Aripiprazole
(CEUORZQYGODEFX-UHFFFAOYSA-N)
Structure
- SMILES
- O=C1CCc2c(N1)cc(cc2)OCCCCN1CCN(CC1)c1cccc(c1Cl)Cl
- Type(s)
- Approved; Investigational
- ATC code(s)
- N05AX12
- Molecular Formula:
- C23H27Cl2N3O2
- Molecular Weight:
- 448.385
- Log P:
- 5.0002
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 1
- TPSA:
- 44.81
- CAS Number(s):
- 24-29-3; 129722-12-9
Synonym(s)
1.
Aripiprazole
2.
7-(4-(4-(2,3-dichlorophenyl)-1-piperazinyl)butyloxy)-3,4-dihydro-2(1H)-quinolinone
3.
Abilify
4.
Aripiprazol
5.
OPC 14597
6.
OPC-14597
External Link(s)
| MeSH | D000068180 |
| PubChem Compound | 60795 |
| BindingDB | 50130293 |
| ChEBI | 31236 |
| CHEMBL | CHEMBL1112 |
| DrugBank | DB01238 |
| DrugCentral | 242 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 34 |
| KEGG | cpd:C12564 dr:D01164 |
| Therapeutic Target Database | D0Y2GK D0P8CI D0H3HM |
| ZINC | 1851149 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Obsessive-Compulsive Disorder | FAERS: 1229 | CTD SIDER US FAERS | |
| 2 | Economic problem | FAERS: 1220 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 3 | Anxiety | FAERS: 1149 Canada Vigilance: 15 | Canada Vigilance SIDER US FAERS | |
| 4 | Tardive Dyskinesia | FAERS: 1033 Canada Vigilance: 7 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 5 | Suicide attempt | FAERS: 1009 Canada Vigilance: 12 | Canada Vigilance SIDER US FAERS | |
| 6 | Emotional distress | FAERS: 1007 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 7 | Product use in unapproved indication | FAERS: 989 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 8 | Drug ineffective | FAERS: 937 Canada Vigilance: 58 | Canada Vigilance US FAERS | |
| 9 | Disability | FAERS: 884 | US FAERS | |
| 10 | Compulsive shopping | FAERS: 839 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 11 | Pain | FAERS: 836 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 12 | Akathisia | FAERS: 727 Canada Vigilance: 17 | Canada Vigilance SIDER US FAERS | |
| 13 | Tremor | FAERS: 699 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 14 | Adverse event | FAERS: 624 Canada Vigilance: 11 | Canada Vigilance OFFSIDES US FAERS | |
| 15 | Anhedonia | FAERS: 554 | US FAERS | |
| 16 | Compulsive sexual behaviour | FAERS: 518 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Maternal exposure during pregnancy | FAERS: 498 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 18 | Pregnancy | FAERS: 458 | SIDER US FAERS | |
| 19 | Gambling | FAERS: 448 Canada Vigilance: 5 | 21241242 | CTD Canada Vigilance US FAERS |
| 20 | Wrong technique in drug usage process | FAERS: 426 | US FAERS | |
| 21 | Drug dose omission | FAERS: 420 | US FAERS | |
| 22 | Nausea | FAERS: 411 Canada Vigilance: 11 | 17414231 18835043 21823597 | CTD SIDER Canada Vigilance US FAERS |
| 23 | Fatigue | FAERS: 409 Canada Vigilance: 6 | 17414231 | CTD SIDER Canada Vigilance US FAERS |
| 24 | Wrong technique in product usage process | FAERS: 406 Canada Vigilance: 19 | Canada Vigilance US FAERS | |
| 25 | Somnolence | FAERS: 380 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 26 | Headache | FAERS: 365 Canada Vigilance: 7 | 17414231 18835043 21823597 | CTD SIDER Canada Vigilance US FAERS |
| 27 | Dystonia | FAERS: 364 Canada Vigilance: 9 | CTD OFFSIDES Canada Vigilance US FAERS | |
| 28 | Dizziness | FAERS: 344 Canada Vigilance: 15 | 17414231 | CTD SIDER Canada Vigilance US FAERS |
| 29 | Blood glucose increased | FAERS: 330 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 30 | Malaise | FAERS: 324 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 31 | Vomiting | FAERS: 324 Canada Vigilance: 11 | Canada Vigilance SIDER US FAERS | |
| 32 | Feeling abnormal | FAERS: 318 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 33 | Restlessness | FAERS: 314 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 34 | Agitation | FAERS: 302 Canada Vigilance: 17 | Canada Vigilance SIDER US FAERS | |
| 35 | Bankruptcy | FAERS: 282 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 36 | Sexual Dysfunction | FAERS: 253 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 37 | Compulsive hoarding | FAERS: 225 | US FAERS | |
| 38 | Diabetes Mellitus | FAERS: 202 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 39 | Musculoskeletal stiffness | FAERS: 196 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 40 | Neuroleptic Malignant Syndrome | FAERS: 196 Canada Vigilance: 6 | 17272970 17414689 18981078 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 41 | Theft | FAERS: 196 | US FAERS | |
| 42 | Weight decreased | FAERS: 192 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 43 | Overdose | FAERS: 189 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 44 | No adverse event | FAERS: 181 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 45 | Schizophrenia | FAERS: 172 Canada Vigilance: 2 |
12363115
12860772 16555168 16858173 16891339 16942633 16953381 17335319 17414231 17644313 18166258 18363460 19230981 19302830 19673087 | CTD OFFSIDES Canada Vigilance US FAERS |
| 46 | Shoplifting | FAERS: 167 | US FAERS | |
| 47 | Cerebrovascular accident | FAERS: 160 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 48 | Incorrect dose administered | FAERS: 159 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 49 | Trichotillomania | FAERS: 155 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Completed Suicide | FAERS: 154 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 51 | Asthenia | FAERS: 153 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 52 | Memory impairment | FAERS: 148 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 53 | Mental impairment | FAERS: 147 | US FAERS | |
| 54 | Product use issue | FAERS: 146 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 55 | Alopecia | FAERS: 136 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 56 | Constipation | FAERS: 123 | 18835043 21823597 | CTD SIDER US FAERS |
| 57 | Anger | FAERS: 116 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 58 | Pneumonia | FAERS: 116 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 59 | Drooling | FAERS: 113 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 60 | Palpitations | FAERS: 110 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 61 | Hypersensitivity | FAERS: 109 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 62 | Paranoia | FAERS: 109 | OFFSIDES SIDER US FAERS | |
| 63 | Chest Pain | FAERS: 106 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 64 | Myalgia | FAERS: 106 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 65 | Crying | FAERS: 103 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 66 | Live Birth | FAERS: 103 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 67 | Emotional disorder | FAERS: 102 | US FAERS | |
| 68 | Prescribed underdose | FAERS: 102 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 69 | Medication Error | FAERS: 99 | US FAERS | |
| 70 | Arthralgia | FAERS: 98 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 71 | Prescribed overdose | FAERS: 98 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 72 | Blood creatine phosphokinase increased | FAERS: 95 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 73 | Amnesia | FAERS: 92 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 74 | Dysarthria | FAERS: 92 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 75 | Lethargy | FAERS: 92 | SIDER US FAERS | |
| 76 | Myocardial Infarction | FAERS: 92 | SIDER US FAERS | |
| 77 | Inappropriate schedule of drug administration | FAERS: 91 | US FAERS | |
| 78 | Pulmonary Embolism | FAERS: 91 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 79 | Personal relationship issue | FAERS: 88 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Muscle Rigidity | FAERS: 87 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 81 | Syncope | FAERS: 87 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 82 | Tachycardia | FAERS: 86 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 83 | Pancreatitis | FAERS: 84 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 84 | Visual Impairment | FAERS: 84 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 85 | Drug withdrawal syndrome | FAERS: 81 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 86 | Nervousness | FAERS: 80 | SIDER US FAERS | |
| 87 | Psychiatric decompensation | FAERS: 79 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 88 | Restless Legs Syndrome | FAERS: 79 | SIDER US FAERS | |
| 89 | Depressed mood | FAERS: 77 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 90 | Hypotension | FAERS: 74 | SIDER US FAERS | |
| 91 | Blood cholesterol increased | FAERS: 73 | SIDER US FAERS | |
| 92 | Product substitution issue | FAERS: 70 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 93 | Urinary Incontinence | FAERS: 70 | SIDER US FAERS | |
| 94 | Blood triglycerides increased | FAERS: 69 | OFFSIDES SIDER US FAERS | |
| 95 | Muscle tightness | FAERS: 66 | SIDER US FAERS | |
| 96 | Mood swings | FAERS: 65 | SIDER US FAERS | |
| 97 | Pruritus | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 98 | Psychiatric symptom | FAERS: 64 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 99 | Accidental overdose | FAERS: 63 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 100 | Thrombosis | FAERS: 62 | US FAERS | |
| 101 | Bipolar Disorder | FAERS: 57 | CTD OFFSIDES US FAERS | |
| 102 | Bruxism | FAERS: 56 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 103 | Dehydration | FAERS: 56 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 104 | Drug administered to patient of inappropriate age | FAERS: 56 | US FAERS | |
| 105 | Stress | FAERS: 53 | US FAERS | |
| 106 | Back Pain | FAERS: 52 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 107 | Therapeutic response unexpected | FAERS: 52 | US FAERS | |
| 108 | White blood cell count decreased | FAERS: 52 | SIDER US FAERS | |
| 109 | Feeling jittery | FAERS: 50 | SIDER US FAERS | |
| 110 | Rhabdomyolysis | FAERS: 50 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 111 | Trismus | FAERS: 50 | SIDER US FAERS | |
| 112 | Dementia | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 113 | Product quality issue | FAERS: 49 | US FAERS | |
| 114 | Hypersomnia | FAERS: 48 | SIDER US FAERS | |
| 115 | Vertigo | FAERS: 47 | SIDER US FAERS | |
| 116 | Aphasia | FAERS: 46 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 117 | Drug administration error | FAERS: 46 | US FAERS | |
| 118 | Oculogyric crisis | FAERS: 46 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 119 | Urinary Retention | FAERS: 46 | SIDER US FAERS | |
| 120 | Deep Vein Thrombosis | FAERS: 45 | SIDER US FAERS | |
| 121 | Hyperphagia | FAERS: 45 | US FAERS | |
| 122 | Peripheral swelling | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 123 | Drug dispensing error | FAERS: 44 | US FAERS | |
| 124 | Abdominal Pain | FAERS: 43 | SIDER US FAERS | |
| 125 | Depressed Level of Consciousness | FAERS: 43 | SIDER US FAERS | |
| 126 | Drug prescribing error | FAERS: 43 | US FAERS | |
| 127 | Epistaxis | FAERS: 43 | SIDER US FAERS | |
