MetaADEDB: Drug

MetaADEDB 2.0 @ LMMD

reviparin

(HTTJABKRGRZYRN-UHFFFAOYSA-N)

Structure

SMILES: OCC1OC(OC2C(OC(C(C2O)OS(=O)(=O)O)OC2C(COS(=O)(=O)O)OC(C(C2O)NC(=O)C)O)C(=O)O)C(C(C1OC1OC(C(=O)O)C(C(C1OS(=O)(=O)O)O)O)OS(=O)(=O)O)NS(=O)(=O)O
Molecular Formula:: C26H42N2O37S5
Molecular Weight:: 1134.930
Log P:: -4.5261
Hydrogen Bond Acceptor:: 39
Hydrogen Bond Donor:: 15
TPSA:: 652.39
CAS Number(s):: 9005-49-6

Synonym(s)

reviparin

Clivarin

Clivarine

LU 47311

LU-47311

reviparin sodium

reviparin-sodium

reviparine

External Link(s)

MeSH	C094240
PubChem Compound	772
IUPHAR/BPS Guide to PHARMACOLOGY	6811
Therapeutic Target Database	D00RQU D0MX5S

Adverse Drug Event(s)

	Name	Number of Reports	Reference(s)	Data Source
1	Heparin-induced thrombocytopenia	FAERS: 724 Canada Vigilance: 73		Canada Vigilance OFFSIDES SIDER US FAERS
2	Thrombocytopenia	FAERS: 344 Canada Vigilance: 2	View details 435052 451885 469218 507970 518011 591536 697611 1310879 1352765 1358714 1386526 1398304 1424893 1451649 1521403 1539524 1558085 1574877 1625071 1635495 1657813 1660803 1666193 1671929 1689564 1713745 1737430 1788719 1977060 2012074 2029354 2042450 2217020 2219218 2318116 2404914 2448206 2457310 2522633 2525017 2607822 2677192 2968585 3047905 3049427 3137127 3239346 3337969 3368814 3418400 3488869 3569071 3597509 3739889 3773133 3803229 3831153 3955462 3976652 4003982 4030832 4044698 4094489 6195949 6232516 6418095 6476504 6476763 6615052 6655013 6718838 6741980 6839984 6871112 6875393 6935763 7058132 7077203 7142830 7167388 7240989 7305655 7460659 7573095 7806103 7979757 7986555 7994280 8031563 8052884 8156472 8171941 8175046 8183389 8213423 8222929 8280214 8282825 8296242 8372814 8400075 8407272 8486459 8512412 8519214 8561350 8623174 8641411 8644608 8650513 8659220 8662173 8726609 8736020 8795488 8857892 8950124 8992808 9027018 9066940 9158107 9165476 9201537 9221488 9298861 9381213 9382401 9390592 9446652 9456945 9475822 9497995 9499523 9646784 9695986 9810286 9824039 9864780 9950545 10209835 10381515 10391290 10431876 10517114 10630659 10638925 10726030 10758796 10883918 10912108 10981578 11236357 11269422 11294800 11401186 11532640 11560843 11578153 11588041 11762651 11771214 11827497 11840659 11936715 12043784 12143956 12221676 12407843 12437677 12520161 12557413 12637624 14653445 14742760 14979398 15071388 15156309 15282674 15333046 15335186 15500112 15503587 15520711 15564710 15795722 16038130 16148626 16149013 16305522 16311669 16313480 16341302 16456608 16510832 16598366 16651880 16893407 16928996 16933276 16961586 17050234 17381384 17720387 17954999 17955717 17996113 18068655 18093673 18208574 18336108 18363253 18589141 18645060 18798244 18799498 18827864 18980087 19129243 19129690 19195684 19212729 19234918 19304774 19415734 19483362 19519692 19576363 19660256 20056052 20123238 20162249 20184249 20495512 20504888 20808689 21138266 24100055 24733133	CTD SIDER Canada Vigilance US FAERS
3	Hypotension	FAERS: 240 Canada Vigilance: 1	View details 2131900 3650484 8225663 10624973 10960424 20123238	CTD Canada Vigilance US FAERS
4	Injury associated with device	FAERS: 223 Canada Vigilance: 1		Canada Vigilance US FAERS
5	Pulmonary Embolism	FAERS: 221 Canada Vigilance: 15	View details 1451649 1574877 1671929 1788719 1977060 2123154 2217020 2607822 3401113 3597509 3962762 4326840 6476763 6741980 7179208 7979757 8196729 8650513 8659220 8857804 9038699 9221488 9382401 9390592 9475822 10758796 11041470 11204326 11236357 11345711 11402364 11827497 11936715 12143956 12147970 12520161 12869178 15333046 16311669 16456608 16928996 16933276 18363253 18583682 18827864 19415734 19483362 19660256 19837550 20037105 24733133	CTD Canada Vigilance US FAERS
6	Nausea	FAERS: 215		OFFSIDES SIDER US FAERS
7	Thrombosis	FAERS: 191 Canada Vigilance: 7	View details 373351 451885 469218 507970 1310879 1352765 1521403 1635495 1657813 1660803 1737430 1848967 2133253 2404914 2457310 2522633 2677192 2968585 3049427 3137127 3368814 3783542 3810521 3831153 3874423 4003982 4044698 4048956 4094489 4801301 6195949 6232516 6476504 6507247 6655013 7077203 7460659 7914574 7948777 7986555 8012887 8031563 8156472 8183389 8213423 8282825 8322273 8407272 8446935 8512412 8519214 8623174 8662173 8726609 9200347 9446652 9456945 9497995 9695986 9824039 9864780 9950545 10217969 10431876 10630659 10981578 11269422 11294800 11532640 11560843 11578153 11588041 12043784 12407843 12452748 12491049 12902121 14979412 15282674 15520711 15795722 15933857 16305522 16341302 16510832 16598366 16893407 16961586 18208574 18645060 18669753 18980087 19129243 19156386 19195684 19238875 19415734 19842721 20495512	CTD SIDER Canada Vigilance US FAERS
8	Deep Vein Thrombosis	FAERS: 165 Canada Vigilance: 18		Canada Vigilance US FAERS
9	Injection site pain	FAERS: 147 Canada Vigilance: 1		Canada Vigilance US FAERS
10	Headache	FAERS: 140 Canada Vigilance: 2	16510832	CTD SIDER Canada Vigilance US FAERS
11	Drug ineffective	FAERS: 125 Canada Vigilance: 10		Canada Vigilance US FAERS
12	Pharmaceutical product complaint	FAERS: 124		US FAERS
13	Injection site bruising	FAERS: 121 Canada Vigilance: 1		Canada Vigilance US FAERS
14	Abdominal Pain	FAERS: 116 Canada Vigilance: 1	4326840 4351955 19309387	CTD OFFSIDES Canada Vigilance US FAERS
15	Product quality issue	FAERS: 113 Canada Vigilance: 1		Canada Vigilance US FAERS
16	Drug exposure during pregnancy	FAERS: 106		US FAERS
17	Medication Error	FAERS: 103 Canada Vigilance: 1		Canada Vigilance US FAERS
18	Asthenia	FAERS: 102 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
19	Vomiting	FAERS: 101		SIDER US FAERS
20	Dizziness	FAERS: 95 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
21	Pain	FAERS: 92 Canada Vigilance: 1	View details 4464499 11137723 12222545 17931375	CTD OFFSIDES SIDER Canada Vigilance US FAERS
22	Chest Pain	FAERS: 91	11320466	CTD US FAERS
23	Cerebrovascular accident	FAERS: 85 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
24	Sepsis	FAERS: 72		US FAERS
25	Malaise	FAERS: 70 Canada Vigilance: 1		Canada Vigilance US FAERS
26	Injection site mass	FAERS: 67		US FAERS
27	Cardiac Arrest	FAERS: 61 Canada Vigilance: 2		Canada Vigilance US FAERS
28	Erythema	FAERS: 58 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
29	Needle issue	FAERS: 58		US FAERS
30	Syncope	FAERS: 55		US FAERS
31	Post procedural complication	FAERS: 53		OFFSIDES US FAERS
32	Fatigue	FAERS: 52		OFFSIDES US FAERS
33	Feeling abnormal	FAERS: 52		US FAERS
34	Incorrect dose administered	FAERS: 52 Canada Vigilance: 1		Canada Vigilance US FAERS
35	Pruritus	FAERS: 52 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
36	Hypersensitivity	FAERS: 49 Canada Vigilance: 1	4265106	CTD SIDER Canada Vigilance US FAERS
37	Drug dose omission	FAERS: 46		US FAERS
38	Device malfunction	FAERS: 45		US FAERS
39	Syringe issue	FAERS: 44		US FAERS
40	Blood creatinine increased	FAERS: 42 Canada Vigilance: 2		Canada Vigilance OFFSIDES US FAERS
41	Respiratory Failure	FAERS: 42		OFFSIDES US FAERS
42	Shock	FAERS: 42		SIDER US FAERS
43	Tachycardia	FAERS: 40 Canada Vigilance: 2	4351955 19309387	CTD Canada Vigilance US FAERS
