Warfarin
(PJVWKTKQMONHTI-UHFFFAOYSA-N)
Structure
- SMILES
- CC(=O)CC(c1c(=O)oc2c(c1O)cccc2)c1ccccc1
- Type(s)
- Approved
- ATC code(s)
- B01AA03
- Molecular Formula:
- C19H16O4
- Molecular Weight:
- 308.328
- Log P:
- 3.6096
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 1
- TPSA:
- 67.51
- CAS Number(s):
- 81-81-2; 56573-89-8; 951658-59-6
Synonym(s)
1.
Warfarin
2.
4-Hydroxy-3-(3-oxo-1-phenylbutyl)-2H-1-benzopyran-2-one
3.
Aldocumar
4.
Apo-Warfarin
5.
Coumadin
6.
Coumadine
7.
Gen-Warfarin
8.
Marevan
9.
Tedicumar
10.
Warfant
11.
Warfarin Potassium
12.
Warfarin Sodium
13.
Potassium, Warfarin
14.
Sodium, Warfarin
External Link(s)
| MeSH | D014859 |
| PubChem Compound | 54678486 |
| BindingDB | 50343352 |
| ChEBI | 87732 |
| CHEMBL | CHEMBL1464 CHEMBL7252 |
| DrugBank | DB00682 |
| DrugCentral | 2847 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 6853 |
| KEGG | cpd:C01541 dr:D08682 |
| Therapeutic Target Database | D0E3OF |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 478 Canada Vigilance: 33 | Canada Vigilance US FAERS | |
| 2 | Epistaxis | FAERS: 298 Canada Vigilance: 14 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 3 | Thrombosis | FAERS: 289 Canada Vigilance: 17 |
2008847
2123154 4413441 8156472 8172181 8322273 10622550 10831996 11144695 11307788 11319192 11518727 12407843 12711887 12902121 15389900 15720958 17245631 17672075 18680736 19300499 19415734 20169542 20597268 20808689 23710884 23814193 | CTD Canada Vigilance US FAERS |
| 4 | Cerebrovascular accident | FAERS: 283 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 5 | Adverse event | FAERS: 276 | US FAERS | |
| 6 | Dizziness | FAERS: 190 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 7 | Asthenia | FAERS: 185 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 8 | Deep Vein Thrombosis | FAERS: 170 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 9 | Headache | FAERS: 165 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 10 | Alopecia | FAERS: 155 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 11 | Nausea | FAERS: 138 Canada Vigilance: 12 | Canada Vigilance SIDER US FAERS | |
| 12 | Fatigue | FAERS: 134 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 13 | Pulmonary Embolism | FAERS: 130 Canada Vigilance: 6 | CTD Canada Vigilance US FAERS | |
| 14 | Calciphylaxis | FAERS: 127 Canada Vigilance: 6 | Canada Vigilance OFFSIDES US FAERS | |
| 15 | Vomiting | FAERS: 106 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 16 | Hypotension | FAERS: 105 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 17 | Malaise | FAERS: 105 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 18 | Overdose | FAERS: 97 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 19 | Hypersensitivity | FAERS: 95 | SIDER US FAERS | |
| 20 | Anticoagulation drug level above therapeutic | FAERS: 93 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 21 | Atrial Fibrillation | FAERS: 88 Canada Vigilance: 1 |
1682588
8161643 8311367 8378946 8431614 9505919 9681093 9706280 10386508 11352885 11514479 12950521 14961170 15130407 15464686 15545674 15785153 15817013 16415938 16913990 17020434 17419358 17890461 18788834 19153410 19169604 19476425 20599166 20655037 21725053 21981797 22040439 25300812 29542828 | CTD Canada Vigilance US FAERS |
| 22 | Skin necrosis | FAERS: 88 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 23 | Abdominal Pain | FAERS: 87 Canada Vigilance: 6 | 4464499 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 24 | Pruritus | FAERS: 83 Canada Vigilance: 9 | 12680483 | CTD SIDER Canada Vigilance US FAERS |
| 25 | Pharmaceutical product complaint | FAERS: 82 | US FAERS | |
| 26 | Medication Error | FAERS: 80 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Pain | FAERS: 80 Canada Vigilance: 4 | 4338821 6186784 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 28 | Toxicity to various agents | FAERS: 76 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Pneumonia | FAERS: 75 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Pregnancy | FAERS: 67 | US FAERS | |
| 31 | Chest Pain | FAERS: 66 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 32 | Anticoagulation drug level below therapeutic | FAERS: 63 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 33 | Product substitution issue | FAERS: 63 Canada Vigilance: 28 | Canada Vigilance US FAERS | |
| 34 | Back Pain | FAERS: 62 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 35 | Prothrombin time abnormal | FAERS: 61 | OFFSIDES US FAERS | |
| 36 | Arthralgia | FAERS: 60 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 37 | Myocardial Infarction | FAERS: 60 Canada Vigilance: 5 | CTD Canada Vigilance US FAERS | |
| 38 | Ecchymosis | FAERS: 56 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 39 | Urinary tract infection | FAERS: 56 | US FAERS | |
| 40 | Acute kidney injury | FAERS: 55 | CTD US FAERS | |
| 41 | Respiratory Failure | FAERS: 52 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Syncope | FAERS: 51 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 43 | Skin Ulcer | FAERS: 50 | US FAERS | |
| 44 | Weight decreased | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Blood urine present | FAERS: 46 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 46 | Incorrect dose administered | FAERS: 45 | US FAERS | |
| 47 | Sepsis | FAERS: 44 | US FAERS | |
| 48 | Constipation | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Product quality issue | FAERS: 42 | US FAERS | |
| 50 | Mental status changes | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Cardiac Arrest | FAERS: 39 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 52 | Blue Toe Syndrome | FAERS: 37 Canada Vigilance: 1 | 6021781 9487280 15389900 | CTD SIDER Canada Vigilance US FAERS |
| 53 | Drug dose omission | FAERS: 37 | US FAERS | |
| 54 | Urticaria | FAERS: 37 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 55 | Erythema | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Drug toxicity | FAERS: 34 | OFFSIDES US FAERS | |
| 57 | Hemiparesis | FAERS: 34 | US FAERS | |
| 58 | Swelling | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 59 | Therapeutic response unexpected with drug substitution | FAERS: 34 | US FAERS | |
| 60 | Unresponsive to stimuli | FAERS: 34 | US FAERS | |
| 61 | Peripheral swelling | FAERS: 32 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 62 | Atrial thrombosis | FAERS: 31 | US FAERS | |
| 63 | Therapy cessation | FAERS: 31 | US FAERS | |
| 64 | Feeling abnormal | FAERS: 29 | SIDER US FAERS | |
| 65 | Gastritis | FAERS: 29 | US FAERS | |
| 66 | Thrombocytopenia | FAERS: 29 Canada Vigilance: 2 | CTD Canada Vigilance US FAERS | |
| 67 | Abdominal discomfort | FAERS: 28 Canada Vigilance: 6 | Canada Vigilance OFFSIDES US FAERS | |
| 68 | Chromaturia | FAERS: 28 | US FAERS | |
| 69 | Infection | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 70 | Tachycardia | FAERS: 28 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 71 | Gastric ulcer | FAERS: 27 | OFFSIDES US FAERS | |
| 72 | Maternal exposure during pregnancy | FAERS: 27 | US FAERS | |
| 73 | Aphasia | FAERS: 26 | US FAERS | |
| 74 | Blood creatinine increased | FAERS: 26 | OFFSIDES US FAERS | |
| 75 | Myalgia | FAERS: 26 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 76 | Nasopharyngitis | FAERS: 26 | US FAERS | |
| 77 | treatment failure | FAERS: 26 | US FAERS | |
| 78 | Diverticulum | FAERS: 24 | OFFSIDES US FAERS | |
| 79 | Duodenal Ulcer | FAERS: 24 | US FAERS | |
| 80 | Feeling Cold | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Lethargy | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 82 | Occult blood positive | FAERS: 24 | US FAERS | |
| 83 | Pericardial effusion | FAERS: 24 | CTD US FAERS | |
| 84 | Flatulence | FAERS: 23 | SIDER US FAERS | |
| 85 | Somnolence | FAERS: 23 | US FAERS | |
| 86 | Cardiac Tamponade | FAERS: 22 | 8299624 8339459 18615373 | CTD OFFSIDES US FAERS |
| 87 | Embolism | FAERS: 22 Canada Vigilance: 1 | 3605140 17020434 | CTD Canada Vigilance US FAERS |
| 88 | Cyanosis | FAERS: 21 | 9382401 | CTD US FAERS |
| 89 | Dysgeusia | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 90 | Necrosis | FAERS: 21 Canada Vigilance: 1 | CTD Canada Vigilance US FAERS | |
| 91 | Prothrombin level decreased | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 92 | Respiratory distress | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 93 | Blindness | FAERS: 20 | 12923003 | CTD US FAERS |
| 94 | Dysarthria | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Laceration | FAERS: 20 | US FAERS | |
| 96 | Cellulitis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 97 | Chills | FAERS: 19 | SIDER US FAERS | |
| 98 | Depressed Level of Consciousness | FAERS: 19 | US FAERS | |
| 99 | Drug resistance | FAERS: 19 | US FAERS | |
| 100 | Leukocytosis | FAERS: 19 | US FAERS | |
| 101 | Limb injury | FAERS: 19 | US FAERS | |
| 102 | Vertigo | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 103 | Accidental overdose | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 104 | Drug dispensing error | FAERS: 18 | US FAERS | |
| 105 | Embolic stroke | FAERS: 18 | OFFSIDES US FAERS | |
| 106 | Hydrocephalus | FAERS: 18 | US FAERS | |
| 107 | Pulmonary thrombosis | FAERS: 18 | OFFSIDES US FAERS | |
| 108 | Visual Impairment | FAERS: 18 | US FAERS | |
