Sunitinib
(WINHZLLDWRZWRT-ATVHPVEESA-N)
Structure
- SMILES
- CCN(CCNC(=O)c1c(C)[nH]c(c1C)/C=C/1\C(=O)Nc2c1cc(F)cc2)CC
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XE04
- Molecular Formula:
- C22H27FN4O2
- Molecular Weight:
- 398.474
- Log P:
- 3.8638
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 3
- TPSA:
- 77.23
- CAS Number(s):
- 341031-54-7; 342641-94-5; 557795-19-4
Synonym(s)
1.
Sunitinib
2.
5-(5-Fluoro-2-oxo-1,2-dihydroindolylidenemethyl)-2,4-dimethyl-1H-pyrrole-3-carboxylic acid (2-diethylaminoethyl)amide
3.
SU 011248
4.
SU 11248
5.
SU-011248
6.
SU-11248
7.
SU011248
8.
SU11248
9.
Sunitinib Malate
10.
Sutent
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Disease Progression | FAERS: 2529 Canada Vigilance: 17 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Fatigue | FAERS: 1573 Canada Vigilance: 24 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 3 | Nausea | FAERS: 1147 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 4 | Asthenia | FAERS: 927 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 5 | Vomiting | FAERS: 874 Canada Vigilance: 7 | 22343322 | CTD SIDER Canada Vigilance US FAERS |
| 6 | Renal Cell Carcinoma | FAERS: 665 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 7 | Malaise | FAERS: 626 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 8 | Stomatitis | FAERS: 609 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 9 | Dysgeusia | FAERS: 607 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 10 | Weight decreased | FAERS: 458 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 11 | Metastatic Renal Cell Carcinoma | FAERS: 411 Canada Vigilance: 5 | Canada Vigilance OFFSIDES US FAERS | |
| 12 | Thrombocytopenia | FAERS: 406 Canada Vigilance: 15 | Canada Vigilance SIDER US FAERS | |
| 13 | Pain | FAERS: 399 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 14 | Oral pain | FAERS: 394 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 15 | Headache | FAERS: 362 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 16 | Dehydration | FAERS: 359 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 17 | Constipation | FAERS: 311 | SIDER US FAERS | |
| 18 | White blood cell count decreased | FAERS: 308 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 19 | Hypothyroidism | FAERS: 284 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 20 | Abdominal Pain | FAERS: 276 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 21 | Dizziness | FAERS: 274 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 22 | Epistaxis | FAERS: 270 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 23 | Dyspepsia | FAERS: 258 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 24 | Pneumonia | FAERS: 248 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 25 | General physical health deterioration | FAERS: 245 | US FAERS | |
| 26 | Abdominal discomfort | FAERS: 237 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 27 | Ascites | FAERS: 233 | OFFSIDES US FAERS | |
| 28 | Dry skin | FAERS: 231 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 29 | Ageusia | FAERS: 226 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 30 | Drug toxicity | FAERS: 219 | OFFSIDES US FAERS | |
| 31 | Toxicity to various agents | FAERS: 219 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Product use issue | FAERS: 192 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | jaundice | FAERS: 180 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 34 | Pruritus | FAERS: 170 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 35 | Back Pain | FAERS: 169 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 36 | Blood creatinine increased | FAERS: 169 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 37 | Myocardial Infarction | FAERS: 169 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 38 | Erythema | FAERS: 155 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 39 | Arthralgia | FAERS: 153 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 40 | Cerebrovascular accident | FAERS: 152 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 41 | Product use in unapproved indication | FAERS: 147 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 42 | Urinary tract infection | FAERS: 147 | SIDER US FAERS | |
| 43 | Chest Pain | FAERS: 143 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 44 | Peripheral swelling | FAERS: 143 | US FAERS | |
| 45 | Respiratory Failure | FAERS: 142 | SIDER US FAERS | |
| 46 | Pancytopenia | FAERS: 140 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 47 | Feeling abnormal | FAERS: 138 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Neutropenia | FAERS: 131 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 49 | Hypotension | FAERS: 124 | US FAERS | |
| 50 | Alopecia | FAERS: 114 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 51 | Chills | FAERS: 112 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 52 | Infection | FAERS: 105 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 53 | Myalgia | FAERS: 105 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 54 | Oropharyngeal pain | FAERS: 105 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 55 | Flatulence | FAERS: 100 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 56 | Abasia | FAERS: 93 | US FAERS | |
| 57 | Drug dose omission | FAERS: 93 | OFFSIDES US FAERS | |
| 58 | Skin Ulcer | FAERS: 93 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Pulmonary Embolism | FAERS: 92 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 60 | Pericardial effusion | FAERS: 91 | SIDER US FAERS | |
| 61 | Sepsis | FAERS: 91 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 62 | Proteinuria | FAERS: 88 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 63 | Joint swelling | FAERS: 85 | US FAERS | |
| 64 | Thrombosis | FAERS: 83 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 65 | Leukopenia | FAERS: 79 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 66 | Somnolence | FAERS: 78 | US FAERS | |
| 67 | Skin lesion | FAERS: 77 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 68 | Burning sensation | FAERS: 75 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Swelling | FAERS: 75 | US FAERS | |
| 70 | Memory impairment | FAERS: 72 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | Aphagia | FAERS: 71 | US FAERS | |
| 72 | Aspartate Aminotransferase Increased | FAERS: 71 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 73 | Nasopharyngitis | FAERS: 71 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 74 | Syncope | FAERS: 71 | US FAERS | |
| 75 | Chromaturia | FAERS: 70 | OFFSIDES SIDER US FAERS | |
| 76 | Influenza | FAERS: 70 | US FAERS | |
| 77 | Renal cancer metastatic | FAERS: 69 | OFFSIDES US FAERS | |
| 78 | Hyperkeratosis | FAERS: 68 | SIDER US FAERS | |
| 79 | Blood sodium decreased | FAERS: 66 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Alanine Aminotransferase Increased | FAERS: 65 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 81 | Intestinal Obstruction | FAERS: 65 | US FAERS | |
| 82 | Blood lactate dehydrogenase increased | FAERS: 63 | US FAERS | |
| 83 | Bone pain | FAERS: 62 | OFFSIDES SIDER US FAERS | |
| 84 | Blood thyroid stimulating hormone increased | FAERS: 59 | OFFSIDES SIDER US FAERS | |
| 85 | Drug ineffective | FAERS: 59 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 86 | Ejection Fraction Decreased | FAERS: 59 | OFFSIDES SIDER US FAERS | |
| 87 | Lethargy | FAERS: 59 | OFFSIDES US FAERS | |
| 88 | Blood urine present | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 89 | Cardiac Arrest | FAERS: 56 | US FAERS | |
| 90 | Diabetes Mellitus | FAERS: 56 | US FAERS | |
| 91 | Hypophagia | FAERS: 55 | US FAERS | |
| 92 | Disorientation | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 93 | Amnesia | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 94 | Blood count abnormal | FAERS: 52 | OFFSIDES US FAERS | |
| 95 | Blood urea increased | FAERS: 52 | US FAERS | |
| 96 | Disseminated Intravascular Coagulation | FAERS: 52 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 97 | Urinary Retention | FAERS: 51 | US FAERS | |
| 98 | Cellulitis | FAERS: 50 | SIDER US FAERS | |
| 99 | Depressed mood | FAERS: 50 | OFFSIDES US FAERS | |
| 100 | Hypertensive crisis | FAERS: 50 | US FAERS | |
| 101 | Anxiety | FAERS: 49 | US FAERS | |
| 102 | Pancreatitis | FAERS: 49 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 103 | Tremor | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 104 | Hyperthyroidism | FAERS: 48 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 105 | Intestinal Perforation | FAERS: 48 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 106 | Dysuria | FAERS: 47 | US FAERS | |
| 107 | Feeling Cold | FAERS: 47 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 108 | Hepatotoxicity | FAERS: 47 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 109 | Bradycardia | FAERS: 46 | OFFSIDES SIDER US FAERS | |
| 110 | No adverse event | FAERS: 46 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 111 | Neutrophil count decreased | FAERS: 45 | US FAERS | |
| 112 | Atrial Fibrillation | FAERS: 44 | US FAERS | |
| 113 | Blood glucose decreased | FAERS: 43 | SIDER US FAERS | |
| 114 | Chest discomfort | FAERS: 43 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 115 | Gastric ulcer | FAERS: 43 | US FAERS | |
| 116 | Hypersensitivity | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 117 | Dysphonia | FAERS: 42 | US FAERS | |
| 118 | Therapy cessation | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 119 | Acne | FAERS: 39 | SIDER US FAERS | |
| 120 | Deep Vein Thrombosis | FAERS: 39 | SIDER US FAERS | |
| 121 | Gastritis | FAERS: 39 | US FAERS | |
| 122 | Musculoskeletal Pain | FAERS: 39 | SIDER US FAERS | |
| 123 | Blood potassium increased | FAERS: 38 | SIDER US FAERS | |
| 124 | Colitis | FAERS: 38 | US FAERS | |
| 125 | furuncle | FAERS: 38 | US FAERS | |
| 126 | Hepatitis | FAERS: 37 | OFFSIDES SIDER US FAERS | |
| 127 | Full blood count decreased | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 128 | Gout | FAERS: 36 | OFFSIDES US FAERS | |
| 129 | Anorexia | FAERS: 35 | SIDER US FAERS | |
| 130 | Bronchitis | FAERS: 35 | SIDER US FAERS | |
| 131 | Cholecystitis | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 132 | Limb injury | FAERS: 35 | OFFSIDES US FAERS | |
| 133 | Blood cholesterol increased | FAERS: 34 | US FAERS | |
| 134 | Delirium | FAERS: 34 | US FAERS | |
