Sitagliptin Phosphate
(MFFMDFFZMYYVKS-SECBINFHSA-N)
Structure
- SMILES
- N[C@H](Cc1cc(F)c(cc1F)F)CC(=O)N1CCn2c(C1)nnc2C(F)(F)F
- Type(s)
- Approved; Investigational
- ATC code(s)
- A10BD07; A10BD12; A10BD24; A10BH01; A10BH51
- Molecular Formula:
- C16H15F6N5O
- Molecular Weight:
- 407.314
- Log P:
- 2.6547
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 77.04
- CAS Number(s):
- 486460-32-6; 790712-60-6
Synonym(s)
1.
Sitagliptin Phosphate
2.
4-Oxo-4-(3-(trifluoromethyl)-5,6-dihydro(1,2,4)triazolo(4,3-a)pyrazin-7(8H)-yl)-1-(2,4,5-trifluorophenyl)butan-2-amine
3.
Januvia
4.
MK 0431
5.
MK-0431
6.
MK0431
7.
Sitagliptin
8.
Sitagliptin Monophosphate Monohydrate
9.
Sitagliptin Phosphate Anhydrous
10.
Sitagliptin Phosphate Monohydrate
11.
0431, MK
12.
Anhydrous, Sitagliptin Phosphate
13.
Monohydrate, Sitagliptin Monophosphate
14.
Monohydrate, Sitagliptin Phosphate
15.
Monophosphate Monohydrate, Sitagliptin
16.
Phosphate Anhydrous, Sitagliptin
17.
Phosphate Monohydrate, Sitagliptin
18.
Phosphate, Sitagliptin
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pancreatitis | FAERS: 1246 Canada Vigilance: 29 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 2 | Pancreatic carcinoma | FAERS: 857 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 3 | Drug ineffective | FAERS: 591 Canada Vigilance: 8 | Canada Vigilance OFFSIDES US FAERS | |
| 4 | Blood glucose increased | FAERS: 585 Canada Vigilance: 10 | Canada Vigilance SIDER US FAERS | |
| 5 | Headache | FAERS: 431 | SIDER US FAERS | |
| 6 | Nausea | FAERS: 376 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 7 | Adverse event | FAERS: 320 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 8 | No adverse event | FAERS: 282 | US FAERS | |
| 9 | Dizziness | FAERS: 278 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 10 | Arthralgia | FAERS: 272 | SIDER US FAERS | |
| 11 | Abdominal Pain | FAERS: 209 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 12 | Drug dose omission | FAERS: 205 | US FAERS | |
| 13 | Vomiting | FAERS: 195 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 14 | Constipation | FAERS: 192 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 15 | Weight decreased | FAERS: 188 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 16 | Malaise | FAERS: 175 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 17 | Back Pain | FAERS: 173 | SIDER US FAERS | |
| 18 | Cerebrovascular accident | FAERS: 161 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 19 | Pruritus | FAERS: 159 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Asthenia | FAERS: 158 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 21 | Myocardial Infarction | FAERS: 148 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Blood glucose decreased | FAERS: 147 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 23 | Myalgia | FAERS: 145 | SIDER US FAERS | |
| 24 | Fatigue | FAERS: 135 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 25 | Blood glucose abnormal | FAERS: 130 | OFFSIDES US FAERS | |
| 26 | Pain | FAERS: 130 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 27 | Wrong technique in drug usage process | FAERS: 124 | OFFSIDES US FAERS | |
| 28 | Pneumonia | FAERS: 123 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 29 | Diabetes mellitus inadequate control | FAERS: 119 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 30 | Lipase increased | FAERS: 118 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Blood creatinine increased | FAERS: 106 | OFFSIDES SIDER US FAERS | |
| 32 | Cholelithiasis | FAERS: 106 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Wrong technique in product usage process | FAERS: 104 | US FAERS | |
| 34 | Abdominal discomfort | FAERS: 103 | SIDER US FAERS | |
| 35 | Dehydration | FAERS: 101 | US FAERS | |
| 36 | Chest Pain | FAERS: 100 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Urinary tract infection | FAERS: 93 | SIDER US FAERS | |
| 38 | Urticaria | FAERS: 88 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 39 | Anxiety | FAERS: 85 | SIDER US FAERS | |
| 40 | Nephrolithiasis | FAERS: 85 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 41 | Hypersensitivity | FAERS: 77 | SIDER US FAERS | |
| 42 | Arthritis | FAERS: 75 | US FAERS | |
| 43 | Pancreaticoduodenectomy | FAERS: 74 | US FAERS | |
| 44 | Renal cyst | FAERS: 74 | US FAERS | |
| 45 | Feeling abnormal | FAERS: 73 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 46 | Nasopharyngitis | FAERS: 72 | OFFSIDES SIDER US FAERS | |
| 47 | Bile duct stent insertion | FAERS: 69 | US FAERS | |
| 48 | Inappropriate schedule of drug administration | FAERS: 69 | OFFSIDES US FAERS | |
| 49 | Alopecia | FAERS: 67 | OFFSIDES US FAERS | |
| 50 | Overdose | FAERS: 67 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 51 | Dyspepsia | FAERS: 66 | SIDER US FAERS | |
| 52 | Product dose omission | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Acute kidney injury | FAERS: 60 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 54 | Atrial Fibrillation | FAERS: 58 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 55 | Product use issue | FAERS: 58 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Coronary Artery Disease | FAERS: 57 | US FAERS | |
| 57 | Ascites | FAERS: 55 | US FAERS | |
| 58 | Peripheral swelling | FAERS: 55 | US FAERS | |
| 59 | Product quality issue | FAERS: 54 | US FAERS | |
| 60 | Atelectasis | FAERS: 53 | US FAERS | |
| 61 | Angioedema | FAERS: 51 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 62 | Cardiac Arrest | FAERS: 51 | US FAERS | |
| 63 | Palpitations | FAERS: 49 | US FAERS | |
| 64 | Tremor | FAERS: 49 | US FAERS | |
| 65 | Hypotension | FAERS: 48 | US FAERS | |
| 66 | Asthma | FAERS: 47 | US FAERS | |
| 67 | Blood glucose fluctuation | FAERS: 47 | US FAERS | |
| 68 | Oropharyngeal pain | FAERS: 45 | OFFSIDES US FAERS | |
| 69 | Thrombocytopenia | FAERS: 45 | US FAERS | |
| 70 | Somnolence | FAERS: 44 | SIDER US FAERS | |
| 71 | Hypothyroidism | FAERS: 43 | US FAERS | |
| 72 | Diverticulum | FAERS: 39 | US FAERS | |
| 73 | Pancreatectomy | FAERS: 39 | US FAERS | |
| 74 | Flatulence | FAERS: 38 | SIDER US FAERS | |
| 75 | Lymphadenopathy | FAERS: 38 | US FAERS | |
| 76 | jaundice | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Circumstance or information capable of leading to medication error | FAERS: 37 | US FAERS | |
| 78 | Erythema | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 79 | Amylase increased | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Hysterectomy | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Gastritis | FAERS: 35 | US FAERS | |
| 82 | Lip swelling | FAERS: 35 | US FAERS | |
| 83 | Pulmonary Embolism | FAERS: 35 | US FAERS | |
| 84 | Swelling | FAERS: 35 | US FAERS | |
| 85 | Deep Vein Thrombosis | FAERS: 34 | US FAERS | |
| 86 | Epistaxis | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 87 | Musculoskeletal Pain | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 88 | Sinusitis | FAERS: 34 | OFFSIDES SIDER US FAERS | |
| 89 | Drug administration error | FAERS: 33 | OFFSIDES US FAERS | |
| 90 | Leukocytosis | FAERS: 33 | US FAERS | |
| 91 | Burning sensation | FAERS: 32 | US FAERS | |
| 92 | Joint swelling | FAERS: 32 | US FAERS | |
| 93 | Pancytopenia | FAERS: 32 | US FAERS | |
| 94 | Pharyngolaryngeal Pain | FAERS: 32 | OFFSIDES SIDER US FAERS | |
| 95 | Benign Prostatic Hyperplasia | FAERS: 31 | US FAERS | |
| 96 | Dysgeusia | FAERS: 31 | US FAERS | |
| 97 | Intestinal Obstruction | FAERS: 31 | US FAERS | |
| 98 | Sepsis | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 99 | Splenectomy | FAERS: 31 | US FAERS | |
| 100 | Syncope | FAERS: 31 | US FAERS | |
| 101 | Bile Duct Stenosis | FAERS: 30 | US FAERS | |
| 102 | Rhabdomyolysis | FAERS: 30 | US FAERS | |
| 103 | Blood cholesterol increased | FAERS: 29 | US FAERS | |
| 104 | Diabetes Mellitus | FAERS: 29 | US FAERS | |
| 105 | Incorrect dose administered | FAERS: 29 | US FAERS | |
| 106 | Pancreatic Cyst | FAERS: 29 | OFFSIDES US FAERS | |
| 107 | Stevens-Johnson Syndrome | FAERS: 29 | SIDER US FAERS | |
| 108 | Stress | FAERS: 29 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 109 | Impaired gastric emptying | FAERS: 28 | OFFSIDES US FAERS | |
| 110 | Tachycardia | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 111 | Chest discomfort | FAERS: 25 | US FAERS | |
| 112 | Infection | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 113 | Malnutrition | FAERS: 25 | SIDER US FAERS | |
| 114 | Glaucoma | FAERS: 24 | US FAERS | |
| 115 | Osteoporosis | FAERS: 24 | US FAERS | |
| 116 | Product packaging quantity issue | FAERS: 24 | US FAERS | |
| 117 | Tonsillectomy | FAERS: 24 | US FAERS | |
| 118 | Ileus | FAERS: 23 | US FAERS | |
| 119 | Insulin-requiring type 2 diabetes mellitus | FAERS: 23 | US FAERS | |
| 120 | Respiratory Failure | FAERS: 23 | US FAERS | |
| 121 | Rheumatoid Arthritis | FAERS: 23 | US FAERS | |
| 122 | Thrombosis | FAERS: 23 | US FAERS | |
| 123 | Cardiomegaly | FAERS: 22 | US FAERS | |
| 124 | Ulcer | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 125 | Vertigo | FAERS: 22 | SIDER US FAERS | |
| 126 | Arteriosclerosis | FAERS: 21 | US FAERS | |
| 127 | Biliary sphincterotomy | FAERS: 21 | US FAERS | |
| 128 | Feeling jittery | FAERS: 21 | US FAERS | |
| 129 | Hunger | FAERS: 21 | US FAERS | |
| 130 | Psoriasis | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 131 | Pulmonary Fibrosis | FAERS: 21 | US FAERS | |
| 132 | Visual Impairment | FAERS: 21 | US FAERS | |
| 133 | Cataract | FAERS: 20 | US FAERS | |
| 134 | Cellulitis | FAERS: 20 | SIDER US FAERS | |
| 135 | Dementia | FAERS: 20 | US FAERS | |
| 136 | Hepatitis | FAERS: 20 | OFFSIDES US FAERS | |
| 137 | Influenza | FAERS: 20 | SIDER US FAERS | |
| 138 | Blood triglycerides increased | FAERS: 19 | US FAERS | |
| 139 | Cataract operation | FAERS: 19 | US FAERS | |
| 140 | Cholecystitis | FAERS: 19 | OFFSIDES US FAERS | |
| 141 | Chromaturia | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 142 | Dysuria | FAERS: 19 | US FAERS | |