| 109 | Circumstance or information capable of leading to medication error | FAERS: 17 | US FAERS | |
| 110 | Dry skin | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 111 | Pallor | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 112 | Septic Shock | FAERS: 17 | US FAERS | |
| 113 | General physical health deterioration | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 114 | Hypophagia | FAERS: 16 | OFFSIDES US FAERS | |
| 115 | Osteoporosis | FAERS: 16 | US FAERS | |
| 116 | Palpitations | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 117 | Diverticulitis | FAERS: 15 | OFFSIDES US FAERS | |
| 118 | Drug exposure during pregnancy | FAERS: 15 | US FAERS | |
| 119 | Joint swelling | FAERS: 15 | US FAERS | |
| 120 | Post procedural complication | FAERS: 15 | US FAERS | |
| 121 | Tremor | FAERS: 15 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 122 | Anxiety | FAERS: 14 | OFFSIDES US FAERS | |
| 123 | Arthritis | FAERS: 14 | US FAERS | |
| 124 | Cataract | FAERS: 14 | US FAERS | |
| 125 | Cerebral Infarction | FAERS: 14 | US FAERS | |
| 126 | Drug abuse | FAERS: 14 | US FAERS | |
| 127 | Hemiplegia | FAERS: 14 | US FAERS | |
| 128 | Menorrhagia | FAERS: 14 | US FAERS | |
| 129 | Prothrombin time ratio increased | FAERS: 14 | US FAERS | |
| 130 | Amnesia | FAERS: 13 | US FAERS | |
| 131 | Arthropathy | FAERS: 13 | US FAERS | |
| 132 | Chest discomfort | FAERS: 13 | US FAERS | |
| 133 | Dehydration | FAERS: 13 | OFFSIDES US FAERS | |
| 134 | Disorientation | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 135 | Hypoxia | FAERS: 13 | US FAERS | |
| 136 | Sinusitis | FAERS: 13 | OFFSIDES US FAERS | |
| 137 | Ulcer | FAERS: 13 | 2594605 | CTD SIDER US FAERS |
| 138 | Urinary Retention | FAERS: 13 | US FAERS | |
| 139 | Acute respiratory failure | FAERS: 12 | OFFSIDES US FAERS | |
| 140 | Bradycardia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 141 | Skin lesion | FAERS: 12 | OFFSIDES US FAERS | |
| 142 | Unevaluable event | FAERS: 12 | US FAERS | |
| 143 | Acute myocardial infarction | FAERS: 11 | US FAERS | |
| 144 | Blood glucose increased | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 145 | Brain Death | FAERS: 11 | OFFSIDES US FAERS | |
| 146 | Drug level increased | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 147 | Intestinal Obstruction | FAERS: 11 | OFFSIDES US FAERS | |
| 148 | Mallory-Weiss Syndrome | FAERS: 11 | US FAERS | |
| 149 | Memory impairment | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 150 | Musculoskeletal Pain | FAERS: 11 | OFFSIDES US FAERS | |
| 151 | Prothrombin time ratio abnormal | FAERS: 11 | US FAERS | |
| 152 | Suicide attempt | FAERS: 11 | US FAERS | |
| 153 | Tinnitus | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Wrong technique in product usage process | FAERS: 11 | US FAERS | |
| 155 | jaundice | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 156 | nervous system disorder | FAERS: 11 | SIDER US FAERS | |
| 157 | Blood glucose decreased | FAERS: 10 | US FAERS | |
| 158 | Bronchitis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 159 | Cystitis | FAERS: 10 | US FAERS | |
| 160 | Dyspepsia | FAERS: 10 | US FAERS | |
| 161 | Gangrene | FAERS: 10 Canada Vigilance: 1 | CTD OFFSIDES Canada Vigilance US FAERS | |
| 162 | Increased tendency to bruise | FAERS: 10 | US FAERS | |
| 163 | Joint injury | FAERS: 10 | US FAERS | |
| 164 | Nephrolithiasis | FAERS: 10 | US FAERS | |
| 165 | Drug prescribing error | FAERS: 9 | US FAERS | |
| 166 | Incorrect product storage | FAERS: 9 | US FAERS | |
| 167 | Product use in unapproved indication | FAERS: 9 | US FAERS | |
| 168 | Proteinuria | FAERS: 9 | US FAERS | |
| 169 | Prothrombin level abnormal | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 170 | Therapy change | FAERS: 9 | US FAERS | |
| 171 | Wrong technique in drug usage process | FAERS: 9 | US FAERS | |
| 172 | Burning sensation | FAERS: 8 | US FAERS | |
| 173 | Clostridium difficile infection | FAERS: 8 | US FAERS | |
| 174 | Coma scale abnormal | FAERS: 8 | US FAERS | |
| 175 | Diabetes Mellitus | FAERS: 8 | US FAERS | |
| 176 | Encephalomalacia | FAERS: 8 | US FAERS | |
| 177 | Flank Pain | FAERS: 8 | OFFSIDES US FAERS | |
| 178 | Intracranial Aneurysm | FAERS: 8 | US FAERS | |
| 179 | Metabolic acidosis | FAERS: 8 | US FAERS | |
| 180 | Petechiae | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 181 | Troponin increased | FAERS: 8 | US FAERS | |
| 182 | Tumour haemorrhage | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 183 | Urinary Incontinence | FAERS: 8 | US FAERS | |
| 184 | Vascular calcification | FAERS: 8 | CTD US FAERS | |
| 185 | Ageusia | FAERS: 7 | US FAERS | |
| 186 | Agitation | FAERS: 7 | US FAERS | |
| 187 | Anorexia | FAERS: 7 | OFFSIDES US FAERS | |
| 188 | Blood urea increased | FAERS: 7 | US FAERS | |
| 189 | Carpal Tunnel Syndrome | FAERS: 7 | 2911095 9061524 | CTD US FAERS |
| 190 | Colitis | FAERS: 7 | 25231984 | CTD OFFSIDES US FAERS |
| 191 | Deafness Neurosensory | FAERS: 7 | OFFSIDES US FAERS | |
| 192 | Dermatitis | FAERS: 7 Canada Vigilance: 1 | 1830603 | CTD SIDER Canada Vigilance US FAERS |
| 193 | Drug administration error | FAERS: 7 | US FAERS | |
| 194 | Dysuria | FAERS: 7 | US FAERS | |
| 195 | Extra dose administered | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 196 | Gastrointestinal arteriovenous malformation | FAERS: 7 | US FAERS | |
| 197 | Inflammation | FAERS: 7 | US FAERS | |
| 198 | Irritable Bowel Syndrome | FAERS: 7 | US FAERS | |
| 199 | Lower respiratory tract infection | FAERS: 7 | US FAERS | |
| 200 | Macular degeneration | FAERS: 7 | US FAERS | |
| 201 | Metrorrhagia | FAERS: 7 | US FAERS | |
| 202 | Monoparesis | FAERS: 7 | US FAERS | |
| 203 | Musculoskeletal stiffness | FAERS: 7 | OFFSIDES US FAERS | |
| 204 | Neck Pain | FAERS: 7 | US FAERS | |
| 205 | Neurological decompensation | FAERS: 7 | US FAERS | |
| 206 | Product use issue | FAERS: 7 | US FAERS | |
| 207 | Purpura | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 208 | Upper airway obstruction | FAERS: 7 | US FAERS | |
| 209 | Acidosis | FAERS: 6 | US FAERS | |
| 210 | Aneurysm | FAERS: 6 | OFFSIDES US FAERS | |
| 211 | Antiphospholipid Syndrome | FAERS: 6 | 11776303 20597268 | CTD US FAERS |
| 212 | Bone density decreased | FAERS: 6 | US FAERS | |
| 213 | Calcinosis | FAERS: 6 | CTD US FAERS | |
| 214 | Cardiomegaly | FAERS: 6 | US FAERS | |
| 215 | Coronary Artery Disease | FAERS: 6 | 758516 | CTD US FAERS |
| 216 | Device occlusion | FAERS: 6 | US FAERS | |
| 217 | Disseminated Intravascular Coagulation | FAERS: 6 Canada Vigilance: 2 | 1147462 | CTD OFFSIDES Canada Vigilance US FAERS |
| 218 | Ejection Fraction Decreased | FAERS: 6 | US FAERS | |
| 219 | Exposure via body fluid | FAERS: 6 | US FAERS | |
| 220 | Gastrointestinal erosion | FAERS: 6 | US FAERS | |
| 221 | Gout | FAERS: 6 | OFFSIDES US FAERS | |
| 222 | Helicobacter test positive | FAERS: 6 | US FAERS | |
| 223 | Inappropriate schedule of drug administration | FAERS: 6 | US FAERS | |
| 224 | MYELODYSPLASTIC SYNDROME | FAERS: 6 | US FAERS | |
| 225 | Macule | FAERS: 6 | US FAERS | |
| 226 | No adverse effect | FAERS: 6 | US FAERS | |
| 227 | No adverse event | FAERS: 6 | US FAERS | |
| 228 | Therapeutic response unexpected | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 229 | Tooth Extraction | FAERS: 6 | OFFSIDES US FAERS | |
| 230 | Wheezing | FAERS: 6 | US FAERS | |
| 231 | Wrong drug administered | FAERS: 6 | US FAERS | |
| 232 | Abasia | FAERS: 5 | OFFSIDES US FAERS | |
| 233 | Abscess | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 234 | Alanine Aminotransferase Increased | FAERS: 5 | US FAERS | |
| 235 | Altered state of consciousness | FAERS: 5 | US FAERS | |
| 236 | Aspartate Aminotransferase Increased | FAERS: 5 | US FAERS | |
| 237 | Atrial Flutter | FAERS: 5 | US FAERS | |
| 238 | Back disorder | FAERS: 5 | US FAERS | |
| 239 | Bedridden | FAERS: 5 | US FAERS | |
| 240 | Blood blister | FAERS: 5 | US FAERS | |
| 241 | Blood iron decreased | FAERS: 5 | US FAERS | |
| 242 | Blood lactate dehydrogenase increased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 243 | Blood potassium decreased | FAERS: 5 | OFFSIDES US FAERS | |
| 244 | Blood pressure fluctuation | FAERS: 5 | US FAERS | |
| 245 | Blood sodium decreased | FAERS: 5 | US FAERS | |
| 246 | Cardiac valve replacement complication | FAERS: 5 | US FAERS | |
| 247 | Cerebral Thrombosis | FAERS: 5 | US FAERS | |
| 248 | Cerebral disorder | FAERS: 5 | US FAERS | |
| 249 | Coagulation test abnormal | FAERS: 5 | US FAERS | |
| 250 | Deafness | FAERS: 5 | US FAERS | |
| 251 | Dementia | FAERS: 5 | US FAERS | |
| 252 | Device malfunction | FAERS: 5 | US FAERS | |
| 253 | Disability | FAERS: 5 | US FAERS | |
| 254 | Drug level below therapeutic | FAERS: 5 | US FAERS | |
| 255 | Duodenitis | FAERS: 5 | OFFSIDES US FAERS | |
| 256 | Endocarditis | FAERS: 5 | US FAERS | |
| 257 | Erectile dysfunction | FAERS: 5 | US FAERS | |
| 258 | Erosive Duodenitis | FAERS: 5 | US FAERS | |
| 259 | Eye pain | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 260 | Flushing | FAERS: 5 | US FAERS | |
| 261 | Heparin-induced thrombocytopenia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 262 | Hernia | FAERS: 5 | US FAERS | |
| 263 | Hip surgery | FAERS: 5 | US FAERS | |