| 135 | Nephrotic Syndrome | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 136 | Skin irritation | FAERS: 34 | US FAERS | |
| 137 | Hypersomnia | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 138 | Inflammation | FAERS: 33 | US FAERS | |
| 139 | Mental status changes | FAERS: 33 | OFFSIDES US FAERS | |
| 140 | Palpitations | FAERS: 33 | US FAERS | |
| 141 | Blood creatine phosphokinase increased | FAERS: 32 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 142 | Blood potassium decreased | FAERS: 32 | SIDER US FAERS | |
| 143 | Blood pressure fluctuation | FAERS: 32 | OFFSIDES US FAERS | |
| 144 | Cholelithiasis | FAERS: 32 | US FAERS | |
| 145 | Decreased immune responsiveness | FAERS: 32 | US FAERS | |
| 146 | Hypogeusia | FAERS: 32 | SIDER US FAERS | |
| 147 | Lower respiratory tract infection | FAERS: 32 | SIDER US FAERS | |
| 148 | Malignant neoplasm progression | FAERS: 32 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 149 | Pallor | FAERS: 32 | US FAERS | |
| 150 | Purpura | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Visual Impairment | FAERS: 31 | US FAERS | |
| 152 | Acute myocardial infarction | FAERS: 30 | US FAERS | |
| 153 | Blood alkaline phosphatase increased | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 154 | Blood glucose increased | FAERS: 30 | SIDER US FAERS | |
| 155 | Depressed Level of Consciousness | FAERS: 30 | SIDER US FAERS | |
| 156 | Discomfort | FAERS: 30 | US FAERS | |
| 157 | Pneumothorax | FAERS: 30 | OFFSIDES SIDER US FAERS | |
| 158 | Sudden death | FAERS: 30 | SIDER US FAERS | |
| 159 | Arthritis | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 160 | Blood albumin decreased | FAERS: 29 | OFFSIDES SIDER US FAERS | |
| 161 | Skin reaction | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 162 | Tongue discomfort | FAERS: 29 | US FAERS | |
| 163 | Cataract | FAERS: 28 | US FAERS | |
| 164 | Haematotoxicity | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 165 | Incorrect dose administered | FAERS: 28 | OFFSIDES US FAERS | |
| 166 | Limb discomfort | FAERS: 28 | SIDER US FAERS | |
| 167 | Musculoskeletal stiffness | FAERS: 28 | US FAERS | |
| 168 | Pain of skin | FAERS: 28 | US FAERS | |
| 169 | Skin toxicity | FAERS: 28 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 170 | Acute kidney injury | FAERS: 27 Canada Vigilance: 3 | 20652569 | CTD Canada Vigilance US FAERS |
| 171 | Anal abscess | FAERS: 27 | SIDER US FAERS | |
| 172 | Blood triglycerides increased | FAERS: 27 | US FAERS | |
| 173 | Diverticulitis | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 174 | Performance status decreased | FAERS: 27 | OFFSIDES US FAERS | |
| 175 | Angina Pectoris | FAERS: 26 | 26581635 | CTD US FAERS |
| 176 | Cytopenia | FAERS: 26 | US FAERS | |
| 177 | Glossitis | FAERS: 26 | OFFSIDES SIDER US FAERS | |
| 178 | Lymphadenopathy | FAERS: 26 | US FAERS | |
| 179 | Neck Pain | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 180 | Retching | FAERS: 26 | US FAERS | |
| 181 | Toothache | FAERS: 26 | US FAERS | |
| 182 | Ulcer | FAERS: 26 | US FAERS | |
| 183 | Eructation | FAERS: 25 | SIDER US FAERS | |
| 184 | Febrile Neutropenia | FAERS: 25 | SIDER US FAERS | |
| 185 | Gastroenteritis | FAERS: 25 | OFFSIDES US FAERS | |
| 186 | Osteonecrosis of Jaw | FAERS: 25 | SIDER US FAERS | |
| 187 | Productive Cough | FAERS: 25 | US FAERS | |
| 188 | Vertigo | FAERS: 25 | US FAERS | |
| 189 | Disease recurrence | FAERS: 24 | OFFSIDES US FAERS | |
| 190 | Dysentery | FAERS: 24 | US FAERS | |
| 191 | Gait inability | FAERS: 24 | US FAERS | |
| 192 | Nasal discomfort | FAERS: 24 | US FAERS | |
| 193 | Tumour haemorrhage | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 194 | Altered state of consciousness | FAERS: 23 | US FAERS | |
| 195 | Aphasia | FAERS: 23 | US FAERS | |
| 196 | Blindness | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 197 | Cystitis | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 198 | Fracture | FAERS: 23 | US FAERS | |
| 199 | Hemiparesis | FAERS: 23 | US FAERS | |
| 200 | Tongue blistering | FAERS: 23 | OFFSIDES US FAERS | |
| 201 | Tooth Infection | FAERS: 23 | US FAERS | |
| 202 | Adverse event | FAERS: 22 | OFFSIDES US FAERS | |
| 203 | Agitation | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 204 | Cholangitis | FAERS: 22 | US FAERS | |
| 205 | Electrolyte imbalance | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 206 | Epilepsy | FAERS: 22 | US FAERS | |
| 207 | Gingivitis | FAERS: 22 | SIDER US FAERS | |
| 208 | Hydrothorax | FAERS: 22 | US FAERS | |
| 209 | Hyperchlorhydria | FAERS: 22 | US FAERS | |
| 210 | Lipase increased | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 211 | Oral candidiasis | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 212 | Septic Shock | FAERS: 22 | SIDER US FAERS | |
| 213 | Aphthous Stomatitis | FAERS: 21 | SIDER US FAERS | |
| 214 | Genital rash | FAERS: 21 | US FAERS | |
| 215 | Night sweats | FAERS: 21 | US FAERS | |
| 216 | Pneumonitis | FAERS: 21 | US FAERS | |
| 217 | Tachycardia | FAERS: 21 | US FAERS | |
| 218 | Transaminases increased | FAERS: 21 | US FAERS | |
| 219 | Deafness | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 220 | Duodenal Ulcer | FAERS: 20 | US FAERS | |
| 221 | Gamma-Glutamyltransferase Increased | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 222 | Pancreatic carcinoma | FAERS: 20 | US FAERS | |
| 223 | Abscess | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 224 | Autoimmune thyroiditis | FAERS: 19 | OFFSIDES US FAERS | |
| 225 | Bedridden | FAERS: 19 | US FAERS | |
| 226 | Cardiotoxicity | FAERS: 19 | 26259608 26385865 31445075 | CTD OFFSIDES US FAERS |
| 227 | Ileus | FAERS: 19 | US FAERS | |
| 228 | Leukoencephalopathy | FAERS: 19 | US FAERS | |
| 229 | Lip swelling | FAERS: 19 | US FAERS | |
| 230 | Malnutrition | FAERS: 19 | SIDER US FAERS | |
| 231 | Neuralgia | FAERS: 19 | US FAERS | |
| 232 | Oral mucosal erythema | FAERS: 19 | US FAERS | |
| 233 | Peritonitis | FAERS: 19 | US FAERS | |
| 234 | Post procedural complication | FAERS: 19 | US FAERS | |
| 235 | Renal pain | FAERS: 19 | US FAERS | |
| 236 | Shock | FAERS: 19 | SIDER US FAERS | |
| 237 | Therapy change | FAERS: 19 | US FAERS | |
| 238 | Unevaluable event | FAERS: 19 | US FAERS | |
| 239 | nervous system disorder | FAERS: 19 | SIDER US FAERS | |
| 240 | Arthropathy | FAERS: 18 | US FAERS | |
| 241 | Asphyxia | FAERS: 18 | US FAERS | |
| 242 | Dermatitis | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 243 | Gastrointestinal toxicity | FAERS: 18 | OFFSIDES US FAERS | |
| 244 | Increased tendency to bruise | FAERS: 18 | US FAERS | |
| 245 | Ocular icterus | FAERS: 18 | US FAERS | |
| 246 | Petechiae | FAERS: 18 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 247 | Respiratory distress | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 248 | Pathological fracture | FAERS: 17 | US FAERS | |
| 249 | Presyncope | FAERS: 17 | US FAERS | |
| 250 | Pulmonary congestion | FAERS: 17 | OFFSIDES US FAERS | |
| 251 | Urticaria | FAERS: 17 | US FAERS | |
| 252 | Anal Ulcer | FAERS: 16 | US FAERS | |
| 253 | Flushing | FAERS: 16 | SIDER US FAERS | |
| 254 | Gastrointestinal infection | FAERS: 16 | OFFSIDES US FAERS | |
| 255 | Hemiplegia | FAERS: 16 | US FAERS | |
| 256 | Mood swings | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 257 | Oropharyngeal blistering | FAERS: 16 | OFFSIDES US FAERS | |
| 258 | Pneumatosis intestinalis | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 259 | Product dose omission | FAERS: 16 | US FAERS | |
| 260 | Rash erythematous | FAERS: 16 | SIDER US FAERS | |
| 261 | Rhabdomyolysis | FAERS: 16 | SIDER US FAERS | |
| 262 | Throat irritation | FAERS: 16 | US FAERS | |
| 263 | Wound Infection | FAERS: 16 | OFFSIDES US FAERS | |
| 264 | Abdominal Abscess | FAERS: 15 | SIDER US FAERS | |
| 265 | Anal Fistula | FAERS: 15 | OFFSIDES SIDER US FAERS | |
| 266 | Cachexia | FAERS: 15 | US FAERS | |
| 267 | Choking | FAERS: 15 | US FAERS | |
| 268 | Dysarthria | FAERS: 15 | US FAERS | |
| 269 | Embolism | FAERS: 15 | OFFSIDES SIDER US FAERS | |
| 270 | Hernia | FAERS: 15 | US FAERS | |
| 271 | Large intestine perforation | FAERS: 15 | US FAERS | |
| 272 | Musculoskeletal chest pain | FAERS: 15 | US FAERS | |
| 273 | Nodule | FAERS: 15 | US FAERS | |
| 274 | Posterior reversible encephalopathy syndrome | FAERS: 15 | SIDER US FAERS | |
| 275 | Sinusitis | FAERS: 15 | US FAERS | |
| 276 | Candidiasis | FAERS: 14 | US FAERS | |
| 277 | Cyanosis | FAERS: 14 | US FAERS | |
| 278 | Gastrointestinal perforation | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 279 | Intentional product misuse | FAERS: 14 | US FAERS | |
| 280 | Nephrolithiasis | FAERS: 14 | US FAERS | |
| 281 | Polyneuropathy | FAERS: 14 | US FAERS | |
| 282 | Quality of life decreased | FAERS: 14 | US FAERS | |
| 283 | Activities of daily living impaired | FAERS: 13 | US FAERS | |
| 284 | Anorectal discomfort | FAERS: 13 | US FAERS | |
| 285 | Anuria | FAERS: 13 | US FAERS | |
| 286 | Blood magnesium decreased | FAERS: 13 | SIDER US FAERS | |
| 287 | Cancer Pain | FAERS: 13 | US FAERS | |
| 288 | Diabetes mellitus inadequate control | FAERS: 13 | US FAERS | |
| 289 | Enterocolitis | FAERS: 13 | US FAERS | |
| 290 | Failure to Thrive | FAERS: 13 | OFFSIDES US FAERS | |
| 291 | Necrosis | FAERS: 13 | 19336648 | CTD US FAERS |
| 292 | Nervousness | FAERS: 13 | US FAERS | |
| 293 | Osteomyelitis | FAERS: 13 | SIDER US FAERS | |
| 294 | Protein total decreased | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 295 | Pulmonary thrombosis | FAERS: 13 | US FAERS | |
| 296 | Pyoderma Gangrenosum | FAERS: 13 | OFFSIDES SIDER US FAERS | |
| 297 | Urinary Incontinence | FAERS: 13 | US FAERS | |
| 298 | Ammonia increased | FAERS: 12 | US FAERS | |
| 299 | Anal Fissure | FAERS: 12 | OFFSIDES US FAERS | |
| 300 | Asthma | FAERS: 12 | US FAERS | |
| 301 | Blood iron decreased | FAERS: 12 | US FAERS | |
| 302 | Cardiac enzymes increased | FAERS: 12 | OFFSIDES US FAERS | |
| 303 | Electrocardiogram change | FAERS: 12 | OFFSIDES US FAERS | |
| 304 | Emotional disorder | FAERS: 12 | US FAERS | |
| 305 | Eye pain | FAERS: 12 | US FAERS | |
| 306 | Guillain-Barre Syndrome | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 307 | Hypokinesia | FAERS: 12 | OFFSIDES US FAERS | |
| 308 | Infarction | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 309 | Liver Abscess | FAERS: 12 | SIDER US FAERS | |
| 310 | Monoplegia | FAERS: 12 | US FAERS | |
| 311 | Nephritis | FAERS: 12 | US FAERS | |
