Mycophenolic Acid
(RTGDFNSFWBGLEC-SYZQJQIISA-N)
Structure
- SMILES
- COc1c(C/C=C(/CCC(=O)OCCN2CCOCC2)\C)c(O)c2c(c1C)COC2=O
- Type(s)
- Approved; Investigational
- Molecular Formula:
- C23H31NO7
- Molecular Weight:
- 433.495
- Log P:
- 2.4619
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 1
- TPSA:
- 94.53
- CAS Number(s):
- 115007-34-6; 128794-94-5
Synonym(s)
1.
Mycophenolic Acid
2.
Cellcept
3.
Mycophenolate Mofetil
4.
Mycophenolate Mofetil Hydrochloride
5.
Mycophenolate Sodium
6.
Mycophenolic Acid Morpholinoethyl Ester
7.
Myfortic
8.
RS 61443
9.
RS-61443
10.
Sodium Mycophenolate
11.
Mofetil Hydrochloride, Mycophenolate
12.
Mofetil, Mycophenolate
13.
Mycophenolate, Sodium
14.
RS61443
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Intentional product use issue | FAERS: 145 | US FAERS | |
| 2 | Malaise | FAERS: 123 | US FAERS | |
| 3 | Drug dose omission | FAERS: 111 | US FAERS | |
| 4 | Nausea | FAERS: 100 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | No adverse event | FAERS: 96 | US FAERS | |
| 6 | Pneumonia | FAERS: 96 | US FAERS | |
| 7 | Drug ineffective | FAERS: 94 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 8 | Cerebrovascular accident | FAERS: 92 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Product use in unapproved indication | FAERS: 83 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Vomiting | FAERS: 83 | US FAERS | |
| 11 | Infection | FAERS: 72 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 12 | Colitis | FAERS: 66 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Headache | FAERS: 65 | US FAERS | |
| 14 | Fatigue | FAERS: 62 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 15 | Hypercreatinaemia | FAERS: 57 | US FAERS | |
| 16 | Myocardial Infarction | FAERS: 56 | US FAERS | |
| 17 | Abdominal Pain | FAERS: 52 | US FAERS | |
| 18 | Blood creatinine increased | FAERS: 51 | OFFSIDES US FAERS | |
| 19 | Respiratory Failure | FAERS: 47 | OFFSIDES US FAERS | |
| 20 | Disease Progression | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Therapy cessation | FAERS: 44 | US FAERS | |
| 22 | Abdominal discomfort | FAERS: 41 | US FAERS | |
| 23 | Asthenia | FAERS: 39 | US FAERS | |
| 24 | Medication Error | FAERS: 38 | US FAERS | |
| 25 | Weight decreased | FAERS: 38 | US FAERS | |
| 26 | Dizziness | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Sepsis | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Urinary tract infection | FAERS: 36 | US FAERS | |
| 29 | Disease recurrence | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 30 | Apoptosis | FAERS: 32 | US FAERS | |
| 31 | Product substitution issue | FAERS: 32 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 32 | Alopecia | FAERS: 31 | OFFSIDES US FAERS | |
| 33 | Cardiac Arrest | FAERS: 30 | US FAERS | |
| 34 | Incorrect dose administered | FAERS: 30 | US FAERS | |
| 35 | Maternal exposure during pregnancy | FAERS: 30 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 36 | Neutropenia | FAERS: 30 | US FAERS | |
| 37 | Peripheral swelling | FAERS: 29 | US FAERS | |
| 38 | Dehydration | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Leukopenia | FAERS: 27 | US FAERS | |
| 40 | Pain | FAERS: 27 | OFFSIDES US FAERS | |
| 41 | Proteinuria | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Tremor | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Pruritus | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 44 | treatment failure | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Arthralgia | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Back Pain | FAERS: 24 | US FAERS | |
| 47 | Pregnancy | FAERS: 24 | US FAERS | |
| 48 | Wrong technique in product usage process | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Hepatotoxicity | FAERS: 23 | US FAERS | |
| 50 | Thrombocytopenia | FAERS: 23 | US FAERS | |
| 51 | White blood cell count decreased | FAERS: 23 | US FAERS | |
| 52 | Blindness | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 53 | Drug ineffective for unapproved indication | FAERS: 22 | US FAERS | |
| 54 | Nephrotic Syndrome | FAERS: 22 | US FAERS | |
| 55 | Product quality issue | FAERS: 21 | US FAERS | |
| 56 | Anxiety | FAERS: 20 | OFFSIDES US FAERS | |
| 57 | Glomerulonephritis | FAERS: 20 | US FAERS | |
| 58 | Septic Shock | FAERS: 19 | US FAERS | |
| 59 | Suicide attempt | FAERS: 19 | US FAERS | |
| 60 | Thrombosis | FAERS: 19 | US FAERS | |
| 61 | Dyspepsia | FAERS: 18 | US FAERS | |
| 62 | General physical health deterioration | FAERS: 18 | OFFSIDES US FAERS | |
| 63 | Viral upper respiratory tract infection | FAERS: 18 | US FAERS | |
| 64 | Bronchiectasis | FAERS: 17 | US FAERS | |
| 65 | Influenza | FAERS: 17 | US FAERS | |
| 66 | Lupus Nephritis | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Myalgia | FAERS: 17 | US FAERS | |
| 68 | Myasthenia Gravis | FAERS: 17 | US FAERS | |
| 69 | Agranulocytosis | FAERS: 16 | US FAERS | |
| 70 | Amnesia | FAERS: 16 | US FAERS | |
| 71 | Apoptotic colonopathy | FAERS: 16 | US FAERS | |
| 72 | Deafness | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 73 | Overdose | FAERS: 16 | US FAERS | |
| 74 | Pancreatitis | FAERS: 16 | US FAERS | |
| 75 | Product dose omission | FAERS: 16 | US FAERS | |
| 76 | Abasia | FAERS: 15 | OFFSIDES US FAERS | |
| 77 | Ascites | FAERS: 15 | US FAERS | |
| 78 | Chest Pain | FAERS: 15 | US FAERS | |
| 79 | Constipation | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Feeling abnormal | FAERS: 15 | US FAERS | |
| 81 | Memory impairment | FAERS: 15 | US FAERS | |
| 82 | Remission not achieved | FAERS: 15 | US FAERS | |
| 83 | Hypersensitivity | FAERS: 14 | US FAERS | |
| 84 | Hypotension | FAERS: 14 | US FAERS | |
| 85 | Liver transplant rejection | FAERS: 14 | OFFSIDES US FAERS | |
| 86 | Pulmonary Embolism | FAERS: 14 | US FAERS | |
| 87 | Sinusitis | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 88 | Therapy non-responder | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 89 | Cellulitis | FAERS: 13 | US FAERS | |
| 90 | Diabetes Mellitus | FAERS: 13 | US FAERS | |
| 91 | Posterior reversible encephalopathy syndrome | FAERS: 13 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 92 | Visual Impairment | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 93 | Drug exposure during pregnancy | FAERS: 12 | US FAERS | |
| 94 | Exposure via father | FAERS: 12 | US FAERS | |
| 95 | Gastrointestinal toxicity | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Intestinal Obstruction | FAERS: 12 | US FAERS | |
| 97 | Swelling | FAERS: 12 | US FAERS | |
| 98 | Toxicity to various agents | FAERS: 12 | US FAERS | |
| 99 | Acute kidney injury | FAERS: 11 | US FAERS | |
| 100 | Drug administration error | FAERS: 11 | US FAERS | |
| 101 | Product use issue | FAERS: 11 | US FAERS | |
| 102 | Skin Ulcer | FAERS: 11 | US FAERS | |
| 103 | Urticaria | FAERS: 11 | US FAERS | |
| 104 | Bronchitis | FAERS: 10 | US FAERS | |
| 105 | Erythema | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 106 | Tachycardia | FAERS: 10 | US FAERS | |
| 107 | Therapy change | FAERS: 10 | US FAERS | |
