Medroxyprogesterone Acetate
(PSGAAPLEWMOORI-PEINSRQWSA-N)
Structure
- SMILES
- O=C1CC[C@]2(C(=C1)[C@@H](C)C[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@]2(OC(=O)C)C(=O)C)C)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- G03AC06; G03DA02; L02AB02
- Molecular Formula:
- C24H34O4
- Molecular Weight:
- 386.524
- Log P:
- 4.6552
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 0
- TPSA:
- 60.44
- CAS Number(s):
- 71-58-9
Synonym(s)
1.
Medroxyprogesterone Acetate
2.
Depo-Medroxyprogesterone Acetate
3.
Medroxyprogesterone 17-Acetate
4.
(6 alpha)-17-(Acetoxy)-6-methylpregn-4-ene-3,20-dione
5.
6-alpha-Methyl-17alpha-hydroxyprogesterone Acetate
6.
Curretab
7.
Cycrin
8.
Depo-Provera
9.
Farlutal
10.
Gestapuran
11.
Medroxyprogesterone 17-Acetate, (6 alpha,17 alpha)-Isomer
12.
Medroxyprogesterone 17-Acetate, (6 beta)-Isomer
13.
Perlutex
14.
Provera
15.
Veramix
16.
6 alpha Methyl 17alpha hydroxyprogesterone Acetate
17.
Depo Medroxyprogesterone Acetate
18.
Depo Provera
19.
DepoProvera
20.
Medroxyprogesterone 17 Acetate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 696 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 2 | Menorrhagia | FAERS: 351 Canada Vigilance: 6 | 6461984 | CTD Canada Vigilance US FAERS |
| 3 | Metrorrhagia | FAERS: 351 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 4 | Headache | FAERS: 347 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 5 | Osteoporosis | FAERS: 311 Canada Vigilance: 13 | Canada Vigilance OFFSIDES US FAERS | |
| 6 | Cerebrovascular accident | FAERS: 306 | US FAERS | |
| 7 | Nausea | FAERS: 259 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 8 | Dizziness | FAERS: 246 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 9 | Thrombosis | FAERS: 226 Canada Vigilance: 1 | CTD Canada Vigilance US FAERS | |
| 10 | Pulmonary Embolism | FAERS: 220 Canada Vigilance: 1 | 1388285 | CTD Canada Vigilance US FAERS |
| 11 | Alopecia | FAERS: 205 Canada Vigilance: 8 | 4261461 | CTD Canada Vigilance US FAERS |
| 12 | Deep Vein Thrombosis | FAERS: 198 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Pain | FAERS: 198 Canada Vigilance: 3 | 3743595 6305660 | CTD Canada Vigilance US FAERS |
| 14 | Malaise | FAERS: 194 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 15 | Drug exposure during pregnancy | FAERS: 192 | OFFSIDES US FAERS | |
| 16 | Anxiety | FAERS: 187 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 17 | Fatigue | FAERS: 179 Canada Vigilance: 3 | 6123383 | CTD Canada Vigilance US FAERS |
| 18 | Injection Site Reaction | FAERS: 176 | US FAERS | |
| 19 | Feeling abnormal | FAERS: 165 | US FAERS | |
| 20 | Myocardial Infarction | FAERS: 162 Canada Vigilance: 1 | 415687 12405240 12904517 | CTD Canada Vigilance US FAERS |
| 21 | Inappropriate schedule of drug administration | FAERS: 155 | US FAERS | |
| 22 | Injection site pain | FAERS: 150 | US FAERS | |
| 23 | Pregnancy with injectable contraceptive | FAERS: 144 | OFFSIDES US FAERS | |
| 24 | Abdominal Pain | FAERS: 138 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 25 | Back Pain | FAERS: 128 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Mood swings | FAERS: 125 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 27 | Arthralgia | FAERS: 124 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 28 | Asthenia | FAERS: 124 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 29 | Osteopenia | FAERS: 119 Canada Vigilance: 19 | Canada Vigilance OFFSIDES US FAERS | |
| 30 | Vomiting | FAERS: 116 Canada Vigilance: 1 | 5550609 | CTD Canada Vigilance US FAERS |
| 31 | Bone density decreased | FAERS: 115 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 32 | Hypersensitivity | FAERS: 113 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Pruritus | FAERS: 111 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 34 | Weight decreased | FAERS: 111 | US FAERS | |
| 35 | Urticaria | FAERS: 110 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 36 | Product quality issue | FAERS: 94 | US FAERS | |
| 37 | Injection site abscess | FAERS: 89 | US FAERS | |
| 38 | Chest Pain | FAERS: 85 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 39 | Night sweats | FAERS: 85 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Incorrect dose administered | FAERS: 74 | US FAERS | |
| 41 | Breast tenderness | FAERS: 73 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 42 | Drug ineffective for unapproved indication | FAERS: 73 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Syncope | FAERS: 73 | US FAERS | |
| 44 | Acne | FAERS: 71 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Incorrect route of drug administration | FAERS: 66 | US FAERS | |
| 46 | Nervousness | FAERS: 66 | US FAERS | |
| 47 | Infertility | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 48 | Palpitations | FAERS: 58 | US FAERS | |
| 49 | Product use issue | FAERS: 55 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 50 | Product use in unapproved indication | FAERS: 52 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 51 | Crying | FAERS: 51 | US FAERS | |
| 52 | Pharmaceutical product complaint | FAERS: 51 | US FAERS | |
| 53 | Bone pain | FAERS: 50 | US FAERS | |
| 54 | Swelling | FAERS: 48 | US FAERS | |
| 55 | Pelvic Pain | FAERS: 46 | US FAERS | |
| 56 | Emotional disorder | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Myalgia | FAERS: 45 | US FAERS | |
| 58 | Pregnancy | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Memory impairment | FAERS: 43 | US FAERS | |
| 60 | Erythema | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Tremor | FAERS: 42 | 86447 | CTD US FAERS |
| 62 | Diabetes Mellitus | FAERS: 41 | US FAERS | |
| 63 | Injection site atrophy | FAERS: 41 | OFFSIDES US FAERS | |
| 64 | Injection site inflammation | FAERS: 41 | OFFSIDES US FAERS | |
| 65 | Contralateral breast cancer | FAERS: 40 | OFFSIDES US FAERS | |
| 66 | Visual Impairment | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Hormone level abnormal | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Urinary tract infection | FAERS: 37 | US FAERS | |
| 69 | Amnesia | FAERS: 35 | US FAERS | |
| 70 | Discomfort | FAERS: 35 | US FAERS | |
| 71 | Injection site erythema | FAERS: 34 | US FAERS | |
| 72 | Asthma | FAERS: 33 | US FAERS | |
| 73 | Breast cancer recurrent | FAERS: 33 | OFFSIDES US FAERS | |
| 74 | Stress | FAERS: 33 | US FAERS | |
| 75 | Hypothyroidism | FAERS: 32 | US FAERS | |
| 76 | Impaired work ability | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Drug dose omission | FAERS: 31 | US FAERS | |
| 78 | Nasopharyngitis | FAERS: 31 | US FAERS | |
| 79 | Anger | FAERS: 29 | US FAERS | |
| 80 | Depressed mood | FAERS: 29 | US FAERS | |
| 81 | Ectopic Pregnancy | FAERS: 29 | US FAERS | |
| 82 | Medication Error | FAERS: 29 | US FAERS | |
| 83 | Vaginal Discharge | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Intentional product misuse | FAERS: 28 | US FAERS | |
| 85 | No adverse event | FAERS: 28 | US FAERS | |
| 86 | Chest discomfort | FAERS: 27 | US FAERS | |
| 87 | Vertigo | FAERS: 27 | 5550609 | CTD US FAERS |
| 88 | Abdominal discomfort | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 89 | Injection site necrosis | FAERS: 26 | US FAERS | |
| 90 | Joint swelling | FAERS: 26 | US FAERS | |
| 91 | Maternal exposure during pregnancy | FAERS: 26 | US FAERS | |
| 92 | Activities of daily living impaired | FAERS: 25 | US FAERS | |
| 93 | Anorexia | FAERS: 24 | US FAERS | |
| 94 | Neck Pain | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Arthropathy | FAERS: 23 | US FAERS | |
| 96 | Dementia | FAERS: 23 | 12771112 | CTD US FAERS |
| 97 | Drug dispensing error | FAERS: 23 | US FAERS | |
| 98 | Fibromyalgia | FAERS: 23 | US FAERS | |
| 99 | Therapeutic response unexpected | FAERS: 23 | US FAERS | |
| 100 | Uterine Polyp | FAERS: 23 | OFFSIDES US FAERS | |
| 101 | Complications of maternal exposure to therapeutic drugs | FAERS: 22 | OFFSIDES US FAERS | |
| 102 | Tachycardia | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 103 | Chills | FAERS: 21 | US FAERS | |
| 104 | Sinusitis | FAERS: 21 | US FAERS | |
| 105 | Cervix carcinoma | FAERS: 20 | US FAERS | |
| 106 | Circumstance or information capable of leading to medication error | FAERS: 20 | US FAERS | |
| 107 | Drug administration error | FAERS: 20 | US FAERS | |
| 108 | Infection | FAERS: 20 | US FAERS | |
| 109 | Paranoia | FAERS: 20 | US FAERS | |
| 110 | Somnolence | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 111 | Suppressed lactation | FAERS: 20 | US FAERS | |
| 112 | Arthritis | FAERS: 19 | US FAERS | |
| 113 | Constipation | FAERS: 19 | US FAERS | |
| 114 | Hypotension | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 115 | Menopause | FAERS: 19 | US FAERS | |
| 116 | Suicide attempt | FAERS: 19 | US FAERS | |