44	Weight decreased	FAERS: 39		US FAERS
45	Myocardial Infarction	FAERS: 37	View details 507970 1461851 1558085 1713559 2174952 2382605 3739889 3803229 3810102 4036989 4173338 4351955 4464499 6232516 7723950 8598594 9183334 9382401 10505926 10645301 10843908 10914357 11320361 11382373 11489769 12227717 12918901 15914518 16537665 20400762	CTD SIDER US FAERS
46	Cerebral Infarction	FAERS: 36	View details 507970 1579960 1944711 2683244 6537834 8614550 9183334 9932617 15115906 19379937	CTD US FAERS
47	Lethargy	FAERS: 36		US FAERS
48	Therapeutic product contamination	FAERS: 36		US FAERS
49	Hypoxia	FAERS: 35 Canada Vigilance: 1	2171807 19074762	CTD OFFSIDES Canada Vigilance US FAERS
50	Infection	FAERS: 35		OFFSIDES SIDER US FAERS
51	Cyanosis	FAERS: 33 Canada Vigilance: 1	8638872	CTD OFFSIDES SIDER Canada Vigilance US FAERS
52	Unresponsive to stimuli	FAERS: 33 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
53	Epistaxis	FAERS: 32 Canada Vigilance: 3		Canada Vigilance OFFSIDES US FAERS
54	General physical health deterioration	FAERS: 32		OFFSIDES US FAERS
55	Hemiparesis	FAERS: 32		US FAERS
56	Product substitution issue	FAERS: 32 Canada Vigilance: 1		Canada Vigilance US FAERS
57	nervous system disorder	FAERS: 32		US FAERS
58	Burning sensation	FAERS: 31		OFFSIDES US FAERS
59	Chills	FAERS: 31 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
60	Injection site erythema	FAERS: 31		US FAERS
61	Unevaluable event	FAERS: 31 Canada Vigilance: 1		Canada Vigilance US FAERS
62	Procedural complication	FAERS: 30		US FAERS
63	Blood potassium increased	FAERS: 29		US FAERS
64	Thrombosis in device	FAERS: 29 Canada Vigilance: 4		Canada Vigilance OFFSIDES US FAERS
65	Cerebral Palsy	FAERS: 28		US FAERS
66	Maternal exposure during pregnancy	FAERS: 28 Canada Vigilance: 5		Canada Vigilance US FAERS
67	Overdose	FAERS: 28		US FAERS
68	Flushing	FAERS: 27 Canada Vigilance: 1		Canada Vigilance US FAERS
69	Blood urea increased	FAERS: 26		OFFSIDES US FAERS
70	Swelling	FAERS: 26		US FAERS
71	Urticaria	FAERS: 26	1357368	CTD SIDER US FAERS
72	Blood fibrinogen increased	FAERS: 25		US FAERS
73	Disseminated Intravascular Coagulation	FAERS: 25 Canada Vigilance: 1	View details 1398304 3239346 3783542 6233579 6418095 6670686 6718838 6839984 6871112 6935763 7058132 7142830 7279412 8052884 8400075 8486459 9134660 9637888 12361208 18798244 19309387 20184249	CTD OFFSIDES Canada Vigilance US FAERS
74	Drug administered at inappropriate site	FAERS: 25		US FAERS
75	White blood cell count abnormal	FAERS: 25		US FAERS
76	Atrial Fibrillation	FAERS: 24	12741440 16946100 19098677	CTD US FAERS
77	Blood gases abnormal	FAERS: 24		US FAERS
78	Abdominal discomfort	FAERS: 23		OFFSIDES US FAERS
79	Heparin-induced thrombocytopenia test positive	FAERS: 23		US FAERS
80	Injection Site Reaction	FAERS: 23 Canada Vigilance: 1		Canada Vigilance US FAERS
81	Stridor	FAERS: 23		US FAERS
82	Anaphylactic shock	FAERS: 22		SIDER US FAERS
83	Coombs test positive	FAERS: 22		US FAERS
84	Retinal Detachment	FAERS: 22		US FAERS
85	Visual disturbance	FAERS: 22		US FAERS
86	Back Pain	FAERS: 21	697611 12227717	CTD US FAERS
87	Mental status changes	FAERS: 21		OFFSIDES US FAERS
88	Product use issue	FAERS: 21		US FAERS
89	Respiratory distress	FAERS: 21		US FAERS
90	Septic Shock	FAERS: 21		OFFSIDES US FAERS
91	Skin necrosis	FAERS: 21 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
92	Bradycardia	FAERS: 20	10624973 11975115	CTD OFFSIDES US FAERS
93	Device Failure	FAERS: 20		US FAERS
94	Disabled relative	FAERS: 20		US FAERS
95	Incorrect route of drug administration	FAERS: 20		US FAERS
96	Injection site nodule	FAERS: 20		US FAERS
97	Neuropathy	FAERS: 20		US FAERS
98	Pneumonia	FAERS: 20 Canada Vigilance: 1		Canada Vigilance US FAERS
99	Antibody test positive	FAERS: 19		US FAERS
100	Mental retardation severity unspecified	FAERS: 19		US FAERS
101	Product contamination	FAERS: 19		US FAERS
102	Accidental exposure to product	FAERS: 18		US FAERS
103	Adverse event	FAERS: 18		US FAERS
104	Anaphylactoid Reaction	FAERS: 18 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
105	Anxiety	FAERS: 18		OFFSIDES US FAERS
106	Gangrene	FAERS: 18 Canada Vigilance: 1	1424893 9382401	CTD OFFSIDES SIDER Canada Vigilance US FAERS
107	Peripheral swelling	FAERS: 18 Canada Vigilance: 1		Canada Vigilance US FAERS
108	Phlebitis	FAERS: 18	View details 831472 1539524 4338821 6617280 6897887 10103699	CTD SIDER US FAERS
109	Respiratory arrest	FAERS: 18 Canada Vigilance: 1		Canada Vigilance US FAERS
110	Venous Thrombosis	FAERS: 18 Canada Vigilance: 1	View details 224344 435052 448439 470959 696156 795299 1493394 1574877 1625071 1713745 1740038 1788719 1845603 1977060 2012074 2042450 2318116 2525017 2607822 3139897 3337969 3401113 3402234 3488869 3597509 3773133 3955462 3962762 3976652 4030832 4126560 4714850 6359570 6476763 6875393 7179208 7240989 7979757 7994280 8171941 8180327 8196729 8280214 8296242 8358198 8372814 8374097 8400075 8644608 8650513 8659220 8795488 8857804 8857892 9201537 9298861 9382401 9390592 9475822 9802851 10517114 10638925 11132655 11204326 11236357 11251344 11345711 11402364 11571356 11771214 11773578 12221676 12437677 12508172 12520161 12680483 14742760 15020349 15686740 16148626 16456608 16933276 17996113 18068655 18336108 18464947 18799498 18827864 19129690 19415734 19519692 19660256 20473075 24733133	CTD Canada Vigilance US FAERS
111	Wrong technique in product usage process	FAERS: 18		US FAERS
112	Alopecia	FAERS: 17	9646784 10726030	CTD SIDER US FAERS
113	Arthralgia	FAERS: 17 Canada Vigilance: 1		Canada Vigilance US FAERS
114	Chest discomfort	FAERS: 17		US FAERS
115	Palpitations	FAERS: 17		US FAERS
116	Poor quality drug administered	FAERS: 17		US FAERS
117	Traumatic Brain Injury	FAERS: 17		US FAERS
118	Tremor	FAERS: 17		US FAERS
119	Accidental needle stick	FAERS: 16		US FAERS
120	Acute kidney injury	FAERS: 16	View details 435128 1310879 3803229 4713939 17996113	CTD US FAERS
121	Cellulitis	FAERS: 16		OFFSIDES US FAERS
122	Coagulation time shortened	FAERS: 16 Canada Vigilance: 1		Canada Vigilance US FAERS
123	Drug administration error	FAERS: 16		US FAERS
124	Ecchymosis	FAERS: 16	1398304	CTD US FAERS
125	Injection site pruritus	FAERS: 16		US FAERS
126	Arterial thrombosis	FAERS: 15 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
127	Cerebral artery occlusion	FAERS: 15		US FAERS
128	Dehydration	FAERS: 15		OFFSIDES US FAERS
129	Drug dispensing error	FAERS: 15		US FAERS
130	Somnolence	FAERS: 15		US FAERS
131	Accidental overdose	FAERS: 14		US FAERS
132	Blindness	FAERS: 14		US FAERS
133	No adverse event	FAERS: 14		US FAERS
134	treatment failure	FAERS: 14		US FAERS
135	Aphakia	FAERS: 13		US FAERS
136	Cardiac Tamponade	FAERS: 13	View details 671691 2301240 8299624 8723606 15875438	CTD OFFSIDES US FAERS
137	Circumstance or information capable of leading to medication error	FAERS: 13		US FAERS
138	Depressed Level of Consciousness	FAERS: 13		US FAERS
139	Disease Progression	FAERS: 13 Canada Vigilance: 2	20400762	CTD OFFSIDES Canada Vigilance US FAERS