| 128 | Circumstance or information capable of leading to medication error | FAERS: 42 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 129 | Abdominal discomfort | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 130 | Hypomania | FAERS: 41 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 131 | Hunger | FAERS: 40 | US FAERS | |
| 132 | Intentional self-injury | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 133 | Incontinence | FAERS: 38 | OFFSIDES SIDER US FAERS | |
| 134 | Nasopharyngitis | FAERS: 37 | SIDER US FAERS | |
| 135 | Blepharospasm | FAERS: 36 | SIDER US FAERS | |
| 136 | Dysphonia | FAERS: 36 | SIDER US FAERS | |
| 137 | Disorientation | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 138 | Excoriation | FAERS: 35 | US FAERS | |
| 139 | Therapy cessation | FAERS: 35 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 140 | Urticaria | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 141 | Drug screen false positive | FAERS: 34 | US FAERS | |
| 142 | Alanine Aminotransferase Increased | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 143 | Drug abuse | FAERS: 32 | US FAERS | |
| 144 | Erectile dysfunction | FAERS: 32 | SIDER US FAERS | |
| 145 | Injection site pain | FAERS: 32 | SIDER US FAERS | |
| 146 | Physical disability | FAERS: 32 | US FAERS | |
| 147 | Priapism | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 148 | Atrial Fibrillation | FAERS: 31 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 149 | Disease recurrence | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 150 | Enuresis | FAERS: 31 | 20119596 | CTD SIDER US FAERS |
| 151 | Unevaluable event | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 152 | Neck Pain | FAERS: 30 | SIDER US FAERS | |
| 153 | Apathy | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 154 | Blood prolactin increased | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 155 | Cardiac Arrest | FAERS: 29 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 156 | Drug monitoring procedure incorrectly performed | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 157 | Erythema | FAERS: 29 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 158 | Acute psychosis | FAERS: 28 | OFFSIDES SIDER US FAERS | |
| 159 | Bradycardia | FAERS: 28 | 20215494 | CTD SIDER US FAERS |
| 160 | Catatonia | FAERS: 28 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 161 | Delirium | FAERS: 28 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 162 | Diabetic Ketoacidosis | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 163 | Drug screen positive | FAERS: 28 | OFFSIDES US FAERS | |
| 164 | Dysuria | FAERS: 28 | SIDER US FAERS | |
| 165 | Impaired work ability | FAERS: 28 | US FAERS | |
| 166 | Asthma | FAERS: 27 | SIDER US FAERS | |
| 167 | Drug exposure during pregnancy | FAERS: 27 | US FAERS | |
| 168 | Exposure during breast feeding | FAERS: 27 | US FAERS | |
| 169 | Neutropenia | FAERS: 27 | SIDER US FAERS | |
| 170 | Swelling | FAERS: 27 | SIDER US FAERS | |
| 171 | Chills | FAERS: 26 | SIDER US FAERS | |
| 172 | Influenza | FAERS: 26 | SIDER US FAERS | |
| 173 | Mental status changes | FAERS: 26 | SIDER US FAERS | |
| 174 | Tachyphrenia | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 175 | Accidental exposure | FAERS: 25 | OFFSIDES US FAERS | |
| 176 | Ataxia | FAERS: 25 | SIDER US FAERS | |
| 177 | Chest discomfort | FAERS: 25 | SIDER US FAERS | |
| 178 | Choking | FAERS: 25 | US FAERS | |
| 179 | Dependence | FAERS: 25 | US FAERS | |
| 180 | Drug Dependence | FAERS: 25 | US FAERS | |
| 181 | Epilepsy | FAERS: 25 | SIDER US FAERS | |
| 182 | Joint stiffness | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 183 | Personality Change | FAERS: 25 | US FAERS | |
| 184 | Torticollis | FAERS: 25 | SIDER US FAERS | |
| 185 | Respiratory Failure | FAERS: 24 | SIDER US FAERS | |
| 186 | Sudden death | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 187 | Thirst | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 188 | Activities of daily living impaired | FAERS: 23 | US FAERS | |
| 189 | Cogwheel Rigidity | FAERS: 23 | OFFSIDES SIDER US FAERS | |
| 190 | Flat affect | FAERS: 23 | OFFSIDES SIDER US FAERS | |
| 191 | General physical health deterioration | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 192 | Hypertensive crisis | FAERS: 23 | US FAERS | |
| 193 | Psychotic symptom | FAERS: 23 | US FAERS | |
| 194 | Toxicity to various agents | FAERS: 23 | US FAERS | |
| 195 | Blood glucose abnormal | FAERS: 22 | OFFSIDES US FAERS | |
| 196 | Dysgeusia | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 197 | Dyspepsia | FAERS: 22 | SIDER US FAERS | |
| 198 | Inability to afford medication | FAERS: 22 | US FAERS | |
| 199 | Joint swelling | FAERS: 22 | SIDER US FAERS | |
| 200 | Urinary tract infection | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 201 | Accidental exposure to product by child | FAERS: 21 | US FAERS | |
| 202 | Acne | FAERS: 21 | US FAERS | |
| 203 | Bipolar I disorder | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 204 | Blindness | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 205 | Diplopia | FAERS: 21 | OFFSIDES SIDER US FAERS | |
| 206 | Dysphemia | FAERS: 21 | SIDER US FAERS | |
| 207 | Mydriasis | FAERS: 21 | US FAERS | |
| 208 | Sluggishness | FAERS: 21 | SIDER US FAERS | |
| 209 | Thrombocytopenia | FAERS: 21 | SIDER US FAERS | |
| 210 | jaundice | FAERS: 21 | SIDER US FAERS | |
| 211 | Accidental exposure to product | FAERS: 20 | US FAERS | |
| 212 | Acute kidney injury | FAERS: 20 | US FAERS | |
| 213 | Blood prolactin decreased | FAERS: 20 | OFFSIDES SIDER US FAERS | |
| 214 | Discomfort | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 215 | Glaucoma | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 216 | Homicide | FAERS: 20 | US FAERS | |
| 217 | Infection | FAERS: 20 | SIDER US FAERS | |
| 218 | Loss of personal independence in daily activities | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 219 | Poor quality sleep | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 220 | Abasia | FAERS: 19 | SIDER US FAERS | |
| 221 | Aspartate Aminotransferase Increased | FAERS: 19 | SIDER US FAERS | |
| 222 | Deafness | FAERS: 19 | SIDER US FAERS | |
| 223 | Excessive eye blinking | FAERS: 19 | US FAERS | |
| 224 | Facial paralysis | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 225 | Ileus | FAERS: 19 | US FAERS | |
| 226 | Ketoacidosis | FAERS: 19 | US FAERS | |
| 227 | Musculoskeletal Pain | FAERS: 19 | SIDER US FAERS | |
| 228 | Physical assault | FAERS: 19 | US FAERS | |
| 229 | Breast Feeding | FAERS: 18 | OFFSIDES US FAERS | |
| 230 | Drug effect incomplete | FAERS: 18 | US FAERS | |
| 231 | Food craving | FAERS: 18 | US FAERS | |
| 232 | Gestational Diabetes | FAERS: 18 | OFFSIDES US FAERS | |
| 233 | Laryngitis | FAERS: 18 | SIDER US FAERS | |
| 234 | Pallor | FAERS: 18 | SIDER US FAERS | |
| 235 | Photophobia | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 236 | Altered state of consciousness | FAERS: 17 | SIDER US FAERS | |
| 237 | Anorexia | FAERS: 17 | SIDER US FAERS | |
| 238 | Blood sodium decreased | FAERS: 17 | US FAERS | |
| 239 | Euphoric mood | FAERS: 17 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 240 | Leukopenia | FAERS: 17 | SIDER US FAERS | |
| 241 | Obesity | FAERS: 17 Canada Vigilance: 1 | 18950384 | CTD SIDER Canada Vigilance US FAERS |
| 242 | Therapy non-responder | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 243 | nervous system disorder | FAERS: 17 | SIDER US FAERS | |
| 244 | Alcohol abuse | FAERS: 16 | SIDER US FAERS | |
| 245 | Electrocardiogram abnormal | FAERS: 16 | SIDER US FAERS | |
| 246 | Eye pain | FAERS: 16 | SIDER US FAERS | |
| 247 | Formication | FAERS: 16 | SIDER US FAERS | |
| 248 | Frustration | FAERS: 16 | US FAERS | |
| 249 | Hypothyroidism | FAERS: 16 | SIDER US FAERS | |
| 250 | Inappropriate schedule of product administration | FAERS: 16 Canada Vigilance: 26 | Canada Vigilance US FAERS | |
| 251 | Oropharyngeal pain | FAERS: 16 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 252 | Angina Pectoris | FAERS: 15 | SIDER US FAERS | |
| 253 | Blood glucose decreased | FAERS: 15 | OFFSIDES SIDER US FAERS | |
| 254 | Bradyphrenia | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 255 | Drug level increased | FAERS: 15 | US FAERS | |
| 256 | Polyuria | FAERS: 15 | OFFSIDES SIDER US FAERS | |
| 257 | Post-Traumatic Stress Disorder | FAERS: 15 | US FAERS | |
| 258 | Psychomotor skills impaired | FAERS: 15 | SIDER US FAERS | |
| 259 | Screaming | FAERS: 15 | US FAERS | |
| 260 | Sepsis | FAERS: 15 | US FAERS | |
| 261 | Serotonin Syndrome | FAERS: 15 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 262 | Stupor | FAERS: 15 | SIDER US FAERS | |
| 263 | treatment failure | FAERS: 15 | OFFSIDES US FAERS | |
| 264 | Blood alkaline phosphatase increased | FAERS: 14 | SIDER US FAERS | |
| 265 | Eye inflammation | FAERS: 14 | US FAERS | |
| 266 | Gastric Bypass | FAERS: 14 | OFFSIDES US FAERS | |
| 267 | Impaired quality of life | FAERS: 14 | US FAERS | |
| 268 | Limb discomfort | FAERS: 14 | US FAERS | |
| 269 | Neurodermatitis | FAERS: 14 | SIDER US FAERS | |
| 270 | Schizoaffective Disorder | FAERS: 14 | OFFSIDES SIDER US FAERS | |
| 271 | Suppressed lactation | FAERS: 14 | US FAERS | |
| 272 | Blood potassium increased | FAERS: 13 | SIDER US FAERS | |
| 273 | Blood urine present | FAERS: 13 | SIDER US FAERS | |
| 274 | Bronchitis | FAERS: 13 | US FAERS | |
| 275 | Cartilage injury | FAERS: 13 | US FAERS | |
| 276 | Cataract | FAERS: 13 | SIDER US FAERS | |
| 277 | Cerebral disorder | FAERS: 13 | US FAERS | |
| 278 | Chronic sinusitis | FAERS: 13 | US FAERS | |
| 279 | Exposure via body fluid | FAERS: 13 | US FAERS | |
| 280 | Flatulence | FAERS: 13 | SIDER US FAERS | |
| 281 | Hyperthyroidism | FAERS: 13 | SIDER US FAERS | |
| 282 | Hypophagia | FAERS: 13 | SIDER US FAERS | |
| 283 | Impaired driving ability | FAERS: 13 | US FAERS | |
| 284 | Inflammatory marker increased | FAERS: 13 | US FAERS | |
| 285 | Intestinal Obstruction | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 286 | Iron deficiency | FAERS: 13 | US FAERS | |
| 287 | Lip swelling | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 288 | Night sweats | FAERS: 13 | SIDER US FAERS | |
| 289 | Product physical issue | FAERS: 13 | US FAERS | |
| 290 | Respiratory distress | FAERS: 13 | SIDER US FAERS | |
| 291 | Tension | FAERS: 13 | SIDER US FAERS | |
| 292 | Throat irritation | FAERS: 13 | US FAERS | |
| 293 | Allergic reaction to excipient | FAERS: 12 | US FAERS | |
| 294 | Anaphylactic shock | FAERS: 12 | SIDER US FAERS | |
| 295 | Ankle Fracture | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 296 | Blood creatinine increased | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 297 | Dental caries | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 298 | Dysmorphism | FAERS: 12 | US FAERS | |
| 299 | Embolism | FAERS: 12 | US FAERS | |
| 300 | Gait inability | FAERS: 12 | US FAERS | |