| 117 | Blindness | FAERS: 18 | US FAERS | |
| 118 | Blood cholesterol increased | FAERS: 18 | US FAERS | |
| 119 | Breast Cyst | FAERS: 18 | OFFSIDES US FAERS | |
| 120 | Influenza | FAERS: 18 | US FAERS | |
| 121 | Premenstrual syndrome | FAERS: 18 | US FAERS | |
| 122 | Dyspareunia | FAERS: 17 | US FAERS | |
| 123 | Injection site infection | FAERS: 17 | US FAERS | |
| 124 | Injection site mass | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 125 | Agitation | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 126 | Burning sensation | FAERS: 16 | US FAERS | |
| 127 | Dry skin | FAERS: 16 | US FAERS | |
| 128 | Lymphadenopathy | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 129 | Drug administered at inappropriate site | FAERS: 15 | US FAERS | |
| 130 | Nonspecific reaction | FAERS: 15 | US FAERS | |
| 131 | Poor quality drug administered | FAERS: 15 | US FAERS | |
| 132 | Pre-existing condition improved | FAERS: 15 | US FAERS | |
| 133 | Pulmonary thrombosis | FAERS: 15 | US FAERS | |
| 134 | Sneezing | FAERS: 15 | US FAERS | |
| 135 | Unevaluable event | FAERS: 15 | US FAERS | |
| 136 | Vulvovaginal dryness | FAERS: 15 | US FAERS | |
| 137 | Anaphylactic shock | FAERS: 14 | US FAERS | |
| 138 | Breast Microcalcification | FAERS: 14 | OFFSIDES US FAERS | |
| 139 | Cholelithiasis | FAERS: 14 | 1385654 | CTD US FAERS |
| 140 | Dysphonia | FAERS: 14 | US FAERS | |
| 141 | Flushing | FAERS: 14 | US FAERS | |
| 142 | Intervertebral Disc Degeneration | FAERS: 14 | US FAERS | |
| 143 | Lip swelling | FAERS: 14 | US FAERS | |
| 144 | Musculoskeletal Pain | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 145 | Peripheral swelling | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 146 | Pneumonia | FAERS: 14 | US FAERS | |
| 147 | Cerebral Infarction | FAERS: 13 | US FAERS | |
| 148 | Cystitis | FAERS: 13 | US FAERS | |
| 149 | Cyst | FAERS: 13 | US FAERS | |
| 150 | Diplopia | FAERS: 13 | US FAERS | |
| 151 | Eye pain | FAERS: 13 | US FAERS | |
| 152 | Injection site bruising | FAERS: 13 | US FAERS | |
| 153 | Pallor | FAERS: 13 | OFFSIDES US FAERS | |
| 154 | Premature Menopause | FAERS: 13 | US FAERS | |
| 155 | Tooth Loss | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 156 | Uterine Cancer | FAERS: 13 | OFFSIDES US FAERS | |
| 157 | Wrong technique in product usage process | FAERS: 13 | US FAERS | |
| 158 | Ankle Fracture | FAERS: 12 | US FAERS | |
| 159 | Drug withdrawal syndrome | FAERS: 12 | US FAERS | |
| 160 | Emotional distress | FAERS: 12 | US FAERS | |
| 161 | Endometriosis | FAERS: 12 | 23183084 | CTD US FAERS |
| 162 | Feeling Cold | FAERS: 12 | US FAERS | |
| 163 | Hirsutism | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 164 | Impaired driving ability | FAERS: 12 | US FAERS | |
| 165 | Injection site pruritus | FAERS: 12 | US FAERS | |
| 166 | Maternal exposure timing unspecified | FAERS: 12 | US FAERS | |
| 167 | Musculoskeletal stiffness | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 168 | Visual disturbance | FAERS: 12 | US FAERS | |
| 169 | Wheezing | FAERS: 12 | US FAERS | |
| 170 | Cold sweat | FAERS: 11 | US FAERS | |
| 171 | Drug exposure before pregnancy | FAERS: 11 | OFFSIDES US FAERS | |
| 172 | Dysarthria | FAERS: 11 | US FAERS | |
| 173 | Embolism | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 174 | Nephrolithiasis | FAERS: 11 | US FAERS | |
| 175 | Oropharyngeal pain | FAERS: 11 | US FAERS | |
| 176 | Thirst | FAERS: 11 | US FAERS | |
| 177 | Tinnitus | FAERS: 11 Canada Vigilance: 1 | 5550609 | CTD Canada Vigilance US FAERS |
| 178 | Wrong technique in drug usage process | FAERS: 11 | US FAERS | |
| 179 | Abasia | FAERS: 10 | US FAERS | |
| 180 | Bipolar Disorder | FAERS: 10 | US FAERS | |
| 181 | Blood glucose fluctuation | FAERS: 10 | US FAERS | |
| 182 | Breast hyperplasia | FAERS: 10 | OFFSIDES US FAERS | |
| 183 | Deafness | FAERS: 10 | 5550609 | CTD US FAERS |
| 184 | Dental caries | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 185 | Disease Progression | FAERS: 10 | US FAERS | |
| 186 | Endometrial Hyperplasia | FAERS: 10 Canada Vigilance: 1 | 2826865 11695813 | CTD OFFSIDES Canada Vigilance US FAERS |
| 187 | Meningioma | FAERS: 10 | 17586005 | CTD US FAERS |
| 188 | Presyncope | FAERS: 10 | US FAERS | |
| 189 | Angioedema | FAERS: 9 | US FAERS | |
| 190 | Blood glucose decreased | FAERS: 9 | US FAERS | |
| 191 | Blood glucose increased | FAERS: 9 | US FAERS | |
| 192 | Blood urine present | FAERS: 9 | US FAERS | |
| 193 | Coronary Artery Disease | FAERS: 9 | US FAERS | |
| 194 | Drug effect incomplete | FAERS: 9 | US FAERS | |
| 195 | Dysgeusia | FAERS: 9 | US FAERS | |
| 196 | Dyspepsia | FAERS: 9 | US FAERS | |
| 197 | Dysuria | FAERS: 9 | US FAERS | |
| 198 | Endometrial hypertrophy | FAERS: 9 | OFFSIDES US FAERS | |
| 199 | Epistaxis | FAERS: 9 | US FAERS | |
| 200 | Incorrect drug administration duration | FAERS: 9 | US FAERS | |
| 201 | Injection site discomfort | FAERS: 9 | US FAERS | |
| 202 | Injection site nodule | FAERS: 9 | US FAERS | |
| 203 | Joint stiffness | FAERS: 9 | US FAERS | |
| 204 | Lethargy | FAERS: 9 | US FAERS | |
| 205 | Pericarditis | FAERS: 9 | US FAERS | |
| 206 | Progesterone decreased | FAERS: 9 | OFFSIDES US FAERS | |
| 207 | Rheumatoid Arthritis | FAERS: 9 | US FAERS | |
| 208 | Sciatica | FAERS: 9 | US FAERS | |
| 209 | Bedridden | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 210 | Carpal Tunnel Syndrome | FAERS: 8 | US FAERS | |
| 211 | Cellulitis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 212 | Cerebral Thrombosis | FAERS: 8 | US FAERS | |
| 213 | Cervical dysplasia | FAERS: 8 | OFFSIDES US FAERS | |
| 214 | Dehydration | FAERS: 8 | US FAERS | |
| 215 | Disease recurrence | FAERS: 8 | US FAERS | |
| 216 | Drug exposure via breast milk | FAERS: 8 | OFFSIDES US FAERS | |
| 217 | Drug prescribing error | FAERS: 8 | US FAERS | |
| 218 | Ear discomfort | FAERS: 8 | US FAERS | |
| 219 | Endometrial disorder | FAERS: 8 | OFFSIDES US FAERS | |
| 220 | Formication | FAERS: 8 | US FAERS | |
| 221 | General physical health deterioration | FAERS: 8 | US FAERS | |
| 222 | Incorrect product storage | FAERS: 8 | US FAERS | |
| 223 | Labyrinthitis | FAERS: 8 | US FAERS | |
| 224 | Limb discomfort | FAERS: 8 | US FAERS | |
| 225 | Photophobia | FAERS: 8 | US FAERS | |
| 226 | Pleurisy | FAERS: 8 | US FAERS | |
| 227 | Pregnancy test positive | FAERS: 8 | US FAERS | |
| 228 | Product dispensing error | FAERS: 8 | US FAERS | |
| 229 | Product packaging issue | FAERS: 8 | US FAERS | |
| 230 | Product size issue | FAERS: 8 | US FAERS | |
| 231 | Retching | FAERS: 8 | US FAERS | |
| 232 | Tuberculosis | FAERS: 8 | US FAERS | |
| 233 | jaundice | FAERS: 8 | US FAERS | |
| 234 | Abdominal tenderness | FAERS: 7 | US FAERS | |
| 235 | Blighted ovum | FAERS: 7 | US FAERS | |
| 236 | Blood pressure fluctuation | FAERS: 7 | US FAERS | |
| 237 | Breast cancer stage II | FAERS: 7 | OFFSIDES US FAERS | |
| 238 | Bronchitis | FAERS: 7 | US FAERS | |
| 239 | Cardiac Arrest | FAERS: 7 | US FAERS | |
| 240 | Chromaturia | FAERS: 7 | US FAERS | |
| 241 | Epilepsy | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 242 | Expired drug administered | FAERS: 7 | US FAERS | |
| 243 | Feeling of body temperature change | FAERS: 7 | US FAERS | |
| 244 | Fracture | FAERS: 7 | US FAERS | |
| 245 | Hysterectomy | FAERS: 7 | US FAERS | |
| 246 | Inflammation | FAERS: 7 | US FAERS | |
| 247 | Injection site scar | FAERS: 7 | US FAERS | |
| 248 | Injection site urticaria | FAERS: 7 | US FAERS | |
| 249 | Laryngitis | FAERS: 7 | US FAERS | |
| 250 | Livedo Reticularis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 251 | Muscle Cramp | FAERS: 7 | 86447 | CTD US FAERS |
| 252 | Obesity | FAERS: 7 | US FAERS | |
| 253 | Optic Neuritis | FAERS: 7 | US FAERS | |
| 254 | Pulmonary Fibrosis | FAERS: 7 | US FAERS | |
| 255 | Renal Colic | FAERS: 7 | US FAERS | |
| 256 | Sexual Dysfunction | FAERS: 7 | US FAERS | |
| 257 | Sinus Tachycardia | FAERS: 7 | US FAERS | |
| 258 | Skin lesion | FAERS: 7 | US FAERS | |
| 259 | Subcutaneous Abscess | FAERS: 7 | US FAERS | |
| 260 | Vasculitis | FAERS: 7 | US FAERS | |
| 261 | Abscess | FAERS: 6 | US FAERS | |
| 262 | Adnexa uteri pain | FAERS: 6 | US FAERS | |
| 263 | Angina Pectoris | FAERS: 6 | US FAERS | |
| 264 | Blood iron decreased | FAERS: 6 | US FAERS | |
| 265 | Blood testosterone decreased | FAERS: 6 | US FAERS | |
| 266 | Breast discomfort | FAERS: 6 | US FAERS | |
| 267 | Coital bleeding | FAERS: 6 | US FAERS | |
| 268 | Disorientation | FAERS: 6 | US FAERS | |
| 269 | Educational problem | FAERS: 6 | US FAERS | |
| 270 | Exposure during breast feeding | FAERS: 6 | US FAERS | |
| 271 | Eye irritation | FAERS: 6 | US FAERS | |
| 272 | Feeling jittery | FAERS: 6 | US FAERS | |