| 108 | Transaminases increased | FAERS: 10 | US FAERS | |
| 109 | Blood glucose increased | FAERS: 9 | US FAERS | |
| 110 | Dysgeusia | FAERS: 9 | US FAERS | |
| 111 | Epilepsy | FAERS: 9 | OFFSIDES US FAERS | |
| 112 | Flatulence | FAERS: 9 | US FAERS | |
| 113 | Hepatitis C | FAERS: 9 | OFFSIDES US FAERS | |
| 114 | Product dispensing error | FAERS: 9 | US FAERS | |
| 115 | Unevaluable event | FAERS: 9 | US FAERS | |
| 116 | Accidental exposure to product | FAERS: 8 | US FAERS | |
| 117 | Cerebral Infarction | FAERS: 8 | US FAERS | |
| 118 | Chills | FAERS: 8 | US FAERS | |
| 119 | Choking | FAERS: 8 | US FAERS | |
| 120 | Intercepted medication error | FAERS: 8 | US FAERS | |
| 121 | Joint swelling | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 122 | Large intestine perforation | FAERS: 8 | US FAERS | |
| 123 | Multiple Sclerosis | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 124 | Nephrosclerosis | FAERS: 8 | US FAERS | |
| 125 | Optic Neuritis | FAERS: 8 | US FAERS | |
| 126 | Oropharyngeal pain | FAERS: 8 | OFFSIDES US FAERS | |
| 127 | Vasculitis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 128 | jaundice | FAERS: 8 | US FAERS | |
| 129 | nervous system disorder | FAERS: 8 | US FAERS | |
| 130 | Acute myocardial infarction | FAERS: 7 | US FAERS | |
| 131 | Asthma | FAERS: 7 | US FAERS | |
| 132 | Chest discomfort | FAERS: 7 | US FAERS | |
| 133 | Cholelithiasis | FAERS: 7 | US FAERS | |
| 134 | Dementia | FAERS: 7 | US FAERS | |
| 135 | Expired product administered | FAERS: 7 | US FAERS | |
| 136 | Failure to Thrive | FAERS: 7 | US FAERS | |
| 137 | Hepatic Encephalopathy | FAERS: 7 | US FAERS | |
| 138 | Hepatitis | FAERS: 7 | US FAERS | |
| 139 | Immunosuppression | FAERS: 7 | US FAERS | |
| 140 | Lymphoma | FAERS: 7 | US FAERS | |
| 141 | Meningitis | FAERS: 7 | US FAERS | |
| 142 | Night sweats | FAERS: 7 | US FAERS | |
| 143 | Pancytopenia | FAERS: 7 | US FAERS | |
| 144 | Peritonitis | FAERS: 7 | US FAERS | |
| 145 | Pulmonary Fibrosis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 146 | Skin lesion | FAERS: 7 | OFFSIDES US FAERS | |
| 147 | Somnolence | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 148 | Squamous cell carcinoma | FAERS: 7 | US FAERS | |
| 149 | Status Epilepticus | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 150 | Accidental overdose | FAERS: 6 | US FAERS | |
| 151 | Acute respiratory failure | FAERS: 6 | US FAERS | |
| 152 | Adverse event | FAERS: 6 | US FAERS | |
| 153 | Angioedema | FAERS: 6 | US FAERS | |
| 154 | Ankle Fracture | FAERS: 6 | US FAERS | |
| 155 | Atrial Fibrillation | FAERS: 6 | US FAERS | |
| 156 | Bone pain | FAERS: 6 | OFFSIDES US FAERS | |
| 157 | C3 glomerulopathy | FAERS: 6 | US FAERS | |
| 158 | Circumstance or information capable of leading to medication error | FAERS: 6 | US FAERS | |
| 159 | Completed Suicide | FAERS: 6 | US FAERS | |
| 160 | Cytopenia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 161 | Drug dispensing error | FAERS: 6 | US FAERS | |
| 162 | Dry skin | FAERS: 6 | OFFSIDES US FAERS | |
| 163 | Enteritis | FAERS: 6 | US FAERS | |
| 164 | Full blood count decreased | FAERS: 6 | US FAERS | |
| 165 | Gout | FAERS: 6 | OFFSIDES US FAERS | |
| 166 | Lymphopenia | FAERS: 6 | US FAERS | |
| 167 | Malabsorption | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 168 | Mental status changes | FAERS: 6 | US FAERS | |
| 169 | Nasopharyngitis | FAERS: 6 | US FAERS | |
| 170 | Peripheral arterial occlusive disease | FAERS: 6 | US FAERS | |
| 171 | Product preparation error | FAERS: 6 | US FAERS | |
| 172 | Respiratory arrest | FAERS: 6 | US FAERS | |
| 173 | Scleroderma | FAERS: 6 | US FAERS | |
| 174 | Skin hypertrophy | FAERS: 6 | OFFSIDES US FAERS | |
| 175 | Stress | FAERS: 6 | US FAERS | |
| 176 | Acne | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 177 | BK virus infection | FAERS: 5 | US FAERS | |
| 178 | Biliary sepsis | FAERS: 5 | US FAERS | |
| 179 | Blood urea increased | FAERS: 5 | US FAERS | |
| 180 | Cholangitis | FAERS: 5 | US FAERS | |
| 181 | Cholecystitis | FAERS: 5 | US FAERS | |
| 182 | Cleft Palate | FAERS: 5 | US FAERS | |
| 183 | Cystitis | FAERS: 5 | US FAERS | |
| 184 | Drug prescribing error | FAERS: 5 | OFFSIDES US FAERS | |
| 185 | Dysarthria | FAERS: 5 | US FAERS | |
| 186 | Dysuria | FAERS: 5 | US FAERS | |
| 187 | Emotional distress | FAERS: 5 | OFFSIDES US FAERS | |
| 188 | Exposure via skin contact | FAERS: 5 | US FAERS | |
| 189 | Extra dose administered | FAERS: 5 | US FAERS | |
| 190 | Gangrene | FAERS: 5 | US FAERS | |
| 191 | Gastritis | FAERS: 5 | US FAERS | |
| 192 | Glaucoma | FAERS: 5 | OFFSIDES US FAERS | |
| 193 | Hernia | FAERS: 5 | US FAERS | |
| 194 | Hyperkeratosis | FAERS: 5 | OFFSIDES US FAERS | |
| 195 | Insurance issue | FAERS: 5 | US FAERS | |
| 196 | Laryngitis | FAERS: 5 | US FAERS | |
| 197 | Lethargy | FAERS: 5 | US FAERS | |
| 198 | Lower respiratory tract infection | FAERS: 5 | US FAERS | |
| 199 | Macular degeneration | FAERS: 5 | US FAERS | |
| 200 | Metastatic Neoplasm | FAERS: 5 | US FAERS | |
| 201 | Myopathy | FAERS: 5 | US FAERS | |
| 202 | Necrosis | FAERS: 5 | US FAERS | |
| 203 | Nephrolithiasis | FAERS: 5 | US FAERS | |
| 204 | Palpitations | FAERS: 5 | US FAERS | |
| 205 | Pneumonitis | FAERS: 5 | US FAERS | |
| 206 | Pregnancy of partner | FAERS: 5 | US FAERS | |
| 207 | Productive Cough | FAERS: 5 | US FAERS | |
| 208 | Renal tubular necrosis | FAERS: 5 | OFFSIDES US FAERS | |
| 209 | Respiratory distress | FAERS: 5 | US FAERS | |
| 210 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 211 | Arthritis | FAERS: 4 | US FAERS | |
| 212 | Autoimmune hepatitis | FAERS: 4 | OFFSIDES US FAERS | |
| 213 | Basal cell carcinoma | FAERS: 4 | US FAERS | |
| 214 | Bedridden | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 215 | Blood creatine phosphokinase increased | FAERS: 4 | US FAERS | |
| 216 | Bradycardia | FAERS: 4 | US FAERS | |
| 217 | Candidiasis | FAERS: 4 | US FAERS | |
| 218 | Cataract | FAERS: 4 | OFFSIDES US FAERS | |
| 219 | Cerebral disorder | FAERS: 4 | US FAERS | |
| 220 | Colonoscopy abnormal | FAERS: 4 | US FAERS | |
| 221 | Coronary Artery Disease | FAERS: 4 | US FAERS | |
| 222 | Deep Vein Thrombosis | FAERS: 4 | US FAERS | |
| 223 | Double Outlet Right Ventricle | FAERS: 4 | US FAERS | |
| 224 | Eczema | FAERS: 4 | US FAERS | |
| 225 | Endocarditis | FAERS: 4 | OFFSIDES US FAERS | |
| 226 | Febrile Neutropenia | FAERS: 4 | US FAERS | |
| 227 | Flank Pain | FAERS: 4 | US FAERS | |
| 228 | Gastroenteritis | FAERS: 4 | OFFSIDES US FAERS | |
| 229 | Hyperparathyroidism | FAERS: 4 | US FAERS | |
| 230 | Hypertensive crisis | FAERS: 4 | US FAERS | |
| 231 | Hypophagia | FAERS: 4 | US FAERS | |
| 232 | Immunosuppressant drug level decreased | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 233 | Inappropriate schedule of drug administration | FAERS: 4 | US FAERS | |
| 234 | Incorrect product storage | FAERS: 4 | US FAERS | |
| 235 | Inflammation | FAERS: 4 | US FAERS | |
| 236 | Injection site extravasation | FAERS: 4 | US FAERS | |
| 237 | Intestinal Perforation | FAERS: 4 | US FAERS | |