| 301 | Hemiparesis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 302 | Hostility | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 303 | Maternal exposure before pregnancy | FAERS: 12 | US FAERS | |
| 304 | Obsessive thoughts | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 305 | Polydipsia | FAERS: 12 | SIDER US FAERS | |
| 306 | Soliloquy | FAERS: 12 | US FAERS | |
| 307 | Stevens-Johnson Syndrome | FAERS: 12 | US FAERS | |
| 308 | Vocal cord cyst | FAERS: 12 | US FAERS | |
| 309 | Arthritis | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 310 | Arthropathy | FAERS: 11 | SIDER US FAERS | |
| 311 | Breech Presentation | FAERS: 11 | OFFSIDES US FAERS | |
| 312 | Burning sensation | FAERS: 11 | SIDER US FAERS | |
| 313 | Erection increased | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 314 | Flushing | FAERS: 11 | SIDER US FAERS | |
| 315 | Fracture | FAERS: 11 | SIDER US FAERS | |
| 316 | Head discomfort | FAERS: 11 | SIDER US FAERS | |
| 317 | Hepatitis | FAERS: 11 | SIDER US FAERS | |
| 318 | Hypokinesia | FAERS: 11 | SIDER US FAERS | |
| 319 | Incorrect route of drug administration | FAERS: 11 | US FAERS | |
| 320 | Menorrhagia | FAERS: 11 | SIDER US FAERS | |
| 321 | Middle insomnia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 322 | Nuchal Rigidity | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 323 | Pregnancy on contraceptive | FAERS: 11 | US FAERS | |
| 324 | Quality of life decreased | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 325 | Sinus Tachycardia | FAERS: 11 | SIDER US FAERS | |
| 326 | Skin lesion | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 327 | Staring | FAERS: 11 | US FAERS | |
| 328 | Tooth Loss | FAERS: 11 | US FAERS | |
| 329 | Transaminases increased | FAERS: 11 | SIDER US FAERS | |
| 330 | VIIth nerve paralysis | FAERS: 11 | SIDER US FAERS | |
| 331 | Abnormal weight gain | FAERS: 10 | OFFSIDES US FAERS | |
| 332 | Bedridden | FAERS: 10 | US FAERS | |
| 333 | Blood glucose fluctuation | FAERS: 10 | SIDER US FAERS | |
| 334 | Cellulitis | FAERS: 10 | SIDER US FAERS | |
| 335 | Cerebral Infarction | FAERS: 10 | US FAERS | |
| 336 | Dysgraphia | FAERS: 10 | US FAERS | |
| 337 | Gastrostomy | FAERS: 10 | US FAERS | |
| 338 | Heat Stroke | FAERS: 10 | SIDER US FAERS | |
| 339 | Hernia | FAERS: 10 | OFFSIDES US FAERS | |
| 340 | Incorrect drug administration duration | FAERS: 10 | US FAERS | |
| 341 | Intentional drug misuse | FAERS: 10 | US FAERS | |
| 342 | Intentional product misuse | FAERS: 10 | US FAERS | |
| 343 | Myopia | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 344 | Neonatal disorder | FAERS: 10 | US FAERS | |
| 345 | Nephrolithiasis | FAERS: 10 | SIDER US FAERS | |
| 346 | Oral pain | FAERS: 10 | SIDER US FAERS | |
| 347 | Pancytopenia | FAERS: 10 | US FAERS | |
| 348 | Performance status decreased | FAERS: 10 | US FAERS | |
| 349 | Presyncope | FAERS: 10 | SIDER US FAERS | |
| 350 | Product used for unknown indication | FAERS: 10 | US FAERS | |
| 351 | Respiratory arrest | FAERS: 10 | SIDER US FAERS | |
| 352 | Sinus bradycardia | FAERS: 10 | US FAERS | |
| 353 | Sinusitis | FAERS: 10 | SIDER US FAERS | |
| 354 | Stomatitis | FAERS: 10 | SIDER US FAERS | |
| 355 | Tinnitus | FAERS: 10 | SIDER US FAERS | |
| 356 | Tongue movement disturbance | FAERS: 10 | US FAERS | |
| 357 | Unresponsive to stimuli | FAERS: 10 | SIDER US FAERS | |
| 358 | Urine output increased | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 359 | Accidental drug intake by child | FAERS: 9 | OFFSIDES US FAERS | |
| 360 | Agranulocytosis | FAERS: 9 | SIDER US FAERS | |
| 361 | Alice in Wonderland Syndrome | FAERS: 9 | US FAERS | |
| 362 | Anorgasmia | FAERS: 9 | SIDER US FAERS | |
| 363 | Cold sweat | FAERS: 9 | SIDER US FAERS | |
| 364 | Disturbance in sexual arousal | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 365 | Drug administered at inappropriate site | FAERS: 9 | US FAERS | |
| 366 | Emotional poverty | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 367 | Leukocytosis | FAERS: 9 | SIDER US FAERS | |
| 368 | Myositis | FAERS: 9 | US FAERS | |
| 369 | Negative thoughts | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 370 | Overweight | FAERS: 9 | OFFSIDES US FAERS | |
| 371 | Stillbirth | FAERS: 9 | US FAERS | |
| 372 | Syringe issue | FAERS: 9 | US FAERS | |
| 373 | Toxic Epidermal Necrolysis | FAERS: 9 | US FAERS | |
| 374 | Visual disturbance | FAERS: 9 | SIDER US FAERS | |
| 375 | Acute myocardial infarction | FAERS: 8 | US FAERS | |
| 376 | Cholelithiasis | FAERS: 8 | SIDER US FAERS | |
| 377 | Ectopic Pregnancy | FAERS: 8 | US FAERS | |
| 378 | Eczema | FAERS: 8 | SIDER US FAERS | |
| 379 | Feeling Cold | FAERS: 8 | US FAERS | |
| 380 | Fibromyalgia | FAERS: 8 | US FAERS | |
| 381 | Hepatomegaly | FAERS: 8 | SIDER US FAERS | |
| 382 | Hyperpyrexia | FAERS: 8 | US FAERS | |
| 383 | Initial insomnia | FAERS: 8 | US FAERS | |
| 384 | Insurance issue | FAERS: 8 | US FAERS | |
| 385 | Intention tremor | FAERS: 8 | OFFSIDES US FAERS | |
| 386 | Intervertebral Disc Degeneration | FAERS: 8 | US FAERS | |
| 387 | Low density lipoprotein increased | FAERS: 8 | US FAERS | |
| 388 | Monocyte count increased | FAERS: 8 | US FAERS | |
| 389 | Multiple Sclerosis | FAERS: 8 | US FAERS | |
| 390 | Muscle Spasticity | FAERS: 8 | US FAERS | |
| 391 | Needle issue | FAERS: 8 | US FAERS | |
| 392 | No adverse effect | FAERS: 8 | OFFSIDES US FAERS | |
| 393 | Partner stress | FAERS: 8 | US FAERS | |
| 394 | Peritonitis | FAERS: 8 | US FAERS | |
| 395 | Product packaging quantity issue | FAERS: 8 | US FAERS | |
| 396 | Strabismus | FAERS: 8 | US FAERS | |
| 397 | Therapy change | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 398 | Tongue biting | FAERS: 8 | US FAERS | |
| 399 | Ulcer | FAERS: 8 | SIDER US FAERS | |
| 400 | Bone pain | FAERS: 7 | SIDER US FAERS | |
| 401 | Clumsiness | FAERS: 7 | US FAERS | |
| 402 | Cyanosis | FAERS: 7 | SIDER US FAERS | |
| 403 | Diabetes Insipidus | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 404 | Dissociation | FAERS: 7 | US FAERS | |
| 405 | Drug ineffective for unapproved indication | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 406 | Dry skin | FAERS: 7 | SIDER US FAERS | |
| 407 | Dysentery | FAERS: 7 | US FAERS | |
| 408 | Electroencephalogram abnormal | FAERS: 7 | US FAERS | |
| 409 | Expired product administered | FAERS: 7 | US FAERS | |
| 410 | Frustration tolerance decreased | FAERS: 7 | US FAERS | |
| 411 | Gastrointestinal Pain | FAERS: 7 | SIDER US FAERS | |
| 412 | Hepatotoxicity | FAERS: 7 | US FAERS | |
| 413 | Impatience | FAERS: 7 | US FAERS | |
| 414 | Incoherent | FAERS: 7 | US FAERS | |
| 415 | Insulin Resistance | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 416 | Intentional product use issue | FAERS: 7 | US FAERS | |
| 417 | Limb injury | FAERS: 7 | US FAERS | |
| 418 | Morbid thoughts | FAERS: 7 | US FAERS | |
| 419 | Multiple sclerosis relapse | FAERS: 7 | US FAERS | |
| 420 | Myoclonus | FAERS: 7 | SIDER US FAERS | |
| 421 | Neonatal respiratory distress | FAERS: 7 | US FAERS | |
| 422 | Neutrophil count decreased | FAERS: 7 | SIDER US FAERS | |
| 423 | Oculogyration | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 424 | Panic Disorder | FAERS: 7 | 18794657 | CTD SIDER US FAERS |
| 425 | Product dose omission | FAERS: 7 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 426 | Selective eating disorder | FAERS: 7 | US FAERS | |
| 427 | Slow response to stimuli | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 428 | Substance Dependence | FAERS: 7 | US FAERS | |
| 429 | Sudden onset of sleep | FAERS: 7 | US FAERS | |
| 430 | Temperature regulation disorder | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 431 | Therapeutic response changed | FAERS: 7 | US FAERS | |
| 432 | Tobacco user | FAERS: 7 | US FAERS | |
| 433 | Toothache | FAERS: 7 | SIDER US FAERS | |
| 434 | Ventricular Fibrillation | FAERS: 7 | US FAERS | |
| 435 | skin abrasion | FAERS: 7 | US FAERS | |
| 436 | Acute Coronary Syndrome | FAERS: 6 | SIDER US FAERS | |
| 437 | Ageusia | FAERS: 6 | US FAERS | |
| 438 | Bradykinesia | FAERS: 6 | SIDER US FAERS | |
| 439 | Bulimia Nervosa | FAERS: 6 | US FAERS | |
| 440 | Cardiomegaly | FAERS: 6 | SIDER US FAERS | |
| 441 | Chromaturia | FAERS: 6 | SIDER US FAERS | |
| 442 | Congenital laryngeal stridor | FAERS: 6 | US FAERS | |
| 443 | Diabetes mellitus inadequate control | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 444 | Dysphasia | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 445 | Educational problem | FAERS: 6 | US FAERS | |
| 446 | Exposure via father | FAERS: 6 | US FAERS | |
| 447 | Eye irritation | FAERS: 6 | SIDER US FAERS | |
| 448 | Eyelid Function Disorder | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 449 | Hemiplegia | FAERS: 6 | US FAERS | |
| 450 | Hypoxia | FAERS: 6 | US FAERS | |
| 451 | Inflammation | FAERS: 6 | SIDER US FAERS | |
| 452 | Injection site mass | FAERS: 6 | US FAERS | |
| 453 | Left Ventricular Hypertrophy | FAERS: 6 | US FAERS | |
| 454 | Low birth weight baby | FAERS: 6 | US FAERS | |
| 455 | Musculoskeletal discomfort | FAERS: 6 | SIDER US FAERS | |
| 456 | Oligohydramnios | FAERS: 6 | US FAERS | |
| 457 | Oropharyngeal spasm | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 458 | Paradoxical drug reaction | FAERS: 6 | US FAERS | |
| 459 | Parkinsonian rest tremor | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 460 | Psoriasis | FAERS: 6 | SIDER US FAERS | |
| 461 | Pulmonary Hypertension | FAERS: 6 | US FAERS | |
| 462 | Retching | FAERS: 6 | SIDER US FAERS | |
| 463 | Sopor | FAERS: 6 | US FAERS | |
| 464 | Splenic vein thrombosis | FAERS: 6 | US FAERS | |
| 465 | Status Epilepticus | FAERS: 6 | US FAERS | |
| 466 | Temperature intolerance | FAERS: 6 | US FAERS | |
| 467 | Violence-related symptom | FAERS: 6 | US FAERS | |
| 468 | Wolff-Parkinson-White Syndrome | FAERS: 6 | US FAERS | |
| 469 | Acute myopia | FAERS: 5 | US FAERS | |
| 470 | Alcohol poisoning | FAERS: 5 | SIDER US FAERS | |
| 471 | Angioedema | FAERS: 5 | SIDER US FAERS | |
| 472 | Appendicitis | FAERS: 5 | SIDER US FAERS | |
| 473 | Asthenopia | FAERS: 5 | US FAERS | |
| 474 | Blood potassium decreased | FAERS: 5 | SIDER US FAERS | |
| 475 | Blood urea increased | FAERS: 5 | SIDER US FAERS | |
| 476 | Blunted affect | FAERS: 5 | SIDER US FAERS | |
| 477 | Bone atrophy | FAERS: 5 | US FAERS | |
| 478 | Cardiac Flutter | FAERS: 5 | US FAERS | |
| 479 | Cytolytic hepatitis | FAERS: 5 | US FAERS | |
| 480 | Drug abuser | FAERS: 5 | US FAERS | |
| 481 | Drug exposure via breast milk | FAERS: 5 | US FAERS | |
| 482 | Ejection Fraction Decreased | FAERS: 5 | US FAERS | |
| 483 | Electrocardiogram change | FAERS: 5 | US FAERS | |
| 484 | Erysipelas | FAERS: 5 | US FAERS | |
| 485 | Head titubation | FAERS: 5 | US FAERS | |
| 486 | Hip surgery | FAERS: 5 | US FAERS | |
| 487 | Hydronephrosis | FAERS: 5 | US FAERS | |
| 488 | Infertility | FAERS: 5 | US FAERS | |
| 489 | Injection site erythema | FAERS: 5 | SIDER US FAERS | |