| 273 | Flatulence | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 274 | Gastroenteritis | FAERS: 6 | US FAERS | |
| 275 | Gestational Diabetes | FAERS: 6 | OFFSIDES US FAERS | |
| 276 | Infectious Mononucleosis | FAERS: 6 | US FAERS | |
| 277 | Intentional self-injury | FAERS: 6 | US FAERS | |
| 278 | Intracranial Aneurysm | FAERS: 6 | US FAERS | |
| 279 | Mastitis | FAERS: 6 | US FAERS | |
| 280 | Pancreatitis | FAERS: 6 | US FAERS | |
| 281 | Pelvic adhesions | FAERS: 6 | US FAERS | |
| 282 | Placenta Accreta | FAERS: 6 | US FAERS | |
| 283 | Poor quality sleep | FAERS: 6 | US FAERS | |
| 284 | Post procedural complication | FAERS: 6 | US FAERS | |
| 285 | Product taste abnormal | FAERS: 6 | US FAERS | |
| 286 | Psychiatric symptom | FAERS: 6 | OFFSIDES US FAERS | |
| 287 | Quality of life decreased | FAERS: 6 | US FAERS | |
| 288 | Renal pain | FAERS: 6 | US FAERS | |
| 289 | Respiratory arrest | FAERS: 6 | US FAERS | |
| 290 | Screaming | FAERS: 6 | US FAERS | |
| 291 | Stillbirth | FAERS: 6 | US FAERS | |
| 292 | Supraventricular tachycardia | FAERS: 6 | US FAERS | |
| 293 | Thrombocytopenia | FAERS: 6 | US FAERS | |
| 294 | Toothache | FAERS: 6 | US FAERS | |
| 295 | nervous system disorder | FAERS: 6 | US FAERS | |
| 296 | Atrioventricular Septal Defect | FAERS: 5 | OFFSIDES US FAERS | |
| 297 | Back disorder | FAERS: 5 | US FAERS | |
| 298 | Blood triglycerides increased | FAERS: 5 | US FAERS | |
| 299 | Chloasma | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 300 | Febrile Neutropenia | FAERS: 5 | US FAERS | |
| 301 | Food Allergy | FAERS: 5 | US FAERS | |
| 302 | General physical condition abnormal | FAERS: 5 | US FAERS | |
| 303 | Hunger | FAERS: 5 | US FAERS | |
| 304 | Hyperthyroidism | FAERS: 5 | US FAERS | |
| 305 | Injection site movement impairment | FAERS: 5 | US FAERS | |
| 306 | Intentional drug misuse | FAERS: 5 | US FAERS | |
| 307 | Irritable Bowel Syndrome | FAERS: 5 | US FAERS | |
| 308 | Lower respiratory tract infection | FAERS: 5 | US FAERS | |
| 309 | Multiple Sclerosis | FAERS: 5 | US FAERS | |
| 310 | Musculoskeletal discomfort | FAERS: 5 | US FAERS | |
| 311 | Nipple pain | FAERS: 5 | US FAERS | |
| 312 | Occupational exposure to product | FAERS: 5 | US FAERS | |
| 313 | Ocular icterus | FAERS: 5 | US FAERS | |
| 314 | Osteosclerosis | FAERS: 5 | US FAERS | |
| 315 | Papule | FAERS: 5 | US FAERS | |
| 316 | Personality Change | FAERS: 5 | US FAERS | |
| 317 | Phlebitis | FAERS: 5 | 866433 | CTD US FAERS |
| 318 | Procedural complication | FAERS: 5 | US FAERS | |
| 319 | Restlessness | FAERS: 5 | US FAERS | |
| 320 | Retinal Vein Occlusion | FAERS: 5 | US FAERS | |
| 321 | Skin irritation | FAERS: 5 | US FAERS | |
| 322 | Stevens-Johnson Syndrome | FAERS: 5 | US FAERS | |
| 323 | Stomatitis | FAERS: 5 | US FAERS | |
| 324 | Therapy non-responder | FAERS: 5 | US FAERS | |
| 325 | Tonsillitis | FAERS: 5 | US FAERS | |
| 326 | Uterine inflammation | FAERS: 5 | US FAERS | |
| 327 | Vitamin D Deficiency | FAERS: 5 | US FAERS | |
| 328 | Vulvovaginal discomfort | FAERS: 5 | US FAERS | |
| 329 | Vulvovaginal mycotic infection | FAERS: 5 | US FAERS | |
| 330 | Anencephaly | FAERS: 4 | US FAERS | |
| 331 | Application site abscess | FAERS: 4 | OFFSIDES US FAERS | |
| 332 | Application site pain | FAERS: 4 | US FAERS | |
| 333 | Atrial thrombosis | FAERS: 4 | US FAERS | |
| 334 | Bipolar I disorder | FAERS: 4 | US FAERS | |
| 335 | Blood follicle stimulating hormone abnormal | FAERS: 4 | US FAERS | |
| 336 | Blood prolactin increased | FAERS: 4 | US FAERS | |
| 337 | Bone density abnormal | FAERS: 4 | US FAERS | |
| 338 | Breast cancer stage III | FAERS: 4 | OFFSIDES US FAERS | |
| 339 | Bronchospasm | FAERS: 4 | US FAERS | |
| 340 | Depression suicidal | FAERS: 4 | US FAERS | |
| 341 | Device Failure | FAERS: 4 | US FAERS | |
| 342 | Diabetes mellitus inadequate control | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 343 | Disseminated Intravascular Coagulation | FAERS: 4 | US FAERS | |
| 344 | Dissociation | FAERS: 4 | US FAERS | |
| 345 | Emotional poverty | FAERS: 4 | US FAERS | |
| 346 | Glaucoma | FAERS: 4 | US FAERS | |
| 347 | Hypersomnia | FAERS: 4 | US FAERS | |
| 348 | Induration | FAERS: 4 | OFFSIDES US FAERS | |
| 349 | Infarction | FAERS: 4 | US FAERS | |
| 350 | Injection site cellulitis | FAERS: 4 | OFFSIDES US FAERS | |
| 351 | Injection site ulcer | FAERS: 4 | US FAERS | |
| 352 | Injection site vesicles | FAERS: 4 | US FAERS | |
| 353 | Injury associated with device | FAERS: 4 | US FAERS | |
| 354 | Joint injury | FAERS: 4 | US FAERS | |
| 355 | Limb injury | FAERS: 4 | US FAERS | |
| 356 | Lipoma | FAERS: 4 | US FAERS | |
| 357 | Malignant neoplasm progression | FAERS: 4 | US FAERS | |
| 358 | Meningitis | FAERS: 4 | US FAERS | |
| 359 | Middle insomnia | FAERS: 4 | US FAERS | |
| 360 | Muscle tightness | FAERS: 4 | US FAERS | |
| 361 | Musculoskeletal chest pain | FAERS: 4 | US FAERS | |
| 362 | Needle issue | FAERS: 4 | US FAERS | |
| 363 | Nerve injury | FAERS: 4 | US FAERS | |
| 364 | Neuralgia | FAERS: 4 | US FAERS | |
| 365 | Osteogenesis Imperfecta | FAERS: 4 | US FAERS | |
| 366 | Ovarian failure | FAERS: 4 | US FAERS | |
| 367 | Pain of skin | FAERS: 4 | US FAERS | |
| 368 | Portal Vein Thrombosis | FAERS: 4 | US FAERS | |
| 369 | Post procedural infection | FAERS: 4 | OFFSIDES US FAERS | |
| 370 | Pre-Eclampsia | FAERS: 4 | US FAERS | |
| 371 | Precancerous cells present | FAERS: 4 | US FAERS | |
| 372 | Product dose omission | FAERS: 4 | US FAERS | |
| 373 | Product prescribing error | FAERS: 4 | US FAERS | |
| 374 | Rash erythematous | FAERS: 4 | US FAERS | |
| 375 | Retinal Detachment | FAERS: 4 | US FAERS | |
| 376 | Rosacea | FAERS: 4 | 4261461 | CTD US FAERS |
| 377 | Schizophrenia | FAERS: 4 | US FAERS | |
| 378 | Scleroderma | FAERS: 4 | OFFSIDES US FAERS | |
| 379 | Shock | FAERS: 4 | US FAERS | |
| 380 | Skin necrosis | FAERS: 4 | US FAERS | |
| 381 | Skin reaction | FAERS: 4 | US FAERS | |
| 382 | Sluggishness | FAERS: 4 | US FAERS | |
| 383 | Small cell lung cancer metastatic | FAERS: 4 | US FAERS | |
| 384 | Spinal column injury | FAERS: 4 | US FAERS | |
| 385 | Staphylococcal abscess | FAERS: 4 | US FAERS | |
| 386 | Thrombophlebitis | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 387 | Uterine spasm | FAERS: 4 | US FAERS | |
| 388 | Vaginal pain | FAERS: 4 | US FAERS | |
| 389 | Venous Thrombosis | FAERS: 4 | 1388285 | CTD US FAERS |
| 390 | Vulvovaginal burning sensation | FAERS: 4 | US FAERS | |
| 391 | Vulvovaginal pain | FAERS: 4 | US FAERS | |
| 392 | Vulvovaginal swelling | FAERS: 4 | US FAERS | |
| 393 | neurofibroma | FAERS: 4 | US FAERS | |
| 394 | Accidental exposure | FAERS: 3 | US FAERS | |
| 395 | Agoraphobia | FAERS: 3 | OFFSIDES US FAERS | |
| 396 | Apathy | FAERS: 3 | US FAERS | |
| 397 | Aphagia | FAERS: 3 | US FAERS | |
| 398 | Atherosclerosis | FAERS: 3 | US FAERS | |
| 399 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 400 | Atrophic vulvovaginitis | FAERS: 3 | US FAERS | |
| 401 | Blood follicle stimulating hormone decreased | FAERS: 3 | US FAERS | |
| 402 | Bradycardia | FAERS: 3 | US FAERS | |
| 403 | Breast fibroma | FAERS: 3 | US FAERS | |
| 404 | Breast infection | FAERS: 3 | US FAERS | |
| 405 | Bruxism | FAERS: 3 | US FAERS | |
| 406 | Carcinoma in Situ | FAERS: 3 | US FAERS | |
| 407 | Cataract | FAERS: 3 | US FAERS | |
| 408 | Cerebellar infarction | FAERS: 3 | US FAERS | |
| 409 | Cerebral disorder | FAERS: 3 | US FAERS | |
| 410 | Cervical polyp | FAERS: 3 | US FAERS | |
| 411 | Choking | FAERS: 3 | US FAERS | |
| 412 | Conversion disorder | FAERS: 3 | US FAERS | |
| 413 | Drug screen false positive | FAERS: 3 | US FAERS | |
| 414 | Economic problem | FAERS: 3 | US FAERS | |
| 415 | Facial Pain | FAERS: 3 | US FAERS | |
| 416 | Fat necrosis | FAERS: 3 | US FAERS | |
| 417 | Femoral artery occlusion | FAERS: 3 | US FAERS | |
| 418 | Fibrin D dimer increased | FAERS: 3 | US FAERS | |
| 419 | Fibroadenoma of breast | FAERS: 3 | OFFSIDES US FAERS | |
| 420 | Food craving | FAERS: 3 | US FAERS | |
| 421 | Gangrene | FAERS: 3 | US FAERS | |
| 422 | Gastric infection | FAERS: 3 | US FAERS | |
| 423 | Gastritis | FAERS: 3 | US FAERS | |
| 424 | Glioblastoma | FAERS: 3 | US FAERS | |
| 425 | Guillain-Barre Syndrome | FAERS: 3 | US FAERS | |
| 426 | HIV test false positive | FAERS: 3 | US FAERS | |
| 427 | Head discomfort | FAERS: 3 | US FAERS | |
| 428 | Hemiplegia | FAERS: 3 | US FAERS | |
| 429 | Hepatitis | FAERS: 3 | US FAERS | |
| 430 | Hernia | FAERS: 3 | US FAERS | |
| 431 | Hydrometra | FAERS: 3 | US FAERS | |
| 432 | Hyperacusis | FAERS: 3 | US FAERS | |
| 433 | Hyperplasia | FAERS: 3 | 11544839 19591991 19609016 | CTD US FAERS |
| 434 | Hypertrichosis | FAERS: 3 | 4261461 | CTD OFFSIDES US FAERS |
