Capecitabine
(GAGWJHPBXLXJQN-UORFTKCHSA-N)
Structure
- SMILES
- CCCCCOC(=O)Nc1nc(=O)n(cc1F)[C@@H]1O[C@@H]([C@H]([C@H]1O)O)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01BC06
- Molecular Formula:
- C15H22FN3O6
- Molecular Weight:
- 359.350
- Log P:
- 0.8332
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 3
- TPSA:
- 122.91
- CAS Number(s):
- 154361-50-9; 958887-39-3
Synonym(s)
1.
Capecitabine
2.
N(4)-pentyloxycarbonyl-5'-deoxy-5-fluorocytidine
3.
Xeloda
External Link(s)
| MeSH | D000069287 |
| PubChem Compound | 60953 |
| ChEBI | 31348 |
| CHEMBL | CHEMBL1773 |
| DrugBank | DB01101 |
| DrugCentral | 480 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 6799 |
| KEGG | cpd:C12650 dr:D01223 |
| Therapeutic Target Database | D00HCQ |
| ZINC | 3806413 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 1043 Canada Vigilance: 13 | 18000507 18813211 20722491 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 2 | Disease Progression | FAERS: 1004 Canada Vigilance: 23 | Canada Vigilance OFFSIDES US FAERS | |
| 3 | Vomiting | FAERS: 774 Canada Vigilance: 12 | CTD SIDER Canada Vigilance US FAERS | |
| 4 | Fatigue | FAERS: 615 Canada Vigilance: 11 | 20015624 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 5 | Malignant neoplasm progression | FAERS: 449 Canada Vigilance: 55 | Canada Vigilance OFFSIDES US FAERS | |
| 6 | Drug ineffective | FAERS: 376 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 7 | Dehydration | FAERS: 372 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 8 | Asthenia | FAERS: 313 Canada Vigilance: 3 | 19246950 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 9 | Erythema | FAERS: 310 Canada Vigilance: 9 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 10 | Stomatitis | FAERS: 305 Canada Vigilance: 4 | 18000507 20015624 20722491 | CTD SIDER Canada Vigilance US FAERS |
| 11 | Dry skin | FAERS: 237 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 12 | Pain | FAERS: 216 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 13 | Weight decreased | FAERS: 205 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 14 | Constipation | FAERS: 186 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 15 | Abdominal Pain | FAERS: 177 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 16 | Malaise | FAERS: 177 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 17 | Dizziness | FAERS: 157 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 18 | Chest Pain | FAERS: 143 Canada Vigilance: 13 | CTD SIDER Canada Vigilance US FAERS | |
| 19 | Neutropenia | FAERS: 139 Canada Vigilance: 4 | CTD SIDER Canada Vigilance US FAERS | |
| 20 | Intestinal Obstruction | FAERS: 134 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 21 | Peripheral swelling | FAERS: 134 | US FAERS | |
| 22 | Burning sensation | FAERS: 122 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 23 | Pneumonia | FAERS: 121 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 24 | Pruritus | FAERS: 121 | SIDER US FAERS | |
| 25 | Headache | FAERS: 118 | 17536204 | CTD SIDER US FAERS |
| 26 | No adverse event | FAERS: 111 | US FAERS | |
| 27 | White blood cell count decreased | FAERS: 107 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 28 | Thrombocytopenia | FAERS: 106 | 17594717 18000507 | CTD SIDER US FAERS |
| 29 | Sepsis | FAERS: 101 | SIDER US FAERS | |
| 30 | Alopecia | FAERS: 90 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 31 | Back Pain | FAERS: 87 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 32 | Leukopenia | FAERS: 83 | 18000507 | CTD SIDER US FAERS |
| 33 | General physical health deterioration | FAERS: 76 | OFFSIDES US FAERS | |
| 34 | Therapy cessation | FAERS: 76 | US FAERS | |
| 35 | Thrombosis | FAERS: 76 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 36 | Febrile Neutropenia | FAERS: 75 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 37 | Infection | FAERS: 73 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 38 | Toxicity to various agents | FAERS: 70 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 39 | Cerebrovascular accident | FAERS: 69 | SIDER US FAERS | |
| 40 | Pulmonary Embolism | FAERS: 69 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 41 | Dysgeusia | FAERS: 68 | SIDER US FAERS | |
| 42 | Hypotension | FAERS: 68 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 43 | Cardiac Arrest | FAERS: 67 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 44 | Abdominal discomfort | FAERS: 66 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 45 | Pancytopenia | FAERS: 65 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 46 | Unevaluable event | FAERS: 64 | US FAERS | |
| 47 | Dihydropyrimidine Dehydrogenase Deficiency | FAERS: 62 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 48 | Drug dose omission | FAERS: 62 | US FAERS | |
| 49 | Myocardial Infarction | FAERS: 62 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 50 | Colitis | FAERS: 61 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 51 | Arthralgia | FAERS: 59 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 52 | Chest discomfort | FAERS: 55 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 53 | Respiratory Failure | FAERS: 51 | US FAERS | |
| 54 | Ascites | FAERS: 49 | OFFSIDES SIDER US FAERS | |
| 55 | Chills | FAERS: 48 | SIDER US FAERS | |
| 56 | Deep Vein Thrombosis | FAERS: 48 | SIDER US FAERS | |
| 57 | Swelling | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 58 | Visual Impairment | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 59 | Somnolence | FAERS: 43 | US FAERS | |
| 60 | Syncope | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 61 | Myalgia | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 62 | Pancreatic carcinoma | FAERS: 42 | US FAERS | |
| 63 | Hypersensitivity | FAERS: 41 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 64 | Metastasis | FAERS: 41 | US FAERS | |
| 65 | Abasia | FAERS: 39 | OFFSIDES US FAERS | |
| 66 | Bone pain | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 67 | Dyspepsia | FAERS: 39 | OFFSIDES SIDER US FAERS | |
| 68 | Anxiety | FAERS: 38 | OFFSIDES SIDER US FAERS | |
| 69 | Eye irritation | FAERS: 37 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 70 | Oral pain | FAERS: 37 | SIDER US FAERS | |
| 71 | Septic Shock | FAERS: 37 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 72 | Atrial Fibrillation | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 73 | Feeling abnormal | FAERS: 36 | SIDER US FAERS | |
| 74 | jaundice | FAERS: 36 | SIDER US FAERS | |
| 75 | Medication Error | FAERS: 35 | US FAERS | |
| 76 | Metastatic Neoplasm | FAERS: 35 | OFFSIDES US FAERS | |
| 77 | Pancreatitis | FAERS: 35 | OFFSIDES US FAERS | |
| 78 | Skin toxicity | FAERS: 35 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 79 | Enteritis | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 80 | Memory impairment | FAERS: 34 | SIDER US FAERS | |
| 81 | Skin reaction | FAERS: 34 | SIDER US FAERS | |
| 82 | Ventricular Fibrillation | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 83 | Gastrointestinal toxicity | FAERS: 33 | OFFSIDES SIDER US FAERS | |
| 84 | Musculoskeletal Pain | FAERS: 33 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 85 | Intentional product use issue | FAERS: 32 | US FAERS | |
| 86 | Palpitations | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 87 | Skin Ulcer | FAERS: 32 | SIDER US FAERS | |
| 88 | Wrong technique in product usage process | FAERS: 32 | US FAERS | |
| 89 | Oropharyngeal pain | FAERS: 31 | OFFSIDES SIDER US FAERS | |
| 90 | Temperature intolerance | FAERS: 31 | SIDER US FAERS | |
| 91 | Urinary tract infection | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 92 | Epistaxis | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 93 | Angina Pectoris | FAERS: 29 | CTD SIDER US FAERS | |
| 94 | Blood potassium decreased | FAERS: 29 | SIDER US FAERS | |
| 95 | Acute kidney injury | FAERS: 28 | US FAERS | |
| 96 | Amnesia | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 97 | Haematotoxicity | FAERS: 28 | US FAERS | |
| 98 | Ileus | FAERS: 28 | SIDER US FAERS | |
| 99 | Cardiotoxicity | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 100 | Flatulence | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 101 | Leukoencephalopathy | FAERS: 27 | US FAERS | |
| 102 | Stevens-Johnson Syndrome | FAERS: 27 | SIDER US FAERS | |
| 103 | Blood glucose increased | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 104 | Carcinoembryonic antigen increased | FAERS: 26 | US FAERS | |
| 105 | Dysuria | FAERS: 26 | OFFSIDES SIDER US FAERS | |
| 106 | Neutropenic sepsis | FAERS: 26 | SIDER US FAERS | |
| 107 | Tachycardia | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 108 | Rash erythematous | FAERS: 25 | SIDER US FAERS | |
| 109 | Tremor | FAERS: 25 | SIDER US FAERS | |
| 110 | Fingerprint loss | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 111 | Full blood count decreased | FAERS: 24 | OFFSIDES US FAERS | |
| 112 | Inflammation | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 113 | Joint swelling | FAERS: 24 | SIDER US FAERS | |
| 114 | Hypophagia | FAERS: 23 | OFFSIDES US FAERS | |
| 115 | Alanine Aminotransferase Increased | FAERS: 22 | SIDER US FAERS | |
| 116 | Blood creatinine increased | FAERS: 22 | SIDER US FAERS | |
| 117 | Drug toxicity | FAERS: 22 | OFFSIDES US FAERS | |
| 118 | Electrolyte imbalance | FAERS: 22 | US FAERS | |
| 119 | Malnutrition | FAERS: 22 | SIDER US FAERS | |
| 120 | Musculoskeletal stiffness | FAERS: 22 | SIDER US FAERS | |
| 121 | Anorexia | FAERS: 21 | OFFSIDES SIDER US FAERS | |
| 122 | Blindness | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 123 | Disorientation | FAERS: 21 | US FAERS | |
| 124 | Dysphonia | FAERS: 21 | SIDER US FAERS | |
| 125 | Acute Coronary Syndrome | FAERS: 20 | CTD SIDER US FAERS | |
| 126 | Ageusia | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 127 | Onychoclasis | FAERS: 20 | OFFSIDES US FAERS | |
| 128 | Overdose | FAERS: 20 | SIDER US FAERS | |
| 129 | Urticaria | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 130 | Aspartate Aminotransferase Increased | FAERS: 19 | SIDER US FAERS | |
| 131 | Cellulitis | FAERS: 19 | OFFSIDES SIDER US FAERS | |
| 132 | Diabetes Mellitus | FAERS: 19 | SIDER US FAERS | |
| 133 | Dysarthria | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 134 | Lethargy | FAERS: 19 | SIDER US FAERS | |
| 135 | Pulmonary thrombosis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 136 | Thermal burn | FAERS: 19 | US FAERS | |