| 312 | Pharyngitis | FAERS: 12 | US FAERS | |
| 313 | Plantar erythema | FAERS: 12 | US FAERS | |
| 314 | Pulmonary Fibrosis | FAERS: 12 | US FAERS | |
| 315 | Respiratory arrest | FAERS: 12 | US FAERS | |
| 316 | Restlessness | FAERS: 12 | US FAERS | |
| 317 | Retinal Detachment | FAERS: 12 | US FAERS | |
| 318 | Scab | FAERS: 12 | US FAERS | |
| 319 | Tinnitus | FAERS: 12 | US FAERS | |
| 320 | Blood creatine increased | FAERS: 11 | US FAERS | |
| 321 | Cerebral Infarction | FAERS: 11 | SIDER US FAERS | |
| 322 | Cheilitis | FAERS: 11 | SIDER US FAERS | |
| 323 | Cholestasis | FAERS: 11 | US FAERS | |
| 324 | Cytolytic hepatitis | FAERS: 11 | US FAERS | |
| 325 | Dementia | FAERS: 11 | US FAERS | |
| 326 | Hyperpyrexia | FAERS: 11 | US FAERS | |
| 327 | Pericarditis | FAERS: 11 | US FAERS | |
| 328 | Subcutaneous Abscess | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 329 | Thyroiditis | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 330 | Wound dehiscence | FAERS: 11 | OFFSIDES US FAERS | |
| 331 | Appendicitis | FAERS: 10 | US FAERS | |
| 332 | Blood amylase increased | FAERS: 10 | US FAERS | |
| 333 | Blood blister | FAERS: 10 | US FAERS | |
| 334 | Coronary Artery Disease | FAERS: 10 | US FAERS | |
| 335 | Cyst | FAERS: 10 | US FAERS | |
| 336 | Encephalitis | FAERS: 10 | US FAERS | |
| 337 | Excoriation | FAERS: 10 | OFFSIDES US FAERS | |
| 338 | Eye irritation | FAERS: 10 | US FAERS | |
| 339 | Gingival Recession | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 340 | Mallory-Weiss Syndrome | FAERS: 10 | US FAERS | |
| 341 | Musculoskeletal discomfort | FAERS: 10 | SIDER US FAERS | |
| 342 | Oral infection | FAERS: 10 | OFFSIDES US FAERS | |
| 343 | Skin hypertrophy | FAERS: 10 | US FAERS | |
| 344 | Temperature intolerance | FAERS: 10 | US FAERS | |
| 345 | Therapeutic response unexpected | FAERS: 10 | US FAERS | |
| 346 | Therapy non-responder | FAERS: 10 | US FAERS | |
| 347 | Thermal burn | FAERS: 10 | US FAERS | |
| 348 | Toxic Epidermal Necrolysis | FAERS: 10 | SIDER US FAERS | |
| 349 | Central nervous system lesion | FAERS: 9 | OFFSIDES US FAERS | |
| 350 | Cerebral Thrombosis | FAERS: 9 | OFFSIDES US FAERS | |
| 351 | Clostridium difficile infection | FAERS: 9 | US FAERS | |
| 352 | Ejection fraction abnormal | FAERS: 9 | OFFSIDES US FAERS | |
| 353 | Erectile dysfunction | FAERS: 9 | OFFSIDES US FAERS | |
| 354 | Hydrocephalus | FAERS: 9 | US FAERS | |
| 355 | Incoherent | FAERS: 9 | US FAERS | |
| 356 | Increased upper airway secretion | FAERS: 9 | OFFSIDES US FAERS | |
| 357 | Irritable Bowel Syndrome | FAERS: 9 | US FAERS | |
| 358 | Joint injury | FAERS: 9 | US FAERS | |
| 359 | Loss of personal independence in daily activities | FAERS: 9 | US FAERS | |
| 360 | Myopathy | FAERS: 9 | SIDER US FAERS | |
| 361 | Palmar erythema | FAERS: 9 | OFFSIDES US FAERS | |
| 362 | Priapism | FAERS: 9 | US FAERS | |
| 363 | Proctitis | FAERS: 9 | US FAERS | |
| 364 | Skin Erosion | FAERS: 9 | US FAERS | |
| 365 | Sluggishness | FAERS: 9 | US FAERS | |
| 366 | Vasculitis | FAERS: 9 | US FAERS | |
| 367 | Anal infection | FAERS: 8 | OFFSIDES US FAERS | |
| 368 | Angioedema | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 369 | Aphonia | FAERS: 8 | OFFSIDES US FAERS | |
| 370 | Basal cell carcinoma | FAERS: 8 | US FAERS | |
| 371 | Cardiac Flutter | FAERS: 8 | OFFSIDES US FAERS | |
| 372 | Cholecystitis infective | FAERS: 8 | US FAERS | |
| 373 | Clostridium difficile colitis | FAERS: 8 | US FAERS | |
| 374 | Cold sweat | FAERS: 8 | US FAERS | |
| 375 | Completed Suicide | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 376 | Diplopia | FAERS: 8 | US FAERS | |
| 377 | Eczema | FAERS: 8 | SIDER US FAERS | |
| 378 | Flank Pain | FAERS: 8 | SIDER US FAERS | |
| 379 | Genital erythema | FAERS: 8 | US FAERS | |
| 380 | Hepatic Encephalopathy | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 381 | Hepatitis B | FAERS: 8 | US FAERS | |
| 382 | Immunosuppression | FAERS: 8 | OFFSIDES US FAERS | |
| 383 | Inappropriate schedule of drug administration | FAERS: 8 | US FAERS | |
| 384 | Joint stiffness | FAERS: 8 | US FAERS | |
| 385 | Mastication disorder | FAERS: 8 | OFFSIDES US FAERS | |
| 386 | Metabolic acidosis | FAERS: 8 | US FAERS | |
| 387 | Metastasis | FAERS: 8 | SIDER US FAERS | |
| 388 | Metrorrhagia | FAERS: 8 | SIDER US FAERS | |
| 389 | Portal Vein Thrombosis | FAERS: 8 | US FAERS | |
| 390 | Protein urine present | FAERS: 8 | SIDER US FAERS | |
| 391 | Renal cyst | FAERS: 8 | OFFSIDES US FAERS | |
| 392 | Rhinitis | FAERS: 8 | US FAERS | |
| 393 | Secretion discharge | FAERS: 8 | US FAERS | |
| 394 | Venous Thrombosis | FAERS: 8 | US FAERS | |
| 395 | treatment failure | FAERS: 8 | US FAERS | |
| 396 | Amylase increased | FAERS: 7 | SIDER US FAERS | |
| 397 | Anal inflammation | FAERS: 7 | US FAERS | |
| 398 | Blood creatinine abnormal | FAERS: 7 | US FAERS | |
| 399 | Blood glucose abnormal | FAERS: 7 | OFFSIDES US FAERS | |
| 400 | Blood potassium abnormal | FAERS: 7 | US FAERS | |
| 401 | Bowel movement irregularity | FAERS: 7 | US FAERS | |
| 402 | Bronchopneumonia | FAERS: 7 | US FAERS | |
| 403 | Cerebral atrophy | FAERS: 7 | US FAERS | |
| 404 | Device related infection | FAERS: 7 | US FAERS | |
| 405 | Electrocardiogram abnormal | FAERS: 7 | US FAERS | |
| 406 | Gastrointestinal Pain | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 407 | Hepatomegaly | FAERS: 7 | US FAERS | |
| 408 | Hyperparathyroidism | FAERS: 7 | US FAERS | |
| 409 | Hypoxia | FAERS: 7 | US FAERS | |
| 410 | Intentional product use issue | FAERS: 7 | US FAERS | |
| 411 | Laceration | FAERS: 7 | US FAERS | |
| 412 | Lymphoma | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 413 | Lymphopenia | FAERS: 7 | SIDER US FAERS | |
| 414 | Malignant Hypertension | FAERS: 7 | US FAERS | |
| 415 | Mental impairment | FAERS: 7 | US FAERS | |
| 416 | Mouth swelling | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 417 | Myositis | FAERS: 7 | US FAERS | |
| 418 | Nocturia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 419 | Oral fungal infection | FAERS: 7 | OFFSIDES US FAERS | |
| 420 | Overdose | FAERS: 7 | US FAERS | |
| 421 | Perianal abscess | FAERS: 7 | OFFSIDES US FAERS | |
| 422 | Peritonsillar Abscess | FAERS: 7 | US FAERS | |
| 423 | Poisoning | FAERS: 7 | US FAERS | |
| 424 | Skin necrosis | FAERS: 7 | US FAERS | |
| 425 | Stress | FAERS: 7 | US FAERS | |
| 426 | Terminal state | FAERS: 7 | US FAERS | |
| 427 | Trismus | FAERS: 7 | US FAERS | |
| 428 | Tuberculosis | FAERS: 7 | US FAERS | |
| 429 | Unresponsive to stimuli | FAERS: 7 | US FAERS | |
| 430 | Urinary tract obstruction | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 431 | Atelectasis | FAERS: 6 | US FAERS | |
| 432 | Atrioventricular Block | FAERS: 6 | US FAERS | |
| 433 | Bone fistula | FAERS: 6 | US FAERS | |
| 434 | Circumstance or information capable of leading to medication error | FAERS: 6 | US FAERS | |
| 435 | Conjunctivitis | FAERS: 6 | US FAERS | |
| 436 | Diverticular perforation | FAERS: 6 | US FAERS | |
| 437 | Ecchymosis | FAERS: 6 | US FAERS | |
| 438 | Erysipelas | FAERS: 6 | US FAERS | |
| 439 | Gastrointestinal sounds abnormal | FAERS: 6 | US FAERS | |
| 440 | Gastrointestinal ulcer | FAERS: 6 | US FAERS | |
| 441 | Genital burning sensation | FAERS: 6 | OFFSIDES US FAERS | |
| 442 | Genital pain | FAERS: 6 | OFFSIDES US FAERS | |
| 443 | Immune thrombocytopenic purpura | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 444 | Incontinence | FAERS: 6 | US FAERS | |
| 445 | Mutism | FAERS: 6 | US FAERS | |
| 446 | Oropharyngeal spasm | FAERS: 6 | US FAERS | |
| 447 | Parotitis | FAERS: 6 | US FAERS | |
| 448 | Product quality issue | FAERS: 6 | US FAERS | |
| 449 | Radiation injury | FAERS: 6 | US FAERS | |
| 450 | Reflux gastritis | FAERS: 6 | US FAERS | |
| 451 | Sneezing | FAERS: 6 | US FAERS | |
| 452 | Thyroid cancer metastatic | FAERS: 6 | US FAERS | |
| 453 | Tooth Loss | FAERS: 6 | US FAERS | |
| 454 | VIIth nerve paralysis | FAERS: 6 | US FAERS | |
| 455 | Wheezing | FAERS: 6 | US FAERS | |
| 456 | Accidental exposure | FAERS: 5 | OFFSIDES US FAERS | |
| 457 | Acute respiratory failure | FAERS: 5 | US FAERS | |
| 458 | Aneurysm | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 459 | Aortitis | FAERS: 5 | OFFSIDES US FAERS | |
| 460 | Blood calcium abnormal | FAERS: 5 | OFFSIDES US FAERS | |
| 461 | Blood creatinine decreased | FAERS: 5 | US FAERS | |
| 462 | Blood thyroid stimulating hormone decreased | FAERS: 5 | US FAERS | |
| 463 | Bone marrow toxicity | FAERS: 5 | US FAERS | |
| 464 | Bradyphrenia | FAERS: 5 | US FAERS | |
| 465 | Breakthrough Pain | FAERS: 5 | US FAERS | |
| 466 | Cardiac Tamponade | FAERS: 5 | US FAERS | |
| 467 | Cerebral ventricle dilatation | FAERS: 5 | OFFSIDES US FAERS | |
| 468 | Dental alveolar anomaly | FAERS: 5 | US FAERS | |
| 469 | Ear discomfort | FAERS: 5 | US FAERS | |
| 470 | Enteritis | FAERS: 5 | US FAERS | |
| 471 | Enzyme abnormality | FAERS: 5 | US FAERS | |
| 472 | Extremity necrosis | FAERS: 5 | US FAERS | |
| 473 | Facial Pain | FAERS: 5 | US FAERS | |
| 474 | Facial paralysis | FAERS: 5 | US FAERS | |
| 475 | Gangrene | FAERS: 5 | US FAERS | |
| 476 | Gastric infection | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 477 | General physical condition abnormal | FAERS: 5 | US FAERS | |
| 478 | Genital discomfort | FAERS: 5 | US FAERS | |
| 479 | Glomerulonephritis | FAERS: 5 | US FAERS | |
| 480 | Hepatic Infection | FAERS: 5 | US FAERS | |
| 481 | Hepatitis C | FAERS: 5 | US FAERS | |
| 482 | Impaired driving ability | FAERS: 5 | US FAERS | |
| 483 | Intervertebral disc disorder | FAERS: 5 | OFFSIDES US FAERS | |
| 484 | Low Cardiac Output Syndrome | FAERS: 5 | OFFSIDES US FAERS | |
| 485 | MYELODYSPLASTIC SYNDROME | FAERS: 5 | US FAERS | |
| 486 | Menorrhagia | FAERS: 5 | US FAERS | |
| 487 | Monocyte count increased | FAERS: 5 | US FAERS | |
| 488 | Myasthenia Gravis | FAERS: 5 | OFFSIDES US FAERS | |
| 489 | Myocardial necrosis marker increased | FAERS: 5 | US FAERS | |
| 490 | Myocarditis | FAERS: 5 | US FAERS | |
| 491 | Onychoclasis | FAERS: 5 | US FAERS | |
| 492 | Open wound | FAERS: 5 | US FAERS | |
| 493 | Oral mucosal eruption | FAERS: 5 | US FAERS | |
| 494 | Platelet count abnormal | FAERS: 5 | OFFSIDES US FAERS | |
| 495 | Poor quality sleep | FAERS: 5 | US FAERS | |
| 496 | Post procedural infection | FAERS: 5 | OFFSIDES US FAERS | |
| 497 | Procedural complication | FAERS: 5 | US FAERS | |
