apixaban
(QNZCBYKSOIHPEH-UHFFFAOYSA-N)
Structure
- SMILES
- COc1ccc(cc1)n1nc(c2c1C(=O)N(CC2)c1ccc(cc1)N1CCCCC1=O)C(=O)N
- Type(s)
- Approved
- ATC code(s)
- B01AF02
- Molecular Formula:
- C25H25N5O4
- Molecular Weight:
- 459.497
- Log P:
- 3.5299
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 1
- TPSA:
- 110.76
- CAS Number(s):
- 503612-47-3
Synonym(s)
1.
apixaban
2.
BMS 562247
3.
BMS-562247
4.
BMS562247
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Cerebrovascular accident | FAERS: 1640 Canada Vigilance: 29 | Canada Vigilance US FAERS | |
| 2 | Adverse event | FAERS: 1495 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Dizziness | FAERS: 722 | SIDER US FAERS | |
| 4 | Thrombosis | FAERS: 719 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 5 | Epistaxis | FAERS: 648 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 6 | Atrial Fibrillation | FAERS: 615 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 7 | Deep Vein Thrombosis | FAERS: 604 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 8 | Pulmonary Embolism | FAERS: 598 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 9 | Headache | FAERS: 571 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Product use issue | FAERS: 538 | US FAERS | |
| 11 | Prescribed underdose | FAERS: 435 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 12 | Fatigue | FAERS: 429 | US FAERS | |
| 13 | Pruritus | FAERS: 420 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 14 | Arthralgia | FAERS: 402 | US FAERS | |
| 15 | Malaise | FAERS: 384 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Nausea | FAERS: 363 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 17 | Pain | FAERS: 351 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Cerebral Infarction | FAERS: 344 | US FAERS | |
| 19 | Pneumonia | FAERS: 328 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Drug dose omission | FAERS: 319 | US FAERS | |
| 21 | Peripheral swelling | FAERS: 319 | US FAERS | |
| 22 | Asthenia | FAERS: 312 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Drug ineffective | FAERS: 272 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Wrong technique in product usage process | FAERS: 256 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Product use in unapproved indication | FAERS: 252 | US FAERS | |
| 26 | Back Pain | FAERS: 243 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Arthropathy | FAERS: 235 | US FAERS | |
| 28 | Blood urine present | FAERS: 233 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 29 | Alopecia | FAERS: 226 | US FAERS | |
| 30 | Nasopharyngitis | FAERS: 223 | US FAERS | |
| 31 | Circumstance or information capable of leading to medication error | FAERS: 216 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 32 | Myocardial Infarction | FAERS: 206 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 33 | Weight decreased | FAERS: 187 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Incorrect dose administered | FAERS: 159 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 35 | Chest Pain | FAERS: 155 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Hypersensitivity | FAERS: 153 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 37 | Vomiting | FAERS: 144 | US FAERS | |
| 38 | Thrombocytopenia | FAERS: 140 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 39 | Myalgia | FAERS: 138 | US FAERS | |
| 40 | Embolic stroke | FAERS: 135 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 41 | Feeling abnormal | FAERS: 134 | US FAERS | |
| 42 | Syncope | FAERS: 130 | SIDER US FAERS | |
| 43 | Abdominal discomfort | FAERS: 120 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Urinary tract infection | FAERS: 119 | US FAERS | |
| 45 | Urticaria | FAERS: 119 | US FAERS | |
| 46 | Memory impairment | FAERS: 118 | US FAERS | |
| 47 | Swelling | FAERS: 117 | US FAERS | |
| 48 | Cataract | FAERS: 115 | US FAERS | |
| 49 | Atrial thrombosis | FAERS: 113 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 50 | Joint swelling | FAERS: 113 | US FAERS | |
| 51 | Laceration | FAERS: 108 | US FAERS | |
| 52 | Visual Impairment | FAERS: 106 | US FAERS | |
| 53 | Constipation | FAERS: 102 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Inappropriate schedule of drug administration | FAERS: 102 | US FAERS | |
| 55 | Acute kidney injury | FAERS: 100 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 56 | Hypotension | FAERS: 100 | SIDER US FAERS | |
| 57 | No adverse event | FAERS: 100 | US FAERS | |
| 58 | Arthritis | FAERS: 99 | US FAERS | |
| 59 | Sepsis | FAERS: 94 | US FAERS | |
| 60 | Anxiety | FAERS: 93 | US FAERS | |
| 61 | Prescribed overdose | FAERS: 90 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Abdominal Pain | FAERS: 87 | US FAERS | |
| 63 | Product storage error | FAERS: 86 | US FAERS | |
| 64 | Dementia | FAERS: 83 | US FAERS | |
| 65 | Chest discomfort | FAERS: 81 | US FAERS | |
| 66 | Overdose | FAERS: 81 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Drug dispensing error | FAERS: 78 | US FAERS | |
| 68 | Somnolence | FAERS: 77 | US FAERS | |
| 69 | Cardiac Tamponade | FAERS: 76 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Blood creatinine increased | FAERS: 75 | US FAERS | |
| 71 | Influenza | FAERS: 75 | US FAERS | |
| 72 | Accidental overdose | FAERS: 74 | OFFSIDES US FAERS | |
| 73 | Musculoskeletal Pain | FAERS: 74 | US FAERS | |
| 74 | Product dose omission | FAERS: 73 | US FAERS | |
| 75 | Chromaturia | FAERS: 70 | US FAERS | |
| 76 | Embolism | FAERS: 70 | US FAERS | |
| 77 | Infection | FAERS: 67 | US FAERS | |
| 78 | Limb injury | FAERS: 65 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 79 | Menorrhagia | FAERS: 65 | SIDER US FAERS | |
| 80 | Cardiac Arrest | FAERS: 62 | US FAERS | |
| 81 | Drug prescribing error | FAERS: 61 | US FAERS | |
| 82 | Tremor | FAERS: 61 | US FAERS | |
| 83 | Wrong technique in drug usage process | FAERS: 60 | OFFSIDES US FAERS | |
| 84 | Cardiac ablation | FAERS: 59 | US FAERS | |
| 85 | General physical health deterioration | FAERS: 59 | US FAERS | |
| 86 | Palpitations | FAERS: 59 | US FAERS | |
| 87 | Pericardial effusion | FAERS: 59 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 88 | treatment failure | FAERS: 59 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 89 | Intentional product use issue | FAERS: 58 | US FAERS | |
| 90 | Acute myocardial infarction | FAERS: 57 | US FAERS | |
| 91 | Dyspepsia | FAERS: 57 | US FAERS | |
| 92 | Erythema | FAERS: 57 | US FAERS | |
| 93 | Gastric ulcer | FAERS: 57 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 94 | Drug administration error | FAERS: 55 | US FAERS | |
| 95 | Medication Error | FAERS: 54 | US FAERS | |
| 96 | Dehydration | FAERS: 53 | US FAERS | |
| 97 | Nephrolithiasis | FAERS: 53 | US FAERS | |
| 98 | Blood glucose increased | FAERS: 52 | US FAERS | |
| 99 | Incorrect product storage | FAERS: 52 | US FAERS | |
| 100 | Infarction | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 101 | Wheezing | FAERS: 51 | US FAERS | |
| 102 | Petechiae | FAERS: 50 | SIDER US FAERS | |
| 103 | Feeling Cold | FAERS: 49 | US FAERS | |
| 104 | Tooth Extraction | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 105 | Amnesia | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 106 | Respiratory Failure | FAERS: 47 | US FAERS | |
| 107 | Tinnitus | FAERS: 45 | US FAERS | |
| 108 | Back disorder | FAERS: 44 | US FAERS | |
| 109 | Gastrostomy | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 110 | High frequency ablation | FAERS: 43 | US FAERS | |
| 111 | Intentional product misuse | FAERS: 43 | US FAERS | |
| 112 | Neck Pain | FAERS: 43 | US FAERS | |
| 113 | Vertigo | FAERS: 43 | US FAERS | |
| 114 | Burning sensation | FAERS: 42 | US FAERS | |
| 115 | Gout | FAERS: 42 | US FAERS | |
| 116 | Product quality issue | FAERS: 42 | US FAERS | |
| 117 | Hernia | FAERS: 41 | US FAERS | |
| 118 | Tachycardia | FAERS: 41 | US FAERS | |
| 119 | Blindness | FAERS: 40 | US FAERS | |
| 120 | Aphasia | FAERS: 39 | US FAERS | |
| 121 | Flatulence | FAERS: 39 | US FAERS | |
| 122 | Bronchitis | FAERS: 38 | US FAERS | |
| 123 | Cellulitis | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 124 | Dysgeusia | FAERS: 38 | US FAERS | |
| 125 | Macular degeneration | FAERS: 37 | US FAERS | |
| 126 | Chills | FAERS: 36 | US FAERS | |
| 127 | Diabetes Mellitus | FAERS: 36 | SIDER US FAERS | |
| 128 | Failure to suspend medication | FAERS: 36 | US FAERS | |
| 129 | Inappropriate schedule of product administration | FAERS: 36 | US FAERS | |
| 130 | Limb discomfort | FAERS: 35 | OFFSIDES US FAERS | |
| 131 | Musculoskeletal stiffness | FAERS: 35 | US FAERS | |
| 132 | Fracture | FAERS: 34 | US FAERS | |
| 133 | Hemiparesis | FAERS: 34 | OFFSIDES US FAERS | |
| 134 | Lethargy | FAERS: 34 | US FAERS | |
| 135 | Joint injury | FAERS: 33 | US FAERS | |
| 136 | Angioedema | FAERS: 32 | US FAERS | |
| 137 | Ecchymosis | FAERS: 32 | SIDER US FAERS | |
| 138 | Deafness | FAERS: 31 | US FAERS | |
| 139 | Skin laceration | FAERS: 31 | US FAERS | |
| 140 | Therapeutic response unexpected | FAERS: 31 | US FAERS | |
| 141 | Toothache | FAERS: 31 | US FAERS | |
| 142 | Gastritis | FAERS: 30 | US FAERS | |
| 143 | Inflammation | FAERS: 30 | US FAERS | |
| 144 | Maternal exposure during pregnancy | FAERS: 30 | US FAERS | |
| 145 | Oropharyngeal pain | FAERS: 30 | OFFSIDES US FAERS | |
| 146 | Sinusitis | FAERS: 30 | US FAERS | |
| 147 | Asthma | FAERS: 29 | US FAERS | |
| 148 | Dysarthria | FAERS: 29 | US FAERS | |
| 149 | Gait inability | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 150 | Acute Coronary Syndrome | FAERS: 28 | US FAERS | |
| 151 | Coronary Artery Disease | FAERS: 28 | US FAERS | |
| 152 | Product dispensing error | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 153 | Vasculitis | FAERS: 27 | US FAERS | |
| 154 | Lip swelling | FAERS: 26 | US FAERS | |
| 155 | Mental status changes | FAERS: 26 | OFFSIDES US FAERS | |
| 156 | Phlebitis | FAERS: 26 | US FAERS | |
| 157 | Pulmonary thrombosis | FAERS: 26 | US FAERS | |
| 158 | Septic Shock | FAERS: 26 | US FAERS | |
| 159 | Sudden death | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 160 | Aneurysm | FAERS: 25 | US FAERS | |