140	Embolism	FAERS: 13 Canada Vigilance: 5	View details 1660803 2818066 4048956 5034842 6010408 10431876 11560843 15335186 16148626	CTD OFFSIDES Canada Vigilance US FAERS
141	Heparin-induced thrombocytopenia test	FAERS: 13		US FAERS
142	Iridocele	FAERS: 13		US FAERS
143	Pallor	FAERS: 13 Canada Vigilance: 1		Canada Vigilance US FAERS
144	Product label confusion	FAERS: 13		US FAERS
145	Unequal Limb Length	FAERS: 13		US FAERS
146	Discomfort	FAERS: 12		US FAERS
147	Musculoskeletal stiffness	FAERS: 12		US FAERS
148	Myalgia	FAERS: 12		US FAERS
149	Necrosis	FAERS: 12	View details 507970 1284839 1493394 2217020 2607822 3189376 3803229 7223861 7709185 9066940 9739898 10517114 10670317 12351979 17667218	CTD SIDER US FAERS
150	Pulmonary thrombosis	FAERS: 12		US FAERS
151	Device difficult to use	FAERS: 11		US FAERS
152	Metabolic acidosis	FAERS: 11		OFFSIDES US FAERS
153	Nodule	FAERS: 11		US FAERS
154	Product measured potency issue	FAERS: 11		US FAERS
155	Urinary tract infection	FAERS: 11		US FAERS
156	Anti-platelet antibody positive	FAERS: 10		US FAERS
157	Blood urine present	FAERS: 10		US FAERS
158	Congenital nystagmus	FAERS: 10		US FAERS
159	Device breakage	FAERS: 10		US FAERS
160	Feeling Cold	FAERS: 10		US FAERS
161	Gastric ulcer	FAERS: 10		US FAERS
162	Injection site irritation	FAERS: 10		SIDER US FAERS
163	Nystagmus	FAERS: 10		US FAERS
164	Restlessness	FAERS: 10		US FAERS
165	Retching	FAERS: 10		US FAERS
166	Wrong technique in drug usage process	FAERS: 10		US FAERS
167	Abasia	FAERS: 9		OFFSIDES US FAERS
168	Activated partial thromboplastin time abnormal	FAERS: 9		US FAERS
169	Angioedema	FAERS: 9	1357368 15299161	CTD US FAERS
170	Anticoagulation drug level above therapeutic	FAERS: 9		US FAERS
171	Ascites	FAERS: 9		OFFSIDES US FAERS
172	Blood blister	FAERS: 9		US FAERS
173	Brain Death	FAERS: 9		US FAERS
174	Cold sweat	FAERS: 9		US FAERS
175	Inappropriate schedule of drug administration	FAERS: 9		US FAERS
176	Osteoporosis	FAERS: 9	View details 2029354 6931182 9646784 10726030	CTD OFFSIDES SIDER US FAERS
177	Procedural hypotension	FAERS: 9		OFFSIDES US FAERS
178	Product dose omission	FAERS: 9		US FAERS
179	Skin Ulcer	FAERS: 9		US FAERS
180	Splenic Rupture	FAERS: 9		US FAERS
181	Thirst	FAERS: 9		US FAERS
182	Wrong drug administered	FAERS: 9		US FAERS
183	Acute myocardial infarction	FAERS: 8		US FAERS
184	Aphasia	FAERS: 8		US FAERS
185	Constipation	FAERS: 8		US FAERS
186	Disorientation	FAERS: 8		US FAERS
187	Duodenal Ulcer	FAERS: 8		US FAERS
188	Fluid overload	FAERS: 8		OFFSIDES SIDER US FAERS
189	Incorrect dose administered by device	FAERS: 8		US FAERS
190	Injection site discomfort	FAERS: 8		US FAERS
191	Injection site necrosis	FAERS: 8		US FAERS
192	Joint swelling	FAERS: 8		US FAERS
193	Medical device complication	FAERS: 8		OFFSIDES US FAERS
194	Memory impairment	FAERS: 8		US FAERS
195	Mydriasis	FAERS: 8		US FAERS
196	Nonspecific reaction	FAERS: 8		US FAERS
197	Pericardial effusion	FAERS: 8	View details 4036989 7789375 8299624 8723606 15875438	CTD OFFSIDES US FAERS
198	Rash erythematous	FAERS: 8		US FAERS
199	Urinary Retention	FAERS: 8		US FAERS
200	Accidental exposure	FAERS: 7		US FAERS
201	Anuria	FAERS: 7	3183852 8225663 11797033	CTD US FAERS
202	Cerebral Thrombosis	FAERS: 7		US FAERS
203	Drug screen positive	FAERS: 7		US FAERS
204	Dyspepsia	FAERS: 7		US FAERS
205	Hemiplegia	FAERS: 7		US FAERS
206	Injection site vesicles	FAERS: 7		US FAERS
207	Injection site warmth	FAERS: 7		US FAERS
208	Lip swelling	FAERS: 7		US FAERS
209	Night sweats	FAERS: 7		US FAERS
210	Occult blood positive	FAERS: 7		US FAERS
211	Osteopenia	FAERS: 7		OFFSIDES US FAERS
212	Pancreatitis	FAERS: 7		US FAERS
213	Scab	FAERS: 7		US FAERS
214	Skin lesion	FAERS: 7		OFFSIDES US FAERS
215	Therapy cessation	FAERS: 7		US FAERS
216	Acidosis	FAERS: 6		US FAERS
217	Calciphylaxis	FAERS: 6		US FAERS
218	Drug specific antibody present	FAERS: 6		US FAERS
219	Dysuria	FAERS: 6		US FAERS
220	Embolic stroke	FAERS: 6		US FAERS
221	Fracture	FAERS: 6		US FAERS
222	Gastritis	FAERS: 6		US FAERS
223	Injection site scar	FAERS: 6		US FAERS
224	Limb discomfort	FAERS: 6		US FAERS
225	Mental Retardation	FAERS: 6		US FAERS
226	Nerve injury	FAERS: 6		US FAERS
227	Neutropenia	FAERS: 6		US FAERS
228	Paraplegia	FAERS: 6	4811051	CTD OFFSIDES US FAERS
229	Product storage error	FAERS: 6		US FAERS
230	Prothrombin time abnormal	FAERS: 6		US FAERS
231	Therapy change	FAERS: 6		US FAERS
232	Urinary Incontinence	FAERS: 6		US FAERS
233	Wound dehiscence	FAERS: 6		OFFSIDES US FAERS
234	Abdominal tenderness	FAERS: 5		US FAERS
235	Abscess	FAERS: 5		OFFSIDES US FAERS
236	Agitation	FAERS: 5		US FAERS
237	Alanine Aminotransferase Increased	FAERS: 5		US FAERS
238	Anorexia	FAERS: 5		US FAERS
239	Antiphospholipid Syndrome	FAERS: 5 Canada Vigilance: 1	11776303	CTD Canada Vigilance US FAERS
240	Atrial Flutter	FAERS: 5		OFFSIDES US FAERS
241	Bedridden	FAERS: 5		OFFSIDES US FAERS
242	Cardiac procedure complication	FAERS: 5		US FAERS
243	Cerebral disorder	FAERS: 5		US FAERS
244	Coagulation time abnormal	FAERS: 5		US FAERS
245	Creatinine renal clearance decreased	FAERS: 5		US FAERS
246	Device defective	FAERS: 5		US FAERS
247	Device operational issue	FAERS: 5		US FAERS
248	Diabetes Mellitus	FAERS: 5		US FAERS
249	Disease recurrence	FAERS: 5		US FAERS
250	Documented hypersensitivity to administered drug	FAERS: 5		US FAERS
251	Drug exposure via breast milk	FAERS: 5		US FAERS
252	Drug level below therapeutic	FAERS: 5		US FAERS
253	Drug prescribing error	FAERS: 5		US FAERS
254	Dysarthria	FAERS: 5		US FAERS
255	Eczema	FAERS: 5		OFFSIDES US FAERS
256	Incorrect drug administration rate	FAERS: 5		US FAERS
257	Multi-organ disorder	FAERS: 5		US FAERS
258	Neck Pain	FAERS: 5		US FAERS
259	Neonatal disorder	FAERS: 5		US FAERS
260	Peripheral embolism	FAERS: 5		US FAERS
261	Postoperative wound complication	FAERS: 5		US FAERS
262	Pregnancy	FAERS: 5		US FAERS
263	Product label issue	FAERS: 5		US FAERS
264	Sudden death	FAERS: 5		US FAERS
265	Suicide attempt	FAERS: 5		US FAERS
266	Transaminases increased	FAERS: 5		US FAERS
267	Vertigo	FAERS: 5		US FAERS
268	Visual Impairment	FAERS: 5		US FAERS
269	Abdominal mass	FAERS: 4		OFFSIDES US FAERS
270	Activities of daily living impaired	FAERS: 4		OFFSIDES US FAERS
271	Acute respiratory failure	FAERS: 4		OFFSIDES US FAERS
272	Altered state of consciousness	FAERS: 4		US FAERS
273	Amnesia	FAERS: 4		US FAERS
274	Angina Pectoris	FAERS: 4	16312887 19309387	CTD US FAERS
275	Anticoagulation drug level below therapeutic	FAERS: 4		US FAERS
276	Arthritis	FAERS: 4		US FAERS
277	Arthropathy	FAERS: 4		US FAERS
278	Aspartate Aminotransferase Increased	FAERS: 4		US FAERS
279	Bone pain	FAERS: 4		OFFSIDES US FAERS
280	Bronchitis	FAERS: 4		OFFSIDES US FAERS
281	Chromaturia	FAERS: 4		US FAERS
282	Contraindicated product administered	FAERS: 4		US FAERS
283	Coronary Artery Disease	FAERS: 4	15251667	CTD US FAERS
284	Deafness	FAERS: 4		US FAERS
285	Delirium	FAERS: 4		US FAERS
286	Device leakage	FAERS: 4		US FAERS
287	Device occlusion	FAERS: 4		US FAERS
288	Dysgeusia	FAERS: 4		OFFSIDES US FAERS
289	Epilepsy	FAERS: 4		US FAERS