| 238 | Leukocytosis | FAERS: 4 | US FAERS | |
| 239 | Leukoencephalopathy | FAERS: 4 | US FAERS | |
| 240 | Lip swelling | FAERS: 4 | US FAERS | |
| 241 | Lung transplant rejection | FAERS: 4 | US FAERS | |
| 242 | Mental impairment | FAERS: 4 | US FAERS | |
| 243 | Mood swings | FAERS: 4 | US FAERS | |
| 244 | Pancreatic carcinoma | FAERS: 4 | US FAERS | |
| 245 | Patent ductus arteriosus | FAERS: 4 | US FAERS | |
| 246 | Pemphigus | FAERS: 4 | US FAERS | |
| 247 | Pericardial effusion | FAERS: 4 | OFFSIDES US FAERS | |
| 248 | Pericarditis | FAERS: 4 | OFFSIDES US FAERS | |
| 249 | Polymorphonuclear chromatin clumping | FAERS: 4 | US FAERS | |
| 250 | Protein urine present | FAERS: 4 | US FAERS | |
| 251 | Rheumatoid Arthritis | FAERS: 4 | US FAERS | |
| 252 | Syncope | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 253 | Therapy partial responder | FAERS: 4 | US FAERS | |
| 254 | Throat cancer | FAERS: 4 | US FAERS | |
| 255 | Throat irritation | FAERS: 4 | US FAERS | |
| 256 | Vertigo | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 257 | Wrong patient received medication | FAERS: 4 | US FAERS | |
| 258 | Abscess | FAERS: 3 | US FAERS | |
| 259 | Acoustic neuritis | FAERS: 3 | US FAERS | |
| 260 | Alanine Aminotransferase Increased | FAERS: 3 | OFFSIDES US FAERS | |
| 261 | Aneurysm | FAERS: 3 | US FAERS | |
| 262 | Antinuclear antibody increased | FAERS: 3 | US FAERS | |
| 263 | Arthropathy | FAERS: 3 | US FAERS | |
| 264 | Back disorder | FAERS: 3 | US FAERS | |
| 265 | Bacterial sepsis | FAERS: 3 | OFFSIDES US FAERS | |
| 266 | Blood albumin decreased | FAERS: 3 | US FAERS | |
| 267 | Blood count abnormal | FAERS: 3 | US FAERS | |
| 268 | Blood glucose abnormal | FAERS: 3 | US FAERS | |
| 269 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 270 | Blood potassium increased | FAERS: 3 | OFFSIDES US FAERS | |
| 271 | Bone marrow depression | FAERS: 3 | US FAERS | |
| 272 | Bronchopulmonary Aspergillosis | FAERS: 3 | US FAERS | |
| 273 | Burning sensation | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 274 | Calcinosis | FAERS: 3 | US FAERS | |
| 275 | Central nervous system lesion | FAERS: 3 | US FAERS | |
| 276 | Cerebral Thrombosis | FAERS: 3 | US FAERS | |
| 277 | Clostridium difficile infection | FAERS: 3 | US FAERS | |
| 278 | Complications of maternal exposure to therapeutic drugs | FAERS: 3 | US FAERS | |
| 279 | Complications of transplant surgery | FAERS: 3 | US FAERS | |
| 280 | Crying | FAERS: 3 | US FAERS | |
| 281 | Cyst | FAERS: 3 | US FAERS | |
| 282 | Cytomegalovirus gastrointestinal infection | FAERS: 3 | US FAERS | |
| 283 | Cytomegalovirus test positive | FAERS: 3 | OFFSIDES US FAERS | |
| 284 | Deformity | FAERS: 3 | US FAERS | |
| 285 | Disseminated Intravascular Coagulation | FAERS: 3 | US FAERS | |
| 286 | Diverticulitis | FAERS: 3 | US FAERS | |
| 287 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 288 | Drug level decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 289 | Dysphonia | FAERS: 3 | US FAERS | |
| 290 | Ecchymosis | FAERS: 3 | US FAERS | |
| 291 | Economic problem | FAERS: 3 | US FAERS | |
| 292 | Encephalitis | FAERS: 3 | US FAERS | |
| 293 | Epistaxis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 294 | Epstein-Barr virus associated lymphoproliferative disorder | FAERS: 3 | OFFSIDES US FAERS | |
| 295 | Erectile dysfunction | FAERS: 3 | US FAERS | |
| 296 | Exposure to chemical pollution | FAERS: 3 | US FAERS | |
| 297 | Extravasation | FAERS: 3 | US FAERS | |
| 298 | Eye irritation | FAERS: 3 | US FAERS | |
| 299 | Flushing | FAERS: 3 | US FAERS | |
| 300 | Fracture | FAERS: 3 | US FAERS | |
| 301 | Frontotemporal dementia | FAERS: 3 | US FAERS | |
| 302 | Gastrectomy | FAERS: 3 | US FAERS | |
| 303 | Gastric ulcer | FAERS: 3 | US FAERS | |
| 304 | Gastrointestinal infection | FAERS: 3 | US FAERS | |
| 305 | Graft versus host disease in gastrointestinal tract | FAERS: 3 | US FAERS | |
| 306 | Granulomatosis with polyangiitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 307 | Hepatic necrosis | FAERS: 3 | US FAERS | |
| 308 | Histiocytosis haematophagic | FAERS: 3 | OFFSIDES US FAERS | |
| 309 | Human polyomavirus infection | FAERS: 3 | US FAERS | |
| 310 | Hydrocephalus | FAERS: 3 | US FAERS | |
| 311 | Hyperthyroidism | FAERS: 3 | US FAERS | |
| 312 | Idiopathic Pulmonary Fibrosis | FAERS: 3 | US FAERS | |
| 313 | Ileus | FAERS: 3 | US FAERS | |
| 314 | Infective glossitis | FAERS: 3 | US FAERS | |
| 315 | Infertility | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 316 | Intercepted product storage error | FAERS: 3 | US FAERS | |
| 317 | Intestinal villi atrophy | FAERS: 3 | US FAERS | |
| 318 | Intracranial Aneurysm | FAERS: 3 | US FAERS | |
| 319 | Laceration | FAERS: 3 | US FAERS | |
| 320 | Limb discomfort | FAERS: 3 | US FAERS | |
| 321 | Lymphocyte count decreased | FAERS: 3 | US FAERS | |
| 322 | Malnutrition | FAERS: 3 | US FAERS | |
| 323 | Manufacturing product shipping issue | FAERS: 3 | US FAERS | |
| 324 | Maternal exposure timing unspecified | FAERS: 3 | US FAERS | |
| 325 | Medication residue present | FAERS: 3 | US FAERS | |
| 326 | Myocarditis | FAERS: 3 | US FAERS | |
| 327 | Nerve injury | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 328 | Neuritis | FAERS: 3 | US FAERS | |
| 329 | Neutrophil count decreased | FAERS: 3 | US FAERS | |
| 330 | Neutrophil morphology abnormal | FAERS: 3 | US FAERS | |
| 331 | Paternal exposure during pregnancy | FAERS: 3 | US FAERS | |
| 332 | Pleurisy | FAERS: 3 | US FAERS | |
| 333 | Pneumocystis jiroveci pneumonia | FAERS: 3 | US FAERS | |
| 334 | Polydactyly | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 335 | Poor quality drug administered | FAERS: 3 | US FAERS | |
| 336 | Product administration error | FAERS: 3 | US FAERS | |
| 337 | Product contamination physical | FAERS: 3 | US FAERS | |
| 338 | Product physical issue | FAERS: 3 | US FAERS | |
| 339 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 340 | Pulmonary Valve Stenosis | FAERS: 3 | US FAERS | |
| 341 | Pulmonary congestion | FAERS: 3 | US FAERS | |
| 342 | Pulmonary function test decreased | FAERS: 3 | US FAERS | |
| 343 | Radiculopathy | FAERS: 3 | US FAERS | |
| 344 | Rash erythematous | FAERS: 3 | US FAERS | |
| 345 | Renal pain | FAERS: 3 | US FAERS | |
| 346 | Rhabdomyolysis | FAERS: 3 | OFFSIDES US FAERS | |
| 347 | Rhinitis | FAERS: 3 | US FAERS | |
| 348 | Shock | FAERS: 3 | US FAERS | |
| 349 | Skin Papilloma | FAERS: 3 | US FAERS | |
| 350 | Somnambulism | FAERS: 3 | US FAERS | |
| 351 | Spinal fusion surgery | FAERS: 3 | US FAERS | |
| 352 | Stomatitis | FAERS: 3 | US FAERS | |
| 353 | Suspected counterfeit product | FAERS: 3 | US FAERS | |
| 354 | Temperature intolerance | FAERS: 3 | US FAERS | |
| 355 | Therapeutic response changed | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 356 | Tinnitus | FAERS: 3 | US FAERS | |
| 357 | Ulcer | FAERS: 3 | US FAERS | |
| 358 | Ventricular hypertrophy | FAERS: 3 | US FAERS | |
| 359 | White blood cell count abnormal | FAERS: 3 | US FAERS | |