| 498 | Renal tubular necrosis | FAERS: 5 | US FAERS | |
| 499 | Scrotal erythema | FAERS: 5 | US FAERS | |
| 500 | Secondary hypothyroidism | FAERS: 5 | US FAERS | |
| 501 | Squamous cell carcinoma | FAERS: 5 | US FAERS | |
| 502 | Suicide attempt | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 503 | Thrombocytopenic purpura | FAERS: 5 | US FAERS | |
| 504 | Tonsillitis | FAERS: 5 | US FAERS | |
| 505 | Uterine Cancer | FAERS: 5 | US FAERS | |
| 506 | Vascular insufficiency | FAERS: 5 | US FAERS | |
| 507 | Ventricular Dysfunction | FAERS: 5 | US FAERS | |
| 508 | Walking aid user | FAERS: 5 | OFFSIDES US FAERS | |
| 509 | Abdominal Infection | FAERS: 4 | US FAERS | |
| 510 | Acute Coronary Syndrome | FAERS: 4 | SIDER US FAERS | |
| 511 | Alveolar Soft Part Sarcoma | FAERS: 4 | US FAERS | |
| 512 | Anger | FAERS: 4 | OFFSIDES US FAERS | |
| 513 | Angular cheilitis | FAERS: 4 | US FAERS | |
| 514 | Anosmia | FAERS: 4 | US FAERS | |
| 515 | Aortic Aneurysm | FAERS: 4 | US FAERS | |
| 516 | Ataxia | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 517 | Back disorder | FAERS: 4 | US FAERS | |
| 518 | Benign Prostatic Hyperplasia | FAERS: 4 | US FAERS | |
| 519 | Biliary Colic | FAERS: 4 | US FAERS | |
| 520 | Blood bilirubin abnormal | FAERS: 4 | US FAERS | |
| 521 | Blood phosphorus increased | FAERS: 4 | OFFSIDES US FAERS | |
| 522 | Blood product transfusion dependent | FAERS: 4 | OFFSIDES US FAERS | |
| 523 | Bronchial Obstruction | FAERS: 4 | US FAERS | |
| 524 | Bursitis | FAERS: 4 | US FAERS | |
| 525 | Crying | FAERS: 4 | US FAERS | |
| 526 | Diplegia | FAERS: 4 | US FAERS | |
| 527 | Disease complication | FAERS: 4 | OFFSIDES US FAERS | |
| 528 | Dyschezia | FAERS: 4 | OFFSIDES US FAERS | |
| 529 | Emphysematous Cholecystitis | FAERS: 4 | OFFSIDES US FAERS | |
| 530 | Escherichia infection | FAERS: 4 | OFFSIDES US FAERS | |
| 531 | Expired product administered | FAERS: 4 | US FAERS | |
| 532 | Full blood count abnormal | FAERS: 4 | US FAERS | |
| 533 | Gastrointestinal carcinoma | FAERS: 4 | US FAERS | |
| 534 | Hydronephrosis | FAERS: 4 | US FAERS | |
| 535 | Hypertensive Encephalopathy | FAERS: 4 | US FAERS | |
| 536 | Immobile | FAERS: 4 | US FAERS | |
| 537 | Inappropriate schedule of product administration | FAERS: 4 | US FAERS | |
| 538 | Increased viscosity of bronchial secretion | FAERS: 4 | US FAERS | |
| 539 | Lung Abscess | FAERS: 4 | US FAERS | |
| 540 | Megacolon | FAERS: 4 | US FAERS | |
| 541 | Metastatic pain | FAERS: 4 | US FAERS | |
| 542 | Nail bed disorder | FAERS: 4 | US FAERS | |
| 543 | Nephritic syndrome | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 544 | Neutropenic sepsis | FAERS: 4 | OFFSIDES US FAERS | |
| 545 | Noninfective encephalitis | FAERS: 4 | US FAERS | |
| 546 | Oncologic complication | FAERS: 4 | US FAERS | |
| 547 | Oral mucosal exfoliation | FAERS: 4 | US FAERS | |
| 548 | Pancreatic enzymes increased | FAERS: 4 | US FAERS | |
| 549 | Pelvic Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 550 | Phlebitis | FAERS: 4 | US FAERS | |
| 551 | Pleurisy | FAERS: 4 | US FAERS | |
| 552 | Pneumopericardium | FAERS: 4 | US FAERS | |
| 553 | Pneumoperitoneum | FAERS: 4 | US FAERS | |
| 554 | Product storage error | FAERS: 4 | US FAERS | |
| 555 | Psoriasis | FAERS: 4 | OFFSIDES US FAERS | |
| 556 | Pulmonary Hypertension | FAERS: 4 | US FAERS | |
| 557 | Radiation Pneumonitis | FAERS: 4 | US FAERS | |
| 558 | Recall phenomenon | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 559 | Rectal abscess | FAERS: 4 | SIDER US FAERS | |
| 560 | Regurgitation | FAERS: 4 | US FAERS | |
| 561 | Renal tubular disorder | FAERS: 4 | OFFSIDES US FAERS | |
| 562 | Respiratory tract congestion | FAERS: 4 | US FAERS | |
| 563 | Rotator cuff syndrome | FAERS: 4 | US FAERS | |
| 564 | Sinus bradycardia | FAERS: 4 | US FAERS | |
| 565 | Slow speech | FAERS: 4 | US FAERS | |
| 566 | Small intestine carcinoma | FAERS: 4 | US FAERS | |
| 567 | Supraventricular tachycardia | FAERS: 4 | OFFSIDES US FAERS | |
| 568 | Thirst | FAERS: 4 | US FAERS | |
| 569 | Tongue exfoliation | FAERS: 4 | US FAERS | |
| 570 | Troponin increased | FAERS: 4 | US FAERS | |
| 571 | Wrong drug administered | FAERS: 4 | US FAERS | |
| 572 | effusion | FAERS: 4 | OFFSIDES US FAERS | |
| 573 | skin abrasion | FAERS: 4 | US FAERS | |
| 574 | Abdominal adhesions | FAERS: 3 | US FAERS | |
| 575 | Acidosis | FAERS: 3 | OFFSIDES US FAERS | |
| 576 | Actinomycosis | FAERS: 3 | US FAERS | |
| 577 | Alveolitis | FAERS: 3 | US FAERS | |
| 578 | Amyotrophic Lateral Sclerosis | FAERS: 3 | US FAERS | |
| 579 | Anal discomfort | FAERS: 3 | OFFSIDES US FAERS | |
| 580 | Apparent death | FAERS: 3 | US FAERS | |
| 581 | Arterial thrombosis | FAERS: 3 | US FAERS | |
| 582 | Arthropod bite | FAERS: 3 | US FAERS | |
| 583 | Atrial thrombosis | FAERS: 3 | US FAERS | |
| 584 | Blood pressure inadequately controlled | FAERS: 3 | US FAERS | |
| 585 | Blood thyroid stimulating hormone abnormal | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 586 | Body temperature fluctuation | FAERS: 3 | US FAERS | |
| 587 | Brain Death | FAERS: 3 | US FAERS | |
| 588 | Carbon dioxide increased | FAERS: 3 | US FAERS | |
| 589 | Cardiomegaly | FAERS: 3 | 24247421 26581635 | CTD US FAERS |
| 590 | Cardiovascular insufficiency | FAERS: 3 | US FAERS | |
| 591 | Carotid artery occlusion | FAERS: 3 | US FAERS | |
| 592 | Catheter related infection | FAERS: 3 | US FAERS | |
| 593 | Colonic fistula | FAERS: 3 | OFFSIDES US FAERS | |
| 594 | Creatinine renal clearance increased | FAERS: 3 | OFFSIDES US FAERS | |
| 595 | Dengue Fever | FAERS: 3 | US FAERS | |
| 596 | Dermatitis acneiform | FAERS: 3 | US FAERS | |
| 597 | Diverticulum | FAERS: 3 | US FAERS | |
| 598 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 599 | Drug ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 600 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 601 | Dysgraphia | FAERS: 3 | US FAERS | |
| 602 | Endocarditis | FAERS: 3 | OFFSIDES US FAERS | |
| 603 | Eosinophilia | FAERS: 3 | US FAERS | |
| 604 | Erythema Multiforme | FAERS: 3 | SIDER US FAERS | |
| 605 | Escherichia urinary tract infection | FAERS: 3 | US FAERS | |
| 606 | Essential Hypertension | FAERS: 3 | US FAERS | |
| 607 | Extra dose administered | FAERS: 3 | US FAERS | |
| 608 | Eye Infection | FAERS: 3 | US FAERS | |
| 609 | Eye allergy | FAERS: 3 | US FAERS | |
| 610 | Fibromyalgia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 611 | Fluid overload | FAERS: 3 | US FAERS | |
| 612 | Formication | FAERS: 3 | US FAERS | |
| 613 | Frustration | FAERS: 3 | US FAERS | |
| 614 | Gastroenteritis norovirus | FAERS: 3 | US FAERS | |
| 615 | Genital infection fungal | FAERS: 3 | US FAERS | |
| 616 | Groin infection | FAERS: 3 | US FAERS | |
| 617 | Heat Stroke | FAERS: 3 | US FAERS | |
| 618 | Hepatic congestion | FAERS: 3 | US FAERS | |
| 619 | Hunger | FAERS: 3 | US FAERS | |
| 620 | Hypercreatininaemia | FAERS: 3 | US FAERS | |
| 621 | Hypertransaminasaemia | FAERS: 3 | US FAERS | |
| 622 | Hypocapnia | FAERS: 3 | US FAERS | |
| 623 | Incision site pain | FAERS: 3 | US FAERS | |
| 624 | Intermittent Claudication | FAERS: 3 | US FAERS | |
| 625 | Intestinal Fistula | FAERS: 3 | US FAERS | |
| 626 | Investigation abnormal | FAERS: 3 | US FAERS | |
| 627 | Iron deficiency | FAERS: 3 | US FAERS | |
| 628 | Lipase abnormal | FAERS: 3 | OFFSIDES US FAERS | |
| 629 | Lobar Pneumonia | FAERS: 3 | US FAERS | |
| 630 | Loose tooth | FAERS: 3 | OFFSIDES US FAERS | |
| 631 | Lymphocyte count decreased | FAERS: 3 | SIDER US FAERS | |
| 632 | Lymphocyte count increased | FAERS: 3 | US FAERS | |
| 633 | Lymphocytosis | FAERS: 3 | OFFSIDES US FAERS | |
| 634 | Mantle cell lymphoma | FAERS: 3 | OFFSIDES US FAERS | |
| 635 | Medical device complication | FAERS: 3 | US FAERS | |
| 636 | Medication Error | FAERS: 3 | US FAERS | |
| 637 | Middle insomnia | FAERS: 3 | US FAERS | |
| 638 | Muscle strain | FAERS: 3 | US FAERS | |
| 639 | Nasal pruritus | FAERS: 3 | US FAERS | |
| 640 | No adverse effect | FAERS: 3 | OFFSIDES US FAERS | |
| 641 | Noninfective gingivitis | FAERS: 3 | US FAERS | |
| 642 | Nutritional condition abnormal | FAERS: 3 | US FAERS | |
| 643 | Occult blood positive | FAERS: 3 | US FAERS | |
| 644 | Optic Neuropathy | FAERS: 3 | US FAERS | |
| 645 | Osteoporosis | FAERS: 3 | US FAERS | |
| 646 | Papule | FAERS: 3 | US FAERS | |
| 647 | Paraplegia | FAERS: 3 | US FAERS | |
| 648 | Penile blister | FAERS: 3 | US FAERS | |
| 649 | Penile exfoliation | FAERS: 3 | US FAERS | |
| 650 | Periodontitis | FAERS: 3 | US FAERS | |
| 651 | Peripheral arterial occlusive disease | FAERS: 3 | US FAERS | |
| 652 | Pharyngotonsillitis | FAERS: 3 | OFFSIDES US FAERS | |
| 653 | Phlebitis deep | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 654 | Photophobia | FAERS: 3 | US FAERS | |
| 655 | Pleuritic pain | FAERS: 3 | US FAERS | |
| 656 | Pneumobilia | FAERS: 3 | US FAERS | |
| 657 | Protein total abnormal | FAERS: 3 | US FAERS | |
| 658 | Pulmonary arterial hypertension | FAERS: 3 | OFFSIDES US FAERS | |
| 659 | Pulmonary necrosis | FAERS: 3 | US FAERS | |
| 660 | Pulmonary sepsis | FAERS: 3 | US FAERS | |
| 661 | Purulence | FAERS: 3 | US FAERS | |
| 662 | Purulent discharge | FAERS: 3 | US FAERS | |
| 663 | Quadriplegia | FAERS: 3 | US FAERS | |
| 664 | Radiation skin injury | FAERS: 3 | US FAERS | |
| 665 | Right ventricular failure | FAERS: 3 | US FAERS | |
| 666 | Sarcoma | FAERS: 3 | US FAERS | |
| 667 | Scrotal Infection | FAERS: 3 | OFFSIDES US FAERS | |
| 668 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 669 | Stevens-Johnson Syndrome | FAERS: 3 | SIDER US FAERS | |
| 670 | Sunburn | FAERS: 3 | US FAERS | |
| 671 | Swelling of eyelid | FAERS: 3 | US FAERS | |
| 672 | Tachyarrhythmia | FAERS: 3 | US FAERS | |
| 673 | Tachyphylaxis | FAERS: 3 | OFFSIDES US FAERS | |
| 674 | Tongue erythema | FAERS: 3 | US FAERS | |
| 675 | Umbilical hernia | FAERS: 3 | US FAERS | |
| 676 | Vaginal Discharge | FAERS: 3 | US FAERS | |
| 677 | Vaginal Fistula | FAERS: 3 | OFFSIDES US FAERS | |
| 678 | Vaginal burning sensation | FAERS: 3 | OFFSIDES US FAERS | |
| 679 | Vascular encephalopathy | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 680 | Venous thrombosis limb | FAERS: 3 | US FAERS | |
| 681 | Viral upper respiratory tract infection | FAERS: 3 | US FAERS | |
| 682 | Visual disturbance | FAERS: 3 | US FAERS | |
| 683 | Vulvovaginal discomfort | FAERS: 3 | US FAERS | |