| 137 | Aphasia | FAERS: 18 | SIDER US FAERS | |
| 138 | Cheilitis | FAERS: 18 | OFFSIDES US FAERS | |
| 139 | Drug administration error | FAERS: 18 | US FAERS | |
| 140 | Nasopharyngitis | FAERS: 18 | SIDER US FAERS | |
| 141 | Therapy change | FAERS: 18 | US FAERS | |
| 142 | Adverse event | FAERS: 17 | OFFSIDES US FAERS | |
| 143 | Aphagia | FAERS: 17 | OFFSIDES US FAERS | |
| 144 | Disseminated Intravascular Coagulation | FAERS: 17 | US FAERS | |
| 145 | Pericardial effusion | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 146 | Abscess | FAERS: 16 | OFFSIDES US FAERS | |
| 147 | Chromaturia | FAERS: 16 | OFFSIDES SIDER US FAERS | |
| 148 | Eye pain | FAERS: 16 | OFFSIDES SIDER US FAERS | |
| 149 | Feeling Cold | FAERS: 16 | US FAERS | |
| 150 | Fracture | FAERS: 16 | US FAERS | |
| 151 | Incorrect dose administered | FAERS: 16 | US FAERS | |
| 152 | Actinic keratosis | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 153 | Dermatitis | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 154 | Device occlusion | FAERS: 15 | US FAERS | |
| 155 | Disease recurrence | FAERS: 15 | US FAERS | |
| 156 | Gastritis | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 157 | Intestinal Perforation | FAERS: 15 | OFFSIDES US FAERS | |
| 158 | Peritonitis | FAERS: 15 | US FAERS | |
| 159 | Toxic Epidermal Necrolysis | FAERS: 15 | SIDER US FAERS | |
| 160 | Anastomotic Leak | FAERS: 14 | US FAERS | |
| 161 | Cholangitis | FAERS: 14 | US FAERS | |
| 162 | Limb discomfort | FAERS: 14 | US FAERS | |
| 163 | Lip swelling | FAERS: 14 | US FAERS | |
| 164 | Neck Pain | FAERS: 14 | SIDER US FAERS | |
| 165 | Neutrophil count decreased | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 166 | Obstruction | FAERS: 14 | OFFSIDES US FAERS | |
| 167 | Proctitis | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 168 | Respiratory distress | FAERS: 14 | SIDER US FAERS | |
| 169 | Throat irritation | FAERS: 14 | US FAERS | |
| 170 | nervous system disorder | FAERS: 14 | SIDER US FAERS | |
| 171 | Agranulocytosis | FAERS: 13 | SIDER US FAERS | |
| 172 | Blood count abnormal | FAERS: 13 | US FAERS | |
| 173 | Blood sodium decreased | FAERS: 13 | US FAERS | |
| 174 | Cholecystitis | FAERS: 13 | OFFSIDES US FAERS | |
| 175 | Cholelithiasis | FAERS: 13 | US FAERS | |
| 176 | Conjunctivitis | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 177 | Cystitis | FAERS: 13 | US FAERS | |
| 178 | Deafness | FAERS: 13 | SIDER US FAERS | |
| 179 | Flushing | FAERS: 13 | SIDER US FAERS | |
| 180 | Gout | FAERS: 13 | US FAERS | |
| 181 | Influenza | FAERS: 13 | SIDER US FAERS | |
| 182 | Mental status changes | FAERS: 13 | US FAERS | |
| 183 | Product quality issue | FAERS: 13 | US FAERS | |
| 184 | Radiation skin injury | FAERS: 13 | OFFSIDES US FAERS | |
| 185 | Cerebral Infarction | FAERS: 12 | US FAERS | |
| 186 | Metabolic acidosis | FAERS: 12 | US FAERS | |
| 187 | Pain of skin | FAERS: 12 | US FAERS | |
| 188 | Pneumonitis | FAERS: 12 | US FAERS | |
| 189 | Pneumothorax | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 190 | Shock | FAERS: 12 | SIDER US FAERS | |
| 191 | Acne | FAERS: 11 | US FAERS | |
| 192 | Biliary sepsis | FAERS: 11 | US FAERS | |
| 193 | Blood glucose decreased | FAERS: 11 | US FAERS | |
| 194 | Blood urine present | FAERS: 11 | US FAERS | |
| 195 | Breast cancer recurrent | FAERS: 11 | OFFSIDES US FAERS | |
| 196 | Clostridium difficile colitis | FAERS: 11 | US FAERS | |
| 197 | Diplopia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 198 | Embolism | FAERS: 11 | SIDER US FAERS | |
| 199 | Gastrointestinal inflammation | FAERS: 11 | US FAERS | |
| 200 | Gastrointestinal perforation | FAERS: 11 | SIDER US FAERS | |
| 201 | Intercepted medication error | FAERS: 11 | US FAERS | |
| 202 | Large intestine perforation | FAERS: 11 | OFFSIDES US FAERS | |
| 203 | Pregnancy | FAERS: 11 | US FAERS | |
| 204 | Sudden death | FAERS: 11 | SIDER US FAERS | |
| 205 | Viral upper respiratory tract infection | FAERS: 11 | US FAERS | |
| 206 | Accidental exposure to product | FAERS: 10 | US FAERS | |
| 207 | Acute myocardial infarction | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 208 | Arterial thrombosis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 209 | Arthritis | FAERS: 10 | SIDER US FAERS | |
| 210 | Bronchitis | FAERS: 10 | SIDER US FAERS | |
| 211 | Depressed Level of Consciousness | FAERS: 10 | SIDER US FAERS | |
| 212 | Diabetes mellitus inadequate control | FAERS: 10 | US FAERS | |
| 213 | Enterocolitis | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 214 | Febrile bone marrow aplasia | FAERS: 10 | US FAERS | |
| 215 | Hemiplegia | FAERS: 10 | US FAERS | |
| 216 | Hyperkeratosis | FAERS: 10 | SIDER US FAERS | |
| 217 | Ileitis | FAERS: 10 | OFFSIDES US FAERS | |
| 218 | Incorrect product storage | FAERS: 10 | US FAERS | |
| 219 | Lymphadenopathy | FAERS: 10 | US FAERS | |
| 220 | Pelvic abscess | FAERS: 10 | US FAERS | |
| 221 | Plantar erythema | FAERS: 10 | OFFSIDES US FAERS | |
| 222 | Respiratory arrest | FAERS: 10 | US FAERS | |
| 223 | Retching | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 224 | Sinusitis | FAERS: 10 | OFFSIDES US FAERS | |
| 225 | Suicide attempt | FAERS: 10 | US FAERS | |
| 226 | Acute respiratory failure | FAERS: 9 | US FAERS | |
| 227 | Blood electrolytes decreased | FAERS: 9 | OFFSIDES US FAERS | |
| 228 | Blood triglycerides increased | FAERS: 9 | SIDER US FAERS | |
| 229 | Cachexia | FAERS: 9 | SIDER US FAERS | |
| 230 | Delirium | FAERS: 9 | US FAERS | |
| 231 | Depressed mood | FAERS: 9 | SIDER US FAERS | |
| 232 | Ejection Fraction Decreased | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 233 | Epilepsy | FAERS: 9 | OFFSIDES US FAERS | |
| 234 | Hypoxia | FAERS: 9 | US FAERS | |
| 235 | Inappropriate schedule of drug administration | FAERS: 9 | US FAERS | |
| 236 | Incontinence | FAERS: 9 | US FAERS | |
| 237 | Infarction | FAERS: 9 | SIDER US FAERS | |
| 238 | Product substitution issue | FAERS: 9 | US FAERS | |
| 239 | Productive Cough | FAERS: 9 | OFFSIDES US FAERS | |
| 240 | Rectal tenesmus | FAERS: 9 | US FAERS | |
| 241 | Skin lesion | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 242 | Therapeutic product ineffective | FAERS: 9 | US FAERS | |
| 243 | Therapy non-responder | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 244 | Tinnitus | FAERS: 9 | SIDER US FAERS | |
| 245 | Ulcer | FAERS: 9 | SIDER US FAERS | |
| 246 | Urinary Incontinence | FAERS: 9 | SIDER US FAERS | |
| 247 | Urinary Retention | FAERS: 9 | SIDER US FAERS | |
| 248 | treatment failure | FAERS: 9 | OFFSIDES US FAERS | |
| 249 | Activities of daily living impaired | FAERS: 8 | US FAERS | |
| 250 | Altered state of consciousness | FAERS: 8 | SIDER US FAERS | |
| 251 | Anuria | FAERS: 8 | US FAERS | |
| 252 | Blood albumin decreased | FAERS: 8 | US FAERS | |
| 253 | Blood urea increased | FAERS: 8 | US FAERS | |
| 254 | Diverticulitis | FAERS: 8 | US FAERS | |
| 255 | Ectropion | FAERS: 8 | US FAERS | |
| 256 | Gastric ulcer | FAERS: 8 | SIDER US FAERS | |
| 257 | Gastrointestinal infection | FAERS: 8 | OFFSIDES US FAERS | |
| 258 | Hemiparesis | FAERS: 8 | OFFSIDES US FAERS | |
| 259 | Hepatotoxicity | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 260 | Hernia | FAERS: 8 | US FAERS | |
| 261 | Nephrolithiasis | FAERS: 8 | OFFSIDES US FAERS | |
| 262 | Pelvic Pain | FAERS: 8 | US FAERS | |
| 263 | Peptic Ulcer | FAERS: 8 | US FAERS | |
| 264 | Procedural complication | FAERS: 8 | US FAERS | |
| 265 | Rhabdomyolysis | FAERS: 8 | US FAERS | |
| 266 | Sarcoidosis | FAERS: 8 | OFFSIDES US FAERS | |
| 267 | Transaminases increased | FAERS: 8 | US FAERS | |
| 268 | Troponin increased | FAERS: 8 | US FAERS | |
| 269 | Vasospasm | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 270 | Vertigo | FAERS: 8 | SIDER US FAERS | |
| 271 | Accidental overdose | FAERS: 7 | US FAERS | |
| 272 | Angioedema | FAERS: 7 | US FAERS | |
| 273 | Aphthous Stomatitis | FAERS: 7 | OFFSIDES US FAERS | |
| 274 | Carbohydrate antigen 19-9 increased | FAERS: 7 | US FAERS | |
| 275 | Crying | FAERS: 7 | US FAERS | |
| 276 | Dementia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 277 | Diabetic Ketoacidosis | FAERS: 7 | US FAERS | |
| 278 | Gastrointestinal stoma complication | FAERS: 7 | US FAERS | |
| 279 | Hospice Care | FAERS: 7 | OFFSIDES US FAERS | |
| 280 | Hydronephrosis | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 281 | Hypersomnia | FAERS: 7 | US FAERS | |
| 282 | Joint Range of Motion Decreased | FAERS: 7 | US FAERS | |
| 283 | Joint stiffness | FAERS: 7 | SIDER US FAERS | |
| 284 | Limb injury | FAERS: 7 | US FAERS | |
| 285 | MYELODYSPLASTIC SYNDROME | FAERS: 7 | US FAERS | |
| 286 | Monoplegia | FAERS: 7 | US FAERS | |
| 287 | Musculoskeletal chest pain | FAERS: 7 | US FAERS | |
| 288 | Neuralgia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 289 | Onycholysis | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 290 | Polyneuropathy | FAERS: 7 | SIDER US FAERS | |
| 291 | Product use issue | FAERS: 7 | US FAERS | |
| 292 | Scab | FAERS: 7 | SIDER US FAERS | |
| 293 | Sinus Tachycardia | FAERS: 7 | SIDER US FAERS | |
| 294 | Skin hypertrophy | FAERS: 7 | US FAERS | |
| 295 | Thrombophlebitis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 296 | Troponin I increased | FAERS: 7 | US FAERS | |
| 297 | Tumour haemorrhage | FAERS: 7 | US FAERS | |
| 298 | Unresponsive to stimuli | FAERS: 7 | US FAERS | |
| 299 | Acidosis | FAERS: 6 | US FAERS | |
| 300 | Ammonia increased | FAERS: 6 | OFFSIDES US FAERS | |
| 301 | Anastomotic complication | FAERS: 6 | US FAERS | |
| 302 | Apparent death | FAERS: 6 | US FAERS | |
| 303 | Arthropathy | FAERS: 6 | OFFSIDES US FAERS | |
| 304 | Asphyxia | FAERS: 6 | OFFSIDES US FAERS | |
| 305 | Ataxia | FAERS: 6 | SIDER US FAERS | |
| 306 | Blood alkaline phosphatase increased | FAERS: 6 | SIDER US FAERS | |
| 307 | Blood cholesterol increased | FAERS: 6 | US FAERS | |
| 308 | Bradycardia | FAERS: 6 | SIDER US FAERS | |
| 309 | Cataract | FAERS: 6 | SIDER US FAERS | |
| 310 | Choking | FAERS: 6 | US FAERS | |
| 311 | Cold sweat | FAERS: 6 | US FAERS | |
| 312 | Dermatitis acneiform | FAERS: 6 | US FAERS | |
| 313 | Device related infection | FAERS: 6 | OFFSIDES US FAERS | |
| 314 | Encephalitis | FAERS: 6 | US FAERS | |
| 315 | Full blood count abnormal | FAERS: 6 | US FAERS | |
| 316 | Gamma-Glutamyltransferase Increased | FAERS: 6 | US FAERS | |
| 317 | Gastrointestinal obstruction | FAERS: 6 | OFFSIDES US FAERS | |