| 143 | Erectile dysfunction | FAERS: 19 | SIDER US FAERS | |
| 144 | Gastrostomy | FAERS: 19 | US FAERS | |
| 145 | Alanine Aminotransferase Increased | FAERS: 18 | US FAERS | |
| 146 | Amnesia | FAERS: 18 | US FAERS | |
| 147 | Blood creatine phosphokinase increased | FAERS: 18 | US FAERS | |
| 148 | Dysphonia | FAERS: 18 | OFFSIDES US FAERS | |
| 149 | Gout | FAERS: 18 | US FAERS | |
| 150 | Medication residue present | FAERS: 18 | US FAERS | |
| 151 | Mental status changes | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 152 | Therapeutic response unexpected | FAERS: 18 | OFFSIDES US FAERS | |
| 153 | Urinary Retention | FAERS: 18 | US FAERS | |
| 154 | Aortic Aneurysm | FAERS: 17 | US FAERS | |
| 155 | Bronchitis | FAERS: 17 | SIDER US FAERS | |
| 156 | Chills | FAERS: 17 | US FAERS | |
| 157 | Inability to afford medication | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 158 | Medication residue | FAERS: 17 | OFFSIDES US FAERS | |
| 159 | Nervousness | FAERS: 17 | SIDER US FAERS | |
| 160 | Acute myocardial infarction | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 161 | Blindness | FAERS: 16 | US FAERS | |
| 162 | Cholangitis | FAERS: 16 | US FAERS | |
| 163 | Diverticulitis | FAERS: 16 | US FAERS | |
| 164 | Drug prescribing error | FAERS: 16 | US FAERS | |
| 165 | Abasia | FAERS: 15 | US FAERS | |
| 166 | Blood alkaline phosphatase increased | FAERS: 15 | US FAERS | |
| 167 | Blood amylase increased | FAERS: 15 | OFFSIDES US FAERS | |
| 168 | Blood urea increased | FAERS: 15 | US FAERS | |
| 169 | Gastric ulcer | FAERS: 15 | US FAERS | |
| 170 | Intervertebral Disc Degeneration | FAERS: 15 | US FAERS | |
| 171 | Neutropenia | FAERS: 15 | US FAERS | |
| 172 | Obesity | FAERS: 15 | US FAERS | |
| 173 | Renal pain | FAERS: 15 | US FAERS | |
| 174 | Unevaluable event | FAERS: 15 | US FAERS | |
| 175 | Arthropathy | FAERS: 14 | US FAERS | |
| 176 | Biliary dilatation | FAERS: 14 | OFFSIDES US FAERS | |
| 177 | Deafness | FAERS: 14 | US FAERS | |
| 178 | Duodenal Ulcer | FAERS: 14 | US FAERS | |
| 179 | Pemphigus | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 180 | Rash erythematous | FAERS: 14 | US FAERS | |
| 181 | Transaminases increased | FAERS: 14 | US FAERS | |
| 182 | Accidental overdose | FAERS: 13 | US FAERS | |
| 183 | Anorexia | FAERS: 13 | US FAERS | |
| 184 | Aspartate Aminotransferase Increased | FAERS: 13 | US FAERS | |
| 185 | Blood creatine increased | FAERS: 13 | OFFSIDES US FAERS | |
| 186 | Blood potassium increased | FAERS: 13 | US FAERS | |
| 187 | Bradycardia | FAERS: 13 | US FAERS | |
| 188 | Creatinine renal clearance increased | FAERS: 13 | OFFSIDES US FAERS | |
| 189 | Diplopia | FAERS: 13 | US FAERS | |
| 190 | Discomfort | FAERS: 13 | SIDER US FAERS | |
| 191 | Drug effect incomplete | FAERS: 13 | US FAERS | |
| 192 | Failure to Thrive | FAERS: 13 | US FAERS | |
| 193 | Limb discomfort | FAERS: 13 | OFFSIDES US FAERS | |
| 194 | Metastatic Neoplasm | FAERS: 13 | US FAERS | |
| 195 | Musculoskeletal stiffness | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 196 | Pancreatic Neoplasm | FAERS: 13 | US FAERS | |
| 197 | Pancreatic enzymes increased | FAERS: 13 | OFFSIDES US FAERS | |
| 198 | Poor quality sleep | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 199 | Vasculitis | FAERS: 13 | US FAERS | |
| 200 | Adrenal mass | FAERS: 12 | US FAERS | |
| 201 | Disease complication | FAERS: 12 | US FAERS | |
| 202 | Disorientation | FAERS: 12 | US FAERS | |
| 203 | Drug dispensing error | FAERS: 12 | US FAERS | |
| 204 | Emotional disorder | FAERS: 12 | US FAERS | |
| 205 | Eye pain | FAERS: 12 | US FAERS | |
| 206 | Increased tendency to bruise | FAERS: 12 | US FAERS | |
| 207 | Malignant ascites | FAERS: 12 | US FAERS | |
| 208 | Night sweats | FAERS: 12 | US FAERS | |
| 209 | Pancreatic stent placement | FAERS: 12 | US FAERS | |
| 210 | Pericardial effusion | FAERS: 12 | US FAERS | |
| 211 | Product use in unapproved indication | FAERS: 12 | US FAERS | |
| 212 | Rhinitis | FAERS: 12 | OFFSIDES US FAERS | |
| 213 | Small intestine carcinoma | FAERS: 12 | US FAERS | |
| 214 | Umbilical hernia | FAERS: 12 | US FAERS | |
| 215 | Urinary Incontinence | FAERS: 12 | US FAERS | |
| 216 | Vitamin D Deficiency | FAERS: 12 | US FAERS | |
| 217 | Back disorder | FAERS: 11 | US FAERS | |
| 218 | Cerebral Infarction | FAERS: 11 | US FAERS | |
| 219 | Clostridium difficile colitis | FAERS: 11 | US FAERS | |
| 220 | Dermatitis | FAERS: 11 | SIDER US FAERS | |
| 221 | Diabetic Ketoacidosis | FAERS: 11 | US FAERS | |
| 222 | Dry skin | FAERS: 11 | US FAERS | |
| 223 | Fibromyalgia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 224 | General physical health deterioration | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 225 | Neck Pain | FAERS: 11 | SIDER US FAERS | |
| 226 | Nocturia | FAERS: 11 | OFFSIDES US FAERS | |
| 227 | Pancreatic carcinoma recurrent | FAERS: 11 | US FAERS | |
| 228 | Skin Ulcer | FAERS: 11 | US FAERS | |
| 229 | Skin lesion | FAERS: 11 | US FAERS | |
| 230 | Skin reaction | FAERS: 11 | US FAERS | |
| 231 | Stomatitis | FAERS: 11 | US FAERS | |
| 232 | Vascular calcification | FAERS: 11 | US FAERS | |
| 233 | Angioplasty | FAERS: 10 | US FAERS | |
| 234 | Autoimmune Pancreatitis | FAERS: 10 | US FAERS | |
| 235 | Cyst | FAERS: 10 | US FAERS | |
| 236 | Flank Pain | FAERS: 10 | US FAERS | |
| 237 | Gastroenteritis | FAERS: 10 | SIDER US FAERS | |
| 238 | Gastroenterostomy | FAERS: 10 | US FAERS | |
| 239 | Memory impairment | FAERS: 10 | US FAERS | |
| 240 | Metastasis | FAERS: 10 | US FAERS | |
| 241 | Musculoskeletal chest pain | FAERS: 10 | OFFSIDES US FAERS | |
| 242 | Pharyngitis | FAERS: 10 | SIDER US FAERS | |
| 243 | Productive Cough | FAERS: 10 | OFFSIDES US FAERS | |
| 244 | Pulmonary Hypertension | FAERS: 10 | US FAERS | |
| 245 | Septic Shock | FAERS: 10 | US FAERS | |
| 246 | Sinus Tachycardia | FAERS: 10 | US FAERS | |
| 247 | Splenomegaly | FAERS: 10 | US FAERS | |
| 248 | Suicide attempt | FAERS: 10 | US FAERS | |
| 249 | Acute respiratory failure | FAERS: 9 | US FAERS | |
| 250 | Ageusia | FAERS: 9 | OFFSIDES US FAERS | |
| 251 | Blood potassium decreased | FAERS: 9 | US FAERS | |
| 252 | Bone pain | FAERS: 9 | US FAERS | |
| 253 | Cachexia | FAERS: 9 | US FAERS | |
| 254 | Carpal Tunnel Syndrome | FAERS: 9 | US FAERS | |
| 255 | Device occlusion | FAERS: 9 | US FAERS | |
| 256 | Diabetic Nephropathy | FAERS: 9 | US FAERS | |
| 257 | Emotional distress | FAERS: 9 | US FAERS | |
| 258 | Expired product administered | FAERS: 9 | US FAERS | |
| 259 | Irritable Bowel Syndrome | FAERS: 9 | US FAERS | |
| 260 | Lethargy | FAERS: 9 | US FAERS | |
| 261 | Metastases to abdominal cavity | FAERS: 9 | US FAERS | |
| 262 | Musculoskeletal discomfort | FAERS: 9 | SIDER US FAERS | |
| 263 | Pancreatic Pseudocyst | FAERS: 9 | US FAERS | |
| 264 | Polyuria | FAERS: 9 | US FAERS | |
| 265 | Respiratory distress | FAERS: 9 | US FAERS | |
| 266 | Splenic vein thrombosis | FAERS: 9 | US FAERS | |
| 267 | Therapy cessation | FAERS: 9 | US FAERS | |
| 268 | Throat cancer | FAERS: 9 | US FAERS | |
| 269 | Thyroid Neoplasm | FAERS: 9 | US FAERS | |
| 270 | Tinnitus | FAERS: 9 | US FAERS | |
| 271 | Wheezing | FAERS: 9 | US FAERS | |
| 272 | Aphonia | FAERS: 8 | OFFSIDES US FAERS | |
| 273 | Arthroscopy | FAERS: 8 | US FAERS | |
| 274 | Carbohydrate antigen 19-9 increased | FAERS: 8 | US FAERS | |
| 275 | Carcinoembryonic antigen increased | FAERS: 8 | US FAERS | |
| 276 | Colectomy | FAERS: 8 | US FAERS | |
| 277 | Colon adenoma | FAERS: 8 | OFFSIDES US FAERS | |
| 278 | Eczema | FAERS: 8 | SIDER US FAERS | |
| 279 | Eructation | FAERS: 8 | US FAERS | |
| 280 | Essential Hypertension | FAERS: 8 | US FAERS | |
| 281 | Flushing | FAERS: 8 | US FAERS | |
| 282 | Gingivitis | FAERS: 8 | US FAERS | |
| 283 | Hypertensive crisis | FAERS: 8 | US FAERS | |
| 284 | Impaired work ability | FAERS: 8 | US FAERS | |
| 285 | Incorrect route of drug administration | FAERS: 8 | US FAERS | |
| 286 | Intentional product misuse | FAERS: 8 | US FAERS | |
| 287 | Liver Abscess | FAERS: 8 | US FAERS | |
| 288 | Lymphoma | FAERS: 8 | US FAERS | |
| 289 | Osteopenia | FAERS: 8 | US FAERS | |
| 290 | Pancreatic calcification | FAERS: 8 | US FAERS | |
| 291 | Pneumobilia | FAERS: 8 | US FAERS | |
| 292 | Portal Vein Thrombosis | FAERS: 8 | US FAERS | |
| 293 | Presyncope | FAERS: 8 | US FAERS | |
| 294 | Seronegative arthritis | FAERS: 8 | US FAERS | |
| 295 | Throat irritation | FAERS: 8 | US FAERS | |
| 296 | Thyroidectomy | FAERS: 8 | US FAERS | |
| 297 | cancer surgery | FAERS: 8 | US FAERS | |
| 298 | Abdominal Abscess | FAERS: 7 | US FAERS | |
| 299 | Aphagia | FAERS: 7 | US FAERS | |
| 300 | Biopsy | FAERS: 7 | US FAERS | |
| 301 | Blood sodium decreased | FAERS: 7 | US FAERS | |
| 302 | Blood urine present | FAERS: 7 | US FAERS | |
| 303 | Cardiac stress test abnormal | FAERS: 7 | US FAERS | |
| 304 | Chemotherapy | FAERS: 7 | US FAERS | |
| 305 | Cholestasis | FAERS: 7 | US FAERS | |
| 306 | Colitis | FAERS: 7 | US FAERS | |
| 307 | Cystitis | FAERS: 7 | US FAERS | |
| 308 | Depressed mood | FAERS: 7 | US FAERS | |
| 309 | Electrolyte imbalance | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 310 | Fluid overload | FAERS: 7 | US FAERS | |
| 311 | Food craving | FAERS: 7 | US FAERS | |
| 312 | Gangrene | FAERS: 7 | US FAERS | |
| 313 | Gastrointestinal Pain | FAERS: 7 | SIDER US FAERS | |
| 314 | Hepatomegaly | FAERS: 7 | US FAERS | |
| 315 | Joint injury | FAERS: 7 | US FAERS | |
| 316 | Joint stiffness | FAERS: 7 | US FAERS | |
| 317 | Metabolic acidosis | FAERS: 7 | US FAERS | |
| 318 | Mood swings | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 319 | Oral pain | FAERS: 7 | US FAERS | |
| 320 | Post procedural complication | FAERS: 7 | US FAERS | |
| 321 | Product supply issue | FAERS: 7 | US FAERS | |
| 322 | Proteinuria | FAERS: 7 | US FAERS | |
| 323 | Pseudocyst | FAERS: 7 | OFFSIDES US FAERS | |
| 324 | Radiotherapy to pancreas | FAERS: 7 | US FAERS | |
| 325 | Rhonchi | FAERS: 7 | US FAERS | |
| 326 | Sexual Dysfunction | FAERS: 7 | US FAERS | |