| 161 | Angina Pectoris | FAERS: 25 | US FAERS | |
| 162 | Nervousness | FAERS: 25 | US FAERS | |
| 163 | Venous Thrombosis | FAERS: 25 | US FAERS | |
| 164 | Discomfort | FAERS: 24 | US FAERS | |
| 165 | Duodenal Ulcer | FAERS: 24 | US FAERS | |
| 166 | Skin Ulcer | FAERS: 24 | US FAERS | |
| 167 | jaundice | FAERS: 24 | US FAERS | |
| 168 | Atrial Flutter | FAERS: 23 | US FAERS | |
| 169 | Bradycardia | FAERS: 23 | US FAERS | |
| 170 | Carpal Tunnel Syndrome | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 171 | Diverticulitis | FAERS: 23 | US FAERS | |
| 172 | Malignant neoplasm progression | FAERS: 23 | US FAERS | |
| 173 | Aortic Aneurysm | FAERS: 22 | US FAERS | |
| 174 | Cerebral Thrombosis | FAERS: 22 | US FAERS | |
| 175 | Increased tendency to bruise | FAERS: 22 | US FAERS | |
| 176 | Ulcer | FAERS: 22 | US FAERS | |
| 177 | Acute respiratory failure | FAERS: 21 | US FAERS | |
| 178 | Cardiac Flutter | FAERS: 21 | US FAERS | |
| 179 | Dysuria | FAERS: 21 | US FAERS | |
| 180 | Flushing | FAERS: 21 | US FAERS | |
| 181 | Hydrocephalus | FAERS: 21 | US FAERS | |
| 182 | Respiratory tract congestion | FAERS: 21 | US FAERS | |
| 183 | Disseminated Intravascular Coagulation | FAERS: 20 | US FAERS | |
| 184 | Hemiplegia | FAERS: 20 | US FAERS | |
| 185 | Hypertensive crisis | FAERS: 20 | US FAERS | |
| 186 | Pancreatic carcinoma | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 187 | Rheumatoid Arthritis | FAERS: 20 | US FAERS | |
| 188 | Skin necrosis | FAERS: 20 | US FAERS | |
| 189 | Sneezing | FAERS: 20 | US FAERS | |
| 190 | Urinary Incontinence | FAERS: 20 | US FAERS | |
| 191 | Agitation | FAERS: 19 | US FAERS | |
| 192 | Basal cell carcinoma | FAERS: 19 | US FAERS | |
| 193 | Cataract operation | FAERS: 19 | US FAERS | |
| 194 | Delirium | FAERS: 19 | US FAERS | |
| 195 | Drug level increased | FAERS: 19 | US FAERS | |
| 196 | Dysphonia | FAERS: 19 | US FAERS | |
| 197 | Product prescribing error | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 198 | Sciatica | FAERS: 19 | US FAERS | |
| 199 | Urinary Retention | FAERS: 19 | US FAERS | |
| 200 | Colitis | FAERS: 18 | US FAERS | |
| 201 | Epilepsy | FAERS: 18 | US FAERS | |
| 202 | Eructation | FAERS: 18 | US FAERS | |
| 203 | Ileus | FAERS: 18 | US FAERS | |
| 204 | Intestinal Obstruction | FAERS: 18 | US FAERS | |
| 205 | Occult blood positive | FAERS: 18 | SIDER US FAERS | |
| 206 | Suicide attempt | FAERS: 18 | US FAERS | |
| 207 | Abasia | FAERS: 17 | US FAERS | |
| 208 | Appendicitis | FAERS: 17 | US FAERS | |
| 209 | Bone pain | FAERS: 17 | US FAERS | |
| 210 | Cystitis | FAERS: 17 | US FAERS | |
| 211 | Depressed Level of Consciousness | FAERS: 17 | OFFSIDES US FAERS | |
| 212 | Diverticulum | FAERS: 17 | US FAERS | |
| 213 | Eye pain | FAERS: 17 | US FAERS | |
| 214 | Head discomfort | FAERS: 17 | US FAERS | |
| 215 | Lymphoma | FAERS: 17 | US FAERS | |
| 216 | Pancreatitis | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 217 | Peripheral venous disease | FAERS: 17 | US FAERS | |
| 218 | Antiphospholipid Syndrome | FAERS: 16 | US FAERS | |
| 219 | Bedridden | FAERS: 16 | US FAERS | |
| 220 | Cholelithiasis | FAERS: 16 | US FAERS | |
| 221 | Creatinine renal clearance decreased | FAERS: 16 | US FAERS | |
| 222 | Disability | FAERS: 16 | US FAERS | |
| 223 | Facial paralysis | FAERS: 16 | US FAERS | |
| 224 | Throat irritation | FAERS: 16 | US FAERS | |
| 225 | Tumour haemorrhage | FAERS: 16 | US FAERS | |
| 226 | Bladder Neoplasm | FAERS: 15 | US FAERS | |
| 227 | Blood blister | FAERS: 15 | US FAERS | |
| 228 | Choking | FAERS: 15 | US FAERS | |
| 229 | Diplopia | FAERS: 15 | US FAERS | |
| 230 | Expired product administered | FAERS: 15 | US FAERS | |
| 231 | Gastrointestinal carcinoma | FAERS: 15 | US FAERS | |
| 232 | Glaucoma | FAERS: 15 | US FAERS | |
| 233 | Lower respiratory tract infection | FAERS: 15 | US FAERS | |
| 234 | Spinal column stenosis | FAERS: 15 | US FAERS | |
| 235 | Thrombophlebitis | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 236 | cancer surgery | FAERS: 15 | US FAERS | |
| 237 | Carotid artery occlusion | FAERS: 14 | US FAERS | |
| 238 | Colectomy | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 239 | Disease Progression | FAERS: 14 | US FAERS | |
| 240 | Dry skin | FAERS: 14 | US FAERS | |
| 241 | Emotional disorder | FAERS: 14 | OFFSIDES US FAERS | |
| 242 | Hip surgery | FAERS: 14 | US FAERS | |
| 243 | Hypersomnia | FAERS: 14 | US FAERS | |
| 244 | Musculoskeletal discomfort | FAERS: 14 | US FAERS | |
| 245 | Pancytopenia | FAERS: 14 | US FAERS | |
| 246 | Sinus headache | FAERS: 14 | US FAERS | |
| 247 | Stress | FAERS: 14 | US FAERS | |
| 248 | Arterial thrombosis | FAERS: 13 | US FAERS | |
| 249 | Arteriosclerosis | FAERS: 13 | US FAERS | |
| 250 | Blood creatinine abnormal | FAERS: 13 | US FAERS | |
| 251 | Brain Contusion | FAERS: 13 | US FAERS | |
| 252 | Cerebral ventricular rupture | FAERS: 13 | US FAERS | |
| 253 | Disorientation | FAERS: 13 | US FAERS | |
| 254 | Fibrin D dimer increased | FAERS: 13 | US FAERS | |
| 255 | Hepatitis | FAERS: 13 | US FAERS | |
| 256 | Incorrect drug administration duration | FAERS: 13 | US FAERS | |
| 257 | Laryngitis | FAERS: 13 | US FAERS | |
| 258 | Product packaging quantity issue | FAERS: 13 | US FAERS | |
| 259 | Respiratory arrest | FAERS: 13 | US FAERS | |
| 260 | Therapy cessation | FAERS: 13 | US FAERS | |
| 261 | Thrombectomy | FAERS: 13 | US FAERS | |
| 262 | skin abrasion | FAERS: 13 | US FAERS | |
| 263 | Endocarditis | FAERS: 12 | US FAERS | |
| 264 | Full blood count decreased | FAERS: 12 | US FAERS | |
| 265 | Neuralgia | FAERS: 12 | US FAERS | |
| 266 | Peripheral embolism | FAERS: 12 | US FAERS | |
| 267 | Pneumonitis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 268 | Pulmonary Hypertension | FAERS: 12 | US FAERS | |
| 269 | Shock | FAERS: 12 | SIDER US FAERS | |
| 270 | Viral upper respiratory tract infection | FAERS: 12 | US FAERS | |
| 271 | Ageusia | FAERS: 11 | US FAERS | |
| 272 | Aspartate Aminotransferase Increased | FAERS: 11 | SIDER US FAERS | |
| 273 | Blood count abnormal | FAERS: 11 | US FAERS | |
| 274 | Blood iron decreased | FAERS: 11 | US FAERS | |
| 275 | Blood pressure fluctuation | FAERS: 11 | US FAERS | |
| 276 | Cyst | FAERS: 11 | US FAERS | |
| 277 | Eczema | FAERS: 11 | US FAERS | |
| 278 | Erectile dysfunction | FAERS: 11 | US FAERS | |
| 279 | Hepatitis C | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 280 | Incontinence | FAERS: 11 | US FAERS | |
| 281 | Malnutrition | FAERS: 11 | US FAERS | |
| 282 | Metrorrhagia | FAERS: 11 | SIDER US FAERS | |
| 283 | Muscle strain | FAERS: 11 | US FAERS | |
| 284 | Necrosis | FAERS: 11 | US FAERS | |
| 285 | Neutropenia | FAERS: 11 | US FAERS | |
| 286 | Peripheral arterial occlusive disease | FAERS: 11 | US FAERS | |
| 287 | Peripheral artery occlusion | FAERS: 11 | US FAERS | |
| 288 | Pulmonary Fibrosis | FAERS: 11 | US FAERS | |
| 289 | Restlessness | FAERS: 11 | US FAERS | |
| 290 | Tooth Infection | FAERS: 11 | US FAERS | |
| 291 | nervous system disorder | FAERS: 11 | SIDER US FAERS | |
| 292 | Acne | FAERS: 10 | US FAERS | |
| 293 | Alanine Aminotransferase Increased | FAERS: 10 | SIDER US FAERS | |
| 294 | Ankle Fracture | FAERS: 10 | US FAERS | |
| 295 | Blood cholesterol increased | FAERS: 10 | US FAERS | |
| 296 | Bursitis | FAERS: 10 | US FAERS | |
| 297 | Catheter placement | FAERS: 10 | US FAERS | |
| 298 | Cerebellar infarction | FAERS: 10 | US FAERS | |
| 299 | Crying | FAERS: 10 | US FAERS | |
| 300 | Dental caries | FAERS: 10 | US FAERS | |
| 301 | Erysipelas | FAERS: 10 | US FAERS | |
| 302 | Gastrectomy | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 303 | Intracranial Aneurysm | FAERS: 10 | US FAERS | |
| 304 | Irritable Bowel Syndrome | FAERS: 10 | US FAERS | |
| 305 | Lactose Intolerance | FAERS: 10 | US FAERS | |
| 306 | Loss of personal independence in daily activities | FAERS: 10 | US FAERS | |
| 307 | Macule | FAERS: 10 | US FAERS | |
| 308 | Mental impairment | FAERS: 10 | US FAERS | |
| 309 | Muscle tightness | FAERS: 10 | US FAERS | |
| 310 | Musculoskeletal chest pain | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 311 | Pallor | FAERS: 10 | US FAERS | |
| 312 | Percutaneous Coronary Intervention | FAERS: 10 | US FAERS | |
| 313 | Post procedural complication | FAERS: 10 | US FAERS | |
| 314 | Product packaging issue | FAERS: 10 | US FAERS | |
| 315 | Productive Cough | FAERS: 10 | US FAERS | |
| 316 | Purpura | FAERS: 10 | US FAERS | |
| 317 | Rash erythematous | FAERS: 10 | US FAERS | |
| 318 | Transaminases increased | FAERS: 10 | SIDER US FAERS | |
| 319 | Tuberculosis | FAERS: 10 | US FAERS | |
| 320 | colonoscopy | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 321 | Abscess | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 322 | Aortic Valve Stenosis | FAERS: 9 | US FAERS | |
| 323 | Blood urea increased | FAERS: 9 | US FAERS | |
| 324 | Cerebral artery occlusion | FAERS: 9 | US FAERS | |
| 325 | Cholecystitis | FAERS: 9 | US FAERS | |
| 326 | Contraindicated product administered | FAERS: 9 | US FAERS | |
| 327 | Craniotomy | FAERS: 9 | US FAERS | |
| 328 | Dermatitis | FAERS: 9 | SIDER US FAERS | |
| 329 | Embolic cerebral infarction | FAERS: 9 | US FAERS | |
| 330 | Emotional distress | FAERS: 9 | US FAERS | |
| 331 | Extra dose administered | FAERS: 9 | US FAERS | |
| 332 | Fibromyalgia | FAERS: 9 | US FAERS | |
| 333 | Hypophagia | FAERS: 9 | US FAERS | |
| 334 | Intervertebral disc disorder | FAERS: 9 | US FAERS | |
| 335 | Lymphadenopathy | FAERS: 9 | US FAERS | |
| 336 | Mouth swelling | FAERS: 9 | US FAERS | |
| 337 | Obesity | FAERS: 9 | US FAERS | |
| 338 | Osteoporosis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 339 | Overweight | FAERS: 9 | US FAERS | |
| 340 | Pneumothorax | FAERS: 9 | US FAERS | |
| 341 | Product label issue | FAERS: 9 | US FAERS | |
| 342 | Prostatectomy | FAERS: 9 | US FAERS | |
| 343 | Psoriasis | FAERS: 9 | OFFSIDES US FAERS | |
| 344 | Pulmonary congestion | FAERS: 9 | US FAERS | |
| 345 | Renal pain | FAERS: 9 | US FAERS | |
| 346 | Retinal Detachment | FAERS: 9 | US FAERS | |
| 347 | Skin irritation | FAERS: 9 | US FAERS | |
| 348 | Sluggishness | FAERS: 9 | US FAERS | |