| 360 | Wrong technique in drug usage process | FAERS: 3 | US FAERS | |
| 361 | Abdominal hernia obstructive | FAERS: 2 | US FAERS | |
| 362 | Acidosis | FAERS: 2 | OFFSIDES US FAERS | |
| 363 | Agitation | FAERS: 2 | US FAERS | |
| 364 | Amyotrophic Lateral Sclerosis | FAERS: 2 | US FAERS | |
| 365 | Anal Ulcer | FAERS: 2 | US FAERS | |
| 366 | Anger | FAERS: 2 | US FAERS | |
| 367 | Antiphospholipid Syndrome | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 368 | Anuria | FAERS: 2 | OFFSIDES US FAERS | |
| 369 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 370 | Aphagia | FAERS: 2 | OFFSIDES US FAERS | |
| 371 | Aphonia | FAERS: 2 | US FAERS | |
| 372 | Aphthous Stomatitis | FAERS: 2 | US FAERS | |
| 373 | Appendicitis | FAERS: 2 | US FAERS | |
| 374 | Arteriosclerosis | FAERS: 2 | US FAERS | |
| 375 | Arteriovenous fistula thrombosis | FAERS: 2 | US FAERS | |
| 376 | Aspartate Aminotransferase Increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 377 | Atrioventricular Septal Defect | FAERS: 2 | US FAERS | |
| 378 | Autoimmune thrombocytopenia | FAERS: 2 | OFFSIDES US FAERS | |
| 379 | B-lymphocyte count decreased | FAERS: 2 | US FAERS | |
| 380 | Bile Duct Stenosis | FAERS: 2 | OFFSIDES US FAERS | |
| 381 | Biliary anastomosis complication | FAERS: 2 | US FAERS | |
| 382 | Bladder tamponade | FAERS: 2 | US FAERS | |
| 383 | Blood alkaline phosphatase increased | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 384 | Blood amylase increased | FAERS: 2 | US FAERS | |
| 385 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 386 | Bone marrow toxicity | FAERS: 2 | US FAERS | |
| 387 | Brachydactyly | FAERS: 2 | US FAERS | |
| 388 | Brain Death | FAERS: 2 | OFFSIDES US FAERS | |
| 389 | Bronchopneumonia | FAERS: 2 | OFFSIDES US FAERS | |
| 390 | CD4 Lymphocytes Decreased | FAERS: 2 | US FAERS | |
| 391 | Calicivirus test positive | FAERS: 2 | US FAERS | |
| 392 | Carbon dioxide decreased | FAERS: 2 | US FAERS | |
| 393 | Cholestasis | FAERS: 2 | US FAERS | |
| 394 | Chronic graft versus host disease in skin | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 395 | Congenital diaphragmatic hernia | FAERS: 2 | US FAERS | |
| 396 | Craniofacial Dysostosis | FAERS: 2 | US FAERS | |
| 397 | Craniosynostosis | FAERS: 2 | US FAERS | |
| 398 | Creatinine renal clearance decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 399 | Cytomegalovirus chorioretinitis | FAERS: 2 | US FAERS | |
| 400 | Delayed Graft Function | FAERS: 2 | US FAERS | |
| 401 | Demyelination | FAERS: 2 | OFFSIDES US FAERS | |
| 402 | Depressed Level of Consciousness | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 403 | Depressed mood | FAERS: 2 | US FAERS | |
| 404 | Device related infection | FAERS: 2 | US FAERS | |
| 405 | Diplopia | FAERS: 2 | US FAERS | |
| 406 | Dissociative disorder | FAERS: 2 | US FAERS | |
| 407 | Drug level below therapeutic | FAERS: 2 | OFFSIDES US FAERS | |
| 408 | Dysmorphism | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 409 | Embolism | FAERS: 2 | US FAERS | |
| 410 | Emotional disorder | FAERS: 2 | US FAERS | |
| 411 | Eosinophilic granulomatosis with polyangiitis | FAERS: 2 | US FAERS | |
| 412 | Epstein-Barr virus test positive | FAERS: 2 | US FAERS | |
| 413 | Extremity necrosis | FAERS: 2 | US FAERS | |
| 414 | Eye inflammation | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 415 | Eye pain | FAERS: 2 | US FAERS | |
| 416 | Facial paralysis | FAERS: 2 | US FAERS | |
| 417 | Feeling Cold | FAERS: 2 | US FAERS | |
| 418 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 419 | Fluid overload | FAERS: 2 | OFFSIDES US FAERS | |
| 420 | Gastric Bypass | FAERS: 2 | US FAERS | |
| 421 | Gastrointestinal mucosal disorder | FAERS: 2 | US FAERS | |
| 422 | Gastrointestinal perforation | FAERS: 2 | US FAERS | |
| 423 | Gastrostomy | FAERS: 2 | US FAERS | |
| 424 | Gaze palsy | FAERS: 2 | US FAERS | |
| 425 | Genital pain | FAERS: 2 | US FAERS | |
| 426 | Gingival Recession | FAERS: 2 | US FAERS | |
| 427 | Gingivitis | FAERS: 2 | US FAERS | |
| 428 | Graft versus host disease in eye | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 429 | Hemiparesis | FAERS: 2 | OFFSIDES US FAERS | |
| 430 | Hepatitis B | FAERS: 2 | OFFSIDES US FAERS | |
| 431 | Hepatosplenomegaly | FAERS: 2 | US FAERS | |
| 432 | Histoplasmosis | FAERS: 2 | US FAERS | |
| 433 | Hydronephrosis | FAERS: 2 | US FAERS | |
| 434 | Hyperaldosteronism | FAERS: 2 | US FAERS | |
| 435 | Hypertensive emergency | FAERS: 2 | US FAERS | |
| 436 | Hypoxia | FAERS: 2 | US FAERS | |
| 437 | Immobile | FAERS: 2 | US FAERS | |
| 438 | Incontinence | FAERS: 2 | US FAERS | |
| 439 | Increased tendency to bruise | FAERS: 2 | US FAERS | |
| 440 | Infusion Site Extravasation | FAERS: 2 | US FAERS | |
| 441 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 442 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 443 | Intestinal infarction | FAERS: 2 | US FAERS | |
| 444 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 445 | Mastication disorder | FAERS: 2 | US FAERS | |
| 446 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 447 | Microphthalmos | FAERS: 2 | US FAERS | |
| 448 | Multifocal motor neuropathy | FAERS: 2 | US FAERS | |
| 449 | Muscle Cramp | FAERS: 2 | US FAERS | |
| 450 | Muscle strain | FAERS: 2 | US FAERS | |
| 451 | Muscle tightness | FAERS: 2 | US FAERS | |
| 452 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 453 | Musculoskeletal stiffness | FAERS: 2 | OFFSIDES US FAERS | |
| 454 | Myositis | FAERS: 2 | US FAERS | |
| 455 | Nephrectomy | FAERS: 2 | US FAERS | |
| 456 | Obesity | FAERS: 2 | US FAERS | |
| 457 | Occult blood positive | FAERS: 2 | US FAERS | |
| 458 | Occupational exposure to product | FAERS: 2 | US FAERS | |
| 459 | Osteoporosis | FAERS: 2 | OFFSIDES US FAERS | |
| 460 | Overweight | FAERS: 2 | US FAERS | |
| 461 | Paranoia | FAERS: 2 | US FAERS | |
| 462 | Paraplegia | FAERS: 2 | US FAERS | |
| 463 | Parathyroidectomy | FAERS: 2 | US FAERS | |
| 464 | Petechiae | FAERS: 2 | US FAERS | |
| 465 | Pneumatosis intestinalis | FAERS: 2 | US FAERS | |
| 466 | Pneumothorax | FAERS: 2 | US FAERS | |
| 467 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 468 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 469 | Pressure of speech | FAERS: 2 | US FAERS | |
| 470 | Product counterfeit | FAERS: 2 | US FAERS | |
| 471 | Product use complaint | FAERS: 2 | US FAERS | |
| 472 | Protein total increased | FAERS: 2 | US FAERS | |
| 473 | Pruritus allergic | FAERS: 2 | OFFSIDES US FAERS | |
| 474 | Psoriasis | FAERS: 2 | US FAERS | |
| 475 | Pulmonary Hypertension | FAERS: 2 | OFFSIDES US FAERS | |
| 476 | Pulmonary Infarction | FAERS: 2 | US FAERS | |
| 477 | Quality of life decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 478 | Rectal discharge | FAERS: 2 | US FAERS | |
| 479 | Renal Artery Stenosis | FAERS: 2 | US FAERS | |
| 480 | Retching | FAERS: 2 | US FAERS | |
| 481 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 482 | Rheumatoid factor increased | FAERS: 2 | US FAERS | |
| 483 | Scab | FAERS: 2 | US FAERS | |