| 327 | Sneezing | FAERS: 7 | US FAERS | |
| 328 | Splenic vein occlusion | FAERS: 7 | US FAERS | |
| 329 | Abdominal mass | FAERS: 6 | US FAERS | |
| 330 | Angina Pectoris | FAERS: 6 | US FAERS | |
| 331 | Appendicitis | FAERS: 6 | OFFSIDES US FAERS | |
| 332 | Basal cell carcinoma | FAERS: 6 | US FAERS | |
| 333 | Bronchospasm | FAERS: 6 | US FAERS | |
| 334 | Cyst removal | FAERS: 6 | US FAERS | |
| 335 | Delirium | FAERS: 6 | US FAERS | |
| 336 | Diabetic Retinopathy | FAERS: 6 | US FAERS | |
| 337 | Diastolic dysfunction | FAERS: 6 | US FAERS | |
| 338 | Erythema Multiforme | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 339 | Gastric Bypass | FAERS: 6 | US FAERS | |
| 340 | Gastrointestinal ulcer | FAERS: 6 | US FAERS | |
| 341 | Granuloma | FAERS: 6 | US FAERS | |
| 342 | Hypertensive heart disease | FAERS: 6 | US FAERS | |
| 343 | Impaired driving ability | FAERS: 6 | OFFSIDES US FAERS | |
| 344 | Incontinence | FAERS: 6 | US FAERS | |
| 345 | Inflammation | FAERS: 6 | US FAERS | |
| 346 | Lipoma | FAERS: 6 | US FAERS | |
| 347 | Localised intraabdominal fluid collection | FAERS: 6 | US FAERS | |
| 348 | Macular degeneration | FAERS: 6 | US FAERS | |
| 349 | Metastases to abdominal wall | FAERS: 6 | US FAERS | |
| 350 | Metastases to adrenals | FAERS: 6 | US FAERS | |
| 351 | Nephrectomy | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 352 | Nodule | FAERS: 6 | US FAERS | |
| 353 | Peptic Ulcer | FAERS: 6 | US FAERS | |
| 354 | Peritonitis | FAERS: 6 | US FAERS | |
| 355 | Polyarthritis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 356 | Poor quality drug administered | FAERS: 6 | US FAERS | |
| 357 | Portal Hypertension | FAERS: 6 | US FAERS | |
| 358 | Product taste abnormal | FAERS: 6 | US FAERS | |
| 359 | Renal tubular necrosis | FAERS: 6 | US FAERS | |
| 360 | Spinal column stenosis | FAERS: 6 | US FAERS | |
| 361 | Spinal fusion surgery | FAERS: 6 | US FAERS | |
| 362 | Spondylitis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 363 | Supraventricular tachycardia | FAERS: 6 | US FAERS | |
| 364 | Abdominal cavity drainage | FAERS: 5 | US FAERS | |
| 365 | Acidosis | FAERS: 5 | US FAERS | |
| 366 | Agitation | FAERS: 5 | US FAERS | |
| 367 | Altered state of consciousness | FAERS: 5 | US FAERS | |
| 368 | Anaphylactic shock | FAERS: 5 | SIDER US FAERS | |
| 369 | Anuria | FAERS: 5 | OFFSIDES US FAERS | |
| 370 | Aphasia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 371 | Atrial Flutter | FAERS: 5 | US FAERS | |
| 372 | Blood phosphorus increased | FAERS: 5 | US FAERS | |
| 373 | Breast tenderness | FAERS: 5 | US FAERS | |
| 374 | Catheter placement | FAERS: 5 | US FAERS | |
| 375 | Cholangiocarcinoma | FAERS: 5 | US FAERS | |
| 376 | Chronic gastritis | FAERS: 5 | US FAERS | |
| 377 | Clostridium difficile infection | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 378 | Creatinine renal clearance decreased | FAERS: 5 | OFFSIDES US FAERS | |
| 379 | Disability | FAERS: 5 | US FAERS | |
| 380 | Duodenal sphincterotomy | FAERS: 5 | US FAERS | |
| 381 | Dysarthria | FAERS: 5 | US FAERS | |
| 382 | Enzyme level increased | FAERS: 5 | US FAERS | |
| 383 | Gamma-Glutamyltransferase Increased | FAERS: 5 | US FAERS | |
| 384 | Hemiparesis | FAERS: 5 | US FAERS | |
| 385 | Hepatic Encephalopathy | FAERS: 5 | US FAERS | |
| 386 | Hepatitis C | FAERS: 5 | US FAERS | |
| 387 | Hepatorenal Syndrome | FAERS: 5 | US FAERS | |
| 388 | Hypophagia | FAERS: 5 | US FAERS | |
| 389 | Hypoxia | FAERS: 5 | US FAERS | |
| 390 | Increased upper airway secretion | FAERS: 5 | OFFSIDES US FAERS | |
| 391 | Intestinal stent insertion | FAERS: 5 | US FAERS | |
| 392 | Left Ventricular Hypertrophy | FAERS: 5 | OFFSIDES US FAERS | |
| 393 | Leukopenia | FAERS: 5 | US FAERS | |
| 394 | Limb injury | FAERS: 5 | US FAERS | |
| 395 | Lupus-like syndrome | FAERS: 5 | US FAERS | |
| 396 | Maternal exposure during pregnancy | FAERS: 5 | US FAERS | |
| 397 | Mesenteric neoplasm | FAERS: 5 | US FAERS | |
| 398 | Microalbuminuria | FAERS: 5 | US FAERS | |
| 399 | Nephrotic Syndrome | FAERS: 5 | US FAERS | |
| 400 | Nerve injury | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 401 | Onychomycosis | FAERS: 5 | US FAERS | |
| 402 | Paracentesis | FAERS: 5 | US FAERS | |
| 403 | Poor quality product administered | FAERS: 5 | US FAERS | |
| 404 | Prescribed overdose | FAERS: 5 | US FAERS | |
| 405 | Product packaging issue | FAERS: 5 | US FAERS | |
| 406 | Prostatic calcification | FAERS: 5 | US FAERS | |
| 407 | Pulmonary congestion | FAERS: 5 | US FAERS | |
| 408 | Pulmonary granuloma | FAERS: 5 | US FAERS | |
| 409 | Rales | FAERS: 5 | US FAERS | |
| 410 | Renal mass | FAERS: 5 | OFFSIDES US FAERS | |
| 411 | Restless Legs Syndrome | FAERS: 5 | US FAERS | |
| 412 | Sinus headache | FAERS: 5 | SIDER US FAERS | |
| 413 | Sudden death | FAERS: 5 | US FAERS | |
| 414 | Temperature intolerance | FAERS: 5 | US FAERS | |
| 415 | Thirst | FAERS: 5 | US FAERS | |
| 416 | Toothache | FAERS: 5 | SIDER US FAERS | |
| 417 | Vena cava filter insertion | FAERS: 5 | US FAERS | |
| 418 | nervous system disorder | FAERS: 5 | SIDER US FAERS | |
| 419 | treatment failure | FAERS: 5 | US FAERS | |
| 420 | Abdominal adhesions | FAERS: 4 | US FAERS | |
| 421 | Abscess | FAERS: 4 | US FAERS | |
| 422 | Accidental exposure to product by child | FAERS: 4 | US FAERS | |
| 423 | Acne | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 424 | Actinic keratosis | FAERS: 4 | US FAERS | |
| 425 | Acute Coronary Syndrome | FAERS: 4 | US FAERS | |
| 426 | Ammonia increased | FAERS: 4 | US FAERS | |
| 427 | Atrioventricular Block | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 428 | Autoimmune thyroiditis | FAERS: 4 | US FAERS | |
| 429 | Bedridden | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 430 | Benign neoplasm of adrenal gland | FAERS: 4 | US FAERS | |
| 431 | Bipolar Disorder | FAERS: 4 | US FAERS | |
| 432 | Blood albumin decreased | FAERS: 4 | US FAERS | |
| 433 | Blood cholesterol abnormal | FAERS: 4 | US FAERS | |
| 434 | Blood creatinine decreased | FAERS: 4 | OFFSIDES US FAERS | |
| 435 | Bone lesion | FAERS: 4 | US FAERS | |
| 436 | Carotid Endarterectomy | FAERS: 4 | US FAERS | |
| 437 | Cholecystitis infective | FAERS: 4 | OFFSIDES US FAERS | |
| 438 | Choledochoenterostomy | FAERS: 4 | US FAERS | |
| 439 | Circumstance or information capable of leading to device use error | FAERS: 4 | US FAERS | |
| 440 | Drain placement | FAERS: 4 | US FAERS | |
| 441 | Drug Dependence | FAERS: 4 | US FAERS | |
| 442 | Drug administered to patient of inappropriate age | FAERS: 4 | US FAERS | |
| 443 | Duodenal Obstruction | FAERS: 4 | US FAERS | |
| 444 | Duodenitis | FAERS: 4 | US FAERS | |
| 445 | Epigastric discomfort | FAERS: 4 | US FAERS | |
| 446 | Excoriation | FAERS: 4 | US FAERS | |
| 447 | Febrile Neutropenia | FAERS: 4 | US FAERS | |
| 448 | Head discomfort | FAERS: 4 | US FAERS | |
| 449 | Hepatic calcification | FAERS: 4 | US FAERS | |
| 450 | Hydronephrosis | FAERS: 4 | US FAERS | |
| 451 | Hypersomnia | FAERS: 4 | US FAERS | |
| 452 | Hypokinesia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 453 | Intestinal Perforation | FAERS: 4 | US FAERS | |
| 454 | Ketoacidosis | FAERS: 4 | US FAERS | |
| 455 | Ketosis | FAERS: 4 | US FAERS | |
| 456 | Laceration | FAERS: 4 | US FAERS | |
| 457 | Left atrial dilatation | FAERS: 4 | US FAERS | |
| 458 | Lower respiratory tract infection | FAERS: 4 | US FAERS | |
| 459 | Medical device complication | FAERS: 4 | US FAERS | |
| 460 | Medication Error | FAERS: 4 | US FAERS | |
| 461 | Obstruction | FAERS: 4 | US FAERS | |
| 462 | Osteosclerosis | FAERS: 4 | US FAERS | |
| 463 | Pancreatic operation | FAERS: 4 | US FAERS | |
| 464 | Post-Traumatic Stress Disorder | FAERS: 4 | US FAERS | |
| 465 | Product availability issue | FAERS: 4 | US FAERS | |
| 466 | Product blister packaging issue | FAERS: 4 | US FAERS | |
| 467 | Product container issue | FAERS: 4 | US FAERS | |
| 468 | Product physical issue | FAERS: 4 | US FAERS | |
| 469 | Pyelonephritis | FAERS: 4 | OFFSIDES US FAERS | |
| 470 | Renal Cell Carcinoma | FAERS: 4 | US FAERS | |
| 471 | Respiratory tract congestion | FAERS: 4 | OFFSIDES US FAERS | |
| 472 | Restlessness | FAERS: 4 | US FAERS | |
| 473 | Retching | FAERS: 4 | SIDER US FAERS | |
| 474 | Shock | FAERS: 4 | US FAERS | |
| 475 | Skin irritation | FAERS: 4 | US FAERS | |
| 476 | Splenic Infarction | FAERS: 4 | US FAERS | |
| 477 | Splenic granuloma | FAERS: 4 | US FAERS | |
| 478 | Suspected counterfeit product | FAERS: 4 | US FAERS | |
| 479 | Unresponsive to stimuli | FAERS: 4 | US FAERS | |
| 480 | Varicose vein operation | FAERS: 4 | US FAERS | |
| 481 | Visual disturbance | FAERS: 4 | US FAERS | |
| 482 | Wound Infection | FAERS: 4 | US FAERS | |
| 483 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 484 | Acute prerenal failure | FAERS: 3 | US FAERS | |
| 485 | Acute sinusitis | FAERS: 3 | US FAERS | |
| 486 | Adenocarcinoma | FAERS: 3 | US FAERS | |
| 487 | Adnexa uteri mass | FAERS: 3 | US FAERS | |
| 488 | Adrenalectomy | FAERS: 3 | US FAERS | |
| 489 | Alcohol abuse | FAERS: 3 | US FAERS | |
| 490 | Anal abscess | FAERS: 3 | US FAERS | |
| 491 | Bile duct adenocarcinoma | FAERS: 3 | US FAERS | |
| 492 | Blood magnesium decreased | FAERS: 3 | US FAERS | |
| 493 | Bursitis | FAERS: 3 | US FAERS | |
| 494 | Cerebral atrophy | FAERS: 3 | US FAERS | |
| 495 | Cold sweat | FAERS: 3 | US FAERS | |
| 496 | Conjunctivitis | FAERS: 3 | US FAERS | |
| 497 | Cystopexy | FAERS: 3 | US FAERS | |
| 498 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 499 | Dermatitis acneiform | FAERS: 3 | US FAERS | |
| 500 | Diaphragmatic Hernia | FAERS: 3 | US FAERS | |
| 501 | Disease Progression | FAERS: 3 | US FAERS | |
| 502 | Drug screen positive | FAERS: 3 | OFFSIDES US FAERS | |
| 503 | Ecchymosis | FAERS: 3 | US FAERS | |
| 504 | Elbow operation | FAERS: 3 | US FAERS | |
| 505 | Electrocardiogram ST segment abnormal | FAERS: 3 | US FAERS | |
| 506 | Electrocardiogram ST-T change | FAERS: 3 | US FAERS | |