| 349 | Unresponsive to stimuli | FAERS: 9 | US FAERS | |
| 350 | White blood cell count decreased | FAERS: 9 | US FAERS | |
| 351 | Accidental exposure to product | FAERS: 8 | US FAERS | |
| 352 | Accidental exposure to product by child | FAERS: 8 | US FAERS | |
| 353 | Amaurosis Fugax | FAERS: 8 | US FAERS | |
| 354 | Animal bite | FAERS: 8 | US FAERS | |
| 355 | Blood glucose decreased | FAERS: 8 | US FAERS | |
| 356 | Bowel movement irregularity | FAERS: 8 | US FAERS | |
| 357 | Cerebral disorder | FAERS: 8 | US FAERS | |
| 358 | Cholangitis | FAERS: 8 | US FAERS | |
| 359 | Cyanosis | FAERS: 8 | US FAERS | |
| 360 | Flank Pain | FAERS: 8 | US FAERS | |
| 361 | Gamma-Glutamyltransferase Increased | FAERS: 8 | SIDER US FAERS | |
| 362 | Gastric Fistula | FAERS: 8 | US FAERS | |
| 363 | Gastroenteritis | FAERS: 8 | US FAERS | |
| 364 | Immune thrombocytopenic purpura | FAERS: 8 | US FAERS | |
| 365 | Medical device implantation | FAERS: 8 | US FAERS | |
| 366 | Myasthenia Gravis | FAERS: 8 | US FAERS | |
| 367 | Night sweats | FAERS: 8 | US FAERS | |
| 368 | Retching | FAERS: 8 | US FAERS | |
| 369 | Rotator cuff syndrome | FAERS: 8 | US FAERS | |
| 370 | Skin lesion | FAERS: 8 | US FAERS | |
| 371 | Splenic Rupture | FAERS: 8 | US FAERS | |
| 372 | Stenosis | FAERS: 8 | US FAERS | |
| 373 | Venous thrombosis limb | FAERS: 8 | US FAERS | |
| 374 | Wound Infection | FAERS: 8 | US FAERS | |
| 375 | Altered state of consciousness | FAERS: 7 | US FAERS | |
| 376 | Amyloidosis | FAERS: 7 | US FAERS | |
| 377 | Benign Prostatic Hyperplasia | FAERS: 7 | US FAERS | |
| 378 | Blood glucose abnormal | FAERS: 7 | US FAERS | |
| 379 | Bronchospasm | FAERS: 7 | US FAERS | |
| 380 | Complication associated with device | FAERS: 7 | US FAERS | |
| 381 | Feeling jittery | FAERS: 7 | US FAERS | |
| 382 | Iron deficiency | FAERS: 7 | US FAERS | |
| 383 | Joint stiffness | FAERS: 7 | US FAERS | |
| 384 | Limb operation | FAERS: 7 | US FAERS | |
| 385 | MYELODYSPLASTIC SYNDROME | FAERS: 7 | US FAERS | |
| 386 | Meniscus injury | FAERS: 7 | US FAERS | |
| 387 | Ophthalmic vein thrombosis | FAERS: 7 | US FAERS | |
| 388 | Oral candidiasis | FAERS: 7 | US FAERS | |
| 389 | Oral pain | FAERS: 7 | US FAERS | |
| 390 | Pelvic venous thrombosis | FAERS: 7 | US FAERS | |
| 391 | Peptic Ulcer | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 392 | Portal Vein Thrombosis | FAERS: 7 | US FAERS | |
| 393 | Product administration error | FAERS: 7 | US FAERS | |
| 394 | Ruptured cerebral aneurysm | FAERS: 7 | US FAERS | |
| 395 | Skin reaction | FAERS: 7 | US FAERS | |
| 396 | Stevens-Johnson Syndrome | FAERS: 7 | US FAERS | |
| 397 | Stomatitis | FAERS: 7 | US FAERS | |
| 398 | Suspected counterfeit product | FAERS: 7 | US FAERS | |
| 399 | Tachyarrhythmia | FAERS: 7 | US FAERS | |
| 400 | Therapy change | FAERS: 7 | US FAERS | |
| 401 | Vascular rupture | FAERS: 7 | US FAERS | |
| 402 | Arthropod bite | FAERS: 6 | US FAERS | |
| 403 | Biopsy | FAERS: 6 | US FAERS | |
| 404 | Cardiac ventricular thrombosis | FAERS: 6 | US FAERS | |
| 405 | Cardiomegaly | FAERS: 6 | US FAERS | |
| 406 | Clostridium difficile infection | FAERS: 6 | US FAERS | |
| 407 | Cold sweat | FAERS: 6 | US FAERS | |
| 408 | Drug administered to patient of inappropriate age | FAERS: 6 | US FAERS | |
| 409 | Dysphemia | FAERS: 6 | US FAERS | |
| 410 | Ear discomfort | FAERS: 6 | US FAERS | |
| 411 | Helicobacter test positive | FAERS: 6 | US FAERS | |
| 412 | Hospice Care | FAERS: 6 | US FAERS | |
| 413 | Hypoxia | FAERS: 6 | US FAERS | |
| 414 | Hysterectomy | FAERS: 6 | US FAERS | |
| 415 | Incorrect product administration duration | FAERS: 6 | US FAERS | |
| 416 | Intentional self-injury | FAERS: 6 | US FAERS | |
| 417 | Large intestinal polypectomy | FAERS: 6 | US FAERS | |
| 418 | Ligament rupture | FAERS: 6 | US FAERS | |
| 419 | Marasmus | FAERS: 6 | US FAERS | |
| 420 | Meningitis | FAERS: 6 | US FAERS | |
| 421 | Mitral Valve Stenosis | FAERS: 6 | US FAERS | |
| 422 | Paraplegia | FAERS: 6 | US FAERS | |
| 423 | Platelet Transfusion | FAERS: 6 | US FAERS | |
| 424 | Pleurisy | FAERS: 6 | US FAERS | |
| 425 | Product physical issue | FAERS: 6 | US FAERS | |
| 426 | Rhabdomyolysis | FAERS: 6 | US FAERS | |
| 427 | Splenic Infarction | FAERS: 6 | US FAERS | |
| 428 | Therapeutic procedure | FAERS: 6 | US FAERS | |
| 429 | Upper-airway cough syndrome | FAERS: 6 | US FAERS | |
| 430 | Vascular occlusion | FAERS: 6 | US FAERS | |
| 431 | Ventricular Fibrillation | FAERS: 6 | US FAERS | |
| 432 | Vitreous floaters | FAERS: 6 | US FAERS | |
| 433 | Angioplasty | FAERS: 5 | US FAERS | |
| 434 | Animal scratch | FAERS: 5 | US FAERS | |
| 435 | Anuria | FAERS: 5 | US FAERS | |
| 436 | Ascites | FAERS: 5 | US FAERS | |
| 437 | Asthenopia | FAERS: 5 | US FAERS | |
| 438 | Autoimmune hepatitis | FAERS: 5 | US FAERS | |
| 439 | Biliary sepsis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 440 | Blood potassium abnormal | FAERS: 5 | US FAERS | |
| 441 | Blood potassium increased | FAERS: 5 | US FAERS | |
| 442 | Blood sodium decreased | FAERS: 5 | US FAERS | |
| 443 | Blue Toe Syndrome | FAERS: 5 | US FAERS | |
| 444 | Cerebral Amyloid Angiopathy | FAERS: 5 | US FAERS | |
| 445 | Chronic sinusitis | FAERS: 5 | US FAERS | |
| 446 | Depressed mood | FAERS: 5 | US FAERS | |
| 447 | Device related infection | FAERS: 5 | US FAERS | |
| 448 | Dysgraphia | FAERS: 5 | US FAERS | |
| 449 | Erythema Multiforme | FAERS: 5 | US FAERS | |
| 450 | Euphoric mood | FAERS: 5 | US FAERS | |
| 451 | Eye irritation | FAERS: 5 | US FAERS | |
| 452 | Fluid overload | FAERS: 5 | US FAERS | |
| 453 | Gastrointestinal Pain | FAERS: 5 | US FAERS | |
| 454 | Gastrointestinal endoscopic therapy | FAERS: 5 | US FAERS | |
| 455 | Gluten sensitivity | FAERS: 5 | US FAERS | |
| 456 | Hydronephrosis | FAERS: 5 | US FAERS | |
| 457 | Laziness | FAERS: 5 | US FAERS | |
| 458 | Leukopenia | FAERS: 5 | US FAERS | |
| 459 | Metastatic Neoplasm | FAERS: 5 | US FAERS | |
| 460 | Mood swings | FAERS: 5 | US FAERS | |
| 461 | Muscle Fatigue | FAERS: 5 | US FAERS | |
| 462 | Nasal discomfort | FAERS: 5 | US FAERS | |
| 463 | Nephrectomy | FAERS: 5 | US FAERS | |
| 464 | Nerve injury | FAERS: 5 | US FAERS | |
| 465 | Pericarditis | FAERS: 5 | US FAERS | |
| 466 | Peripheral artery thrombosis | FAERS: 5 | US FAERS | |
| 467 | Poisoning | FAERS: 5 | US FAERS | |
| 468 | Polyneuropathy | FAERS: 5 | OFFSIDES US FAERS | |
| 469 | Presyncope | FAERS: 5 | US FAERS | |
| 470 | Prothrombin level decreased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 471 | Renal Cell Carcinoma | FAERS: 5 | US FAERS | |
| 472 | Restless Legs Syndrome | FAERS: 5 | US FAERS | |
| 473 | Retinal Artery Occlusion | FAERS: 5 | US FAERS | |
| 474 | Right ventricular failure | FAERS: 5 | US FAERS | |
| 475 | Skin Papilloma | FAERS: 5 | US FAERS | |
| 476 | Splenomegaly | FAERS: 5 | US FAERS | |
| 477 | Thirst | FAERS: 5 | US FAERS | |
| 478 | Thoracic cavity drainage | FAERS: 5 | US FAERS | |
| 479 | Underweight | FAERS: 5 | US FAERS | |
| 480 | Venous occlusion | FAERS: 5 | US FAERS | |
| 481 | Agranulocytosis | FAERS: 4 | US FAERS | |
| 482 | Angiodysplasia | FAERS: 4 | US FAERS | |
| 483 | Anti factor X activity increased | FAERS: 4 | US FAERS | |
| 484 | Asphyxia | FAERS: 4 | US FAERS | |
| 485 | Ataxia | FAERS: 4 | US FAERS | |
| 486 | Atrioventricular Block | FAERS: 4 | US FAERS | |
| 487 | Blood cholesterol | FAERS: 4 | US FAERS | |
| 488 | Blood creatinine decreased | FAERS: 4 | US FAERS | |
| 489 | Blood glucose fluctuation | FAERS: 4 | US FAERS | |
| 490 | Carbon dioxide increased | FAERS: 4 | US FAERS | |
| 491 | Choking sensation | FAERS: 4 | US FAERS | |
| 492 | Cholestasis | FAERS: 4 | US FAERS | |
| 493 | Completed Suicide | FAERS: 4 | US FAERS | |
| 494 | Conjunctivitis | FAERS: 4 | US FAERS | |
| 495 | Device related thrombosis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 496 | Diabetes mellitus inadequate control | FAERS: 4 | US FAERS | |
| 497 | Duodenitis | FAERS: 4 | US FAERS | |
| 498 | Dysplasia | FAERS: 4 | US FAERS | |
| 499 | Endometriosis | FAERS: 4 | US FAERS | |
| 500 | Feeling of body temperature change | FAERS: 4 | US FAERS | |
| 501 | Formication | FAERS: 4 | US FAERS | |
| 502 | Gastric Antral Vascular Ectasia | FAERS: 4 | US FAERS | |
| 503 | Gastrointestinal perforation | FAERS: 4 | US FAERS | |
| 504 | Gastrointestinal sounds abnormal | FAERS: 4 | US FAERS | |
| 505 | Hyperchlorhydria | FAERS: 4 | US FAERS | |
| 506 | Hyperthyroidism | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 507 | Hypertransaminasaemia | FAERS: 4 | US FAERS | |
| 508 | Hypothyroidism | FAERS: 4 | US FAERS | |
| 509 | Immobile | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 510 | Implantable defibrillator insertion | FAERS: 4 | US FAERS | |
| 511 | Intermittent Claudication | FAERS: 4 | US FAERS | |
| 512 | Laparotomy | FAERS: 4 | US FAERS | |
| 513 | Limb mass | FAERS: 4 | US FAERS | |
| 514 | Lithotripsy | FAERS: 4 | US FAERS | |
| 515 | Loose tooth | FAERS: 4 | US FAERS | |
| 516 | Mallory-Weiss Syndrome | FAERS: 4 | OFFSIDES US FAERS | |
| 517 | Medication residue present | FAERS: 4 | US FAERS | |
| 518 | Nasal Polyps | FAERS: 4 | US FAERS | |
| 519 | Nephrotic Syndrome | FAERS: 4 | US FAERS | |
| 520 | Nocturia | FAERS: 4 | US FAERS | |
| 521 | Osteomyelitis | FAERS: 4 | US FAERS | |
| 522 | Performance status decreased | FAERS: 4 | US FAERS | |
| 523 | Platelet count abnormal | FAERS: 4 | US FAERS | |
| 524 | Polymyalgia Rheumatica | FAERS: 4 | US FAERS | |
| 525 | Post procedural infection | FAERS: 4 | US FAERS | |
| 526 | Post procedural stroke | FAERS: 4 | US FAERS | |
| 527 | Procedural complication | FAERS: 4 | US FAERS | |
| 528 | Product commingling | FAERS: 4 | US FAERS | |
| 529 | Product use complaint | FAERS: 4 | US FAERS | |
| 530 | Protein S Deficiency | FAERS: 4 | US FAERS | |
| 531 | Protein S decreased | FAERS: 4 | US FAERS | |
| 532 | Prothrombin time ratio increased | FAERS: 4 | US FAERS | |
| 533 | Renal cyst | FAERS: 4 | US FAERS | |
| 534 | Respiratory distress | FAERS: 4 | US FAERS | |
| 535 | Retinal vascular thrombosis | FAERS: 4 | US FAERS | |
| 536 | Schizophrenia | FAERS: 4 | US FAERS | |