| 264 | Hypocoagulable state | FAERS: 5 | US FAERS | |
| 265 | Intracranial Hypotension | FAERS: 5 | US FAERS | |
| 266 | Malabsorption | FAERS: 5 | US FAERS | |
| 267 | Nervousness | FAERS: 5 | US FAERS | |
| 268 | Oral pain | FAERS: 5 | US FAERS | |
| 269 | Oropharyngeal pain | FAERS: 5 | OFFSIDES US FAERS | |
| 270 | Peritonitis | FAERS: 5 | US FAERS | |
| 271 | Phlebitis | FAERS: 5 Canada Vigilance: 2 | 4338821 | CTD Canada Vigilance US FAERS |
| 272 | Presyncope | FAERS: 5 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 273 | Product physical issue | FAERS: 5 | US FAERS | |
| 274 | Productive Cough | FAERS: 5 | US FAERS | |
| 275 | Pyelonephritis | FAERS: 5 | US FAERS | |
| 276 | Rash erythematous | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 277 | Respiratory arrest | FAERS: 5 | US FAERS | |
| 278 | Sexual Dysfunction | FAERS: 5 | US FAERS | |
| 279 | Tooth Loss | FAERS: 5 | OFFSIDES US FAERS | |
| 280 | Transcription medication error | FAERS: 5 | US FAERS | |
| 281 | Urine output increased | FAERS: 5 | US FAERS | |
| 282 | Visual disturbance | FAERS: 5 | US FAERS | |
| 283 | Abdominal tenderness | FAERS: 4 | US FAERS | |
| 284 | Abnormal clotting factor | FAERS: 4 | US FAERS | |
| 285 | Accidental exposure to product | FAERS: 4 | US FAERS | |
| 286 | Amputation | FAERS: 4 | US FAERS | |
| 287 | Angiodysplasia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 288 | Ankle Fracture | FAERS: 4 | US FAERS | |
| 289 | Arterial Injury | FAERS: 4 | US FAERS | |
| 290 | Arteriosclerosis | FAERS: 4 | US FAERS | |
| 291 | Ascites | FAERS: 4 | OFFSIDES US FAERS | |
| 292 | Blood albumin decreased | FAERS: 4 | US FAERS | |
| 293 | Blood cholesterol increased | FAERS: 4 | US FAERS | |
| 294 | Blood homocysteine increased | FAERS: 4 | US FAERS | |
| 295 | Cardiac Flutter | FAERS: 4 | US FAERS | |
| 296 | Cholelithiasis | FAERS: 4 | US FAERS | |
| 297 | Cold sweat | FAERS: 4 | US FAERS | |
| 298 | Delirium | FAERS: 4 | US FAERS | |
| 299 | Device related infection | FAERS: 4 | OFFSIDES US FAERS | |
| 300 | Disease Progression | FAERS: 4 | US FAERS | |
| 301 | Disease recurrence | FAERS: 4 | US FAERS | |
| 302 | Drug dispensed to wrong patient | FAERS: 4 | US FAERS | |
| 303 | Drug level changed | FAERS: 4 | US FAERS | |
| 304 | Dry gangrene | FAERS: 4 | US FAERS | |
| 305 | Dysphonia | FAERS: 4 | OFFSIDES US FAERS | |
| 306 | Ejection fraction abnormal | FAERS: 4 | US FAERS | |
| 307 | Epigastric discomfort | FAERS: 4 | US FAERS | |
| 308 | Fluid overload | FAERS: 4 | OFFSIDES US FAERS | |
| 309 | Full blood count decreased | FAERS: 4 | US FAERS | |
| 310 | Gamma-Glutamyltransferase Increased | FAERS: 4 | US FAERS | |
| 311 | Ileus | FAERS: 4 | US FAERS | |
| 312 | Iron deficiency | FAERS: 4 | US FAERS | |
| 313 | Oliguria | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 314 | Pain of skin | FAERS: 4 | OFFSIDES US FAERS | |
| 315 | Pancreatic carcinoma | FAERS: 4 | US FAERS | |
| 316 | Paraplegia | FAERS: 4 | US FAERS | |
| 317 | Peripheral embolism | FAERS: 4 | US FAERS | |
| 318 | Portal Vein Thrombosis | FAERS: 4 | OFFSIDES US FAERS | |
| 319 | Product label issue | FAERS: 4 | US FAERS | |
| 320 | Product solubility abnormal | FAERS: 4 | US FAERS | |
| 321 | Product storage error | FAERS: 4 | US FAERS | |
| 322 | Quadriplegia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 323 | Renal tubular necrosis | FAERS: 4 | US FAERS | |
| 324 | Skin reaction | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 325 | Splenomegaly | FAERS: 4 | US FAERS | |
| 326 | Stillbirth | FAERS: 4 | US FAERS | |
| 327 | Stress | FAERS: 4 | US FAERS | |
| 328 | Temperature intolerance | FAERS: 4 | SIDER US FAERS | |
| 329 | Thrombosis in device | FAERS: 4 | OFFSIDES US FAERS | |
| 330 | Vascular occlusion | FAERS: 4 | US FAERS | |
| 331 | Ventricular Fibrillation | FAERS: 4 | US FAERS | |
| 332 | Vitamin K Deficiency | FAERS: 4 | US FAERS | |
| 333 | Wound Infection | FAERS: 4 | OFFSIDES US FAERS | |
| 334 | Abdominal Compartment Syndrome | FAERS: 3 | US FAERS | |
| 335 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 336 | Acute Coronary Syndrome | FAERS: 3 | US FAERS | |
| 337 | Anaphylactic shock | FAERS: 3 | SIDER US FAERS | |
| 338 | Angina Pectoris | FAERS: 3 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 339 | Anuria | FAERS: 3 | US FAERS | |
| 340 | Aortic Aneurysm | FAERS: 3 | US FAERS | |
| 341 | Arterial thrombosis | FAERS: 3 | US FAERS | |
| 342 | Ataxia | FAERS: 3 | US FAERS | |
| 343 | Blood count abnormal | FAERS: 3 | US FAERS | |
| 344 | Blood iron abnormal | FAERS: 3 | US FAERS | |
| 345 | Blood potassium increased | FAERS: 3 | OFFSIDES US FAERS | |
| 346 | Blood thyroid stimulating hormone decreased | FAERS: 3 | US FAERS | |
| 347 | Breast necrosis | FAERS: 3 | US FAERS | |
| 348 | Cardiac ablation | FAERS: 3 | US FAERS | |
| 349 | Carotid artery occlusion | FAERS: 3 | US FAERS | |
| 350 | Cataract operation | FAERS: 3 | OFFSIDES US FAERS | |
| 351 | Contraindicated product administered | FAERS: 3 | US FAERS | |
| 352 | Dieulafoy's vascular malformation | FAERS: 3 | US FAERS | |
| 353 | Discomfort | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 354 | Drug level decreased | FAERS: 3 | US FAERS | |
| 355 | Emotional distress | FAERS: 3 | OFFSIDES US FAERS | |
| 356 | Eschar | FAERS: 3 | US FAERS | |
| 357 | Escherichia urinary tract infection | FAERS: 3 | US FAERS | |
| 358 | Exophthalmos | FAERS: 3 | US FAERS | |
| 359 | Exposure during breast feeding | FAERS: 3 | US FAERS | |
| 360 | Extremity necrosis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 361 | Fat necrosis | FAERS: 3 | US FAERS | |
| 362 | Fracture | FAERS: 3 | US FAERS | |
| 363 | Hepatitis | FAERS: 3 | 7836716 12243603 | CTD SIDER US FAERS |
| 364 | Hydronephrosis | FAERS: 3 | US FAERS | |
| 365 | Hypertensive emergency | FAERS: 3 | US FAERS | |
| 366 | Hypotrichosis | FAERS: 3 | US FAERS | |
| 367 | Idiopathic Pulmonary Fibrosis | FAERS: 3 | US FAERS | |
| 368 | Influenza | FAERS: 3 | US FAERS | |
| 369 | Injection Site Reaction | FAERS: 3 | US FAERS | |
| 370 | Laboratory test interference | FAERS: 3 | OFFSIDES US FAERS | |
| 371 | Lactose Intolerance | FAERS: 3 | US FAERS | |
| 372 | Limb discomfort | FAERS: 3 | US FAERS | |
| 373 | Live Birth | FAERS: 3 | US FAERS | |
| 374 | Livedo Reticularis | FAERS: 3 | 8507086 18280355 | CTD US FAERS |
| 375 | Loss of personal independence in daily activities | FAERS: 3 | US FAERS | |
| 376 | Low birth weight baby | FAERS: 3 | US FAERS | |
| 377 | Malignant neoplasm progression | FAERS: 3 | US FAERS | |
| 378 | Malnutrition | FAERS: 3 | US FAERS | |
| 379 | Medical device implantation | FAERS: 3 | US FAERS | |
| 380 | Mood swings | FAERS: 3 | US FAERS | |
| 381 | Multi-organ disorder | FAERS: 3 | OFFSIDES US FAERS | |
| 382 | Muscle Cramp | FAERS: 3 | US FAERS | |
| 383 | Muscle Rigidity | FAERS: 3 | US FAERS | |
| 384 | Musculoskeletal chest pain | FAERS: 3 | US FAERS | |
| 385 | Musculoskeletal discomfort | FAERS: 3 | OFFSIDES US FAERS | |
| 386 | Obesity | FAERS: 3 | US FAERS | |
| 387 | Peptic Ulcer | FAERS: 3 | US FAERS | |
| 388 | Pneumonitis | FAERS: 3 | US FAERS | |
| 389 | Polyhydramnios | FAERS: 3 | US FAERS | |
| 390 | Portal hypertensive gastropathy | FAERS: 3 | US FAERS | |
| 391 | Procedural complication | FAERS: 3 | US FAERS | |
| 392 | Procedural site reaction | FAERS: 3 | US FAERS | |
| 393 | Protein C decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 394 | Protein S Deficiency | FAERS: 3 | US FAERS | |
| 395 | Pulmonary Hypertension | FAERS: 3 | OFFSIDES US FAERS | |
| 396 | Quadriparesis | FAERS: 3 | US FAERS | |
| 397 | Reaction to drug excipients | FAERS: 3 | US FAERS | |
| 398 | Rectal polyp | FAERS: 3 | US FAERS | |
| 399 | Refusal of treatment by relative | FAERS: 3 | US FAERS | |
| 400 | Respiratory Depression | FAERS: 3 | US FAERS | |
| 401 | Retinal vascular thrombosis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 402 | Ruptured cerebral aneurysm | FAERS: 3 | US FAERS | |
| 403 | Sneezing | FAERS: 3 | US FAERS | |
| 404 | Soft tissue necrosis | FAERS: 3 | US FAERS | |
| 405 | Splenic Infarction | FAERS: 3 | OFFSIDES US FAERS | |
| 406 | Splenic Rupture | FAERS: 3 | US FAERS | |
| 407 | Sudden death | FAERS: 3 | US FAERS | |
| 408 | Superficial siderosis of central nervous system | FAERS: 3 | US FAERS | |
| 409 | Tooth Infection | FAERS: 3 | OFFSIDES US FAERS | |
| 410 | Urinary sediment present | FAERS: 3 | US FAERS | |
| 411 | Vascular rupture | FAERS: 3 | US FAERS | |
| 412 | Vascular stent thrombosis | FAERS: 3 | US FAERS | |
| 413 | Vasculitis | FAERS: 3 Canada Vigilance: 1 | 9487280 20337814 | CTD SIDER Canada Vigilance US FAERS |
| 414 | Ventricular hypokinesia | FAERS: 3 | US FAERS | |
| 415 | cancer surgery | FAERS: 3 | US FAERS | |
| 416 | liposarcoma | FAERS: 3 | US FAERS | |
| 417 | Accidental exposure | FAERS: 2 | US FAERS | |
| 418 | Activated partial thromboplastin time abnormal | FAERS: 2 | US FAERS | |
| 419 | Acute tonsillitis | FAERS: 2 | US FAERS | |
| 420 | Adenocarcinoma | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 421 | Amyloidosis | FAERS: 2 | US FAERS | |
| 422 | Angioedema | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 423 | Anorectal discomfort | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 424 | Anosmia | FAERS: 2 | US FAERS | |