| 490 | Irritable Bowel Syndrome | FAERS: 5 | SIDER US FAERS | |
| 491 | Ketosis | FAERS: 5 | US FAERS | |
| 492 | Laceration | FAERS: 5 | SIDER US FAERS | |
| 493 | Lung consolidation | FAERS: 5 | US FAERS | |
| 494 | Lymphadenopathy | FAERS: 5 | SIDER US FAERS | |
| 495 | Macular degeneration | FAERS: 5 | US FAERS | |
| 496 | Mastication disorder | FAERS: 5 | SIDER US FAERS | |
| 497 | Muscle strain | FAERS: 5 | SIDER US FAERS | |
| 498 | Myasthenia Gravis | FAERS: 5 | OFFSIDES US FAERS | |
| 499 | Oromandibular dystonia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 500 | Pericarditis | FAERS: 5 | OFFSIDES US FAERS | |
| 501 | Periodontitis | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 502 | Pre-Eclampsia | FAERS: 5 | US FAERS | |
| 503 | Pregnancy test positive | FAERS: 5 | US FAERS | |
| 504 | Respiratory Depression | FAERS: 5 | US FAERS | |
| 505 | Retinal Detachment | FAERS: 5 | US FAERS | |
| 506 | Retinal Vein Occlusion | FAERS: 5 | US FAERS | |
| 507 | Rheumatoid Arthritis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 508 | Septic Shock | FAERS: 5 | SIDER US FAERS | |
| 509 | Skin Ulcer | FAERS: 5 | SIDER US FAERS | |
| 510 | Skin reaction | FAERS: 5 | US FAERS | |
| 511 | Sudden Cardiac Death | FAERS: 5 | OFFSIDES US FAERS | |
| 512 | Thrombophlebitis | FAERS: 5 | SIDER US FAERS | |
| 513 | Walking aid user | FAERS: 5 | US FAERS | |
| 514 | Abortion early | FAERS: 4 | OFFSIDES US FAERS | |
| 515 | Akinesia | FAERS: 4 | SIDER US FAERS | |
| 516 | Ammonia increased | FAERS: 4 | US FAERS | |
| 517 | Angle Closure Glaucoma | FAERS: 4 | US FAERS | |
| 518 | Anhidrosis | FAERS: 4 | US FAERS | |
| 519 | Antiphospholipid Syndrome | FAERS: 4 | US FAERS | |
| 520 | Anuria | FAERS: 4 | US FAERS | |
| 521 | Aphonia | FAERS: 4 | OFFSIDES US FAERS | |
| 522 | Atrioventricular Block | FAERS: 4 | SIDER US FAERS | |
| 523 | Azoospermia | FAERS: 4 | US FAERS | |
| 524 | Back disorder | FAERS: 4 | US FAERS | |
| 525 | Behavioral addiction | FAERS: 4 | US FAERS | |
| 526 | Blood testosterone decreased | FAERS: 4 | US FAERS | |
| 527 | Blood testosterone increased | FAERS: 4 | US FAERS | |
| 528 | Blood thyroid stimulating hormone increased | FAERS: 4 | US FAERS | |
| 529 | Blood triglycerides abnormal | FAERS: 4 | US FAERS | |
| 530 | Brain Death | FAERS: 4 | US FAERS | |
| 531 | Breast tenderness | FAERS: 4 | SIDER US FAERS | |
| 532 | Cachexia | FAERS: 4 | US FAERS | |
| 533 | Carbon dioxide decreased | FAERS: 4 | US FAERS | |
| 534 | Carpal Tunnel Syndrome | FAERS: 4 | SIDER US FAERS | |
| 535 | Central nervous system lesion | FAERS: 4 | US FAERS | |
| 536 | Cholestasis | FAERS: 4 | US FAERS | |
| 537 | Consciousness fluctuating | FAERS: 4 | US FAERS | |
| 538 | Coronary Artery Disease | FAERS: 4 | US FAERS | |
| 539 | Cyst | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 540 | Delayed Puberty | FAERS: 4 | US FAERS | |
| 541 | Dependent Personality Disorder | FAERS: 4 | US FAERS | |
| 542 | Device leakage | FAERS: 4 | US FAERS | |
| 543 | Diplegia | FAERS: 4 | US FAERS | |
| 544 | Disseminated Intravascular Coagulation | FAERS: 4 | US FAERS | |
| 545 | Drug resistance | FAERS: 4 | US FAERS | |
| 546 | Electrocardiogram repolarisation abnormality | FAERS: 4 | US FAERS | |
| 547 | Endometriosis | FAERS: 4 | US FAERS | |
| 548 | Erythema Multiforme | FAERS: 4 | US FAERS | |
| 549 | Forceps delivery | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 550 | Gastritis | FAERS: 4 | SIDER US FAERS | |
| 551 | Hallucinations, mixed | FAERS: 4 | US FAERS | |
| 552 | Hepatitis B | FAERS: 4 | US FAERS | |
| 553 | Hormone level abnormal | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 554 | Hyperkinesia | FAERS: 4 | SIDER US FAERS | |
| 555 | Hyporeflexia | FAERS: 4 | SIDER US FAERS | |
| 556 | Impaired gastric emptying | FAERS: 4 | US FAERS | |
| 557 | Impaired self-care | FAERS: 4 | OFFSIDES US FAERS | |
| 558 | Inappropriate affect | FAERS: 4 | US FAERS | |
| 559 | Infectious Mononucleosis | FAERS: 4 | US FAERS | |
| 560 | Joint Range of Motion Decreased | FAERS: 4 | SIDER US FAERS | |
| 561 | Laziness | FAERS: 4 | US FAERS | |
| 562 | Lower respiratory tract infection | FAERS: 4 | SIDER US FAERS | |
| 563 | Maternal exposure timing unspecified | FAERS: 4 | US FAERS | |
| 564 | Metabolic alkalosis | FAERS: 4 | US FAERS | |
| 565 | Micrographia | FAERS: 4 | US FAERS | |
| 566 | Monoplegia | FAERS: 4 | US FAERS | |
| 567 | Muscle tone disorder | FAERS: 4 | US FAERS | |
| 568 | Neonatal respiratory failure | FAERS: 4 | OFFSIDES US FAERS | |
| 569 | Neuralgia | FAERS: 4 | SIDER US FAERS | |
| 570 | Pancreatic Cyst | FAERS: 4 | US FAERS | |
| 571 | Pancreatic carcinoma | FAERS: 4 | US FAERS | |
| 572 | Pericardial effusion | FAERS: 4 | US FAERS | |
| 573 | Poisoning | FAERS: 4 | US FAERS | |
| 574 | Precocious Puberty | FAERS: 4 | US FAERS | |
| 575 | Product counterfeit | FAERS: 4 | US FAERS | |
| 576 | Product taste abnormal | FAERS: 4 | US FAERS | |
| 577 | Psychological Trauma | FAERS: 4 | US FAERS | |
| 578 | Pulmonary thrombosis | FAERS: 4 | US FAERS | |
| 579 | Pyelonephritis | FAERS: 4 | SIDER US FAERS | |
| 580 | Renal pain | FAERS: 4 | US FAERS | |
| 581 | Retinitis Pigmentosa | FAERS: 4 | US FAERS | |
| 582 | Seizure like phenomena | FAERS: 4 | US FAERS | |
| 583 | Semen viscosity abnormal | FAERS: 4 | US FAERS | |
| 584 | Sexual abuse | FAERS: 4 | US FAERS | |
| 585 | Shock | FAERS: 4 | SIDER US FAERS | |
| 586 | Slow speech | FAERS: 4 | US FAERS | |
| 587 | Snoring | FAERS: 4 | US FAERS | |
| 588 | Supraventricular tachycardia | FAERS: 4 | SIDER US FAERS | |
| 589 | Synostosis | FAERS: 4 | OFFSIDES US FAERS | |
| 590 | Testicular necrosis | FAERS: 4 | US FAERS | |
| 591 | Thirst decreased | FAERS: 4 | US FAERS | |
| 592 | Tongue blistering | FAERS: 4 | OFFSIDES US FAERS | |
| 593 | Tonsillitis | FAERS: 4 | US FAERS | |
| 594 | Trisomy 21 | FAERS: 4 | US FAERS | |
| 595 | Troponin increased | FAERS: 4 | US FAERS | |
| 596 | Tuberculosis | FAERS: 4 | US FAERS | |
| 597 | Urinary hesitation | FAERS: 4 | SIDER US FAERS | |
| 598 | Venous Thrombosis | FAERS: 4 | US FAERS | |
| 599 | Water Intoxication | FAERS: 4 | OFFSIDES US FAERS | |
| 600 | Wheezing | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 601 | Yawning | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 602 | Acute sinusitis | FAERS: 3 | US FAERS | |
| 603 | Adams-Stokes Syndrome | FAERS: 3 | US FAERS | |
| 604 | Agoraphobia | FAERS: 3 | SIDER US FAERS | |
| 605 | Alopecia Areata | FAERS: 3 | US FAERS | |
| 606 | Amphetamines positive | FAERS: 3 | US FAERS | |
| 607 | Antidepressant drug level increased | FAERS: 3 | US FAERS | |
| 608 | Asphyxia | FAERS: 3 | SIDER US FAERS | |
| 609 | Bladder spasm | FAERS: 3 | US FAERS | |
| 610 | Blood pressure fluctuation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 611 | Blood sodium increased | FAERS: 3 | US FAERS | |
| 612 | Bone density abnormal | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 613 | Bowel movement irregularity | FAERS: 3 | US FAERS | |
| 614 | Branchiogenic syndrome | FAERS: 3 | US FAERS | |
| 615 | CYP2D6 polymorphism | FAERS: 3 | US FAERS | |
| 616 | Cheilitis | FAERS: 3 | SIDER US FAERS | |
| 617 | Cholecystitis | FAERS: 3 | SIDER US FAERS | |
| 618 | Colitis | FAERS: 3 | SIDER US FAERS | |
| 619 | Congenital pulmonary hypertension | FAERS: 3 | US FAERS | |
| 620 | Dermatitis | FAERS: 3 | SIDER US FAERS | |
| 621 | Diabetic Retinopathy | FAERS: 3 | OFFSIDES US FAERS | |
| 622 | Dissociative disorder | FAERS: 3 | US FAERS | |
| 623 | Drowning | FAERS: 3 | OFFSIDES US FAERS | |
| 624 | Drug level below therapeutic | FAERS: 3 | US FAERS | |
| 625 | Drug monitoring procedure not performed | FAERS: 3 | US FAERS | |
| 626 | Drug toxicity | FAERS: 3 | US FAERS | |
| 627 | Dyslalia | FAERS: 3 | US FAERS | |
| 628 | Encephalitis | FAERS: 3 | US FAERS | |
| 629 | Enterococcal infection | FAERS: 3 | US FAERS | |
| 630 | Eructation | FAERS: 3 | SIDER US FAERS | |
| 631 | Excessive masturbation | FAERS: 3 | US FAERS | |
| 632 | Excitability | FAERS: 3 | SIDER US FAERS | |
| 633 | Exhibitionism | FAERS: 3 | OFFSIDES US FAERS | |
| 634 | Exposure via breast milk | FAERS: 3 | US FAERS | |
| 635 | Facial Paresis | FAERS: 3 | US FAERS | |
| 636 | Factor V Leiden mutation | FAERS: 3 | US FAERS | |
| 637 | False positive investigation result | FAERS: 3 | US FAERS | |
| 638 | Fibrin D dimer increased | FAERS: 3 | US FAERS | |
| 639 | Flight of ideas | FAERS: 3 | US FAERS | |
| 640 | Full blood count decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 641 | Fumbling | FAERS: 3 | US FAERS | |
| 642 | Gastroenteritis | FAERS: 3 | SIDER US FAERS | |
| 643 | Gastrointestinal sounds abnormal | FAERS: 3 | US FAERS | |
| 644 | Gaze palsy | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 645 | Glossitis | FAERS: 3 | SIDER US FAERS | |
| 646 | Granulomatous dermatitis | FAERS: 3 | US FAERS | |
| 647 | Hysterectomy | FAERS: 3 | OFFSIDES US FAERS | |
| 648 | Immune thrombocytopenic purpura | FAERS: 3 | US FAERS | |
| 649 | Incorrect product storage | FAERS: 3 | US FAERS | |
| 650 | Injection Site Reaction | FAERS: 3 | SIDER US FAERS | |
| 651 | Injection site discomfort | FAERS: 3 | SIDER US FAERS | |
| 652 | Injection site extravasation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 653 | Injection site irritation | FAERS: 3 | US FAERS | |
| 654 | Injection site nodule | FAERS: 3 | US FAERS | |
| 655 | Injection site ulcer | FAERS: 3 | US FAERS | |
| 656 | Joint injury | FAERS: 3 | US FAERS | |
| 657 | Kleptomania | FAERS: 3 | US FAERS | |
| 658 | Libido disorder | FAERS: 3 | US FAERS | |
| 659 | Lipase increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 660 | Male sexual dysfunction | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 661 | Mallory-Weiss Syndrome | FAERS: 3 | US FAERS | |
| 662 | Mastitis | FAERS: 3 | US FAERS | |
| 663 | Meningitis | FAERS: 3 | US FAERS | |
| 664 | Muscle Fatigue | FAERS: 3 | OFFSIDES US FAERS | |
| 665 | Necrosis | FAERS: 3 | US FAERS | |
| 666 | Neonatal aspiration | FAERS: 3 | US FAERS | |
| 667 | Nephrotic Syndrome | FAERS: 3 | US FAERS | |
| 668 | Noonan Syndrome | FAERS: 3 | US FAERS | |
| 669 | Nystagmus | FAERS: 3 | US FAERS | |
| 670 | Obesity surgery | FAERS: 3 | US FAERS | |
| 671 | Ocular discomfort | FAERS: 3 | US FAERS | |
| 672 | Onychoclasis | FAERS: 3 | US FAERS | |
| 673 | Oral candidiasis | FAERS: 3 | SIDER US FAERS | |
| 674 | Osteomyelitis | FAERS: 3 | US FAERS | |
| 675 | Paternal exposure timing unspecified | FAERS: 3 | US FAERS | |
| 676 | Peripheral arterial occlusive disease | FAERS: 3 | US FAERS | |
| 677 | Platelet aggregation decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 678 | Poor quality drug administered | FAERS: 3 | US FAERS | |
| 679 | Poriomania | FAERS: 3 | US FAERS | |
| 680 | Postural Orthostatic Tachycardia Syndrome | FAERS: 3 | OFFSIDES US FAERS | |
| 681 | Product administered to patient of inappropriate age | FAERS: 3 | US FAERS | |
| 682 | Product communication issue | FAERS: 3 | US FAERS | |
| 683 | Product difficult to swallow | FAERS: 3 | US FAERS | |