290	Escherichia infection	FAERS: 4		US FAERS
291	Expired product administered	FAERS: 4		US FAERS
292	Flank Pain	FAERS: 4		US FAERS
293	Flatulence	FAERS: 4		OFFSIDES US FAERS
294	Hydrocephalus	FAERS: 4	18972074	CTD US FAERS
295	Hypersomnia	FAERS: 4		US FAERS
296	Hypoaldosteronism	FAERS: 4	10726030	CTD US FAERS
297	Hypocoagulable state	FAERS: 4		US FAERS
298	Hypospadias	FAERS: 4		US FAERS
299	Infarction	FAERS: 4 Canada Vigilance: 1	11771214	CTD Canada Vigilance US FAERS
300	Injection site cellulitis	FAERS: 4 Canada Vigilance: 1		Canada Vigilance US FAERS
301	Injection site urticaria	FAERS: 4 Canada Vigilance: 1		Canada Vigilance US FAERS
302	Intestinal Perforation	FAERS: 4 Canada Vigilance: 1		Canada Vigilance US FAERS
303	Laceration	FAERS: 4		OFFSIDES US FAERS
304	Nasal Flaring	FAERS: 4		US FAERS
305	Nasopharyngitis	FAERS: 4		US FAERS
306	Neuralgia	FAERS: 4		US FAERS
307	Neurological decompensation	FAERS: 4		US FAERS
308	Occupational exposure to product	FAERS: 4		US FAERS
309	Oropharyngeal pain	FAERS: 4		OFFSIDES US FAERS
310	Pain of skin	FAERS: 4		OFFSIDES US FAERS
311	Pancreatic carcinoma	FAERS: 4		US FAERS
312	Peptic Ulcer	FAERS: 4		US FAERS
313	Petechiae	FAERS: 4 Canada Vigilance: 3		Canada Vigilance US FAERS
314	Poor peripheral circulation	FAERS: 4		US FAERS
315	Portal Vein Thrombosis	FAERS: 4 Canada Vigilance: 1		Canada Vigilance US FAERS
316	Presyncope	FAERS: 4		US FAERS
317	Product barcode issue	FAERS: 4		US FAERS
318	Product counterfeit	FAERS: 4		US FAERS
319	Product physical issue	FAERS: 4		US FAERS
320	Pulmonary congestion	FAERS: 4		OFFSIDES US FAERS
321	Renal pain	FAERS: 4		US FAERS
322	Toxic Epidermal Necrolysis	FAERS: 4 Canada Vigilance: 1		Canada Vigilance US FAERS
323	Ventricular Fibrillation	FAERS: 4	6401894 18972074	CTD OFFSIDES US FAERS
324	Viral upper respiratory tract infection	FAERS: 4		US FAERS
325	Wheezing	FAERS: 4		US FAERS
326	Wound Infection	FAERS: 4		OFFSIDES US FAERS
327	jaundice	FAERS: 4	8638872	CTD US FAERS
328	Abdominal Abscess	FAERS: 3		US FAERS
329	Activated partial thromboplastin time shortened	FAERS: 3		OFFSIDES US FAERS
330	Anoxic Encephalopathy	FAERS: 3		US FAERS
331	Anti factor X activity increased	FAERS: 3		US FAERS
332	Aphagia	FAERS: 3		US FAERS
333	Atelectasis	FAERS: 3		OFFSIDES US FAERS
334	Atrial thrombosis	FAERS: 3		US FAERS
335	Automatism	FAERS: 3		OFFSIDES US FAERS
336	Bladder pain	FAERS: 3		US FAERS
337	Blood glucose increased	FAERS: 3		US FAERS
338	Blood pressure immeasurable	FAERS: 3		US FAERS
339	Cardiac valve replacement complication	FAERS: 3		US FAERS
340	Cholelithiasis	FAERS: 3		US FAERS
341	Colectomy	FAERS: 3		OFFSIDES US FAERS
342	Complication associated with device	FAERS: 3		US FAERS
343	Complications of maternal exposure to therapeutic drugs	FAERS: 3		US FAERS
344	Concomitant disease aggravated	FAERS: 3		US FAERS
345	Crying	FAERS: 3		US FAERS
346	Device computer issue	FAERS: 3		US FAERS
347	Diplopia	FAERS: 3		OFFSIDES US FAERS
348	Diverticulitis	FAERS: 3		US FAERS
349	Dry skin	FAERS: 3		OFFSIDES US FAERS
350	Electroencephalogram abnormal	FAERS: 3		US FAERS
351	Endocarditis	FAERS: 3		OFFSIDES US FAERS
352	Eosinophilia	FAERS: 3	9646784 10726030	CTD US FAERS
353	Extravasation	FAERS: 3		SIDER US FAERS
354	Eye pain	FAERS: 3		US FAERS
355	Fibrin D dimer increased	FAERS: 3		US FAERS
356	Gastrointestinal Pain	FAERS: 3		US FAERS
357	Gastrointestinal arteriovenous malformation	FAERS: 3		US FAERS
358	Gout	FAERS: 3		US FAERS
359	Hepatic Infarction	FAERS: 3		US FAERS
360	Hepatotoxicity	FAERS: 3		OFFSIDES US FAERS
361	Hypoperfusion	FAERS: 3		US FAERS
362	Ileus	FAERS: 3		US FAERS
363	Incoherent	FAERS: 3		US FAERS
364	Injection site extravasation	FAERS: 3		US FAERS
365	Injection site inflammation	FAERS: 3		US FAERS
366	Injection site scab	FAERS: 3		US FAERS
367	Intercepted medication error	FAERS: 3		US FAERS
368	Intestinal Obstruction	FAERS: 3		OFFSIDES US FAERS
369	Intracranial Aneurysm	FAERS: 3		OFFSIDES US FAERS
370	Laboratory test interference	FAERS: 3		US FAERS
371	Leukocytosis	FAERS: 3		US FAERS
372	Lymphoma	FAERS: 3		US FAERS
373	Meningitis	FAERS: 3		US FAERS
374	Muscle necrosis	FAERS: 3		OFFSIDES US FAERS
375	Musculoskeletal Pain	FAERS: 3		OFFSIDES US FAERS
376	Nephrolithiasis	FAERS: 3		US FAERS
377	Osteomyelitis	FAERS: 3		OFFSIDES US FAERS
378	Pancytopenia	FAERS: 3		US FAERS
379	Paradoxical drug reaction	FAERS: 3		US FAERS
380	Peripheral arterial occlusive disease	FAERS: 3		US FAERS
381	Peripheral artery thrombosis	FAERS: 3 Canada Vigilance: 1		Canada Vigilance US FAERS
382	Peritonitis	FAERS: 3		OFFSIDES US FAERS
383	Physical product label issue	FAERS: 3		US FAERS
384	Quadriplegia	FAERS: 3	697611	CTD US FAERS
385	Skin reaction	FAERS: 3		US FAERS
386	Suspected product quality issue	FAERS: 3		US FAERS
387	Synostosis	FAERS: 3		US FAERS
388	Throat irritation	FAERS: 3		US FAERS
389	Thrombocytosis	FAERS: 3		US FAERS
390	Thrombophlebitis	FAERS: 3	View details 3783118 4452704 7806103 8748367	CTD OFFSIDES US FAERS
391	Troponin increased	FAERS: 3		US FAERS
392	Venous Insufficiency	FAERS: 3		US FAERS
393	Wrong technique in device usage process	FAERS: 3		US FAERS
394	Abdominal rigidity	FAERS: 2		US FAERS
395	Adrenal mass	FAERS: 2		US FAERS
396	Adrenal thrombosis	FAERS: 2		US FAERS
397	Amniotic fluid volume decreased	FAERS: 2		US FAERS
398	Amputation	FAERS: 2		US FAERS
399	Anger	FAERS: 2		US FAERS
400	Anti factor X antibody positive	FAERS: 2		US FAERS
401	Antiphospholipid antibodies positive	FAERS: 2		US FAERS
402	Antithrombin III Deficiency	FAERS: 2	11446944	CTD US FAERS
403	Aortic embolus	FAERS: 2		US FAERS
404	Arterial Injury	FAERS: 2		US FAERS
405	Asthma	FAERS: 2	9235556 19467809	CTD OFFSIDES SIDER US FAERS
406	Atrioventricular Block	FAERS: 2	8225663	CTD US FAERS
407	Blood cholesterol increased	FAERS: 2		US FAERS
408	Blood creatine phosphokinase increased	FAERS: 2		US FAERS
409	Blood glucose abnormal	FAERS: 2		US FAERS
410	Blood iron decreased	FAERS: 2		OFFSIDES US FAERS
411	Blood potassium decreased	FAERS: 2		OFFSIDES US FAERS
412	Blood pressure fluctuation	FAERS: 2		OFFSIDES US FAERS
413	Blood sodium increased	FAERS: 2		US FAERS
414	Blood triglycerides increased	FAERS: 2		US FAERS
415	Bronchospasm	FAERS: 2		US FAERS
416	Bursitis	FAERS: 2		OFFSIDES US FAERS
417	Candidiasis	FAERS: 2		US FAERS
418	Cardiac dysfunction	FAERS: 2		US FAERS
419	Cardiac perforation	FAERS: 2		US FAERS
420	Cardiomegaly	FAERS: 2		US FAERS
421	Catheter related infection	FAERS: 2		US FAERS
422	Catheter site discharge	FAERS: 2		US FAERS
423	Central nervous system lesion	FAERS: 2		US FAERS
424	Choking	FAERS: 2		US FAERS
425	Clostridium test positive	FAERS: 2		US FAERS
426	Colitis	FAERS: 2		US FAERS
427	Coronary bypass thrombosis	FAERS: 2		US FAERS
428	Deformity	FAERS: 2		US FAERS
429	Dementia	FAERS: 2		US FAERS
430	Depressed mood	FAERS: 2		US FAERS
431	Device use error	FAERS: 2		US FAERS
432	Diabetes Insipidus	FAERS: 2		US FAERS
433	Diabetic Ketoacidosis	FAERS: 2		US FAERS
434	Disseminated intravascular coagulation in newborn	FAERS: 2		US FAERS
435	Diverticulum	FAERS: 2		US FAERS
436	Dose calculation error	FAERS: 2		US FAERS