| 425 | Antiphospholipid Antibodies | FAERS: 2 | US FAERS | |
| 426 | Arthropod bite | FAERS: 2 | US FAERS | |
| 427 | Asthma | FAERS: 2 | OFFSIDES US FAERS | |
| 428 | Atrial tachycardia | FAERS: 2 | US FAERS | |
| 429 | Benign Prostatic Hyperplasia | FAERS: 2 | OFFSIDES US FAERS | |
| 430 | Biopsy kidney abnormal | FAERS: 2 | US FAERS | |
| 431 | Bladder Neoplasm | FAERS: 2 | US FAERS | |
| 432 | Blood alcohol increased | FAERS: 2 | US FAERS | |
| 433 | Blood creatinine abnormal | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 434 | Blood fibrinogen decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 435 | Blood folate increased | FAERS: 2 | US FAERS | |
| 436 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 437 | Blood phosphorus increased | FAERS: 2 | US FAERS | |
| 438 | Blood testosterone decreased | FAERS: 2 | US FAERS | |
| 439 | Blood thyroid stimulating hormone abnormal | FAERS: 2 | US FAERS | |
| 440 | Blood urea nitrogen/creatinine ratio increased | FAERS: 2 | US FAERS | |
| 441 | Bone pain | FAERS: 2 | US FAERS | |
| 442 | Brachydactyly | FAERS: 2 | US FAERS | |
| 443 | Brain scan abnormal | FAERS: 2 | US FAERS | |
| 444 | Breast Feeding | FAERS: 2 | US FAERS | |
| 445 | Bronchospasm | FAERS: 2 | US FAERS | |
| 446 | Cardiac Death | FAERS: 2 | US FAERS | |
| 447 | Catheter related complication | FAERS: 2 | US FAERS | |
| 448 | Cerebral vasoconstriction | FAERS: 2 | US FAERS | |
| 449 | Cholangitis | FAERS: 2 | US FAERS | |
| 450 | Cholecystitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 451 | Cholestasis | FAERS: 2 | 3753126 | CTD US FAERS |
| 452 | Clostridium difficile colitis | FAERS: 2 | US FAERS | |
| 453 | Coagulation factor V level abnormal | FAERS: 2 | US FAERS | |
| 454 | Coagulation time abnormal | FAERS: 2 | US FAERS | |
| 455 | Coagulation time shortened | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 456 | Colon adenoma | FAERS: 2 | US FAERS | |
| 457 | Compression fracture | FAERS: 2 | OFFSIDES US FAERS | |
| 458 | Congenital hearing disorder | FAERS: 2 | US FAERS | |
| 459 | Congenital osteodystrophy | FAERS: 2 | US FAERS | |
| 460 | Congenital tracheomalacia | FAERS: 2 | US FAERS | |
| 461 | Contraindicated drug administered | FAERS: 2 | US FAERS | |
| 462 | Cyst | FAERS: 2 | OFFSIDES US FAERS | |
| 463 | Dandy-Walker Syndrome | FAERS: 2 | 4082063 | CTD US FAERS |
| 464 | Dental caries | FAERS: 2 | US FAERS | |
| 465 | Dental cleaning | FAERS: 2 | US FAERS | |
| 466 | Diabetes Insipidus | FAERS: 2 | US FAERS | |
| 467 | Diabetes mellitus inadequate control | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 468 | Dialysis related complication | FAERS: 2 | US FAERS | |
| 469 | Drug level above therapeutic | FAERS: 2 | US FAERS | |
| 470 | Drug level fluctuating | FAERS: 2 | OFFSIDES US FAERS | |
| 471 | Drug-disease interaction | FAERS: 2 | US FAERS | |
| 472 | Ear congestion | FAERS: 2 | OFFSIDES US FAERS | |
| 473 | Emotional disorder | FAERS: 2 | US FAERS | |
| 474 | Endodontic procedure | FAERS: 2 | OFFSIDES US FAERS | |
| 475 | Eosinophilia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 476 | Erysipelas | FAERS: 2 | US FAERS | |
| 477 | Expired drug administered | FAERS: 2 | US FAERS | |
| 478 | Expired product administered | FAERS: 2 | US FAERS | |
| 479 | Exposure via father | FAERS: 2 | US FAERS | |
| 480 | Facial paralysis | FAERS: 2 | US FAERS | |
| 481 | Factor V Leiden mutation | FAERS: 2 | US FAERS | |
| 482 | Feeling jittery | FAERS: 2 | US FAERS | |
| 483 | Fibrin D dimer increased | FAERS: 2 | US FAERS | |
| 484 | Food Allergy | FAERS: 2 | US FAERS | |
| 485 | Fracture treatment | FAERS: 2 | US FAERS | |
| 486 | Gastrointestinal angiodysplasia | FAERS: 2 | US FAERS | |
| 487 | Gastrointestinal motility disorder | FAERS: 2 | US FAERS | |
| 488 | Gastrointestinal ulcer | FAERS: 2 | US FAERS | |
| 489 | Glaucoma | FAERS: 2 | US FAERS | |
| 490 | Glomerular Filtration Rate | FAERS: 2 | US FAERS | |
| 491 | Graft thrombosis | FAERS: 2 | US FAERS | |
| 492 | Hepatic Vein Thrombosis | FAERS: 2 | US FAERS | |
| 493 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 494 | Herbal interaction | FAERS: 2 | US FAERS | |
| 495 | High frequency ablation | FAERS: 2 | US FAERS | |
| 496 | Hunger | FAERS: 2 | US FAERS | |
| 497 | Hypersomnia | FAERS: 2 | US FAERS | |
| 498 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 499 | Hypervitaminosis D | FAERS: 2 | US FAERS | |
| 500 | Hypothyroidism | FAERS: 2 | US FAERS | |
| 501 | Incontinence | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 502 | Incorrect product administration duration | FAERS: 2 | US FAERS | |
| 503 | Incorrect storage of drug | FAERS: 2 | US FAERS | |
| 504 | Injection site bruising | FAERS: 2 | US FAERS | |
| 505 | Intestinal infarction | FAERS: 2 | US FAERS | |
| 506 | Laryngitis | FAERS: 2 | US FAERS | |
| 507 | Lentigo | FAERS: 2 | US FAERS | |
| 508 | Leukocytoclastic vasculitis | FAERS: 2 | US FAERS | |
| 509 | Limb operation | FAERS: 2 | US FAERS | |
| 510 | Lip swelling | FAERS: 2 | US FAERS | |
| 511 | Liver scan abnormal | FAERS: 2 | US FAERS | |
| 512 | Lymphadenopathy | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 513 | Medical device complication | FAERS: 2 | US FAERS | |
| 514 | Meningitis | FAERS: 2 | US FAERS | |
| 515 | Meningomyelocele | FAERS: 2 | US FAERS | |
| 516 | Mental impairment | FAERS: 2 | US FAERS | |
| 517 | Metastasis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 518 | Myopathy | FAERS: 2 | US FAERS | |
| 519 | Nerve Root Compression | FAERS: 2 | US FAERS | |
| 520 | Nerve injury | FAERS: 2 | US FAERS | |
| 521 | Neuralgia | FAERS: 2 | OFFSIDES US FAERS | |
| 522 | Neutropenia | FAERS: 2 | US FAERS | |
| 523 | Night sweats | FAERS: 2 | US FAERS | |
| 524 | Obstruction | FAERS: 2 | US FAERS | |
| 525 | Orthostatic intolerance | FAERS: 2 | US FAERS | |
| 526 | Palmar erythema | FAERS: 2 | US FAERS | |
| 527 | Pancreatic cyst rupture | FAERS: 2 | US FAERS | |
| 528 | Pancreatic enzymes increased | FAERS: 2 | US FAERS | |
| 529 | Pancytopenia | FAERS: 2 | US FAERS | |
| 530 | Patent ductus arteriosus | FAERS: 2 | US FAERS | |
| 531 | Penile necrosis | FAERS: 2 | US FAERS | |
| 532 | Peripheral arterial occlusive disease | FAERS: 2 | US FAERS | |
| 533 | Peripheral venous disease | FAERS: 2 | US FAERS | |
| 534 | Photophobia | FAERS: 2 | US FAERS | |
| 535 | Pleuritic pain | FAERS: 2 | US FAERS | |
| 536 | Pneumothorax | FAERS: 2 | US FAERS | |
| 537 | Poisoning | FAERS: 2 | US FAERS | |
| 538 | Polyuria | FAERS: 2 | US FAERS | |
| 539 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 540 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 541 | Poverty of speech | FAERS: 2 | US FAERS | |
| 542 | Proctitis | FAERS: 2 | US FAERS | |
| 543 | Product counterfeit | FAERS: 2 | US FAERS | |
| 544 | Product packaging confusion | FAERS: 2 | US FAERS | |
| 545 | Product prescribing issue | FAERS: 2 | US FAERS | |
| 546 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 547 | Protein C Deficiency | FAERS: 2 | 18376272 | CTD US FAERS |
| 548 | Protein total decreased | FAERS: 2 | US FAERS | |
| 549 | Psoriasis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 550 | Pulmonary congestion | FAERS: 2 | OFFSIDES US FAERS | |
| 551 | Quality of life decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 552 | Radiation proctitis | FAERS: 2 | US FAERS | |
| 553 | Renal cancer metastatic | FAERS: 2 | US FAERS | |
| 554 | Retching | FAERS: 2 | US FAERS | |
| 555 | Retinal Artery Occlusion | FAERS: 2 | US FAERS | |
| 556 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 557 | Rhabdomyolysis | FAERS: 2 | 10620105 12243603 | CTD US FAERS |
| 558 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 559 | Rosacea | FAERS: 2 | US FAERS | |
| 560 | Scab | FAERS: 2 | US FAERS | |
| 561 | Seroma | FAERS: 2 | US FAERS | |
| 562 | Shock | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 563 | Skin laceration | FAERS: 2 | US FAERS | |
| 564 | Sopor | FAERS: 2 | US FAERS | |
| 565 | Spinal column stenosis | FAERS: 2 | OFFSIDES US FAERS | |
| 566 | Squamous cell carcinoma of lung | FAERS: 2 | US FAERS | |
| 567 | Sudden Cardiac Death | FAERS: 2 | US FAERS | |
| 568 | Suprapubic pain | FAERS: 2 | US FAERS | |
| 569 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 570 | Suspected counterfeit product | FAERS: 2 | US FAERS | |
| 571 | Talipes | FAERS: 2 | US FAERS | |
| 572 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 573 | Thirst | FAERS: 2 | US FAERS | |
| 574 | Thrombotic stroke | FAERS: 2 | US FAERS | |
| 575 | Tongue movement disturbance | FAERS: 2 | US FAERS | |
| 576 | Transfusion-Related Acute Lung Injury | FAERS: 2 | US FAERS | |
| 577 | Trismus | FAERS: 2 | US FAERS | |
| 578 | Urethritis noninfective | FAERS: 2 | US FAERS | |
| 579 | Vascular pseudoaneurysm ruptured | FAERS: 2 | US FAERS | |
| 580 | Vasculitic rash | FAERS: 2 | US FAERS | |
| 581 | Vena cava filter insertion | FAERS: 2 | US FAERS | |
| 582 | Vitamin B6 increased | FAERS: 2 | US FAERS | |
| 583 | Vitamin D Deficiency | FAERS: 2 | US FAERS | |
| 584 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 585 | Vulvovaginal burning sensation | FAERS: 2 | US FAERS | |
| 586 | Wound necrosis | FAERS: 2 | US FAERS | |
| 587 | ATRIAL ENLARGEMENT | FAERS: 1 | US FAERS | |