| 684 | Product label issue | FAERS: 3 | US FAERS | |
| 685 | Product packaging issue | FAERS: 3 | US FAERS | |
| 686 | Psychiatric evaluation | FAERS: 3 | US FAERS | |
| 687 | Purpura | FAERS: 3 | SIDER US FAERS | |
| 688 | Pyelocaliectasis | FAERS: 3 | US FAERS | |
| 689 | Rebound psychosis | FAERS: 3 | US FAERS | |
| 690 | Retinal Degeneration | FAERS: 3 | US FAERS | |
| 691 | Retrograde ejaculation | FAERS: 3 | US FAERS | |
| 692 | Rhinitis | FAERS: 3 | SIDER US FAERS | |
| 693 | Shoulder Dystocia | FAERS: 3 | US FAERS | |
| 694 | Sinus headache | FAERS: 3 | SIDER US FAERS | |
| 695 | Splenomegaly | FAERS: 3 | US FAERS | |
| 696 | Suicide threat | FAERS: 3 | US FAERS | |
| 697 | Tension Headache | FAERS: 3 | US FAERS | |
| 698 | Tetany | FAERS: 3 | US FAERS | |
| 699 | Thyroglobulin increased | FAERS: 3 | OFFSIDES US FAERS | |
| 700 | Tracheobronchitis | FAERS: 3 | US FAERS | |
| 701 | Uterine contractions during pregnancy | FAERS: 3 | OFFSIDES US FAERS | |
| 702 | Uterine dilation and evacuation | FAERS: 3 | US FAERS | |
| 703 | Vasculitis | FAERS: 3 | US FAERS | |
| 704 | Victim of homicide | FAERS: 3 | US FAERS | |
| 705 | Vocal Cord Paralysis | FAERS: 3 | US FAERS | |
| 706 | Wrong drug administered | FAERS: 3 | US FAERS | |
| 707 | furuncle | FAERS: 3 | OFFSIDES US FAERS | |
| 708 | Abscess | FAERS: 2 | US FAERS | |
| 709 | Accidental underdose | FAERS: 2 | US FAERS | |
| 710 | Acoustic Neuroma | FAERS: 2 | US FAERS | |
| 711 | Acquired Immunodeficiency Syndrome | FAERS: 2 | US FAERS | |
| 712 | Agitated depression | FAERS: 2 | US FAERS | |
| 713 | Altered visual depth perception | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 714 | Amputation | FAERS: 2 | US FAERS | |
| 715 | Anorexia Nervosa | FAERS: 2 | US FAERS | |
| 716 | Anosognosia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 717 | Aphagia | FAERS: 2 | US FAERS | |
| 718 | Apparent death | FAERS: 2 | US FAERS | |
| 719 | Ascites | FAERS: 2 | US FAERS | |
| 720 | Autistic Disorder | FAERS: 2 | 17069544 | CTD US FAERS |
| 721 | Autonomic failure syndrome | FAERS: 2 | US FAERS | |
| 722 | Bacterial sepsis | FAERS: 2 | US FAERS | |
| 723 | Biliary Colic | FAERS: 2 | US FAERS | |
| 724 | Blighted ovum | FAERS: 2 | US FAERS | |
| 725 | Blood blister | FAERS: 2 | US FAERS | |
| 726 | Blood chloride decreased | FAERS: 2 | US FAERS | |
| 727 | Blood chloride increased | FAERS: 2 | US FAERS | |
| 728 | Blood count abnormal | FAERS: 2 | US FAERS | |
| 729 | Blood creatine increased | FAERS: 2 | US FAERS | |
| 730 | Blood creatine phosphokinase | FAERS: 2 | US FAERS | |
| 731 | Blood insulin abnormal | FAERS: 2 | US FAERS | |
| 732 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 733 | Blood parathyroid hormone decreased | FAERS: 2 | US FAERS | |
| 734 | Blood pressure inadequately controlled | FAERS: 2 | US FAERS | |
| 735 | Body temperature fluctuation | FAERS: 2 | US FAERS | |
| 736 | Bone density decreased | FAERS: 2 | US FAERS | |
| 737 | Boredom | FAERS: 2 | US FAERS | |
| 738 | Brain Hypoxia | FAERS: 2 | US FAERS | |
| 739 | Breast engorgement | FAERS: 2 | US FAERS | |
| 740 | Central Nervous System Infection | FAERS: 2 | US FAERS | |
| 741 | Cerebral Palsy | FAERS: 2 | OFFSIDES US FAERS | |
| 742 | Cerebral ventricle dilatation | FAERS: 2 | US FAERS | |
| 743 | Cervix carcinoma | FAERS: 2 | US FAERS | |
| 744 | Chemical injury | FAERS: 2 | US FAERS | |
| 745 | Choking sensation | FAERS: 2 | US FAERS | |
| 746 | Cholecystitis infective | FAERS: 2 | US FAERS | |
| 747 | Choreoathetosis | FAERS: 2 | SIDER US FAERS | |
| 748 | Claustrophobia | FAERS: 2 | US FAERS | |
| 749 | Clostridium test positive | FAERS: 2 | US FAERS | |
| 750 | Cognitive deterioration | FAERS: 2 | SIDER US FAERS | |
| 751 | Colectomy | FAERS: 2 | US FAERS | |
| 752 | Congenital cystic kidney disease | FAERS: 2 | US FAERS | |
| 753 | Congenital diaphragmatic hernia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 754 | Conjunctivitis | FAERS: 2 | SIDER US FAERS | |
| 755 | Counterfeit drug administered | FAERS: 2 | US FAERS | |
| 756 | Cystitis | FAERS: 2 | SIDER US FAERS | |
| 757 | Dark circles under eyes | FAERS: 2 | US FAERS | |
| 758 | Deafness Neurosensory | FAERS: 2 | US FAERS | |
| 759 | Deformity | FAERS: 2 | US FAERS | |
| 760 | Dehydroepiandrosterone increased | FAERS: 2 | US FAERS | |
| 761 | Deja Vu | FAERS: 2 | OFFSIDES US FAERS | |
| 762 | Delusional disorder, unspecified type | FAERS: 2 | OFFSIDES US FAERS | |
| 763 | Demyelination | FAERS: 2 | US FAERS | |
| 764 | Device malfunction | FAERS: 2 | US FAERS | |
| 765 | Device use error | FAERS: 2 | US FAERS | |
| 766 | Diabetic Nephropathy | FAERS: 2 | OFFSIDES US FAERS | |
| 767 | Diastolic hypertension | FAERS: 2 | US FAERS | |
| 768 | Diet refusal | FAERS: 2 | SIDER US FAERS | |
| 769 | Disease Progression | FAERS: 2 | US FAERS | |
| 770 | Diverticulitis | FAERS: 2 | US FAERS | |
| 771 | Drug Tolerance | FAERS: 2 | US FAERS | |
| 772 | Drug dose titration not performed | FAERS: 2 | US FAERS | |
| 773 | Drug level decreased | FAERS: 2 | US FAERS | |
| 774 | Duodenal Ulcer | FAERS: 2 | SIDER US FAERS | |
| 775 | Ear discomfort | FAERS: 2 | US FAERS | |
| 776 | Electrocardiogram QT interval abnormal | FAERS: 2 | US FAERS | |
| 777 | Empyema | FAERS: 2 | US FAERS | |
| 778 | Endometrial thickening | FAERS: 2 | US FAERS | |
| 779 | Enlarged uvula | FAERS: 2 | US FAERS | |
| 780 | Enteritis | FAERS: 2 | US FAERS | |
| 781 | Epidermolysis | FAERS: 2 | US FAERS | |
| 782 | Excessive sexual fantasies | FAERS: 2 | US FAERS | |
| 783 | Exposure via partner | FAERS: 2 | US FAERS | |
| 784 | Failure to Thrive | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 785 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 786 | Fluid overload | FAERS: 2 | US FAERS | |
| 787 | Foaming at mouth | FAERS: 2 | US FAERS | |
| 788 | Focal Nodular Hyperplasia | FAERS: 2 | US FAERS | |
| 789 | Foreign body aspiration | FAERS: 2 | US FAERS | |
| 790 | Fuchs' syndrome | FAERS: 2 | US FAERS | |
| 791 | Fulminant type 1 diabetes mellitus | FAERS: 2 | US FAERS | |
| 792 | Gamma-Glutamyltransferase Increased | FAERS: 2 | SIDER US FAERS | |
| 793 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 794 | Gastrointestinal stoma complication | FAERS: 2 | US FAERS | |
| 795 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 796 | Growth retardation | FAERS: 2 | US FAERS | |
| 797 | Hearing aid therapy | FAERS: 2 | US FAERS | |
| 798 | Hearing disability | FAERS: 2 | US FAERS | |
| 799 | Hepatitis C | FAERS: 2 | US FAERS | |
| 800 | High density lipoprotein abnormal | FAERS: 2 | US FAERS | |
| 801 | High density lipoprotein increased | FAERS: 2 | US FAERS | |
| 802 | Hydrocephalus | FAERS: 2 | US FAERS | |
| 803 | Hyperacusis | FAERS: 2 | SIDER US FAERS | |
| 804 | Hypogonadism | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 805 | Illness anxiety disorder | FAERS: 2 | US FAERS | |
| 806 | Illogical thinking | FAERS: 2 | US FAERS | |
| 807 | Immobile | FAERS: 2 | US FAERS | |
| 808 | Incorrect storage of drug | FAERS: 2 | US FAERS | |
| 809 | Induration | FAERS: 2 | SIDER US FAERS | |
| 810 | Infantile apnoeic attack | FAERS: 2 | US FAERS | |
| 811 | Infarction | FAERS: 2 | US FAERS | |
| 812 | Injection site inflammation | FAERS: 2 | US FAERS | |
| 813 | Intervertebral disc compression | FAERS: 2 | US FAERS | |
| 814 | Intervertebral disc disorder | FAERS: 2 | US FAERS | |
| 815 | Invasive Ductal Breast Carcinoma | FAERS: 2 | US FAERS | |
| 816 | Keratitis | FAERS: 2 | US FAERS | |
| 817 | Lack of satiety | FAERS: 2 | US FAERS | |
| 818 | Lactation Disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 819 | Laparotomy | FAERS: 2 | US FAERS | |
| 820 | Latent Autoimmune Diabetes in Adults | FAERS: 2 | US FAERS | |
| 821 | Lid sulcus deepened | FAERS: 2 | US FAERS | |
| 822 | Lipids abnormal | FAERS: 2 | US FAERS | |
| 823 | Living in residential institution | FAERS: 2 | US FAERS | |
| 824 | Loose tooth | FAERS: 2 | US FAERS | |
| 825 | Loss of dreaming | FAERS: 2 | US FAERS | |
| 826 | Lymphoma | FAERS: 2 | US FAERS | |
| 827 | Lymphopenia | FAERS: 2 | US FAERS | |
| 828 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 829 | Macrocytosis | FAERS: 2 | US FAERS | |
| 830 | Malnutrition | FAERS: 2 | SIDER US FAERS | |
| 831 | Mastectomy | FAERS: 2 | US FAERS | |
| 832 | Meconium Aspiration Syndrome | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 833 | Meningioma | FAERS: 2 | US FAERS | |
| 834 | Meningomyelocele | FAERS: 2 | US FAERS | |
| 835 | Meniscus operation | FAERS: 2 | US FAERS | |
| 836 | Menopause | FAERS: 2 | US FAERS | |
| 837 | Mental retardation severity unspecified | FAERS: 2 | US FAERS | |
| 838 | Moaning | FAERS: 2 | US FAERS | |
| 839 | Mouth swelling | FAERS: 2 | US FAERS | |
| 840 | Myocardial rupture | FAERS: 2 | US FAERS | |
| 841 | Myoglobin blood increased | FAERS: 2 | OFFSIDES US FAERS | |
| 842 | Narcolepsy | FAERS: 2 | US FAERS | |
| 843 | Nerve injury | FAERS: 2 | SIDER US FAERS | |
| 844 | Neuropsychiatric syndrome | FAERS: 2 | US FAERS | |
| 845 | Nocturia | FAERS: 2 | SIDER US FAERS | |
| 846 | Optic Atrophy | FAERS: 2 | US FAERS | |
| 847 | Oropharyngeal blistering | FAERS: 2 | US FAERS | |
| 848 | Oropharyngeal discomfort | FAERS: 2 | SIDER US FAERS | |
| 849 | Orthostatic hypertension | FAERS: 2 | SIDER US FAERS | |
| 850 | Osteopenia | FAERS: 2 | SIDER US FAERS | |
| 851 | Osteoporosis | FAERS: 2 | SIDER US FAERS | |
| 852 | Ovarian cyst torsion | FAERS: 2 | US FAERS | |
| 853 | Packaging design issue | FAERS: 2 | US FAERS | |
| 854 | Pancreatic calcification | FAERS: 2 | US FAERS | |
| 855 | Patient Isolation | FAERS: 2 | US FAERS | |
| 856 | Patient uncooperative | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 857 | Pelvic Pain | FAERS: 2 | SIDER US FAERS | |
| 858 | Petechiae | FAERS: 2 | SIDER US FAERS | |
| 859 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 860 | Pharyngolaryngeal Pain | FAERS: 2 | SIDER US FAERS | |
| 861 | Physical deconditioning | FAERS: 2 | US FAERS | |
| 862 | Pleurothotonus | FAERS: 2 | US FAERS | |
| 863 | Polyneuropathy | FAERS: 2 | US FAERS | |
| 864 | Post procedural complication | FAERS: 2 | US FAERS | |
| 865 | Posturing | FAERS: 2 | US FAERS | |
| 866 | Prehypertension | FAERS: 2 | US FAERS | |
| 867 | Premenstrual syndrome | FAERS: 2 | SIDER US FAERS | |
| 868 | Prescription drug used without a prescription | FAERS: 2 | US FAERS | |
| 869 | Pressure of speech | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 870 | Product closure issue | FAERS: 2 | US FAERS | |
| 871 | Product contamination | FAERS: 2 | US FAERS | |
| 872 | Product contamination physical | FAERS: 2 | US FAERS | |
| 873 | Product dispensing error | FAERS: 2 | US FAERS | |
| 874 | Product distribution issue | FAERS: 2 | US FAERS | |
| 875 | Product formulation issue | FAERS: 2 | US FAERS | |
| 876 | Product friable | FAERS: 2 | US FAERS | |
| 877 | Product preparation error | FAERS: 2 | US FAERS | |
| 878 | Product preparation issue | FAERS: 2 | US FAERS | |
| 879 | Productive Cough | FAERS: 2 | SIDER US FAERS | |