| 537 | Seroma | FAERS: 4 | US FAERS | |
| 538 | Squamous cell carcinoma of skin | FAERS: 4 | US FAERS | |
| 539 | Tachyphrenia | FAERS: 4 | US FAERS | |
| 540 | Temperature intolerance | FAERS: 4 | US FAERS | |
| 541 | Throat cancer | FAERS: 4 | US FAERS | |
| 542 | Thrombotic stroke | FAERS: 4 | US FAERS | |
| 543 | Tongue discomfort | FAERS: 4 | US FAERS | |
| 544 | Uterine Cancer | FAERS: 4 | US FAERS | |
| 545 | Wrong drug administered | FAERS: 4 | US FAERS | |
| 546 | prostatitis | FAERS: 4 | US FAERS | |
| 547 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 548 | Anger | FAERS: 3 | US FAERS | |
| 549 | Aortic valve calcification | FAERS: 3 | US FAERS | |
| 550 | Apallic syndrome | FAERS: 3 | US FAERS | |
| 551 | Aphonia | FAERS: 3 | US FAERS | |
| 552 | Arterial Injury | FAERS: 3 | US FAERS | |
| 553 | Arteriovenous fistula | FAERS: 3 | US FAERS | |
| 554 | Atypical pneumonia | FAERS: 3 | US FAERS | |
| 555 | Bladder tamponade | FAERS: 3 | US FAERS | |
| 556 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 557 | Bronchiectasis | FAERS: 3 | US FAERS | |
| 558 | Cachexia | FAERS: 3 | US FAERS | |
| 559 | Carotid Artery Thrombosis | FAERS: 3 | US FAERS | |
| 560 | Cartilage injury | FAERS: 3 | US FAERS | |
| 561 | Catheter site discharge | FAERS: 3 | US FAERS | |
| 562 | Cerebral microhaemorrhage | FAERS: 3 | US FAERS | |
| 563 | Cheilitis | FAERS: 3 | US FAERS | |
| 564 | Chronic gastritis | FAERS: 3 | US FAERS | |
| 565 | Clostridium difficile colitis | FAERS: 3 | US FAERS | |
| 566 | Cluster Headache | FAERS: 3 | US FAERS | |
| 567 | Compression fracture | FAERS: 3 | US FAERS | |
| 568 | Congenital cystic kidney disease | FAERS: 3 | US FAERS | |
| 569 | Debridement | FAERS: 3 | US FAERS | |
| 570 | Device dislocation | FAERS: 3 | US FAERS | |
| 571 | Device occlusion | FAERS: 3 | US FAERS | |
| 572 | Diabetes Insipidus | FAERS: 3 | US FAERS | |
| 573 | Electrolyte imbalance | FAERS: 3 | US FAERS | |
| 574 | Encephalocele | FAERS: 3 | US FAERS | |
| 575 | Enterococcal infection | FAERS: 3 | US FAERS | |
| 576 | Epigastric discomfort | FAERS: 3 | US FAERS | |
| 577 | Exfoliative rash | FAERS: 3 | US FAERS | |
| 578 | Exsanguination | FAERS: 3 | US FAERS | |
| 579 | Extremity necrosis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 580 | Facial Pain | FAERS: 3 | US FAERS | |
| 581 | Facial Paresis | FAERS: 3 | US FAERS | |
| 582 | Folliculitis | FAERS: 3 | US FAERS | |
| 583 | Food Allergy | FAERS: 3 | US FAERS | |
| 584 | Fracture treatment | FAERS: 3 | US FAERS | |
| 585 | Gangrene | FAERS: 3 | US FAERS | |
| 586 | Gastrointestinal angiodysplasia | FAERS: 3 | US FAERS | |
| 587 | Gastrointestinal arteriovenous malformation | FAERS: 3 | US FAERS | |
| 588 | Gastrointestinal motility disorder | FAERS: 3 | US FAERS | |
| 589 | Gastrointestinal obstruction | FAERS: 3 | US FAERS | |
| 590 | Gastrointestinal ulcer | FAERS: 3 | US FAERS | |
| 591 | Gastrointestinal vascular malformation | FAERS: 3 | US FAERS | |
| 592 | Gingival Recession | FAERS: 3 | US FAERS | |
| 593 | Glioblastoma | FAERS: 3 | US FAERS | |
| 594 | Hepatic Encephalopathy | FAERS: 3 | US FAERS | |
| 595 | Hunger | FAERS: 3 | US FAERS | |
| 596 | Hypocoagulable state | FAERS: 3 | US FAERS | |
| 597 | Inability to afford medication | FAERS: 3 | US FAERS | |
| 598 | Incoherent | FAERS: 3 | US FAERS | |
| 599 | Infective exacerbation of chronic obstructive airways disease | FAERS: 3 | US FAERS | |
| 600 | Injection site bruising | FAERS: 3 | US FAERS | |
| 601 | Intercepted product prescribing error | FAERS: 3 | US FAERS | |
| 602 | Interventional procedure | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 603 | Intervertebral Disc Degeneration | FAERS: 3 | US FAERS | |
| 604 | Intestinal Perforation | FAERS: 3 | US FAERS | |
| 605 | Intestinal polypectomy | FAERS: 3 | US FAERS | |
| 606 | Intestinal resection | FAERS: 3 | US FAERS | |
| 607 | Intracranial mass | FAERS: 3 | US FAERS | |
| 608 | Leukocytosis | FAERS: 3 | US FAERS | |
| 609 | Lissencephaly | FAERS: 3 | US FAERS | |
| 610 | Lymphadenitis | FAERS: 3 | US FAERS | |
| 611 | Malabsorption | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 612 | Meningorrhagia | FAERS: 3 | US FAERS | |
| 613 | Middle insomnia | FAERS: 3 | US FAERS | |
| 614 | Monoplegia | FAERS: 3 | US FAERS | |
| 615 | Multi-organ disorder | FAERS: 3 | US FAERS | |
| 616 | Myocardial strain | FAERS: 3 | US FAERS | |
| 617 | Neurological decompensation | FAERS: 3 | US FAERS | |
| 618 | Onychoclasis | FAERS: 3 | US FAERS | |
| 619 | Pain of skin | FAERS: 3 | US FAERS | |
| 620 | Peritonitis | FAERS: 3 | US FAERS | |
| 621 | Personality Change | FAERS: 3 | US FAERS | |
| 622 | Pertussis | FAERS: 3 | US FAERS | |
| 623 | Poor quality sleep | FAERS: 3 | US FAERS | |
| 624 | Post procedural discharge | FAERS: 3 | US FAERS | |
| 625 | Product blister packaging issue | FAERS: 3 | US FAERS | |
| 626 | Product container issue | FAERS: 3 | US FAERS | |
| 627 | Product package associated injury | FAERS: 3 | US FAERS | |
| 628 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 629 | Protein urine present | FAERS: 3 | US FAERS | |
| 630 | Prothrombin time abnormal | FAERS: 3 | US FAERS | |
| 631 | Pyelonephritis | FAERS: 3 | US FAERS | |
| 632 | Quadriplegia | FAERS: 3 | US FAERS | |
| 633 | Radiculopathy | FAERS: 3 | US FAERS | |
| 634 | Rehabilitation therapy | FAERS: 3 | US FAERS | |
| 635 | Scab | FAERS: 3 | US FAERS | |
| 636 | Secretion discharge | FAERS: 3 | US FAERS | |
| 637 | Senile dementia | FAERS: 3 | US FAERS | |
| 638 | Sinus bradycardia | FAERS: 3 | OFFSIDES US FAERS | |
| 639 | Sinus operation | FAERS: 3 | US FAERS | |
| 640 | Sinus rhythm | FAERS: 3 | US FAERS | |
| 641 | Skeletal injury | FAERS: 3 | US FAERS | |
| 642 | Subcutaneous Abscess | FAERS: 3 | US FAERS | |
| 643 | Sudden Cardiac Death | FAERS: 3 | US FAERS | |
| 644 | Sunburn | FAERS: 3 | US FAERS | |
| 645 | Tension Headache | FAERS: 3 | US FAERS | |
| 646 | Thalamic infarction | FAERS: 3 | US FAERS | |
| 647 | Thermal burn | FAERS: 3 | US FAERS | |
| 648 | Throat clearing | FAERS: 3 | US FAERS | |
| 649 | Thrombocytosis | FAERS: 3 | US FAERS | |
| 650 | Thromboembolectomy | FAERS: 3 | US FAERS | |
| 651 | Tongue biting | FAERS: 3 | US FAERS | |
| 652 | Tongue erythema | FAERS: 3 | US FAERS | |
| 653 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 654 | Traumatic fracture | FAERS: 3 | US FAERS | |
| 655 | Urethral Stenosis | FAERS: 3 | US FAERS | |
| 656 | Urinary tract obstruction | FAERS: 3 | US FAERS | |
| 657 | Vena cava filter insertion | FAERS: 3 | US FAERS | |
| 658 | Ventricular arrhythmia | FAERS: 3 | US FAERS | |
| 659 | Ventricular drainage | FAERS: 3 | US FAERS | |
| 660 | Vertebral Artery Dissection | FAERS: 3 | US FAERS | |
| 661 | furuncle | FAERS: 3 | US FAERS | |
| 662 | Abdominal mass | FAERS: 2 | US FAERS | |
| 663 | Abortion early | FAERS: 2 | US FAERS | |
| 664 | Accidental underdose | FAERS: 2 | US FAERS | |
| 665 | Alcohol abuse | FAERS: 2 | US FAERS | |
| 666 | Alcohol interaction | FAERS: 2 | US FAERS | |
| 667 | Alopecia Areata | FAERS: 2 | US FAERS | |
| 668 | Amyotrophic Lateral Sclerosis | FAERS: 2 | US FAERS | |
| 669 | Anal Fissure | FAERS: 2 | US FAERS | |
| 670 | Anal Fistula | FAERS: 2 | US FAERS | |
| 671 | Anaphylactic shock | FAERS: 2 | SIDER US FAERS | |
| 672 | Anastomotic ulcer | FAERS: 2 | US FAERS | |
| 673 | Anosmia | FAERS: 2 | US FAERS | |
| 674 | Anticoagulation drug level increased | FAERS: 2 | US FAERS | |
| 675 | Antiphospholipid antibodies positive | FAERS: 2 | US FAERS | |
| 676 | Apathy | FAERS: 2 | US FAERS | |
| 677 | Arthropod sting | FAERS: 2 | US FAERS | |
| 678 | Atrial tachycardia | FAERS: 2 | OFFSIDES US FAERS | |
| 679 | Bicytopenia | FAERS: 2 | US FAERS | |
| 680 | Bile Duct Stenosis | FAERS: 2 | US FAERS | |
| 681 | Bile duct stent insertion | FAERS: 2 | US FAERS | |
| 682 | Blepharospasm | FAERS: 2 | US FAERS | |
| 683 | Blood albumin decreased | FAERS: 2 | US FAERS | |
| 684 | Blood alkaline phosphatase increased | FAERS: 2 | SIDER US FAERS | |
| 685 | Blood bilirubin abnormal | FAERS: 2 | US FAERS | |
| 686 | Blood cholesterol abnormal | FAERS: 2 | US FAERS | |
| 687 | Blood creatine increased | FAERS: 2 | US FAERS | |
| 688 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 689 | Blood electrolytes decreased | FAERS: 2 | US FAERS | |
| 690 | Blood glucose normal | FAERS: 2 | US FAERS | |
| 691 | Blood homocysteine increased | FAERS: 2 | US FAERS | |
| 692 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 693 | Blood sodium abnormal | FAERS: 2 | US FAERS | |
| 694 | Blood sodium increased | FAERS: 2 | US FAERS | |
| 695 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 696 | Brain Death | FAERS: 2 | US FAERS | |
| 697 | Brain natriuretic peptide increased | FAERS: 2 | US FAERS | |
| 698 | Breast cancer recurrent | FAERS: 2 | US FAERS | |
| 699 | Bronchoscopy | FAERS: 2 | US FAERS | |
| 700 | CD4 Lymphocytes Decreased | FAERS: 2 | US FAERS | |
| 701 | Calciphylaxis | FAERS: 2 | US FAERS | |
| 702 | Capillaritis | FAERS: 2 | US FAERS | |
| 703 | Carcinoembryonic antigen increased | FAERS: 2 | US FAERS | |
| 704 | Cardiac Death | FAERS: 2 | US FAERS | |
| 705 | Cardiac perforation | FAERS: 2 | US FAERS | |
| 706 | Cardiac valve vegetation | FAERS: 2 | US FAERS | |
| 707 | Carotid artery aneurysm | FAERS: 2 | US FAERS | |
| 708 | Cell Death | FAERS: 2 | US FAERS | |
| 709 | Cerebral atrophy | FAERS: 2 | OFFSIDES US FAERS | |
| 710 | Cholecystitis infective | FAERS: 2 | US FAERS | |
| 711 | Circumstance or information capable of leading to device use error | FAERS: 2 | US FAERS | |
| 712 | Clonus | FAERS: 2 | US FAERS | |
| 713 | Clostridium test | FAERS: 2 | US FAERS | |
| 714 | Clostridium test positive | FAERS: 2 | US FAERS | |
| 715 | Coagulation factor V level abnormal | FAERS: 2 | US FAERS | |
| 716 | Coagulation factor VIII level increased | FAERS: 2 | US FAERS | |
| 717 | Coagulation test abnormal | FAERS: 2 | US FAERS | |
| 718 | Coagulation time abnormal | FAERS: 2 | US FAERS | |
| 719 | Counterfeit drug administered | FAERS: 2 | US FAERS | |
| 720 | Cryotherapy | FAERS: 2 | US FAERS | |
| 721 | Cystoscopy | FAERS: 2 | US FAERS | |
| 722 | Dental cleaning | FAERS: 2 | US FAERS | |