| 588 | Abdominal mass | FAERS: 1 | US FAERS | |
| 589 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 590 | Abdominal wall infection | FAERS: 1 | OFFSIDES US FAERS | |
| 591 | Acne | FAERS: 1 | OFFSIDES US FAERS | |
| 592 | Acquired phimosis | FAERS: 1 | US FAERS | |
| 593 | Acquired von Willebrand's disease | FAERS: 1 | US FAERS | |
| 594 | Adrenalectomy | FAERS: 1 | US FAERS | |
| 595 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 596 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 597 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 598 | Alcohol problem | FAERS: 1 | US FAERS | |
| 599 | Alcohol withdrawal syndrome | FAERS: 1 | US FAERS | |
| 600 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 601 | Alveolitis | FAERS: 1 | US FAERS | |
| 602 | Anal Fissure | FAERS: 1 | US FAERS | |
| 603 | Anal abscess | FAERS: 1 | US FAERS | |
| 604 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 605 | Anger | FAERS: 1 | US FAERS | |
| 606 | Angiodermatitis | FAERS: 1 | US FAERS | |
| 607 | Ankylosing spondylitis | FAERS: 1 | US FAERS | |
| 608 | Anorectal ulcer | FAERS: 1 | US FAERS | |
| 609 | Anticoagulation drug level abnormal | FAERS: 1 | US FAERS | |
| 610 | Anticoagulation drug level increased | FAERS: 1 | US FAERS | |
| 611 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 612 | Aphonia | FAERS: 1 | US FAERS | |
| 613 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 614 | Apparent death | FAERS: 1 | US FAERS | |
| 615 | Arterial bypass operation | FAERS: 1 | US FAERS | |
| 616 | Arteriovenous graft thrombosis | FAERS: 1 | US FAERS | |
| 617 | Arthropod sting | FAERS: 1 | US FAERS | |
| 618 | Atelectasis | FAERS: 1 | US FAERS | |
| 619 | Atrophic vulvovaginitis | FAERS: 1 | US FAERS | |
| 620 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 621 | Axillary vein thrombosis | FAERS: 1 | US FAERS | |
| 622 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 623 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 624 | Basal ganglia stroke | FAERS: 1 | US FAERS | |
| 625 | Basilar artery thrombosis | FAERS: 1 | US FAERS | |
| 626 | Bile Duct Stenosis | FAERS: 1 | OFFSIDES US FAERS | |
| 627 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 628 | Binge Drinking | FAERS: 1 | US FAERS | |
| 629 | Biopsy site unspecified abnormal | FAERS: 1 | US FAERS | |
| 630 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 631 | Bladder Diverticulum | FAERS: 1 | US FAERS | |
| 632 | Bladder cyst | FAERS: 1 | US FAERS | |
| 633 | Bladder pain | FAERS: 1 | US FAERS | |
| 634 | Bladder spasm | FAERS: 1 | US FAERS | |
| 635 | Bleeding time shortened | FAERS: 1 | US FAERS | |
| 636 | Blood acid phosphatase abnormal | FAERS: 1 | US FAERS | |
| 637 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 638 | Blood arsenic increased | FAERS: 1 | US FAERS | |
| 639 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 640 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 641 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 642 | Blood parathyroid hormone decreased | FAERS: 1 | US FAERS | |
| 643 | Blood parathyroid hormone increased | FAERS: 1 | US FAERS | |
| 644 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 645 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 646 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 647 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 648 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 649 | Blood viscosity abnormal | FAERS: 1 | US FAERS | |
| 650 | Blood viscosity decreased | FAERS: 1 | US FAERS | |
| 651 | Bone density abnormal | FAERS: 1 | US FAERS | |
| 652 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 653 | Brachiocephalic vein thrombosis | FAERS: 1 | US FAERS | |
| 654 | Brain Contusion | FAERS: 1 | US FAERS | |
| 655 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 656 | Breath alcohol test positive | FAERS: 1 | US FAERS | |
| 657 | Breech Presentation | FAERS: 1 | US FAERS | |
| 658 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 659 | Bunion | FAERS: 1 | US FAERS | |
| 660 | Bursitis | FAERS: 1 | US FAERS | |
| 661 | CT hypotension complex | FAERS: 1 | US FAERS | |
| 662 | Cachexia | FAERS: 1 | US FAERS | |
| 663 | Candidiasis | FAERS: 1 | US FAERS | |
| 664 | Cardiac herniation | FAERS: 1 | US FAERS | |
| 665 | Cardiac infection | FAERS: 1 | US FAERS | |
| 666 | Cardiac valve vegetation | FAERS: 1 | US FAERS | |
| 667 | Cardiac ventricular disorder | FAERS: 1 | US FAERS | |
| 668 | Catheter placement | FAERS: 1 | US FAERS | |
| 669 | Cauda Equina Syndrome | FAERS: 1 | US FAERS | |
| 670 | Cerebral Amyloid Angiopathy | FAERS: 1 | US FAERS | |
| 671 | Cerebral calcification | FAERS: 1 | US FAERS | |
| 672 | Cerebral microhaemorrhage | FAERS: 1 | US FAERS | |
| 673 | Cerebral ventricle dilatation | FAERS: 1 | US FAERS | |
| 674 | Cervical cord compression | FAERS: 1 | US FAERS | |
| 675 | Cheilitis | FAERS: 1 | US FAERS | |
| 676 | Choanal Atresia | FAERS: 1 | US FAERS | |
| 677 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 678 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 679 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 680 | Chronic pigmented purpura | FAERS: 1 | US FAERS | |
| 681 | Clostridium test positive | FAERS: 1 | US FAERS | |
| 682 | Clubbing | FAERS: 1 | US FAERS | |
| 683 | Coagulation factor VII level decreased | FAERS: 1 | US FAERS | |
| 684 | Coagulation factor VIII level increased | FAERS: 1 | US FAERS | |
| 685 | Collateral Circulation | FAERS: 1 | US FAERS | |
| 686 | Colonoscopy abnormal | FAERS: 1 | US FAERS | |
| 687 | Congenital pulmonary hypertension | FAERS: 1 | US FAERS | |
| 688 | Congenital skin dimples | FAERS: 1 | US FAERS | |
| 689 | Conjunctival pallor | FAERS: 1 | US FAERS | |
| 690 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 691 | Corneal Opacity | FAERS: 1 | US FAERS | |
| 692 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 693 | Craniotomy | FAERS: 1 | OFFSIDES US FAERS | |
| 694 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 695 | Crying | FAERS: 1 | US FAERS | |
| 696 | Cyanopsia | FAERS: 1 | US FAERS | |
| 697 | Device Failure | FAERS: 1 | US FAERS | |
| 698 | Device related thrombosis | FAERS: 1 | US FAERS | |
| 699 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 700 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 701 | Diplopia | FAERS: 1 | OFFSIDES US FAERS | |
| 702 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 703 | Documented hypersensitivity to administered product | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 704 | Drug Dependence | FAERS: 1 | US FAERS | |
| 705 | Drug screen negative | FAERS: 1 | US FAERS | |
| 706 | Drug withdrawal syndrome | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 707 | Dural tear | FAERS: 1 | US FAERS | |
| 708 | Dysentery | FAERS: 1 | US FAERS | |
| 709 | Dysphasia | FAERS: 1 | US FAERS | |
| 710 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 711 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 712 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 713 | Empyema | FAERS: 1 | US FAERS | |
| 714 | Endotracheal intubation complication | FAERS: 1 | US FAERS | |
| 715 | Enterococcus test positive | FAERS: 1 | US FAERS | |
| 716 | Epidermal necrosis | FAERS: 1 | US FAERS | |
| 717 | Eructation | FAERS: 1 | US FAERS | |
| 718 | Escherichia infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 719 | Excoriation | FAERS: 1 | US FAERS | |
| 720 | Extravasation | FAERS: 1 | US FAERS | |
| 721 | Eye Infection | FAERS: 1 | US FAERS | |
| 722 | Eye Redness | FAERS: 1 | US FAERS | |
| 723 | Eye ulcer | FAERS: 1 | US FAERS | |
| 724 | Eyelid infection | FAERS: 1 | US FAERS | |
| 725 | Facial Pain | FAERS: 1 | US FAERS | |
| 726 | Facial Paresis | FAERS: 1 | US FAERS | |
| 727 | Factor V deficiency | FAERS: 1 | US FAERS | |
| 728 | Feeding tube complication | FAERS: 1 | US FAERS | |
| 729 | Fibrin D dimer decreased | FAERS: 1 | US FAERS | |
| 730 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 731 | Floppy iris syndrome | FAERS: 1 | US FAERS | |
| 732 | Folliculitis | FAERS: 1 | US FAERS | |
| 733 | Food Poisoning | FAERS: 1 | US FAERS | |
| 734 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 735 | Gait inability | FAERS: 1 | US FAERS | |
| 736 | Gastrectomy | FAERS: 1 | US FAERS | |
| 737 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 738 | Gastric mucosa erythema | FAERS: 1 | US FAERS | |
| 739 | Gastroenteritis helicobacter | FAERS: 1 | US FAERS | |
| 740 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 741 | Gastrointestinal angiodysplasia haemorrhagic | FAERS: 1 | US FAERS | |
| 742 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 743 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 744 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 745 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 746 | Gastrointestinal stoma complication | FAERS: 1 | US FAERS | |
| 747 | Gastrointestinal vascular malformation | FAERS: 1 | US FAERS | |
| 748 | Gastrostomy | FAERS: 1 | US FAERS | |
| 749 | Gene Mutation | FAERS: 1 | US FAERS | |
| 750 | General symptom | FAERS: 1 | US FAERS | |
| 751 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 752 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 753 | Graft infection | FAERS: 1 | US FAERS | |