| 507 | Electrocardiogram abnormal | FAERS: 3 | US FAERS | |
| 508 | Erythema Nodosum | FAERS: 3 | US FAERS | |
| 509 | Exfoliative rash | FAERS: 3 | OFFSIDES US FAERS | |
| 510 | Extra dose administered | FAERS: 3 | US FAERS | |
| 511 | Fat necrosis | FAERS: 3 | US FAERS | |
| 512 | Feeding tube complication | FAERS: 3 | US FAERS | |
| 513 | Fungal test positive | FAERS: 3 | US FAERS | |
| 514 | Gastrointestinal infection | FAERS: 3 | US FAERS | |
| 515 | Gastrointestinal wall thickening | FAERS: 3 | US FAERS | |
| 516 | Genital rash | FAERS: 3 | OFFSIDES US FAERS | |
| 517 | Gluten sensitivity | FAERS: 3 | US FAERS | |
| 518 | Hepatectomy | FAERS: 3 | US FAERS | |
| 519 | Hepatic cancer metastatic | FAERS: 3 | OFFSIDES US FAERS | |
| 520 | Hernia | FAERS: 3 | US FAERS | |
| 521 | Hyperchlorhydria | FAERS: 3 | US FAERS | |
| 522 | Hyperkeratosis | FAERS: 3 | US FAERS | |
| 523 | Hyperphagia | FAERS: 3 | US FAERS | |
| 524 | Hyperventilation | FAERS: 3 | US FAERS | |
| 525 | Immune thrombocytopenic purpura | FAERS: 3 | US FAERS | |
| 526 | Inappropriate schedule of product administration | FAERS: 3 | US FAERS | |
| 527 | Infarction | FAERS: 3 | US FAERS | |
| 528 | Intervertebral disc disorder | FAERS: 3 | US FAERS | |
| 529 | Iron deficiency | FAERS: 3 | US FAERS | |
| 530 | Lactose Intolerance | FAERS: 3 | US FAERS | |
| 531 | Laparotomy | FAERS: 3 | US FAERS | |
| 532 | Laryngitis | FAERS: 3 | US FAERS | |
| 533 | Lichen Planus | FAERS: 3 | US FAERS | |
| 534 | Limb operation | FAERS: 3 | US FAERS | |
| 535 | Lip and/or oral cavity cancer | FAERS: 3 | US FAERS | |
| 536 | Lung consolidation | FAERS: 3 | US FAERS | |
| 537 | Malignant neoplasm of ampulla of Vater | FAERS: 3 | US FAERS | |
| 538 | Meningitis | FAERS: 3 | US FAERS | |
| 539 | Metastases to stomach | FAERS: 3 | US FAERS | |
| 540 | Morbid thoughts | FAERS: 3 | US FAERS | |
| 541 | Multiple Myeloma | FAERS: 3 | US FAERS | |
| 542 | Muscle tightness | FAERS: 3 | SIDER US FAERS | |
| 543 | Ocular discomfort | FAERS: 3 | US FAERS | |
| 544 | Oral candidiasis | FAERS: 3 | US FAERS | |
| 545 | Oropharyngeal discomfort | FAERS: 3 | US FAERS | |
| 546 | Otitis Media | FAERS: 3 | US FAERS | |
| 547 | Pancreatic Insufficiency | FAERS: 3 | US FAERS | |
| 548 | Pancreatic duct dilatation | FAERS: 3 | US FAERS | |
| 549 | Pancreatic enlargement | FAERS: 3 | US FAERS | |
| 550 | Pancreatic leak | FAERS: 3 | US FAERS | |
| 551 | Pancreatobiliary sphincterotomy | FAERS: 3 | US FAERS | |
| 552 | Pelvic Pain | FAERS: 3 | US FAERS | |
| 553 | Peripheral venous disease | FAERS: 3 | US FAERS | |
| 554 | Personality Change | FAERS: 3 | US FAERS | |
| 555 | Petechiae | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 556 | Phlebitis | FAERS: 3 | US FAERS | |
| 557 | Photophobia | FAERS: 3 | US FAERS | |
| 558 | Postoperative wound complication | FAERS: 3 | US FAERS | |
| 559 | Precancerous cells present | FAERS: 3 | US FAERS | |
| 560 | Product prescribing error | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 561 | Product prescribing issue | FAERS: 3 | US FAERS | |
| 562 | Product tampering | FAERS: 3 | US FAERS | |
| 563 | Protein total decreased | FAERS: 3 | US FAERS | |
| 564 | Pulmonary vascular disorder | FAERS: 3 | US FAERS | |
| 565 | Purpura | FAERS: 3 | US FAERS | |
| 566 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 567 | Rosacea | FAERS: 3 | US FAERS | |
| 568 | Rotator cuff syndrome | FAERS: 3 | US FAERS | |
| 569 | Scab | FAERS: 3 | US FAERS | |
| 570 | Sciatica | FAERS: 3 | SIDER US FAERS | |
| 571 | Seroma | FAERS: 3 | OFFSIDES US FAERS | |
| 572 | Sjogren's Syndrome | FAERS: 3 | US FAERS | |
| 573 | Skeletal injury | FAERS: 3 | US FAERS | |
| 574 | Sluggishness | FAERS: 3 | US FAERS | |
| 575 | Snoring | FAERS: 3 | OFFSIDES US FAERS | |
| 576 | Squamous cell carcinoma | FAERS: 3 | US FAERS | |
| 577 | Synovial Cyst | FAERS: 3 | US FAERS | |
| 578 | Tooth Extraction | FAERS: 3 | US FAERS | |
| 579 | Tooth Loss | FAERS: 3 | US FAERS | |
| 580 | Toxic Epidermal Necrolysis | FAERS: 3 | US FAERS | |
| 581 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 582 | Upper respiratory tract congestion | FAERS: 3 | US FAERS | |
| 583 | Urinary tract inflammation | FAERS: 3 | US FAERS | |
| 584 | Uterine Cancer | FAERS: 3 | OFFSIDES US FAERS | |
| 585 | Vascular purpura | FAERS: 3 | US FAERS | |
| 586 | Venous Thrombosis | FAERS: 3 | US FAERS | |
| 587 | Ventricular Fibrillation | FAERS: 3 | US FAERS | |
| 588 | Wrong drug administered | FAERS: 3 | US FAERS | |
| 589 | pseudomembranous colitis | FAERS: 3 | US FAERS | |
| 590 | Abdominal tenderness | FAERS: 2 | US FAERS | |
| 591 | Abulia | FAERS: 2 | US FAERS | |
| 592 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 593 | Adenoidectomy | FAERS: 2 | US FAERS | |
| 594 | Alcohol poisoning | FAERS: 2 | US FAERS | |
| 595 | Amylase abnormal | FAERS: 2 | US FAERS | |
| 596 | Amyotrophic Lateral Sclerosis | FAERS: 2 | US FAERS | |
| 597 | Anal Fistula | FAERS: 2 | OFFSIDES US FAERS | |
| 598 | Aneurysm | FAERS: 2 | US FAERS | |
| 599 | Anger | FAERS: 2 | US FAERS | |
| 600 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 601 | Aortic valve calcification | FAERS: 2 | US FAERS | |
| 602 | Arthropod bite | FAERS: 2 | US FAERS | |
| 603 | Atypical pneumonia | FAERS: 2 | US FAERS | |
| 604 | Autoimmune hepatitis | FAERS: 2 | OFFSIDES US FAERS | |
| 605 | Bacterial test positive | FAERS: 2 | US FAERS | |
| 606 | Bladder Diverticulum | FAERS: 2 | US FAERS | |
| 607 | Bladder prolapse | FAERS: 2 | US FAERS | |
| 608 | Blepharospasm | FAERS: 2 | US FAERS | |
| 609 | Blood calcitonin increased | FAERS: 2 | US FAERS | |
| 610 | Blood cholesterol | FAERS: 2 | US FAERS | |
| 611 | Blood urea abnormal | FAERS: 2 | US FAERS | |
| 612 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 613 | Brain natriuretic peptide increased | FAERS: 2 | OFFSIDES US FAERS | |
| 614 | Breast Cyst | FAERS: 2 | US FAERS | |
| 615 | Bronchial Hyperreactivity | FAERS: 2 | US FAERS | |
| 616 | Bronchiectasis | FAERS: 2 | US FAERS | |
| 617 | Cardiac Tamponade | FAERS: 2 | US FAERS | |
| 618 | Carotid bruit | FAERS: 2 | OFFSIDES US FAERS | |
| 619 | Catheter site erythema | FAERS: 2 | US FAERS | |
| 620 | Cholecystostomy | FAERS: 2 | US FAERS | |
| 621 | Chondroplasty | FAERS: 2 | US FAERS | |
| 622 | Clubbing | FAERS: 2 | US FAERS | |
| 623 | Clumsiness | FAERS: 2 | US FAERS | |
| 624 | Completed Suicide | FAERS: 2 | OFFSIDES US FAERS | |
| 625 | Conjunctival pallor | FAERS: 2 | US FAERS | |
| 626 | Counterfeit product administered | FAERS: 2 | US FAERS | |
| 627 | Culture urine positive | FAERS: 2 | US FAERS | |
| 628 | Cyanopsia | FAERS: 2 | US FAERS | |
| 629 | Cyanosis | FAERS: 2 | US FAERS | |
| 630 | Cystic Fibrosis | FAERS: 2 | US FAERS | |
| 631 | Cystitis escherichia | FAERS: 2 | US FAERS | |
| 632 | Cytolytic hepatitis | FAERS: 2 | US FAERS | |
| 633 | Deformity | FAERS: 2 | US FAERS | |
| 634 | Delusional disorder, unspecified type | FAERS: 2 | US FAERS | |
| 635 | Device malfunction | FAERS: 2 | US FAERS | |
| 636 | Diabetic Foot | FAERS: 2 | US FAERS | |
| 637 | Dialysis device insertion | FAERS: 2 | US FAERS | |
| 638 | Disseminated Intravascular Coagulation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 639 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 640 | Ear tube insertion | FAERS: 2 | US FAERS | |
| 641 | Early retirement | FAERS: 2 | US FAERS | |
| 642 | Early satiety | FAERS: 2 | US FAERS | |
| 643 | Ejection Fraction Decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 644 | Endocarditis | FAERS: 2 | US FAERS | |
| 645 | Endotracheal intubation complication | FAERS: 2 | US FAERS | |
| 646 | Enterobacter test positive | FAERS: 2 | US FAERS | |
| 647 | Enterococcal infection | FAERS: 2 | US FAERS | |
| 648 | Epicondylitis | FAERS: 2 | US FAERS | |
| 649 | Epilepsy | FAERS: 2 | US FAERS | |
| 650 | Exploratory operation | FAERS: 2 | US FAERS | |
| 651 | Eye Infection | FAERS: 2 | OFFSIDES US FAERS | |
| 652 | Eye irritation | FAERS: 2 | US FAERS | |
| 653 | Feeling Cold | FAERS: 2 | US FAERS | |
| 654 | Fibrin D dimer increased | FAERS: 2 | US FAERS | |
| 655 | Food Poisoning | FAERS: 2 | US FAERS | |
| 656 | Formication | FAERS: 2 | OFFSIDES US FAERS | |
| 657 | Fracture | FAERS: 2 | US FAERS | |
| 658 | Frustration | FAERS: 2 | US FAERS | |
| 659 | Gallbladder adenocarcinoma | FAERS: 2 | US FAERS | |
| 660 | Gastrectomy | FAERS: 2 | US FAERS | |
| 661 | Gastric Dilatation | FAERS: 2 | US FAERS | |
| 662 | Gastric Fistula | FAERS: 2 | US FAERS | |
| 663 | Gastric ulcer helicobacter | FAERS: 2 | SIDER US FAERS | |
| 664 | Gastrointestinal erosion | FAERS: 2 | US FAERS | |
| 665 | Gastrointestinal sounds abnormal | FAERS: 2 | US FAERS | |
| 666 | Gastrointestinal toxicity | FAERS: 2 | US FAERS | |
| 667 | General symptom | FAERS: 2 | US FAERS | |
| 668 | Genital swelling | FAERS: 2 | US FAERS | |
| 669 | Gingival Recession | FAERS: 2 | US FAERS | |
| 670 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 671 | Hemiplegia | FAERS: 2 | US FAERS | |
| 672 | Hepatic necrosis | FAERS: 2 | US FAERS | |
| 673 | Hepatobiliary neoplasm | FAERS: 2 | US FAERS | |
| 674 | Hepatosplenomegaly | FAERS: 2 | US FAERS | |
| 675 | Hip surgery | FAERS: 2 | US FAERS | |
| 676 | Hydrothorax | FAERS: 2 | US FAERS | |
| 677 | Hyperparathyroidism | FAERS: 2 | US FAERS | |
| 678 | Hyperthyroidism | FAERS: 2 | US FAERS | |
| 679 | Hypoaesthesia facial | FAERS: 2 | US FAERS | |
| 680 | Hyporeflexia | FAERS: 2 | US FAERS | |
| 681 | Hypoventilation | FAERS: 2 | US FAERS | |
| 682 | Immunosuppression | FAERS: 2 | US FAERS | |
| 683 | Impatience | FAERS: 2 | US FAERS | |
| 684 | Incoherent | FAERS: 2 | US FAERS | |
| 685 | Incorrect drug dosage form administered | FAERS: 2 | US FAERS | |
| 686 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 687 | Incorrect storage of drug | FAERS: 2 | US FAERS | |
| 688 | Infectious colitis | FAERS: 2 | US FAERS | |
| 689 | Infrequent bowel movements | FAERS: 2 | US FAERS | |
| 690 | Inspiratory capacity decreased | FAERS: 2 | US FAERS | |
| 691 | Insulin autoimmune syndrome | FAERS: 2 | US FAERS | |