| 435 | Hypoaesthesia facial | FAERS: 3 | US FAERS | |
| 436 | Iatrogenic injury | FAERS: 3 | US FAERS | |
| 437 | Inadequate lubrication | FAERS: 3 | US FAERS | |
| 438 | Inflammatory carcinoma of breast stage IV | FAERS: 3 | US FAERS | |
| 439 | Injection site cyst | FAERS: 3 | US FAERS | |
| 440 | Injection site hypersensitivity | FAERS: 3 | US FAERS | |
| 441 | Injection site indentation | FAERS: 3 | US FAERS | |
| 442 | Injection site scab | FAERS: 3 | US FAERS | |
| 443 | Injection site warmth | FAERS: 3 | US FAERS | |
| 444 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 445 | Intercepted drug dispensing error | FAERS: 3 | US FAERS | |
| 446 | Lactation Disorder | FAERS: 3 | US FAERS | |
| 447 | Lymphoma | FAERS: 3 | US FAERS | |
| 448 | Maternal exposure before pregnancy | FAERS: 3 | US FAERS | |
| 449 | Meniscus injury | FAERS: 3 | US FAERS | |
| 450 | Mental impairment | FAERS: 3 | US FAERS | |
| 451 | Muscle strain | FAERS: 3 | US FAERS | |
| 452 | Myositis | FAERS: 3 | US FAERS | |
| 453 | Oligohydramnios | FAERS: 3 | US FAERS | |
| 454 | Pelvic discomfort | FAERS: 3 | US FAERS | |
| 455 | Pericardial effusion | FAERS: 3 | US FAERS | |
| 456 | Pregnancy on oral contraceptive | FAERS: 3 | US FAERS | |
| 457 | Pregnancy test false positive | FAERS: 3 | US FAERS | |
| 458 | Product administration error | FAERS: 3 | US FAERS | |
| 459 | Product blister packaging issue | FAERS: 3 | US FAERS | |
| 460 | Product container issue | FAERS: 3 | US FAERS | |
| 461 | Product counterfeit | FAERS: 3 | US FAERS | |
| 462 | Psoriasis | FAERS: 3 | US FAERS | |
| 463 | Pulmonary Infarction | FAERS: 3 | US FAERS | |
| 464 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 465 | Retinal vascular thrombosis | FAERS: 3 | US FAERS | |
| 466 | Sepsis | FAERS: 3 | US FAERS | |
| 467 | Skin hypertrophy | FAERS: 3 | US FAERS | |
| 468 | Teeth brittle | FAERS: 3 | US FAERS | |
| 469 | Tenosynovitis | FAERS: 3 | US FAERS | |
| 470 | Tension | FAERS: 3 | US FAERS | |
| 471 | Thoracic vertebral fracture | FAERS: 3 | US FAERS | |
| 472 | Ulcer | FAERS: 3 | US FAERS | |
| 473 | Accessory breast | FAERS: 2 | OFFSIDES US FAERS | |
| 474 | Accidental overdose | FAERS: 2 | US FAERS | |
| 475 | Administration site hypersensitivity | FAERS: 2 | US FAERS | |
| 476 | Adverse event | FAERS: 2 | US FAERS | |
| 477 | Alcohol interaction | FAERS: 2 | OFFSIDES US FAERS | |
| 478 | Allergic cough | FAERS: 2 | US FAERS | |
| 479 | Amyotrophic Lateral Sclerosis | FAERS: 2 | US FAERS | |
| 480 | Anal Fistula | FAERS: 2 | OFFSIDES US FAERS | |
| 481 | Anaphylactoid Reaction | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 482 | Anorectal discomfort | FAERS: 2 | US FAERS | |
| 483 | Anorgasmia | FAERS: 2 | US FAERS | |
| 484 | Application site swelling | FAERS: 2 | US FAERS | |
| 485 | Arterial thrombosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 486 | Atelectasis | FAERS: 2 | US FAERS | |
| 487 | Bacterial Vaginosis | FAERS: 2 | US FAERS | |
| 488 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 489 | Blood cholesterol abnormal | FAERS: 2 | US FAERS | |
| 490 | Blood count abnormal | FAERS: 2 | US FAERS | |
| 491 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 492 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 493 | Blood pressure immeasurable | FAERS: 2 | US FAERS | |
| 494 | Breast engorgement | FAERS: 2 | US FAERS | |
| 495 | Breast necrosis | FAERS: 2 | OFFSIDES US FAERS | |
| 496 | Bronchopneumonia | FAERS: 2 | US FAERS | |
| 497 | Calcium deficiency | FAERS: 2 | US FAERS | |
| 498 | Candidiasis | FAERS: 2 | US FAERS | |
| 499 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 500 | Cardiomegaly | FAERS: 2 | US FAERS | |
| 501 | Cartilage injury | FAERS: 2 | OFFSIDES US FAERS | |
| 502 | Cholecystitis | FAERS: 2 | US FAERS | |
| 503 | Claustrophobia | FAERS: 2 | US FAERS | |
| 504 | Completed Suicide | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 505 | Concomitant disease progression | FAERS: 2 | US FAERS | |
| 506 | Cortisol increased | FAERS: 2 | US FAERS | |
| 507 | Counterfeit drug administered | FAERS: 2 | US FAERS | |
| 508 | Culture positive | FAERS: 2 | US FAERS | |
| 509 | Culture wound positive | FAERS: 2 | US FAERS | |
| 510 | Delirium | FAERS: 2 | US FAERS | |
| 511 | Demyelination | FAERS: 2 | US FAERS | |
| 512 | Diabetic Ketoacidosis | FAERS: 2 | US FAERS | |
| 513 | Disabled relative | FAERS: 2 | US FAERS | |
| 514 | Disturbance in sexual arousal | FAERS: 2 | US FAERS | |
| 515 | Diverticulitis | FAERS: 2 | US FAERS | |
| 516 | Drug effective for unapproved indication | FAERS: 2 | US FAERS | |
| 517 | Drug screen positive | FAERS: 2 | US FAERS | |
| 518 | Dystonia | FAERS: 2 | OFFSIDES US FAERS | |
| 519 | Eczema | FAERS: 2 | US FAERS | |
| 520 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 521 | Encapsulation reaction | FAERS: 2 | US FAERS | |
| 522 | Erythema Nodosum | FAERS: 2 | US FAERS | |
| 523 | Essential Tremor | FAERS: 2 | US FAERS | |
| 524 | Excitability | FAERS: 2 | US FAERS | |
| 525 | Fluid overload | FAERS: 2 | US FAERS | |
| 526 | Frustration tolerance decreased | FAERS: 2 | US FAERS | |
| 527 | Gait inability | FAERS: 2 | US FAERS | |
| 528 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 529 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 530 | Gastrointestinal infection | FAERS: 2 | OFFSIDES US FAERS | |
| 531 | Genital abscess | FAERS: 2 | US FAERS | |
| 532 | Genital pain | FAERS: 2 | US FAERS | |
| 533 | Gingivitis | FAERS: 2 | US FAERS | |
| 534 | Gout | FAERS: 2 | US FAERS | |
| 535 | Head titubation | FAERS: 2 | US FAERS | |
| 536 | Hemiparesis | FAERS: 2 | US FAERS | |
| 537 | Hepatitis B surface antigen positive | FAERS: 2 | US FAERS | |
| 538 | Hepatitis C | FAERS: 2 | US FAERS | |
| 539 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 540 | Hydrocephalus | FAERS: 2 | US FAERS | |
| 541 | Hyperphagia | FAERS: 2 | US FAERS | |
| 542 | Hypokinesia | FAERS: 2 | US FAERS | |
| 543 | Hypotrichosis | FAERS: 2 | US FAERS | |
| 544 | Impatience | FAERS: 2 | US FAERS | |
| 545 | Inadequate analgesia | FAERS: 2 | US FAERS | |
| 546 | Incontinence | FAERS: 2 | US FAERS | |
| 547 | Incorrect storage of drug | FAERS: 2 | US FAERS | |
| 548 | Increased viscosity of bronchial secretion | FAERS: 2 | US FAERS | |
| 549 | Infusion site inflammation | FAERS: 2 | US FAERS | |
| 550 | Injection site extravasation | FAERS: 2 | US FAERS | |
| 551 | Injection site injury | FAERS: 2 | US FAERS | |
| 552 | Injection site irritation | FAERS: 2 | US FAERS | |
| 553 | Injection site papule | FAERS: 2 | US FAERS | |
| 554 | Insulin Resistance | FAERS: 2 | 8751273 | CTD US FAERS |
| 555 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 556 | Intentional misuse | FAERS: 2 | US FAERS | |
| 557 | Intercepted medication error | FAERS: 2 | US FAERS | |
| 558 | Intervertebral disc compression | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 559 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 560 | Joint sprain | FAERS: 2 | US FAERS | |
| 561 | Lipoatrophy | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 562 | Loss of personal independence in daily activities | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 563 | Low birth weight baby | FAERS: 2 | US FAERS | |
| 564 | Macular degeneration | FAERS: 2 | US FAERS | |
| 565 | Mastoiditis | FAERS: 2 | US FAERS | |
| 566 | Medication residue | FAERS: 2 | US FAERS | |
| 567 | Meningism | FAERS: 2 | US FAERS | |
| 568 | Microcephaly | FAERS: 2 | OFFSIDES US FAERS | |
| 569 | Mononucleosis syndrome | FAERS: 2 | US FAERS | |
| 570 | Mycobacterium abscessus Infection | FAERS: 2 | US FAERS | |
| 571 | Myocarditis | FAERS: 2 | US FAERS | |
| 572 | Necrosis | FAERS: 2 | 8921121 | CTD US FAERS |
| 573 | Negative thoughts | FAERS: 2 | US FAERS | |
| 574 | Neonatal disorder | FAERS: 2 | US FAERS | |
| 575 | Nodule | FAERS: 2 | OFFSIDES US FAERS | |
| 576 | Obesity surgery | FAERS: 2 | OFFSIDES US FAERS | |
| 577 | Osteomalacia | FAERS: 2 | US FAERS | |
| 578 | Otitis Media | FAERS: 2 | US FAERS | |
| 579 | Ovarian enlargement | FAERS: 2 | US FAERS | |
| 580 | Overdose | FAERS: 2 | US FAERS | |
| 581 | Overweight | FAERS: 2 | US FAERS | |
| 582 | Panic Disorder | FAERS: 2 | US FAERS | |
| 583 | Patellofemoral Pain Syndrome | FAERS: 2 | US FAERS | |
| 584 | Pelvic Inflammatory Disease | FAERS: 2 | US FAERS | |
| 585 | Pelvic fluid collection | FAERS: 2 | OFFSIDES US FAERS | |
| 586 | Pelvic venous thrombosis | FAERS: 2 | US FAERS | |
| 587 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 588 | Poisoning | FAERS: 2 | US FAERS | |
| 589 | Polysubstance abuse | FAERS: 2 | US FAERS | |
| 590 | Post procedural pain | FAERS: 2 | US FAERS | |
| 591 | Post-Traumatic Stress Disorder | FAERS: 2 | US FAERS | |