| 318 | Intestinal resection | FAERS: 6 | US FAERS | |
| 319 | Lymphopenia | FAERS: 6 | SIDER US FAERS | |
| 320 | Medication residue present | FAERS: 6 | US FAERS | |
| 321 | Mouth swelling | FAERS: 6 | US FAERS | |
| 322 | Musculoskeletal discomfort | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 323 | Nervousness | FAERS: 6 | US FAERS | |
| 324 | Night sweats | FAERS: 6 | SIDER US FAERS | |
| 325 | Optic Neuritis | FAERS: 6 | OFFSIDES US FAERS | |
| 326 | Oral candidiasis | FAERS: 6 | SIDER US FAERS | |
| 327 | Oropharyngeal blistering | FAERS: 6 | OFFSIDES US FAERS | |
| 328 | Pericarditis | FAERS: 6 | OFFSIDES US FAERS | |
| 329 | Pleurisy | FAERS: 6 | US FAERS | |
| 330 | Post procedural complication | FAERS: 6 | SIDER US FAERS | |
| 331 | Post procedural infection | FAERS: 6 | US FAERS | |
| 332 | Protein total decreased | FAERS: 6 | US FAERS | |
| 333 | Psoriasis | FAERS: 6 | US FAERS | |
| 334 | Radiation injury | FAERS: 6 | US FAERS | |
| 335 | Retinal Detachment | FAERS: 6 | US FAERS | |
| 336 | Skin irritation | FAERS: 6 | US FAERS | |
| 337 | Stress | FAERS: 6 | US FAERS | |
| 338 | Wheezing | FAERS: 6 | US FAERS | |
| 339 | effusion | FAERS: 6 | OFFSIDES US FAERS | |
| 340 | Agitation | FAERS: 5 | US FAERS | |
| 341 | Agonal rhythm | FAERS: 5 | OFFSIDES US FAERS | |
| 342 | Alanine aminotransferase abnormal | FAERS: 5 | US FAERS | |
| 343 | Anaphylactic shock | FAERS: 5 | US FAERS | |
| 344 | Aspartate aminotransferase abnormal | FAERS: 5 | US FAERS | |
| 345 | Asthma | FAERS: 5 | SIDER US FAERS | |
| 346 | Bowel movement irregularity | FAERS: 5 | US FAERS | |
| 347 | Cardiomegaly | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 348 | Coronary Artery Disease | FAERS: 5 | US FAERS | |
| 349 | Dark circles under eyes | FAERS: 5 | OFFSIDES US FAERS | |
| 350 | Discomfort | FAERS: 5 | SIDER US FAERS | |
| 351 | Eczema | FAERS: 5 | OFFSIDES US FAERS | |
| 352 | Electrocardiogram abnormal | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 353 | Eye Infection | FAERS: 5 | US FAERS | |
| 354 | Gastric Dilatation | FAERS: 5 | US FAERS | |
| 355 | Gastric infection | FAERS: 5 | US FAERS | |
| 356 | Gastrointestinal Pain | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 357 | Gastrointestinal hypomotility | FAERS: 5 | US FAERS | |
| 358 | Genital erythema | FAERS: 5 | US FAERS | |
| 359 | Hypokinesia | FAERS: 5 | US FAERS | |
| 360 | Immobile | FAERS: 5 | US FAERS | |
| 361 | Joint injury | FAERS: 5 | US FAERS | |
| 362 | Leukocytosis | FAERS: 5 | US FAERS | |
| 363 | Macule | FAERS: 5 | US FAERS | |
| 364 | Mental impairment | FAERS: 5 | US FAERS | |
| 365 | Middle insomnia | FAERS: 5 | US FAERS | |
| 366 | Nerve injury | FAERS: 5 | US FAERS | |
| 367 | Palmar erythema | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 368 | Personality Change | FAERS: 5 | SIDER US FAERS | |
| 369 | Petechiae | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 370 | Phlebitis | FAERS: 5 | 12564432 | CTD SIDER US FAERS |
| 371 | Pulmonary congestion | FAERS: 5 | US FAERS | |
| 372 | Secretion discharge | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 373 | Skin Wrinkling | FAERS: 5 | US FAERS | |
| 374 | Skin tightness | FAERS: 5 | US FAERS | |
| 375 | Terminal state | FAERS: 5 | US FAERS | |
| 376 | Thirst | FAERS: 5 | SIDER US FAERS | |
| 377 | Tooth Loss | FAERS: 5 | OFFSIDES US FAERS | |
| 378 | Trismus | FAERS: 5 | SIDER US FAERS | |
| 379 | Wound dehiscence | FAERS: 5 | OFFSIDES US FAERS | |
| 380 | Abdominal Abscess | FAERS: 4 | US FAERS | |
| 381 | Acute prerenal failure | FAERS: 4 | OFFSIDES US FAERS | |
| 382 | Adenocarcinoma | FAERS: 4 | 17594717 | CTD OFFSIDES US FAERS |
| 383 | Anorectal discomfort | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 384 | Aphonia | FAERS: 4 | US FAERS | |
| 385 | Biliary cancer metastatic | FAERS: 4 | OFFSIDES US FAERS | |
| 386 | Cardiac Tamponade | FAERS: 4 | OFFSIDES US FAERS | |
| 387 | Cerebellar Ataxia | FAERS: 4 | 18407475 18945862 | CTD US FAERS |
| 388 | Cerebral disorder | FAERS: 4 | US FAERS | |
| 389 | Circumstance or information capable of leading to medication error | FAERS: 4 | US FAERS | |
| 390 | Corneal erosion | FAERS: 4 | OFFSIDES US FAERS | |
| 391 | Cyanosis | FAERS: 4 | US FAERS | |
| 392 | Dermatomyositis | FAERS: 4 | US FAERS | |
| 393 | Duodenal Obstruction | FAERS: 4 | OFFSIDES US FAERS | |
| 394 | Duodenal Ulcer | FAERS: 4 | OFFSIDES US FAERS | |
| 395 | Dyschezia | FAERS: 4 | US FAERS | |
| 396 | Emotional disorder | FAERS: 4 | OFFSIDES US FAERS | |
| 397 | Eructation | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 398 | Erythema Nodosum | FAERS: 4 | OFFSIDES US FAERS | |
| 399 | Failure to anastomose | FAERS: 4 | OFFSIDES US FAERS | |
| 400 | Gastrointestinal motility disorder | FAERS: 4 | SIDER US FAERS | |
| 401 | Hepatitis | FAERS: 4 | SIDER US FAERS | |
| 402 | Hepatomegaly | FAERS: 4 | SIDER US FAERS | |
| 403 | Hysterectomy | FAERS: 4 | US FAERS | |
| 404 | Immunosuppression | FAERS: 4 | US FAERS | |
| 405 | Incoherent | FAERS: 4 | US FAERS | |
| 406 | Investigation abnormal | FAERS: 4 | OFFSIDES US FAERS | |
| 407 | Lymphangiosis carcinomatosa | FAERS: 4 | US FAERS | |
| 408 | Macular degeneration | FAERS: 4 | US FAERS | |
| 409 | Malignant ascites | FAERS: 4 | OFFSIDES US FAERS | |
| 410 | Mastectomy | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 411 | Mucosal necrosis | FAERS: 4 | OFFSIDES US FAERS | |
| 412 | Oncologic complication | FAERS: 4 | US FAERS | |
| 413 | Optic Atrophy | FAERS: 4 | OFFSIDES US FAERS | |
| 414 | Peripheral artery thrombosis | FAERS: 4 | US FAERS | |
| 415 | Platelet count abnormal | FAERS: 4 | US FAERS | |
| 416 | Poor peripheral circulation | FAERS: 4 | US FAERS | |
| 417 | Poor quality drug administered | FAERS: 4 | US FAERS | |
| 418 | Psychiatric symptom | FAERS: 4 | SIDER US FAERS | |
| 419 | Pyogenic granuloma | FAERS: 4 | OFFSIDES US FAERS | |
| 420 | Rectal abscess | FAERS: 4 | US FAERS | |
| 421 | Rectal discharge | FAERS: 4 | US FAERS | |
| 422 | Renal tubular acidosis | FAERS: 4 | US FAERS | |
| 423 | Squamous cell carcinoma | FAERS: 4 | US FAERS | |
| 424 | Streptococcus test positive | FAERS: 4 | US FAERS | |
| 425 | Subileus | FAERS: 4 | OFFSIDES US FAERS | |
| 426 | Sudden Cardiac Death | FAERS: 4 | US FAERS | |
| 427 | Sunburn | FAERS: 4 | US FAERS | |
| 428 | Venous occlusion | FAERS: 4 | US FAERS | |
| 429 | Visual disturbance | FAERS: 4 | US FAERS | |
| 430 | Abdominal adhesions | FAERS: 3 | OFFSIDES US FAERS | |
| 431 | Anal abscess | FAERS: 3 | OFFSIDES US FAERS | |
| 432 | Anastomotic stenosis | FAERS: 3 | OFFSIDES US FAERS | |
| 433 | Ankle Fracture | FAERS: 3 | OFFSIDES US FAERS | |
| 434 | Anterior Spinal Artery Syndrome | FAERS: 3 | US FAERS | |
| 435 | Back disorder | FAERS: 3 | US FAERS | |
| 436 | Benign Prostatic Hyperplasia | FAERS: 3 | OFFSIDES US FAERS | |
| 437 | Bicytopenia | FAERS: 3 | US FAERS | |
| 438 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 439 | Blood testosterone decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 440 | Bronchopneumonia | FAERS: 3 | SIDER US FAERS | |
| 441 | Carbohydrate antigen 15-3 increased | FAERS: 3 | US FAERS | |
| 442 | Cardiac enzymes increased | FAERS: 3 | US FAERS | |
| 443 | Catheter site infection | FAERS: 3 | US FAERS | |
| 444 | Central nervous system lesion | FAERS: 3 | OFFSIDES US FAERS | |
| 445 | Cholestasis | FAERS: 3 | US FAERS | |
| 446 | Completed Suicide | FAERS: 3 | OFFSIDES US FAERS | |
| 447 | Creatinine renal clearance decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 448 | Culture positive | FAERS: 3 | US FAERS | |
| 449 | Culture urine positive | FAERS: 3 | US FAERS | |
| 450 | Cyst | FAERS: 3 | OFFSIDES US FAERS | |
| 451 | Cytomegalovirus enterocolitis | FAERS: 3 | US FAERS | |
| 452 | Duodenal ulcer perforation | FAERS: 3 | US FAERS | |
| 453 | Ecchymosis | FAERS: 3 | SIDER US FAERS | |
| 454 | Electrocardiogram change | FAERS: 3 | OFFSIDES US FAERS | |
| 455 | Eosinophilia | FAERS: 3 | US FAERS | |
| 456 | Epigastric discomfort | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 457 | Erythromelalgia | FAERS: 3 | US FAERS | |
| 458 | Excoriation | FAERS: 3 | US FAERS | |
| 459 | Eyelid margin crusting | FAERS: 3 | OFFSIDES US FAERS | |
| 460 | Failure to Thrive | FAERS: 3 | US FAERS | |
| 461 | Gastroenteritis | FAERS: 3 | SIDER US FAERS | |
| 462 | Gastrointestinal mucosal disorder | FAERS: 3 | US FAERS | |
| 463 | Gastrointestinal ulcer | FAERS: 3 | OFFSIDES US FAERS | |
| 464 | Gastrostomy | FAERS: 3 | US FAERS | |
| 465 | Glaucoma | FAERS: 3 | US FAERS | |
| 466 | Glossitis | FAERS: 3 | US FAERS | |
| 467 | Granuloma | FAERS: 3 | OFFSIDES US FAERS | |
| 468 | Guillain-Barre Syndrome | FAERS: 3 | US FAERS | |
| 469 | Hepatic necrosis | FAERS: 3 | US FAERS | |
| 470 | Hypothyroidism | FAERS: 3 | SIDER US FAERS | |
| 471 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 472 | Intercepted product storage error | FAERS: 3 | US FAERS | |
| 473 | Interstitial granulomatous dermatitis | FAERS: 3 | US FAERS | |
| 474 | Intestinal Fistula | FAERS: 3 | OFFSIDES US FAERS | |
| 475 | Intestinal anastomosis complication | FAERS: 3 | OFFSIDES US FAERS | |
| 476 | Intra-abdominal fluid collection | FAERS: 3 | US FAERS | |
| 477 | Keratitis | FAERS: 3 | SIDER US FAERS | |
| 478 | Kounis Syndrome | FAERS: 3 | US FAERS | |
| 479 | Laceration | FAERS: 3 | US FAERS | |
| 480 | Lip exfoliation | FAERS: 3 | US FAERS | |
| 481 | Long QT Syndrome | FAERS: 3 | US FAERS | |
| 482 | Loose tooth | FAERS: 3 | OFFSIDES US FAERS | |
| 483 | Lower respiratory tract infection | FAERS: 3 | SIDER US FAERS | |
| 484 | Metastases to stomach | FAERS: 3 | OFFSIDES US FAERS | |
| 485 | Nail pigmentation | FAERS: 3 | US FAERS | |
| 486 | Necrosis | FAERS: 3 | US FAERS | |
| 487 | Neutropenic colitis | FAERS: 3 | US FAERS | |
| 488 | Oliguria | FAERS: 3 | US FAERS | |
| 489 | Onychalgia | FAERS: 3 | US FAERS | |
| 490 | Open wound | FAERS: 3 | OFFSIDES US FAERS | |
| 491 | Oral fungal infection | FAERS: 3 | OFFSIDES US FAERS | |
| 492 | Oral mucosal exfoliation | FAERS: 3 | OFFSIDES US FAERS | |
| 493 | Oromandibular dystonia | FAERS: 3 | US FAERS | |
| 494 | Osteoporosis | FAERS: 3 | US FAERS | |
| 495 | Pallor | FAERS: 3 | US FAERS | |
| 496 | Pancreatic Pseudocyst | FAERS: 3 | US FAERS | |
| 497 | Paresis | FAERS: 3 | US FAERS | |
| 498 | Pelvic venous thrombosis | FAERS: 3 | US FAERS | |