| 484 | Scleritis | FAERS: 2 | US FAERS | |
| 485 | Sclerodactylia | FAERS: 2 | US FAERS | |
| 486 | Single umbilical artery | FAERS: 2 | US FAERS | |
| 487 | Sjogren's Syndrome | FAERS: 2 | US FAERS | |
| 488 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 489 | Sudden Cardiac Death | FAERS: 2 | US FAERS | |
| 490 | Suture related complication | FAERS: 2 | US FAERS | |
| 491 | Synovitis | FAERS: 2 | US FAERS | |
| 492 | Systemic Inflammatory Response Syndrome | FAERS: 2 | US FAERS | |
| 493 | Systemic Scleroderma | FAERS: 2 | US FAERS | |
| 494 | Terminal state | FAERS: 2 | US FAERS | |
| 495 | Thermal burn | FAERS: 2 | US FAERS | |
| 496 | Tooth Extraction | FAERS: 2 | US FAERS | |
| 497 | Trichorrhexis | FAERS: 2 | US FAERS | |
| 498 | Tuberculosis | FAERS: 2 | US FAERS | |
| 499 | Varicella Zoster Virus Infection | FAERS: 2 | US FAERS | |
| 500 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 501 | Vertebroplasty | FAERS: 2 | US FAERS | |
| 502 | Visual disturbance | FAERS: 2 | US FAERS | |
| 503 | Wheezing | FAERS: 2 | US FAERS | |
| 504 | effusion | FAERS: 2 | US FAERS | |
| 505 | intensive care | FAERS: 2 | US FAERS | |
| 506 | Abdominal adhesions | FAERS: 1 | US FAERS | |
| 507 | Abdominal mass | FAERS: 1 | US FAERS | |
| 508 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 509 | Abulia | FAERS: 1 | US FAERS | |
| 510 | Accidental exposure | FAERS: 1 | US FAERS | |
| 511 | Acid fast bacilli infection | FAERS: 1 | US FAERS | |
| 512 | Acquired porphyria | FAERS: 1 | US FAERS | |
| 513 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 514 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 515 | Adenoviral hepatitis | FAERS: 1 | US FAERS | |
| 516 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 517 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 518 | Alopecia totalis | FAERS: 1 | US FAERS | |
| 519 | Altered state of consciousness | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 520 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 521 | Amblyopia | FAERS: 1 | US FAERS | |
| 522 | Amputation | FAERS: 1 | US FAERS | |
| 523 | Anal abscess | FAERS: 1 | US FAERS | |
| 524 | Anal squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 525 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 526 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 527 | Angular cheilitis | FAERS: 1 | US FAERS | |
| 528 | Animal bite | FAERS: 1 | US FAERS | |
| 529 | Anorexia | FAERS: 1 | US FAERS | |
| 530 | Antibody test negative | FAERS: 1 | US FAERS | |
| 531 | Aortic Rupture | FAERS: 1 | US FAERS | |
| 532 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 533 | Apathy | FAERS: 1 | US FAERS | |
| 534 | Arterial Injury | FAERS: 1 | US FAERS | |
| 535 | Arterial therapeutic procedure | FAERS: 1 | US FAERS | |
| 536 | Asphyxia | FAERS: 1 | US FAERS | |
| 537 | Asterixis | FAERS: 1 | US FAERS | |
| 538 | Astrocytoma | FAERS: 1 | US FAERS | |
| 539 | Astrovirus test positive | FAERS: 1 | US FAERS | |
| 540 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 541 | Bankruptcy | FAERS: 1 | US FAERS | |
| 542 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 543 | Biliary Colic | FAERS: 1 | US FAERS | |
| 544 | Biliary Fistula | FAERS: 1 | US FAERS | |
| 545 | Biliary abscess | FAERS: 1 | US FAERS | |
| 546 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 547 | Bladder prolapse | FAERS: 1 | US FAERS | |
| 548 | Blepharospasm | FAERS: 1 | US FAERS | |
| 549 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 550 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 551 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 552 | Blood immunoglobulin G decreased | FAERS: 1 | US FAERS | |
| 553 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 554 | Blood parathyroid hormone increased | FAERS: 1 | US FAERS | |
| 555 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 556 | Blood urea nitrogen/creatinine ratio decreased | FAERS: 1 | US FAERS | |
| 557 | Blood urine present | FAERS: 1 | US FAERS | |
| 558 | Body height below normal | FAERS: 1 | US FAERS | |
| 559 | Bone density decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 560 | Bowen's Disease | FAERS: 1 | US FAERS | |
| 561 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 562 | Brain Abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 563 | Bronchospasm | FAERS: 1 | US FAERS | |
| 564 | Butterfly rash | FAERS: 1 | US FAERS | |
| 565 | Cachexia | FAERS: 1 | US FAERS | |
| 566 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 567 | Cardiac sarcoidosis | FAERS: 1 | US FAERS | |
| 568 | Cardiac valve vegetation | FAERS: 1 | US FAERS | |
| 569 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 570 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 571 | Cavernous Sinus Thrombosis | FAERS: 1 | US FAERS | |
| 572 | Cerebellar Ataxia | FAERS: 1 | OFFSIDES US FAERS | |
| 573 | Cerebellar dysplasia | FAERS: 1 | US FAERS | |
| 574 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 575 | Cervical dysplasia | FAERS: 1 | US FAERS | |
| 576 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 577 | Cheilitis | FAERS: 1 | US FAERS | |
| 578 | Chorioamnionitis | FAERS: 1 | US FAERS | |
| 579 | Chorioretinitis | FAERS: 1 | US FAERS | |
| 580 | Chronic lymphocytic inflammation with pontine perivascular enhancement responsive to steroids | FAERS: 1 | US FAERS | |
| 581 | Cleft uvula | FAERS: 1 | US FAERS | |
| 582 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 583 | Clubbing | FAERS: 1 | US FAERS | |
| 584 | Clumsiness | FAERS: 1 | US FAERS | |
| 585 | Coagulation factor VII level decreased | FAERS: 1 | US FAERS | |
| 586 | Colonic fistula | FAERS: 1 | US FAERS | |
| 587 | Complication associated with device | FAERS: 1 | US FAERS | |
| 588 | Complications of intestinal transplant | FAERS: 1 | US FAERS | |
| 589 | Congenital acrochordon | FAERS: 1 | US FAERS | |
| 590 | Congenital anomaly in offspring | FAERS: 1 | US FAERS | |
| 591 | Congenital hearing disorder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 592 | Congenital hydronephrosis | FAERS: 1 | US FAERS | |
| 593 | Congenital osteodystrophy | FAERS: 1 | US FAERS | |
| 594 | Congenital renal cyst | FAERS: 1 | US FAERS | |
| 595 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 596 | Cor pulmonale | FAERS: 1 | US FAERS | |
| 597 | Corneal Perforation | FAERS: 1 | OFFSIDES US FAERS | |
| 598 | Corneal thinning | FAERS: 1 | US FAERS | |
| 599 | Craniofacial deformity | FAERS: 1 | US FAERS | |
| 600 | Crushing injury of trunk | FAERS: 1 | US FAERS | |
| 601 | Cystic Fibrosis | FAERS: 1 | US FAERS | |
| 602 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 603 | Cytomegalovirus test | FAERS: 1 | US FAERS | |
| 604 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 605 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 606 | Dengue Fever | FAERS: 1 | US FAERS | |
| 607 | Dental caries | FAERS: 1 | OFFSIDES US FAERS | |
| 608 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 609 | Dermatitis | FAERS: 1 | US FAERS | |
| 610 | Device Failure | FAERS: 1 | OFFSIDES US FAERS | |