| 880 | Progressive supranuclear palsy | FAERS: 2 | US FAERS | |
| 881 | Pseudomyopia | FAERS: 2 | US FAERS | |
| 882 | Psychogenic seizure | FAERS: 2 | US FAERS | |
| 883 | Pulmonary pain | FAERS: 2 | US FAERS | |
| 884 | Rabbit syndrome | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 885 | Renal tubular necrosis | FAERS: 2 | US FAERS | |
| 886 | Respiratory depth decreased | FAERS: 2 | US FAERS | |
| 887 | Resting Tremor | FAERS: 2 | US FAERS | |
| 888 | Retinal Artery Occlusion | FAERS: 2 | US FAERS | |
| 889 | Retinal scar | FAERS: 2 | US FAERS | |
| 890 | Scab | FAERS: 2 | SIDER US FAERS | |
| 891 | Scarlet Fever | FAERS: 2 | US FAERS | |
| 892 | School refusal | FAERS: 2 | US FAERS | |
| 893 | Sciatica | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 894 | Secondary hyperthyroidism | FAERS: 2 | US FAERS | |
| 895 | Secretion discharge | FAERS: 2 | US FAERS | |
| 896 | Seminal vesicular disorder | FAERS: 2 | US FAERS | |
| 897 | Serum Sickness | FAERS: 2 | US FAERS | |
| 898 | Sexual activity increased | FAERS: 2 | US FAERS | |
| 899 | Sinus Arrhythmia | FAERS: 2 | US FAERS | |
| 900 | Skin laceration | FAERS: 2 | SIDER US FAERS | |
| 901 | Sneezing | FAERS: 2 | SIDER US FAERS | |
| 902 | Somatic symptom disorder | FAERS: 2 | US FAERS | |
| 903 | Somnambulism | FAERS: 2 | SIDER US FAERS | |
| 904 | Spina Bifida | FAERS: 2 | OFFSIDES US FAERS | |
| 905 | Spinal column stenosis | FAERS: 2 | US FAERS | |
| 906 | Spinal fusion surgery | FAERS: 2 | US FAERS | |
| 907 | Starvation | FAERS: 2 | OFFSIDES US FAERS | |
| 908 | Subclavian artery thrombosis | FAERS: 2 | US FAERS | |
| 909 | Suspected counterfeit product | FAERS: 2 | US FAERS | |
| 910 | Syndactyly | FAERS: 2 | US FAERS | |
| 911 | Syphilis test positive | FAERS: 2 | OFFSIDES US FAERS | |
| 912 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 913 | Tachyphylaxis | FAERS: 2 | OFFSIDES US FAERS | |
| 914 | Tethered Cord Syndrome | FAERS: 2 | US FAERS | |
| 915 | Thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 916 | Thyroid Neoplasm | FAERS: 2 | US FAERS | |
| 917 | Thyroid hormones decreased | FAERS: 2 | US FAERS | |
| 918 | Thyroidectomy | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 919 | Transcription medication error | FAERS: 2 | US FAERS | |
| 920 | Transplant | FAERS: 2 | US FAERS | |
| 921 | Traumatic Brain Injury | FAERS: 2 | US FAERS | |
| 922 | Troponin I increased | FAERS: 2 | US FAERS | |
| 923 | Unemployment | FAERS: 2 | US FAERS | |
| 924 | Unresponsive to pain stimuli | FAERS: 2 | OFFSIDES US FAERS | |
| 925 | Urine amphetamine positive | FAERS: 2 | US FAERS | |
| 926 | Vaginal Discharge | FAERS: 2 | SIDER US FAERS | |
| 927 | Vanishing twin syndrome | FAERS: 2 | US FAERS | |
| 928 | Vascular purpura | FAERS: 2 | US FAERS | |
| 929 | Ventricular arrhythmia | FAERS: 2 | SIDER US FAERS | |
| 930 | Vitamin D Deficiency | FAERS: 2 | US FAERS | |
| 931 | Xerophthalmia | FAERS: 2 | US FAERS | |
| 932 | cancer surgery | FAERS: 2 | US FAERS | |
| 933 | Abulia | FAERS: 1 | US FAERS | |
| 934 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 935 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 936 | Alanine aminotransferase decreased | FAERS: 1 | US FAERS | |
| 937 | Alcohol withdrawal syndrome | FAERS: 1 | US FAERS | |
| 938 | Allergic cough | FAERS: 1 | US FAERS | |
| 939 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 940 | Amylase increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 941 | Anal Fissure | FAERS: 1 | US FAERS | |
| 942 | Anembryonic gestation | FAERS: 1 | US FAERS | |
| 943 | Anosmia | FAERS: 1 | US FAERS | |
| 944 | Anticonvulsant drug level increased | FAERS: 1 | US FAERS | |
| 945 | Antiphospholipid Antibodies | FAERS: 1 | US FAERS | |
| 946 | Antiphospholipid antibodies positive | FAERS: 1 | US FAERS | |
| 947 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 948 | Apgar score abnormal | FAERS: 1 | US FAERS | |
| 949 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 950 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 951 | Arthropod sting | FAERS: 1 | US FAERS | |
| 952 | Aspartate aminotransferase decreased | FAERS: 1 | US FAERS | |
| 953 | Astigmatism | FAERS: 1 | US FAERS | |
| 954 | Atrial Flutter | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 955 | Atrial tachycardia | FAERS: 1 | US FAERS | |
| 956 | Aura | FAERS: 1 | OFFSIDES US FAERS | |
| 957 | Auricular swelling | FAERS: 1 | US FAERS | |
| 958 | Autophobia | FAERS: 1 | US FAERS | |
| 959 | Bacterial test positive | FAERS: 1 | SIDER US FAERS | |
| 960 | Ballismus | FAERS: 1 | US FAERS | |
| 961 | Benign Prostatic Hyperplasia | FAERS: 1 | SIDER US FAERS | |
| 962 | Birdshot Chorioretinopathy | FAERS: 1 | US FAERS | |
| 963 | Blood amino acid level increased | FAERS: 1 | US FAERS | |
| 964 | Blood catecholamines decreased | FAERS: 1 | US FAERS | |
| 965 | Blood cholesterol abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 966 | Blood cholesterol | FAERS: 1 | OFFSIDES US FAERS | |
| 967 | Blood creatine phosphokinase MB increased | FAERS: 1 | SIDER US FAERS | |
| 968 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 969 | Blood follicle stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 970 | Blood growth hormone abnormal | FAERS: 1 | US FAERS | |
| 971 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 972 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 973 | Blood pressure orthostatic decreased | FAERS: 1 | US FAERS | |
| 974 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 975 | Blood triglycerides | FAERS: 1 | US FAERS | |
| 976 | Blood urea nitrogen/creatinine ratio increased | FAERS: 1 | US FAERS | |
| 977 | Bloom Syndrome | FAERS: 1 | US FAERS | |
| 978 | Borderline Personality Disorder | FAERS: 1 | US FAERS | |
| 979 | Brain Contusion | FAERS: 1 | US FAERS | |
| 980 | Breast Cyst | FAERS: 1 | US FAERS | |
| 981 | Burning Mouth Syndrome | FAERS: 1 | US FAERS | |
| 982 | Bursitis | FAERS: 1 | SIDER US FAERS | |
| 983 | Butterfly rash | FAERS: 1 | OFFSIDES US FAERS | |
| 984 | Calcinosis | FAERS: 1 | US FAERS | |
| 985 | Candidiasis | FAERS: 1 | US FAERS | |
| 986 | Carcinoma | FAERS: 1 | US FAERS | |
| 987 | Cardiac Death | FAERS: 1 | OFFSIDES US FAERS | |
| 988 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 989 | Cardiac function test abnormal | FAERS: 1 | US FAERS | |
| 990 | Cardiometabolic syndrome | FAERS: 1 | US FAERS | |
| 991 | Cerebellar stroke | FAERS: 1 | US FAERS | |
| 992 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 993 | Choroiditis | FAERS: 1 | US FAERS | |
| 994 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 995 | Clonus | FAERS: 1 | US FAERS | |
| 996 | Compulsive lip biting | FAERS: 1 | US FAERS | |
| 997 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 998 | Congenital torticollis | FAERS: 1 | US FAERS | |
| 999 | Conversion disorder | FAERS: 1 | US FAERS | |
| 1000 | Cor pulmonale | FAERS: 1 | US FAERS | |
| 1001 | Corneal irritation | FAERS: 1 | US FAERS | |
| 1002 | Cotard's syndrome | FAERS: 1 | US FAERS | |
| 1003 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 1004 | Croup infectious | FAERS: 1 | US FAERS | |
| 1005 | Cutis Laxa | FAERS: 1 | US FAERS | |
| 1006 | Cytomegalovirus test positive | FAERS: 1 | US FAERS | |
| 1007 | Delusion of reference | FAERS: 1 | US FAERS | |
| 1008 | Delusional disorder, persecutory type | FAERS: 1 | US FAERS | |
| 1009 | Dermo-hypodermitis | FAERS: 1 | US FAERS | |
| 1010 | Device computer issue | FAERS: 1 | US FAERS | |
| 1011 | Diabetic metabolic decompensation | FAERS: 1 | US FAERS | |
| 1012 | Diaphragmatic spasm | FAERS: 1 | US FAERS | |
| 1013 | Disease complication | FAERS: 1 | US FAERS | |
| 1014 | Dissociative Identity Disorder | FAERS: 1 | US FAERS | |
| 1015 | Drain placement | FAERS: 1 | US FAERS | |
| 1016 | Dreamy state | FAERS: 1 | US FAERS | |
| 1017 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 1018 | Drug effect variable | FAERS: 1 | US FAERS | |
| 1019 | Drug effective for unapproved indication | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1020 | Drug level changed | FAERS: 1 | US FAERS | |
| 1021 | Duodenitis | FAERS: 1 | US FAERS | |
| 1022 | Dyslexia | FAERS: 1 | US FAERS | |
| 1023 | Dyspareunia | FAERS: 1 | US FAERS | |
| 1024 | Early menarche | FAERS: 1 | SIDER US FAERS | |
| 1025 | Ecchymosis | FAERS: 1 | SIDER US FAERS | |
| 1026 | Electrolyte depletion | FAERS: 1 | US FAERS | |
| 1027 | Enamel anomaly | FAERS: 1 | US FAERS | |
| 1028 | Eosinophilia | FAERS: 1 | SIDER US FAERS | |
| 1029 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 1030 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 1031 | Essential Tremor | FAERS: 1 | US FAERS | |
| 1032 | Expired drug administered | FAERS: 1 | US FAERS | |
| 1033 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 1034 | Extra dose administered | FAERS: 1 | US FAERS | |
| 1035 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 1036 | Eyelid infection | FAERS: 1 | US FAERS | |
| 1037 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 1038 | Facial Pain | FAERS: 1 | SIDER US FAERS | |
| 1039 | Failure of child resistant mechanism for pharmaceutical product | FAERS: 1 | US FAERS | |
| 1040 | False positive laboratory result | FAERS: 1 | US FAERS | |
| 1041 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 1042 | Feeding disorder neonatal | FAERS: 1 | US FAERS | |
| 1043 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 1044 | Female Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 1045 | Fight in school | FAERS: 1 | US FAERS | |
| 1046 | Flank Pain | FAERS: 1 | SIDER US FAERS | |
| 1047 | Frostbite | FAERS: 1 | US FAERS | |
| 1048 | Gangrene | FAERS: 1 | US FAERS | |
| 1049 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 1050 | Gene Mutation | FAERS: 1 | US FAERS | |
| 1051 | Genital pain | FAERS: 1 | US FAERS | |
| 1052 | Gingival Recession | FAERS: 1 | US FAERS | |
| 1053 | Gingivitis | FAERS: 1 | SIDER US FAERS | |
| 1054 | Glasgow coma scale abnormal | FAERS: 1 | US FAERS | |
| 1055 | Glioma | FAERS: 1 | US FAERS | |
| 1056 | Granulocyte count decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 1057 | Head Banging | FAERS: 1 | US FAERS | |
| 1058 | Heat Exhaustion | FAERS: 1 | SIDER US FAERS | |
| 1059 | Helicobacter test positive | FAERS: 1 | US FAERS | |
| 1060 | Herbal interaction | FAERS: 1 | US FAERS | |
| 1061 | Hidradenitis | FAERS: 1 | US FAERS | |
| 1062 | Hip Dysplasia | FAERS: 1 | US FAERS | |
| 1063 | Histrionic Personality Disorder | FAERS: 1 | US FAERS | |
| 1064 | Hoarseness | FAERS: 1 | SIDER US FAERS | |
| 1065 | Homosexuality | FAERS: 1 | US FAERS | |
| 1066 | Hyperchlorhydria | FAERS: 1 | SIDER US FAERS | |
| 1067 | Hypercreatininaemia | FAERS: 1 | US FAERS | |
| 1068 | Hyperemesis Gravidarum | FAERS: 1 | US FAERS | |
| 1069 | Hyperkeratosis | FAERS: 1 | SIDER US FAERS | |
| 1070 | Hypermetabolism | FAERS: 1 | US FAERS | |
| 1071 | Hypersplenism | FAERS: 1 | US FAERS | |
| 1072 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 1073 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 1074 | Hypohidrosis | FAERS: 1 | US FAERS | |