437	Drug toxicity	FAERS: 2		OFFSIDES US FAERS
438	Dry gangrene	FAERS: 2		US FAERS
439	Echocardiogram abnormal	FAERS: 2		US FAERS
440	Ejection Fraction Decreased	FAERS: 2		OFFSIDES US FAERS
441	Electrocardiogram change	FAERS: 2		US FAERS
442	Enterocutaneous Fistula	FAERS: 2		US FAERS
443	Erythema Multiforme	FAERS: 2		US FAERS
444	Eschar	FAERS: 2		US FAERS
445	Excoriation	FAERS: 2		OFFSIDES US FAERS
446	Exposure during breast feeding	FAERS: 2		US FAERS
447	Exposure via blood	FAERS: 2		US FAERS
448	Exposure via contaminated device	FAERS: 2		US FAERS
449	Extra dose administered	FAERS: 2		US FAERS
450	Eye irritation	FAERS: 2		US FAERS
451	Facial paralysis	FAERS: 2		US FAERS
452	Factor Xa activity decreased	FAERS: 2		US FAERS
453	Fat necrosis	FAERS: 2		US FAERS
454	Feeling jittery	FAERS: 2		US FAERS
455	Feeling of body temperature change	FAERS: 2		OFFSIDES US FAERS
456	Femoral artery occlusion	FAERS: 2		US FAERS
457	Fibromyalgia	FAERS: 2		OFFSIDES US FAERS
458	Foreign body aspiration	FAERS: 2		US FAERS
459	Graft infection	FAERS: 2		US FAERS
460	Hepatitis	FAERS: 2		US FAERS
461	Hernia	FAERS: 2		US FAERS
462	Hypophagia	FAERS: 2		OFFSIDES US FAERS
463	Iatrogenic injury	FAERS: 2		US FAERS
464	Immobile	FAERS: 2		US FAERS
465	Incision site complication	FAERS: 2		US FAERS
466	Incorrect product storage	FAERS: 2		US FAERS
467	Induration	FAERS: 2		US FAERS
468	Influenza	FAERS: 2		US FAERS
469	Injection site hypersensitivity	FAERS: 2		US FAERS
470	Injection site injury	FAERS: 2		US FAERS
471	Injection site thrombosis	FAERS: 2		US FAERS
472	Intentional product misuse	FAERS: 2		US FAERS
473	Intercepted drug dispensing error	FAERS: 2		US FAERS
474	Intercepted product administration error	FAERS: 2		US FAERS
475	Joint stiffness	FAERS: 2		OFFSIDES US FAERS
476	Ligament rupture	FAERS: 2		US FAERS
477	Live Birth	FAERS: 2		US FAERS
478	Livedo Reticularis	FAERS: 2	8486459	CTD OFFSIDES US FAERS
479	Lobar Pneumonia	FAERS: 2		US FAERS
480	Locked-In Syndrome	FAERS: 2		US FAERS
481	Malignant neoplasm progression	FAERS: 2		OFFSIDES US FAERS
482	Mallory-Weiss Syndrome	FAERS: 2		US FAERS
483	Menorrhagia	FAERS: 2		US FAERS
484	Mental impairment	FAERS: 2		US FAERS
485	Metrorrhagia	FAERS: 2	5161937	CTD US FAERS
486	Middle insomnia	FAERS: 2		US FAERS
487	Musculoskeletal chest pain	FAERS: 2		US FAERS
488	Oral pain	FAERS: 2		US FAERS
489	PO2 decreased	FAERS: 2		US FAERS
490	Pelvic venous thrombosis	FAERS: 2		US FAERS
491	Percussion test abnormal	FAERS: 2		US FAERS
492	Photophobia	FAERS: 2		US FAERS
493	Platelet aggregation abnormal	FAERS: 2		US FAERS
494	Platelet factor 4 increased	FAERS: 2		US FAERS
495	Polyhydramnios	FAERS: 2		US FAERS
496	Poor quality product administered	FAERS: 2		US FAERS
497	Post procedural discharge	FAERS: 2		US FAERS
498	Post procedural infection	FAERS: 2		US FAERS
499	Postoperative thrombosis	FAERS: 2		US FAERS
500	Posturing	FAERS: 2		US FAERS
501	Priapism	FAERS: 2	10726030	CTD SIDER US FAERS
502	Primary Adrenal Insufficiency	FAERS: 2		US FAERS
503	Product administered at inappropriate site	FAERS: 2		US FAERS
504	Product administration error	FAERS: 2		US FAERS
505	Product availability issue	FAERS: 2		US FAERS
506	Product contamination physical	FAERS: 2		US FAERS
507	Product packaging issue	FAERS: 2		US FAERS
508	Productive Cough	FAERS: 2		OFFSIDES US FAERS
509	Pseudomonal sepsis	FAERS: 2		US FAERS
510	Pulmonary Infarction	FAERS: 2		US FAERS
511	Puncture site reaction	FAERS: 2		US FAERS
512	Purpura	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
513	Renal tubular necrosis	FAERS: 2		US FAERS
514	Respiratory Depression	FAERS: 2		US FAERS
515	Right ventricular failure	FAERS: 2		US FAERS
516	Ruptured cerebral aneurysm	FAERS: 2		US FAERS
517	Similar reaction on previous exposure to drug	FAERS: 2		US FAERS
518	Sinus Tachycardia	FAERS: 2		US FAERS
519	Skin test positive	FAERS: 2		US FAERS
520	Soft tissue necrosis	FAERS: 2		US FAERS
521	Splenic Infarction	FAERS: 2		US FAERS
522	Splenic vein thrombosis	FAERS: 2		US FAERS
523	Status Epilepticus	FAERS: 2		US FAERS
524	Stent occlusion	FAERS: 2		US FAERS
525	Stillbirth	FAERS: 2		US FAERS
526	Stress	FAERS: 2		US FAERS
527	Subcutaneous Emphysema	FAERS: 2		US FAERS
528	Surgical failure	FAERS: 2		US FAERS
529	Systemic Inflammatory Response Syndrome	FAERS: 2		US FAERS
530	Therapy non-responder	FAERS: 2		US FAERS
531	Tinnitus	FAERS: 2		US FAERS
532	Tonic clonic movements	FAERS: 2		US FAERS
533	Toxicity to various agents	FAERS: 2		US FAERS
534	Trismus	FAERS: 2		US FAERS
535	Trisomy 21	FAERS: 2		US FAERS
536	Uterine contractions during pregnancy	FAERS: 2		US FAERS
537	Vena cava filter insertion	FAERS: 2		OFFSIDES US FAERS
538	White clot in blood present	FAERS: 2		US FAERS
539	Wrong dose	FAERS: 2		US FAERS
540	effusion	FAERS: 2		OFFSIDES US FAERS
541	Abdominal adhesions	FAERS: 1		US FAERS
542	Acute Coronary Syndrome	FAERS: 1	7923645 11407108 18972074	CTD SIDER US FAERS
543	Acute prerenal failure	FAERS: 1		OFFSIDES US FAERS
544	Adenocarcinoma	FAERS: 1		US FAERS
545	Agranulocytosis	FAERS: 1		US FAERS
546	Alanine aminotransferase abnormal	FAERS: 1		US FAERS
547	Alcohol poisoning	FAERS: 1		US FAERS
548	Alcohol withdrawal syndrome	FAERS: 1		US FAERS
549	Allergy to chemicals	FAERS: 1		US FAERS
550	Amyotrophic Lateral Sclerosis	FAERS: 1		US FAERS
551	Anal Fissure	FAERS: 1		US FAERS
552	Aneurysm	FAERS: 1		OFFSIDES US FAERS
553	Angiomyolipoma	FAERS: 1		US FAERS
554	Ankle Fracture	FAERS: 1		US FAERS
555	Anosmia	FAERS: 1		US FAERS
556	Anti factor X activity decreased	FAERS: 1		US FAERS
557	Anticipatory anxiety	FAERS: 1		US FAERS
558	Anticonvulsant drug level decreased	FAERS: 1		US FAERS
559	Antiphospholipid Antibodies	FAERS: 1		US FAERS
560	Aortic Aneurysm	FAERS: 1		US FAERS
561	Apallic syndrome	FAERS: 1		US FAERS
562	Apparent death	FAERS: 1		US FAERS
563	Apparent life threatening event	FAERS: 1		US FAERS
564	Application site pain	FAERS: 1		US FAERS
565	Arterial bypass thrombosis	FAERS: 1		US FAERS
566	Arteriovenous fistula site complication	FAERS: 1		US FAERS
567	Asphyxia	FAERS: 1		US FAERS
568	Asthenopia	FAERS: 1		US FAERS
569	Auricular swelling	FAERS: 1		US FAERS
570	Axillary vein thrombosis	FAERS: 1		US FAERS
571	Back disorder	FAERS: 1		OFFSIDES US FAERS
572	Bacteria blood identified	FAERS: 1		US FAERS
573	Belligerence	FAERS: 1		US FAERS
574	Biotin deficiency	FAERS: 1		US FAERS
575	Bipolar Disorder	FAERS: 1		OFFSIDES US FAERS
576	Bladder Neoplasm	FAERS: 1		US FAERS
577	Bladder necrosis	FAERS: 1		US FAERS
578	Bladder spasm	FAERS: 1		US FAERS
579	Blepharospasm	FAERS: 1		US FAERS
580	Blighted ovum	FAERS: 1		US FAERS
581	Blister rupture	FAERS: 1		US FAERS
582	Blood alcohol increased	FAERS: 1		US FAERS
583	Blood chloride decreased	FAERS: 1		US FAERS
584	Blood count abnormal	FAERS: 1		OFFSIDES US FAERS
585	Blood creatinine decreased	FAERS: 1		OFFSIDES US FAERS
586	Blood glucose fluctuation	FAERS: 1		US FAERS
587	Blood lactate dehydrogenase increased	FAERS: 1		US FAERS
588	Blood magnesium increased	FAERS: 1		OFFSIDES US FAERS
589	Blood osmolarity decreased	FAERS: 1		US FAERS
590	Blood pH decreased	FAERS: 1		US FAERS