| 499 | Penile erythema | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 500 | Performance status decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 501 | Periportal sinus dilatation | FAERS: 3 | US FAERS | |
| 502 | Pharyngitis | FAERS: 3 | SIDER US FAERS | |
| 503 | Pharyngolaryngeal Pain | FAERS: 3 | SIDER US FAERS | |
| 504 | Photophobia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 505 | Poisoning | FAERS: 3 | US FAERS | |
| 506 | Portal Vein Thrombosis | FAERS: 3 | US FAERS | |
| 507 | Postoperative abscess | FAERS: 3 | US FAERS | |
| 508 | Product dose omission | FAERS: 3 | US FAERS | |
| 509 | Product physical issue | FAERS: 3 | US FAERS | |
| 510 | Product storage error | FAERS: 3 | US FAERS | |
| 511 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 512 | Pulmonary Fibrosis | FAERS: 3 | US FAERS | |
| 513 | Pulmonary Hypertension | FAERS: 3 | US FAERS | |
| 514 | Pulmonary granuloma | FAERS: 3 | US FAERS | |
| 515 | Purulence | FAERS: 3 | OFFSIDES US FAERS | |
| 516 | Quality of life decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 517 | Radiation mucositis | FAERS: 3 | US FAERS | |
| 518 | Recall phenomenon | FAERS: 3 | SIDER US FAERS | |
| 519 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 520 | Restlessness | FAERS: 3 | US FAERS | |
| 521 | Rheumatoid Arthritis | FAERS: 3 | US FAERS | |
| 522 | Sciatica | FAERS: 3 | US FAERS | |
| 523 | Scleroderma | FAERS: 3 | US FAERS | |
| 524 | Screaming | FAERS: 3 | US FAERS | |
| 525 | Sick Sinus Syndrome | FAERS: 3 | US FAERS | |
| 526 | Skin Induration | FAERS: 3 | US FAERS | |
| 527 | Skin laceration | FAERS: 3 | OFFSIDES US FAERS | |
| 528 | Small intestine carcinoma | FAERS: 3 | US FAERS | |
| 529 | Stent occlusion | FAERS: 3 | OFFSIDES US FAERS | |
| 530 | Suspected counterfeit product | FAERS: 3 | US FAERS | |
| 531 | Therapeutic response unexpected | FAERS: 3 | OFFSIDES US FAERS | |
| 532 | Urethral ulcer | FAERS: 3 | OFFSIDES US FAERS | |
| 533 | VIIth nerve paralysis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 534 | Venous Thrombosis | FAERS: 3 | SIDER US FAERS | |
| 535 | Vitiligo | FAERS: 3 | US FAERS | |
| 536 | Vulvovaginal discomfort | FAERS: 3 | OFFSIDES US FAERS | |
| 537 | White matter lesion | FAERS: 3 | US FAERS | |
| 538 | Wound Infection | FAERS: 3 | US FAERS | |
| 539 | furuncle | FAERS: 3 | US FAERS | |
| 540 | Abdominal cavity drainage | FAERS: 2 | US FAERS | |
| 541 | Abdominal tenderness | FAERS: 2 | OFFSIDES US FAERS | |
| 542 | Alveolitis | FAERS: 2 | US FAERS | |
| 543 | Anal Fissure | FAERS: 2 | US FAERS | |
| 544 | Anal Ulcer | FAERS: 2 | US FAERS | |
| 545 | Anal cancer metastatic | FAERS: 2 | US FAERS | |
| 546 | Anger | FAERS: 2 | OFFSIDES US FAERS | |
| 547 | Appendicitis | FAERS: 2 | OFFSIDES US FAERS | |
| 548 | Arteriosclerosis | FAERS: 2 | OFFSIDES US FAERS | |
| 549 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 550 | Bile Duct Stenosis | FAERS: 2 | US FAERS | |
| 551 | Biliary Colic | FAERS: 2 | US FAERS | |
| 552 | Bladder pain | FAERS: 2 | US FAERS | |
| 553 | Blood blister | FAERS: 2 | OFFSIDES US FAERS | |
| 554 | Blood creatinine abnormal | FAERS: 2 | US FAERS | |
| 555 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 556 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 557 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 558 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 559 | Blood pressure inadequately controlled | FAERS: 2 | US FAERS | |
| 560 | Brachiocephalic vein thrombosis | FAERS: 2 | US FAERS | |
| 561 | Brain Hypoxia | FAERS: 2 | US FAERS | |
| 562 | Breast tenderness | FAERS: 2 | US FAERS | |
| 563 | Bronchospasm | FAERS: 2 | SIDER US FAERS | |
| 564 | Bursitis | FAERS: 2 | OFFSIDES US FAERS | |
| 565 | Carcinoma | FAERS: 2 | 11432636 | CTD US FAERS |
| 566 | Cardiomyopathy acute | FAERS: 2 | US FAERS | |
| 567 | Catheter placement | FAERS: 2 | OFFSIDES US FAERS | |
| 568 | Cerebellar infarction | FAERS: 2 | US FAERS | |
| 569 | Cerebral Thrombosis | FAERS: 2 | OFFSIDES US FAERS | |
| 570 | Cerebral atrophy | FAERS: 2 | US FAERS | |
| 571 | Choking sensation | FAERS: 2 | US FAERS | |
| 572 | Cholangiocarcinoma | FAERS: 2 | US FAERS | |
| 573 | Cholecystitis infective | FAERS: 2 | US FAERS | |
| 574 | Choroidal Detachment | FAERS: 2 | US FAERS | |
| 575 | Clostridium difficile infection | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 576 | Colon cancer recurrent | FAERS: 2 | US FAERS | |
| 577 | Creatinine renal clearance increased | FAERS: 2 | US FAERS | |
| 578 | Cytomegalovirus gastrointestinal ulcer | FAERS: 2 | US FAERS | |
| 579 | Dental caries | FAERS: 2 | OFFSIDES US FAERS | |
| 580 | Device Failure | FAERS: 2 | US FAERS | |
| 581 | Disease complication | FAERS: 2 | US FAERS | |
| 582 | Diverticular perforation | FAERS: 2 | US FAERS | |
| 583 | Drug clearance decreased | FAERS: 2 | US FAERS | |
| 584 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 585 | Emotional distress | FAERS: 2 | OFFSIDES US FAERS | |
| 586 | Enterocutaneous Fistula | FAERS: 2 | OFFSIDES US FAERS | |
| 587 | Enzyme abnormality | FAERS: 2 | US FAERS | |
| 588 | Epiploic appendagitis | FAERS: 2 | US FAERS | |
| 589 | Erosive balanitis | FAERS: 2 | OFFSIDES US FAERS | |
| 590 | Eschar | FAERS: 2 | US FAERS | |
| 591 | Escherichia infection | FAERS: 2 | US FAERS | |
| 592 | Exposure via father | FAERS: 2 | US FAERS | |
| 593 | Exposure via ingestion | FAERS: 2 | US FAERS | |
| 594 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 595 | Foaming at mouth | FAERS: 2 | US FAERS | |
| 596 | Foreign body sensation in eyes | FAERS: 2 | US FAERS | |
| 597 | Gait inability | FAERS: 2 | US FAERS | |
| 598 | Gas Poisoning | FAERS: 2 | US FAERS | |
| 599 | Gastric Stenosis | FAERS: 2 | OFFSIDES US FAERS | |
| 600 | Gastrointestinal stoma output increased | FAERS: 2 | US FAERS | |
| 601 | Gastrooesophageal cancer | FAERS: 2 | OFFSIDES US FAERS | |
| 602 | Genital burning sensation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 603 | Genital injury | FAERS: 2 | US FAERS | |
| 604 | Genital rash | FAERS: 2 | US FAERS | |
| 605 | Giardiasis | FAERS: 2 | US FAERS | |
| 606 | Gingivitis | FAERS: 2 | US FAERS | |
| 607 | Granulocyte count decreased | FAERS: 2 | US FAERS | |
| 608 | Hepatic Encephalopathy | FAERS: 2 | US FAERS | |
| 609 | Hepatic cancer metastatic | FAERS: 2 | SIDER US FAERS | |
| 610 | Hepatorenal Syndrome | FAERS: 2 | US FAERS | |
| 611 | Hip surgery | FAERS: 2 | OFFSIDES US FAERS | |
| 612 | Hunger | FAERS: 2 | US FAERS | |
| 613 | Hyperpyrexia | FAERS: 2 | US FAERS | |
| 614 | Hyporeflexia | FAERS: 2 | US FAERS | |
| 615 | Ileal ulcer | FAERS: 2 | US FAERS | |
| 616 | Immunology test abnormal | FAERS: 2 | US FAERS | |
| 617 | Impaired work ability | FAERS: 2 | OFFSIDES US FAERS | |
| 618 | Impatience | FAERS: 2 | US FAERS | |
| 619 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 620 | Incorrect drug dosage form administered | FAERS: 2 | US FAERS | |
| 621 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 622 | Infrequent bowel movements | FAERS: 2 | US FAERS | |
| 623 | Intestinal gangrene | FAERS: 2 | US FAERS | |
| 624 | Iridocyclitis | FAERS: 2 | US FAERS | |
| 625 | Keratoconjunctivitis Sicca | FAERS: 2 | US FAERS | |
| 626 | Limb mass | FAERS: 2 | US FAERS | |
| 627 | Lipase increased | FAERS: 2 | US FAERS | |
| 628 | Lipids abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 629 | Lipoma | FAERS: 2 | SIDER US FAERS | |
| 630 | Lupus-like syndrome | FAERS: 2 | US FAERS | |
| 631 | Lymphoma | FAERS: 2 | US FAERS | |
| 632 | Megacolon | FAERS: 2 | US FAERS | |
| 633 | Menorrhagia | FAERS: 2 | US FAERS | |
| 634 | Mood swings | FAERS: 2 | SIDER US FAERS | |
| 635 | Mucosal exfoliation | FAERS: 2 | US FAERS | |
| 636 | Multi-organ disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 637 | Muscle Fatigue | FAERS: 2 | US FAERS | |
| 638 | Mutism | FAERS: 2 | US FAERS | |
| 639 | Nail Infection | FAERS: 2 | OFFSIDES US FAERS | |
| 640 | Nail bed disorder | FAERS: 2 | US FAERS | |
| 641 | Nail bed tenderness | FAERS: 2 | US FAERS | |
| 642 | Nephritis | FAERS: 2 | US FAERS | |
| 643 | Neuropathy | FAERS: 2 | SIDER US FAERS | |
| 644 | Neutropenic infection | FAERS: 2 | US FAERS | |
| 645 | Nodule | FAERS: 2 | OFFSIDES US FAERS | |
| 646 | Non-cardiac chest pain | FAERS: 2 | US FAERS | |
| 647 | Noninfective gingivitis | FAERS: 2 | US FAERS | |
| 648 | Occult blood positive | FAERS: 2 | OFFSIDES US FAERS | |
| 649 | Occupational exposure to product | FAERS: 2 | US FAERS | |
| 650 | Ocular discomfort | FAERS: 2 | US FAERS | |
| 651 | Oral Cavity Fistula | FAERS: 2 | OFFSIDES US FAERS | |
| 652 | Oral mucosal eruption | FAERS: 2 | US FAERS | |
| 653 | Oral toxicity | FAERS: 2 | US FAERS | |
| 654 | Oropharyngeal spasm | FAERS: 2 | US FAERS | |
| 655 | Osteonecrosis of Jaw | FAERS: 2 | US FAERS | |
| 656 | Pain management | FAERS: 2 | US FAERS | |
| 657 | Paraplegia | FAERS: 2 | US FAERS | |
| 658 | Pathological fracture | FAERS: 2 | US FAERS | |
| 659 | Penile exfoliation | FAERS: 2 | OFFSIDES US FAERS | |
| 660 | Pericarditis malignant | FAERS: 2 | US FAERS | |
| 661 | Peripheral occlusive disease | FAERS: 2 | US FAERS | |
| 662 | Peripheral paralysis | FAERS: 2 | US FAERS | |
| 663 | Pleuritic pain | FAERS: 2 | US FAERS | |
| 664 | Pneumocentesis | FAERS: 2 | US FAERS | |
| 665 | Polydipsia | FAERS: 2 | US FAERS | |
| 666 | Polyuria | FAERS: 2 | SIDER US FAERS | |
| 667 | Positron emission tomogram abnormal | FAERS: 2 | US FAERS | |
| 668 | Postoperative ileus | FAERS: 2 | US FAERS | |
| 669 | Pre-Eclampsia | FAERS: 2 | US FAERS | |
| 670 | Prerenal failure | FAERS: 2 | US FAERS | |
| 671 | Procedural site reaction | FAERS: 2 | US FAERS | |
| 672 | Proctocolitis | FAERS: 2 | US FAERS | |
| 673 | Product difficult to swallow | FAERS: 2 | US FAERS | |
| 674 | Product size issue | FAERS: 2 | US FAERS | |
| 675 | Product solubility abnormal | FAERS: 2 | US FAERS | |
| 676 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 677 | Prothrombin level decreased | FAERS: 2 | SIDER US FAERS | |
| 678 | Pulmonary artery thrombosis | FAERS: 2 | US FAERS | |
| 679 | Pulmonary pain | FAERS: 2 | US FAERS | |
| 680 | Purpura | FAERS: 2 | SIDER US FAERS | |
| 681 | Purulent discharge | FAERS: 2 | OFFSIDES US FAERS | |
| 682 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 683 | Renal pain | FAERS: 2 | US FAERS | |
| 684 | Respiratory tract congestion | FAERS: 2 | OFFSIDES US FAERS | |
| 685 | Retinal Artery Occlusion | FAERS: 2 | US FAERS | |
| 686 | Scrotal Infection | FAERS: 2 | OFFSIDES US FAERS | |