| 1075 | Hypometabolism | FAERS: 1 | US FAERS | |
| 1076 | Hypothalamo-pituitary disorder | FAERS: 1 | US FAERS | |
| 1077 | Illiteracy | FAERS: 1 | US FAERS | |
| 1078 | Incorrect product administration duration | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1079 | Injection site abscess | FAERS: 1 | US FAERS | |
| 1080 | Injection site joint discomfort | FAERS: 1 | US FAERS | |
| 1081 | Injection site movement impairment | FAERS: 1 | US FAERS | |
| 1082 | Injection site warmth | FAERS: 1 | US FAERS | |
| 1083 | Injury asphyxiation | FAERS: 1 | SIDER US FAERS | |
| 1084 | Injury associated with device | FAERS: 1 | US FAERS | |
| 1085 | Insulin-requiring type 2 diabetes mellitus | FAERS: 1 | OFFSIDES US FAERS | |
| 1086 | Intellectual Disability | FAERS: 1 | 16891339 17069544 | CTD US FAERS |
| 1087 | Intelligence test abnormal | FAERS: 1 | US FAERS | |
| 1088 | Intercepted product dispensing error | FAERS: 1 | US FAERS | |
| 1089 | Intestinal Perforation | FAERS: 1 | SIDER US FAERS | |
| 1090 | Intestinal resection | FAERS: 1 | US FAERS | |
| 1091 | Intrusive thoughts | FAERS: 1 | US FAERS | |
| 1092 | Joint sprain | FAERS: 1 | SIDER US FAERS | |
| 1093 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 1094 | Laryngospasm | FAERS: 1 | SIDER US FAERS | |
| 1095 | Left atrial dilatation | FAERS: 1 | US FAERS | |
| 1096 | Ligament pain | FAERS: 1 | US FAERS | |
| 1097 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 1098 | Lip pruritus | FAERS: 1 | US FAERS | |
| 1099 | Lung Abscess | FAERS: 1 | US FAERS | |
| 1100 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 1101 | Lymphocyte percentage decreased | FAERS: 1 | US FAERS | |
| 1102 | Macule | FAERS: 1 | US FAERS | |
| 1103 | Malabsorption | FAERS: 1 | US FAERS | |
| 1104 | Male Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 1105 | Maternal exposure during breast feeding | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1106 | Measles | FAERS: 1 | US FAERS | |
| 1107 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 1108 | Medication monitoring error | FAERS: 1 | US FAERS | |
| 1109 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 1110 | Meniscus injury | FAERS: 1 | US FAERS | |
| 1111 | Mental Retardation | FAERS: 1 | SIDER US FAERS | |
| 1112 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 1113 | Micrococcus test positive | FAERS: 1 | US FAERS | |
| 1114 | Milk Allergy | FAERS: 1 | US FAERS | |
| 1115 | Mouth Breathing | FAERS: 1 | US FAERS | |
| 1116 | Mucosal pigmentation | FAERS: 1 | US FAERS | |
| 1117 | Multiple allergies | FAERS: 1 | US FAERS | |
| 1118 | Multiple drug overdose | FAERS: 1 | US FAERS | |
| 1119 | Multiple drug overdose intentional | FAERS: 1 | US FAERS | |
| 1120 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 1121 | Musculoskeletal chest pain | FAERS: 1 | SIDER US FAERS | |
| 1122 | Mutism | FAERS: 1 | US FAERS | |
| 1123 | Myoglobin urine present | FAERS: 1 | OFFSIDES US FAERS | |
| 1124 | Myopathy | FAERS: 1 | SIDER US FAERS | |
| 1125 | Nasal Polyps | FAERS: 1 | US FAERS | |
| 1126 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 1127 | Negativism | FAERS: 1 | US FAERS | |
| 1128 | Neonatal tachycardia | FAERS: 1 | US FAERS | |
| 1129 | Nephritis | FAERS: 1 | US FAERS | |
| 1130 | Neurological decompensation | FAERS: 1 | US FAERS | |
| 1131 | Neuropathy | FAERS: 1 | SIDER US FAERS | |
| 1132 | Neutrophil percentage increased | FAERS: 1 | US FAERS | |
| 1133 | Nicotine Dependence | FAERS: 1 | US FAERS | |
| 1134 | Nutritional condition abnormal | FAERS: 1 | US FAERS | |
| 1135 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 1136 | Ocular icterus | FAERS: 1 | US FAERS | |
| 1137 | Opisthotonus | FAERS: 1 | US FAERS | |
| 1138 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 1139 | Oral infection | FAERS: 1 | US FAERS | |
| 1140 | Osteitis | FAERS: 1 | US FAERS | |
| 1141 | Pancreatic Insufficiency | FAERS: 1 | US FAERS | |
| 1142 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 1143 | Papule | FAERS: 1 | US FAERS | |
| 1144 | Paranoid Personality Disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 1145 | Pathological fracture | FAERS: 1 | US FAERS | |
| 1146 | Periarthritis | FAERS: 1 | US FAERS | |
| 1147 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 1148 | Phlebitis | FAERS: 1 | SIDER US FAERS | |
| 1149 | Phobia of driving | FAERS: 1 | OFFSIDES US FAERS | |
| 1150 | Physical abuse | FAERS: 1 | US FAERS | |
| 1151 | Physical product label issue | FAERS: 1 | US FAERS | |
| 1152 | Pilonidal Cyst | FAERS: 1 | OFFSIDES US FAERS | |
| 1153 | Plantar erythema | FAERS: 1 | US FAERS | |
| 1154 | Pleurisy | FAERS: 1 | US FAERS | |
| 1155 | Pneumothorax | FAERS: 1 | US FAERS | |
| 1156 | Polymyositis | FAERS: 1 | US FAERS | |
| 1157 | Poor feeding infant | FAERS: 1 | US FAERS | |
| 1158 | Poor personal hygiene | FAERS: 1 | OFFSIDES US FAERS | |
| 1159 | Poor weight gain neonatal | FAERS: 1 | US FAERS | |
| 1160 | Postresuscitation encephalopathy | FAERS: 1 | US FAERS | |
| 1161 | Potentiating drug interaction | FAERS: 1 | US FAERS | |
| 1162 | Poverty | FAERS: 1 | US FAERS | |
| 1163 | Pregnancy of partner | FAERS: 1 | US FAERS | |
| 1164 | Pregnancy test false positive | FAERS: 1 | US FAERS | |
| 1165 | Pregnancy test negative | FAERS: 1 | US FAERS | |
| 1166 | Premature Ejaculation | FAERS: 1 | SIDER US FAERS | |
| 1167 | Procedural complication | FAERS: 1 | US FAERS | |
| 1168 | Product administration error | FAERS: 1 | US FAERS | |
| 1169 | Product complaint | FAERS: 1 | US FAERS | |
| 1170 | Product container issue | FAERS: 1 | US FAERS | |
| 1171 | Product container seal issue | FAERS: 1 | US FAERS | |
| 1172 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 1173 | Product label confusion | FAERS: 1 | US FAERS | |
| 1174 | Product prescribing error | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1175 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 1176 | Product quality control issue | FAERS: 1 | US FAERS | |
| 1177 | Product reconstitution quality issue | FAERS: 1 | US FAERS | |
| 1178 | Product supply issue | FAERS: 1 | US FAERS | |
| 1179 | Product tampering | FAERS: 1 | US FAERS | |
| 1180 | Prolactinoma | FAERS: 1 | US FAERS | |
| 1181 | Protein urine present | FAERS: 1 | SIDER US FAERS | |
| 1182 | Pseudolymphoma | FAERS: 1 | US FAERS | |
| 1183 | Pyogenic granuloma | FAERS: 1 | US FAERS | |
| 1184 | Quadriparesis | FAERS: 1 | US FAERS | |
| 1185 | Rash erythematous | FAERS: 1 | SIDER US FAERS | |
| 1186 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 1187 | Rebound effect | FAERS: 1 | US FAERS | |
| 1188 | Rectal spasm | FAERS: 1 | US FAERS | |
| 1189 | Reduced facial expression | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1190 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 1191 | Renal Colic | FAERS: 1 | US FAERS | |
| 1192 | Respiratory dyskinesia | FAERS: 1 | US FAERS | |
| 1193 | Respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 1194 | Right atrial dilatation | FAERS: 1 | US FAERS | |
| 1195 | Rosacea | FAERS: 1 | SIDER US FAERS | |
| 1196 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 1197 | Saliva altered | FAERS: 1 | US FAERS | |
| 1198 | Sedation complication | FAERS: 1 | US FAERS | |
| 1199 | Sensation of blood flow | FAERS: 1 | US FAERS | |
| 1200 | Sense of oppression | FAERS: 1 | US FAERS | |
| 1201 | Sexual Aversion Disorder | FAERS: 1 | US FAERS | |
| 1202 | Sexual transmission of infection | FAERS: 1 | US FAERS | |
| 1203 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 1204 | Single functional kidney | FAERS: 1 | US FAERS | |
| 1205 | Sinus pain | FAERS: 1 | SIDER US FAERS | |
| 1206 | Skin irritation | FAERS: 1 | SIDER US FAERS | |
| 1207 | Sleep Paralysis | FAERS: 1 | US FAERS | |
| 1208 | Sleep-related eating disorder | FAERS: 1 | US FAERS | |
| 1209 | Somatic symptom disorder of pregnancy | FAERS: 1 | US FAERS | |
| 1210 | Somatoform Disorder | FAERS: 1 | SIDER US FAERS | |
| 1211 | Spinal Stenosis | FAERS: 1 | US FAERS | |
| 1212 | Splenectomy | FAERS: 1 | US FAERS | |
| 1213 | Spontaneous ejaculation | FAERS: 1 | US FAERS | |
| 1214 | Spontaneous penile erection | FAERS: 1 | SIDER US FAERS | |
| 1215 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 1216 | Stubbornness | FAERS: 1 | US FAERS | |
| 1217 | Sunburn | FAERS: 1 | SIDER US FAERS | |
| 1218 | Symptom recurrence | FAERS: 1 | US FAERS | |
| 1219 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 1220 | Systemic lupus erythematosus rash | FAERS: 1 | US FAERS | |
| 1221 | Therapeutic drug monitoring analysis not performed | FAERS: 1 | US FAERS | |
| 1222 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 1223 | Therapeutic product effect decreased | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1224 | Therapeutic product ineffective | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1225 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 1226 | Thermal burn | FAERS: 1 | US FAERS | |
| 1227 | Thoracostomy | FAERS: 1 | US FAERS | |
| 1228 | Throat cancer | FAERS: 1 | US FAERS | |
| 1229 | Thrombocytosis | FAERS: 1 | SIDER US FAERS | |
| 1230 | Thrombotic cerebral infarction | FAERS: 1 | US FAERS | |
| 1231 | Time perception altered | FAERS: 1 | US FAERS | |
| 1232 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 1233 | Tongue exfoliation | FAERS: 1 | US FAERS | |
| 1234 | Tongue spasm | FAERS: 1 | SIDER US FAERS | |
| 1235 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 1236 | Tooth Infection | FAERS: 1 | US FAERS | |
| 1237 | Total bile acids increased | FAERS: 1 | US FAERS | |
| 1238 | Total cholesterol/HDL ratio decreased | FAERS: 1 | US FAERS | |
| 1239 | Transmission of drug via semen | FAERS: 1 | US FAERS | |
| 1240 | Underweight | FAERS: 1 | US FAERS | |
| 1241 | Unexpected therapeutic drug effect | FAERS: 1 | US FAERS | |
| 1242 | Up and down phenomenon | FAERS: 1 | US FAERS | |
| 1243 | Urinary tract infection pseudomonal | FAERS: 1 | US FAERS | |
| 1244 | Urine ketone body present | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 1245 | Uveitis | FAERS: 1 | US FAERS | |
| 1246 | Vehicle solution use | FAERS: 1 | US FAERS | |
| 1247 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 1248 | Vibratory sense increased | FAERS: 1 | US FAERS | |
| 1249 | Victim of sexual abuse | FAERS: 1 | US FAERS | |
| 1250 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 1251 | Vulvovaginal pruritus | FAERS: 1 | OFFSIDES US FAERS | |
| 1252 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 1253 | Waxy flexibility | FAERS: 1 | US FAERS | |
| 1254 | Wheelchair user | FAERS: 1 | US FAERS | |
| 1255 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 1256 | Writer's Cramp | FAERS: 1 | US FAERS | |
| 1257 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 1258 | carbuncle | FAERS: 1 | US FAERS | |
| 1259 | Abdominal bloating | SIDER | ||
| 1260 | Abdominal sepsis | OFFSIDES | ||
| 1261 | Abdominal tenderness | OFFSIDES SIDER | ||
| 1262 | Abnormal ejaculation | SIDER | ||