| 754 | Growth retardation | FAERS: 1 | US FAERS | |
| 755 | Haematinuria | FAERS: 1 | US FAERS | |
| 756 | Head discomfort | FAERS: 1 | US FAERS | |
| 757 | Heart valve calcification | FAERS: 1 | US FAERS | |
| 758 | Heart valve stenosis | FAERS: 1 | US FAERS | |
| 759 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 760 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 761 | Hordeolum | FAERS: 1 | US FAERS | |
| 762 | Hydranencephaly | FAERS: 1 | US FAERS | |
| 763 | Hyperdynamic left ventricle | FAERS: 1 | US FAERS | |
| 764 | Hyperplasia | FAERS: 1 | US FAERS | |
| 765 | Hyperreflexia | FAERS: 1 | US FAERS | |
| 766 | Hypertrophy | FAERS: 1 | US FAERS | |
| 767 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 768 | Hypoperfusion | FAERS: 1 | US FAERS | |
| 769 | Hypoplastic nasal cartilage | FAERS: 1 | US FAERS | |
| 770 | Hysterectomy | FAERS: 1 | OFFSIDES US FAERS | |
| 771 | Hysteroscopy | FAERS: 1 | US FAERS | |
| 772 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 773 | Impaired gastric emptying | FAERS: 1 | OFFSIDES US FAERS | |
| 774 | Implant site reaction | FAERS: 1 | US FAERS | |
| 775 | Implantable defibrillator insertion | FAERS: 1 | OFFSIDES US FAERS | |
| 776 | Inability to crawl | FAERS: 1 | US FAERS | |
| 777 | Incarcerated hernia | FAERS: 1 | US FAERS | |
| 778 | Incarcerated inguinal hernia | FAERS: 1 | US FAERS | |
| 779 | Incision site infection | FAERS: 1 | US FAERS | |
| 780 | Incision site ulcer | FAERS: 1 | US FAERS | |
| 781 | Incoherent | FAERS: 1 | US FAERS | |
| 782 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 783 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 784 | Increased insulin requirement | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 785 | Increased upper airway secretion | FAERS: 1 | OFFSIDES US FAERS | |
| 786 | Infusion site pain | FAERS: 1 | US FAERS | |
| 787 | Injury associated with device | FAERS: 1 | US FAERS | |
| 788 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 789 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 790 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 791 | Intercepted wrong patient selected | FAERS: 1 | US FAERS | |
| 792 | Intervertebral Disc Degeneration | FAERS: 1 | OFFSIDES US FAERS | |
| 793 | Intestinal gangrene | FAERS: 1 | US FAERS | |
| 794 | Intestinal polyp haemorrhage | FAERS: 1 | US FAERS | |
| 795 | Intestinal transplant | FAERS: 1 | US FAERS | |
| 796 | Intussusception | FAERS: 1 | US FAERS | |
| 797 | Investigation noncompliance | FAERS: 1 | US FAERS | |
| 798 | Irregular breathing | FAERS: 1 | US FAERS | |
| 799 | Jejunal ulcer | FAERS: 1 | US FAERS | |
| 800 | Joint Range of Motion Decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 801 | Latent Tuberculosis | FAERS: 1 | US FAERS | |
| 802 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 803 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 804 | Lid sulcus deepened | FAERS: 1 | US FAERS | |
| 805 | Lipodystrophy acquired | FAERS: 1 | US FAERS | |
| 806 | Liver Abscess | FAERS: 1 | US FAERS | |
| 807 | Lividity | FAERS: 1 | US FAERS | |
| 808 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 809 | Lung Abscess | FAERS: 1 | US FAERS | |
| 810 | Lymphoma | FAERS: 1 | US FAERS | |
| 811 | Macrocephaly | FAERS: 1 | US FAERS | |
| 812 | Markedly reduced dietary intake | FAERS: 1 | US FAERS | |
| 813 | Mastectomy | FAERS: 1 | OFFSIDES US FAERS | |
| 814 | Mastoiditis | FAERS: 1 | US FAERS | |
| 815 | Maternal exposure during breast feeding | FAERS: 1 | US FAERS | |
| 816 | Meningioma | FAERS: 1 | US FAERS | |
| 817 | Meniscus injury | FAERS: 1 | US FAERS | |
| 818 | Mental Retardation | FAERS: 1 | US FAERS | |
| 819 | Mouth Breathing | FAERS: 1 | US FAERS | |
| 820 | Multiple Myeloma | FAERS: 1 | 25102945 | CTD US FAERS |
| 821 | Multiple allergies | FAERS: 1 | US FAERS | |
| 822 | Muscle strain | FAERS: 1 | US FAERS | |
| 823 | Mydriasis | FAERS: 1 | US FAERS | |
| 824 | Neonatal respiratory distress | FAERS: 1 | US FAERS | |
| 825 | Neonatal respiratory failure | FAERS: 1 | US FAERS | |
| 826 | Nephritis | FAERS: 1 | US FAERS | |
| 827 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 828 | Neuropathy | FAERS: 1 | US FAERS | |
| 829 | Nocturia | FAERS: 1 | US FAERS | |
| 830 | Nonspecific reaction | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 831 | Normal delivery | FAERS: 1 | US FAERS | |
| 832 | Oncologic complication | FAERS: 1 | US FAERS | |
| 833 | Open wound | FAERS: 1 | OFFSIDES US FAERS | |
| 834 | Ophthalmic vein thrombosis | FAERS: 1 | US FAERS | |
| 835 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 836 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 837 | Oral infection | FAERS: 1 | US FAERS | |
| 838 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 839 | Osteocalcin decreased | FAERS: 1 | US FAERS | |
| 840 | Osteolysis | FAERS: 1 | US FAERS | |
| 841 | Osteomyelitis | FAERS: 1 | OFFSIDES US FAERS | |
| 842 | Osteopenia | FAERS: 1 | OFFSIDES US FAERS | |
| 843 | Overweight | FAERS: 1 | US FAERS | |
| 844 | PROTHROMBIN TIME | FAERS: 1 | OFFSIDES US FAERS | |
| 845 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 846 | Pancreatitis | FAERS: 1 | SIDER US FAERS | |
| 847 | Panniculitis | FAERS: 1 | US FAERS | |
| 848 | Paranoia | FAERS: 1 | US FAERS | |
| 849 | Parotitis | FAERS: 1 | US FAERS | |
| 850 | Pectus excavatum | FAERS: 1 | US FAERS | |
| 851 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 852 | Pericarditis | FAERS: 1 | 4036989 | CTD US FAERS |
| 853 | Perineal pain | FAERS: 1 | US FAERS | |
| 854 | Periodontal destruction | FAERS: 1 | US FAERS | |
| 855 | Periodontitis | FAERS: 1 | OFFSIDES US FAERS | |
| 856 | Peripheral artery stenosis | FAERS: 1 | US FAERS | |
| 857 | Peripheral artery thrombosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 858 | Peritonsillar Abscess | FAERS: 1 | US FAERS | |
| 859 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 860 | Phrenic nerve paralysis | FAERS: 1 | US FAERS | |
| 861 | Plasma cell myeloma recurrent | FAERS: 1 | US FAERS | |
| 862 | Platelet function test abnormal | FAERS: 1 | US FAERS | |
| 863 | Pleurisy | FAERS: 1 | US FAERS | |
| 864 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 865 | Pneumocephalus | FAERS: 1 | US FAERS | |
| 866 | Polyarthritis | FAERS: 1 | US FAERS | |
| 867 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 868 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 869 | Post procedural bile leak | FAERS: 1 | US FAERS | |
| 870 | Post procedural discomfort | FAERS: 1 | US FAERS | |
| 871 | Post procedural infection | FAERS: 1 | US FAERS | |
| 872 | Post procedural pulmonary embolism | FAERS: 1 | US FAERS | |
| 873 | Postoperative respiratory failure | FAERS: 1 | US FAERS | |
| 874 | Postoperative thrombosis | FAERS: 1 | US FAERS | |
| 875 | Postrenal failure | FAERS: 1 | US FAERS | |
| 876 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 877 | Pregnancy with contraceptive device | FAERS: 1 | US FAERS | |
| 878 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 879 | Product commingling | FAERS: 1 | US FAERS | |
| 880 | Product container seal issue | FAERS: 1 | US FAERS | |
| 881 | Product dispensing error | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 882 | Product dosage form confusion | FAERS: 1 | US FAERS | |
| 883 | Product dose omission | FAERS: 1 | US FAERS | |
| 884 | Product formulation issue | FAERS: 1 | US FAERS | |
| 885 | Product lot number issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 886 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 887 | Product monitoring error | FAERS: 1 | US FAERS | |
| 888 | Product packaging issue | FAERS: 1 | US FAERS | |
| 889 | Propionibacterium infection | FAERS: 1 | US FAERS | |
| 890 | Prosthetic cardiac valve thrombosis | FAERS: 1 | US FAERS | |
| 891 | Protein S abnormal | FAERS: 1 | US FAERS | |
| 892 | Protein S decreased | FAERS: 1 | US FAERS | |
| 893 | Protein S increased | FAERS: 1 | US FAERS | |
| 894 | Proteus test positive | FAERS: 1 | US FAERS | |
| 895 | Prothrombin time ratio decreased | FAERS: 1 | US FAERS | |
| 896 | Psoas sign | FAERS: 1 | US FAERS | |
| 897 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 898 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 899 | Pyoderma | FAERS: 1 | US FAERS | |
| 900 | Pyogenic granuloma | FAERS: 1 | US FAERS | |
| 901 | Radiculopathy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 902 | Rash scaly | FAERS: 1 | US FAERS | |
| 903 | Rectal abscess | FAERS: 1 | US FAERS | |
| 904 | Regurgitation | FAERS: 1 | US FAERS | |
| 905 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 906 | Renal cyst | FAERS: 1 | OFFSIDES US FAERS | |
| 907 | Renal tubular atrophy | FAERS: 1 | US FAERS | |
| 908 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 909 | Restless Legs Syndrome | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 910 | Reticulocyte count increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 911 | Retroperitoneal lymphadenopathy | FAERS: 1 | OFFSIDES US FAERS | |
| 912 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 913 | Schizophrenia | FAERS: 1 | US FAERS | |
| 914 | Sciatica | FAERS: 1 | US FAERS | |
| 915 | Screaming | FAERS: 1 | US FAERS | |
| 916 | Secretion discharge | FAERS: 1 | US FAERS | |