| 692 | Intermittent Claudication | FAERS: 2 | US FAERS | |
| 693 | Intestinal infarction | FAERS: 2 | OFFSIDES US FAERS | |
| 694 | Intestinal resection | FAERS: 2 | US FAERS | |
| 695 | Intraductal papillary mucinous neoplasm | FAERS: 2 | US FAERS | |
| 696 | Invasive Ductal Breast Carcinoma | FAERS: 2 | US FAERS | |
| 697 | Laparoscopy | FAERS: 2 | US FAERS | |
| 698 | Leukoencephalopathy | FAERS: 2 | US FAERS | |
| 699 | Lip exfoliation | FAERS: 2 | OFFSIDES US FAERS | |
| 700 | Lipase abnormal | FAERS: 2 | US FAERS | |
| 701 | Liver scan abnormal | FAERS: 2 | US FAERS | |
| 702 | Lobar Pneumonia | FAERS: 2 | US FAERS | |
| 703 | Loose tooth | FAERS: 2 | US FAERS | |
| 704 | Lung Abscess | FAERS: 2 | US FAERS | |
| 705 | Lymphangiosis carcinomatosa | FAERS: 2 | US FAERS | |
| 706 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 707 | Malabsorption | FAERS: 2 | US FAERS | |
| 708 | Malaria | FAERS: 2 | US FAERS | |
| 709 | Malignant melanoma stage II | FAERS: 2 | US FAERS | |
| 710 | Malignant melanoma stage III | FAERS: 2 | US FAERS | |
| 711 | Mastectomy | FAERS: 2 | US FAERS | |
| 712 | Mastoiditis | FAERS: 2 | OFFSIDES US FAERS | |
| 713 | Mechanical ileus | FAERS: 2 | US FAERS | |
| 714 | Meningioma | FAERS: 2 | OFFSIDES US FAERS | |
| 715 | Meniscus injury | FAERS: 2 | US FAERS | |
| 716 | Mental impairment | FAERS: 2 | US FAERS | |
| 717 | Mesenteric arteriosclerosis | FAERS: 2 | US FAERS | |
| 718 | Metabolic function test abnormal | FAERS: 2 | US FAERS | |
| 719 | Metastases to muscle | FAERS: 2 | US FAERS | |
| 720 | Metrorrhagia | FAERS: 2 | US FAERS | |
| 721 | Moyamoya Disease | FAERS: 2 | US FAERS | |
| 722 | Multiple Endocrine Neoplasia | FAERS: 2 | US FAERS | |
| 723 | Multiple Sclerosis | FAERS: 2 | US FAERS | |
| 724 | Myocarditis | FAERS: 2 | US FAERS | |
| 725 | Myoclonus | FAERS: 2 | US FAERS | |
| 726 | Myositis | FAERS: 2 | US FAERS | |
| 727 | Narcolepsy | FAERS: 2 | US FAERS | |
| 728 | Nasal discomfort | FAERS: 2 | OFFSIDES US FAERS | |
| 729 | Nephritis | FAERS: 2 | US FAERS | |
| 730 | Neuralgia | FAERS: 2 | US FAERS | |
| 731 | Nodule on extremity | FAERS: 2 | US FAERS | |
| 732 | Non-cardiac chest pain | FAERS: 2 | SIDER US FAERS | |
| 733 | Ocular icterus | FAERS: 2 | US FAERS | |
| 734 | Oculomucocutaneous syndrome | FAERS: 2 | US FAERS | |
| 735 | Oncologic complication | FAERS: 2 | US FAERS | |
| 736 | Orchitis | FAERS: 2 | US FAERS | |
| 737 | Oropharyngeal candidiasis | FAERS: 2 | US FAERS | |
| 738 | Osteitis Deformans | FAERS: 2 | US FAERS | |
| 739 | Pain of skin | FAERS: 2 | US FAERS | |
| 740 | Pallor | FAERS: 2 | US FAERS | |
| 741 | Panic Disorder | FAERS: 2 | US FAERS | |
| 742 | Parotitis | FAERS: 2 | US FAERS | |
| 743 | Pathological fracture | FAERS: 2 | US FAERS | |
| 744 | Pelvic fluid collection | FAERS: 2 | US FAERS | |
| 745 | Peripancreatic fluid collection | FAERS: 2 | US FAERS | |
| 746 | Peripheral arterial occlusive disease | FAERS: 2 | US FAERS | |
| 747 | Pilonidal Cyst | FAERS: 2 | US FAERS | |
| 748 | Pneumothorax | FAERS: 2 | US FAERS | |
| 749 | Polymyalgia Rheumatica | FAERS: 2 | US FAERS | |
| 750 | Portosplenomesenteric venous thrombosis | FAERS: 2 | US FAERS | |
| 751 | Positron emission tomogram abnormal | FAERS: 2 | US FAERS | |
| 752 | Post procedural fistula | FAERS: 2 | US FAERS | |
| 753 | Postoperative respiratory failure | FAERS: 2 | US FAERS | |
| 754 | Prescribed underdose | FAERS: 2 | US FAERS | |
| 755 | Prescription drug used without a prescription | FAERS: 2 | US FAERS | |
| 756 | Product commingling | FAERS: 2 | US FAERS | |
| 757 | Product contamination physical | FAERS: 2 | US FAERS | |
| 758 | Product counterfeit | FAERS: 2 | US FAERS | |
| 759 | Product dispensing error | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 760 | Product distribution issue | FAERS: 2 | US FAERS | |
| 761 | Product origin unknown | FAERS: 2 | US FAERS | |
| 762 | Product storage error | FAERS: 2 | US FAERS | |
| 763 | Protein urine present | FAERS: 2 | US FAERS | |
| 764 | Pulmonary arterial hypertension | FAERS: 2 | US FAERS | |
| 765 | Pulmonary arterial pressure increased | FAERS: 2 | US FAERS | |
| 766 | Pulmonary venous thrombosis | FAERS: 2 | US FAERS | |
| 767 | QRS axis abnormal | FAERS: 2 | US FAERS | |
| 768 | Radical prostatectomy | FAERS: 2 | US FAERS | |
| 769 | Radiotherapy to prostate | FAERS: 2 | US FAERS | |
| 770 | Rehabilitation therapy | FAERS: 2 | US FAERS | |
| 771 | Renal Colic | FAERS: 2 | US FAERS | |
| 772 | Renal vein occlusion | FAERS: 2 | US FAERS | |
| 773 | Retinal Vein Occlusion | FAERS: 2 | US FAERS | |
| 774 | Schizophrenia | FAERS: 2 | US FAERS | |
| 775 | Shunt occlusion | FAERS: 2 | US FAERS | |
| 776 | Sinus operation | FAERS: 2 | US FAERS | |
| 777 | Skin Papilloma | FAERS: 2 | US FAERS | |
| 778 | Skin neoplasm excision | FAERS: 2 | US FAERS | |
| 779 | Skin tightness | FAERS: 2 | US FAERS | |
| 780 | Sodium retention | FAERS: 2 | US FAERS | |
| 781 | Splenic Rupture | FAERS: 2 | US FAERS | |
| 782 | Splenic cyst | FAERS: 2 | US FAERS | |
| 783 | Spondylolisthesis | FAERS: 2 | US FAERS | |
| 784 | Status Epilepticus | FAERS: 2 | US FAERS | |
| 785 | Sweating fever | FAERS: 2 | US FAERS | |
| 786 | Systemic Inflammatory Response Syndrome | FAERS: 2 | US FAERS | |
| 787 | Therapeutic product ineffective | FAERS: 2 | US FAERS | |
| 788 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 789 | Thermal burn | FAERS: 2 | US FAERS | |
| 790 | Thrombocytosis | FAERS: 2 | US FAERS | |
| 791 | Trismus | FAERS: 2 | US FAERS | |
| 792 | Troponin increased | FAERS: 2 | US FAERS | |
| 793 | Tuberculosis | FAERS: 2 | US FAERS | |
| 794 | Typhoid Fever | FAERS: 2 | US FAERS | |
| 795 | Upper respiratory tract inflammation | FAERS: 2 | US FAERS | |
| 796 | Urge Incontinence | FAERS: 2 | US FAERS | |
| 797 | Urinary tract infection fungal | FAERS: 2 | US FAERS | |
| 798 | Urine flow decreased | FAERS: 2 | US FAERS | |
| 799 | Urine ketone body present | FAERS: 2 | US FAERS | |
| 800 | Uterine atrophy | FAERS: 2 | US FAERS | |
| 801 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 802 | Venous stent insertion | FAERS: 2 | US FAERS | |
| 803 | Ventricular hypokinesia | FAERS: 2 | US FAERS | |
| 804 | Vulvovaginal discomfort | FAERS: 2 | US FAERS | |
| 805 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 806 | Wound dehiscence | FAERS: 2 | US FAERS | |
| 807 | hypertensive nephropathy | FAERS: 2 | US FAERS | |
| 808 | kyphosis | FAERS: 2 | US FAERS | |
| 809 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 810 | Abdominal panniculectomy | FAERS: 1 | US FAERS | |
| 811 | Abdominal wall neoplasm malignant | FAERS: 1 | US FAERS | |
| 812 | Abdominal wound dehiscence | FAERS: 1 | US FAERS | |
| 813 | Accessory spleen | FAERS: 1 | US FAERS | |
| 814 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 815 | Actinomycosis | FAERS: 1 | US FAERS | |
| 816 | Adenoidal disorder | FAERS: 1 | US FAERS | |
| 817 | Adjustment disorder with depressed mood | FAERS: 1 | US FAERS | |
| 818 | Administration site reaction | FAERS: 1 | US FAERS | |
| 819 | Adnexa uteri cyst | FAERS: 1 | US FAERS | |
| 820 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 821 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 822 | Amaurosis | FAERS: 1 | US FAERS | |
| 823 | Anal Fissure | FAERS: 1 | US FAERS | |
| 824 | Anal discomfort | FAERS: 1 | US FAERS | |
| 825 | Anal sphincterotomy | FAERS: 1 | US FAERS | |
| 826 | Anastomotic complication | FAERS: 1 | US FAERS | |
| 827 | Anastomotic stenosis | FAERS: 1 | US FAERS | |
| 828 | Anastomotic ulcer | FAERS: 1 | US FAERS | |
| 829 | Angiomyolipoma | FAERS: 1 | US FAERS | |
| 830 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 831 | Animal bite | FAERS: 1 | US FAERS | |
| 832 | Animal scratch | FAERS: 1 | US FAERS | |
| 833 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 834 | Anorectal swelling | FAERS: 1 | US FAERS | |
| 835 | Anosmia | FAERS: 1 | US FAERS | |
| 836 | Anti-insulin receptor antibody positive | FAERS: 1 | US FAERS | |
| 837 | Anticoagulation drug level below therapeutic | FAERS: 1 | US FAERS | |
| 838 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 839 | Aortic aneurysm repair | FAERS: 1 | US FAERS | |
| 840 | Aortic valve sclerosis | FAERS: 1 | US FAERS | |
| 841 | Apathy | FAERS: 1 | US FAERS | |
| 842 | Arterial restenosis | FAERS: 1 | US FAERS | |
| 843 | Arterial therapeutic procedure | FAERS: 1 | US FAERS | |
| 844 | Arteriovenous graft site infection | FAERS: 1 | US FAERS | |
| 845 | Asphyxia | FAERS: 1 | US FAERS | |
| 846 | Asterixis | FAERS: 1 | US FAERS | |
| 847 | Asthenopia | FAERS: 1 | US FAERS | |
| 848 | Ataxia | FAERS: 1 | US FAERS | |
| 849 | Atrial tachycardia | FAERS: 1 | US FAERS | |
| 850 | Atrophic vulvovaginitis | FAERS: 1 | US FAERS | |
| 851 | Auricular swelling | FAERS: 1 | US FAERS | |
| 852 | Azoospermia | FAERS: 1 | OFFSIDES US FAERS | |
| 853 | B-lymphocyte abnormalities | FAERS: 1 | US FAERS | |
| 854 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 855 | Benign Neoplasm | FAERS: 1 | US FAERS | |
| 856 | Benign bone neoplasm | FAERS: 1 | US FAERS | |
| 857 | Benign breast lump removal | FAERS: 1 | US FAERS | |
| 858 | Benign neoplasm of prostate | FAERS: 1 | US FAERS | |
| 859 | Benign neoplasm of thyroid gland | FAERS: 1 | US FAERS | |
| 860 | Bicuspid aortic valve | FAERS: 1 | US FAERS | |
| 861 | Bile duct necrosis | FAERS: 1 | US FAERS | |
| 862 | Biliary tract dilation procedure | FAERS: 1 | US FAERS | |
| 863 | Biliary tract infection bacterial | FAERS: 1 | US FAERS | |
| 864 | Bladder instillation procedure | FAERS: 1 | US FAERS | |
| 865 | Bladder neoplasm surgery | FAERS: 1 | US FAERS | |
| 866 | Bladder pain | FAERS: 1 | US FAERS | |
| 867 | Bladder spasm | FAERS: 1 | US FAERS | |
| 868 | Bladder trabeculation | FAERS: 1 | US FAERS | |
| 869 | Blepharitis | FAERS: 1 | US FAERS | |
| 870 | Blister rupture | FAERS: 1 | US FAERS | |
| 871 | Blood Pressure | FAERS: 1 | US FAERS | |
| 872 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 873 | Blood blister | FAERS: 1 | US FAERS | |
