone body | OFFSIDES | ||
| 1259 | Blood parathyroid hormone decreased | OFFSIDES | ||
| 1260 | Blood triglycerides | OFFSIDES | ||
| 1261 | Blurred vision | OFFSIDES | ||
| 1262 | Body Temperature | OFFSIDES | ||
| 1263 | Brain Diseases | 20486040 | CTD | |
| 1264 | Catheter site infection | OFFSIDES | ||
| 1265 | Cerebral atrophy | OFFSIDES | ||
| 1266 | Choking sensation | OFFSIDES | ||
| 1267 | Choking | OFFSIDES | ||
| 1268 | Cholangiolitis | OFFSIDES | ||
| 1269 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 1270 | Cirrhosis | OFFSIDES | ||
| 1271 | Cocaine-Related Disorders | 12736327 | CTD | |
| 1272 | Concomitant disease progression | OFFSIDES | ||
| 1273 | Confabulation | OFFSIDES | ||
| 1274 | Contact Dermatitis | OFFSIDES | ||
| 1275 | Delusion of replacement | OFFSIDES | ||
| 1276 | Dental caries | OFFSIDES | ||
| 1277 | Denture wearer | OFFSIDES | ||
| 1278 | Depressive disorder | 17026771 | CTD | |
| 1279 | Device leakage | OFFSIDES | ||
| 1280 | Diabetes | OFFSIDES | ||
| 1281 | Diabetic Retinopathy | OFFSIDES | ||
| 1282 | Disorders of Sex Development | 20049201 | CTD | |
| 1283 | Drowsiness | OFFSIDES | ||
| 1284 | Electromechanical dissociation | OFFSIDES | ||
| 1285 | Fluid overload | OFFSIDES | ||
| 1286 | Genital Diseases, Male | 20049201 | CTD | |
| 1287 | Gynecomastia | 8881946 15151957 | CTD | |
| 1288 | Helicobacter pylori identification test positive | OFFSIDES | ||
| 1289 | Hematuria | 7563345 11992064 | CTD | |
| 1290 | Heparin-induced thrombocytopenia | OFFSIDES | ||
| 1291 | Hiccough | OFFSIDES | ||
| 1292 | Hoarseness | OFFSIDES | ||
| 1293 | Hostility | OFFSIDES | ||
| 1294 | Intention tremor | OFFSIDES | ||
| 1295 | Joint ligament rupture | OFFSIDES | ||
| 1296 | Laboratory test interference | OFFSIDES | ||
| 1297 | Laryngospasm | OFFSIDES | ||
| 1298 | Livedo Reticularis | OFFSIDES | ||
| 1299 | Lower respiratory tract infection viral | OFFSIDES | ||
| 1300 | Mitral Valve Stenosis | OFFSIDES | ||
| 1301 | Nephrotic Syndrome | OFFSIDES | ||
| 1302 | Nervous tension | OFFSIDES | ||
| 1303 | Parkinsonian rest tremor | OFFSIDES | ||
| 1304 | Penile torsion | Canada Vigilance: 1 | Canada Vigilance | |
| 1305 | Pharyngolaryngeal Pain | OFFSIDES | ||
| 1306 | Pneumothorax | OFFSIDES | ||
| 1307 | Product administration error | Canada Vigilance: 1 | Canada Vigilance | |
| 1308 | Product dose omission | Canada Vigilance: 1 | Canada Vigilance | |
| 1309 | Prostate examination abnormal | OFFSIDES | ||
| 1310 | Prostatic Hyperplasia |
7544731
8881946 8911291 9121510 9610579 9644979 11583366 12639651 12670567 15705083 19248599 20486040 21128595 22015851 27687055 27750143 27866977 | CTD | |
| 1311 | Prostatic Neoplasms | CTD | ||
| 1312 | Renal pain | Canada Vigilance: 1 | Canada Vigilance | |
| 1313 | Respiratory Failure | OFFSIDES | ||
| 1314 | Right atrial dilatation | OFFSIDES | ||
| 1315 | Sequestrectomy | OFFSIDES | ||
| 1316 | Soft Tissue Infection | OFFSIDES | ||
| 1317 | Status Epilepticus | 20437568 | CTD | |
| 1318 | Sudden Cardiac Death | OFFSIDES | ||
| 1319 | Sudden death | OFFSIDES | ||
| 1320 | Syringomyelia | OFFSIDES | ||
| 1321 | Tachyphylaxis | Canada Vigilance: 2 | Canada Vigilance | |
| 1322 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 1323 | Tongue biting | OFFSIDES | ||
| 1324 | Tooth Infection | OFFSIDES | ||
| 1325 | Trauma | SIDER | ||
| 1326 | Ventricular hypokinesia | OFFSIDES | ||
| 1327 | Wound Debridement | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.