| 611 | Device dislocation | FAERS: 1 | US FAERS | |
| 612 | Device dispensing error | FAERS: 1 | US FAERS | |
| 613 | Device occlusion | FAERS: 1 | US FAERS | |
| 614 | Diabetes mellitus inadequate control | FAERS: 1 | OFFSIDES US FAERS | |
| 615 | Diabetes with hyperosmolarity | FAERS: 1 | US FAERS | |
| 616 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 617 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 618 | Diffuse Large B-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 619 | Diffuse alopecia | FAERS: 1 | US FAERS | |
| 620 | Diffuse large B-cell lymphoma recurrent | FAERS: 1 | US FAERS | |
| 621 | Diplegia | FAERS: 1 | US FAERS | |
| 622 | Disability | FAERS: 1 | US FAERS | |
| 623 | Discomfort | FAERS: 1 | US FAERS | |
| 624 | Disease complication | FAERS: 1 | US FAERS | |
| 625 | Disorientation | FAERS: 1 | US FAERS | |
| 626 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 627 | Diverticulum | FAERS: 1 | US FAERS | |
| 628 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 629 | Drug resistance | FAERS: 1 | US FAERS | |
| 630 | Drug screen negative | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 631 | Drug titration error | FAERS: 1 | US FAERS | |
| 632 | Drug toxicity | FAERS: 1 | OFFSIDES US FAERS | |
| 633 | Duodenal atresia | FAERS: 1 | US FAERS | |
| 634 | Duodenal perforation | FAERS: 1 | US FAERS | |
| 635 | Dysgraphia | FAERS: 1 | US FAERS | |
| 636 | Ectopic kidney | FAERS: 1 | US FAERS | |
| 637 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 638 | Empyema | FAERS: 1 | US FAERS | |
| 639 | Endophthalmitis | FAERS: 1 | US FAERS | |
| 640 | Enterobacter pneumonia | FAERS: 1 | US FAERS | |
| 641 | Enterococcal infection | FAERS: 1 | OFFSIDES US FAERS | |
| 642 | Enterocolitis | FAERS: 1 | US FAERS | |
| 643 | Eosinophilic colitis | FAERS: 1 | US FAERS | |
| 644 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 645 | Escherichia infection | FAERS: 1 | OFFSIDES US FAERS | |
| 646 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 647 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 648 | Evans syndrome | FAERS: 1 | US FAERS | |
| 649 | Exophthalmos | FAERS: 1 | US FAERS | |
| 650 | Eye Infection | FAERS: 1 | US FAERS | |
| 651 | Facial Pain | FAERS: 1 | US FAERS | |
| 652 | Factor XII Deficiency | FAERS: 1 | US FAERS | |
| 653 | Fibrosis | FAERS: 1 | US FAERS | |
| 654 | Focal glomerulosclerosis | FAERS: 1 | OFFSIDES US FAERS | |
| 655 | Food Poisoning | FAERS: 1 | US FAERS | |
| 656 | Formication | FAERS: 1 | US FAERS | |
| 657 | Full blood count increased | FAERS: 1 | US FAERS | |
| 658 | Gastritis herpes | FAERS: 1 | US FAERS | |
| 659 | Gastrointestinal candidiasis | FAERS: 1 | US FAERS | |
| 660 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 661 | Gastrointestinal erosion | FAERS: 1 | US FAERS | |
| 662 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 663 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 664 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 665 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 666 | Gastrointestinal protozoal infection | FAERS: 1 | US FAERS | |
| 667 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 668 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 669 | Gene Mutation | FAERS: 1 | US FAERS | |
| 670 | Gingival Hyperplasia | FAERS: 1 | US FAERS | |
| 671 | Gingival Hypertrophy | FAERS: 1 | US FAERS | |
| 672 | Glioblastoma | FAERS: 1 | US FAERS | |
| 673 | Graft dysfunction | FAERS: 1 | US FAERS | |
| 674 | Graft loss | FAERS: 1 | US FAERS | |
| 675 | Graft versus host disease in intestine | FAERS: 1 | US FAERS | |
| 676 | Granulocyte count decreased | FAERS: 1 | US FAERS | |
| 677 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 678 | Growth retardation | FAERS: 1 | US FAERS | |
| 679 | Heart alternation | FAERS: 1 | US FAERS | |
| 680 | Hepatitis C RNA increased | FAERS: 1 | US FAERS | |
| 681 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 682 | Hilar lymphadenopathy | FAERS: 1 | US FAERS | |
| 683 | Hip surgery | FAERS: 1 | US FAERS | |
| 684 | Holoprosencephaly | FAERS: 1 | US FAERS | |
| 685 | Hospice Care | FAERS: 1 | US FAERS | |
| 686 | Hunger | FAERS: 1 | US FAERS | |
| 687 | Hypersomnia | FAERS: 1 | US FAERS | |
| 688 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 689 | Hypogonadism | FAERS: 1 | US FAERS | |
| 690 | Hypokinesia | FAERS: 1 | US FAERS | |
| 691 | Hypoplastic Left Heart Syndrome | FAERS: 1 | US FAERS | |
| 692 | Hyporeflexia | FAERS: 1 | OFFSIDES US FAERS | |
| 693 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 694 | Ileitis | FAERS: 1 | US FAERS | |
| 695 | Illogical thinking | FAERS: 1 | US FAERS | |
| 696 | Immune Reconstitution Inflammatory Syndrome | FAERS: 1 | US FAERS | |
| 697 | Immunosuppressant drug level increased | FAERS: 1 | US FAERS | |
| 698 | Impaired work ability | FAERS: 1 | US FAERS | |
| 699 | Impetigo | FAERS: 1 | US FAERS | |
| 700 | Implant tissue necrosis | FAERS: 1 | US FAERS | |
| 701 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 702 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 703 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 704 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 705 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 706 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 707 | Infarction | FAERS: 1 | US FAERS | |
| 708 | Infusion site pain | FAERS: 1 | US FAERS | |
| 709 | Initial insomnia | FAERS: 1 | US FAERS | |
| 710 | Injection site discharge | FAERS: 1 | US FAERS | |
| 711 | Injection site ulcer | FAERS: 1 | US FAERS | |
| 712 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 713 | Intestinal resection | FAERS: 1 | US FAERS | |
| 714 | Intracranial mass | FAERS: 1 | US FAERS | |
| 715 | Intraspinal abscess | FAERS: 1 | US FAERS | |
| 716 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 717 | JC virus test positive | FAERS: 1 | US FAERS | |
| 718 | Joint Range of Motion Decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 719 | Joint injury | FAERS: 1 | US FAERS | |
| 720 | Keratitis | FAERS: 1 | US FAERS | |
| 721 | Laryngomalacia | FAERS: 1 | US FAERS | |
| 722 | Laziness | FAERS: 1 | US FAERS | |
| 723 | Lichen Planus | FAERS: 1 | US FAERS | |
| 724 | Limb reconstructive surgery | FAERS: 1 | US FAERS | |
| 725 | Lipids abnormal | FAERS: 1 | US FAERS | |
| 726 | Lipoma | FAERS: 1 | US FAERS | |
| 727 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 728 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 729 | Low set ears | FAERS: 1 | US FAERS | |
| 730 | Lung cyst | FAERS: 1 | US FAERS | |
| 731 | Lung squamous cell carcinoma stage IV | FAERS: 1 | US FAERS | |
| 732 | Lupus enteritis | FAERS: 1 | US FAERS | |
| 733 | Lyme Disease | FAERS: 1 | US FAERS | |
| 734 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 735 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 736 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 737 | Malignant tumour excision | FAERS: 1 | US FAERS | |
| 738 | Mandibulofacial Dysostosis | FAERS: 1 | US FAERS | |
| 739 | Meningocele | FAERS: 1 | US FAERS | |