| 874 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 875 | Blood elastase increased | FAERS: 1 | OFFSIDES US FAERS | |
| 876 | Blood glucagon increased | FAERS: 1 | US FAERS | |
| 877 | Blood growth hormone increased | FAERS: 1 | US FAERS | |
| 878 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 879 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 880 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 881 | Bone erosion | FAERS: 1 | US FAERS | |
| 882 | Borderline glaucoma | FAERS: 1 | US FAERS | |
| 883 | Brain Contusion | FAERS: 1 | US FAERS | |
| 884 | Breast cancer stage III | FAERS: 1 | US FAERS | |
| 885 | Breast cancer stage II | FAERS: 1 | US FAERS | |
| 886 | Breast discomfort | FAERS: 1 | US FAERS | |
| 887 | Bronchial wall thickening | FAERS: 1 | US FAERS | |
| 888 | Bruxism | FAERS: 1 | US FAERS | |
| 889 | Bunion operation | FAERS: 1 | US FAERS | |
| 890 | Butterfly rash | FAERS: 1 | US FAERS | |
| 891 | C-reactive protein abnormal | FAERS: 1 | US FAERS | |
| 892 | Calcinosis | FAERS: 1 | US FAERS | |
| 893 | Capillary Leak Syndrome | FAERS: 1 | US FAERS | |
| 894 | Carbon dioxide decreased | FAERS: 1 | US FAERS | |
| 895 | Carcinoembryonic Antigen | FAERS: 1 | US FAERS | |
| 896 | Cardiac Death | FAERS: 1 | OFFSIDES US FAERS | |
| 897 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 898 | Cardiac ablation | FAERS: 1 | US FAERS | |
| 899 | Cardiac assistance device user | FAERS: 1 | US FAERS | |
| 900 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 901 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 902 | Cardiac imaging procedure abnormal | FAERS: 1 | US FAERS | |
| 903 | Cardiac valve sclerosis | FAERS: 1 | US FAERS | |
| 904 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 905 | Carotid artery aneurysm | FAERS: 1 | US FAERS | |
| 906 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 907 | Catheter site cellulitis | FAERS: 1 | OFFSIDES US FAERS | |
| 908 | Catheter site pain | FAERS: 1 | US FAERS | |
| 909 | Caustic injury | FAERS: 1 | US FAERS | |
| 910 | Central nervous system lesion | FAERS: 1 | OFFSIDES US FAERS | |
| 911 | Cerebellar infarction | FAERS: 1 | US FAERS | |
| 912 | Cerebral Arteriosclerosis | FAERS: 1 | US FAERS | |
| 913 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 914 | Cerebral calcification | FAERS: 1 | US FAERS | |
| 915 | Choking | FAERS: 1 | US FAERS | |
| 916 | Chronic respiratory failure | FAERS: 1 | US FAERS | |
| 917 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 918 | Coagulation test abnormal | FAERS: 1 | US FAERS | |
| 919 | Coccidioidomycosis | FAERS: 1 | US FAERS | |
| 920 | Colonic fistula | FAERS: 1 | US FAERS | |
| 921 | Complication associated with device | FAERS: 1 | US FAERS | |
| 922 | Congenital syphilitic osteochondritis | FAERS: 1 | US FAERS | |
| 923 | Contrast media reaction | FAERS: 1 | US FAERS | |
| 924 | Coronary angioplasty | FAERS: 1 | US FAERS | |
| 925 | Coronary artery insufficiency | FAERS: 1 | OFFSIDES US FAERS | |
| 926 | Crying | FAERS: 1 | US FAERS | |
| 927 | Culture positive | FAERS: 1 | US FAERS | |
| 928 | Cyst drainage | FAERS: 1 | US FAERS | |
| 929 | Cystocele | FAERS: 1 | US FAERS | |
| 930 | Cytopenia | FAERS: 1 | US FAERS | |
| 931 | Dawn phenomenon | FAERS: 1 | US FAERS | |
| 932 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 933 | Debridement | FAERS: 1 | US FAERS | |
| 934 | Decompression Sickness | FAERS: 1 | US FAERS | |
| 935 | Decreased immune responsiveness | FAERS: 1 | OFFSIDES US FAERS | |
| 936 | Decreased vibratory sense | FAERS: 1 | US FAERS | |
| 937 | Depression suicidal | FAERS: 1 | US FAERS | |
| 938 | Dermabrasion | FAERS: 1 | US FAERS | |
| 939 | Device difficult to use | FAERS: 1 | US FAERS | |
| 940 | Device dislocation | FAERS: 1 | US FAERS | |
| 941 | Device extrusion | FAERS: 1 | US FAERS | |
| 942 | Device lead damage | FAERS: 1 | US FAERS | |
| 943 | Device related infection | FAERS: 1 | US FAERS | |
| 944 | Diabetes mellitus management | FAERS: 1 | US FAERS | |
| 945 | Diabetic Autonomic Neuropathy | FAERS: 1 | US FAERS | |
| 946 | Diabetic metabolic decompensation | FAERS: 1 | US FAERS | |
| 947 | Dilatation intrahepatic duct acquired | FAERS: 1 | US FAERS | |
| 948 | Distributive shock | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 949 | Disturbance in sexual arousal | FAERS: 1 | US FAERS | |
| 950 | Diverticular perforation | FAERS: 1 | OFFSIDES US FAERS | |
| 951 | Drug diversion | FAERS: 1 | US FAERS | |
| 952 | Drug monitoring procedure incorrectly performed | FAERS: 1 | US FAERS | |
| 953 | Drug name confusion | FAERS: 1 | US FAERS | |
| 954 | Drug resistance | FAERS: 1 | US FAERS | |
| 955 | Drug toxicity | FAERS: 1 | US FAERS | |
| 956 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 957 | Dry gangrene | FAERS: 1 | US FAERS | |
| 958 | Duodenal ulcer perforation | FAERS: 1 | US FAERS | |
| 959 | Dyschezia | FAERS: 1 | US FAERS | |
| 960 | Dysmorphism | FAERS: 1 | US FAERS | |
| 961 | Dysthymic Disorder | FAERS: 1 | US FAERS | |
| 962 | Ear congestion | FAERS: 1 | US FAERS | |
| 963 | Eating disorder symptom | FAERS: 1 | US FAERS | |
| 964 | Economic problem | FAERS: 1 | OFFSIDES US FAERS | |
| 965 | Electrocardiogram ST-T segment abnormal | FAERS: 1 | US FAERS | |
| 966 | Elevated mood | FAERS: 1 | OFFSIDES US FAERS | |
| 967 | Endometrial adenocarcinoma | FAERS: 1 | US FAERS | |
| 968 | Endometrial thickening | FAERS: 1 | US FAERS | |
| 969 | Endoscopic ultrasound abnormal | FAERS: 1 | US FAERS | |
| 970 | Endoscopy small intestine abnormal | FAERS: 1 | US FAERS | |
| 971 | Enterocolitis | FAERS: 1 | US FAERS | |
| 972 | Enterocutaneous Fistula | FAERS: 1 | US FAERS | |
| 973 | Enuresis | FAERS: 1 | US FAERS | |
| 974 | Eosinophilia | FAERS: 1 | US FAERS | |
| 975 | Epidermal growth factor receptor decreased | FAERS: 1 | US FAERS | |
| 976 | Erosive Duodenitis | FAERS: 1 | US FAERS | |
| 977 | Escherichia infection | FAERS: 1 | US FAERS | |
| 978 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 979 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 980 | Essential Tremor | FAERS: 1 | US FAERS | |
| 981 | Euphoric mood | FAERS: 1 | US FAERS | |
| 982 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 983 | Exophthalmos | FAERS: 1 | US FAERS | |
| 984 | Expired drug administered | FAERS: 1 | US FAERS | |
| 985 | Exposure to chemical pollution | FAERS: 1 | US FAERS | |
| 986 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 987 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 988 | Eye allergy | FAERS: 1 | US FAERS | |
| 989 | Eye excision | FAERS: 1 | US FAERS | |
| 990 | Eye inflammation | FAERS: 1 | US FAERS | |
| 991 | Eye laser surgery | FAERS: 1 | US FAERS | |
| 992 | Eye muscle operation | FAERS: 1 | US FAERS | |
| 993 | Facial Pain | FAERS: 1 | US FAERS | |
| 994 | Facial paralysis | FAERS: 1 | US FAERS | |
| 995 | Factor II mutation | FAERS: 1 | US FAERS | |
| 996 | Fascial rupture | FAERS: 1 | US FAERS | |
| 997 | Feeding tube user | FAERS: 1 | US FAERS | |
| 998 | Female Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 999 | Femoral artery occlusion | FAERS: 1 | US FAERS | |
| 1000 | Finger repair operation | FAERS: 1 | US FAERS | |
| 1001 | Fixed drug eruption | FAERS: 1 | US FAERS | |
| 1002 | Flat affect | FAERS: 1 | US FAERS | |
| 1003 | Focal Nodular Hyperplasia | FAERS: 1 | US FAERS | |
| 1004 | Food Allergy | FAERS: 1 | OFFSIDES US FAERS | |
| 1005 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 1006 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 1007 | Gait inability | FAERS: 1 | US FAERS | |
| 1008 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 1009 | Gastric infection | FAERS: 1 | US FAERS | |
| 1010 | Gastric mucosa erythema | FAERS: 1 | US FAERS | |
| 1011 | Gastric stent insertion | FAERS: 1 | US FAERS | |
| 1012 | Gastrinoma | FAERS: 1 | US FAERS | |
| 1013 | Gastrointestinal angiodysplasia haemorrhagic | FAERS: 1 | US FAERS | |
| 1014 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 1015 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 1016 | Gastrointestinal motility disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 1017 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 1018 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 1019 | Gastrointestinal stoma complication | FAERS: 1 | US FAERS | |
| 1020 | Gastrointestinal telangiectasia | FAERS: 1 | US FAERS | |
| 1021 | Genital atrophy | FAERS: 1 | US FAERS | |
| 1022 | Gingival Hyperplasia | FAERS: 1 | US FAERS | |
| 1023 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 1024 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 1025 | Graft thrombosis | FAERS: 1 | US FAERS | |
| 1026 | Granulomatous liver disease | FAERS: 1 | OFFSIDES US FAERS | |
| 1027 | Head titubation | FAERS: 1 | OFFSIDES US FAERS | |
| 1028 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 1029 | Helicobacter test positive | FAERS: 1 | US FAERS | |
| 1030 | Hepatic Infarction | FAERS: 1 | US FAERS | |
| 1031 | Hepatic Infection | FAERS: 1 | US FAERS | |
| 1032 | Hepatic cancer stage IV | FAERS: 1 | US FAERS | |
| 1033 | Hepatic displacement | FAERS: 1 | US FAERS | |
| 1034 | Hepatitis A | FAERS: 1 | US FAERS | |
| 1035 | Hydrocele operation | FAERS: 1 | US FAERS | |
| 1036 | Hyperlipasaemia | FAERS: 1 | US FAERS | |
| 1037 | Hyperpituitarism | FAERS: 1 | US FAERS | |
| 1038 | Hyperplastic cholecystopathy | FAERS: 1 | US FAERS | |
| 1039 | Hypertensive emergency | FAERS: 1 | US FAERS | |
| 1040 | Hypogonadism | FAERS: 1 | US FAERS | |
| 1041 | Hysterotomy | FAERS: 1 | US FAERS | |
| 1042 | Iliac artery occlusion | FAERS: 1 | US FAERS | |
| 1043 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 1044 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 1045 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 1046 | Incision site complication | FAERS: 1 | US FAERS | |
| 1047 | Incision site erythema | FAERS: 1 | US FAERS | |
| 1048 | Incisional hernia | FAERS: 1 | US FAERS | |
| 1049 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 1050 | Induration | FAERS: 1 | US FAERS | |