| 592 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 593 | Product administered at inappropriate site | FAERS: 2 | US FAERS | |
| 594 | Product coating issue | FAERS: 2 | US FAERS | |
| 595 | Product complaint | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 596 | Product contamination | FAERS: 2 | US FAERS | |
| 597 | Product shape issue | FAERS: 2 | US FAERS | |
| 598 | Productive Cough | FAERS: 2 | US FAERS | |
| 599 | Progesterone increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 600 | Prolactinoma | FAERS: 2 | US FAERS | |
| 601 | Pseudobulbar Palsy | FAERS: 2 | US FAERS | |
| 602 | Radiation skin injury | FAERS: 2 | OFFSIDES US FAERS | |
| 603 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 604 | Retrograde amnesia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 605 | Rhinitis | FAERS: 2 | US FAERS | |
| 606 | Rotator cuff syndrome | FAERS: 2 | US FAERS | |
| 607 | Salpingitis | FAERS: 2 | US FAERS | |
| 608 | Scab | FAERS: 2 | US FAERS | |
| 609 | Schistosomiasis | FAERS: 2 | US FAERS | |
| 610 | Secretion discharge | FAERS: 2 | US FAERS | |
| 611 | Skin discomfort | FAERS: 2 | US FAERS | |
| 612 | Smear site unspecified abnormal | FAERS: 2 | US FAERS | |
| 613 | Somatoform disorder pregnancy | FAERS: 2 | US FAERS | |
| 614 | Spinal column stenosis | FAERS: 2 | US FAERS | |
| 615 | Splenic vein thrombosis | FAERS: 2 | US FAERS | |
| 616 | Sunburn | FAERS: 2 | US FAERS | |
| 617 | Superior Vena Cava Syndrome | FAERS: 2 | US FAERS | |
| 618 | Syndactyly | FAERS: 2 | US FAERS | |
| 619 | Tablet issue | FAERS: 2 | US FAERS | |
| 620 | Talipes | FAERS: 2 | US FAERS | |
| 621 | Therapy cessation | FAERS: 2 | US FAERS | |
| 622 | Throat irritation | FAERS: 2 | US FAERS | |
| 623 | Thyroidectomy | FAERS: 2 | US FAERS | |
| 624 | Transaminases increased | FAERS: 2 | US FAERS | |
| 625 | Trisomy 21 | FAERS: 2 | US FAERS | |
| 626 | Underweight | FAERS: 2 | US FAERS | |
| 627 | Unwanted pregnancy | FAERS: 2 | US FAERS | |
| 628 | Upper respiratory tract congestion | FAERS: 2 | US FAERS | |
| 629 | Urinary Retention | FAERS: 2 | US FAERS | |
| 630 | Urine human chorionic gonadotropin positive | FAERS: 2 | US FAERS | |
| 631 | Uterine atrophy | FAERS: 2 | US FAERS | |
| 632 | Uterine contractions during pregnancy | FAERS: 2 | US FAERS | |
| 633 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 634 | Vaginal mycosis | FAERS: 2 | US FAERS | |
| 635 | Vaginal pH abnormal | FAERS: 2 | US FAERS | |
| 636 | Vaginitis | FAERS: 2 | US FAERS | |
| 637 | Venous Injury | FAERS: 2 | US FAERS | |
| 638 | Venous thrombosis limb | FAERS: 2 | US FAERS | |
| 639 | Ventricular arrhythmia | FAERS: 2 | US FAERS | |
| 640 | Victim of homicide | FAERS: 2 | OFFSIDES US FAERS | |
| 641 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 642 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 643 | muscle injury | FAERS: 2 | US FAERS | |
| 644 | Abdominal mass | FAERS: 1 | US FAERS | |
| 645 | Aborted pregnancy | FAERS: 1 | US FAERS | |
| 646 | Acanthosis | FAERS: 1 | US FAERS | |
| 647 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 648 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 649 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 650 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 651 | Adenocarcinoma | FAERS: 1 | CTD OFFSIDES US FAERS | |
| 652 | Administration site bruise | FAERS: 1 | US FAERS | |
| 653 | Adrenal mass | FAERS: 1 | OFFSIDES US FAERS | |
| 654 | Adrenocortical insufficiency chronic | FAERS: 1 | US FAERS | |
| 655 | Ageusia | FAERS: 1 | US FAERS | |
| 656 | Alcohol Intolerance | FAERS: 1 | US FAERS | |
| 657 | Alcohol problem | FAERS: 1 | US FAERS | |
| 658 | Altered state of consciousness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 659 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 660 | Amniotic fluid volume decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 661 | Androgenetic Alopecia | FAERS: 1 | US FAERS | |
| 662 | Androgens increased | FAERS: 1 | US FAERS | |
| 663 | Anhedonia | FAERS: 1 | US FAERS | |
| 664 | Anosmia | FAERS: 1 | US FAERS | |
| 665 | Anoxia | FAERS: 1 | US FAERS | |
| 666 | Anoxic Encephalopathy | FAERS: 1 | US FAERS | |
| 667 | Appendicitis | FAERS: 1 | US FAERS | |
| 668 | Application site erythema | FAERS: 1 | US FAERS | |
| 669 | Application site exfoliation | FAERS: 1 | US FAERS | |
| 670 | Application site folliculitis | FAERS: 1 | US FAERS | |
| 671 | Application site induration | FAERS: 1 | US FAERS | |
| 672 | Application site inflammation | FAERS: 1 | US FAERS | |
| 673 | Application site papules | FAERS: 1 | US FAERS | |
| 674 | Application site vesicles | FAERS: 1 | US FAERS | |
| 675 | Arachnoiditis | FAERS: 1 | US FAERS | |
| 676 | Arthropod bite | FAERS: 1 | US FAERS | |
| 677 | Ascites | FAERS: 1 | US FAERS | |
| 678 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 679 | Autoimmune progesterone dermatitis | FAERS: 1 | US FAERS | |
| 680 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 681 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 682 | Avulsion fracture | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 683 | Bacteria stool identified | FAERS: 1 | US FAERS | |
| 684 | Bacteria wound identified | FAERS: 1 | US FAERS | |
| 685 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 686 | Benign female reproductive tract neoplasm | FAERS: 1 | US FAERS | |
| 687 | Bile output increased | FAERS: 1 | US FAERS | |
| 688 | Biliary Colic | FAERS: 1 | US FAERS | |
| 689 | Biopsy cervix abnormal | FAERS: 1 | US FAERS | |
| 690 | Bladder malposition acquired | FAERS: 1 | US FAERS | |
| 691 | Blepharospasm | FAERS: 1 | US FAERS | |
| 692 | Blood copper increased | FAERS: 1 | US FAERS | |
| 693 | Blood cortisol decreased | FAERS: 1 | US FAERS | |
| 694 | Blood gonadotrophin decreased | FAERS: 1 | US FAERS | |
| 695 | Blood human chorionic gonadotropin positive | FAERS: 1 | US FAERS | |
| 696 | Blood mercury abnormal | FAERS: 1 | US FAERS | |
| 697 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 698 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 699 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 700 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 701 | Blood prolactin decreased | FAERS: 1 | US FAERS | |
| 702 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 703 | Body fat disorder | FAERS: 1 | US FAERS | |
| 704 | Bone Sarcoma | FAERS: 1 | US FAERS | |
| 705 | Bone density increased | FAERS: 1 | US FAERS | |
| 706 | Breakthrough Pain | FAERS: 1 | US FAERS | |
| 707 | Breech Presentation | FAERS: 1 | US FAERS | |
| 708 | Budd-Chiari Syndrome | FAERS: 1 | US FAERS | |
| 709 | Bursitis | FAERS: 1 | US FAERS | |
| 710 | Cachexia | FAERS: 1 | US FAERS | |
| 711 | Calcinosis | FAERS: 1 | US FAERS | |
| 712 | Carcinoma | FAERS: 1 | 3743595 19146866 | CTD US FAERS |
| 713 | Carotid artery aneurysm | FAERS: 1 | US FAERS | |
| 714 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 715 | Catheter sepsis | FAERS: 1 | US FAERS | |
| 716 | Cauda Equina Syndrome | FAERS: 1 | US FAERS | |
| 717 | Cavernous Sinus Thrombosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 718 | Central pain syndrome | FAERS: 1 | US FAERS | |
| 719 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 720 | Cheilitis | FAERS: 1 | US FAERS | |
| 721 | Choking sensation | FAERS: 1 | US FAERS | |
| 722 | Cholestasis | FAERS: 1 | US FAERS | |
| 723 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 724 | Cleft Palate | FAERS: 1 | 6461082 | CTD US FAERS |
| 725 | Colitis | FAERS: 1 | US FAERS | |
| 726 | Comedone | FAERS: 1 | US FAERS | |
| 727 | Complement factor C3 increased | FAERS: 1 | US FAERS | |
| 728 | Compression fracture | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 729 | Congenital Hydrocephalus | FAERS: 1 | US FAERS | |
| 730 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 731 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 732 | Coombs test positive | FAERS: 1 | US FAERS | |
| 733 | Cortisol deficiency | FAERS: 1 | US FAERS | |
| 734 | Cyanosis | FAERS: 1 | US FAERS | |
| 735 | Cytomegalovirus antibody positive | FAERS: 1 | US FAERS | |
| 736 | Cytotoxic cardiomyopathy | FAERS: 1 | US FAERS | |
| 737 | Decidual cast | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 738 | Deformity | FAERS: 1 | US FAERS | |
| 739 | Dengue Fever | FAERS: 1 | US FAERS | |
| 740 | Dependence | FAERS: 1 | US FAERS | |
| 741 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 742 | Dermatitis | FAERS: 1 | US FAERS | |
| 743 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 744 | Detachment of retinal pigment epithelium | FAERS: 1 | US FAERS | |
| 745 | Device malfunction | FAERS: 1 | US FAERS | |
| 746 | Device occlusion | FAERS: 1 | US FAERS | |