| 723 | Diabetic Retinopathy | FAERS: 2 | US FAERS | |
| 724 | Diabetic cystopathy | FAERS: 2 | US FAERS | |
| 725 | Dialysis related complication | FAERS: 2 | US FAERS | |
| 726 | Diplegia | FAERS: 2 | US FAERS | |
| 727 | Disease recurrence | FAERS: 2 | US FAERS | |
| 728 | Drug Dependence | FAERS: 2 | US FAERS | |
| 729 | Drug abuse | FAERS: 2 | US FAERS | |
| 730 | Echocardiogram abnormal | FAERS: 2 | US FAERS | |
| 731 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 732 | Empyema | FAERS: 2 | US FAERS | |
| 733 | Endodontic procedure | FAERS: 2 | US FAERS | |
| 734 | Enlarged uvula | FAERS: 2 | US FAERS | |
| 735 | Enteritis | FAERS: 2 | US FAERS | |
| 736 | Enzyme level increased | FAERS: 2 | US FAERS | |
| 737 | Epidural catheter placement | FAERS: 2 | US FAERS | |
| 738 | Erosive Duodenitis | FAERS: 2 | US FAERS | |
| 739 | Escherichia infection | FAERS: 2 | US FAERS | |
| 740 | Escherichia sepsis | FAERS: 2 | US FAERS | |
| 741 | Eye Infection | FAERS: 2 | US FAERS | |
| 742 | Factor VIII Deficiency | FAERS: 2 | US FAERS | |
| 743 | Food aversion | FAERS: 2 | US FAERS | |
| 744 | Gastric Bypass | FAERS: 2 | US FAERS | |
| 745 | Gastric Dilatation | FAERS: 2 | US FAERS | |
| 746 | Gastric adenoma | FAERS: 2 | US FAERS | |
| 747 | Gastric infection | FAERS: 2 | US FAERS | |
| 748 | Gastrointestinal erosion | FAERS: 2 | US FAERS | |
| 749 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 750 | Gingivitis | FAERS: 2 | US FAERS | |
| 751 | Granulocyte count decreased | FAERS: 2 | US FAERS | |
| 752 | Haptoglobin Decreased | FAERS: 2 | US FAERS | |
| 753 | Heart valve calcification | FAERS: 2 | US FAERS | |
| 754 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 755 | Hepatotoxicity | FAERS: 2 | OFFSIDES US FAERS | |
| 756 | Hyperphagia | FAERS: 2 | US FAERS | |
| 757 | Hyperplasia | FAERS: 2 | US FAERS | |
| 758 | Hypertensive emergency | FAERS: 2 | US FAERS | |
| 759 | Implant site infection | FAERS: 2 | US FAERS | |
| 760 | Inappropriate affect | FAERS: 2 | US FAERS | |
| 761 | Incision site vesicles | FAERS: 2 | US FAERS | |
| 762 | Incorrect product dosage form administered | FAERS: 2 | US FAERS | |
| 763 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 764 | Infectious pleural effusion | FAERS: 2 | US FAERS | |
| 765 | Influenza A virus test positive | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 766 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 767 | Intercepted medication error | FAERS: 2 | US FAERS | |
| 768 | Intestinal infarction | FAERS: 2 | US FAERS | |
| 769 | Labile blood pressure | FAERS: 2 | US FAERS | |
| 770 | Labyrinthitis | FAERS: 2 | US FAERS | |
| 771 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 772 | Laser Therapy | FAERS: 2 | US FAERS | |
| 773 | Left atrial appendage occlusion | FAERS: 2 | US FAERS | |
| 774 | Lip and/or oral cavity cancer | FAERS: 2 | US FAERS | |
| 775 | Mesenteric arterial occlusion | FAERS: 2 | US FAERS | |
| 776 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 777 | Metastasis | FAERS: 2 | US FAERS | |
| 778 | Miliaria | FAERS: 2 | US FAERS | |
| 779 | Mole excision | FAERS: 2 | US FAERS | |
| 780 | Monoparesis | FAERS: 2 | US FAERS | |
| 781 | Myocarditis | FAERS: 2 | US FAERS | |
| 782 | Myopathy | FAERS: 2 | US FAERS | |
| 783 | Nasal inflammation | FAERS: 2 | US FAERS | |
| 784 | Nerve Block | FAERS: 2 | US FAERS | |
| 785 | Nodule | FAERS: 2 | US FAERS | |
| 786 | Non-cardiac chest pain | FAERS: 2 | US FAERS | |
| 787 | Noninfective gingivitis | FAERS: 2 | US FAERS | |
| 788 | Norovirus test positive | FAERS: 2 | US FAERS | |
| 789 | Obstruction | FAERS: 2 | US FAERS | |
| 790 | Ocular discomfort | FAERS: 2 | US FAERS | |
| 791 | Ocular icterus | FAERS: 2 | US FAERS | |
| 792 | Onychomycosis | FAERS: 2 | US FAERS | |
| 793 | Ophthalmoplegia | FAERS: 2 | US FAERS | |
| 794 | Osteitis | FAERS: 2 | US FAERS | |
| 795 | Paranasal sinus hypersecretion | FAERS: 2 | US FAERS | |
| 796 | Paranoia | FAERS: 2 | US FAERS | |
| 797 | Pelvic Pain | FAERS: 2 | US FAERS | |
| 798 | Penile swelling | FAERS: 2 | US FAERS | |
| 799 | Perineal pain | FAERS: 2 | US FAERS | |
| 800 | Periodontitis | FAERS: 2 | US FAERS | |
| 801 | Pharyngitis | FAERS: 2 | US FAERS | |
| 802 | Photophobia | FAERS: 2 | US FAERS | |
| 803 | Piloerection | FAERS: 2 | US FAERS | |
| 804 | Polyuria | FAERS: 2 | US FAERS | |
| 805 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 806 | Portal Hypertension | FAERS: 2 | US FAERS | |
| 807 | Post procedural pulmonary embolism | FAERS: 2 | US FAERS | |
| 808 | Post-traumatic neck syndrome | FAERS: 2 | US FAERS | |
| 809 | Postoperative abscess | FAERS: 2 | US FAERS | |
| 810 | Poverty of speech | FAERS: 2 | US FAERS | |
| 811 | Pre-existing condition improved | FAERS: 2 | US FAERS | |
| 812 | Product expiration date issue | FAERS: 2 | US FAERS | |
| 813 | Product lot number issue | FAERS: 2 | US FAERS | |
| 814 | Product size issue | FAERS: 2 | US FAERS | |
| 815 | Product substitution issue | FAERS: 2 | US FAERS | |
| 816 | Product used for unknown indication | FAERS: 2 | US FAERS | |
| 817 | Prosthetic cardiac valve thrombosis | FAERS: 2 | US FAERS | |
| 818 | Proteinuria | FAERS: 2 | US FAERS | |
| 819 | Pulmonary arterial hypertension | FAERS: 2 | US FAERS | |
| 820 | Pulmonary venous thrombosis | FAERS: 2 | US FAERS | |
| 821 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 822 | Radial nerve compression | FAERS: 2 | US FAERS | |
| 823 | Rectal discharge | FAERS: 2 | US FAERS | |
| 824 | Rectal polyp | FAERS: 2 | US FAERS | |
| 825 | Regurgitation | FAERS: 2 | US FAERS | |
| 826 | Renal Colic | FAERS: 2 | US FAERS | |
| 827 | Respiratory tract inflammation | FAERS: 2 | US FAERS | |
| 828 | Retinal Vascular Disorder | FAERS: 2 | US FAERS | |
| 829 | Retinal Vein Occlusion | FAERS: 2 | US FAERS | |
| 830 | Retinal artery embolism | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 831 | Retinopexy | FAERS: 2 | US FAERS | |
| 832 | Retinoschisis | FAERS: 2 | US FAERS | |
| 833 | Rhinitis | FAERS: 2 | US FAERS | |
| 834 | Seizure like phenomena | FAERS: 2 | US FAERS | |
| 835 | Silent myocardial infarction | FAERS: 2 | US FAERS | |
| 836 | Sinoatrial Block | FAERS: 2 | US FAERS | |
| 837 | Sjogren's Syndrome | FAERS: 2 | US FAERS | |
| 838 | Skin Wrinkling | FAERS: 2 | US FAERS | |
| 839 | Skin neoplasm excision | FAERS: 2 | US FAERS | |
| 840 | Sopor | FAERS: 2 | US FAERS | |
| 841 | Spinal column injury | FAERS: 2 | US FAERS | |
| 842 | Spinal fusion surgery | FAERS: 2 | US FAERS | |
| 843 | Splenectomy | FAERS: 2 | US FAERS | |
| 844 | Splinter | FAERS: 2 | US FAERS | |
| 845 | Spondylitis | FAERS: 2 | US FAERS | |
| 846 | Staphylococcus test positive | FAERS: 2 | US FAERS | |
| 847 | Stridor | FAERS: 2 | US FAERS | |
| 848 | Subgaleal haematoma | FAERS: 2 | US FAERS | |
| 849 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 850 | Temporal Arteritis | FAERS: 2 | US FAERS | |
| 851 | Thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 852 | Thrombosis in device | FAERS: 2 | US FAERS | |
| 853 | Thyroidectomy | FAERS: 2 | US FAERS | |
| 854 | Tinea Pedis | FAERS: 2 | US FAERS | |
| 855 | Tooth Loss | FAERS: 2 | US FAERS | |
| 856 | Toxic Epidermal Necrolysis | FAERS: 2 | US FAERS | |
| 857 | Trichorrhexis | FAERS: 2 | US FAERS | |
| 858 | Troponin increased | FAERS: 2 | US FAERS | |
| 859 | Trousseau's syndrome | FAERS: 2 | US FAERS | |
| 860 | Urinary tract infection fungal | FAERS: 2 | US FAERS | |
| 861 | Uterine Polyp | FAERS: 2 | US FAERS | |
| 862 | Uterine Prolapse | FAERS: 2 | US FAERS | |
| 863 | Vascular calcification | FAERS: 2 | US FAERS | |
| 864 | Vascular encephalopathy | FAERS: 2 | US FAERS | |
| 865 | Vascular pain | FAERS: 2 | US FAERS | |
| 866 | Vascular stent thrombosis | FAERS: 2 | US FAERS | |
| 867 | Venous Injury | FAERS: 2 | US FAERS | |
| 868 | Vertebral artery occlusion | FAERS: 2 | US FAERS | |
| 869 | Vertebral column mass | FAERS: 2 | US FAERS | |
| 870 | Vulvovaginal discomfort | FAERS: 2 | US FAERS | |
| 871 | Wound dehiscence | FAERS: 2 | US FAERS | |
| 872 | Wound necrosis | FAERS: 2 | US FAERS | |
| 873 | Wrong dose | FAERS: 2 | US FAERS | |
| 874 | Wrong patient received medication | FAERS: 2 | US FAERS | |
| 875 | Wrong product administered | FAERS: 2 | US FAERS | |
| 876 | angiogram | FAERS: 2 | US FAERS | |
| 877 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 878 | Abdominal cavity drainage | FAERS: 1 | US FAERS | |
| 879 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 880 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 881 | Acid fast bacilli infection | FAERS: 1 | US FAERS | |
| 882 | Acquired foramen magnum stenosis | FAERS: 1 | US FAERS | |
| 883 | Activated partial thromboplastin time abnormal | FAERS: 1 | US FAERS | |
| 884 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 885 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 886 | Ammonia increased | FAERS: 1 | US FAERS | |
| 887 | Anal abscess | FAERS: 1 | US FAERS | |
| 888 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 889 | Ankle deformity | FAERS: 1 | US FAERS | |
| 890 | Ankylosing spondylitis | FAERS: 1 | US FAERS | |
| 891 | Anorectal ulcer | FAERS: 1 | US FAERS | |
| 892 | Anti factor X activity | FAERS: 1 | US FAERS | |
| 893 | Anti factor Xa activity decreased | FAERS: 1 | US FAERS | |
| 894 | Antibody test positive | FAERS: 1 | US FAERS | |
| 895 | Antiphospholipid Antibodies | FAERS: 1 | US FAERS | |
| 896 | Antiphospholipid antibodies negative | FAERS: 1 | US FAERS | |
| 897 | Antithrombin III Deficiency | FAERS: 1 | US FAERS | |
| 898 | Aortic Rupture | FAERS: 1 | US FAERS | |
| 899 | Aortic bypass | FAERS: 1 | US FAERS | |
| 900 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 901 | Aortic valve sclerosis | FAERS: 1 | US FAERS | |
| 902 | Aphagia | FAERS: 1 | US FAERS | |
| 903 | Arterial restenosis | FAERS: 1 | US FAERS | |
| 904 | Arterial therapeutic procedure | FAERS: 1 | US FAERS | |
| 905 | Arteriosclerotic retinopathy | FAERS: 1 | US FAERS | |
| 906 | Arteriovenous graft | FAERS: 1 | US FAERS | |
| 907 | Arteritis | FAERS: 1 | US FAERS | |
| 908 | Arthroscopy | FAERS: 1 | US FAERS | |
| 909 | Artificial crown procedure | FAERS: 1 | US FAERS | |
| 910 | Artificial heart implant | FAERS: 1 | US FAERS | |