| 1051 | Infected bite | FAERS: 1 | US FAERS | |
| 1052 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 1053 | Inflammatory pain | FAERS: 1 | US FAERS | |
| 1054 | Inhibitory drug interaction | FAERS: 1 | US FAERS | |
| 1055 | Inner ear operation | FAERS: 1 | US FAERS | |
| 1056 | Insulin Resistance | FAERS: 1 | US FAERS | |
| 1057 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 1058 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 1059 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 1060 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 1061 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 1062 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 1063 | Internal injury | FAERS: 1 | US FAERS | |
| 1064 | Intestinal adenocarcinoma | FAERS: 1 | US FAERS | |
| 1065 | Intestinal cyst | FAERS: 1 | US FAERS | |
| 1066 | Intestinal polypectomy | FAERS: 1 | US FAERS | |
| 1067 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 1068 | Intra-abdominal pressure increased | FAERS: 1 | US FAERS | |
| 1069 | Intraductal papillary-mucinous carcinoma of pancreas | FAERS: 1 | US FAERS | |
| 1070 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 1071 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 1072 | Joint destruction | FAERS: 1 | US FAERS | |
| 1073 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 1074 | Lacrimal duct procedure | FAERS: 1 | US FAERS | |
| 1075 | Large intestinal polypectomy | FAERS: 1 | US FAERS | |
| 1076 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 1077 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 1078 | Ligament rupture | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1079 | Lip Infection | FAERS: 1 | US FAERS | |
| 1080 | Lipids abnormal | FAERS: 1 | US FAERS | |
| 1081 | Lipogranuloma | FAERS: 1 | US FAERS | |
| 1082 | Lipomatosis | FAERS: 1 | US FAERS | |
| 1083 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 1084 | Lower respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 1085 | Lumbar radiculopathy | FAERS: 1 | US FAERS | |
| 1086 | Lumbarisation | FAERS: 1 | US FAERS | |
| 1087 | Lung cyst | FAERS: 1 | US FAERS | |
| 1088 | Lyme Disease | FAERS: 1 | US FAERS | |
| 1089 | Lymphangioma | FAERS: 1 | US FAERS | |
| 1090 | Lymphangitis | FAERS: 1 | US FAERS | |
| 1091 | Lymphocele | FAERS: 1 | US FAERS | |
| 1092 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 1093 | Lymphoid tissue hyperplasia | FAERS: 1 | US FAERS | |
| 1094 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 1095 | Malignant Hypertension | FAERS: 1 | OFFSIDES US FAERS | |
| 1096 | Malignant melanoma in situ | FAERS: 1 | US FAERS | |
| 1097 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 1098 | Mallory-Weiss Syndrome | FAERS: 1 | US FAERS | |
| 1099 | Marasmus | FAERS: 1 | US FAERS | |
| 1100 | Mass excision | FAERS: 1 | US FAERS | |
| 1101 | Mastication disorder | FAERS: 1 | US FAERS | |
| 1102 | Mastocytosis | FAERS: 1 | US FAERS | |
| 1103 | Mastoidectomy | FAERS: 1 | US FAERS | |
| 1104 | Measles | FAERS: 1 | US FAERS | |
| 1105 | Mediastinal mass | FAERS: 1 | US FAERS | |
| 1106 | Medical device change | FAERS: 1 | US FAERS | |
| 1107 | Medical device implantation | FAERS: 1 | US FAERS | |
| 1108 | Medication crystals in urine present | FAERS: 1 | US FAERS | |
| 1109 | Meniscus removal | FAERS: 1 | US FAERS | |
| 1110 | Mesenteric Vascular Occlusion | FAERS: 1 | US FAERS | |
| 1111 | Metastases to biliary tract | FAERS: 1 | US FAERS | |
| 1112 | Metastases to gallbladder | FAERS: 1 | US FAERS | |
| 1113 | Metastases to thorax | FAERS: 1 | US FAERS | |
| 1114 | Middle insomnia | FAERS: 1 | US FAERS | |
| 1115 | Mixed dementia | FAERS: 1 | US FAERS | |
| 1116 | Mononeuritis | FAERS: 1 | US FAERS | |
| 1117 | Mononeuropathy Multiplex | FAERS: 1 | US FAERS | |
| 1118 | Mononucleosis syndrome | FAERS: 1 | US FAERS | |
| 1119 | Mouth swelling | FAERS: 1 | US FAERS | |
| 1120 | Mucinous adenocarcinoma of appendix | FAERS: 1 | US FAERS | |
| 1121 | Mucosal atrophy | FAERS: 1 | US FAERS | |
| 1122 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 1123 | Muscle strain | FAERS: 1 | US FAERS | |
| 1124 | Muscle tone disorder | FAERS: 1 | US FAERS | |
| 1125 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 1126 | Mydriasis | FAERS: 1 | US FAERS | |
| 1127 | Myelitis | FAERS: 1 | US FAERS | |
| 1128 | Myolipoma | FAERS: 1 | US FAERS | |
| 1129 | Myopathy | FAERS: 1 | US FAERS | |
| 1130 | Myopia | FAERS: 1 | OFFSIDES US FAERS | |
| 1131 | Nephrocalcinosis | FAERS: 1 | US FAERS | |
| 1132 | Neurolysis | FAERS: 1 | US FAERS | |
| 1133 | Neuropathy | FAERS: 1 | US FAERS | |
| 1134 | Neutropenic colitis | FAERS: 1 | US FAERS | |
| 1135 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 1136 | Nicotine Dependence | FAERS: 1 | US FAERS | |
| 1137 | Nipple pain | FAERS: 1 | US FAERS | |
| 1138 | No adverse effect | FAERS: 1 | US FAERS | |
| 1139 | Noninfective sialoadenitis | FAERS: 1 | US FAERS | |
| 1140 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 1141 | Nuchal Rigidity | FAERS: 1 | US FAERS | |
| 1142 | Ocular Hypertension | FAERS: 1 | US FAERS | |
| 1143 | Oliguria | FAERS: 1 | US FAERS | |
| 1144 | Onycholysis | FAERS: 1 | US FAERS | |
| 1145 | Open reduction of fracture | FAERS: 1 | US FAERS | |
| 1146 | Ophthalmological examination abnormal | FAERS: 1 | US FAERS | |
| 1147 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 1148 | Oral administration complication | FAERS: 1 | US FAERS | |
| 1149 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 1150 | Oral infection | FAERS: 1 | US FAERS | |
| 1151 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 1152 | Oropharyngeal blistering | FAERS: 1 | OFFSIDES US FAERS | |
| 1153 | Otitis Externa | FAERS: 1 | US FAERS | |
| 1154 | Ovarian germ cell teratoma benign | FAERS: 1 | US FAERS | |
| 1155 | Overweight | FAERS: 1 | US FAERS | |
| 1156 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 1157 | Pancreatic Duct Stenosis | FAERS: 1 | US FAERS | |
| 1158 | Pancreatic Fistula | FAERS: 1 | US FAERS | |
| 1159 | Pancreatic carcinoma stage I | FAERS: 1 | US FAERS | |
| 1160 | Pancreatic duct obstruction | FAERS: 1 | US FAERS | |
| 1161 | Pancreatic steatosis | FAERS: 1 | US FAERS | |
| 1162 | Pancreaticosplenectomy | FAERS: 1 | US FAERS | |
| 1163 | Papilloma | FAERS: 1 | US FAERS | |
| 1164 | Paranasal cyst | FAERS: 1 | US FAERS | |
| 1165 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 1166 | Parathyroidectomy | FAERS: 1 | US FAERS | |
| 1167 | Paresis | FAERS: 1 | US FAERS | |
| 1168 | Parotid gland inflammation | FAERS: 1 | US FAERS | |
| 1169 | Partial lung resection | FAERS: 1 | US FAERS | |
| 1170 | Patient dissatisfaction with treatment | FAERS: 1 | US FAERS | |
| 1171 | Pelvic cyst | FAERS: 1 | US FAERS | |
| 1172 | Pelvic mass | FAERS: 1 | US FAERS | |
| 1173 | Performance status decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 1174 | Pericardial Cyst | FAERS: 1 | US FAERS | |
| 1175 | Perinephric collection | FAERS: 1 | US FAERS | |
| 1176 | Peripheral artery bypass | FAERS: 1 | US FAERS | |
| 1177 | Peripheral artery stenosis | FAERS: 1 | US FAERS | |
| 1178 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 1179 | Peritoneal carcinoma metastatic | FAERS: 1 | US FAERS | |
| 1180 | Perivascular dermatitis | FAERS: 1 | US FAERS | |
| 1181 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 1182 | Pharyngolaryngeal discomfort | FAERS: 1 | US FAERS | |
| 1183 | Pilonidal sinus repair | FAERS: 1 | US FAERS | |
| 1184 | Plasmacytoma | FAERS: 1 | US FAERS | |
| 1185 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 1186 | Pneumonitis | FAERS: 1 | US FAERS | |
| 1187 | Pneumoperitoneum | FAERS: 1 | OFFSIDES US FAERS | |
| 1188 | Poisoning | FAERS: 1 | US FAERS | |
| 1189 | Polydipsia | FAERS: 1 | US FAERS | |
| 1190 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 1191 | Poor dental condition | FAERS: 1 | US FAERS | |
| 1192 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 1193 | Poor personal hygiene | FAERS: 1 | US FAERS | |
| 1194 | Portal vein stenosis | FAERS: 1 | US FAERS | |
| 1195 | Post procedural hypothyroidism | FAERS: 1 | US FAERS | |
| 1196 | Post procedural infection | FAERS: 1 | US FAERS | |
| 1197 | Post procedural urine leak | FAERS: 1 | US FAERS | |
| 1198 | Postoperative abscess | FAERS: 1 | US FAERS | |
| 1199 | Postoperative fever | FAERS: 1 | US FAERS | |
| 1200 | Postoperative ileus | FAERS: 1 | US FAERS | |
| 1201 | Procedural complication | FAERS: 1 | US FAERS | |
| 1202 | Procedural hypotension | FAERS: 1 | US FAERS | |
| 1203 | Proctitis | FAERS: 1 | US FAERS | |
| 1204 | Product coating issue | FAERS: 1 | US FAERS | |
| 1205 | Product complaint | FAERS: 1 | US FAERS | |
| 1206 | Product compounding quality issue | FAERS: 1 | US FAERS | |
| 1207 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 1208 | Product label issue | FAERS: 1 | US FAERS | |
| 1209 | Product lot number issue | FAERS: 1 | US FAERS | |
| 1210 | Product name confusion | FAERS: 1 | US FAERS | |
| 1211 | Product packaging counterfeit | FAERS: 1 | US FAERS | |
| 1212 | Product residue present | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1213 | Product selection error | FAERS: 1 | US FAERS | |
| 1214 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 1215 | Product substitution issue | FAERS: 1 | US FAERS | |
| 1216 | Prostatectomy | FAERS: 1 | US FAERS | |
| 1217 | Prothrombin time abnormal | FAERS: 1 | US FAERS | |
| 1218 | Prurigo | FAERS: 1 | US FAERS | |
| 1219 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 1220 | Psoas Abscess | FAERS: 1 | US FAERS | |
| 1221 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 1222 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 1223 | Purulence | FAERS: 1 | US FAERS | |
| 1224 | Purulent discharge | FAERS: 1 | US FAERS | |
| 1225 | Pyelocaliectasis | FAERS: 1 | US FAERS | |
| 1226 | Pyuria | FAERS: 1 | US FAERS | |
| 1227 | Radical hysterectomy | FAERS: 1 | US FAERS | |
| 1228 | Radiotherapy to abdomen | FAERS: 1 | US FAERS | |