| 1263 | Action Tremor | SIDER | ||
| 1264 | Activated Protein C Resistance | OFFSIDES | ||
| 1265 | Adnexitis | OFFSIDES | ||
| 1266 | Akathisia, Drug-Induced | CTD | ||
| 1267 | Albuminuria | SIDER | ||
| 1268 | Alpha 1 foetoprotein amniotic fluid increased | OFFSIDES | ||
| 1269 | Amblyopia | SIDER | ||
| 1270 | Amphetamine-Related Disorders | 17115868 17327886 | CTD | |
| 1271 | Amphetamines | OFFSIDES | ||
| 1272 | Anorectal discomfort | SIDER | ||
| 1273 | Anti-thyroid antibody positive | OFFSIDES | ||
| 1274 | Anxiety Disorders | 17414231 21823597 | CTD | |
| 1275 | Arthropod bite | SIDER | ||
| 1276 | Asperger Syndrome | 19519261 | CTD | |
| 1277 | Bacteria urine identified | SIDER | ||
| 1278 | Bladder discomfort | SIDER | ||
| 1279 | Bladder pain | SIDER | ||
| 1280 | Blepharitis | SIDER | ||
| 1281 | Blepharoptosis | 15358981 | CTD | |
| 1282 | Blood Glucose | OFFSIDES | ||
| 1283 | Blood alcohol | OFFSIDES | ||
| 1284 | Blood and lymphatic system disorders | SIDER | ||
| 1285 | Blood cortisol abnormal | OFFSIDES | ||
| 1286 | Blood creatine abnormal | OFFSIDES | ||
| 1287 | Blood creatine phosphokinase abnormal | SIDER | ||
| 1288 | Blood creatine phosphokinase decreased | OFFSIDES | ||
| 1289 | Blood fibrinogen | OFFSIDES | ||
| 1290 | Blood human chorionic gonadotropin positive | OFFSIDES | ||
| 1291 | Blood lactate dehydrogenase increased | SIDER | ||
| 1292 | Blood triglycerides decreased | SIDER | ||
| 1293 | Blurred vision | OFFSIDES | ||
| 1294 | Bronchial Hyperreactivity | SIDER | ||
| 1295 | Bronchopneumopathy | SIDER | ||
| 1296 | Bronchopulmonary Dysplasia | OFFSIDES | ||
| 1297 | Buccoglossal syndrome | SIDER | ||
| 1298 | Bulimia | OFFSIDES | ||
| 1299 | Candiduria | OFFSIDES | ||
| 1300 | Carbohydrate tolerance decreased | SIDER | ||
| 1301 | Cardiac discomfort | OFFSIDES | ||
| 1302 | Catalepsy | CTD | ||
| 1303 | Cerebral Arteriosclerosis | OFFSIDES | ||
| 1304 | Cerebrovascular Insufficiency | OFFSIDES | ||
| 1305 | Cervix carcinoma stage I | OFFSIDES | ||
| 1306 | Chest tightness | SIDER | ||
| 1307 | Chest wall pain | SIDER | ||
| 1308 | Child Development Disorders, Pervasive | 19519261 | CTD | |
| 1309 | Cholestasis of pregnancy | OFFSIDES | ||
| 1310 | Circumoral paresthesia | SIDER | ||
| 1311 | Cocaine-Related Disorders | CTD | ||
| 1312 | Colonic Pseudo-Obstruction | OFFSIDES | ||
| 1313 | Complication of device removal | OFFSIDES | ||
| 1314 | Conjunctival abrasion | OFFSIDES | ||
| 1315 | Craniotomy | OFFSIDES | ||
| 1316 | Creatine Phosphokinase Increased | SIDER | ||
| 1317 | Creatinine increased | SIDER | ||
| 1318 | Cutaneous Candidiasis | OFFSIDES | ||
| 1319 | Cyst removal | OFFSIDES | ||
| 1320 | Decreased immune responsiveness | SIDER | ||
| 1321 | Delusional perception | SIDER | ||
| 1322 | Depressive disorder | 21823597 | CTD | |
| 1323 | Device breakage | OFFSIDES | ||
| 1324 | Diabetes | OFFSIDES | ||
| 1325 | Diabetes with hyperosmolarity | OFFSIDES | ||
| 1326 | Diabetic Autonomic Neuropathy | OFFSIDES | ||
| 1327 | Diabetic Foot | OFFSIDES | ||
| 1328 | Diabetic blindness | OFFSIDES | ||
| 1329 | Diabetic neuropathic ulcer | OFFSIDES | ||
| 1330 | Diabetic ulcer | OFFSIDES | ||
| 1331 | Disorders of Excessive Somnolence | 17414241 | CTD | |
| 1332 | Drug titration error | Canada Vigilance: 1 | Canada Vigilance | |
| 1333 | Dyskinesia, Drug-Induced | 19533295 | CTD | |
| 1334 | Ear and labyrinth disorders | SIDER | ||
| 1335 | Ear congestion | OFFSIDES | ||
| 1336 | Electrocardiogram ST segment abnormal | SIDER | ||
| 1337 | Electrocardiogram T wave peaked | OFFSIDES | ||
| 1338 | Enlargement abdomen | SIDER | ||
| 1339 | Eosinophilic Pneumonia | OFFSIDES | ||
| 1340 | Epididymitis | SIDER | ||
| 1341 | Exaggerated startle response | OFFSIDES | ||
| 1342 | Exfoliative rash | SIDER | ||
| 1343 | Eye Infection | SIDER | ||
| 1344 | Eye Redness | SIDER | ||
| 1345 | Facial Neuralgia | OFFSIDES | ||
| 1346 | Fatty Liver | OFFSIDES | ||
| 1347 | Folliculitis | SIDER | ||
| 1348 | Foraminotomy | OFFSIDES | ||
| 1349 | Fungal rash | OFFSIDES | ||
| 1350 | Galactorrhea | 16055781 | CTD | |
| 1351 | Gastric pH decreased | SIDER | ||
| 1352 | Gastroduodenitis | OFFSIDES | ||
| 1353 | Glomerular vascular disorder | OFFSIDES | ||
| 1354 | Glycosuria | SIDER | ||
| 1355 | Gout | SIDER | ||
| 1356 | Head lag abnormal | SIDER | ||
| 1357 | Heart sounds abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 1358 | Heat illness | OFFSIDES | ||
| 1359 | Heaviness of head | SIDER | ||
| 1360 | Hepatitis B positive | OFFSIDES | ||
| 1361 | Hiccough | OFFSIDES | ||
| 1362 | Hirsutism | SIDER | ||
| 1363 | Huntington Disease | 19170197 | CTD | |
| 1364 | Hyperinsulinism | SIDER | ||
| 1365 | Hyperosmolar state | OFFSIDES | ||
| 1366 | Hyperparathyroidism | SIDER | ||
| 1367 | Hyperprolactinemia | CTD | ||
| 1368 | Hyperreflexia | SIDER | ||
| 1369 | Hypotension, Orthostatic | 18778452 | CTD | |
| 1370 | Ideas of reference | OFFSIDES | ||
| 1371 | Incorrect route of product administration | Canada Vigilance: 1 | Canada Vigilance | |
| 1372 | Infective exacerbation of chronic obstructive airways disease | OFFSIDES | ||
| 1373 | Infestation | SIDER | ||
| 1374 | Injection site burning | SIDER | ||
| 1375 | Injection site nerve damage | OFFSIDES | ||
| 1376 | Injection site pruritus | SIDER | ||
| 1377 | Injection site stinging | SIDER | ||
| 1378 | Lactic dehydrogenase activity increased | SIDER | ||
| 1379 | Leukorrhea | SIDER | ||
| 1380 | Ligament injury | OFFSIDES | ||
| 1381 | Ligament rupture | OFFSIDES | ||
| 1382 | Lightheadedness | SIDER | ||
| 1383 | Long QT Syndrome | 18363460 | CTD | |
| 1384 | Macroglossia | OFFSIDES | ||
| 1385 | Manic psychosis | SIDER | ||
| 1386 | Markedly reduced dietary intake | SIDER | ||
| 1387 | Meningocele | OFFSIDES | ||
| 1388 | Meniscus removal | OFFSIDES | ||
| 1389 | Menstruation Disturbances | 17728426 | CTD | |
| 1390 | Mental disorders | 16856516 | CTD | |
| 1391 | Metastases to thorax | OFFSIDES | ||
| 1392 | Metatarsalgia | OFFSIDES | ||
| 1393 | Microcephaly | OFFSIDES | ||
| 1394 | Movement Disorders | 16390909 17728431 17873695 | CTD | |
| 1395 | Muscle enzyme increased | SIDER | ||
| 1396 | Muscle relaxant therapy | SIDER | ||
| 1397 | Myelodysplasia | OFFSIDES | ||
| 1398 | Myeloid maturation arrest | OFFSIDES | ||
| 1399 | Myopericarditis | OFFSIDES | ||
| 1400 | Myxedema | 19934393 | CTD | |
| 1401 | Neck exploration | OFFSIDES | ||
| 1402 | Neck stiffness | SIDER | ||
| 1403 | Neck tightness | SIDER | ||
| 1404 | Necrobiosis Lipoidica Diabeticorum | OFFSIDES | ||
| 1405 | Neonatal oversedation | OFFSIDES | ||
| 1406 | Oliguria | SIDER | ||
| 1407 | Onychomycosis | SIDER | ||
| 1408 | Open reduction of fracture | OFFSIDES | ||
| 1409 | Open wound | SIDER | ||
| 1410 | Optic Neuropathy | OFFSIDES | ||
| 1411 | Osteotomy | OFFSIDES | ||
| 1412 | Otitis Externa | SIDER | ||
| 1413 | Otitis Media | SIDER | ||
| 1414 | Pain during injection | SIDER | ||
| 1415 | Pain of skin | Canada Vigilance: 2 | Canada Vigilance | |
| 1416 | Pancreatic Pseudocyst | OFFSIDES | ||
| 1417 | Paranasal sinus hypersecretion | SIDER | ||
| 1418 | Paranoid reaction | SIDER | ||
| 1419 | Parkinsonian Disorders | CTD | ||
| 1420 | Parotitis | SIDER | ||
| 1421 | Patient restraint | OFFSIDES | ||
| 1422 | Pemphigus | SIDER | ||
| 1423 | Penile prosthesis user | OFFSIDES | ||
| 1424 | Peptic Ulcer | SIDER | ||
| 1425 | Peripheral embolism | OFFSIDES | ||
| 1426 | Periumbilical abscess | OFFSIDES | ||
| 1427 | Pharyngitis | SIDER | ||
| 1428 | Pineal germinoma | OFFSIDES | ||
| 1429 | Polyhydramnios | OFFSIDES | ||
| 1430 | Post procedural swelling | OFFSIDES | ||
| 1431 | Presbyopia | OFFSIDES | ||
| 1432 | Product administered at inappropriate site | Canada Vigilance: 1 | Canada Vigilance | |
| 1433 | Prostate cancer recurrent | OFFSIDES | ||
| 1434 | Prostatic Obstruction | OFFSIDES | ||
| 1435 | Proteinuria | SIDER | ||
| 1436 | Psychomotor Agitation | 19222986 21823597 | CTD | |
| 1437 | Psychoses, Substance-Induced | 17478598 | CTD | |
| 1438 | Psychotic Disorders | CTD | ||
| 1439 | Pulmonary congestion | SIDER | ||
| 1440 | Punctate keratitis | OFFSIDES | ||
| 1441 | Radiotherapy to brain | OFFSIDES | ||
| 1442 | Rash scaly | SIDER | ||
| 1443 | Red cell distribution width abnormal | OFFSIDES | ||
| 1444 | Redness | SIDER | ||
| 1445 | Respiratory tract congestion | SIDER | ||
| 1446 | Retrocollis | OFFSIDES | ||
| 1447 | Rhonchi | SIDER | ||
| 1448 | Schizophrenic reaction | SIDER | ||
| 1449 | Schizotypal Personality Disorder | OFFSIDES | ||
| 1450 | Seizures | 15830832 19778573 | CTD | |
| 1451 | Self Mutilation | SIDER | ||
| 1452 | Serum prolactin decreased | SIDER | ||
| 1453 | Skin Induration | SIDER | ||
| 1454 | Skin Papilloma | SIDER | ||
| 1455 | Sleep Initiation and Maintenance Disorders | 16240856 21823597 | CTD | |
| 1456 | Sleep Talking | SIDER | ||
| 1457 | Splenic varices | OFFSIDES | ||
| 1458 | Stereotypic Movement Disorder | 15358981 | CTD | |
| 1459 | Stiffness | SIDER | ||
| 1460 | Stress ulcer | OFFSIDES | ||
| 1461 | Substance Withdrawal Syndrome | 19166895 | CTD | |
| 1462 | Substance-Related Disorders | 16240856 16523807 | CTD | |
| 1463 | Suicide | SIDER | ||
| 1464 | Sweating | SIDER | ||
| 1465 | Synovitis | OFFSIDES | ||
| 1466 | Teeth brittle | OFFSIDES | ||
| 1467 | Tenosynovitis | SIDER | ||
| 1468 | Therapeutic product effect incomplete | Canada Vigilance: 2 | Canada Vigilance | |
| 1469 | Therapeutic product ineffective for unapproved indication | OFFSIDES | ||
| 1470 | Tightness in jaw | SIDER | ||
| 1471 | Tinea Pedis | OFFSIDES | ||
| 1472 | Tinea | OFFSIDES | ||
| 1473 | Tongue Diseases | 17728431 | CTD | |
| 1474 | Unresponsive to verbal stimuli | SIDER | ||
| 1475 | Upset stomach | SIDER | ||
| 1476 | Urethral discharge | SIDER | ||
| 1477 | Urine cannabinoids increased | OFFSIDES | ||
| 1478 | Urolithiasis | SIDER | ||
| 1479 | Uterovaginal prolapse | OFFSIDES | ||
| 1480 | Vagal nerve stimulator implantation | OFFSIDES | ||
| 1481 | Vaginal mycosis | SIDER | ||
| 1482 | Vascular anomaly | OFFSIDES | ||
| 1483 | Vascular bypass graft | OFFSIDES | ||
| 1484 | Vasodilation procedure | SIDER | ||
| 1485 | Vasodilation | SIDER | ||
| 1486 | Venipuncture site bruise | SIDER | ||
| 1487 | Venous Thromboembolism | SIDER | ||
| 1488 | Verbigeration | OFFSIDES | ||
| 1489 | Vertebroplasty | OFFSIDES | ||
| 1490 | Vesiculobullous rash | SIDER | ||
| 1491 | Vessel puncture site bruise | SIDER | ||
| 1492 | Vision Disorders | 17414231 | CTD | |
| 1493 | Vulvovaginal dryness | SIDER | ||
| 1494 | Vulvovaginal mycotic infection | SIDER | ||
| 1495 | Vulvovaginal pain | OFFSIDES | ||
| 1496 | Waist circumference increased | SIDER | ||
| 1497 | Weight Gain | 12860772 17414231 | CTD OFFSIDES | |
| 1498 | Wrong dose | Canada Vigilance: 1 | Canada Vigilance | |
| 1499 | Xanthopsia | OFFSIDES | ||
| 1500 | Xerosis | SIDER | ||
| 1501 | fibroma | OFFSIDES | ||
| 1502 | kyphosis | SIDER | ||
| 1503 | prostatitis | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.