| 740 | Meniscus injury | FAERS: 1 | US FAERS | |
| 741 | Menorrhagia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 742 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 743 | Metastases to muscle | FAERS: 1 | US FAERS | |
| 744 | Microcephaly | FAERS: 1 | US FAERS | |
| 745 | Microgenia | FAERS: 1 | US FAERS | |
| 746 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 747 | Monocyte count decreased | FAERS: 1 | US FAERS | |
| 748 | Multi-organ disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 749 | Myasthenic Syndrome | FAERS: 1 | US FAERS | |
| 750 | Nasal Flaring | FAERS: 1 | US FAERS | |
| 751 | Neonatal pneumonia | FAERS: 1 | US FAERS | |
| 752 | Nephritic syndrome | FAERS: 1 | US FAERS | |
| 753 | Nerve Block | FAERS: 1 | US FAERS | |
| 754 | Nervousness | FAERS: 1 | US FAERS | |
| 755 | Neuralgia | FAERS: 1 | OFFSIDES US FAERS | |
| 756 | Neuromyelitis Optica | FAERS: 1 | US FAERS | |
| 757 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 758 | No adverse effect | FAERS: 1 | US FAERS | |
| 759 | Nodule | FAERS: 1 | US FAERS | |
| 760 | Onychoclasis | FAERS: 1 | US FAERS | |
| 761 | Onychomycosis | FAERS: 1 | US FAERS | |
| 762 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 763 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 764 | Oral pain | FAERS: 1 | US FAERS | |
| 765 | Orchitis | FAERS: 1 | US FAERS | |
| 766 | Osteomyelitis | FAERS: 1 | OFFSIDES US FAERS | |
| 767 | Pain of skin | FAERS: 1 | OFFSIDES US FAERS | |
| 768 | Pallor | FAERS: 1 | US FAERS | |
| 769 | Pancreatic operation | FAERS: 1 | US FAERS | |
| 770 | Panic Disorder | FAERS: 1 | US FAERS | |
| 771 | Panniculitis | FAERS: 1 | US FAERS | |
| 772 | Paratracheal lymphadenopathy | FAERS: 1 | US FAERS | |
| 773 | Paternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 774 | Pelvic Inflammatory Disease | FAERS: 1 | US FAERS | |
| 775 | Personality Change | FAERS: 1 | US FAERS | |
| 776 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 777 | Pharyngitis | FAERS: 1 | US FAERS | |
| 778 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 779 | Pierre Robin Syndrome | FAERS: 1 | US FAERS | |
| 780 | Plasmapheresis | FAERS: 1 | US FAERS | |
| 781 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 782 | Polymyositis | FAERS: 1 | OFFSIDES US FAERS | |
| 783 | Polyomavirus-associated nephropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 784 | Portal Hypertension | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 785 | Post procedural complication | FAERS: 1 | US FAERS | |
| 786 | Post procedural swelling | FAERS: 1 | US FAERS | |
| 787 | Postrenal failure | FAERS: 1 | US FAERS | |
| 788 | Prader-Willi Syndrome | FAERS: 1 | US FAERS | |
| 789 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 790 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 791 | Product appearance confusion | FAERS: 1 | US FAERS | |
| 792 | Product availability issue | FAERS: 1 | US FAERS | |
| 793 | Product closure issue | FAERS: 1 | US FAERS | |
| 794 | Product coating issue | FAERS: 1 | US FAERS | |
| 795 | Product contamination | FAERS: 1 | US FAERS | |
| 796 | Product dispensing issue | FAERS: 1 | US FAERS | |
| 797 | Product distribution issue | FAERS: 1 | US FAERS | |
| 798 | Product gel formation | FAERS: 1 | US FAERS | |
| 799 | Product prescribing error | FAERS: 1 | US FAERS | |
| 800 | Product size issue | FAERS: 1 | US FAERS | |
| 801 | Product storage error | FAERS: 1 | US FAERS | |
| 802 | Prostatic specific antigen decreased | FAERS: 1 | US FAERS | |
| 803 | Protein-losing gastroenteropathy | FAERS: 1 | US FAERS | |
| 804 | Pseudomonal sepsis | FAERS: 1 | US FAERS | |
| 805 | Pseudomonas bronchitis | FAERS: 1 | US FAERS | |
| 806 | Psychiatric evaluation | FAERS: 1 | US FAERS | |
| 807 | Pterygium | FAERS: 1 | US FAERS | |
| 808 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 809 | Pulmonary toxicity | FAERS: 1 | US FAERS | |
| 810 | Purpura Fulminans | FAERS: 1 | US FAERS | |
| 811 | Purpura | FAERS: 1 | US FAERS | |
| 812 | Purulent discharge | FAERS: 1 | US FAERS | |
| 813 | Pyelonephritis | FAERS: 1 | OFFSIDES US FAERS | |
| 814 | Pyloric Stenosis | FAERS: 1 | US FAERS | |
| 815 | Pyoderma Gangrenosum | FAERS: 1 | US FAERS | |
| 816 | Pyuria | FAERS: 1 | US FAERS | |
| 817 | Quadriplegia | FAERS: 1 | OFFSIDES US FAERS | |
| 818 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 819 | Rectal Prolapse | FAERS: 1 | US FAERS | |
| 820 | Regurgitation | FAERS: 1 | US FAERS | |
| 821 | Renal tubular acidosis | FAERS: 1 | US FAERS | |
| 822 | Reperfusion Injury | FAERS: 1 | US FAERS | |
| 823 | Residual urine | FAERS: 1 | US FAERS | |
| 824 | Respiratory papilloma | FAERS: 1 | US FAERS | |
| 825 | Restlessness | FAERS: 1 | US FAERS | |
| 826 | Retinal Degeneration | FAERS: 1 | US FAERS | |
| 827 | Retinitis | FAERS: 1 | US FAERS | |
| 828 | Retrognathia | FAERS: 1 | US FAERS | |
| 829 | Rhinitis perennial | FAERS: 1 | US FAERS | |
| 830 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 831 | Salmonella test positive | FAERS: 1 | US FAERS | |
| 832 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 833 | Sclerosing encapsulating peritonitis | FAERS: 1 | US FAERS | |
| 834 | Senile dementia | FAERS: 1 | US FAERS | |
| 835 | Septic embolus | FAERS: 1 | US FAERS | |
| 836 | Shoulder deformity | FAERS: 1 | US FAERS | |
| 837 | Skeletal injury | FAERS: 1 | US FAERS | |
| 838 | Skin irritation | FAERS: 1 | US FAERS | |
| 839 | Sluggishness | FAERS: 1 | US FAERS | |
| 840 | Smallpox | FAERS: 1 | US FAERS | |
| 841 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 842 | Splenic neoplasm malignancy unspecified | FAERS: 1 | US FAERS | |
| 843 | Splenomegaly | FAERS: 1 | US FAERS | |
| 844 | Splinter | FAERS: 1 | US FAERS | |
| 845 | Squamous cell carcinoma of lung | FAERS: 1 | US FAERS | |
| 846 | Stillbirth | FAERS: 1 | US FAERS | |
| 847 | Strongyloidiasis | FAERS: 1 | US FAERS | |
| 848 | Subacute endocarditis | FAERS: 1 | US FAERS | |
| 849 | Sudden death | FAERS: 1 | US FAERS | |
| 850 | Superinfection lung | FAERS: 1 | US FAERS | |
| 851 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 852 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 853 | T-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 854 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 855 | Talipes | FAERS: 1 | US FAERS | |
| 856 | Tension Headache | FAERS: 1 | US FAERS | |
| 857 | Therapeutic product effect variable | FAERS: 1 | US FAERS | |
| 858 | Therapeutic product ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 859 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 860 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 861 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 862 | Thirst | FAERS: 1 | US FAERS | |
| 863 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 864 | Tinea Pedis | FAERS: 1 | US FAERS | |
| 865 | Tongue biting | FAERS: 1 | US FAERS | |
| 866 | Tooth Loss | FAERS: 1 | US FAERS | |
| 867 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 868 | Toxic Shock Syndrome | FAERS: 1 | US FAERS | |