| 684 | Vulvovaginal pruritus | FAERS: 3 | US FAERS | |
| 685 | White blood cell count abnormal | FAERS: 3 | OFFSIDES US FAERS | |
| 686 | Wound Complication | FAERS: 3 | US FAERS | |
| 687 | Wound decomposition | FAERS: 3 | US FAERS | |
| 688 | Wrong technique in drug usage process | FAERS: 3 | US FAERS | |
| 689 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 690 | Abortion early | FAERS: 2 | OFFSIDES US FAERS | |
| 691 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 692 | Accidental overdose | FAERS: 2 | US FAERS | |
| 693 | Acquired phimosis | FAERS: 2 | US FAERS | |
| 694 | Agranulocytosis | FAERS: 2 | US FAERS | |
| 695 | Akathisia | FAERS: 2 | US FAERS | |
| 696 | Anal erosion | FAERS: 2 | US FAERS | |
| 697 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 698 | Anastomotic Leak | FAERS: 2 | OFFSIDES US FAERS | |
| 699 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 700 | Arteriosclerosis | FAERS: 2 | US FAERS | |
| 701 | Arteritis | FAERS: 2 | OFFSIDES US FAERS | |
| 702 | Atrial tachycardia | FAERS: 2 | US FAERS | |
| 703 | Bacterial test positive | FAERS: 2 | US FAERS | |
| 704 | Bile Duct Stenosis | FAERS: 2 | US FAERS | |
| 705 | Biliary dilatation | FAERS: 2 | US FAERS | |
| 706 | Biliary sepsis | FAERS: 2 | US FAERS | |
| 707 | Biliary tract infection | FAERS: 2 | US FAERS | |
| 708 | Blepharitis | FAERS: 2 | US FAERS | |
| 709 | Blepharospasm | FAERS: 2 | US FAERS | |
| 710 | Blood bilirubin unconjugated increased | FAERS: 2 | US FAERS | |
| 711 | Blood cholesterol abnormal | FAERS: 2 | US FAERS | |
| 712 | Blood electrolytes abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 713 | Blood glucose fluctuation | FAERS: 2 | US FAERS | |
| 714 | Blood triglycerides abnormal | FAERS: 2 | US FAERS | |
| 715 | Bone abscess | FAERS: 2 | US FAERS | |
| 716 | Brain natriuretic peptide increased | FAERS: 2 | US FAERS | |
| 717 | Bronchospasm | FAERS: 2 | US FAERS | |
| 718 | Burning feet syndrome | FAERS: 2 | US FAERS | |
| 719 | Capillary Leak Syndrome | FAERS: 2 | US FAERS | |
| 720 | Cardiac Death | FAERS: 2 | OFFSIDES US FAERS | |
| 721 | Cardiac discomfort | FAERS: 2 | US FAERS | |
| 722 | Cardiac dysfunction | FAERS: 2 | US FAERS | |
| 723 | Carpal Tunnel Syndrome | FAERS: 2 | US FAERS | |
| 724 | Catarrh | FAERS: 2 | US FAERS | |
| 725 | Cell Death | FAERS: 2 | US FAERS | |
| 726 | Chemical injury | FAERS: 2 | US FAERS | |
| 727 | Choking sensation | FAERS: 2 | US FAERS | |
| 728 | Chronic gastritis | FAERS: 2 | US FAERS | |
| 729 | Coagulation factor increased | FAERS: 2 | OFFSIDES US FAERS | |
| 730 | Coagulation test abnormal | FAERS: 2 | US FAERS | |
| 731 | Cutis Laxa | FAERS: 2 | US FAERS | |
| 732 | Demyelination | FAERS: 2 | OFFSIDES US FAERS | |
| 733 | Dental discomfort | FAERS: 2 | US FAERS | |
| 734 | Depression suicidal | FAERS: 2 | US FAERS | |
| 735 | Device Failure | FAERS: 2 | US FAERS | |
| 736 | Device occlusion | FAERS: 2 | US FAERS | |
| 737 | Drug Dependence | FAERS: 2 | US FAERS | |
| 738 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 739 | Drug resistance | FAERS: 2 | US FAERS | |
| 740 | Duodenal fistula | FAERS: 2 | US FAERS | |
| 741 | Duodenitis | FAERS: 2 | US FAERS | |
| 742 | Ecthyma | FAERS: 2 | US FAERS | |
| 743 | Embolic stroke | FAERS: 2 | OFFSIDES US FAERS | |
| 744 | Emotional distress | FAERS: 2 | US FAERS | |
| 745 | Empyema | FAERS: 2 | US FAERS | |
| 746 | Enterocutaneous Fistula | FAERS: 2 | OFFSIDES US FAERS | |
| 747 | Enterovesical Fistula | FAERS: 2 | OFFSIDES US FAERS | |
| 748 | Erosive Duodenitis | FAERS: 2 | US FAERS | |
| 749 | Erythropenia | FAERS: 2 | US FAERS | |
| 750 | Eschar | FAERS: 2 | US FAERS | |
| 751 | Exposure to body fluid | FAERS: 2 | US FAERS | |
| 752 | Exsanguination | FAERS: 2 | US FAERS | |
| 753 | Eye inflammation | FAERS: 2 | US FAERS | |
| 754 | Feeling jittery | FAERS: 2 | US FAERS | |
| 755 | Fluid intake restriction | FAERS: 2 | US FAERS | |
| 756 | Food Allergy | FAERS: 2 | OFFSIDES US FAERS | |
| 757 | Food Poisoning | FAERS: 2 | US FAERS | |
| 758 | Gallbladder necrosis | FAERS: 2 | OFFSIDES US FAERS | |
| 759 | Gastric Dilatation | FAERS: 2 | US FAERS | |
| 760 | Gastrointestinal inflammation | FAERS: 2 | OFFSIDES US FAERS | |
| 761 | Gastrointestinal motility disorder | FAERS: 2 | US FAERS | |
| 762 | Gastrointestinal obstruction | FAERS: 2 | US FAERS | |
| 763 | Gingival erythema | FAERS: 2 | US FAERS | |
| 764 | Haptoglobin Decreased | FAERS: 2 | US FAERS | |
| 765 | Hepatic necrosis | FAERS: 2 | US FAERS | |
| 766 | Hernia pain | FAERS: 2 | US FAERS | |
| 767 | Histiocytosis haematophagic | FAERS: 2 | US FAERS | |
| 768 | Hospice Care | FAERS: 2 | US FAERS | |
| 769 | Hyperphagia | FAERS: 2 | US FAERS | |
| 770 | Hypertensive heart disease | FAERS: 2 | US FAERS | |
| 771 | Hyperventilation | FAERS: 2 | US FAERS | |
| 772 | Hypoaesthesia facial | FAERS: 2 | OFFSIDES US FAERS | |
| 773 | Hypogonadism | FAERS: 2 | US FAERS | |
| 774 | Hypohidrosis | FAERS: 2 | US FAERS | |
| 775 | Hypophysitis | FAERS: 2 | US FAERS | |
| 776 | Hyposideraemia | FAERS: 2 | US FAERS | |
| 777 | Impaired gastric emptying | FAERS: 2 | US FAERS | |
| 778 | Impaired self-care | FAERS: 2 | US FAERS | |
| 779 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 780 | Infected neoplasm | FAERS: 2 | US FAERS | |
| 781 | Infection in an immunocompromised host | FAERS: 2 | US FAERS | |
| 782 | Infectious pleural effusion | FAERS: 2 | US FAERS | |
| 783 | Infrequent bowel movements | FAERS: 2 | US FAERS | |
| 784 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 785 | Intervertebral Disc Degeneration | FAERS: 2 | US FAERS | |
| 786 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 787 | Leukocytosis | FAERS: 2 | US FAERS | |
| 788 | Limb operation | FAERS: 2 | US FAERS | |
| 789 | Liver sarcoidosis | FAERS: 2 | US FAERS | |
| 790 | Lymphangiosis carcinomatosa | FAERS: 2 | US FAERS | |
| 791 | Macroglossia | FAERS: 2 | OFFSIDES US FAERS | |
| 792 | Macular degeneration | FAERS: 2 | US FAERS | |
| 793 | Malaria | FAERS: 2 | US FAERS | |
| 794 | Malignant tumour excision | FAERS: 2 | US FAERS | |
| 795 | Meningeal disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 796 | Meningioma | FAERS: 2 | US FAERS | |
| 797 | Meningitis | FAERS: 2 | US FAERS | |
| 798 | Mesenteric arteriosclerosis | FAERS: 2 | US FAERS | |
| 799 | Mesothelioma | FAERS: 2 | US FAERS | |
| 800 | Metabolic function test abnormal | FAERS: 2 | US FAERS | |
| 801 | Metastatic Neoplasm | FAERS: 2 | OFFSIDES US FAERS | |
| 802 | Mineral deficiency | FAERS: 2 | US FAERS | |
| 803 | Motion Sickness | FAERS: 2 | US FAERS | |
| 804 | Multiple Sclerosis | FAERS: 2 | US FAERS | |
| 805 | Myoclonus | FAERS: 2 | US FAERS | |
| 806 | Nephrectomy | FAERS: 2 | OFFSIDES US FAERS | |
| 807 | Nerve Root Compression | FAERS: 2 | US FAERS | |
| 808 | Neuropathy | FAERS: 2 | US FAERS | |
| 809 | Non-cardiac chest pain | FAERS: 2 | OFFSIDES US FAERS | |
| 810 | Nuchal Rigidity | FAERS: 2 | US FAERS | |
| 811 | Oliguria | FAERS: 2 | US FAERS | |
| 812 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 813 | Oral discharge | FAERS: 2 | US FAERS | |
| 814 | Orchitis | FAERS: 2 | US FAERS | |
| 815 | Oropharyngeal candidiasis | FAERS: 2 | US FAERS | |
| 816 | Oropharyngeal discomfort | FAERS: 2 | US FAERS | |
| 817 | Orthostatic hypertension | FAERS: 2 | US FAERS | |
| 818 | Ovarian clear cell carcinoma | FAERS: 2 | US FAERS | |
| 819 | Oxygen saturation abnormal | FAERS: 2 | US FAERS | |
| 820 | Pancreatic Fistula | FAERS: 2 | US FAERS | |
| 821 | Pancreatic duct obstruction | FAERS: 2 | US FAERS | |
| 822 | Paranasal sinus discomfort | FAERS: 2 | US FAERS | |
| 823 | Paraparesis | FAERS: 2 | US FAERS | |
| 824 | Pelvic Infection | FAERS: 2 | US FAERS | |
| 825 | Pelvic abscess | FAERS: 2 | US FAERS | |
| 826 | Perineal erythema | FAERS: 2 | US FAERS | |
| 827 | Periproctitis | FAERS: 2 | OFFSIDES US FAERS | |
| 828 | Peritoneal perforation | FAERS: 2 | US FAERS | |
| 829 | Personality Change | FAERS: 2 | US FAERS | |
| 830 | Physical disability | FAERS: 2 | US FAERS | |
| 831 | Pilonidal Cyst | FAERS: 2 | US FAERS | |
| 832 | Polydipsia | FAERS: 2 | US FAERS | |
| 833 | Polyuria | FAERS: 2 | OFFSIDES US FAERS | |
| 834 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 835 | Pre-existing condition improved | FAERS: 2 | US FAERS | |
| 836 | Primary Hypothyroidism | FAERS: 2 | SIDER US FAERS | |
| 837 | Proctocolitis | FAERS: 2 | OFFSIDES US FAERS | |
| 838 | Product expiration date issue | FAERS: 2 | US FAERS | |
| 839 | Product label issue | FAERS: 2 | US FAERS | |
| 840 | Product physical issue | FAERS: 2 | US FAERS | |
| 841 | Prothrombin level decreased | FAERS: 2 | US FAERS | |
| 842 | Pulmonary Infarction | FAERS: 2 | US FAERS | |
| 843 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 844 | Pyuria | FAERS: 2 | US FAERS | |
| 845 | Quadriparesis | FAERS: 2 | OFFSIDES US FAERS | |
| 846 | Renal abscess | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 847 | Renal vascular thrombosis | FAERS: 2 | US FAERS | |
| 848 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 849 | Rhinalgia | FAERS: 2 | US FAERS | |
| 850 | Sciatica | FAERS: 2 | US FAERS | |
| 851 | Senile dementia | FAERS: 2 | US FAERS | |
| 852 | Sensitivity to weather change | FAERS: 2 | US FAERS | |
| 853 | Seroma | FAERS: 2 | US FAERS | |
| 854 | Sight disability | FAERS: 2 | US FAERS | |
| 855 | Skeletal injury | FAERS: 2 | US FAERS | |
| 856 | Skin Induration | FAERS: 2 | US FAERS | |
| 857 | Skin Papilloma | FAERS: 2 | US FAERS | |
| 858 | Skin Wrinkling | FAERS: 2 | US FAERS | |
| 859 | Spinal column stenosis | FAERS: 2 | US FAERS | |
| 860 | Squamous cell carcinoma of skin | FAERS: 2 | US FAERS | |
| 861 | Subclavian artery thrombosis | FAERS: 2 | OFFSIDES US FAERS | |
| 862 | Superinfection | FAERS: 2 | US FAERS | |
| 863 | Suspected counterfeit product | FAERS: 2 | US FAERS | |
| 864 | Systolic dysfunction | FAERS: 2 | US FAERS | |
| 865 | Temporal Arteritis | FAERS: 2 | US FAERS | |
| 866 | Throat clearing | FAERS: 2 | US FAERS | |
| 867 | Time perception altered | FAERS: 2 | US FAERS | |
| 868 | Tinea Pedis | FAERS: 2 | US FAERS | |
| 869 | Tooth Extraction | FAERS: 2 | US FAERS | |
| 870 | Toxic Shock Syndrome | FAERS: 2 | US FAERS | |
| 871 | Tracheal Stenosis | FAERS: 2 | OFFSIDES US FAERS | |
| 872 | Transferrin decreased | FAERS: 2 | US FAERS | |
| 873 | Trichodynia | FAERS: 2 | US FAERS | |
| 874 | Underweight | FAERS: 2 | US FAERS | |
| 875 | Unresponsive to verbal stimuli | FAERS: 2 | US FAERS | |