591	Blood pressure inadequately controlled	FAERS: 1		US FAERS
592	Blood sodium decreased	FAERS: 1		US FAERS
593	Blood viscosity decreased	FAERS: 1		US FAERS
594	Body fat disorder	FAERS: 1		US FAERS
595	Bowel movement irregularity	FAERS: 1		US FAERS
596	Brain stem embolism	FAERS: 1		US FAERS
597	Breast necrosis	FAERS: 1		US FAERS
598	Breech Presentation	FAERS: 1		US FAERS
599	CREST Syndrome	FAERS: 1		US FAERS
600	Calcinosis	FAERS: 1		US FAERS
601	Campylobacter test positive	FAERS: 1		US FAERS
602	Candida sepsis	FAERS: 1		US FAERS
603	Cardiac Death	FAERS: 1		US FAERS
604	Cardiac valve prosthesis user	FAERS: 1		US FAERS
605	Cardiac vein perforation	FAERS: 1		US FAERS
606	Cardiac ventricular thrombosis	FAERS: 1		US FAERS
607	Carotid Artery Thrombosis	FAERS: 1		US FAERS
608	Cataract operation	FAERS: 1		OFFSIDES US FAERS
609	Catheter related complication	FAERS: 1		US FAERS
610	Catheter site related reaction	FAERS: 1		OFFSIDES US FAERS
611	Catheter site swelling	FAERS: 1		US FAERS
612	Catheter site thrombosis	FAERS: 1		US FAERS
613	Cauda Equina Syndrome	FAERS: 1		US FAERS
614	Cavernous Sinus Thrombosis	FAERS: 1		US FAERS
615	Cerebellar Ataxia	FAERS: 1		US FAERS
616	Cerebellar infarction	FAERS: 1		US FAERS
617	Cheyne-Stokes Respiration	FAERS: 1		US FAERS
618	Choking sensation	FAERS: 1		OFFSIDES US FAERS
619	Cholestasis	FAERS: 1	2040875	CTD US FAERS
620	Circumstance or information capable of leading to device use error	FAERS: 1		US FAERS
621	Claustrophobia	FAERS: 1		OFFSIDES US FAERS
622	Clostridium difficile colitis	FAERS: 1		OFFSIDES US FAERS
623	Clostridium difficile infection	FAERS: 1		US FAERS
624	Clumsiness	FAERS: 1		US FAERS
625	Coagulation test abnormal	FAERS: 1		US FAERS
626	Complication of device insertion	FAERS: 1		US FAERS
627	Congenital hydronephrosis	FAERS: 1		US FAERS
628	Coronary vascular graft occlusion	FAERS: 1		US FAERS
629	Craniosynostosis	FAERS: 1		US FAERS
630	Cryptococcus test positive	FAERS: 1		US FAERS
631	Culture urine positive	FAERS: 1		US FAERS
632	Culture wound positive	FAERS: 1		US FAERS
633	Cystitis	FAERS: 1		US FAERS
634	Demyelination	FAERS: 1		OFFSIDES US FAERS
635	Dependence	FAERS: 1		US FAERS
636	Dermal absorption impaired	FAERS: 1		US FAERS
637	Dermo-hypodermitis	FAERS: 1		US FAERS
638	Device allergy	FAERS: 1		US FAERS
639	Device capturing issue	FAERS: 1		US FAERS
640	Device component issue	FAERS: 1		US FAERS
641	Device lead issue	FAERS: 1		US FAERS
642	Device related infection	FAERS: 1 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
643	Device use issue	FAERS: 1		US FAERS
644	Diabetic metabolic decompensation	FAERS: 1		US FAERS
645	Dialysis device complication	FAERS: 1		US FAERS
646	Diastolic dysfunction	FAERS: 1		US FAERS
647	Disease complication	FAERS: 1		US FAERS
648	Drug Dependence	FAERS: 1		US FAERS
649	Drug abuser	FAERS: 1		US FAERS
650	Drug abuse	FAERS: 1		US FAERS
651	Drug effect incomplete	FAERS: 1		US FAERS
652	Drug label confusion	FAERS: 1		US FAERS
653	Drug level increased	FAERS: 1		US FAERS
654	Drug monitoring procedure incorrectly performed	FAERS: 1		US FAERS
655	Drug monitoring procedure not performed	FAERS: 1		US FAERS
656	Drug resistance	FAERS: 1		US FAERS
657	Duodenitis	FAERS: 1		OFFSIDES US FAERS
658	Duplicate therapy error	FAERS: 1		US FAERS
659	Dysmorphism	FAERS: 1		US FAERS
660	Dysphonia	FAERS: 1		US FAERS
661	Dystonia	FAERS: 1		US FAERS
662	Economic problem	FAERS: 1		OFFSIDES US FAERS
663	Ectopic Pregnancy	FAERS: 1		US FAERS
664	Electrocardiogram ST segment abnormal	FAERS: 1		US FAERS
665	Electrocardiogram abnormal	FAERS: 1		US FAERS
666	Electrolyte imbalance	FAERS: 1		US FAERS
667	Embedded device	FAERS: 1		US FAERS
668	Emotional distress	FAERS: 1		OFFSIDES US FAERS
669	Enlarged uvula	FAERS: 1		US FAERS
670	Enteritis	FAERS: 1		US FAERS
671	Enterococcal infection	FAERS: 1		OFFSIDES US FAERS
672	Erysipelas	FAERS: 1		US FAERS
673	Euphoric mood	FAERS: 1		US FAERS
674	Exfoliative rash	FAERS: 1		US FAERS
675	Exsanguination	FAERS: 1		US FAERS
676	Extremity necrosis	FAERS: 1		US FAERS
677	Facial Pain	FAERS: 1		US FAERS
678	Factor II mutation	FAERS: 1		US FAERS
679	Factor V deficiency	FAERS: 1		US FAERS
680	Fasciotomy	FAERS: 1		US FAERS
681	Feeding tube complication	FAERS: 1		US FAERS
682	Foaming at mouth	FAERS: 1		US FAERS
683	Food Allergy	FAERS: 1		US FAERS
684	Formication	FAERS: 1		US FAERS
685	Frustration	FAERS: 1		US FAERS
686	Full blood count abnormal	FAERS: 1		US FAERS
687	Gasping syndrome	FAERS: 1		US FAERS
688	Gastrointestinal erosion	FAERS: 1		US FAERS
689	Gastrointestinal infection	FAERS: 1		US FAERS
690	Gastrointestinal inflammation	FAERS: 1		US FAERS
691	Gastrointestinal sounds abnormal	FAERS: 1		US FAERS
692	Gastrointestinal ulcer	FAERS: 1		US FAERS
693	Gene Mutation	FAERS: 1		US FAERS
694	General physical condition abnormal	FAERS: 1		US FAERS
695	Genital swelling	FAERS: 1		US FAERS
696	Glaucoma	FAERS: 1		US FAERS
697	Glomerulonephritis	FAERS: 1		US FAERS
698	Gluten sensitivity	FAERS: 1		US FAERS
699	Graft thrombosis	FAERS: 1		US FAERS
700	Granulomatosis with polyangiitis	FAERS: 1		US FAERS
701	Granuloma	FAERS: 1		OFFSIDES US FAERS
702	Grey Turner's sign	FAERS: 1		US FAERS
703	Groin infection	FAERS: 1		US FAERS
704	Head titubation	FAERS: 1		US FAERS
705	Heparin resistance	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
706	Hepatic artery occlusion	FAERS: 1		US FAERS
707	Hepatic artery thrombosis	FAERS: 1		US FAERS
708	Hepatic cancer metastatic	FAERS: 1		US FAERS
709	Hepatitis B	FAERS: 1	25550158	CTD US FAERS
710	Hernia pain	FAERS: 1		US FAERS
711	Hunger	FAERS: 1		US FAERS
712	Hydronephrosis	FAERS: 1		US FAERS
713	Hyperacusis	FAERS: 1		US FAERS
714	Hypercalciuria	FAERS: 1		US FAERS
715	Hyperkeratosis	FAERS: 1		US FAERS
716	Hyperphagia	FAERS: 1		US FAERS
717	Hyperreflexia	FAERS: 1		OFFSIDES US FAERS
718	Hypertensive emergency	FAERS: 1		US FAERS
719	Hypoaesthesia facial	FAERS: 1		US FAERS
720	Hypokinesia	FAERS: 1		US FAERS
721	Hypopituitarism	FAERS: 1	9365341	CTD US FAERS
722	Hypoplastic Left Heart Syndrome	FAERS: 1		US FAERS
723	Hyporeflexia	FAERS: 1		US FAERS
724	Hypothyroidism	FAERS: 1		US FAERS
725	Hypoventilation	FAERS: 1		US FAERS
726	Idiosyncratic drug reaction	FAERS: 1		US FAERS
727	Immunology test abnormal	FAERS: 1		US FAERS
728	Impaired driving ability	FAERS: 1		US FAERS
729	Impaired self-care	FAERS: 1		US FAERS
730	Implant site thrombosis	FAERS: 1		US FAERS
731	Inability to afford medication	FAERS: 1		US FAERS
732	Inappropriate schedule of product administration	FAERS: 1		US FAERS
733	Incision site pain	FAERS: 1		US FAERS
734	Incisional hernia	FAERS: 1		US FAERS
735	Incorrect drug administration duration	FAERS: 1		US FAERS
736	Incorrect product administration duration	FAERS: 1		US FAERS
737	Incorrect route of product administration	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
738	Increased tendency to bruise	FAERS: 1		US FAERS
739	Infantile apnoeic attack	FAERS: 1		US FAERS
740	Inflammation	FAERS: 1	16391376	CTD US FAERS
741	Infusion Site Extravasation	FAERS: 1		US FAERS
742	Infusion site bruising	FAERS: 1		US FAERS