| 687 | Simple Partial Seizures | FAERS: 2 | US FAERS | |
| 688 | Skin necrosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 689 | Sodium retention | FAERS: 2 | US FAERS | |
| 690 | Solar lentigo | FAERS: 2 | US FAERS | |
| 691 | Somnambulism | FAERS: 2 | US FAERS | |
| 692 | Splenic Infarction | FAERS: 2 | OFFSIDES US FAERS | |
| 693 | Staphylococcal abscess | FAERS: 2 | US FAERS | |
| 694 | Staphylococcus test positive | FAERS: 2 | US FAERS | |
| 695 | Steatohepatitis | FAERS: 2 | US FAERS | |
| 696 | Streptococcal endocarditis | FAERS: 2 | US FAERS | |
| 697 | Systemic Scleroderma | FAERS: 2 | US FAERS | |
| 698 | Tension | FAERS: 2 | US FAERS | |
| 699 | Tongue blistering | FAERS: 2 | US FAERS | |
| 700 | Tongue discomfort | FAERS: 2 | US FAERS | |
| 701 | Tooth Extraction | FAERS: 2 | OFFSIDES US FAERS | |
| 702 | Tooth Infection | FAERS: 2 | OFFSIDES US FAERS | |
| 703 | Troponin T increased | FAERS: 2 | US FAERS | |
| 704 | Uterine Polyp | FAERS: 2 | US FAERS | |
| 705 | Ventricular hypokinesia | FAERS: 2 | US FAERS | |
| 706 | Vocal Cord Paralysis | FAERS: 2 | US FAERS | |
| 707 | Vulvovaginal dryness | FAERS: 2 | US FAERS | |
| 708 | Wheelchair user | FAERS: 2 | OFFSIDES US FAERS | |
| 709 | skin abrasion | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 710 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 711 | Abdominal mass | FAERS: 1 | OFFSIDES US FAERS | |
| 712 | Abdominal strangulated hernia | FAERS: 1 | US FAERS | |
| 713 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 714 | Abdominal wound dehiscence | FAERS: 1 | US FAERS | |
| 715 | Accidental exposure | FAERS: 1 | US FAERS | |
| 716 | Acute polyneuropathy | FAERS: 1 | US FAERS | |
| 717 | Adnexa uteri pain | FAERS: 1 | US FAERS | |
| 718 | Allergic bronchitis | FAERS: 1 | US FAERS | |
| 719 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 720 | Amaurosis Fugax | FAERS: 1 | US FAERS | |
| 721 | Anal Fistula | FAERS: 1 | OFFSIDES US FAERS | |
| 722 | Anal inflammation | FAERS: 1 | OFFSIDES US FAERS | |
| 723 | Anastomotic fistula | FAERS: 1 | US FAERS | |
| 724 | Aneurysm | FAERS: 1 | US FAERS | |
| 725 | Angioplasty | FAERS: 1 | US FAERS | |
| 726 | Angular cheilitis | FAERS: 1 | US FAERS | |
| 727 | Animal bite | FAERS: 1 | OFFSIDES US FAERS | |
| 728 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 729 | Apathy | FAERS: 1 | US FAERS | |
| 730 | Apoptosis | FAERS: 1 | US FAERS | |
| 731 | Application site reaction | FAERS: 1 | US FAERS | |
| 732 | Arterial insufficiency | FAERS: 1 | US FAERS | |
| 733 | Aspergillosis | FAERS: 1 | US FAERS | |
| 734 | Astigmatism | FAERS: 1 | US FAERS | |
| 735 | Auriculotemporal Syndrome | FAERS: 1 | US FAERS | |
| 736 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 737 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 738 | Bacteria blood identified | FAERS: 1 | US FAERS | |
| 739 | Bacteria stool identified | FAERS: 1 | US FAERS | |
| 740 | Basal cell carcinoma | FAERS: 1 | OFFSIDES US FAERS | |
| 741 | Bile duct cancer recurrent | FAERS: 1 | US FAERS | |
| 742 | Biliary tract infection | FAERS: 1 | US FAERS | |
| 743 | Blastomycosis | FAERS: 1 | US FAERS | |
| 744 | Blepharitis | FAERS: 1 | US FAERS | |
| 745 | Blood Pressure | FAERS: 1 | US FAERS | |
| 746 | Blood albumin increased | FAERS: 1 | US FAERS | |
| 747 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 748 | Blood count normal | FAERS: 1 | US FAERS | |
| 749 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 750 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 751 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 752 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 753 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 754 | Bone Sarcoma | FAERS: 1 | US FAERS | |
| 755 | Bone erosion | FAERS: 1 | OFFSIDES US FAERS | |
| 756 | Bone fissure | FAERS: 1 | US FAERS | |
| 757 | Bone marrow depression | FAERS: 1 | SIDER US FAERS | |
| 758 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 759 | Burning Mouth Syndrome | FAERS: 1 | SIDER US FAERS | |
| 760 | Burning feet syndrome | FAERS: 1 | US FAERS | |
| 761 | Candida test positive | FAERS: 1 | US FAERS | |
| 762 | Candiduria | FAERS: 1 | US FAERS | |
| 763 | Carbohydrate antigen 27.29 increased | FAERS: 1 | US FAERS | |
| 764 | Carcinoembryonic antigen decreased | FAERS: 1 | US FAERS | |
| 765 | Carcinoma in situ of eye | FAERS: 1 | US FAERS | |
| 766 | Cardiac Death | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 767 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 768 | Cardiac stress test abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 769 | Cardiac ventricular disorder | FAERS: 1 | US FAERS | |
| 770 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 771 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 772 | Cartilage atrophy | FAERS: 1 | US FAERS | |
| 773 | Catarrh | FAERS: 1 | US FAERS | |
| 774 | Catatonia | FAERS: 1 | US FAERS | |
| 775 | Catheter related infection | FAERS: 1 | US FAERS | |
| 776 | Catheter site erythema | FAERS: 1 | US FAERS | |
| 777 | Cerebral Arteriosclerosis | FAERS: 1 | US FAERS | |
| 778 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 779 | Cerebral ataxia | FAERS: 1 | US FAERS | |
| 780 | Chemical burn of skin | FAERS: 1 | US FAERS | |
| 781 | Chemotherapy | FAERS: 1 | US FAERS | |
| 782 | Chronic sinusitis | FAERS: 1 | OFFSIDES US FAERS | |
| 783 | Cleft Palate | FAERS: 1 | US FAERS | |
| 784 | Clostridium colitis | FAERS: 1 | US FAERS | |
| 785 | Colectomy | FAERS: 1 | US FAERS | |
| 786 | Colonic Pseudo-Obstruction | FAERS: 1 | US FAERS | |
| 787 | Colostomy infection | FAERS: 1 | US FAERS | |
| 788 | Coma acidotic | FAERS: 1 | US FAERS | |
| 789 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 790 | Cor pulmonale | FAERS: 1 | US FAERS | |
| 791 | Corneal Perforation | FAERS: 1 | US FAERS | |
| 792 | Corneal degeneration | FAERS: 1 | US FAERS | |
| 793 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 794 | Corneal irritation | FAERS: 1 | US FAERS | |
| 795 | Coronary artery insufficiency | FAERS: 1 | US FAERS | |
| 796 | Critical Illness | FAERS: 1 | US FAERS | |
| 797 | Cutis Laxa | FAERS: 1 | US FAERS | |
| 798 | Cyst removal | FAERS: 1 | US FAERS | |
| 799 | Cytogenetic analysis abnormal | FAERS: 1 | US FAERS | |
| 800 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 801 | Cytomegalovirus gastroenteritis | FAERS: 1 | US FAERS | |
| 802 | Cytomegalovirus gastrointestinal infection | FAERS: 1 | US FAERS | |
| 803 | Dacryocanaliculitis | FAERS: 1 | US FAERS | |
| 804 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 805 | Deficiency of bile secretion | FAERS: 1 | US FAERS | |
| 806 | Deformity | FAERS: 1 | US FAERS | |
| 807 | Demyelination | FAERS: 1 | OFFSIDES US FAERS | |
| 808 | Deposit eye | FAERS: 1 | US FAERS | |
| 809 | Device breakage | FAERS: 1 | US FAERS | |
| 810 | Device difficult to use | FAERS: 1 | US FAERS | |
| 811 | Device dislocation | FAERS: 1 | US FAERS | |
| 812 | Device leakage | FAERS: 1 | US FAERS | |
| 813 | Device malfunction | FAERS: 1 | US FAERS | |
| 814 | Device related thrombosis | FAERS: 1 | US FAERS | |
| 815 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 816 | Diabetic Retinopathy | FAERS: 1 | US FAERS | |
| 817 | Diaphragmatic Hernia | FAERS: 1 | US FAERS | |
| 818 | Diet refusal | FAERS: 1 | US FAERS | |
| 819 | Diplegia | FAERS: 1 | US FAERS | |
| 820 | Dissociation | FAERS: 1 | US FAERS | |
| 821 | Drug level decreased | FAERS: 1 | US FAERS | |
| 822 | Drug metabolising enzyme decreased | FAERS: 1 | US FAERS | |
| 823 | Drug resistance | FAERS: 1 | US FAERS | |
| 824 | Drug screen positive | FAERS: 1 | US FAERS | |
| 825 | Dyschromatopsia | FAERS: 1 | US FAERS | |
| 826 | Dysentery | FAERS: 1 | US FAERS | |
| 827 | Dysgraphia | FAERS: 1 | OFFSIDES US FAERS | |
| 828 | Dyslalia | FAERS: 1 | US FAERS | |
| 829 | Dyspareunia | FAERS: 1 | US FAERS | |
| 830 | Dysphasia | FAERS: 1 | SIDER US FAERS | |
| 831 | Dysphemia | FAERS: 1 | US FAERS | |
| 832 | Dystonia | FAERS: 1 | 18607849 | CTD US FAERS |
| 833 | Ear discomfort | FAERS: 1 | SIDER US FAERS | |
| 834 | Echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 835 | Economic problem | FAERS: 1 | US FAERS | |
| 836 | Electrocardiogram T wave amplitude increased | FAERS: 1 | US FAERS | |
| 837 | Electrolyte depletion | FAERS: 1 | US FAERS | |
| 838 | Endocrine test abnormal | FAERS: 1 | US FAERS | |
| 839 | Enterovesical Fistula | FAERS: 1 | US FAERS | |
| 840 | Enzyme level increased | FAERS: 1 | US FAERS | |
| 841 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 842 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 843 | Escherichia test positive | FAERS: 1 | US FAERS | |
| 844 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 845 | Exophthalmos | FAERS: 1 | US FAERS | |
| 846 | Expired drug administered | FAERS: 1 | US FAERS | |
| 847 | Expired product administered | FAERS: 1 | US FAERS | |
| 848 | Exposure via partner | FAERS: 1 | US FAERS | |
| 849 | Exposure via skin contact | FAERS: 1 | US FAERS | |
| 850 | Extra dose administered | FAERS: 1 | US FAERS | |
| 851 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 852 | Eye inflammation | FAERS: 1 | US FAERS | |
| 853 | Facial paralysis | FAERS: 1 | SIDER US FAERS | |
| 854 | Factor VIII Deficiency | FAERS: 1 | US FAERS | |
| 855 | False positive investigation result | FAERS: 1 | US FAERS | |
| 856 | Fasting | FAERS: 1 | US FAERS | |
| 857 | Femoral artery occlusion | FAERS: 1 | OFFSIDES US FAERS | |
| 858 | Fibromyalgia | FAERS: 1 | OFFSIDES US FAERS | |
| 859 | Fibrosis | FAERS: 1 | SIDER US FAERS | |
| 860 | Fistula discharge | FAERS: 1 | OFFSIDES US FAERS | |
| 861 | Flank Pain | FAERS: 1 | US FAERS | |
| 862 | Fluid overload | FAERS: 1 | US FAERS | |
| 863 | Food aversion | FAERS: 1 | US FAERS | |
| 864 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 865 | Fracture pain | FAERS: 1 | US FAERS | |
| 866 | Frostbite | FAERS: 1 | US FAERS | |
| 867 | Gangrene | FAERS: 1 | US FAERS | |
| 868 | Gastrectomy | FAERS: 1 | US FAERS | |
| 869 | Gastric sarcoma | FAERS: 1 | US FAERS | |
| 870 | Gastroenteritis norovirus | FAERS: 1 | OFFSIDES US FAERS | |
| 871 | Gastrointestinal candidiasis | FAERS: 1 | SIDER US FAERS | |
| 872 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 873 | Gastrointestinal erosion | FAERS: 1 | US FAERS | |
| 874 | Gastrointestinal mucosal exfoliation | FAERS: 1 | US FAERS | |
| 875 | Gastrointestinal stoma output decreased | FAERS: 1 | US FAERS | |