| 876 | Upper respiratory tract inflammation | FAERS: 2 | US FAERS | |
| 877 | Vascular bypass dysfunction | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 878 | Vasculitic rash | FAERS: 2 | US FAERS | |
| 879 | Venous Injury | FAERS: 2 | US FAERS | |
| 880 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 881 | Vocal Cord Paralysis | FAERS: 2 | US FAERS | |
| 882 | Vulvovaginal pain | FAERS: 2 | US FAERS | |
| 883 | Waist circumference increased | FAERS: 2 | US FAERS | |
| 884 | ADAMTS13 activity decreased | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 885 | ATRIAL ENLARGEMENT | FAERS: 1 | US FAERS | |
| 886 | Abdominal mass | FAERS: 1 | US FAERS | |
| 887 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 888 | Abdominal wall neoplasm malignant | FAERS: 1 | US FAERS | |
| 889 | Abscess of salivary gland | FAERS: 1 | US FAERS | |
| 890 | Acquired diaphragmatic eventration | FAERS: 1 | US FAERS | |
| 891 | Adrenal mass | FAERS: 1 | US FAERS | |
| 892 | Agraphia | FAERS: 1 | US FAERS | |
| 893 | Albuminuria | FAERS: 1 | US FAERS | |
| 894 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 895 | Ammonia decreased | FAERS: 1 | US FAERS | |
| 896 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 897 | Anastomotic complication | FAERS: 1 | US FAERS | |
| 898 | Angiodysplasia | FAERS: 1 | US FAERS | |
| 899 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 900 | Animal bite | FAERS: 1 | US FAERS | |
| 901 | Anti-platelet antibody positive | FAERS: 1 | US FAERS | |
| 902 | Antifungal treatment | FAERS: 1 | US FAERS | |
| 903 | Aortic Injury | FAERS: 1 | US FAERS | |
| 904 | Aortic Rupture | FAERS: 1 | US FAERS | |
| 905 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 906 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 907 | Apathy | FAERS: 1 | US FAERS | |
| 908 | Application site ulcer | FAERS: 1 | US FAERS | |
| 909 | Arterial Injury | FAERS: 1 | US FAERS | |
| 910 | Arteriovenous fistula site complication | FAERS: 1 | US FAERS | |
| 911 | Arteriovenous fistula | FAERS: 1 | US FAERS | |
| 912 | Aspergillosis | FAERS: 1 | OFFSIDES US FAERS | |
| 913 | Asthenopia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 914 | Astringent therapy | FAERS: 1 | US FAERS | |
| 915 | Atrial Flutter | FAERS: 1 | OFFSIDES US FAERS | |
| 916 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 917 | Bacteria blood identified | FAERS: 1 | US FAERS | |
| 918 | Bacteria stool identified | FAERS: 1 | US FAERS | |
| 919 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 920 | Bacteriuria | FAERS: 1 | US FAERS | |
| 921 | Benign Neoplasm | FAERS: 1 | US FAERS | |
| 922 | Benign neoplasm of thyroid gland | FAERS: 1 | US FAERS | |
| 923 | Bile output increased | FAERS: 1 | US FAERS | |
| 924 | Bilirubin conjugated abnormal | FAERS: 1 | US FAERS | |
| 925 | Biopsy | FAERS: 1 | US FAERS | |
| 926 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 927 | Bladder tamponade | FAERS: 1 | US FAERS | |
| 928 | Blister rupture | FAERS: 1 | US FAERS | |
| 929 | Blood Pressure | FAERS: 1 | US FAERS | |
| 930 | Blood albumin increased | FAERS: 1 | US FAERS | |
| 931 | Blood albumin | FAERS: 1 | OFFSIDES US FAERS | |
| 932 | Blood calcitonin increased | FAERS: 1 | US FAERS | |
| 933 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 934 | Blood corticotrophin abnormal | FAERS: 1 | US FAERS | |
| 935 | Blood creatine abnormal | FAERS: 1 | US FAERS | |
| 936 | Blood erythropoietin increased | FAERS: 1 | US FAERS | |
| 937 | Blood gastrin increased | FAERS: 1 | US FAERS | |
| 938 | Blood iron increased | FAERS: 1 | US FAERS | |
| 939 | Blood lactate dehydrogenase abnormal | FAERS: 1 | US FAERS | |
| 940 | Blood magnesium abnormal | FAERS: 1 | US FAERS | |
| 941 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 942 | Blood pH increased | FAERS: 1 | US FAERS | |
| 943 | Blood phosphorus abnormal | FAERS: 1 | US FAERS | |
| 944 | Blood phosphorus decreased | FAERS: 1 | SIDER US FAERS | |
| 945 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 946 | Blood urea nitrogen/creatinine ratio decreased | FAERS: 1 | US FAERS | |
| 947 | Blood urea nitrogen/creatinine ratio increased | FAERS: 1 | US FAERS | |
| 948 | Blood uric acid abnormal | FAERS: 1 | US FAERS | |
| 949 | Bone Sarcoma | FAERS: 1 | US FAERS | |
| 950 | Bone decalcification | FAERS: 1 | US FAERS | |
| 951 | Bone erosion | FAERS: 1 | US FAERS | |
| 952 | Bone lesion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 953 | Brain stem syndrome | FAERS: 1 | US FAERS | |
| 954 | Breast tenderness | FAERS: 1 | US FAERS | |
| 955 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 956 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 957 | Bronchopneumopathy | FAERS: 1 | US FAERS | |
| 958 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 959 | Brown-Sequard Syndrome | FAERS: 1 | US FAERS | |
| 960 | Buccal mucosal roughening | FAERS: 1 | US FAERS | |
| 961 | Budd-Chiari Syndrome | FAERS: 1 | US FAERS | |
| 962 | Butterfly rash | FAERS: 1 | US FAERS | |
| 963 | Calcium deficiency | FAERS: 1 | US FAERS | |
| 964 | Campylobacter infection | FAERS: 1 | US FAERS | |
| 965 | Candida sepsis | FAERS: 1 | US FAERS | |
| 966 | Capillary Fragility | FAERS: 1 | US FAERS | |
| 967 | Capsule physical issue | FAERS: 1 | US FAERS | |
| 968 | Carcinoembryonic antigen increased | FAERS: 1 | US FAERS | |
| 969 | Cardiac neoplasm unspecified | FAERS: 1 | US FAERS | |
| 970 | Cardio-respiratory distress | FAERS: 1 | US FAERS | |
| 971 | Carotid Artery Thrombosis | FAERS: 1 | US FAERS | |
| 972 | Catatonia | FAERS: 1 | US FAERS | |
| 973 | Catheter related complication | FAERS: 1 | US FAERS | |
| 974 | Catheter site infection | FAERS: 1 | US FAERS | |
| 975 | Cellulitis of male external genital organ | FAERS: 1 | US FAERS | |
| 976 | Central Nervous System Infection | FAERS: 1 | US FAERS | |
| 977 | Cerebellar Ataxia | FAERS: 1 | US FAERS | |
| 978 | Cerebellar infarction | FAERS: 1 | US FAERS | |
| 979 | Cerebral Amyloid Angiopathy | FAERS: 1 | US FAERS | |
| 980 | Cerebral circulatory failure | FAERS: 1 | US FAERS | |
| 981 | Cerebral cyst | FAERS: 1 | US FAERS | |
| 982 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 983 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 984 | Cholecystocholangitis | FAERS: 1 | US FAERS | |
| 985 | Chordoma | FAERS: 1 | 24223206 | CTD US FAERS |
| 986 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 987 | Clear Cell Sarcoma of Soft Tissue | FAERS: 1 | US FAERS | |
| 988 | Clostridium colitis | FAERS: 1 | US FAERS | |
| 989 | Clostridium difficile toxin test positive | FAERS: 1 | OFFSIDES US FAERS | |
| 990 | Compression fracture | FAERS: 1 | OFFSIDES US FAERS | |
| 991 | Conjunctival pallor | FAERS: 1 | US FAERS | |
| 992 | Contrast media allergy | FAERS: 1 | US FAERS | |
| 993 | Corneal Perforation | FAERS: 1 | US FAERS | |
| 994 | Corneal erosion | FAERS: 1 | US FAERS | |
| 995 | Cortisol decreased | FAERS: 1 | US FAERS | |
| 996 | Counterfeit product administered | FAERS: 1 | US FAERS | |
| 997 | Creatinine renal clearance decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 998 | Crush syndrome | FAERS: 1 | US FAERS | |
| 999 | Cubital Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 1000 | Culture wound positive | FAERS: 1 | US FAERS | |
| 1001 | Decreased insulin requirement | FAERS: 1 | US FAERS | |
| 1002 | Demodicidosis | FAERS: 1 | US FAERS | |
| 1003 | Dental caries | FAERS: 1 | US FAERS | |
| 1004 | Dermo-hypodermitis | FAERS: 1 | US FAERS | |
| 1005 | Device breakage | FAERS: 1 | US FAERS | |
| 1006 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 1007 | Diabetic metabolic decompensation | FAERS: 1 | US FAERS | |
| 1008 | Dissociation | FAERS: 1 | US FAERS | |
| 1009 | Drooling | FAERS: 1 | US FAERS | |
| 1010 | Drowning | FAERS: 1 | US FAERS | |
| 1011 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 1012 | Drug effective for unapproved indication | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1013 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 1014 | Duodenal perforation | FAERS: 1 | OFFSIDES US FAERS | |
| 1015 | Dyschromatopsia | FAERS: 1 | US FAERS | |
| 1016 | Dystonia | FAERS: 1 | US FAERS | |
| 1017 | Eating disorder symptom | FAERS: 1 | US FAERS | |
| 1018 | Echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 1019 | Echography abnormal | FAERS: 1 | US FAERS | |
| 1020 | Economic problem | FAERS: 1 | US FAERS | |
| 1021 | Educational problem | FAERS: 1 | US FAERS | |
| 1022 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 1023 | Electrocardiogram ST-T segment depression | FAERS: 1 | US FAERS | |
| 1024 | Electrocardiogram repolarisation abnormality | FAERS: 1 | OFFSIDES US FAERS | |
| 1025 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 1026 | Endometrial adenocarcinoma | FAERS: 1 | US FAERS | |
| 1027 | Enzyme level increased | FAERS: 1 | US FAERS | |
| 1028 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 1029 | Epidermolysis Bullosa | FAERS: 1 | US FAERS | |
| 1030 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 1031 | Epiploic appendagitis | FAERS: 1 | US FAERS | |
| 1032 | Escherichia test positive | FAERS: 1 | US FAERS | |
| 1033 | Exposure via partner | FAERS: 1 | US FAERS | |
| 1034 | Eye ulcer | FAERS: 1 | US FAERS | |
| 1035 | Eyelid erosion | FAERS: 1 | US FAERS | |
| 1036 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 1037 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 1038 | Facial Neuralgia | FAERS: 1 | US FAERS | |
| 1039 | Fasciitis | FAERS: 1 | US FAERS | |
| 1040 | Febrile infection | FAERS: 1 | US FAERS | |
| 1041 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 1042 | Fistula discharge | FAERS: 1 | US FAERS | |
| 1043 | Food craving | FAERS: 1 | US FAERS | |
| 1044 | Foreign body aspiration | FAERS: 1 | US FAERS | |
| 1045 | Fungus sputum test positive | FAERS: 1 | OFFSIDES US FAERS | |
| 1046 | Gastric Fistula | FAERS: 1 | US FAERS | |
| 1047 | Gastric hypomotility | FAERS: 1 | US FAERS | |
| 1048 | Gastrointestinal angiodysplasia | FAERS: 1 | US FAERS | |
| 1049 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 1050 | Gastrointestinal mucosal disorder | FAERS: 1 | US FAERS | |
| 1051 | Gastrointestinal stoma complication | FAERS: 1 | US FAERS | |
| 1052 | Gastrointestinal viral infection | FAERS: 1 | US FAERS | |
| 1053 | Gastrointestinal wall thickening | FAERS: 1 | US FAERS | |
| 1054 | Gastrooesophageal sphincter insufficiency | FAERS: 1 | US FAERS | |