| 911 | Asbestosis | FAERS: 1 | US FAERS | |
| 912 | Astigmatism | FAERS: 1 | US FAERS | |
| 913 | Atelectasis | FAERS: 1 | OFFSIDES US FAERS | |
| 914 | Atrial appendage closure | FAERS: 1 | US FAERS | |
| 915 | Aura | FAERS: 1 | US FAERS | |
| 916 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 917 | Basilar artery occlusion | FAERS: 1 | US FAERS | |
| 918 | Benign neoplasm of bladder | FAERS: 1 | US FAERS | |
| 919 | Bladder calculus removal | FAERS: 1 | US FAERS | |
| 920 | Bladder cancer recurrent | FAERS: 1 | US FAERS | |
| 921 | Bladder cancer stage IV | FAERS: 1 | US FAERS | |
| 922 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 923 | Bladder neoplasm surgery | FAERS: 1 | US FAERS | |
| 924 | Bladder papilloma | FAERS: 1 | US FAERS | |
| 925 | Bladder prolapse | FAERS: 1 | US FAERS | |
| 926 | Blepharitis | FAERS: 1 | US FAERS | |
| 927 | Blood albumin increased | FAERS: 1 | US FAERS | |
| 928 | Blood heavy metal increased | FAERS: 1 | US FAERS | |
| 929 | Blood iron increased | FAERS: 1 | US FAERS | |
| 930 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 931 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 932 | Blood selenium increased | FAERS: 1 | US FAERS | |
| 933 | Blood urea abnormal | FAERS: 1 | US FAERS | |
| 934 | Bloody peritoneal effluent | FAERS: 1 | US FAERS | |
| 935 | Bone fissure | FAERS: 1 | US FAERS | |
| 936 | Bone lesion | FAERS: 1 | US FAERS | |
| 937 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 938 | Brain Abscess | FAERS: 1 | US FAERS | |
| 939 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 940 | Brain stem thrombosis | FAERS: 1 | US FAERS | |
| 941 | Breast Cyst | FAERS: 1 | US FAERS | |
| 942 | Breast discomfort | FAERS: 1 | US FAERS | |
| 943 | Breast tenderness | FAERS: 1 | US FAERS | |
| 944 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 945 | Bronchial irritation | FAERS: 1 | US FAERS | |
| 946 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 947 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 948 | Bruxism | FAERS: 1 | US FAERS | |
| 949 | Bursa injury | FAERS: 1 | US FAERS | |
| 950 | Butterfly rash | FAERS: 1 | US FAERS | |
| 951 | Candida sepsis | FAERS: 1 | US FAERS | |
| 952 | Capillary Fragility | FAERS: 1 | US FAERS | |
| 953 | Cardiac Hypertrophy | FAERS: 1 | US FAERS | |
| 954 | Cardiac assistance device user | FAERS: 1 | US FAERS | |
| 955 | Cardiac cirrhosis | FAERS: 1 | US FAERS | |
| 956 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 957 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 958 | Cardiac monitoring | FAERS: 1 | US FAERS | |
| 959 | Cardiac valve fibroelastoma | FAERS: 1 | US FAERS | |
| 960 | Cardiac valve rupture | FAERS: 1 | US FAERS | |
| 961 | Cardio-respiratory distress | FAERS: 1 | US FAERS | |
| 962 | Cardiovascular evaluation | FAERS: 1 | US FAERS | |
| 963 | Catatonia | FAERS: 1 | US FAERS | |
| 964 | Catheter site injury | FAERS: 1 | US FAERS | |
| 965 | Catheter site swelling | FAERS: 1 | US FAERS | |
| 966 | Catheter site thrombosis | FAERS: 1 | US FAERS | |
| 967 | Cerebellar artery thrombosis | FAERS: 1 | US FAERS | |
| 968 | Cerebellar embolism | FAERS: 1 | US FAERS | |
| 969 | Cerebral artery stenosis | FAERS: 1 | US FAERS | |
| 970 | Cerebral microembolism | FAERS: 1 | US FAERS | |
| 971 | Cerebral vascular occlusion | FAERS: 1 | US FAERS | |
| 972 | Cerebral ventricle collapse | FAERS: 1 | US FAERS | |
| 973 | Cerebral ventricle dilatation | FAERS: 1 | US FAERS | |
| 974 | Cerebrospinal fluid retention | FAERS: 1 | US FAERS | |
| 975 | Cervical cord compression | FAERS: 1 | US FAERS | |
| 976 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 977 | Chemotherapy toxicity attenuation | FAERS: 1 | US FAERS | |
| 978 | Chemotherapy | FAERS: 1 | US FAERS | |
| 979 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 980 | Cholangiostomy | FAERS: 1 | US FAERS | |
| 981 | Cholelithotomy | FAERS: 1 | US FAERS | |
| 982 | Cholesteatoma | FAERS: 1 | US FAERS | |
| 983 | Chorioretinitis | FAERS: 1 | US FAERS | |
| 984 | Chronic left ventricular failure | FAERS: 1 | US FAERS | |
| 985 | Claustrophobia | FAERS: 1 | US FAERS | |
| 986 | Clumsiness | FAERS: 1 | US FAERS | |
| 987 | Coagulation factor VIII level abnormal | FAERS: 1 | US FAERS | |
| 988 | Coagulation factor VIII level decreased | FAERS: 1 | US FAERS | |
| 989 | Coagulation factor XIII level decreased | FAERS: 1 | US FAERS | |
| 990 | Coagulation factor increased | FAERS: 1 | US FAERS | |
| 991 | Coagulation time shortened | FAERS: 1 | US FAERS | |
| 992 | Complicated fracture | FAERS: 1 | US FAERS | |
| 993 | Confabulation | FAERS: 1 | US FAERS | |
| 994 | Congenital absence of cranial vault | FAERS: 1 | US FAERS | |
| 995 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 996 | Contraindicated product prescribed | FAERS: 1 | US FAERS | |
| 997 | Cor pulmonale | FAERS: 1 | US FAERS | |
| 998 | Coronary artery embolism | FAERS: 1 | US FAERS | |
| 999 | Corrective lens user | FAERS: 1 | US FAERS | |
| 1000 | Counterfeit product administered | FAERS: 1 | US FAERS | |
| 1001 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 1002 | Cyst removal | FAERS: 1 | US FAERS | |
| 1003 | Cystocele | FAERS: 1 | US FAERS | |
| 1004 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 1005 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 1006 | Decreased insulin requirement | FAERS: 1 | US FAERS | |
| 1007 | Dengue Fever | FAERS: 1 | US FAERS | |
| 1008 | Dental discomfort | FAERS: 1 | US FAERS | |
| 1009 | Dental examination | FAERS: 1 | US FAERS | |
| 1010 | Dental prosthesis placement | FAERS: 1 | US FAERS | |
| 1011 | Denture wearer | FAERS: 1 | US FAERS | |
| 1012 | Dependence on oxygen therapy | FAERS: 1 | US FAERS | |
| 1013 | Deprescribing error | FAERS: 1 | US FAERS | |
| 1014 | Device Failure | FAERS: 1 | US FAERS | |
| 1015 | Device breakage | FAERS: 1 | US FAERS | |
| 1016 | Device computer issue | FAERS: 1 | US FAERS | |
| 1017 | Device dependence | FAERS: 1 | US FAERS | |
| 1018 | Device deposit issue | FAERS: 1 | US FAERS | |
| 1019 | Device function test | FAERS: 1 | US FAERS | |
| 1020 | Device malfunction | FAERS: 1 | US FAERS | |
| 1021 | Disease complication | FAERS: 1 | US FAERS | |
| 1022 | Dissociation | FAERS: 1 | US FAERS | |
| 1023 | Disuse syndrome | FAERS: 1 | US FAERS | |
| 1024 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 1025 | Drain placement | FAERS: 1 | US FAERS | |
| 1026 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 1027 | Drug dispensing issue | FAERS: 1 | US FAERS | |
| 1028 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 1029 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 1030 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 1031 | Drug level below therapeutic | FAERS: 1 | US FAERS | |
| 1032 | Drug level decreased | FAERS: 1 | US FAERS | |
| 1033 | Drug monitoring procedure not performed | FAERS: 1 | US FAERS | |
| 1034 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 1035 | Dry age-related macular degeneration | FAERS: 1 | US FAERS | |
| 1036 | Dry gangrene | FAERS: 1 | US FAERS | |
| 1037 | Duodenal perforation | FAERS: 1 | US FAERS | |
| 1038 | Dysacusis | FAERS: 1 | US FAERS | |
| 1039 | Dyslexia | FAERS: 1 | US FAERS | |
| 1040 | Dystonia | FAERS: 1 | US FAERS | |
| 1041 | Ear congestion | FAERS: 1 | US FAERS | |
| 1042 | Early satiety | FAERS: 1 | US FAERS | |
| 1043 | Economic problem | FAERS: 1 | US FAERS | |
| 1044 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 1045 | Encephalitis | FAERS: 1 | US FAERS | |
| 1046 | Enterobacter sepsis | FAERS: 1 | US FAERS | |
| 1047 | Enterocolitis | FAERS: 1 | US FAERS | |
| 1048 | Entropion | FAERS: 1 | US FAERS | |
| 1049 | Enuresis | FAERS: 1 | US FAERS | |
| 1050 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 1051 | Epidermolysis Bullosa | FAERS: 1 | US FAERS | |
| 1052 | Epstein-Barr virus test positive | FAERS: 1 | US FAERS | |
| 1053 | Essential Tremor | FAERS: 1 | US FAERS | |
| 1054 | Excessive cerumen production | FAERS: 1 | US FAERS | |
| 1055 | Excoriation | FAERS: 1 | US FAERS | |
| 1056 | Exophthalmos | FAERS: 1 | US FAERS | |
| 1057 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 1058 | Eye inflammation | FAERS: 1 | US FAERS | |
| 1059 | Eyelash thickening | FAERS: 1 | US FAERS | |
| 1060 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 1061 | Factor V Leiden mutation | FAERS: 1 | US FAERS | |
| 1062 | Factor V deficiency | FAERS: 1 | US FAERS | |
| 1063 | Fasciitis | FAERS: 1 | US FAERS | |
| 1064 | Fasciotomy | FAERS: 1 | US FAERS | |
| 1065 | Fear of falling | FAERS: 1 | US FAERS | |
| 1066 | Febrile infection | FAERS: 1 | US FAERS | |
| 1067 | Fibrin D dimer decreased | FAERS: 1 | US FAERS | |
| 1068 | Fibrinolysis | FAERS: 1 | US FAERS | |
| 1069 | Fibrosis | FAERS: 1 | US FAERS | |
| 1070 | Fistula of small intestine | FAERS: 1 | US FAERS | |
| 1071 | Flight of ideas | FAERS: 1 | US FAERS | |
| 1072 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 1073 | Fluid replacement | FAERS: 1 | US FAERS | |
| 1074 | Focal Nodular Hyperplasia | FAERS: 1 | US FAERS | |
| 1075 | Food Poisoning | FAERS: 1 | US FAERS | |
| 1076 | Foraminotomy | FAERS: 1 | US FAERS | |
| 1077 | Frontotemporal dementia | FAERS: 1 | US FAERS | |
| 1078 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 1079 | Gastric dysplasia | FAERS: 1 | US FAERS | |
| 1080 | Gastric polypectomy | FAERS: 1 | US FAERS | |
| 1081 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 1082 | Gastrointestinal angiectasia | FAERS: 1 | US FAERS | |
| 1083 | Gastrointestinal dysplasia | FAERS: 1 | US FAERS | |
| 1084 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 1085 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 1086 | Gastrointestinal mucosal disorder | FAERS: 1 | US FAERS | |
| 1087 | Gastrointestinal tract adenoma | FAERS: 1 | US FAERS | |
| 1088 | General symptom | FAERS: 1 | US FAERS | |
| 1089 | Genital discharge | FAERS: 1 | US FAERS | |
| 1090 | Genital infection fungal | FAERS: 1 | US FAERS | |
| 1091 | Genital neoplasm malignant female | FAERS: 1 | US FAERS | |
| 1092 | Genitourinary operation | FAERS: 1 | US FAERS | |
| 1093 | Gingival Atrophy | FAERS: 1 | US FAERS | |