| 747 | Diaphragmatic Hernia | FAERS: 1 | OFFSIDES US FAERS | |
| 748 | Disability | FAERS: 1 | US FAERS | |
| 749 | Diverticulum | FAERS: 1 | US FAERS | |
| 750 | Drug abuser | FAERS: 1 | US FAERS | |
| 751 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 752 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 753 | Drug withdrawal convulsions | FAERS: 1 | US FAERS | |
| 754 | Dysentery | FAERS: 1 | US FAERS | |
| 755 | Dysphemia | FAERS: 1 | US FAERS | |
| 756 | Dysplasia | FAERS: 1 | US FAERS | |
| 757 | Ear congestion | FAERS: 1 | US FAERS | |
| 758 | Ear, nose and throat examination abnormal | FAERS: 1 | US FAERS | |
| 759 | Echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 760 | Eclampsia | FAERS: 1 | OFFSIDES US FAERS | |
| 761 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 762 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 763 | Embolic stroke | FAERS: 1 | US FAERS | |
| 764 | Endometritis | FAERS: 1 | US FAERS | |
| 765 | Epidermal growth factor receptor increased | FAERS: 1 | US FAERS | |
| 766 | Epstein Barr virus positive mucocutaneous ulcer | FAERS: 1 | US FAERS | |
| 767 | Erysipelas | FAERS: 1 | US FAERS | |
| 768 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 769 | Eustachian tube disorder | FAERS: 1 | US FAERS | |
| 770 | Expired product administered | FAERS: 1 | US FAERS | |
| 771 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 772 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 773 | Exposure via father | FAERS: 1 | US FAERS | |
| 774 | Extra dose administered | FAERS: 1 | US FAERS | |
| 775 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 776 | Eye Redness | FAERS: 1 | US FAERS | |
| 777 | Eye inflammation | FAERS: 1 | US FAERS | |
| 778 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 779 | Facial Paresis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 780 | Facial paralysis | FAERS: 1 | US FAERS | |
| 781 | False negative pregnancy test | FAERS: 1 | US FAERS | |
| 782 | Fat necrosis of breast | FAERS: 1 | US FAERS | |
| 783 | Female sex hormone level | FAERS: 1 | US FAERS | |
| 784 | Female sexual dysfunction | FAERS: 1 | US FAERS | |
| 785 | Femoral arterial stenosis | FAERS: 1 | US FAERS | |
| 786 | Fibromatosis | FAERS: 1 | US FAERS | |
| 787 | Flank Pain | FAERS: 1 | US FAERS | |
| 788 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 789 | Frustration | FAERS: 1 | US FAERS | |
| 790 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 791 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 792 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 793 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 794 | Gastric mucosal lesion | FAERS: 1 | US FAERS | |
| 795 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 796 | Gastrointestinal disorder congenital | FAERS: 1 | US FAERS | |
| 797 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 798 | Genital discharge | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 799 | Genital discomfort | FAERS: 1 | US FAERS | |
| 800 | Gingival Recession | FAERS: 1 | US FAERS | |
| 801 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 802 | Graft thrombosis | FAERS: 1 | US FAERS | |
| 803 | Granuloma | FAERS: 1 | US FAERS | |
| 804 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 805 | Growing pains | FAERS: 1 | US FAERS | |
| 806 | Growth retardation | FAERS: 1 | US FAERS | |
| 807 | Halitosis | FAERS: 1 | US FAERS | |
| 808 | Head circumference abnormal | FAERS: 1 | US FAERS | |
| 809 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 810 | Hepatitis B positive | FAERS: 1 | US FAERS | |
| 811 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 812 | Hilar lymphadenopathy | FAERS: 1 | OFFSIDES US FAERS | |
| 813 | Hip surgery | FAERS: 1 | OFFSIDES US FAERS | |
| 814 | Histoplasmosis | FAERS: 1 | US FAERS | |
| 815 | Homicide | FAERS: 1 | US FAERS | |
| 816 | Homosexuality | FAERS: 1 | US FAERS | |
| 817 | Hostility | FAERS: 1 | US FAERS | |
| 818 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 819 | Hypercalciuria | FAERS: 1 | US FAERS | |
| 820 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 821 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 822 | Hyperprogesteronism | FAERS: 1 | US FAERS | |
| 823 | Hypochondriasis | FAERS: 1 | US FAERS | |
| 824 | Hypophagia | FAERS: 1 | US FAERS | |
| 825 | Hypothalamo-pituitary disorder | FAERS: 1 | US FAERS | |
| 826 | Idiopathic guttate hypomelanosis | FAERS: 1 | US FAERS | |
| 827 | Ileus | FAERS: 1 | US FAERS | |
| 828 | Iliotibial Band Syndrome | FAERS: 1 | US FAERS | |
| 829 | Immediate post-injection reaction | FAERS: 1 | US FAERS | |
| 830 | Immunosuppression | FAERS: 1 | US FAERS | |
| 831 | Impaired self-care | FAERS: 1 | US FAERS | |
| 832 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 833 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 834 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 835 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 836 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 837 | Infusion site bruising | FAERS: 1 | US FAERS | |
| 838 | Initial insomnia | FAERS: 1 | US FAERS | |
| 839 | Injected limb mobility decreased | FAERS: 1 | US FAERS | |
| 840 | Injection site exfoliation | FAERS: 1 | US FAERS | |
| 841 | Injection site fibrosis | FAERS: 1 | US FAERS | |
| 842 | Injection site joint inflammation | FAERS: 1 | US FAERS | |
| 843 | Injection site joint movement impairment | FAERS: 1 | US FAERS | |
| 844 | Injection site pallor | FAERS: 1 | US FAERS | |
| 845 | Instillation site discomfort | FAERS: 1 | US FAERS | |
| 846 | Insulin-requiring type 2 diabetes mellitus | FAERS: 1 | US FAERS | |
| 847 | Intention tremor | FAERS: 1 | US FAERS | |
| 848 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 849 | Intercepted product administration error | FAERS: 1 | US FAERS | |
| 850 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 851 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 852 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 853 | Intestinal infarction | FAERS: 1 | US FAERS | |
| 854 | Intracranial meningioma malignant | FAERS: 1 | US FAERS | |
| 855 | Iron deficiency | FAERS: 1 | US FAERS | |
| 856 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 857 | Laboratory test interference | FAERS: 1 | OFFSIDES US FAERS | |
| 858 | Laceration | FAERS: 1 | US FAERS | |
| 859 | Lactescent serum | FAERS: 1 | US FAERS | |
| 860 | Lactose Intolerance | FAERS: 1 | OFFSIDES US FAERS | |
| 861 | Laryngospasm | FAERS: 1 | US FAERS | |
| 862 | Ligament rupture | FAERS: 1 | US FAERS | |
| 863 | Limb operation | FAERS: 1 | US FAERS | |
| 864 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 865 | Lipodystrophy acquired | FAERS: 1 | US FAERS | |
| 866 | Liver function test decreased | FAERS: 1 | US FAERS | |
| 867 | Lochia malodourous | FAERS: 1 | US FAERS | |
| 868 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 869 | Lung consolidation | FAERS: 1 | US FAERS | |
| 870 | Lyme Disease | FAERS: 1 | US FAERS | |
| 871 | Lymph node cancer metastatic | FAERS: 1 | OFFSIDES US FAERS | |
| 872 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 873 | Lymphostasis | FAERS: 1 | US FAERS | |
| 874 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 875 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 876 | Malabsorption | FAERS: 1 | US FAERS | |
| 877 | Malaria | FAERS: 1 | US FAERS | |
| 878 | Malignant neoplasm of choroid | FAERS: 1 | US FAERS | |
| 879 | Malnutrition | FAERS: 1 | US FAERS | |
| 880 | Markedly reduced dietary intake | FAERS: 1 | US FAERS | |
| 881 | Meconium abnormal | FAERS: 1 | US FAERS | |
| 882 | Meconium plug syndrome | FAERS: 1 | US FAERS | |
| 883 | Medication residue present | FAERS: 1 | US FAERS | |
| 884 | Melanoma recurrent | FAERS: 1 | US FAERS | |
| 885 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 886 | Mental retardation severity unspecified | FAERS: 1 | US FAERS | |
| 887 | Mental status changes | FAERS: 1 | US FAERS | |
| 888 | Metaplasia | FAERS: 1 | US FAERS | |
| 889 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 890 | Monoparesis | FAERS: 1 | US FAERS | |
| 891 | Monoplegia | FAERS: 1 | OFFSIDES US FAERS | |
| 892 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 893 | Mouth cyst | FAERS: 1 | US FAERS | |
| 894 | Mouth swelling | FAERS: 1 | US FAERS | |
| 895 | Multiple Myeloma | FAERS: 1 | US FAERS | |
| 896 | Multiple allergies | FAERS: 1 | US FAERS | |
| 897 | Muscle necrosis | FAERS: 1 | US FAERS | |
| 898 | Mutism | FAERS: 1 | US FAERS | |
| 899 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 900 | Mycobacterium chelonei infection | FAERS: 1 | US FAERS | |
| 901 | Myomectomy | FAERS: 1 | US FAERS | |
| 902 | Nasal Polyps | FAERS: 1 | US FAERS | |
| 903 | Nephritis | FAERS: 1 | US FAERS | |