743	Infusion site erythema	FAERS: 1		US FAERS
744	Infusion site pain	FAERS: 1		US FAERS
745	Infusion site reaction	FAERS: 1		US FAERS
746	Initial insomnia	FAERS: 1		US FAERS
747	Injection site abscess	FAERS: 1		US FAERS
748	Injection site atrophy	FAERS: 1		US FAERS
749	Injection site desquamation	FAERS: 1		US FAERS
750	Injection site eczema	FAERS: 1		US FAERS
751	Injection site hypertrophy	FAERS: 1		US FAERS
752	Injection site infection	FAERS: 1		US FAERS
753	Injection site joint swelling	FAERS: 1		US FAERS
754	Injection site laceration	FAERS: 1		US FAERS
755	Injection site pallor	FAERS: 1		US FAERS
756	Injection site phlebitis	FAERS: 1		US FAERS
757	Instillation site irritation	FAERS: 1		US FAERS
758	Insurance issue	FAERS: 1		US FAERS
759	Intentional self-injury	FAERS: 1		US FAERS
760	Intercepted drug administration error	FAERS: 1		US FAERS
761	Intestinal infarction	FAERS: 1		US FAERS
762	Intracranial mass	FAERS: 1		US FAERS
763	Iron deficiency	FAERS: 1		US FAERS
764	Joint Range of Motion Decreased	FAERS: 1		OFFSIDES US FAERS
765	Jugular vein distension	FAERS: 1		US FAERS
766	Kounis Syndrome	FAERS: 1		US FAERS
767	Large intestine perforation	FAERS: 1		US FAERS
768	Leukopenia	FAERS: 1		US FAERS
769	Limb injury	FAERS: 1		OFFSIDES US FAERS
770	Lipase increased	FAERS: 1		US FAERS
771	Lipodystrophy acquired	FAERS: 1		US FAERS
772	Low birth weight baby	FAERS: 1		US FAERS
773	Lumbosacral plexopathy	FAERS: 1		US FAERS
774	Lung consolidation	FAERS: 1		US FAERS
775	Lupus encephalitis	FAERS: 1		US FAERS
776	Lyme Disease	FAERS: 1		US FAERS
777	Lymphadenopathy	FAERS: 1		US FAERS
778	Lymphopenia	FAERS: 1		US FAERS
779	MYELODYSPLASTIC SYNDROME	FAERS: 1		US FAERS
780	Mastectomy	FAERS: 1		OFFSIDES US FAERS
781	Mechanical ileus	FAERS: 1		US FAERS
782	Mediastinal effusion	FAERS: 1		US FAERS
783	Medical device site reaction	FAERS: 1		US FAERS
784	Melanomatous meningitis	FAERS: 1		US FAERS
785	Metastasis	FAERS: 1		US FAERS
786	Metastatic Neoplasm	FAERS: 1		OFFSIDES US FAERS
787	Moaning	FAERS: 1		US FAERS
788	Monoparesis	FAERS: 1		OFFSIDES US FAERS
789	Monoplegia	FAERS: 1		US FAERS
790	Multiple Epiphyseal Dysplasia	FAERS: 1		US FAERS
791	Multiple allergies	FAERS: 1		US FAERS
792	Multiple drug overdose	FAERS: 1		US FAERS
793	Muscle Rigidity	FAERS: 1		US FAERS
794	Muscle Spasticity	FAERS: 1		US FAERS
795	Muscle tightness	FAERS: 1		US FAERS
796	Musculoskeletal discomfort	FAERS: 1		US FAERS
797	Myocarditis	FAERS: 1		US FAERS
798	Nasal mucosal disorder	FAERS: 1		US FAERS
799	Neonatal aspiration	FAERS: 1		US FAERS
800	Neonatal infection	FAERS: 1		US FAERS
801	Neonatal tachycardia	FAERS: 1		US FAERS
802	Nephrectomy	FAERS: 1		US FAERS
803	Nervousness	FAERS: 1		US FAERS
804	Neurological examination abnormal	FAERS: 1		US FAERS
805	Neutrophil count decreased	FAERS: 1		OFFSIDES US FAERS
806	No reaction on previous exposure to drug	FAERS: 1		US FAERS
807	Nocturia	FAERS: 1		US FAERS
808	Nutritional condition abnormal	FAERS: 1		US FAERS
809	Oliguria	FAERS: 1	19309387	CTD OFFSIDES US FAERS
810	Open wound	FAERS: 1		OFFSIDES US FAERS
811	Orthosis user	FAERS: 1		US FAERS
812	Otitis Media	FAERS: 1		US FAERS
813	Oxygen saturation abnormal	FAERS: 1		US FAERS
814	PCO2 increased	FAERS: 1		US FAERS
815	Panniculitis	FAERS: 1		US FAERS
816	Patient restraint	FAERS: 1		US FAERS
817	Pelvic fluid collection	FAERS: 1		US FAERS
818	Penile contusion	FAERS: 1		US FAERS
819	Penile necrosis	FAERS: 1		US FAERS
820	Performance enhancing product use	FAERS: 1		US FAERS
821	Peripheral artery dissection	FAERS: 1		US FAERS
822	Peripheral artery occlusion	FAERS: 1		US FAERS
823	Peripheral nerve palsy	FAERS: 1		US FAERS
824	Peritoneal cyst	FAERS: 1		US FAERS
825	Personality Change	FAERS: 1		US FAERS
826	Pharyngolaryngeal Pain	FAERS: 1		US FAERS
827	Pityriasis Rubra Pilaris	FAERS: 1		US FAERS
828	Plagiocephaly	FAERS: 1		US FAERS
829	Platelet aggregation	FAERS: 1		US FAERS
830	Platelet count abnormal	FAERS: 1		US FAERS
831	Platelet dysfunction	FAERS: 1		US FAERS
832	Pleuritic pain	FAERS: 1		US FAERS
833	Pneumoperitoneum	FAERS: 1		US FAERS
834	Pneumothorax	FAERS: 1		OFFSIDES US FAERS
835	Polyneuropathy	FAERS: 1		US FAERS
836	Portal Hypertension	FAERS: 1		US FAERS
837	Portal hypertensive gastropathy	FAERS: 1		US FAERS
838	Post procedural myocardial infarction	FAERS: 1		US FAERS
839	Post procedural swelling	FAERS: 1		US FAERS
840	Postoperative renal failure	FAERS: 1		US FAERS
841	Postpartum venous thrombosis	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
842	Procedural site reaction	FAERS: 1		US FAERS
843	Procedural vomiting	FAERS: 1		US FAERS
844	Product appearance confusion	FAERS: 1		US FAERS
845	Product closure issue	FAERS: 1		US FAERS
846	Product commingling	FAERS: 1		US FAERS
847	Product communication issue	FAERS: 1		US FAERS
848	Product complaint	FAERS: 1		US FAERS
849	Product compounding quality issue	FAERS: 1		US FAERS
850	Product container issue	FAERS: 1		US FAERS
851	Product contamination with body fluid	FAERS: 1		US FAERS
852	Product formulation issue	FAERS: 1		US FAERS
853	Product label on wrong product	FAERS: 1		US FAERS
854	Product outer packaging issue	FAERS: 1		US FAERS
855	Product packaging confusion	FAERS: 1		US FAERS
856	Product packaging quantity issue	FAERS: 1		US FAERS
857	Product prescribing error	FAERS: 1		US FAERS
858	Product residue present	FAERS: 1		US FAERS
859	Product substitution	FAERS: 1		US FAERS
860	Product use complaint	FAERS: 1		US FAERS
861	Product use in unapproved indication	FAERS: 1		US FAERS
862	Protein S Deficiency	FAERS: 1		US FAERS
863	Protein S decreased	FAERS: 1		US FAERS
864	Proteinuria	FAERS: 1	9111513	CTD US FAERS
865	Prothrombin level decreased	FAERS: 1		US FAERS
866	Psoriasis	FAERS: 1		US FAERS
867	Pulmonary Hypertension	FAERS: 1		OFFSIDES US FAERS
868	Pulmonary arterial pressure increased	FAERS: 1		US FAERS
869	Pulmonary artery thrombosis	FAERS: 1		US FAERS
870	Pulmonary vasculitis	FAERS: 1		US FAERS
871	Purulent discharge	FAERS: 1		OFFSIDES US FAERS
872	Quality of life decreased	FAERS: 1		US FAERS
873	Reaction to drug excipients	FAERS: 1		US FAERS
874	Rebound effect	FAERS: 1		US FAERS
875	Rectal tenesmus	FAERS: 1		US FAERS
876	Red blood cell schistocytes present	FAERS: 1		US FAERS
877	Refusal of treatment by relative	FAERS: 1		US FAERS
878	Respiratory fume inhalation disorder	FAERS: 1		US FAERS
879	Respiratory tract congestion	FAERS: 1		US FAERS
880	Retroperitoneal abscess	FAERS: 1		US FAERS
881	Rhabdomyolysis	FAERS: 1		US FAERS
882	Rhonchi	FAERS: 1		US FAERS
883	Rotator cuff syndrome	FAERS: 1		US FAERS
884	Rubber sensitivity	FAERS: 1		US FAERS
885	School refusal	FAERS: 1		US FAERS
886	Screaming	FAERS: 1		US FAERS
887	Secretion discharge	FAERS: 1		US FAERS
888	Sensory integrative dysfunction	FAERS: 1		US FAERS
889	Serum Sickness	FAERS: 1		US FAERS
890	Sinus headache	FAERS: 1		US FAERS
891	Sinusitis	FAERS: 1		OFFSIDES US FAERS
892	Skin graft rejection	FAERS: 1		US FAERS
893	Skin irritation	FAERS: 1		US FAERS
894	Skin laceration	FAERS: 1		US FAERS
895	Sneezing	FAERS: 1		US FAERS
896	Soft Tissue Infection	FAERS: 1		US FAERS