| 1094 | Gingival Hyperplasia | FAERS: 1 | US FAERS | |
| 1095 | Glaucoma surgery | FAERS: 1 | US FAERS | |
| 1096 | Glossitis | FAERS: 1 | US FAERS | |
| 1097 | Graft infection | FAERS: 1 | US FAERS | |
| 1098 | Granuloma Annulare | FAERS: 1 | US FAERS | |
| 1099 | Granulomatosis with polyangiitis | FAERS: 1 | US FAERS | |
| 1100 | Hair injury | FAERS: 1 | US FAERS | |
| 1101 | Hearing disability | FAERS: 1 | US FAERS | |
| 1102 | Heat Stroke | FAERS: 1 | US FAERS | |
| 1103 | Heat illness | FAERS: 1 | US FAERS | |
| 1104 | Heparin-induced thrombocytopenia | FAERS: 1 | US FAERS | |
| 1105 | Hepatic Infection | FAERS: 1 | US FAERS | |
| 1106 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 1107 | Hepatitis A | FAERS: 1 | US FAERS | |
| 1108 | Hepatitis B | FAERS: 1 | US FAERS | |
| 1109 | Hepatitis E | FAERS: 1 | US FAERS | |
| 1110 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 1111 | Herbal interaction | FAERS: 1 | US FAERS | |
| 1112 | Hernial eventration | FAERS: 1 | US FAERS | |
| 1113 | Heteroplasia | FAERS: 1 | US FAERS | |
| 1114 | Histiocytosis haematophagic | FAERS: 1 | US FAERS | |
| 1115 | Hordeolum | FAERS: 1 | US FAERS | |
| 1116 | Hypercapnia | FAERS: 1 | US FAERS | |
| 1117 | Hypereosinophilic syndrome | FAERS: 1 | US FAERS | |
| 1118 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 1119 | Hypersplenism | FAERS: 1 | US FAERS | |
| 1120 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 1121 | Hyperventilation | FAERS: 1 | US FAERS | |
| 1122 | Hypervitaminosis | FAERS: 1 | US FAERS | |
| 1123 | Hypokinesia | FAERS: 1 | US FAERS | |
| 1124 | Hypothalamo-pituitary disorder | FAERS: 1 | US FAERS | |
| 1125 | Hypoventilation | FAERS: 1 | US FAERS | |
| 1126 | Idiopathic Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 1127 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 1128 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 1129 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 1130 | Impaired work ability | FAERS: 1 | US FAERS | |
| 1131 | Impetigo | FAERS: 1 | US FAERS | |
| 1132 | Implant site thrombosis | FAERS: 1 | US FAERS | |
| 1133 | Inability to crawl | FAERS: 1 | US FAERS | |
| 1134 | Incarcerated hernia | FAERS: 1 | US FAERS | |
| 1135 | Incarcerated inguinal hernia | FAERS: 1 | US FAERS | |
| 1136 | Incision site pain | FAERS: 1 | US FAERS | |
| 1137 | Incisional hernia | FAERS: 1 | US FAERS | |
| 1138 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 1139 | Incorrect route of drug administration | FAERS: 1 | OFFSIDES US FAERS | |
| 1140 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 1141 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 1142 | Increased viscosity of bronchial secretion | FAERS: 1 | US FAERS | |
| 1143 | Infected dermal cyst | FAERS: 1 | US FAERS | |
| 1144 | Infectious colitis | FAERS: 1 | US FAERS | |
| 1145 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 1146 | Inflammatory pain | FAERS: 1 | US FAERS | |
| 1147 | Inhibitory drug interaction | FAERS: 1 | US FAERS | |
| 1148 | Initial insomnia | FAERS: 1 | US FAERS | |
| 1149 | Injection | FAERS: 1 | US FAERS | |
| 1150 | Insulin Resistance | FAERS: 1 | US FAERS | |
| 1151 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 1152 | Intercepted product dispensing error | FAERS: 1 | US FAERS | |
| 1153 | Intervertebral disc compression | FAERS: 1 | US FAERS | |
| 1154 | Intestinal varices | FAERS: 1 | US FAERS | |
| 1155 | Intraductal papillary mucinous neoplasm | FAERS: 1 | US FAERS | |
| 1156 | Intraductal papillary-mucinous carcinoma of pancreas | FAERS: 1 | US FAERS | |
| 1157 | Intramedullary rod insertion | FAERS: 1 | US FAERS | |
| 1158 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 1159 | Janus kinase 2 mutation | FAERS: 1 | US FAERS | |
| 1160 | Jejunal ulcer | FAERS: 1 | US FAERS | |
| 1161 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 1162 | Joint microhaemorrhage | FAERS: 1 | US FAERS | |
| 1163 | Kaolin cephalin clotting time prolonged | FAERS: 1 | US FAERS | |
| 1164 | Klebsiella test positive | FAERS: 1 | US FAERS | |
| 1165 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 1166 | Large intestinal stenosis | FAERS: 1 | US FAERS | |
| 1167 | Large intestine erosion | FAERS: 1 | US FAERS | |
| 1168 | Lead dislodgement | FAERS: 1 | US FAERS | |
| 1169 | Leriche Syndrome | FAERS: 1 | US FAERS | |
| 1170 | Lesion excision | FAERS: 1 | US FAERS | |
| 1171 | Leukoplakia | FAERS: 1 | US FAERS | |
| 1172 | Lichen Planus | FAERS: 1 | US FAERS | |
| 1173 | Ligament injury | FAERS: 1 | US FAERS | |
| 1174 | Ligament pain | FAERS: 1 | US FAERS | |
| 1175 | Lip Infection | FAERS: 1 | US FAERS | |
| 1176 | Lip erythema | FAERS: 1 | US FAERS | |
| 1177 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 1178 | Lip neoplasm malignant stage unspecified | FAERS: 1 | US FAERS | |
| 1179 | Lipoma | FAERS: 1 | US FAERS | |
| 1180 | Lipoprotein (a) increased | FAERS: 1 | US FAERS | |
| 1181 | Listeriosis | FAERS: 1 | US FAERS | |
| 1182 | Live Birth | FAERS: 1 | US FAERS | |
| 1183 | Liver carcinoma ruptured | FAERS: 1 | US FAERS | |
| 1184 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 1185 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 1186 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 1187 | Lower respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 1188 | Lung perforation | FAERS: 1 | US FAERS | |
| 1189 | Lyme Disease | FAERS: 1 | US FAERS | |
| 1190 | Lymphopenia | FAERS: 1 | US FAERS | |
| 1191 | Magnesium Deficiency | FAERS: 1 | US FAERS | |
| 1192 | Malignant neoplasm of thymus | FAERS: 1 | US FAERS | |
| 1193 | Mantle cell lymphoma | FAERS: 1 | US FAERS | |
| 1194 | Manual Lymphatic Drainage | FAERS: 1 | US FAERS | |
| 1195 | Manufacturing issue | FAERS: 1 | US FAERS | |
| 1196 | Manufacturing product shipping issue | FAERS: 1 | US FAERS | |
| 1197 | Mastectomy | FAERS: 1 | US FAERS | |
| 1198 | Mastication disorder | FAERS: 1 | US FAERS | |
| 1199 | May-Thurner Syndrome | FAERS: 1 | US FAERS | |
| 1200 | Medical device change | FAERS: 1 | US FAERS | |
| 1201 | Medical device complication | FAERS: 1 | US FAERS | |
| 1202 | Medical device site infection | FAERS: 1 | US FAERS | |
| 1203 | Medical device site pain | FAERS: 1 | US FAERS | |
| 1204 | Meniscus operation | FAERS: 1 | US FAERS | |
| 1205 | Menopause | FAERS: 1 | US FAERS | |
| 1206 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 1207 | Mesothelioma | FAERS: 1 | US FAERS | |
| 1208 | Methylenetetrahydrofolate reductase gene mutation | FAERS: 1 | US FAERS | |
| 1209 | Microembolism | FAERS: 1 | US FAERS | |
| 1210 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 1211 | Mineral supplementation | FAERS: 1 | US FAERS | |
| 1212 | Moaning | FAERS: 1 | US FAERS | |
| 1213 | Mononeuritis | FAERS: 1 | US FAERS | |
| 1214 | Motion Sickness | FAERS: 1 | US FAERS | |
| 1215 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 1216 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 1217 | Muscle abscess | FAERS: 1 | US FAERS | |
| 1218 | Myelofibrosis | FAERS: 1 | US FAERS | |
| 1219 | Myoclonus | FAERS: 1 | US FAERS | |
| 1220 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 1221 | Narcolepsy | FAERS: 1 | US FAERS | |
| 1222 | Nasal mucosa atrophy | FAERS: 1 | US FAERS | |
| 1223 | Nephritis allergic | FAERS: 1 | US FAERS | |
| 1224 | Nephrosclerosis | FAERS: 1 | US FAERS | |
| 1225 | Nervous system cyst | FAERS: 1 | US FAERS | |
| 1226 | Neurodermatitis | FAERS: 1 | US FAERS | |
| 1227 | Nipple pain | FAERS: 1 | US FAERS | |
| 1228 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 1229 | Obesity surgery | FAERS: 1 | US FAERS | |
| 1230 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 1231 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 1232 | Oliguria | FAERS: 1 | US FAERS | |
| 1233 | Onychalgia | FAERS: 1 | US FAERS | |
| 1234 | Open reduction of fracture | FAERS: 1 | US FAERS | |
| 1235 | Oral contusion | FAERS: 1 | US FAERS | |
| 1236 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 1237 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 1238 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 1239 | Orthostatic intolerance | FAERS: 1 | US FAERS | |
| 1240 | Osteolysis | FAERS: 1 | US FAERS | |
| 1241 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 1242 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 1243 | PCO2 increased | FAERS: 1 | US FAERS | |
| 1244 | PO2 decreased | FAERS: 1 | US FAERS | |
| 1245 | Pain management | FAERS: 1 | US FAERS | |
| 1246 | Pancreatectomy | FAERS: 1 | US FAERS | |
| 1247 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 1248 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 1249 | Panic Disorder | FAERS: 1 | US FAERS | |
| 1250 | Papilloma | FAERS: 1 | US FAERS | |
| 1251 | Papule | FAERS: 1 | US FAERS | |
| 1252 | Paracentesis | FAERS: 1 | US FAERS | |
| 1253 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 1254 | Paraparesis | FAERS: 1 | US FAERS | |
| 1255 | Pelvic discomfort | FAERS: 1 | US FAERS | |
| 1256 | Pelvic operation | FAERS: 1 | US FAERS | |
| 1257 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 1258 | Perinephric collection | FAERS: 1 | US FAERS | |
| 1259 | Peripheral artery bypass | FAERS: 1 | US FAERS | |
| 1260 | Peripheral artery stenosis | FAERS: 1 | US FAERS | |
| 1261 | Peritonsillar Abscess | FAERS: 1 | US FAERS | |
| 1262 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 1263 | Phimosis | FAERS: 1 | US FAERS | |
| 1264 | Phrenic nerve paralysis | FAERS: 1 | US FAERS | |
| 1265 | Plasmapheresis | FAERS: 1 | US FAERS | |
| 1266 | Platelet function test abnormal | FAERS: 1 | US FAERS | |
| 1267 | Polyarthritis | FAERS: 1 | US FAERS | |
| 1268 | Polypoidal choroidal vasculopathy | FAERS: 1 | US FAERS | |
| 1269 | Post procedural fistula | FAERS: 1 | US FAERS | |
| 1270 | Post procedural inflammation | FAERS: 1 | US FAERS | |
| 1271 | Post procedural sepsis | FAERS: 1 | US FAERS | |
| 1272 | Post-traumatic pain | FAERS: 1 | US FAERS | |
| 1273 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 1274 | Postoperative renal failure | FAERS: 1 | US FAERS | |
| 1275 | Postrenal failure | FAERS: 1 | US FAERS | |
| 1276 | Precancerous skin lesion | FAERS: 1 | US FAERS | |