| 904 | Nerve root injury | FAERS: 1 | US FAERS | |
| 905 | Neuropathy | FAERS: 1 | US FAERS | |
| 906 | No adverse effect | FAERS: 1 | US FAERS | |
| 907 | Nocturia | FAERS: 1 | US FAERS | |
| 908 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 909 | Omphalitis | FAERS: 1 | US FAERS | |
| 910 | Onychomycosis | FAERS: 1 | US FAERS | |
| 911 | Open wound | FAERS: 1 | US FAERS | |
| 912 | Oral infection | FAERS: 1 | US FAERS | |
| 913 | Oral pain | FAERS: 1 | US FAERS | |
| 914 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 915 | Osteitis Deformans | FAERS: 1 | US FAERS | |
| 916 | Osteopetrosis | FAERS: 1 | US FAERS | |
| 917 | Ovarian vein thrombosis | FAERS: 1 | US FAERS | |
| 918 | Ovulation disorder | FAERS: 1 | US FAERS | |
| 919 | PO2 decreased | FAERS: 1 | US FAERS | |
| 920 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 921 | Paresis | FAERS: 1 | US FAERS | |
| 922 | Pathological fracture | FAERS: 1 | US FAERS | |
| 923 | Pelvic Floor Muscle Weakness | FAERS: 1 | US FAERS | |
| 924 | Pelvic Infection | FAERS: 1 | US FAERS | |
| 925 | Pelvic abscess | FAERS: 1 | US FAERS | |
| 926 | Pelvic mass | FAERS: 1 | OFFSIDES US FAERS | |
| 927 | Pemphigus | FAERS: 1 | US FAERS | |
| 928 | Performance status decreased | FAERS: 1 | US FAERS | |
| 929 | Periorbital swelling | FAERS: 1 | US FAERS | |
| 930 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 931 | Peritonitis | FAERS: 1 | US FAERS | |
| 932 | Peritonsillar Abscess | FAERS: 1 | US FAERS | |
| 933 | Petechiae | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 934 | Physical examination abnormal | FAERS: 1 | US FAERS | |
| 935 | Pneumothorax | FAERS: 1 | US FAERS | |
| 936 | Polymenorrhagia | FAERS: 1 | US FAERS | |
| 937 | Polymyositis | FAERS: 1 | US FAERS | |
| 938 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 939 | Poor response to ovulation induction | FAERS: 1 | US FAERS | |
| 940 | Post inflammatory pigmentation change | FAERS: 1 | US FAERS | |
| 941 | Post procedural bile leak | FAERS: 1 | US FAERS | |
| 942 | Post procedural cellulitis | FAERS: 1 | OFFSIDES US FAERS | |
| 943 | Postmenopause | FAERS: 1 | US FAERS | |
| 944 | Postoperative infection | FAERS: 1 | US FAERS | |
| 945 | Postoperative thrombosis | FAERS: 1 | US FAERS | |
| 946 | Postoperative wound complication | FAERS: 1 | US FAERS | |
| 947 | Pregnancy on contraceptive | FAERS: 1 | US FAERS | |
| 948 | Pregnancy with contraceptive device | FAERS: 1 | US FAERS | |
| 949 | Pregnancy with implant contraceptive | FAERS: 1 | US FAERS | |
| 950 | Premenstrual Dysphoric Disorder | FAERS: 1 | US FAERS | |
| 951 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 952 | Primary hypogonadism | FAERS: 1 | US FAERS | |
| 953 | Product appearance confusion | FAERS: 1 | US FAERS | |
| 954 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 955 | Product label confusion | FAERS: 1 | US FAERS | |
| 956 | Product leakage | FAERS: 1 | US FAERS | |
| 957 | Product preparation issue | FAERS: 1 | US FAERS | |
| 958 | Product storage error | FAERS: 1 | US FAERS | |
| 959 | Product substitution issue | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 960 | Product use complaint | FAERS: 1 | US FAERS | |
| 961 | Progesterone receptor assay negative | FAERS: 1 | OFFSIDES US FAERS | |
| 962 | Protein C increased | FAERS: 1 | US FAERS | |
| 963 | Protein urine present | FAERS: 1 | US FAERS | |
| 964 | Pseudolymphoma | FAERS: 1 | US FAERS | |
| 965 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 966 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 967 | Pulmonary granuloma | FAERS: 1 | US FAERS | |
| 968 | Purulence | FAERS: 1 | US FAERS | |
| 969 | Purulent discharge | FAERS: 1 | US FAERS | |
| 970 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 971 | Quadruple vessel bypass graft | FAERS: 1 | US FAERS | |
| 972 | Radiation interaction | FAERS: 1 | US FAERS | |
| 973 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 974 | Renal abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 975 | Renal artery occlusion | FAERS: 1 | US FAERS | |
| 976 | Renal cell carcinoma recurrent | FAERS: 1 | US FAERS | |
| 977 | Renal cyst | FAERS: 1 | US FAERS | |
| 978 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 979 | Risk of future pregnancy miscarriage | FAERS: 1 | US FAERS | |
| 980 | Ruptured ectopic pregnancy | FAERS: 1 | US FAERS | |
| 981 | Sacroiliac fracture | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 982 | Salpingectomy | FAERS: 1 | US FAERS | |
| 983 | Scotoma | FAERS: 1 | US FAERS | |
| 984 | Sensation of blood flow | FAERS: 1 | US FAERS | |
| 985 | Seroma | FAERS: 1 | US FAERS | |
| 986 | Shoulder Pain | FAERS: 1 | US FAERS | |
| 987 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 988 | Sinus headache | FAERS: 1 | US FAERS | |
| 989 | Sinus operation | FAERS: 1 | US FAERS | |
| 990 | Sinus pain | FAERS: 1 | US FAERS | |
| 991 | Sinus polyp | FAERS: 1 | US FAERS | |
| 992 | Sjogren's Syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 993 | Skeletal injury | FAERS: 1 | US FAERS | |
| 994 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 995 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 996 | Skin neoplasm excision | FAERS: 1 | OFFSIDES US FAERS | |
| 997 | Spinal haemangioma | FAERS: 1 | US FAERS | |
| 998 | Splenectomy | FAERS: 1 | US FAERS | |
| 999 | Splenic granuloma | FAERS: 1 | US FAERS | |
| 1000 | Splenomegaly | FAERS: 1 | US FAERS | |
| 1001 | Spousal Abuse | FAERS: 1 | US FAERS | |
| 1002 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 1003 | Starvation | FAERS: 1 | US FAERS | |
| 1004 | Strabismus | FAERS: 1 | US FAERS | |
| 1005 | Stridor | FAERS: 1 | US FAERS | |
| 1006 | Subcutaneous nodule | FAERS: 1 | OFFSIDES US FAERS | |
| 1007 | Sudden death | FAERS: 1 | US FAERS | |
| 1008 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 1009 | Synovitis | FAERS: 1 | US FAERS | |
| 1010 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 1011 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 1012 | Therapeutic product effect increased | FAERS: 1 | US FAERS | |
| 1013 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 1014 | Throat cancer | FAERS: 1 | US FAERS | |
| 1015 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 1016 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 1017 | Tobacco user | FAERS: 1 | US FAERS | |
| 1018 | Tonsillectomy | FAERS: 1 | US FAERS | |
| 1019 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 1020 | Tooth Infection | FAERS: 1 | US FAERS | |
| 1021 | Transplant | FAERS: 1 | US FAERS | |
| 1022 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 1023 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 1024 | Ultrasound scan abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 1025 | Unemployment | FAERS: 1 | US FAERS | |
| 1026 | Unexpected therapeutic drug effect | FAERS: 1 | US FAERS | |
| 1027 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 1028 | Ureteric cancer metastatic | FAERS: 1 | US FAERS | |
| 1029 | Urinary tract infection fungal | FAERS: 1 | US FAERS | |
| 1030 | Urine amphetamine positive | FAERS: 1 | US FAERS | |
| 1031 | Uterine Prolapse | FAERS: 1 | US FAERS | |
| 1032 | Vaginal mucosal blistering | FAERS: 1 | US FAERS | |
| 1033 | Vein pain | FAERS: 1 | US FAERS | |
| 1034 | Venous occlusion | FAERS: 1 | US FAERS | |
| 1035 | Ventricular Fibrillation | FAERS: 1 | OFFSIDES US FAERS | |
| 1036 | Vertebral foraminal stenosis | FAERS: 1 | US FAERS | |
| 1037 | Victim of sexual abuse | FAERS: 1 | US FAERS | |
| 1038 | Visual snow syndrome | FAERS: 1 | US FAERS | |
| 1039 | Vulvitis | FAERS: 1 | OFFSIDES US FAERS | |
| 1040 | Vulvovaginal rash | FAERS: 1 | US FAERS | |
| 1041 | Weight | FAERS: 1 | US FAERS | |
| 1042 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 1043 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 1044 | Wound necrosis | FAERS: 1 | US FAERS | |
| 1045 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 1046 | furuncle | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1047 | Abnormal cervical smear | OFFSIDES | ||
| 1048 | Acne Vulgaris | 4261461 | CTD | |
| 1049 | Acquired diaphragmatic eventration | OFFSIDES | ||
| 1050 | Adenoma | 8751273 | CTD | |
| 1051 | Adrenal Cortex Diseases | 8751273 | CTD | |
| 1052 | Alopecia effluvium | OFFSIDES | ||
| 1053 | Amenorrhea | 3159786 6461984 | CTD OFFSIDES | |
| 1054 | Anal polyp | OFFSIDES | ||
| 1055 | Anemia, Megaloblastic | 6520357 | CTD | |
| 1056 | Antithrombin III Deficiency | OFFSIDES | ||
| 1057 | Aortic aneurysm repair | OFFSIDES | ||
| 1058 | Aortic bruit | OFFSIDES | ||
| 1059 | Arteriogram coronary abnormal | OFFSIDES | ||
| 1060 | Asterixis | OFFSIDES | ||
| 1061 | Ataxia | 6123383 | CTD | |
| 1062 | Basal cell carcinoma | OFFSIDES | ||
| 1063 | Bicytopenia | OFFSIDES | ||