| 1055 | Gastropleural fistula | FAERS: 1 | US FAERS | |
| 1056 | Genital Herpes | FAERS: 1 | US FAERS | |
| 1057 | Genital injury | FAERS: 1 | US FAERS | |
| 1058 | Gingival Hyperplasia | FAERS: 1 | US FAERS | |
| 1059 | Gingival blister | FAERS: 1 | US FAERS | |
| 1060 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 1061 | Granulocyte count | FAERS: 1 | US FAERS | |
| 1062 | Growth retardation | FAERS: 1 | US FAERS | |
| 1063 | HELLP Syndrome | FAERS: 1 | US FAERS | |
| 1064 | Heat illness | FAERS: 1 | US FAERS | |
| 1065 | Hepatic artery embolism | FAERS: 1 | US FAERS | |
| 1066 | Hepatic artery thrombosis | FAERS: 1 | US FAERS | |
| 1067 | Hepatitis B DNA increased | FAERS: 1 | US FAERS | |
| 1068 | Hepatobiliary scan abnormal | FAERS: 1 | US FAERS | |
| 1069 | Hidradenitis | FAERS: 1 | US FAERS | |
| 1070 | Hip surgery | FAERS: 1 | US FAERS | |
| 1071 | Human papilloma virus test positive | FAERS: 1 | US FAERS | |
| 1072 | Hyperacusis | FAERS: 1 | US FAERS | |
| 1073 | Hyperlipasaemia | FAERS: 1 | US FAERS | |
| 1074 | Hypertensive emergency | FAERS: 1 | US FAERS | |
| 1075 | Hypertrophy | FAERS: 1 | US FAERS | |
| 1076 | Hypoparathyroidism | FAERS: 1 | US FAERS | |
| 1077 | Iatrogenic injury | FAERS: 1 | OFFSIDES US FAERS | |
| 1078 | Idiopathic Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 1079 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 1080 | Impaired work ability | FAERS: 1 | US FAERS | |
| 1081 | Impatience | FAERS: 1 | US FAERS | |
| 1082 | Incision site complication | FAERS: 1 | OFFSIDES US FAERS | |
| 1083 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 1084 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 1085 | Induration | FAERS: 1 | US FAERS | |
| 1086 | Infected cyst | FAERS: 1 | US FAERS | |
| 1087 | Infectious colitis | FAERS: 1 | US FAERS | |
| 1088 | Infectious peritonitis | FAERS: 1 | US FAERS | |
| 1089 | Infusion site necrosis | FAERS: 1 | US FAERS | |
| 1090 | Initial insomnia | FAERS: 1 | US FAERS | |
| 1091 | Injury associated with device | FAERS: 1 | US FAERS | |
| 1092 | Insurance issue | FAERS: 1 | US FAERS | |
| 1093 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 1094 | Intestinal gangrene | FAERS: 1 | US FAERS | |
| 1095 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 1096 | Intussusception | FAERS: 1 | OFFSIDES US FAERS | |
| 1097 | Irregular sleep wake rhythm disorder | FAERS: 1 | US FAERS | |
| 1098 | Jaw fistula | FAERS: 1 | US FAERS | |
| 1099 | Joint Instability | FAERS: 1 | US FAERS | |
| 1100 | Keratitis | FAERS: 1 | US FAERS | |
| 1101 | Labile hypertension | FAERS: 1 | US FAERS | |
| 1102 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 1103 | Laryngitis | FAERS: 1 | US FAERS | |
| 1104 | Left atrial dilatation | FAERS: 1 | US FAERS | |
| 1105 | Left ventricular end-diastolic pressure increased | FAERS: 1 | US FAERS | |
| 1106 | Leishmaniasis | FAERS: 1 | US FAERS | |
| 1107 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 1108 | Limb asymmetry | FAERS: 1 | US FAERS | |
| 1109 | Limb mass | FAERS: 1 | US FAERS | |
| 1110 | Lip Infection | FAERS: 1 | US FAERS | |
| 1111 | Lip erythema | FAERS: 1 | US FAERS | |
| 1112 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 1113 | Liver function test decreased | FAERS: 1 | US FAERS | |
| 1114 | Localised intraabdominal fluid collection | FAERS: 1 | US FAERS | |
| 1115 | Long QT Syndrome | FAERS: 1 | 21906609 24052561 | CTD US FAERS |
| 1116 | Lower Urinary Tract Symptoms | FAERS: 1 | US FAERS | |
| 1117 | Lung hypoinflation | FAERS: 1 | US FAERS | |
| 1118 | Lung perforation | FAERS: 1 | US FAERS | |
| 1119 | Lymphangitis | FAERS: 1 | US FAERS | |
| 1120 | Macrocytosis | FAERS: 1 | OFFSIDES US FAERS | |
| 1121 | Malabsorption | FAERS: 1 | US FAERS | |
| 1122 | Malignant genitourinary tract neoplasm | FAERS: 1 | US FAERS | |
| 1123 | Medical device discomfort | FAERS: 1 | US FAERS | |
| 1124 | Medical device pain | FAERS: 1 | US FAERS | |
| 1125 | Medication residue | FAERS: 1 | US FAERS | |
| 1126 | Medication residue present | FAERS: 1 | US FAERS | |
| 1127 | Mental disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 1128 | Metastatic salivary gland cancer | FAERS: 1 | US FAERS | |
| 1129 | Microalbuminuria | FAERS: 1 | US FAERS | |
| 1130 | Microcytosis | FAERS: 1 | US FAERS | |
| 1131 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 1132 | Moaning | FAERS: 1 | US FAERS | |
| 1133 | Monoparesis | FAERS: 1 | US FAERS | |
| 1134 | Multiple Myeloma | FAERS: 1 | US FAERS | |
| 1135 | Multiple gated acquisition scan abnormal | FAERS: 1 | US FAERS | |
| 1136 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 1137 | Muscle necrosis | FAERS: 1 | US FAERS | |
| 1138 | Myasthenic Syndrome | FAERS: 1 | US FAERS | |
| 1139 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 1140 | Myelitis | FAERS: 1 | US FAERS | |
| 1141 | Nail cuticle fissure | FAERS: 1 | US FAERS | |
| 1142 | Nail pigmentation | FAERS: 1 | US FAERS | |
| 1143 | Nasal inflammation | FAERS: 1 | US FAERS | |
| 1144 | Nasal mucosal disorder | FAERS: 1 | US FAERS | |
| 1145 | Nasopharyngeal cancer recurrent | FAERS: 1 | US FAERS | |
| 1146 | Nerve injury | FAERS: 1 | US FAERS | |
| 1147 | Neurodermatitis | FAERS: 1 | US FAERS | |
| 1148 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 1149 | Neutrophil count abnormal | FAERS: 1 | US FAERS | |
| 1150 | Nipple pain | FAERS: 1 | US FAERS | |
| 1151 | Non-renal cell carcinoma of kidney | FAERS: 1 | US FAERS | |
| 1152 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 1153 | Nystagmus | FAERS: 1 | OFFSIDES US FAERS | |
| 1154 | Obstruction | FAERS: 1 | US FAERS | |
| 1155 | Ocular Toxicity | FAERS: 1 | US FAERS | |
| 1156 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 1157 | Oculomucocutaneous syndrome | FAERS: 1 | US FAERS | |
| 1158 | Omphalitis | FAERS: 1 | US FAERS | |
| 1159 | Onychalgia | FAERS: 1 | US FAERS | |
| 1160 | Onycholysis | FAERS: 1 | US FAERS | |
| 1161 | Ophthalmoplegia | FAERS: 1 | OFFSIDES US FAERS | |
| 1162 | Oral pruritus | FAERS: 1 | US FAERS | |
| 1163 | Orchitis noninfective | FAERS: 1 | US FAERS | |
| 1164 | Osteitis | FAERS: 1 | US FAERS | |
| 1165 | Osteocalcin increased | FAERS: 1 | US FAERS | |
| 1166 | Osteogenesis Imperfecta | FAERS: 1 | US FAERS | |
| 1167 | Osteolysis | FAERS: 1 | US FAERS | |
| 1168 | Ototoxicity | FAERS: 1 | US FAERS | |
| 1169 | Overweight | FAERS: 1 | US FAERS | |
| 1170 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 1171 | Paracentesis | FAERS: 1 | US FAERS | |
| 1172 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 1173 | Paranoia | FAERS: 1 | US FAERS | |
| 1174 | Parkinsonian crisis | FAERS: 1 | US FAERS | |
| 1175 | Pelvic Inflammatory Disease | FAERS: 1 | US FAERS | |
| 1176 | Pelvic fluid collection | FAERS: 1 | US FAERS | |
| 1177 | Pelvic venous thrombosis | FAERS: 1 | US FAERS | |
| 1178 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 1179 | Perianal erythema | FAERS: 1 | US FAERS | |
| 1180 | Perineal pain | FAERS: 1 | US FAERS | |
| 1181 | Perineal ulceration | FAERS: 1 | US FAERS | |
| 1182 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 1183 | Peripheral motor neuropathy | FAERS: 1 | US FAERS | |
| 1184 | Perirectal abscess | FAERS: 1 | SIDER US FAERS | |
| 1185 | Peritoneal Fibrosis | FAERS: 1 | US FAERS | |
| 1186 | Peritoneal Infection | FAERS: 1 | US FAERS | |
| 1187 | Phimosis | FAERS: 1 | US FAERS | |
| 1188 | Plague | FAERS: 1 | US FAERS | |
| 1189 | Pneumocystis jiroveci pneumonia | FAERS: 1 | US FAERS | |
| 1190 | Polymyositis | FAERS: 1 | US FAERS | |
| 1191 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 1192 | Positron emission tomogram abnormal | FAERS: 1 | US FAERS | |
| 1193 | Post procedural bile leak | FAERS: 1 | US FAERS | |
| 1194 | Post procedural discharge | FAERS: 1 | US FAERS | |
| 1195 | Post procedural inflammation | FAERS: 1 | US FAERS | |
| 1196 | Post procedural pneumonia | FAERS: 1 | US FAERS | |
| 1197 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 1198 | Postoperative ileus | FAERS: 1 | US FAERS | |
| 1199 | Postoperative wound complication | FAERS: 1 | OFFSIDES US FAERS | |
| 1200 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 1201 | Prescription form tampering | FAERS: 1 | US FAERS | |
| 1202 | Procalcitonin increased | FAERS: 1 | US FAERS | |
| 1203 | Product coating issue | FAERS: 1 | US FAERS | |
| 1204 | Product communication issue | FAERS: 1 | US FAERS | |
| 1205 | Product dispensing error | FAERS: 1 | US FAERS | |
| 1206 | Product size issue | FAERS: 1 | US FAERS | |
| 1207 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 1208 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 1209 | Psoas Abscess | FAERS: 1 | US FAERS | |
| 1210 | Psychiatric decompensation | FAERS: 1 | US FAERS | |
| 1211 | Pulmonary arterial pressure increased | FAERS: 1 | OFFSIDES US FAERS | |
| 1212 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 1213 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 1214 | Pulmonary venous thrombosis | FAERS: 1 | US FAERS | |
| 1215 | Pyoderma | FAERS: 1 | US FAERS | |
| 1216 | Radiation interaction | FAERS: 1 | US FAERS | |
| 1217 | Rectal injury | FAERS: 1 | US FAERS | |
| 1218 | Red blood cell schistocytes present | FAERS: 1 | US FAERS | |
| 1219 | Refusal of treatment by relative | FAERS: 1 | US FAERS | |
| 1220 | Renal Colic | FAERS: 1 | US FAERS | |
| 1221 | Renal artery occlusion | FAERS: 1 | US FAERS | |
| 1222 | Renal mass | FAERS: 1 | OFFSIDES US FAERS | |
| 1223 | Reproductive tract hypoplasia, male | FAERS: 1 | US FAERS | |
| 1224 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 1225 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 1226 | Retinal vascular thrombosis | FAERS: 1 | US FAERS | |
| 1227 | Retroperitoneal abscess | FAERS: 1 | US FAERS | |
| 1228 | Rosacea | FAERS: 1 | US FAERS | |
| 1229 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 1230 | Saliva altered | FAERS: 1 | OFFSIDES US FAERS | |
| 1231 | Sarcopenia | FAERS: 1 | US FAERS | |
| 1232 | Scan abnormal | FAERS: 1 | US FAERS | |
| 1233 | Scotoma | FAERS: 1 | US FAERS | |
| 1234 | Sensorimotor disorder | FAERS: 1 | US FAERS | |
| 1235 | Shoulder Pain | FAERS: 1 | US FAERS | |
| 1236 | Shunt stenosis | FAERS: 1 | US FAERS | |
| 1237 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 1238 | Sigmoiditis | FAERS: 1 | US FAERS | |
| 1239 | Single functional kidney | FAERS: 1 | US FAERS | |
| 1240 | Sinoatrial Block | FAERS: 1 | US FAERS | |
| 1241 | Skin discomfort | FAERS: 1 | US FAERS | |