| 876 | Gastrointestinal wall thickening | FAERS: 1 | US FAERS | |
| 877 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 878 | Genital discomfort | FAERS: 1 | US FAERS | |
| 879 | Gingival Recession | FAERS: 1 | US FAERS | |
| 880 | Gingival discomfort | FAERS: 1 | US FAERS | |
| 881 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 882 | Head and neck cancer metastatic | FAERS: 1 | US FAERS | |
| 883 | Head discomfort | FAERS: 1 | US FAERS | |
| 884 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 885 | Hemiparaesthesia | FAERS: 1 | US FAERS | |
| 886 | Hepatectomy | FAERS: 1 | US FAERS | |
| 887 | Hepatic cancer stage IV | FAERS: 1 | US FAERS | |
| 888 | Hepatitis C | FAERS: 1 | US FAERS | |
| 889 | Hernial eventration | FAERS: 1 | US FAERS | |
| 890 | Histology | FAERS: 1 | US FAERS | |
| 891 | Hoarseness | FAERS: 1 | SIDER US FAERS | |
| 892 | Hydrothorax | FAERS: 1 | US FAERS | |
| 893 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 894 | Hypercreatinaemia | FAERS: 1 | US FAERS | |
| 895 | Hyperphagia | FAERS: 1 | US FAERS | |
| 896 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 897 | Hyperventilation | FAERS: 1 | US FAERS | |
| 898 | Hypohidrosis | FAERS: 1 | US FAERS | |
| 899 | Hypoperfusion | FAERS: 1 | US FAERS | |
| 900 | Hypothalamo-pituitary disorder | FAERS: 1 | US FAERS | |
| 901 | Hypotrichosis | FAERS: 1 | US FAERS | |
| 902 | Idiosyncratic drug reaction | FAERS: 1 | US FAERS | |
| 903 | Iliac artery occlusion | FAERS: 1 | US FAERS | |
| 904 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 905 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 906 | Impaired self-care | FAERS: 1 | US FAERS | |
| 907 | Incision site complication | FAERS: 1 | OFFSIDES US FAERS | |
| 908 | Incision site infection | FAERS: 1 | US FAERS | |
| 909 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 910 | Induration | FAERS: 1 | US FAERS | |
| 911 | Infectious colitis | FAERS: 1 | US FAERS | |
| 912 | Infectious peritonitis | FAERS: 1 | US FAERS | |
| 913 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 914 | Intracranial Hypotension | FAERS: 1 | OFFSIDES US FAERS | |
| 915 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 916 | Keratopathy | FAERS: 1 | US FAERS | |
| 917 | Klebsiella sepsis | FAERS: 1 | US FAERS | |
| 918 | Labile blood pressure | FAERS: 1 | OFFSIDES US FAERS | |
| 919 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 920 | Lagophthalmos | FAERS: 1 | US FAERS | |
| 921 | Laryngeal cancer recurrent | FAERS: 1 | US FAERS | |
| 922 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 923 | Lichen Planus | FAERS: 1 | US FAERS | |
| 924 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 925 | Liver Abscess | FAERS: 1 | US FAERS | |
| 926 | Liver scan abnormal | FAERS: 1 | US FAERS | |
| 927 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 928 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 929 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 930 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 931 | Lung Abscess | FAERS: 1 | US FAERS | |
| 932 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 933 | Lymphangitis | FAERS: 1 | OFFSIDES US FAERS | |
| 934 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 935 | Marasmus | FAERS: 1 | US FAERS | |
| 936 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 937 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 938 | Measles | FAERS: 1 | US FAERS | |
| 939 | Mechanical ileus | FAERS: 1 | US FAERS | |
| 940 | Medical device complication | FAERS: 1 | OFFSIDES US FAERS | |
| 941 | Medical induction of coma | FAERS: 1 | US FAERS | |
| 942 | Meningeal disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 943 | Mesenteric neoplasm | FAERS: 1 | US FAERS | |
| 944 | Mesothelioma | FAERS: 1 | US FAERS | |
| 945 | Metabolic alkalosis | FAERS: 1 | US FAERS | |
| 946 | Metastases to adrenals | FAERS: 1 | US FAERS | |
| 947 | Metastases to pelvis | FAERS: 1 | US FAERS | |
| 948 | Metastatic pain | FAERS: 1 | US FAERS | |
| 949 | Metastatic salivary gland cancer | FAERS: 1 | OFFSIDES US FAERS | |
| 950 | Miller Fisher Syndrome | FAERS: 1 | US FAERS | |
| 951 | Mineral supplementation | FAERS: 1 | US FAERS | |
| 952 | Monoparesis | FAERS: 1 | OFFSIDES US FAERS | |
| 953 | Mouth Breathing | FAERS: 1 | US FAERS | |
| 954 | Mucocutaneous rash | FAERS: 1 | US FAERS | |
| 955 | Mucosal erosion | FAERS: 1 | OFFSIDES US FAERS | |
| 956 | Mucosal toxicity | FAERS: 1 | US FAERS | |
| 957 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 958 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 959 | Muscle strain | FAERS: 1 | US FAERS | |
| 960 | Muscle tightness | FAERS: 1 | US FAERS | |
| 961 | Mydriasis | FAERS: 1 | US FAERS | |
| 962 | Myocardial strain | FAERS: 1 | US FAERS | |
| 963 | Myocarditis | FAERS: 1 | SIDER US FAERS | |
| 964 | Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 965 | Myopathy | FAERS: 1 | US FAERS | |
| 966 | Nail bed infection | FAERS: 1 | OFFSIDES US FAERS | |
| 967 | Nasal mucosal disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 968 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 969 | Neuritis | FAERS: 1 | US FAERS | |
| 970 | Ocular icterus | FAERS: 1 | OFFSIDES US FAERS | |
| 971 | Onychomycosis | FAERS: 1 | US FAERS | |
| 972 | Ophthalmological examination abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 973 | Ophthalmoplegia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 974 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 975 | Oral discharge | FAERS: 1 | US FAERS | |
| 976 | Oral infection | FAERS: 1 | OFFSIDES US FAERS | |
| 977 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 978 | Orchitis | FAERS: 1 | US FAERS | |
| 979 | Oropharyngeal candidiasis | FAERS: 1 | US FAERS | |
| 980 | Oropharyngeal discomfort | FAERS: 1 | SIDER US FAERS | |
| 981 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 982 | Osmotic demyelination syndrome | FAERS: 1 | US FAERS | |
| 983 | Osteitis | FAERS: 1 | US FAERS | |
| 984 | Osteochondritis | FAERS: 1 | US FAERS | |
| 985 | Osteolysis | FAERS: 1 | US FAERS | |
| 986 | Osteopenia | FAERS: 1 | OFFSIDES US FAERS | |
| 987 | Osteoradionecrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 988 | Ovarian enlargement | FAERS: 1 | OFFSIDES US FAERS | |
| 989 | Overlap syndrome | FAERS: 1 | US FAERS | |
| 990 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 991 | Pancreatic Cyst | FAERS: 1 | OFFSIDES US FAERS | |
| 992 | Pancreatic Insufficiency | FAERS: 1 | US FAERS | |
| 993 | Pancreatic carcinoma recurrent | FAERS: 1 | US FAERS | |
| 994 | Panniculitis | FAERS: 1 | US FAERS | |
| 995 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 996 | Paraneoplastic dermatomyositis | FAERS: 1 | OFFSIDES US FAERS | |
| 997 | Paranoia | FAERS: 1 | OFFSIDES US FAERS | |
| 998 | Parapharyngeal abscess | FAERS: 1 | US FAERS | |
| 999 | Pelvic Infection | FAERS: 1 | US FAERS | |
| 1000 | Pelvic Inflammatory Disease | FAERS: 1 | US FAERS | |
| 1001 | Pelvic fluid collection | FAERS: 1 | US FAERS | |
| 1002 | Pemphigus | FAERS: 1 | US FAERS | |
| 1003 | Penile Infection | FAERS: 1 | OFFSIDES US FAERS | |
| 1004 | Penile blister | FAERS: 1 | US FAERS | |
| 1005 | Penile swelling | FAERS: 1 | US FAERS | |
| 1006 | Perineal pain | FAERS: 1 | US FAERS | |
| 1007 | Perineal ulceration | FAERS: 1 | US FAERS | |
| 1008 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 1009 | Peripheral artery occlusion | FAERS: 1 | US FAERS | |
| 1010 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 1011 | Peripheral motor neuropathy | FAERS: 1 | US FAERS | |
| 1012 | Peritoneal perforation | FAERS: 1 | US FAERS | |
| 1013 | Phagocytosis | FAERS: 1 | US FAERS | |
| 1014 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 1015 | Pharyngitis bacterial | FAERS: 1 | US FAERS | |
| 1016 | Photodermatosis | FAERS: 1 | US FAERS | |
| 1017 | Pigmentation lip | FAERS: 1 | US FAERS | |
| 1018 | Platelet aggregation inhibition | FAERS: 1 | US FAERS | |
| 1019 | Pleural Mesothelioma | FAERS: 1 | US FAERS | |
| 1020 | Pneumatosis Cystoides Intestinalis | FAERS: 1 | US FAERS | |
| 1021 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 1022 | Polyarthritis | FAERS: 1 | US FAERS | |
| 1023 | Polymyositis | FAERS: 1 | US FAERS | |
| 1024 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 1025 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 1026 | Postoperative thrombosis | FAERS: 1 | US FAERS | |
| 1027 | Postoperative wound complication | FAERS: 1 | US FAERS | |
| 1028 | Poverty of speech | FAERS: 1 | US FAERS | |
| 1029 | Precancerous cells present | FAERS: 1 | OFFSIDES US FAERS | |
| 1030 | Pregnancy test positive | FAERS: 1 | US FAERS | |
| 1031 | Pressure of speech | FAERS: 1 | US FAERS | |
| 1032 | Presyncope | FAERS: 1 | US FAERS | |
| 1033 | Procalcitonin increased | FAERS: 1 | US FAERS | |
| 1034 | Procedural intestinal perforation | FAERS: 1 | US FAERS | |
| 1035 | Procedural nausea | FAERS: 1 | US FAERS | |
| 1036 | Product barcode issue | FAERS: 1 | US FAERS | |
| 1037 | Product dispensing error | FAERS: 1 | US FAERS | |
| 1038 | Product label on wrong product | FAERS: 1 | US FAERS | |
| 1039 | Product package associated injury | FAERS: 1 | US FAERS | |
| 1040 | Product preparation error | FAERS: 1 | US FAERS | |
| 1041 | Protein C decreased | FAERS: 1 | US FAERS | |
| 1042 | Protein urine present | FAERS: 1 | SIDER US FAERS | |
| 1043 | Prothrombin time ratio increased | FAERS: 1 | US FAERS | |
| 1044 | Pulmonary necrosis | FAERS: 1 | US FAERS | |
| 1045 | Quadriparesis | FAERS: 1 | OFFSIDES US FAERS | |
| 1046 | Radiation Pneumonitis | FAERS: 1 | US FAERS | |
| 1047 | Radiation associated pain | FAERS: 1 | US FAERS | |
| 1048 | Radiation interaction | FAERS: 1 | US FAERS | |
| 1049 | Radiation necrosis | FAERS: 1 | US FAERS | |
| 1050 | Radiation proctitis | FAERS: 1 | US FAERS | |
| 1051 | Rectal Obstruction | FAERS: 1 | US FAERS | |
| 1052 | Rectal Stenosis | FAERS: 1 | US FAERS | |
| 1053 | Rectal spasm | FAERS: 1 | US FAERS | |
| 1054 | Reflux gastritis | FAERS: 1 | US FAERS | |
| 1055 | Regurgitation | FAERS: 1 | US FAERS | |
| 1056 | Renal Colic | FAERS: 1 | US FAERS | |
| 1057 | Renal interstitial fibrosis | FAERS: 1 | US FAERS | |
| 1058 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 1059 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 1060 | Retrograde amnesia | FAERS: 1 | US FAERS | |
| 1061 | Retroperitoneal abscess | FAERS: 1 | US FAERS | |
| 1062 | Retroperitoneal effusion | FAERS: 1 | US FAERS | |