| 1277 | Pregnancy on contraceptive | FAERS: 1 | US FAERS | |
| 1278 | Pregnancy | FAERS: 1 | US FAERS | |
| 1279 | Premenstrual cramps | FAERS: 1 | US FAERS | |
| 1280 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 1281 | Procoagulant therapy | FAERS: 1 | US FAERS | |
| 1282 | Proctitis | FAERS: 1 | US FAERS | |
| 1283 | Product availability issue | FAERS: 1 | US FAERS | |
| 1284 | Product closure issue | FAERS: 1 | US FAERS | |
| 1285 | Product container seal issue | FAERS: 1 | US FAERS | |
| 1286 | Product contamination physical | FAERS: 1 | US FAERS | |
| 1287 | Product counterfeit | FAERS: 1 | US FAERS | |
| 1288 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 1289 | Product distribution issue | FAERS: 1 | US FAERS | |
| 1290 | Product label confusion | FAERS: 1 | US FAERS | |
| 1291 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 1292 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 1293 | Product residue present | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1294 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 1295 | Product supply issue | FAERS: 1 | US FAERS | |
| 1296 | Prostatic Obstruction | FAERS: 1 | US FAERS | |
| 1297 | Prostatic hypoplasia | FAERS: 1 | US FAERS | |
| 1298 | Prostatic pain | FAERS: 1 | US FAERS | |
| 1299 | Prostatic specific antigen decreased | FAERS: 1 | US FAERS | |
| 1300 | Prosthesis Implantation | FAERS: 1 | US FAERS | |
| 1301 | Protein C Deficiency | FAERS: 1 | US FAERS | |
| 1302 | Protein C decreased | FAERS: 1 | US FAERS | |
| 1303 | Protein total abnormal | FAERS: 1 | US FAERS | |
| 1304 | Prothrombin time ratio abnormal | FAERS: 1 | US FAERS | |
| 1305 | Prurigo | FAERS: 1 | US FAERS | |
| 1306 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 1307 | Pseudomonal sepsis | FAERS: 1 | US FAERS | |
| 1308 | Psychiatric evaluation | FAERS: 1 | US FAERS | |
| 1309 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 1310 | Psychological Trauma | FAERS: 1 | US FAERS | |
| 1311 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 1312 | Psychotic symptom | FAERS: 1 | US FAERS | |
| 1313 | Pterygium | FAERS: 1 | US FAERS | |
| 1314 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 1315 | Pulmonary Valve Stenosis | FAERS: 1 | US FAERS | |
| 1316 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 1317 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 1318 | Pulmonary tuberculoma | FAERS: 1 | US FAERS | |
| 1319 | Pulmonary vascular disorder | FAERS: 1 | US FAERS | |
| 1320 | Pustular psoriasis | FAERS: 1 | US FAERS | |
| 1321 | Pyelocaliectasis | FAERS: 1 | US FAERS | |
| 1322 | Quadriparesis | FAERS: 1 | US FAERS | |
| 1323 | Radiation injury | FAERS: 1 | US FAERS | |
| 1324 | Radiation prostatitis | FAERS: 1 | US FAERS | |
| 1325 | Radicular pain | FAERS: 1 | US FAERS | |
| 1326 | Radiotherapy to thyroid | FAERS: 1 | US FAERS | |
| 1327 | Rash follicular | FAERS: 1 | US FAERS | |
| 1328 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 1329 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 1330 | Rectal fissure | FAERS: 1 | US FAERS | |
| 1331 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 1332 | Rectocele | FAERS: 1 | US FAERS | |
| 1333 | Refusal of examination | FAERS: 1 | US FAERS | |
| 1334 | Refusal of treatment by relative | FAERS: 1 | US FAERS | |
| 1335 | Renal artery occlusion | FAERS: 1 | US FAERS | |
| 1336 | Renal cancer metastatic | FAERS: 1 | US FAERS | |
| 1337 | Renal mass | FAERS: 1 | US FAERS | |
| 1338 | Respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 1339 | Respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 1340 | Retinal vascular occlusion | FAERS: 1 | US FAERS | |
| 1341 | Rheumatic Heart Disease | FAERS: 1 | US FAERS | |
| 1342 | Right Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 1343 | Right atrial enlargement | FAERS: 1 | US FAERS | |
| 1344 | Rosacea | FAERS: 1 | US FAERS | |
| 1345 | Salivary gland operation | FAERS: 1 | US FAERS | |
| 1346 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 1347 | Scedosporium infection | FAERS: 1 | US FAERS | |
| 1348 | Scleroderma | FAERS: 1 | US FAERS | |
| 1349 | Sclerotherapy | FAERS: 1 | US FAERS | |
| 1350 | Screaming | FAERS: 1 | US FAERS | |
| 1351 | Secondary hypertension | FAERS: 1 | US FAERS | |
| 1352 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 1353 | Shoulder deformity | FAERS: 1 | US FAERS | |
| 1354 | Sight disability | FAERS: 1 | US FAERS | |
| 1355 | Silicosis | FAERS: 1 | US FAERS | |
| 1356 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 1357 | Sinusitis aspergillus | FAERS: 1 | US FAERS | |
| 1358 | Skin Induration | FAERS: 1 | US FAERS | |
| 1359 | Skin graft rejection | FAERS: 1 | US FAERS | |
| 1360 | Slow speech | FAERS: 1 | US FAERS | |
| 1361 | Small cell lung cancer metastatic | FAERS: 1 | US FAERS | |
| 1362 | Small intestine carcinoma | FAERS: 1 | US FAERS | |
| 1363 | Somatic symptom disorder | FAERS: 1 | US FAERS | |
| 1364 | Somnambulism | FAERS: 1 | US FAERS | |
| 1365 | Spinal Stenosis | FAERS: 1 | US FAERS | |
| 1366 | Spinal cord paralysis | FAERS: 1 | US FAERS | |
| 1367 | Splenic hamartoma | FAERS: 1 | US FAERS | |
| 1368 | Squamous cell carcinoma of lung | FAERS: 1 | US FAERS | |
| 1369 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 1370 | Starvation | FAERS: 1 | US FAERS | |
| 1371 | Stoma closure | FAERS: 1 | US FAERS | |
| 1372 | Strabismus | FAERS: 1 | US FAERS | |
| 1373 | Subclavian Steal Syndrome | FAERS: 1 | US FAERS | |
| 1374 | Subclavian artery occlusion | FAERS: 1 | US FAERS | |
| 1375 | Subclavian artery thrombosis | FAERS: 1 | US FAERS | |
| 1376 | Superinfection | FAERS: 1 | US FAERS | |
| 1377 | Surgical failure | FAERS: 1 | US FAERS | |
| 1378 | Surgical skin tear | FAERS: 1 | US FAERS | |
| 1379 | Suture insertion | FAERS: 1 | US FAERS | |
| 1380 | Suture rupture | FAERS: 1 | US FAERS | |
| 1381 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 1382 | Synovitis | FAERS: 1 | US FAERS | |
| 1383 | Syphilis | FAERS: 1 | US FAERS | |
| 1384 | Systemic mycosis | FAERS: 1 | US FAERS | |
| 1385 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 1386 | Teeth brittle | FAERS: 1 | US FAERS | |
| 1387 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 1388 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 1389 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 1390 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 1391 | Thoracostomy | FAERS: 1 | US FAERS | |
| 1392 | Thoracotomy | FAERS: 1 | US FAERS | |
| 1393 | Thromboangiitis Obliterans | FAERS: 1 | US FAERS | |
| 1394 | Thrombotic cerebral infarction | FAERS: 1 | US FAERS | |
| 1395 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 1396 | Thyroid fibrosis | FAERS: 1 | US FAERS | |
| 1397 | Tick-borne fever | FAERS: 1 | US FAERS | |
| 1398 | Toe operation | FAERS: 1 | US FAERS | |
| 1399 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 1400 | Tonsillitis | FAERS: 1 | US FAERS | |
| 1401 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 1402 | Transcription medication error | FAERS: 1 | US FAERS | |
| 1403 | Transfusion-Related Acute Lung Injury | FAERS: 1 | US FAERS | |
| 1404 | Transvalvular pressure gradient increased | FAERS: 1 | US FAERS | |
| 1405 | Trichiasis | FAERS: 1 | US FAERS | |
| 1406 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 1407 | Troponin I increased | FAERS: 1 | US FAERS | |
| 1408 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 1409 | Ureterolithiasis | FAERS: 1 | US FAERS | |
| 1410 | Urinary tract infection enterococcal | FAERS: 1 | US FAERS | |
| 1411 | Urinary tract polyp | FAERS: 1 | US FAERS | |
| 1412 | Urine output increased | FAERS: 1 | US FAERS | |
| 1413 | Urine potassium increased | FAERS: 1 | US FAERS | |
| 1414 | Uterine dilation and evacuation | FAERS: 1 | US FAERS | |
| 1415 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 1416 | Varicophlebitis | FAERS: 1 | US FAERS | |
| 1417 | Vascular compression | FAERS: 1 | US FAERS | |
| 1418 | Vascular stent occlusion | FAERS: 1 | US FAERS | |
| 1419 | Vasculitic rash | FAERS: 1 | US FAERS | |
| 1420 | Vein collapse | FAERS: 1 | US FAERS | |
| 1421 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 1422 | Ventricular failure | FAERS: 1 | US FAERS | |
| 1423 | Vertebral Artery Stenosis | FAERS: 1 | US FAERS | |
| 1424 | Vertebroplasty | FAERS: 1 | US FAERS | |
| 1425 | Vessel puncture site bruise | FAERS: 1 | US FAERS | |
| 1426 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 1427 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 1428 | Vitreous injury | FAERS: 1 | US FAERS | |
| 1429 | Vocal Cord Dysfunction | FAERS: 1 | US FAERS | |
| 1430 | Vulval cancer metastatic | FAERS: 1 | US FAERS | |
| 1431 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 1432 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 1433 | Walking aid user | FAERS: 1 | US FAERS | |
| 1434 | Withdrawal hypertension | FAERS: 1 | US FAERS | |
| 1435 | Wound abscess | FAERS: 1 | US FAERS | |
| 1436 | Wound closure | FAERS: 1 | US FAERS | |
| 1437 | Wrong strength | FAERS: 1 | US FAERS | |
| 1438 | effusion | FAERS: 1 | US FAERS | |
| 1439 | keratoacanthoma | FAERS: 1 | US FAERS | |
| 1440 | muscle injury | FAERS: 1 | US FAERS | |
| 1441 | neurofibroma | FAERS: 1 | US FAERS | |
| 1442 | ovarian neoplasm | FAERS: 1 | US FAERS | |
| 1443 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 1444 | Abnormal vision | OFFSIDES | ||
| 1445 | Agraphia | OFFSIDES | ||
| 1446 | Alanine aminotransferase abnormal | SIDER | ||
| 1447 | Anticonvulsant drug level increased | OFFSIDES | ||
| 1448 | Bacterial disease carrier | OFFSIDES | ||
| 1449 | Blood and lymphatic system disorders | SIDER | ||
| 1450 | Blood sodium | OFFSIDES | ||
| 1451 | Blood thyroid stimulating hormone | OFFSIDES | ||
| 1452 | Bronchopneumonia | OFFSIDES | ||
| 1453 | Chemotherapeutic drug level increased | OFFSIDES | ||
| 1454 | Drowsiness | OFFSIDES | ||
| 1455 | Eosinophilic myocarditis | OFFSIDES | ||
| 1456 | Hiccough | OFFSIDES | ||
| 1457 | Intentional drug misuse | OFFSIDES | ||
| 1458 | Intraoperative Hemorrhage | SIDER | ||
| 1459 | Intraspinal bleeding | SIDER | ||
| 1460 | Procedural hypotension | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.