| 1229 | Radiotherapy to joint | FAERS: 1 | US FAERS | |
| 1230 | Reactive gastropathy | FAERS: 1 | US FAERS | |
| 1231 | Recall phenomenon | FAERS: 1 | US FAERS | |
| 1232 | Rectal fissure | FAERS: 1 | US FAERS | |
| 1233 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 1234 | Rectocele | FAERS: 1 | US FAERS | |
| 1235 | Restrictive pulmonary disease | FAERS: 1 | US FAERS | |
| 1236 | Reticulocyte count decreased | FAERS: 1 | US FAERS | |
| 1237 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 1238 | Retinal exudates | FAERS: 1 | US FAERS | |
| 1239 | Retinal telangiectasia | FAERS: 1 | US FAERS | |
| 1240 | Rheumatoid Vasculitis | FAERS: 1 | US FAERS | |
| 1241 | Rhinalgia | FAERS: 1 | US FAERS | |
| 1242 | Rhinitis perennial | FAERS: 1 | US FAERS | |
| 1243 | Salivary gland adenoma | FAERS: 1 | US FAERS | |
| 1244 | Salpingectomy | FAERS: 1 | US FAERS | |
| 1245 | Salpingo-oophorectomy unilateral | FAERS: 1 | US FAERS | |
| 1246 | Sarcoma | FAERS: 1 | US FAERS | |
| 1247 | Sarcopenia | FAERS: 1 | US FAERS | |
| 1248 | Scleroderma | FAERS: 1 | US FAERS | |
| 1249 | Screaming | FAERS: 1 | US FAERS | |
| 1250 | Secretion discharge | FAERS: 1 | US FAERS | |
| 1251 | Semen volume decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 1252 | Septic embolus | FAERS: 1 | US FAERS | |
| 1253 | Severe Acute Respiratory Syndrome | FAERS: 1 | US FAERS | |
| 1254 | Simple mastectomy | FAERS: 1 | US FAERS | |
| 1255 | Single functional kidney | FAERS: 1 | US FAERS | |
| 1256 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 1257 | Sinus polyp | FAERS: 1 | US FAERS | |
| 1258 | Skin laceration | FAERS: 1 | US FAERS | |
| 1259 | Skin necrosis | FAERS: 1 | US FAERS | |
| 1260 | Skin nodule | FAERS: 1 | US FAERS | |
| 1261 | Sleep disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 1262 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 1263 | Small intestine carcinoma metastatic | FAERS: 1 | US FAERS | |
| 1264 | Soft tissue flap operation | FAERS: 1 | US FAERS | |
| 1265 | Soft tissue inflammation | FAERS: 1 | US FAERS | |
| 1266 | Soft tissue mass | FAERS: 1 | US FAERS | |
| 1267 | Sperm count decreased | FAERS: 1 | US FAERS | |
| 1268 | Spinal X-ray abnormal | FAERS: 1 | US FAERS | |
| 1269 | Spondylolysis | FAERS: 1 | US FAERS | |
| 1270 | Squamous cell carcinoma of lung | FAERS: 1 | US FAERS | |
| 1271 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 1272 | Starvation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1273 | Stasis dermatitis | FAERS: 1 | US FAERS | |
| 1274 | Steroid therapy | FAERS: 1 | US FAERS | |
| 1275 | Strabismus | FAERS: 1 | US FAERS | |
| 1276 | Subacute endocarditis | FAERS: 1 | US FAERS | |
| 1277 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 1278 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 1279 | Sunburn | FAERS: 1 | US FAERS | |
| 1280 | Superior Mesenteric Artery Syndrome | FAERS: 1 | US FAERS | |
| 1281 | Surgical failure | FAERS: 1 | US FAERS | |
| 1282 | Suture related complication | FAERS: 1 | US FAERS | |
| 1283 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 1284 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 1285 | Tension Headache | FAERS: 1 | US FAERS | |
| 1286 | Tension | FAERS: 1 | SIDER US FAERS | |
| 1287 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 1288 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 1289 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 1290 | Therapy change | FAERS: 1 | US FAERS | |
| 1291 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 1292 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 1293 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 1294 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 1295 | Thymoma | FAERS: 1 | US FAERS | |
| 1296 | Tinea Pedis | FAERS: 1 | US FAERS | |
| 1297 | Tinea cruris | FAERS: 1 | OFFSIDES US FAERS | |
| 1298 | Toe operation | FAERS: 1 | US FAERS | |
| 1299 | Tongue biting | FAERS: 1 | US FAERS | |
| 1300 | Tongue blistering | FAERS: 1 | US FAERS | |
| 1301 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 1302 | Tongue eruption | FAERS: 1 | US FAERS | |
| 1303 | Tooth Infection | FAERS: 1 | SIDER US FAERS | |
| 1304 | Transaminases abnormal | FAERS: 1 | US FAERS | |
| 1305 | Transplant | FAERS: 1 | US FAERS | |
| 1306 | Traumatic liver injury | FAERS: 1 | US FAERS | |
| 1307 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 1308 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 1309 | Troponin I increased | FAERS: 1 | US FAERS | |
| 1310 | Trousseau's syndrome | FAERS: 1 | US FAERS | |
| 1311 | Tympanic Membrane Perforation | FAERS: 1 | OFFSIDES US FAERS | |
| 1312 | Unable to afford prescribed medication | FAERS: 1 | US FAERS | |
| 1313 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 1314 | Ureteral stent insertion | FAERS: 1 | US FAERS | |
| 1315 | Ureterocele | FAERS: 1 | US FAERS | |
| 1316 | Ureterolithiasis | FAERS: 1 | US FAERS | |
| 1317 | Urethral Stenosis | FAERS: 1 | US FAERS | |
| 1318 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 1319 | Urine alcohol test positive | FAERS: 1 | US FAERS | |
| 1320 | Urine output increased | FAERS: 1 | US FAERS | |
| 1321 | Uterine Polyp | FAERS: 1 | US FAERS | |
| 1322 | Uterine Prolapse | FAERS: 1 | US FAERS | |
| 1323 | Uveitis | FAERS: 1 | US FAERS | |
| 1324 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 1325 | Vagus Nerve Disorder | FAERS: 1 | US FAERS | |
| 1326 | Varicocele | FAERS: 1 | US FAERS | |
| 1327 | Vascular access placement | FAERS: 1 | US FAERS | |
| 1328 | Vascular encephalopathy | FAERS: 1 | US FAERS | |
| 1329 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 1330 | Vascular rupture | FAERS: 1 | US FAERS | |
| 1331 | Vascular stent insertion | FAERS: 1 | US FAERS | |
| 1332 | Vasculitic rash | FAERS: 1 | US FAERS | |
| 1333 | Venous Insufficiency | FAERS: 1 | US FAERS | |
| 1334 | Venous ligation | FAERS: 1 | US FAERS | |
| 1335 | Venous stenosis | FAERS: 1 | US FAERS | |
| 1336 | Vertebral lesion | FAERS: 1 | US FAERS | |
| 1337 | Vertebral wedging | FAERS: 1 | US FAERS | |
| 1338 | Vertebroplasty | FAERS: 1 | US FAERS | |
| 1339 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 1340 | Visual acuity reduced transiently | FAERS: 1 | US FAERS | |
| 1341 | Vitamin B12 abnormal | FAERS: 1 | US FAERS | |
| 1342 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 1343 | Vocal cord nodule removal | FAERS: 1 | US FAERS | |
| 1344 | Wheelchair user | FAERS: 1 | US FAERS | |
| 1345 | White blood cell count abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 1346 | Wound Complication | FAERS: 1 | US FAERS | |
| 1347 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 1348 | angiogram | FAERS: 1 | US FAERS | |
| 1349 | effusion | FAERS: 1 | US FAERS | |
| 1350 | fibroma | FAERS: 1 | US FAERS | |
| 1351 | insulinoma | FAERS: 1 | US FAERS | |
| 1352 | neurofibroma | FAERS: 1 | US FAERS | |
| 1353 | Acute bronchitis | SIDER | ||
| 1354 | Agoraphobia | OFFSIDES | ||
| 1355 | Anhedonia | OFFSIDES | ||
| 1356 | Aseptic Meningitis | OFFSIDES | ||
| 1357 | Balanitis | OFFSIDES | ||
| 1358 | Blastomycosis | OFFSIDES | ||
| 1359 | Blood 25-hydroxycholecalciferol decreased | OFFSIDES | ||
| 1360 | Blood creatine decreased | OFFSIDES | ||
| 1361 | Blood homocysteine | OFFSIDES | ||
| 1362 | Blurred vision | OFFSIDES | ||
| 1363 | Cardioactive drug level increased | OFFSIDES | ||
| 1364 | Chronic active hepatitis | OFFSIDES | ||
| 1365 | Complex partial seizures | OFFSIDES | ||
| 1366 | Corneal striae | OFFSIDES | ||
| 1367 | Cranial Nerve Infection | OFFSIDES | ||
| 1368 | Delusional disorder, persecutory type | OFFSIDES | ||
| 1369 | Diarrhea | OFFSIDES | ||
| 1370 | Drowning | OFFSIDES | ||
| 1371 | Drug withdrawal headache | OFFSIDES | ||
| 1372 | Ear and labyrinth disorders | SIDER | ||
| 1373 | Ear discomfort | OFFSIDES | ||
| 1374 | Epiglottitis | OFFSIDES | ||
| 1375 | Eschar | OFFSIDES | ||
| 1376 | Fat intolerance | OFFSIDES | ||
| 1377 | Feeling of body temperature change | OFFSIDES | ||
| 1378 | Gammopathy | OFFSIDES | ||
| 1379 | Granulocyte count increased | OFFSIDES | ||
| 1380 | Hemicephalalgia | OFFSIDES | ||
| 1381 | Histoplasmosis | OFFSIDES | ||
| 1382 | Idiopathic urticaria | OFFSIDES | ||
| 1383 | Implant site erythema | OFFSIDES | ||
| 1384 | Inability to crawl | OFFSIDES | ||
| 1385 | Infestation | SIDER | ||
| 1386 | Inhalation Therapy | OFFSIDES | ||
| 1387 | Iritis | OFFSIDES | ||
| 1388 | Lipase | OFFSIDES | ||
| 1389 | Loss of proprioception | OFFSIDES | ||
| 1390 | Lower respiratory tract infection fungal | OFFSIDES | ||
| 1391 | Mediastinitis | OFFSIDES | ||
| 1392 | Meibomianitis | OFFSIDES | ||
| 1393 | Migraine with Aura | OFFSIDES | ||
| 1394 | Mixed Connective Tissue Disease | OFFSIDES | ||
| 1395 | Myoclonic Epilepsy | OFFSIDES | ||
| 1396 | Orthopnea | OFFSIDES | ||
| 1397 | Ototoxicity | OFFSIDES | ||
| 1398 | Ovarian adenoma | OFFSIDES | ||
| 1399 | Palpable purpura | OFFSIDES | ||
| 1400 | Penile Infection | OFFSIDES | ||
| 1401 | Penile necrosis | OFFSIDES | ||
| 1402 | Perianal abscess | OFFSIDES | ||
| 1403 | Physical assault | OFFSIDES | ||
| 1404 | Physical testicle examination abnormal | OFFSIDES | ||
| 1405 | Post inflammatory pigmentation change | OFFSIDES | ||
| 1406 | Presbyopia | OFFSIDES | ||
| 1407 | Progressive supranuclear palsy | OFFSIDES | ||
| 1408 | Renal embolism | OFFSIDES | ||
| 1409 | Respiratory tract infection bacterial | OFFSIDES | ||
| 1410 | Retinal vascular thrombosis | OFFSIDES | ||
| 1411 | Rhinorrhea | OFFSIDES | ||
| 1412 | Risus sardonicus | OFFSIDES | ||
| 1413 | Saliva altered | OFFSIDES | ||
| 1414 | Shoulder Pain | SIDER | ||
| 1415 | Testicular mass | OFFSIDES | ||
| 1416 | Thalamic infarction | OFFSIDES | ||
| 1417 | Tracheal fistula | OFFSIDES | ||
| 1418 | Tracheobronchitis | SIDER | ||
| 1419 | Uterine spasm | OFFSIDES | ||
| 1420 | Venoocclusive disease | OFFSIDES | ||
| 1421 | Vitrectomy | OFFSIDES | ||
| 1422 | Vulvovaginal pain | OFFSIDES | ||
| 1423 | Wound evisceration | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.