| 917 | Sensorimotor disorder | FAERS: 1 | US FAERS | |
| 918 | Sight disability | FAERS: 1 | US FAERS | |
| 919 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 920 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 921 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 922 | Skin nodule | FAERS: 1 | US FAERS | |
| 923 | Slow speech | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 924 | Sluggishness | FAERS: 1 | US FAERS | |
| 925 | Small intestine carcinoma | FAERS: 1 | US FAERS | |
| 926 | Snoring | FAERS: 1 | US FAERS | |
| 927 | Somnambulism | FAERS: 1 | US FAERS | |
| 928 | Spermatozoa abnormal | FAERS: 1 | US FAERS | |
| 929 | Spinal column injury | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 930 | Spinal vascular disorder | FAERS: 1 | US FAERS | |
| 931 | Splenic vein occlusion | FAERS: 1 | US FAERS | |
| 932 | Spondylitis | FAERS: 1 | US FAERS | |
| 933 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 934 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 935 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 936 | Stenosis | FAERS: 1 | US FAERS | |
| 937 | Stenotrophomonas infection | FAERS: 1 | US FAERS | |
| 938 | Stent occlusion | FAERS: 1 | US FAERS | |
| 939 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 940 | Stomatitis | FAERS: 1 | US FAERS | |
| 941 | Streptococcus test positive | FAERS: 1 | US FAERS | |
| 942 | Stress ulcer | FAERS: 1 | US FAERS | |
| 943 | Stupor | FAERS: 1 | US FAERS | |
| 944 | Subgaleal haematoma | FAERS: 1 | US FAERS | |
| 945 | Sunburn | FAERS: 1 | US FAERS | |
| 946 | Superinfection bacterial | FAERS: 1 | US FAERS | |
| 947 | Superior Vena Cava Syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 948 | Suppressed lactation | FAERS: 1 | US FAERS | |
| 949 | Suture rupture | FAERS: 1 | US FAERS | |
| 950 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 951 | Thalamic infarction | FAERS: 1 | US FAERS | |
| 952 | Thecal sac compression | FAERS: 1 | US FAERS | |
| 953 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 954 | Therapeutic response changed | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 955 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 956 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 957 | Thoracostomy | FAERS: 1 | US FAERS | |
| 958 | Thoracotomy | FAERS: 1 | OFFSIDES US FAERS | |
| 959 | Throat irritation | FAERS: 1 | US FAERS | |
| 960 | Thrombectomy | FAERS: 1 | US FAERS | |
| 961 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 962 | Tooth Avulsion | FAERS: 1 | US FAERS | |
| 963 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 964 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 965 | Tracheostomy malfunction | FAERS: 1 | US FAERS | |
| 966 | Transaminases increased | FAERS: 1 | US FAERS | |
| 967 | Transfusion Reaction | FAERS: 1 | US FAERS | |
| 968 | Traumatic fracture | FAERS: 1 | US FAERS | |
| 969 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 970 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 971 | Troponin I increased | FAERS: 1 | US FAERS | |
| 972 | Tuberculosis | FAERS: 1 | US FAERS | |
| 973 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 974 | Ureterolithiasis | FAERS: 1 | US FAERS | |
| 975 | Urinary bladder polyp | FAERS: 1 | US FAERS | |
| 976 | Urinary tract infection enterococcal | FAERS: 1 | US FAERS | |
| 977 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 978 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 979 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 980 | Vein collapse | FAERS: 1 | US FAERS | |
| 981 | Vena cava injury | FAERS: 1 | US FAERS | |
| 982 | Venous Insufficiency | FAERS: 1 | US FAERS | |
| 983 | Venous Thrombosis | FAERS: 1 |
1252799
1830603 2911095 4025903 4714850 8358198 8374097 9382401 10073268 12221676 12680483 14723717 15608975 15733061 16313547 16680743 17549307 19513580 21797966 25712335 26219158 28867752 | CTD US FAERS |
| 984 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 985 | Vessel puncture site pain | FAERS: 1 | US FAERS | |
| 986 | Victim of homicide | FAERS: 1 | US FAERS | |
| 987 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 988 | Vitiligo | FAERS: 1 | US FAERS | |
| 989 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 990 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 991 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 992 | Weaning failure | FAERS: 1 | US FAERS | |
| 993 | Wheelchair user | FAERS: 1 | US FAERS | |
| 994 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 995 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 996 | Wound Complication | FAERS: 1 | US FAERS | |
| 997 | effusion | FAERS: 1 | OFFSIDES US FAERS | |
| 998 | furuncle | FAERS: 1 | US FAERS | |
| 999 | leiomyosarcoma | FAERS: 1 | US FAERS | |
| 1000 | muscle injury | FAERS: 1 | US FAERS | |
| 1001 | ovarian neoplasm | FAERS: 1 | US FAERS | |
| 1002 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 1003 | AIDS Dementia Complex | OFFSIDES | ||
| 1004 | Abdominal Cramps | SIDER | ||
| 1005 | Abdominal Infection | OFFSIDES | ||
| 1006 | Abdominal bloating | SIDER | ||
| 1007 | Abnormalities, Drug-Induced | CTD | ||
| 1008 | Acid reflux | OFFSIDES | ||
| 1009 | Actinomycosis | OFFSIDES | ||
| 1010 | Acute sinusitis | OFFSIDES | ||
| 1011 | Adrenal cortex necrosis | Canada Vigilance: 1 | Canada Vigilance | |
| 1012 | Alanine aminotransferase abnormal | OFFSIDES | ||
| 1013 | Alveoloplasty | OFFSIDES | ||
| 1014 | Amaurosis Fugax | 9890845 | CTD | |
| 1015 | Anemia, Hemolytic | 1147462 | CTD | |
| 1016 | Aneurysm, Dissecting | 14960440 | CTD | |
| 1017 | Aneurysm, Ruptured | 9457092 | CTD | |
| 1018 | Anhedonia | OFFSIDES | ||
| 1019 | Aortic Aneurysm, Thoracic | 14960440 | CTD | |
| 1020 | Appendicitis | OFFSIDES | ||
| 1021 | Arterial Occlusive Diseases | 3337969 | CTD | |
| 1022 | Arteriosclerosis Obliterans | OFFSIDES | ||
| 1023 | Arteriovenous fistula thrombosis | OFFSIDES | ||
| 1024 | Artificial crown procedure | OFFSIDES | ||
| 1025 | Aspartate aminotransferase abnormal | OFFSIDES | ||
| 1026 | Asphyxia | OFFSIDES | ||
| 1027 | Atrioventricular Block | OFFSIDES | ||
| 1028 | Biopsy bone abnormal | OFFSIDES | ||
| 1029 | Biopsy | OFFSIDES | ||
| 1030 | Blood Coagulation Disorders | CTD | ||
| 1031 | Blood Glucose | OFFSIDES | ||
| 1032 | Blood alkaline phosphatase abnormal | OFFSIDES | ||
| 1033 | Blood bicarbonate abnormal | OFFSIDES | ||
| 1034 | Blood electrolytes abnormal | OFFSIDES | ||
| 1035 | Blood lactate dehydrogenase abnormal | OFFSIDES | ||
| 1036 | Blood urea abnormal | OFFSIDES | ||
| 1037 | Blurred vision | OFFSIDES | ||
| 1038 | Bone Diseases, Developmental | 21839171 | CTD | |
| 1039 | Bone lesion | OFFSIDES | ||
| 1040 | Bone scan abnormal | OFFSIDES | ||
| 1041 | Bone swelling | OFFSIDES | ||
| 1042 | Brain Injuries | 25094061 | CTD | |
| 1043 | Brain Ischemia | 19762702 20212195 21030703 | CTD | |
| 1044 | Breast Diseases | 1147462 | CTD | |
| 1045 | Bullous eruption | SIDER | ||
| 1046 | Carcinoma, Transitional Cell | 11885838 | CTD | |
| 1047 | Cardiomyopathies | 10410811 | CTD | |
| 1048 | Carotid bruit | OFFSIDES | ||
| 1049 | Cartilage Diseases | 9286443 | CTD | |
| 1050 | Catheter related infection | OFFSIDES | ||
| 1051 | Caustic injury | OFFSIDES | ||
| 1052 | Central line infection | OFFSIDES | ||
| 1053 | Central nervous system lesion | OFFSIDES | ||
| 1054 | Cerebellar Diseases | 17124390 17290088 19864677 | CTD | |
| 1055 | Cerebral Hemorrhage |
920167
1723166 2256004 6635725 7770109 8098092 8172435 8211340 8308951 9017779 9890845 11061249 12574807 12830257 12948457 15111374 15452298 16306465 16322483 16415938 16858720 16865206 17030765 17124390 17290088 17657657 18173903 18396247 18772448 18824672 18852344 18852345 19039219 19139370 19286588 19319147 19342242 19513316 19762702 19859832 20085756 20203487 20212195 20431083 20514955 20635460 21127298 | CTD | |
| 1056 | Cerebral atrophy | OFFSIDES | ||
| 1057 | Cerebrovascular Disorders | 7644046 | CTD | |
| 1058 | Cervicobrachial syndrome | OFFSIDES | ||
| 1059 | Chemical and Drug Induced Liver Injury | 22331495 25499135 | CTD | |
| 1060 | Chemotherapeutic drug level increased | OFFSIDES | ||
| 1061 | Choking sensation | OFFSIDES | ||
| 1062 | Chondrodysplasia Punctata | CTD | ||
| 1063 | Choroid Hemorrhage | 12923003 | CTD | |
| 1064 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 1065 | Chronic gastritis | Canada Vigilance: 1 | Canada Vigilance | |
| 1066 | Cluster Headache | 15608975 | CTD | |
| 1067 | Coccidioidomycosis | OFFSIDES | ||
| 1068 | Cold intolerance | SIDER | ||
| 1069 | Compartment syndromes | CTD | ||
| 1070 | Concomitant disease aggravated | OFFSIDES | ||
| 1071 | Confabulation | OFFSIDES | ||
| 1072 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 1073 | Cor pulmonale | OFFSIDES | ||
| 1074 | Coronary Aneurysm | 18665415 | CTD | |
| 1075 | Coronary Restenosis | 12872399 17827517 | CTD | |
| 1076 | Coronary Thrombosis | CTD | ||
| 1077 | Coronary angioplasty | OFFSIDES | ||
| 1078 | Craniofacial Abnormalities | 7359739 17107801 20922410 | CTD | |
| 1079 | Cytokine storm | OFFSIDES | ||
| 1080 | Debridement | OFFSIDES | ||
| 1081 | Demyelination | OFFSIDES | ||
| 1082 | Dental Fistula | OFFSIDES | ||
| 1083 | Dental abscess | OFFSIDES | ||
| 1084 | Dental prosthesis user | OFFSIDES | ||