| 1063 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 1064 | Rhinalgia | FAERS: 1 | US FAERS | |
| 1065 | Rhinitis | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 1066 | Saliva altered | FAERS: 1 | US FAERS | |
| 1067 | Scan myocardial perfusion abnormal | FAERS: 1 | US FAERS | |
| 1068 | Scleral degeneration | FAERS: 1 | US FAERS | |
| 1069 | Scotoma | FAERS: 1 | US FAERS | |
| 1070 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 1071 | Sense of oppression | FAERS: 1 | US FAERS | |
| 1072 | Sensitivity to weather change | FAERS: 1 | US FAERS | |
| 1073 | Septic embolus | FAERS: 1 | US FAERS | |
| 1074 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 1075 | Sinus operation | FAERS: 1 | US FAERS | |
| 1076 | Sinus pain | FAERS: 1 | US FAERS | |
| 1077 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 1078 | Skin discomfort | FAERS: 1 | US FAERS | |
| 1079 | Skin graft failure | FAERS: 1 | US FAERS | |
| 1080 | Skin texture abnormal | FAERS: 1 | US FAERS | |
| 1081 | Small bowel angioedema | FAERS: 1 | US FAERS | |
| 1082 | Small intestine carcinoma metastatic | FAERS: 1 | US FAERS | |
| 1083 | Sneezing | FAERS: 1 | SIDER US FAERS | |
| 1084 | Spinal column stenosis | FAERS: 1 | OFFSIDES US FAERS | |
| 1085 | Staring | FAERS: 1 | US FAERS | |
| 1086 | Starvation | FAERS: 1 | US FAERS | |
| 1087 | Stem cell transplant | FAERS: 1 | US FAERS | |
| 1088 | Stoma Site Infection | FAERS: 1 | US FAERS | |
| 1089 | Stoma complication | FAERS: 1 | US FAERS | |
| 1090 | Stoma obstruction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1091 | Stoma site irritation | FAERS: 1 | US FAERS | |
| 1092 | Stoma site pain | FAERS: 1 | US FAERS | |
| 1093 | Stoma site reaction | FAERS: 1 | US FAERS | |
| 1094 | Stubbornness | FAERS: 1 | US FAERS | |
| 1095 | Subcutaneous Emphysema | FAERS: 1 | OFFSIDES US FAERS | |
| 1096 | Superinfection | FAERS: 1 | SIDER US FAERS | |
| 1097 | Supraventricular tachycardia | FAERS: 1 | SIDER US FAERS | |
| 1098 | Suture related complication | FAERS: 1 | US FAERS | |
| 1099 | Tenosynovitis | FAERS: 1 | US FAERS | |
| 1100 | Tension Headache | FAERS: 1 | US FAERS | |
| 1101 | Tetany | FAERS: 1 | US FAERS | |
| 1102 | Thoracic cavity drainage | FAERS: 1 | US FAERS | |
| 1103 | Thoracic vertebral fracture | FAERS: 1 | OFFSIDES US FAERS | |
| 1104 | Throat cancer | FAERS: 1 | US FAERS | |
| 1105 | Thrombosis in device | FAERS: 1 | OFFSIDES US FAERS | |
| 1106 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 1107 | Tongue biting | FAERS: 1 | US FAERS | |
| 1108 | Tongue eruption | FAERS: 1 | US FAERS | |
| 1109 | Tooth Crowding | FAERS: 1 | US FAERS | |
| 1110 | Toothache | FAERS: 1 | US FAERS | |
| 1111 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 1112 | Tuberculosis | FAERS: 1 | US FAERS | |
| 1113 | Umbilical hernia | FAERS: 1 | OFFSIDES US FAERS | |
| 1114 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 1115 | Urethral Obstruction | FAERS: 1 | US FAERS | |
| 1116 | Urinary sediment present | FAERS: 1 | US FAERS | |
| 1117 | Urinary tract infection enterococcal | FAERS: 1 | OFFSIDES US FAERS | |
| 1118 | Urinary tract inflammation | FAERS: 1 | US FAERS | |
| 1119 | Urine output increased | FAERS: 1 | SIDER US FAERS | |
| 1120 | Uveitis | FAERS: 1 | US FAERS | |
| 1121 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 1122 | Vaginal erosion | FAERS: 1 | US FAERS | |
| 1123 | Vaginal mucosal blistering | FAERS: 1 | OFFSIDES US FAERS | |
| 1124 | Varicose vein operation | FAERS: 1 | US FAERS | |
| 1125 | Vasculitis | FAERS: 1 | US FAERS | |
| 1126 | Venous thrombosis limb | FAERS: 1 | OFFSIDES US FAERS | |
| 1127 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 1128 | Ventricular Flutter | FAERS: 1 | US FAERS | |
| 1129 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 1130 | Vertebroplasty | FAERS: 1 | OFFSIDES US FAERS | |
| 1131 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 1132 | Vulvovaginal inflammation | FAERS: 1 | US FAERS | |
| 1133 | Vulvovaginal pain | FAERS: 1 | SIDER US FAERS | |
| 1134 | Vulvovaginal pruritus | FAERS: 1 | OFFSIDES US FAERS | |
| 1135 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 1136 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 1137 | Wolff-Parkinson-White Syndrome | FAERS: 1 | US FAERS | |
| 1138 | Wound Complication | FAERS: 1 | OFFSIDES US FAERS | |
| 1139 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 1140 | Wrong product administered | FAERS: 1 | US FAERS | |
| 1141 | Xeroderma | FAERS: 1 | US FAERS | |
| 1142 | ovarian neoplasm | FAERS: 1 | US FAERS | |
| 1143 | Abdominal Compartment Syndrome | OFFSIDES | ||
| 1144 | Abdominal sepsis | OFFSIDES | ||
| 1145 | Abducens Nerve Diseases | 20479552 | CTD | |
| 1146 | Abnormal cervical smear | OFFSIDES | ||
| 1147 | Abnormal vision | SIDER | ||
| 1148 | Abscess management | OFFSIDES | ||
| 1149 | Acantholysis | OFFSIDES | ||
| 1150 | Acanthoma | OFFSIDES | ||
| 1151 | Acute overdose | SIDER | ||
| 1152 | Adnexa uteri cyst | OFFSIDES | ||
| 1153 | Adrenal mass | OFFSIDES | ||
| 1154 | Afferent Loop Syndrome | OFFSIDES | ||
| 1155 | Albumin globulin ratio decreased | OFFSIDES | ||
| 1156 | Alveoloplasty | OFFSIDES | ||
| 1157 | Anal infection | OFFSIDES | ||
| 1158 | Anemia | 17594717 18000507 19396018 | CTD | |
| 1159 | Angiofibroma | OFFSIDES | ||
| 1160 | Anhedonia | OFFSIDES | ||
| 1161 | Anhidrosis | OFFSIDES | ||
| 1162 | Antipsychotic drug level increased | OFFSIDES | ||
| 1163 | Aortic valve sclerosis | OFFSIDES | ||
| 1164 | Aortitis | OFFSIDES | ||
| 1165 | Appendiceal Neoplasms | 18813211 | CTD | |
| 1166 | Aspiration Pneumonia | OFFSIDES | ||
| 1167 | Asthenopia | OFFSIDES | ||
| 1168 | Atelectasis | OFFSIDES | ||
| 1169 | Atrial Flutter | Canada Vigilance: 1 | Canada Vigilance | |
| 1170 | Atrial arrhythmia | SIDER | ||
| 1171 | Atrial natriuretic peptide increased | OFFSIDES | ||
| 1172 | Atrial thrombosis | OFFSIDES | ||
| 1173 | Atrophic vulvovaginitis | OFFSIDES | ||
| 1174 | Atrophy of tongue papillae | OFFSIDES | ||
| 1175 | Autonomic neuropathy | OFFSIDES | ||
| 1176 | Bacteria tissue specimen identified | OFFSIDES | ||
| 1177 | Bacteria urine identified | OFFSIDES | ||
| 1178 | Bacterial disease carrier | OFFSIDES | ||
| 1179 | Balanitis | OFFSIDES | ||
| 1180 | Balanoposthitis | SIDER | ||
| 1181 | Benign breast lump removal | OFFSIDES | ||
| 1182 | Biopsy bladder abnormal | OFFSIDES | ||
| 1183 | Bladder neck obstruction | OFFSIDES | ||
| 1184 | Blepharoptosis | OFFSIDES | ||
| 1185 | Blood and lymphatic system disorders | SIDER | ||
| 1186 | Blood calcitonin decreased | OFFSIDES | ||
| 1187 | Blood cortisol decreased | OFFSIDES | ||
| 1188 | Blood follicle stimulating hormone decreased | OFFSIDES | ||
| 1189 | Blood follicle stimulating hormone increased | OFFSIDES | ||
| 1190 | Blood in stool | SIDER | ||
| 1191 | Blood prolactin increased | OFFSIDES | ||
| 1192 | Body Temperature | OFFSIDES | ||
| 1193 | Bone callus excessive | OFFSIDES | ||
| 1194 | Bone density decreased | OFFSIDES | ||
| 1195 | Bone fragmentation | OFFSIDES | ||
| 1196 | Bone lesion | OFFSIDES | ||
| 1197 | Bone swelling | OFFSIDES | ||
| 1198 | Bone trimming | OFFSIDES | ||
| 1199 | Brachial pulse increased | Canada Vigilance: 1 | Canada Vigilance | |
| 1200 | Brain Abscess | OFFSIDES | ||
| 1201 | Brain Diseases | 19276137 | CTD | |
| 1202 | Breast prosthesis user | OFFSIDES | ||
| 1203 | Bronchiectasis | OFFSIDES | ||
| 1204 | Budd-Chiari Syndrome | OFFSIDES | ||
| 1205 | Bulbar palsy | OFFSIDES | ||
| 1206 | Ca++ increased | SIDER | ||
| 1207 | Calcium low | SIDER | ||
| 1208 | Cardiac pain | SIDER | ||
| 1209 | Catheter site phlebitis | OFFSIDES | ||
| 1210 | Catheter site swelling | OFFSIDES | ||
| 1211 | Cauda Equina Syndrome | OFFSIDES | ||
| 1212 | Cerebellar Diseases | 19833683 | CTD | |
| 1213 | Cerebral Amyloid Angiopathy | OFFSIDES | ||
| 1214 | Cerebral artery stenosis | OFFSIDES | ||
| 1215 | Cerebrosclerosis | OFFSIDES | ||
| 1216 | Cervical cord compression | OFFSIDES | ||
| 1217 | Cervical dysplasia | OFFSIDES | ||
| 1218 | Cervical polyp | OFFSIDES | ||
| 1219 | Chemotherapeutic drug level increased | OFFSIDES | ||
| 1220 | Chest tightness | SIDER | ||
| 1221 | Cholangiolitis | OFFSIDES | ||
| 1222 | Cholestatic liver injury | OFFSIDES | ||
| 1223 | Choriocarcinoma | OFFSIDES | ||
| 1224 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 1225 | Chronic ulcerative colitis | OFFSIDES | ||
| 1226 | Clostridium difficile toxin test positive | OFFSIDES | ||
| 1227 | Colonic Neoplasms | CTD | ||
| 1228 | Colonic fistula | OFFSIDES | ||
| 1229 | Colorectal Neoplasms |
16645374
17179728 18448328 18473752 18945862 19693536 19833683 20212239 20462981 20722491 21048041 21114776 27631426 | CTD | |
| 1230 | Compression fracture | OFFSIDES | ||
| 1231 | Congenital cystic kidney disease | OFFSIDES | ||
| 1232 | Congenital pyelocaliectasis | OFFSIDES | ||
| 1233 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 1234 | Conjunctival deposit | OFFSIDES | ||
| 1235 | Contact Dermatitis | OFFSIDES | ||
| 1236 | Contralateral breast cancer | OFFSIDES | ||
| 1237 | Cryotherapy | OFFSIDES | ||
| 1238 | Cyst drainage | OFFSIDES | ||
| 1239 | Cystocele | OFFSIDES | ||
| 1240 | Debridement | OFFSIDES | ||
| 1241 | Decreased immune responsiveness | OFFSIDES | ||
| 1242 | Dental Fistula | OFFSIDES | ||
| 1243 | Dental Plaque | OFFSIDES | ||
| 1244 | Dental abscess | OFFSIDES | ||
| 1245 | Dental alveolar anomaly | OFFSIDES | ||
| 1246 | Dental cleaning | OFFSIDES | ||
| 1247 | Dental prosthesis placement | OFFSIDES | ||
| 1248 | Dental prosthesis user | OFFSIDES | ||
| 1249 | Denture wearer | OFFSIDES | ||
| 1250 | Device migration | OFFSIDES | ||
| 1251 | Diabetic Foot | OFFSIDES | ||
| 1252 | Diarrhea | CTD OFFSIDES | ||
| 1253 | Disturbance in sexual arousal | SIDER | ||
| 1254 | Diverticulosis | OFFSIDES | ||
| 1255 | Diverticulum | OFFSIDES | ||
| 1256 | Drug metabolising enzyme test abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 1257 | Duodenitis | OFFSIDES SIDER | ||
| 1258 | Ear and labyrinth disorders | SIDER | ||
| 1259 | Electrocardiogram ST-T change | OFFSIDES | ||
| 1260 | Electrocardiogram ST-T segment depression | OFFSIDES | ||
| 1261 | Electrocardiogram poor R-wave progression | OFFSIDES | ||
| 1262 | Embolic cerebral infarction | OFFSIDES | ||
| 1263 | Embolic stroke | OFFSIDES | ||
| 1264 | Endodontic procedure | OFFSIDES | ||
| 1265 | Endometriosis | OFFSIDES | ||
| 1266 | Enterocolitis bacterial | OFFSIDES | ||
| 1267 | Epicondylitis | OFFSIDES | ||