| 1064 | Biliary cirrhosis | OFFSIDES | ||
| 1065 | Biopsy breast abnormal | OFFSIDES | ||
| 1066 | Biopsy site unspecified abnormal | OFFSIDES | ||
| 1067 | Biopsy | OFFSIDES | ||
| 1068 | Blepharoptosis | OFFSIDES | ||
| 1069 | Blood bicarbonate | OFFSIDES | ||
| 1070 | Blood immunoglobulin M | OFFSIDES | ||
| 1071 | Bone neoplasms | 10791010 10969600 | CTD | |
| 1072 | Bone swelling | OFFSIDES | ||
| 1073 | Breast Diseases | 6805242 | CTD | |
| 1074 | Bronchoalveolar lavage abnormal | OFFSIDES | ||
| 1075 | Bronchoscopy abnormal | OFFSIDES | ||
| 1076 | Cancer gene carrier | OFFSIDES | ||
| 1077 | Carcinoma, Endometrioid | 6461984 6920328 | CTD | |
| 1078 | Cardiac Tamponade | OFFSIDES | ||
| 1079 | Cardiovascular Diseases | 2935644 2942707 | CTD | |
| 1080 | Catalepsy | 6303368 6315179 | CTD | |
| 1081 | Cataract operation | OFFSIDES | ||
| 1082 | Catheter placement | OFFSIDES | ||
| 1083 | Central venous catheter removal | OFFSIDES | ||
| 1084 | Chemical and Drug Induced Liver Injury | 8751273 | CTD | |
| 1085 | Cholangiogram abnormal | OFFSIDES | ||
| 1086 | Cluster Headache | OFFSIDES | ||
| 1087 | Cognition Disorders | 12771113 | CTD | |
| 1088 | Cognitive deterioration | OFFSIDES | ||
| 1089 | Colonic fistula | OFFSIDES | ||
| 1090 | Congenital pyelocaliectasis | OFFSIDES | ||
| 1091 | Coronary angioplasty | OFFSIDES | ||
| 1092 | Cryotherapy | OFFSIDES | ||
| 1093 | Cushing Syndrome | 8522428 | CTD | |
| 1094 | Cyst aspiration | OFFSIDES | ||
| 1095 | Dental cleaning | OFFSIDES | ||
| 1096 | Dental discomfort | OFFSIDES | ||
| 1097 | Depressive disorder | 6123383 | CTD | |
| 1098 | Diabetic Nephropathy | OFFSIDES | ||
| 1099 | Dyskinesia, Drug-Induced | 17909305 | CTD | |
| 1100 | Early satiety | OFFSIDES | ||
| 1101 | Edema | 2935644 | CTD | |
| 1102 | Endocervical curettage | OFFSIDES | ||
| 1103 | Endometrial Neoplasms | CTD | ||
| 1104 | Endometrial metaplasia | OFFSIDES | ||
| 1105 | Endoscopy abnormal | OFFSIDES | ||
| 1106 | Epilepsy, Temporal Lobe | 123269 | CTD | |
| 1107 | Epinephrine increased | OFFSIDES | ||
| 1108 | Escherichia sepsis | OFFSIDES | ||
| 1109 | Ethmoid sinus surgery | OFFSIDES | ||
| 1110 | Euphoric mood | OFFSIDES | ||
| 1111 | Exanthema | 6123383 | CTD | |
| 1112 | Exploratory operation | OFFSIDES | ||
| 1113 | Failure of implant | OFFSIDES | ||
| 1114 | Fatty Liver | 1465320 | CTD | |
| 1115 | Fetal Resorption | 6461082 | CTD | |
| 1116 | Fungal peritonitis | OFFSIDES | ||
| 1117 | Galactorrhea | OFFSIDES | ||
| 1118 | Gastrointestinal Hemorrhage | 4537069 | CTD | |
| 1119 | Genital Diseases, Male | 2934853 | CTD | |
| 1120 | Germ Cell Cancer | OFFSIDES | ||
| 1121 | Gingival Hypertrophy | OFFSIDES | ||
| 1122 | Grip strength | OFFSIDES | ||
| 1123 | Haematotoxicity | OFFSIDES | ||
| 1124 | Heart Diseases | 12904517 15070921 | CTD | |
| 1125 | Hemolytic-Uremic Syndrome | 6429463 | CTD | |
| 1126 | Hemorrhage | 8583103 | CTD | |
| 1127 | Hepatic Veno-Occlusive Disease | 8832011 | CTD | |
| 1128 | Hidradenitis | OFFSIDES | ||
| 1129 | Hyperdynamic precordium | OFFSIDES | ||
| 1130 | Hypocalciuria | OFFSIDES | ||
| 1131 | Hypospadias | 4416533 | CTD | |
| 1132 | Hysteroscopy | OFFSIDES | ||
| 1133 | Iliac artery stenosis | OFFSIDES | ||
| 1134 | Injection site coldness | Canada Vigilance: 1 | Canada Vigilance | |
| 1135 | Intestinal Diseases | 4537069 | CTD | |
| 1136 | Intestinal congestion | OFFSIDES | ||
| 1137 | Intracranial Embolism | 11422601 | CTD | |
| 1138 | Iridectomy | OFFSIDES | ||
| 1139 | Jaundice, Obstructive | 23956101 | CTD | |
| 1140 | Keratomileusis | OFFSIDES | ||
| 1141 | Lesion excision | OFFSIDES | ||
| 1142 | Leukoencephalopathy | OFFSIDES | ||
| 1143 | Live Birth | OFFSIDES | ||
| 1144 | Lymph nodes scan abnormal | OFFSIDES | ||
| 1145 | Lymphangioleiomyomatosis | 17586005 | CTD | |
| 1146 | Lymphangiosis carcinomatosa | OFFSIDES | ||
| 1147 | Lymphedema | OFFSIDES | ||
| 1148 | Lymphoplasmacytoid lymphoma/immunocytoma | OFFSIDES | ||
| 1149 | Malignant tumour excision | OFFSIDES | ||
| 1150 | Mammary Neoplasms, Experimental | CTD | ||
| 1151 | Massage | OFFSIDES | ||
| 1152 | Mastectomy | OFFSIDES | ||
| 1153 | Mediastinitis | OFFSIDES | ||
| 1154 | Mediastinoscopy | OFFSIDES | ||
| 1155 | Medical device implantation | OFFSIDES | ||
| 1156 | Medical device removal | OFFSIDES | ||
| 1157 | Menstruation Disturbances | 17982332 | CTD | |
| 1158 | Mental disorders | 6123383 | CTD | |
| 1159 | Metastases to abdominal wall | OFFSIDES | ||
| 1160 | Modified radical mastectomy | OFFSIDES | ||
| 1161 | Mood Disorders | 12727949 | CTD | |
| 1162 | Multi-organ disorder | OFFSIDES | ||
| 1163 | Muscle flap operation | OFFSIDES | ||
| 1164 | Neoplasm Metastasis | CTD | ||
| 1165 | Neoplasm prophylaxis | OFFSIDES | ||
| 1166 | No reaction on previous exposure to drug | Canada Vigilance: 1 | Canada Vigilance | |
| 1167 | Non-small cell lung cancer recurrent | OFFSIDES | ||
| 1168 | Obstruction | OFFSIDES | ||
| 1169 | Oligomenorrhea | 6461984 | CTD OFFSIDES | |
| 1170 | Open reduction of fracture | OFFSIDES | ||
| 1171 | Oral polypectomy | OFFSIDES | ||
| 1172 | Pancreatic Pseudocyst | OFFSIDES | ||
| 1173 | Panic disorder with agoraphobia | OFFSIDES | ||
| 1174 | Papilledema | 2975585 | CTD | |
| 1175 | Perianal abscess | OFFSIDES | ||
| 1176 | Peritoneal Dialysis | OFFSIDES | ||
| 1177 | Perivascular dermatitis | OFFSIDES | ||
| 1178 | Peroneal nerve injury | OFFSIDES | ||
| 1179 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 1180 | Physical disability | OFFSIDES | ||
| 1181 | Pityriasis Lichenoides | 4692137 | CTD | |
| 1182 | Pneumoperitoneum | OFFSIDES | ||
| 1183 | Portal Hypertension | OFFSIDES | ||
| 1184 | Positron emission tomogram abnormal | OFFSIDES | ||
| 1185 | Post procedural fistula | OFFSIDES | ||
| 1186 | Posterior Capsulotomy | OFFSIDES | ||
| 1187 | Postoperative abscess | OFFSIDES | ||
| 1188 | Postoperative adhesion | OFFSIDES | ||
| 1189 | Postural Orthostatic Tachycardia Syndrome | OFFSIDES | ||
| 1190 | Premature Birth | 17000233 18712170 | CTD | |
| 1191 | Prenatal Exposure Delayed Effects | 830309 | CTD | |
| 1192 | Proctitis | OFFSIDES | ||
| 1193 | Proctocolitis | OFFSIDES | ||
| 1194 | Progesterone receptor assay | OFFSIDES | ||
| 1195 | Prostatic Neoplasms | 2942707 3743595 7538260 | CTD | |
| 1196 | Protein total increased | OFFSIDES | ||
| 1197 | Pruritus allergic | OFFSIDES | ||
| 1198 | Pseudotumor Cerebri | 6454568 | CTD | |
| 1199 | Pyeloplasty | OFFSIDES | ||
| 1200 | Radiation associated pain | OFFSIDES | ||
| 1201 | Rectal polypectomy | OFFSIDES | ||
| 1202 | Rectal polyp | OFFSIDES | ||
| 1203 | Red man syndrome | OFFSIDES | ||
| 1204 | Reflux laryngitis | OFFSIDES | ||
| 1205 | Removal of inert matter from skin or subcutaneous tissue | OFFSIDES | ||
| 1206 | Renal artery stent placement | OFFSIDES | ||
| 1207 | Renal mass | OFFSIDES | ||
| 1208 | Renal tubular acidosis | OFFSIDES | ||
| 1209 | Respiratory distress | Canada Vigilance: 1 | Canada Vigilance | |
| 1210 | Rift Valley Fever | OFFSIDES | ||
| 1211 | Sarcoma, Experimental | 3522997 | CTD | |
| 1212 | Sarcoma | 2947675 | CTD | |
| 1213 | Septoplasty | OFFSIDES | ||
| 1214 | Sequestrectomy | OFFSIDES | ||
| 1215 | Sinus Thrombosis, Intracranial | 887403 | CTD | |
| 1216 | Sinus antrostomy | OFFSIDES | ||
| 1217 | Skin tightness | OFFSIDES | ||
| 1218 | Sleep disorder due to general medical condition, insomnia type | Canada Vigilance: 1 | Canada Vigilance | |
| 1219 | Squamous cell carcinoma of skin | OFFSIDES | ||
| 1220 | Syphilis | OFFSIDES | ||
| 1221 | Therapeutic product ineffective for unapproved indication | OFFSIDES | ||
| 1222 | Thoracotomy | OFFSIDES | ||
| 1223 | Thromboembolism | 1080277 | CTD | |
| 1224 | Tooth Extraction | OFFSIDES | ||
| 1225 | Tooth repair | OFFSIDES | ||
| 1226 | Tracheobronchitis | OFFSIDES | ||
| 1227 | Transfusion Reaction | OFFSIDES | ||
| 1228 | Ultrasound abdomen abnormal | OFFSIDES | ||
| 1229 | Ultrasound biliary tract | OFFSIDES | ||
| 1230 | Ultrasound breast abnormal | OFFSIDES | ||
| 1231 | Ultrasound uterus abnormal | OFFSIDES | ||
| 1232 | Urination Disorders | 1533207 | CTD | |
| 1233 | Urologic Diseases | 6461082 | CTD | |
| 1234 | Vaginoplasty | OFFSIDES | ||
| 1235 | Vascular Diseases | 6805242 | CTD | |
| 1236 | Vascular calcification | OFFSIDES | ||
| 1237 | Vasectomy | OFFSIDES | ||
| 1238 | Venous Thromboembolism | 12812381 | CTD | |
| 1239 | Ventricular Dysfunction, Left | 21670166 | CTD | |
| 1240 | Vertebrobasilar Insufficiency | 5550609 | CTD | |
| 1241 | Vitrectomy | OFFSIDES | ||
| 1242 | Walking aid user | Canada Vigilance: 1 | Canada Vigilance | |
| 1243 | Weight Gain | 123269 17982332 | CTD | |
| 1244 | Wound closure | OFFSIDES | ||
| 1245 | colonoscopy | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.