| 869 | Tracheal Stenosis | FAERS: 1 | US FAERS | |
| 870 | Transaminases abnormal | FAERS: 1 | US FAERS | |
| 871 | Transitional cell carcinoma metastatic | FAERS: 1 | US FAERS | |
| 872 | Tuberculoma of central nervous system | FAERS: 1 | US FAERS | |
| 873 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 874 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 875 | Upper respiratory fungal infection | FAERS: 1 | US FAERS | |
| 876 | Upper respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 877 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 878 | Urinary Retention | FAERS: 1 | US FAERS | |
| 879 | Urinary bladder atrophy | FAERS: 1 | US FAERS | |
| 880 | Urinary tract infection viral | FAERS: 1 | US FAERS | |
| 881 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 882 | Urine protein/creatinine ratio abnormal | FAERS: 1 | US FAERS | |
| 883 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 884 | Uterine Prolapse | FAERS: 1 | US FAERS | |
| 885 | Uveitis | FAERS: 1 | US FAERS | |
| 886 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 887 | Vagus Nerve Disorder | FAERS: 1 | US FAERS | |
| 888 | Vascular compression | FAERS: 1 | US FAERS | |
| 889 | Viral vasculitis | FAERS: 1 | US FAERS | |
| 890 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 891 | Walking aid user | FAERS: 1 | US FAERS | |
| 892 | West Nile viral infection | FAERS: 1 | US FAERS | |
| 893 | Withdrawal of life support | FAERS: 1 | US FAERS | |
| 894 | Wrong dose | FAERS: 1 | US FAERS | |
| 895 | hypertensive nephropathy | FAERS: 1 | US FAERS | |
| 896 | insulinoma | FAERS: 1 | US FAERS | |
| 897 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 898 | Abdominal Abscess | OFFSIDES | ||
| 899 | Acute bronchitis | OFFSIDES | ||
| 900 | Acute graft versus host disease in intestine | OFFSIDES | ||
| 901 | Adenitis | OFFSIDES | ||
| 902 | Alveolitis | OFFSIDES | ||
| 903 | Anhedonia | OFFSIDES | ||
| 904 | Anti-platelet antibody positive | OFFSIDES | ||
| 905 | Aspergillosis | OFFSIDES | ||
| 906 | Bacteria sputum identified | OFFSIDES | ||
| 907 | Bacterial culture positive | OFFSIDES | ||
| 908 | Bacterial pyelonephritis | Canada Vigilance: 1 | Canada Vigilance | |
| 909 | Biliary sphincterotomy | OFFSIDES | ||
| 910 | Bipolar Disorder | OFFSIDES | ||
| 911 | Blood chloride increased | OFFSIDES | ||
| 912 | Blood creatine phosphokinase decreased | OFFSIDES | ||
| 913 | Blood lactate dehydrogenase increased | Canada Vigilance: 1 | Canada Vigilance | |
| 914 | Blood potassium | OFFSIDES | ||
| 915 | Blood product transfusion dependent | OFFSIDES | ||
| 916 | Blood sodium decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 917 | Bone infarction | OFFSIDES | ||
| 918 | Bone lesion | OFFSIDES | ||
| 919 | Breast necrosis | OFFSIDES | ||
| 920 | CYTOMEGALOVIRUS ANTIGEN | OFFSIDES | ||
| 921 | Cardiac Flutter | OFFSIDES | ||
| 922 | Chemotherapeutic drug level increased | OFFSIDES | ||
| 923 | Chronic left ventricular failure | OFFSIDES | ||
| 924 | Congenital intestinal malformation | Canada Vigilance: 2 | Canada Vigilance | |
| 925 | Cutaneous Candidiasis | OFFSIDES | ||
| 926 | Cytomegalovirus antibody positive | OFFSIDES | ||
| 927 | Debridement | OFFSIDES | ||
| 928 | Diabetes | OFFSIDES | ||
| 929 | Diabetes Insipidus | OFFSIDES | ||
| 930 | Diverticulosis | OFFSIDES | ||
| 931 | Endoscopy abnormal | OFFSIDES | ||
| 932 | Engraftment syndrome | OFFSIDES | ||
| 933 | Erythropenia | OFFSIDES | ||
| 934 | Excoriation | OFFSIDES | ||
| 935 | Exfoliative rash | OFFSIDES | ||
| 936 | Extremity contracture | OFFSIDES | ||
| 937 | Eye allergy | OFFSIDES | ||
| 938 | Fatty Liver | OFFSIDES | ||
| 939 | Fungus serology test positive | OFFSIDES | ||
| 940 | Gait inability | Canada Vigilance: 1 | Canada Vigilance | |
| 941 | Gamma-Glutamyltransferase Increased | OFFSIDES | ||
| 942 | Graft infection | OFFSIDES | ||
| 943 | Graft versus host disease in liver | Canada Vigilance: 1 | Canada Vigilance | |
| 944 | Graft versus host disease in lung | Canada Vigilance: 1 | Canada Vigilance | |
| 945 | Graft versus host disease in skin | Canada Vigilance: 1 | Canada Vigilance | |
| 946 | Grip strength | OFFSIDES | ||
| 947 | HLA marker study | OFFSIDES | ||
| 948 | Haematotoxicity | OFFSIDES | ||
| 949 | Hepatic artery stenosis | OFFSIDES | ||
| 950 | Hepatic artery thrombosis | OFFSIDES | ||
| 951 | Hepatitis B positive | OFFSIDES | ||
| 952 | Hepatitis C antibody positive | OFFSIDES | ||
| 953 | Human herpesvirus 8 infection | OFFSIDES | ||
| 954 | Hydrophobia | OFFSIDES | ||
| 955 | Hyperpigmentation | OFFSIDES | ||
| 956 | Immunosuppressant drug level | OFFSIDES | ||
| 957 | Infusion site mobility decreased | OFFSIDES | ||
| 958 | Intestinal malrotation repair | Canada Vigilance: 1 | Canada Vigilance | |
| 959 | Intussusception | OFFSIDES | ||
| 960 | Joint Instability | OFFSIDES | ||
| 961 | Joint stiffness | OFFSIDES | ||
| 962 | Klebsiella sepsis | OFFSIDES | ||
| 963 | Leukopenia neonatal | OFFSIDES | ||
| 964 | Lung consolidation | OFFSIDES | ||
| 965 | Lupus pneumonitis | OFFSIDES | ||
| 966 | Lymphocele | OFFSIDES | ||
| 967 | Marasmus | OFFSIDES | ||
| 968 | Maternal exposure before pregnancy | Canada Vigilance: 1 | Canada Vigilance | |
| 969 | Mechanical ventilation | OFFSIDES | ||
| 970 | Mitochondrial myopathy acquired | OFFSIDES | ||
| 971 | Mucormycosis | OFFSIDES | ||
| 972 | Muscle Fatigue | OFFSIDES | ||
| 973 | Muscle Weakness | OFFSIDES | ||
| 974 | Muscle flap operation | OFFSIDES | ||
| 975 | Muscle necrosis | OFFSIDES | ||
| 976 | Myoglobin blood present | OFFSIDES | ||
| 977 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 978 | Oliguria | OFFSIDES | ||
| 979 | Ophthalmoplegia | OFFSIDES | ||
| 980 | Oropharyngitis fungal | OFFSIDES | ||
| 981 | Osteolysis | OFFSIDES | ||
| 982 | Osteoma | OFFSIDES | ||
| 983 | Osteoradionecrosis | OFFSIDES | ||
| 984 | Ovarian failure | OFFSIDES | ||
| 985 | Pancreatic Cyst | OFFSIDES | ||
| 986 | Pericarditis lupus | OFFSIDES | ||
| 987 | Periodontitis | OFFSIDES | ||
| 988 | Poor personal hygiene | OFFSIDES | ||
| 989 | Post procedural bile leak | OFFSIDES | ||
| 990 | Posterior Capsulotomy | OFFSIDES | ||
| 991 | Potentiating drug interaction | OFFSIDES | ||
| 992 | Precocious Puberty | OFFSIDES | ||
| 993 | Primary sequestrum | OFFSIDES | ||
| 994 | Pulmonary vascular disorder | OFFSIDES | ||
| 995 | Renal tubular atrophy | OFFSIDES | ||
| 996 | Renal tubular disorder | OFFSIDES | ||
| 997 | Retinal Vasculitis | OFFSIDES | ||
| 998 | Sequestrectomy | OFFSIDES | ||
| 999 | Skin Induration | OFFSIDES | ||
| 1000 | Skin tightness | OFFSIDES | ||
| 1001 | Stem cell transplant | OFFSIDES | ||
| 1002 | Subcutaneous nodule | OFFSIDES | ||
| 1003 | Systemic mycosis | OFFSIDES | ||
| 1004 | Tinea | OFFSIDES | ||
| 1005 | Tonsillitis | Canada Vigilance: 1 | Canada Vigilance | |
| 1006 | Tooth Infection | OFFSIDES | ||
| 1007 | Urinary tract infection pseudomonal | OFFSIDES | ||
| 1008 | Venoocclusive disease | OFFSIDES | ||
| 1009 | Weight Gain | OFFSIDES | ||
| 1010 | Wound Infection | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.