| 1268 | Epididymitis | OFFSIDES | ||
| 1269 | Erysipelas | OFFSIDES | ||
| 1270 | Erythema Multiforme | SIDER | ||
| 1271 | Erythrodermic psoriasis | OFFSIDES | ||
| 1272 | Esophageal Neoplasms | 19276137 | CTD | |
| 1273 | Esophageal Stenosis | OFFSIDES | ||
| 1274 | Ethmoid sinus surgery | OFFSIDES | ||
| 1275 | Eustachian tube disorder | OFFSIDES | ||
| 1276 | Facial Pain | SIDER | ||
| 1277 | Faecaluria | OFFSIDES | ||
| 1278 | Fanconi Syndrome | 19584382 | CTD OFFSIDES | |
| 1279 | Fatty Liver | OFFSIDES | ||
| 1280 | Fine motor delay | OFFSIDES | ||
| 1281 | Fluid replacement | OFFSIDES | ||
| 1282 | Food Allergy | SIDER | ||
| 1283 | Foot Dermatoses | CTD | ||
| 1284 | Foot Injuries | 17022868 | CTD | |
| 1285 | Foreign body trauma | OFFSIDES | ||
| 1286 | Formication | OFFSIDES | ||
| 1287 | Fracture treatment | OFFSIDES | ||
| 1288 | Fungus urine test positive | OFFSIDES | ||
| 1289 | Gallbladder cancer stage IV | OFFSIDES | ||
| 1290 | Gamma radiation therapy to brain | OFFSIDES | ||
| 1291 | Gastric Bypass | OFFSIDES | ||
| 1292 | Gastric outlet obstruction | OFFSIDES | ||
| 1293 | Gastrointestinal Neoplasms | 18000507 | CTD | |
| 1294 | Gastrointestinal mucosal necrosis | OFFSIDES | ||
| 1295 | Gastrointestinal sounds abnormal | OFFSIDES | ||
| 1296 | Gastropleural fistula | OFFSIDES | ||
| 1297 | General physical condition | OFFSIDES | ||
| 1298 | General symptom | OFFSIDES | ||
| 1299 | Gingival blister | OFFSIDES | ||
| 1300 | Gingival erythema | OFFSIDES | ||
| 1301 | Grip strength | OFFSIDES | ||
| 1302 | Hand Dermatoses | CTD | ||
| 1303 | Hand Injuries | 17022868 | CTD | |
| 1304 | Head and Neck Neoplasms | 20722491 | CTD | |
| 1305 | Heart Diseases | 11996484 | CTD | |
| 1306 | Hemisensory Neglect | OFFSIDES | ||
| 1307 | Hemorrhage | 12564432 | CTD | |
| 1308 | Hepatic artery thrombosis | OFFSIDES | ||
| 1309 | Hiccough | OFFSIDES | ||
| 1310 | Hidradenitis | OFFSIDES | ||
| 1311 | High frequency ablation | OFFSIDES | ||
| 1312 | Hilar lymphadenopathy | OFFSIDES | ||
| 1313 | Hirsutism | SIDER | ||
| 1314 | Hordeolum | OFFSIDES | ||
| 1315 | Hypercapnia | OFFSIDES | ||
| 1316 | Hyperlipasaemia | OFFSIDES | ||
| 1317 | Hypermetabolism | OFFSIDES | ||
| 1318 | Hyperpigmentation | 12564432 17669305 | CTD OFFSIDES | |
| 1319 | Hypertensive crisis | SIDER | ||
| 1320 | Hypocalcemia | 19584382 | CTD | |
| 1321 | Hypokalemia | 18360625 19584382 | CTD | |
| 1322 | Hypophosphatemia | 19584382 | CTD | |
| 1323 | Impetigo | OFFSIDES | ||
| 1324 | Incisional hernia | SIDER | ||
| 1325 | Infestation | SIDER | ||
| 1326 | Infusion site mobility decreased | OFFSIDES | ||
| 1327 | Infusion site pain | SIDER | ||
| 1328 | Injection Site Reaction | SIDER | ||
| 1329 | Injection site infection | SIDER | ||
| 1330 | Injection site pain | SIDER | ||
| 1331 | Injury asphyxiation | OFFSIDES | ||
| 1332 | Inspiratory capacity decreased | OFFSIDES | ||
| 1333 | Intertrigo | SIDER | ||
| 1334 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 1335 | Intervertebral disc compression | OFFSIDES | ||
| 1336 | Intervertebral disc disorder | OFFSIDES | ||
| 1337 | Jejunal ulcer | OFFSIDES | ||
| 1338 | Keratitis sicca | OFFSIDES | ||
| 1339 | Keratoconjunctivitis | SIDER | ||
| 1340 | Keratomileusis | OFFSIDES | ||
| 1341 | Lactose Intolerance | OFFSIDES | ||
| 1342 | Laryngitis | SIDER | ||
| 1343 | Laryngospasm | OFFSIDES | ||
| 1344 | Leg Ulcer | SIDER | ||
| 1345 | Lesion excision | OFFSIDES | ||
| 1346 | Leukodystrophy | OFFSIDES | ||
| 1347 | Life expectancy shortened | OFFSIDES | ||
| 1348 | Localised skin reaction | SIDER | ||
| 1349 | Locked-In Syndrome | OFFSIDES | ||
| 1350 | Loop electrosurgical excision procedure | OFFSIDES | ||
| 1351 | Loss of confidence | SIDER | ||
| 1352 | Lumbar radiculopathy | OFFSIDES | ||
| 1353 | Lymph node palpable | OFFSIDES | ||
| 1354 | Lymphatic system neoplasm | OFFSIDES | ||
| 1355 | Macrocytosis | OFFSIDES | ||
| 1356 | Macroglossia | OFFSIDES | ||
| 1357 | Malignant mesenteric neoplasm | OFFSIDES | ||
| 1358 | Malignant tumour excision | OFFSIDES | ||
| 1359 | Mass excision | OFFSIDES | ||
| 1360 | Mastication disorder | OFFSIDES | ||
| 1361 | Mechanical urticaria | OFFSIDES | ||
| 1362 | Mediastinoscopy | OFFSIDES | ||
| 1363 | Medical device removal | OFFSIDES | ||
| 1364 | Meningioma | OFFSIDES | ||
| 1365 | Mental Retardation | SIDER | ||
| 1366 | Metaplasia | OFFSIDES | ||
| 1367 | Metastases to abdominal cavity | OFFSIDES | ||
| 1368 | Metastases to nasal sinuses | OFFSIDES | ||
| 1369 | Metrorrhagia | SIDER | ||
| 1370 | Myocardial Ischemia | 17633978 17953177 | CTD | |
| 1371 | Myoclonus | SIDER | ||
| 1372 | Myosclerosis | OFFSIDES | ||
| 1373 | Nail changes | SIDER | ||
| 1374 | Necrotizing Enterocolitis | SIDER | ||
| 1375 | Neoplasm Invasiveness | 23531514 | CTD | |
| 1376 | Neoplasm Metastasis | CTD | ||
| 1377 | Neoplasms, Unknown Primary | 17594717 | CTD | |
| 1378 | Neoplasms | 16374040 | CTD | |
| 1379 | Nerve Block | OFFSIDES | ||
| 1380 | Nerve Degeneration | OFFSIDES | ||
| 1381 | Neurologic Manifestations | 20462981 | CTD | |
| 1382 | Neurotoxicity Syndromes | 15218302 | CTD | |
| 1383 | Nipple pain | OFFSIDES | ||
| 1384 | Nocturia | SIDER | ||
| 1385 | Nodal osteoarthritis | OFFSIDES | ||
| 1386 | Open reduction of fracture | OFFSIDES | ||
| 1387 | Oral polypectomy | OFFSIDES | ||
| 1388 | Oral torus | OFFSIDES | ||
| 1389 | Orthosis user | OFFSIDES | ||
| 1390 | Osteochondrosis | OFFSIDES | ||
| 1391 | Osteomyelitis | OFFSIDES | ||
| 1392 | Osteosclerosis | OFFSIDES | ||
| 1393 | Otitis Media | SIDER | ||
| 1394 | Ovarian adhesion | OFFSIDES | ||
| 1395 | Overweight | OFFSIDES | ||
| 1396 | PCO2 abnormal | OFFSIDES | ||
| 1397 | Pancreatic calcification | OFFSIDES | ||
| 1398 | Pancreatic enzymes increased | OFFSIDES | ||
| 1399 | Paraparesis | OFFSIDES | ||
| 1400 | Paresthesia | CTD | ||
| 1401 | Periarthritis | OFFSIDES | ||
| 1402 | Periostitis | OFFSIDES | ||
| 1403 | Peripheral Nervous System Diseases | 17179728 20212239 | CTD | |
| 1404 | Peripheral nerve lesion | OFFSIDES | ||
| 1405 | Perivascular dermatitis | OFFSIDES | ||
| 1406 | Pharyngeal Stenosis | OFFSIDES | ||
| 1407 | Phimosis | OFFSIDES | ||
| 1408 | Physical disability | OFFSIDES | ||
| 1409 | Pleura carcinoma | OFFSIDES | ||
| 1410 | Pleural fistula | OFFSIDES | ||
| 1411 | Pleurectomy | OFFSIDES | ||
| 1412 | Pleurodesis | OFFSIDES | ||
| 1413 | Pneumonectomy | OFFSIDES | ||
| 1414 | Poikilocytosis | OFFSIDES | ||
| 1415 | Poor dental condition | OFFSIDES | ||
| 1416 | Post procedural pain | OFFSIDES | ||
| 1417 | Post-traumatic pain | OFFSIDES | ||
| 1418 | Potassium low | SIDER | ||
| 1419 | Pre-menstrual tension syndrome | SIDER | ||
| 1420 | Precancerous skin lesion | OFFSIDES | ||
| 1421 | Premenstrual Tension | SIDER | ||
| 1422 | Premenstrual syndrome | SIDER | ||
| 1423 | Prolapse repair | OFFSIDES | ||
| 1424 | Prostatic Neoplasms | 22026922 | CTD | |
| 1425 | Prostatitis Escherichia coli | OFFSIDES | ||
| 1426 | Prosthesis Implantation | OFFSIDES | ||
| 1427 | Protein C Deficiency | OFFSIDES | ||
| 1428 | Protein-losing gastroenteropathy | OFFSIDES | ||
| 1429 | Proteinuria | SIDER | ||
| 1430 | Prurigo | SIDER | ||
| 1431 | Pseudomonal sepsis | OFFSIDES | ||
| 1432 | Psychotic disorder due to a general medical condition | OFFSIDES | ||
| 1433 | Pulmonary microemboli | OFFSIDES | ||
| 1434 | Punctate keratitis | SIDER | ||
| 1435 | Pyelotomy | OFFSIDES | ||
| 1436 | Q Fever | OFFSIDES | ||
| 1437 | Radiation recall syndrome | SIDER | ||
| 1438 | Rales | OFFSIDES SIDER | ||
| 1439 | Rectal Neoplasms | 17536204 18607849 21273620 | CTD | |
| 1440 | Rectal fissure | OFFSIDES | ||
| 1441 | Redness of face | SIDER | ||
| 1442 | Renal cyst | OFFSIDES | ||
| 1443 | Residual urine | OFFSIDES | ||
| 1444 | Retroperitoneal fibrosis | OFFSIDES | ||
| 1445 | Rhinorrhea | OFFSIDES | ||
| 1446 | Rosacea | SIDER | ||
| 1447 | Salpingo-oophorectomy | OFFSIDES | ||
| 1448 | Sarcopenia | 19351764 | CTD | |
| 1449 | Scleroderma renal crisis | OFFSIDES | ||
| 1450 | Scrotal erythema | OFFSIDES | ||
| 1451 | Sequestrectomy | OFFSIDES | ||
| 1452 | Seroma | OFFSIDES | ||
| 1453 | Shivering | SIDER | ||
| 1454 | Shock, Cardiogenic | 18813211 | CTD | |
| 1455 | Single functional kidney | OFFSIDES | ||
| 1456 | Sinus antrostomy | OFFSIDES | ||
| 1457 | Sinus bradycardia | OFFSIDES | ||
| 1458 | Skeletal injury | OFFSIDES | ||
| 1459 | Smoker | OFFSIDES | ||
| 1460 | Sodium decreased | SIDER | ||
| 1461 | Soft Tissue Infection | OFFSIDES | ||
| 1462 | Soft tissue inflammation | OFFSIDES | ||
| 1463 | Somatoform Disorder | SIDER | ||
| 1464 | Spinal claudication | OFFSIDES | ||
| 1465 | Spinal corpectomy | OFFSIDES | ||
| 1466 | Spinal fusion surgery | OFFSIDES | ||
| 1467 | Splenic cyst | OFFSIDES | ||
| 1468 | Stomach Neoplasms | CTD | ||
| 1469 | Suture insertion | OFFSIDES | ||
| 1470 | Synovial Cyst | OFFSIDES | ||
| 1471 | Tachycardia, Ventricular | 19584743 | CTD | |
| 1472 | Therapeutic procedure | OFFSIDES | ||
| 1473 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 1474 | Therapeutic product effect incomplete | Canada Vigilance: 2 | Canada Vigilance | |
| 1475 | Thoracotomy | OFFSIDES | ||
| 1476 | Tonsillitis | OFFSIDES SIDER | ||
| 1477 | Tooth Resorption | OFFSIDES | ||
| 1478 | Tooth repair | OFFSIDES | ||
| 1479 | Toxic dilatation of intestine | SIDER | ||
| 1480 | Tracheal Stenosis | OFFSIDES | ||
| 1481 | Transferrin decreased | OFFSIDES | ||
| 1482 | Tricuspid valve sclerosis | OFFSIDES | ||
| 1483 | Troponin | OFFSIDES | ||
| 1484 | Urethral caruncle | OFFSIDES | ||
| 1485 | Uterine Prolapse | OFFSIDES | ||
| 1486 | Vaginal pain | SIDER | ||
| 1487 | Vaginoplasty | OFFSIDES | ||
| 1488 | Vascular Access Complication | OFFSIDES | ||
| 1489 | Vascular purpura | SIDER | ||
| 1490 | Vascular test abnormal | OFFSIDES | ||
| 1491 | Vena cava injury | OFFSIDES | ||
| 1492 | Venous Insufficiency | OFFSIDES | ||
| 1493 | Venous stenosis | OFFSIDES | ||
| 1494 | Viral labyrinthitis | OFFSIDES | ||
| 1495 | Vulvovaginal mycotic infection | OFFSIDES | ||
| 1496 | Waist circumference increased | OFFSIDES | ||
| 1497 | Walking aid user | OFFSIDES | ||
| 1498 | White blood cells stool positive | OFFSIDES | ||
| 1499 | Wound decomposition | OFFSIDES | ||
| 1500 | Wound discharge increased | SIDER | ||
| 1501 | colonoscopy | OFFSIDES | ||
| 1502 | insulinoma | OFFSIDES | ||
| 1503 | kyphosis | OFFSIDES | ||
| 1504 | rhinoplasty | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.