| 1242 | Skin laceration | FAERS: 1 | US FAERS | |
| 1243 | Skin nodule | FAERS: 1 | US FAERS | |
| 1244 | Skin texture abnormal | FAERS: 1 | US FAERS | |
| 1245 | Skin weeping | FAERS: 1 | US FAERS | |
| 1246 | Small cell lung cancer metastatic | FAERS: 1 | US FAERS | |
| 1247 | Soft tissue inflammation | FAERS: 1 | US FAERS | |
| 1248 | Soft tissue necrosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1249 | Sopor | FAERS: 1 | US FAERS | |
| 1250 | Sperm count decreased | FAERS: 1 | US FAERS | |
| 1251 | Spinal artery embolism | FAERS: 1 | US FAERS | |
| 1252 | Splenic abscess | FAERS: 1 | US FAERS | |
| 1253 | Splenic vein thrombosis | FAERS: 1 | US FAERS | |
| 1254 | Splenitis | FAERS: 1 | US FAERS | |
| 1255 | Splenomegaly | FAERS: 1 | US FAERS | |
| 1256 | Spondylitis | FAERS: 1 | OFFSIDES US FAERS | |
| 1257 | Spondylolisthesis | FAERS: 1 | US FAERS | |
| 1258 | Spontaneous penile erection | FAERS: 1 | US FAERS | |
| 1259 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 1260 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 1261 | Stauffer's syndrome | FAERS: 1 | US FAERS | |
| 1262 | Steroid diabetes | FAERS: 1 | US FAERS | |
| 1263 | Sweat gland infection | FAERS: 1 | US FAERS | |
| 1264 | Syndactyly | FAERS: 1 | US FAERS | |
| 1265 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 1266 | Synovial sarcoma metastatic | FAERS: 1 | US FAERS | |
| 1267 | Systolic hypertension | FAERS: 1 | US FAERS | |
| 1268 | T-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 1269 | Taciturnity | FAERS: 1 | US FAERS | |
| 1270 | Temperature regulation disorder | FAERS: 1 | US FAERS | |
| 1271 | Tension Headache | FAERS: 1 | US FAERS | |
| 1272 | Tension | FAERS: 1 | US FAERS | |
| 1273 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 1274 | Thirst decreased | FAERS: 1 | US FAERS | |
| 1275 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 1276 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 1277 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 1278 | Thymic cancer metastatic | FAERS: 1 | US FAERS | |
| 1279 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 1280 | Thyroid atrophy | FAERS: 1 | US FAERS | |
| 1281 | Thyroid hormones increased | FAERS: 1 | US FAERS | |
| 1282 | Tinea cruris | FAERS: 1 | OFFSIDES US FAERS | |
| 1283 | Tongue eruption | FAERS: 1 | US FAERS | |
| 1284 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 1285 | Torticollis | FAERS: 1 | US FAERS | |
| 1286 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 1287 | Tracheal fistula | FAERS: 1 | US FAERS | |
| 1288 | Tracheal pain | FAERS: 1 | US FAERS | |
| 1289 | Traumatic liver injury | FAERS: 1 | US FAERS | |
| 1290 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 1291 | Trigeminal Nerve Disorder | FAERS: 1 | US FAERS | |
| 1292 | Trousseau's syndrome | FAERS: 1 | US FAERS | |
| 1293 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 1294 | Type III immune complex mediated reaction | FAERS: 1 | US FAERS | |
| 1295 | Ultrasound biliary tract abnormal | FAERS: 1 | US FAERS | |
| 1296 | Upper respiratory fungal infection | FAERS: 1 | US FAERS | |
| 1297 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 1298 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 1299 | Urethral Obstruction | FAERS: 1 | US FAERS | |
| 1300 | Urethral perforation | FAERS: 1 | US FAERS | |
| 1301 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 1302 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 1303 | Vaginal lesion | FAERS: 1 | US FAERS | |
| 1304 | Varicocele | FAERS: 1 | US FAERS | |
| 1305 | Vascular compression | FAERS: 1 | US FAERS | |
| 1306 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 1307 | Vascular purpura | FAERS: 1 | US FAERS | |
| 1308 | Vascular rupture | FAERS: 1 | US FAERS | |
| 1309 | Vena cava injury | FAERS: 1 | US FAERS | |
| 1310 | Venous occlusion | FAERS: 1 | US FAERS | |
| 1311 | Vertebral column mass | FAERS: 1 | US FAERS | |
| 1312 | Viral myocarditis | FAERS: 1 | US FAERS | |
| 1313 | Vulvitis | FAERS: 1 | US FAERS | |
| 1314 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 1315 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 1316 | Vulvovaginal rash | FAERS: 1 | US FAERS | |
| 1317 | Water Pollution | FAERS: 1 | US FAERS | |
| 1318 | Wound necrosis | FAERS: 1 | US FAERS | |
| 1319 | Xeroderma | FAERS: 1 | US FAERS | |
| 1320 | fibroma | FAERS: 1 | US FAERS | |
| 1321 | insulinoma | FAERS: 1 | US FAERS | |
| 1322 | leiomyosarcoma | FAERS: 1 | US FAERS | |
| 1323 | liposarcoma | FAERS: 1 | US FAERS | |
| 1324 | muscle injury | FAERS: 1 | US FAERS | |
| 1325 | ovarian neoplasm | FAERS: 1 | US FAERS | |
| 1326 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 1327 | Abdominal sepsis | SIDER | ||
| 1328 | Abdominal symptom | Canada Vigilance: 1 | Canada Vigilance | |
| 1329 | Abnormal vision | OFFSIDES | ||
| 1330 | Acalculous Cholecystitis | SIDER | ||
| 1331 | Adrenal gland cancer metastatic | OFFSIDES | ||
| 1332 | Agitated depression | OFFSIDES | ||
| 1333 | Albumin globulin ratio decreased | OFFSIDES | ||
| 1334 | Alertness decreased | SIDER | ||
| 1335 | Anisocoria | OFFSIDES | ||
| 1336 | Aortic valve sclerosis | OFFSIDES | ||
| 1337 | Apoptosis | SIDER | ||
| 1338 | Aversion | OFFSIDES | ||
| 1339 | Bacillus infection | OFFSIDES | ||
| 1340 | Bacterial disease carrier | OFFSIDES | ||
| 1341 | Beta 2 microglobulin increased | OFFSIDES | ||
| 1342 | Beta-N-acetyl-D-glucosaminidase increased | OFFSIDES | ||
| 1343 | Bladder cancer stage IV | OFFSIDES | ||
| 1344 | Blepharoptosis | OFFSIDES | ||
| 1345 | Blood and lymphatic system disorders | SIDER | ||
| 1346 | Blood chloride abnormal | OFFSIDES | ||
| 1347 | Blood copper abnormal | OFFSIDES | ||
| 1348 | Blood potassium | OFFSIDES | ||
| 1349 | Blood sodium increased | SIDER | ||
| 1350 | Blood testosterone decreased | OFFSIDES | ||
| 1351 | Body Temperature | OFFSIDES | ||
| 1352 | Bone Diseases | 22343322 | CTD | |
| 1353 | Bone Marrow Diseases | 22343322 | CTD | |
| 1354 | Burning Mouth Syndrome | OFFSIDES | ||
| 1355 | Ca++ increased | SIDER | ||
| 1356 | Calcium low | SIDER | ||
| 1357 | Carcinoma in Situ | Canada Vigilance: 1 | Canada Vigilance | |
| 1358 | Carcinoma, Ehrlich Tumor | 24751611 | CTD | |
| 1359 | Cardioactive drug level increased | OFFSIDES | ||
| 1360 | Cardiovascular Diseases | 20637791 22343322 | CTD | |
| 1361 | Cervical cord compression | OFFSIDES | ||
| 1362 | Cholangiolitis | OFFSIDES | ||
| 1363 | Confabulation | OFFSIDES | ||
| 1364 | Conjunctival irritation | OFFSIDES | ||
| 1365 | Contact Dermatitis | OFFSIDES | ||
| 1366 | Creatinine increased | SIDER | ||
| 1367 | Denervation atrophy | OFFSIDES | ||
| 1368 | Dental abscess | OFFSIDES | ||
| 1369 | Destructive thyroiditis | SIDER | ||
| 1370 | Device migration | OFFSIDES | ||
| 1371 | Diabetic Foot | OFFSIDES | ||
| 1372 | Diarrhea | 22343322 | CTD | |
| 1373 | Diverticulosis | OFFSIDES | ||
| 1374 | Drug withdrawal headache | OFFSIDES | ||
| 1375 | Early satiety | OFFSIDES | ||
| 1376 | Electrocardiogram ST-T segment abnormal | OFFSIDES | ||
| 1377 | Exfoliative rash | SIDER | ||
| 1378 | Fibrosis | 26581635 | CTD | |
| 1379 | Gastrointestinal Diseases | 22343322 | CTD | |
| 1380 | Gastrointestinal Neoplasms | 19336648 20637791 | CTD | |
| 1381 | Gastrointestinal Stromal Tumors | 16772838 26581635 | CTD | |
| 1382 | Globulin abnormal | OFFSIDES | ||
| 1383 | Glucose decreased | SIDER | ||
| 1384 | Glucose increased | SIDER | ||
| 1385 | Hair discoloration | SIDER | ||
| 1386 | Heart Diseases | 23707608 31025080 | CTD | |
| 1387 | Heart failure | 21906609 | CTD | |
| 1388 | Hepatic infection bacterial | OFFSIDES | ||
| 1389 | Histology | OFFSIDES | ||
| 1390 | Hordeolum | OFFSIDES | ||
| 1391 | Implant site infection | OFFSIDES | ||
| 1392 | Incision site infection | OFFSIDES | ||
| 1393 | Infestation | SIDER | ||
| 1394 | Infusion site mobility decreased | OFFSIDES | ||
| 1395 | Inspiratory capacity decreased | OFFSIDES | ||
| 1396 | Kidney Failure | OFFSIDES | ||
| 1397 | Leukoderma | SIDER | ||
| 1398 | Leukopenia neonatal | OFFSIDES | ||
| 1399 | Liver Failure, Acute | 19336648 | CTD | |
| 1400 | Lividity | OFFSIDES | ||
| 1401 | Loss of proprioception | OFFSIDES | ||
| 1402 | Lumbar radiculopathy | OFFSIDES | ||
| 1403 | Lymphatic Diseases | 22343322 | CTD | |
| 1404 | Malignant mesenteric neoplasm | OFFSIDES | ||
| 1405 | Metastases to peripheral vascular system | OFFSIDES | ||
| 1406 | Mg reduced | SIDER | ||
| 1407 | Myelosuppression | SIDER | ||
| 1408 | Myocardial Disorder | SIDER | ||
| 1409 | Myocardial Ischemia | 26581635 | CTD | |
| 1410 | Neoplasm Metastasis | 22269210 22374800 | CTD | |
| 1411 | Neoplasms | 23288144 | CTD | |
| 1412 | Neuroendocrine Tumors | 26581635 | CTD | |
| 1413 | Optic Disc Edema | OFFSIDES | ||
| 1414 | Oroantral Fistula | OFFSIDES | ||
| 1415 | Orthopnea | OFFSIDES | ||
| 1416 | Osteosarcoma | Canada Vigilance: 1 | Canada Vigilance | |
| 1417 | Pancreatic Diseases | 22343322 | CTD | |
| 1418 | Papilloma | OFFSIDES | ||
| 1419 | Phosphorus low | SIDER | ||
| 1420 | Pleurectomy | OFFSIDES | ||
| 1421 | Potassium increased | SIDER | ||
| 1422 | Potassium low | SIDER | ||
| 1423 | Pre-Eclampsia | OFFSIDES | ||
| 1424 | Prostate examination abnormal | OFFSIDES | ||
| 1425 | Prostatic Neoplasms | 22532600 | CTD | |
| 1426 | Prothrombin time ratio increased | OFFSIDES | ||
| 1427 | Prurigo | SIDER | ||
| 1428 | Psychiatric symptom | OFFSIDES | ||
| 1429 | Radicular pain | OFFSIDES | ||
| 1430 | Rales | OFFSIDES | ||
| 1431 | Rash follicular | SIDER | ||
| 1432 | Recurrence | 25605917 | CTD | |
| 1433 | Rhabdomyosarcoma | Canada Vigilance: 1 | Canada Vigilance | |
| 1434 | Sinus operation | OFFSIDES | ||
| 1435 | Sinus rhythm | OFFSIDES | ||
| 1436 | Sodium decreased | SIDER | ||
| 1437 | Sodium high | SIDER | ||
| 1438 | Superficial Thrombophlebitis | OFFSIDES | ||
| 1439 | Superior Vena Cava Syndrome | OFFSIDES | ||
| 1440 | Thyrotoxicosis | SIDER | ||
| 1441 | Unspecified visual loss | SIDER | ||
| 1442 | Upper airway obstruction | OFFSIDES | ||
| 1443 | Urine osmolarity decreased | OFFSIDES | ||
| 1444 | Venous Insufficiency | OFFSIDES | ||
| 1445 | Ventricular Dysfunction, Left | 21906609 31025080 | CTD | |
| 1446 | Ventricular hypokinesia | OFFSIDES | ||
| 1447 | Vertebral lesion | Canada Vigilance: 1 | Canada Vigilance | |
| 1448 | Vertebroplasty | OFFSIDES | ||
| 1449 | Very low density lipoprotein increased | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.