| 1085 | Dermatitis, Allergic Contact | 12680483 | CTD | |
| 1086 | Dermatomyositis | OFFSIDES | ||
| 1087 | Dextrocardia | 8025399 | CTD | |
| 1088 | Diverticulosis | OFFSIDES | ||
| 1089 | Drug Eruptions | CTD | ||
| 1090 | Drug Overdose | 16553037 | CTD | |
| 1091 | Drug specific antibody | Canada Vigilance: 1 | Canada Vigilance | |
| 1092 | Duodenal ulcer perforation | OFFSIDES | ||
| 1093 | Dyscalculia | OFFSIDES | ||
| 1094 | Dysgraphia | OFFSIDES | ||
| 1095 | Dysostoses | 9286443 | CTD | |
| 1096 | Ear discharge | OFFSIDES | ||
| 1097 | Embryo Loss | 25724286 | CTD | |
| 1098 | Enterococcal infection | OFFSIDES | ||
| 1099 | Enterocutaneous Fistula | OFFSIDES | ||
| 1100 | Eosinophilic myocarditis | OFFSIDES | ||
| 1101 | Esophageal Diseases | 2594605 | CTD | |
| 1102 | Exfoliative rash | Canada Vigilance: 1 | Canada Vigilance | |
| 1103 | Extravasation of Diagnostic and Therapeutic Materials | 18629579 | CTD | |
| 1104 | Extremity contracture | OFFSIDES | ||
| 1105 | Eyelids pruritus | OFFSIDES | ||
| 1106 | Facial Neuralgia | OFFSIDES | ||
| 1107 | Femoral Neuropathy | CTD | ||
| 1108 | Femoral artery occlusion | OFFSIDES | ||
| 1109 | Fetal Death | 25724286 | CTD | |
| 1110 | Fetal Diseases | CTD | ||
| 1111 | Fetal Growth Retardation | 15605910 | CTD | |
| 1112 | Fistula discharge | OFFSIDES | ||
| 1113 | Foreign body sensation in eyes | OFFSIDES | ||
| 1114 | Formication | OFFSIDES | ||
| 1115 | Gamma-glutamyltransferase abnormal | OFFSIDES | ||
| 1116 | Gastrointestinal Hemorrhage | CTD | ||
| 1117 | Gastrointestinal Pain | SIDER | ||
| 1118 | Gastrointestinal perforation | OFFSIDES | ||
| 1119 | Gaucher Disease | 12359135 | CTD | |
| 1120 | Gingival Hyperplasia | OFFSIDES | ||
| 1121 | Goiter | OFFSIDES | ||
| 1122 | Hearing Loss, Bilateral | 17107801 | CTD | |
| 1123 | Heart Diseases | 12407843 | CTD | |
| 1124 | Heart failure | 8161643 28347583 | CTD | |
| 1125 | Hematoma, Epidural, Spinal | 12131644 | CTD | |
| 1126 | Hematoma, Subdural, Acute | 12503044 | CTD | |
| 1127 | Hematoma, Subdural | CTD | ||
| 1128 | Hematoma |
1723166
3985451 4049235 6186784 6742561 6877563 8211340 8358198 8875729 9222930 15452298 16083035 17342281 17493413 18209921 18772448 19859832 20203487 20570795 20670592 | CTD | |
| 1129 | Hematuria |
1247776
1252799 3573184 3944305 4810770 5766081 7880236 8239258 8555895 10604355 11885838 12468482 12639164 16538970 16553520 20420818 | CTD | |
| 1130 | Hemorrhage |
920167
1273617 2029354 2057444 2256004 4085515 4464499 4721281 6137140 6409240 7146883 7351817 8280198 8311367 9457092 9890845 10386508 10647763 11144695 11319192 11352885 12586128 12830257 12882664 14644906 14961170 15130407 15276120 15464686 15801992 15817013 16265377 16415938 16553037 17419358 17493205 17639754 17679129 17885258 18033572 18198244 18209921 18388341 18429757 18629579 18852344 19357539 19575095 19577348 19817159 20350510 20597268 20599166 20837828 21692828 23117658 25001151 25094061 25325928 25521356 26445138 26502504 27581200 28689179 | CTD | |
| 1131 | Hemothorax | 18615373 | CTD OFFSIDES | |
| 1132 | Hypereosinophilic syndrome | 20169542 28347583 | CTD | |
| 1133 | Hyperglycemia | 27488359 | CTD | |
| 1134 | Hyperkeratosis | OFFSIDES | ||
| 1135 | Hyperpigmentation | OFFSIDES | ||
| 1136 | Hyperpyrexia | Canada Vigilance: 1 | Canada Vigilance | |
| 1137 | Hypertrophic Cardiomyopathy | OFFSIDES | ||
| 1138 | Hypoglycemia | 27488359 | CTD | |
| 1139 | Impetigo | OFFSIDES | ||
| 1140 | Infarction | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 1141 | Infected cyst | OFFSIDES | ||
| 1142 | Infusion site mobility decreased | OFFSIDES | ||
| 1143 | Intention tremor | OFFSIDES | ||
| 1144 | Intracranial Embolism and Thrombosis | 2396277 | CTD | |
| 1145 | Intracranial Thrombosis | 4714850 | CTD | |
| 1146 | Intubation | OFFSIDES | ||
| 1147 | Ischemia | 9382401 | CTD | |
| 1148 | Jaundice, Obstructive | 7465480 | CTD | |
| 1149 | Joint Instability | OFFSIDES | ||
| 1150 | Joint stiffness | OFFSIDES | ||
| 1151 | Kidney Diseases | CTD | ||
| 1152 | Kidney Failure | OFFSIDES | ||
| 1153 | Life expectancy shortened | OFFSIDES | ||
| 1154 | Loose tooth | OFFSIDES | ||
| 1155 | Lung consolidation | OFFSIDES | ||
| 1156 | Lung diseases | 920167 | CTD | |
| 1157 | Lymphocyte stimulation test positive | OFFSIDES | ||
| 1158 | Malignant tumour excision | OFFSIDES | ||
| 1159 | Median Neuropathy | 9222930 | CTD | |
| 1160 | Metastases to adrenals | OFFSIDES | ||
| 1161 | Migraine with Aura | 28960288 | CTD | |
| 1162 | Mitral Valve Stenosis | 2008847 23415960 | CTD | |
| 1163 | Mononeuritis | OFFSIDES | ||
| 1164 | Mucocutaneous Lymph Node Syndrome | 30121860 | CTD | |
| 1165 | Muscle tightness | OFFSIDES | ||
| 1166 | Myocardial Ischemia | 9457092 10410811 18665415 | CTD | |
| 1167 | Myomectomy | OFFSIDES | ||
| 1168 | Myositis | 11062950 | CTD | |
| 1169 | Neoplasm Invasiveness | 25231984 26206560 | CTD | |
| 1170 | Neoplasm Metastasis | 26206560 | CTD | |
| 1171 | Neoplasms, Experimental | 26206560 | CTD | |
| 1172 | Nephritis, Interstitial | 2500616 18380703 | CTD | |
| 1173 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 1174 | Neurologic Manifestations | 2544816 | CTD | |
| 1175 | Neutropenic colitis | OFFSIDES | ||
| 1176 | Nystagmus | OFFSIDES | ||
| 1177 | Optic Atrophy | 7359739 | CTD | |
| 1178 | Oral Cavity Fistula | OFFSIDES | ||
| 1179 | Osteosclerosis | OFFSIDES | ||
| 1180 | Papilledema | 4714850 | CTD | |
| 1181 | Paranasal sinus hypersecretion | OFFSIDES | ||
| 1182 | Paresthesia | 4049235 | CTD | |
| 1183 | Penile Diseases | 20808689 | CTD | |
| 1184 | Pericarditis, Constrictive | 4036989 | CTD | |
| 1185 | Physical disability | OFFSIDES | ||
| 1186 | Pityriasis Lichenoides et Varioliformis Acuta | OFFSIDES | ||
| 1187 | Plaque, Atherosclerotic | 7755771 | CTD | |
| 1188 | Postoperative Complications | 1723166 25894159 26583785 | CTD | |
| 1189 | Postoperative Hemorrhage | 16094036 17654609 18615373 | CTD | |
| 1190 | Prenatal Exposure Delayed Effects | CTD | ||
| 1191 | Prenatal Injuries | 21839171 25094061 25724286 | CTD | |
| 1192 | Priapism | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 1193 | Primary sequestrum | OFFSIDES | ||
| 1194 | Product administered to patient of inappropriate age | Canada Vigilance: 7 | Canada Vigilance | |
| 1195 | Pseudotumor Cerebri | 2089186 | CTD | |
| 1196 | Pulmonary Fibrosis | 26780485 | CTD | |
| 1197 | Pulmonary radiation injury | OFFSIDES | ||
| 1198 | Purulence | OFFSIDES | ||
| 1199 | Purulent discharge | OFFSIDES | ||
| 1200 | QRS axis abnormal | OFFSIDES | ||
| 1201 | Radial Neuropathy | 9222930 | CTD | |
| 1202 | Radiation skin injury | OFFSIDES | ||
| 1203 | Radiotherapy to brain | OFFSIDES | ||
| 1204 | Renal Artery Stenosis | OFFSIDES | ||
| 1205 | Renal Insufficiency | 9155634 | CTD | |
| 1206 | Retinal Hemorrhage | 12855977 | CTD | |
| 1207 | Retinal Vein Occlusion | 16508428 | CTD | |
| 1208 | Rhinitis | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 1209 | Rupture | 19292309 | CTD | |
| 1210 | Saliva altered | OFFSIDES | ||
| 1211 | Sciatic Neuropathy | 5011743 | CTD | |
| 1212 | Scleromalacia | OFFSIDES | ||
| 1213 | Secondary sequestrum | OFFSIDES | ||
| 1214 | Seizures | 65671 2057444 | CTD | |
| 1215 | Shock, Cardiogenic | 5090805 | CTD | |
| 1216 | Sick Sinus Syndrome | OFFSIDES | ||
| 1217 | Sinus Thrombosis, Intracranial | 12269725 18786290 | CTD | |
| 1218 | Sinus operation | OFFSIDES | ||
| 1219 | Situs Inversus | 8025399 | CTD | |
| 1220 | Skin Induration | OFFSIDES | ||
| 1221 | Skin hypertrophy | OFFSIDES | ||
| 1222 | Skin tightness | OFFSIDES | ||
| 1223 | Soft Tissue Injuries | OFFSIDES | ||
| 1224 | Soft tissue inflammation | OFFSIDES | ||
| 1225 | Spinal Cord Diseases | 9286443 | CTD | |
| 1226 | Spinal Cord Vascular Diseases | CTD | ||
| 1227 | Spinal Diseases | 9286443 | CTD | |
| 1228 | Spinal Stenosis | Canada Vigilance: 1 | Canada Vigilance | |
| 1229 | Spondylarthropathies | 8875729 | CTD | |
| 1230 | Subarachnoid Hemorrhage | 1886315 6170022 11566245 | CTD | |
| 1231 | Subcutaneous nodule | OFFSIDES | ||
| 1232 | Tendon Injuries | 19292309 | CTD | |
| 1233 | Teratogenesis | 25724286 | CTD | |
| 1234 | Thromboembolism |
1493394
2029354 7908358 8280198 8378946 10625032 11144695 12743448 14961170 15215815 15801992 16094036 16960144 17549307 18662264 18698879 18763667 18852344 21935704 25312789 | CTD | |
| 1235 | Thrombophilia | 2214444 17493413 | CTD | |
| 1236 | Thrombophlebitis | 23814193 | CTD | |
| 1237 | Thyroidectomy | OFFSIDES | ||
| 1238 | Tobacco interaction | Canada Vigilance: 1 | Canada Vigilance | |
| 1239 | Tooth repair | OFFSIDES | ||
| 1240 | Tracheitis | OFFSIDES | ||
| 1241 | Traumatic liver injury | SIDER | ||
| 1242 | Ultrasound scan abnormal | OFFSIDES | ||
| 1243 | Unresponsive to pain stimuli | OFFSIDES | ||
| 1244 | Ureteral Diseases | 16083035 | CTD | |
| 1245 | Urethral Stenosis | OFFSIDES | ||
| 1246 | Vascular Diseases | CTD | ||
| 1247 | Vascular insufficiency | OFFSIDES | ||
| 1248 | Vasculitis, Leukocytoclastic, Cutaneous | CTD | ||
| 1249 | Vasospasm | OFFSIDES | ||
| 1250 | Venous Thromboembolism | CTD | ||
| 1251 | Voice Disorders | 6742561 | CTD | |
| 1252 | Walking aid user | OFFSIDES | ||
| 1253 | Warfarin syndrome | 15605910 | CTD | |
| 1254 | kyphosis | 17107801 | CTD OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.