897	Spina Bifida	FAERS: 1		US FAERS
898	Spinal column stenosis	FAERS: 1		US FAERS
899	Splenomegaly	FAERS: 1		US FAERS
900	Sputum culture positive	FAERS: 1		US FAERS
901	Squamous cell carcinoma	FAERS: 1		US FAERS
902	Staphylococcal osteomyelitis	FAERS: 1		US FAERS
903	Staphylococcus test positive	FAERS: 1		US FAERS
904	Steatohepatitis	FAERS: 1		US FAERS
905	Stenotrophomonas sepsis	FAERS: 1		US FAERS
906	Stevens-Johnson Syndrome	FAERS: 1	25811541	CTD OFFSIDES US FAERS
907	Stupor	FAERS: 1		US FAERS
908	Subcutaneous nodule	FAERS: 1		US FAERS
909	Superinfection	FAERS: 1		US FAERS
910	Superior Vena Cava Syndrome	FAERS: 1		US FAERS
911	Supraventricular tachycardia	FAERS: 1		OFFSIDES US FAERS
912	Suture related complication	FAERS: 1		US FAERS
913	Synovial Cyst	FAERS: 1		OFFSIDES US FAERS
914	Tachyarrhythmia	FAERS: 1		US FAERS
915	Temperature intolerance	FAERS: 1		US FAERS
916	Terminal state	FAERS: 1		US FAERS
917	Thalamic infarction	FAERS: 1		US FAERS
918	Therapeutic drug monitoring analysis incorrectly performed	FAERS: 1		US FAERS
919	Therapeutic product ineffective	FAERS: 1		US FAERS
920	Therapeutic response unexpected	FAERS: 1		US FAERS
921	Therapy regimen changed	FAERS: 1		US FAERS
922	Thoracic vertebral fracture	FAERS: 1		US FAERS
923	Thrombotic stroke	FAERS: 1		US FAERS
924	Tongue biting	FAERS: 1		US FAERS
925	Tongue discomfort	FAERS: 1		US FAERS
926	Tooth Infection	FAERS: 1		OFFSIDES US FAERS
927	Toxic Shock Syndrome	FAERS: 1		US FAERS
928	Toxicologic test abnormal	FAERS: 1		US FAERS
929	Tracheomalacia	FAERS: 1		US FAERS
930	Transcription medication error	FAERS: 1		US FAERS
931	Traumatic delivery	FAERS: 1		US FAERS
932	Trichorrhexis	FAERS: 1		US FAERS
933	Truncus coeliacus thrombosis	FAERS: 1		US FAERS
934	Tumour haemorrhage	FAERS: 1		US FAERS
935	Ulcer	FAERS: 1		SIDER US FAERS
936	Unresponsive to pain stimuli	FAERS: 1		OFFSIDES US FAERS
937	Urethral discharge	FAERS: 1		US FAERS
938	Urine flow decreased	FAERS: 1		US FAERS
939	Vascular graft thrombosis	FAERS: 1		US FAERS
940	Vascular rupture	FAERS: 1		US FAERS
941	Vascular stent thrombosis	FAERS: 1		US FAERS
942	Vasoplegia syndrome	FAERS: 1		US FAERS
943	Vasospasm	FAERS: 1		US FAERS
944	Venous perforation	FAERS: 1		US FAERS
945	Venous thrombosis limb	FAERS: 1		US FAERS
946	Ventricular Dysfunction	FAERS: 1	8713574	CTD US FAERS
947	Ventricular failure	FAERS: 1		US FAERS
948	Ventricular hypertrophy	FAERS: 1		US FAERS
949	Ventricular hypokinesia	FAERS: 1		US FAERS
950	Visceral venous thrombosis	FAERS: 1		US FAERS
951	Vital functions abnormal	FAERS: 1		US FAERS
952	Vitreous Detachment	FAERS: 1		US FAERS
953	West Nile virus test positive	FAERS: 1		US FAERS
954	Wound evisceration	FAERS: 1		US FAERS
955	Wound necrosis	FAERS: 1		US FAERS
956	Wound sepsis	FAERS: 1		US FAERS
957	Wrong device used	FAERS: 1		US FAERS
958	X-linked chromosomal disorder	FAERS: 1		US FAERS
959	X-ray abnormal	FAERS: 1		US FAERS
960	muscle injury	FAERS: 1		US FAERS
961	AIDS Dementia Complex			OFFSIDES
962	Acid reflux			OFFSIDES
963	Actinomycosis			OFFSIDES
964	Acute bronchitis			OFFSIDES
965	Adenoiditis			OFFSIDES
966	Adenoma			OFFSIDES
967	Adnexa uteri cyst			OFFSIDES
968	Afibrinogenemia		1558085	CTD
969	Albuminuria		10645038	CTD
970	Alveolitis			OFFSIDES
971	Amaurosis Fugax		9890845	CTD
972	Amphetamines			OFFSIDES
973	Anemia, Hemolytic		8486459	CTD
974	Anemia		5161937	CTD
975	Aneurysm, Dissecting		17660937	CTD
976	Angina, Unstable		View details 1608405 2382605 9382401 11382373 11869846 15251667	CTD
977	Anhedonia			OFFSIDES
978	Anhidrosis			OFFSIDES
979	Anterior Compartment Syndrome		9875937 15069410	CTD
980	Anticonvulsant drug level below therapeutic			OFFSIDES
981	Aortic Diseases		View details 3955462 7986555 8171941 8213423 8512412 9456945 11560843	CTD
982	Arterial Occlusive Diseases		View details 435052 441387 469218 591536 1358714 1574877 1713745 1737430 1977060 2042450 3280884 3337969 3569071 3773133 3976652 4044698 5034842 6195949 6476763 6875393 7240989 7305655 8031563 8213423 8641411 8659224 8950124 9201537 9298861 9382401 9475822 9497995 9810286 9950545 11269422 11532640 11560843 11773578 11827497 15156309 16456608 17114860 17954999 18799498	CTD
983	Arteriosclerosis Obliterans			OFFSIDES
984	Arteriosclerosis			OFFSIDES
985	Artificial crown procedure			OFFSIDES
986	Astigmatism			OFFSIDES
987	Atherosclerosis		9200341	CTD
988	Atrial tachycardia			OFFSIDES
989	Autoimmune Diseases		12623829 20162249	CTD
990	Bacillus infection			OFFSIDES
991	Bacterial disease carrier			OFFSIDES
992	Band neutrophil percentage increased			OFFSIDES
993	Benign Prostatic Hyperplasia			OFFSIDES
994	Bilirubin conjugated increased			OFFSIDES
995	Biopsy			OFFSIDES
996	Blepharitis			OFFSIDES
997	Blepharoptosis			OFFSIDES
998	Blood Coagulation Disorders		7167388	CTD
999	Blood Glucose			OFFSIDES
1000	Blood Platelet Disorders		10907031	CTD
1001	Blood albumin decreased			OFFSIDES
1002	Blood calcitonin increased			OFFSIDES
1003	Blood chloride increased			OFFSIDES
1004	Blood immunoglobulin A decreased			OFFSIDES
1005	Blood immunoglobulin A increased			OFFSIDES
1006	Blood immunoglobulin M decreased			OFFSIDES
1007	Blood iron increased			OFFSIDES
1008	Blood pH increased			OFFSIDES
1009	Blood parathyroid hormone increased			OFFSIDES
1010	Blood phosphorus decreased			OFFSIDES
1011	Blood sodium			OFFSIDES
1012	Blood thyroid stimulating hormone increased			OFFSIDES
1013	Blurred vision			OFFSIDES
1014	Body Temperature			OFFSIDES
1015	Bone density decreased			OFFSIDES
1016	Bone density increased			OFFSIDES
1017	Bone lesion			OFFSIDES
1018	Bone scan abnormal			OFFSIDES
1019	Brachial Plexus Neuropathies		11451857	CTD
1020	Brain Edema		9390654	CTD
1021	Brain Infarction		1682588 3739889 12452748	CTD
1022	Brain Injuries		21534203	CTD
1023	Brain Ischemia		4024857 19379937	CTD
1024	Breast tenderness			OFFSIDES
1025	Bronchiolitis			OFFSIDES
1026	Bronchoalveolar Lavage			OFFSIDES
1027	Bronchoscopy abnormal			OFFSIDES
1028	Bruxism			OFFSIDES
1029	Carotid Artery Diseases		3280884	CTD
1030	Carotid artery insufficiency			OFFSIDES
1031	Carotid bruit			OFFSIDES
1032	Cataract			OFFSIDES
1033	Catheter placement			OFFSIDES
1034	Central line infection			OFFSIDES
1035	Central venous catheter removal			OFFSIDES
1036	Cerebral Hemorrhage		View details 1461851 1579960 2264071 2683244 3401113 3455245 3960090 6537834 7723950 9836764 10717596 11706099 12034327 12690208 14630814 15115906 16149013 16190367 16510832 17114860 20360541	CTD
1037	Cerebral atrophy			OFFSIDES
1038	Charles Bonnet Syndrome			OFFSIDES
1039	Chemical and Drug Induced Liver Injury		View details 10804648 11074748 19074762 19367693 21138266	CTD
1040	Cholecystitis		20601855	CTD OFFSIDES
1041	Chronic Obstructive Airway Disease			OFFSIDES
1042	Chronic sinusitis			OFFSIDES
1043	Cirrhosis			OFFSIDES
1044	Color blindness			OFFSIDES
1045	Compartment syndromes		View details 1493394 10645301 11797033 15114479	CTD
1046	Complications of transplant surgery			OFFSIDES
1047	Compression fracture			OFFSIDES
1048	Confabulation			OFFSIDES
1049	Congenital pyelocaliectasis			OFFSIDES
1050	Contracture			OFFSIDES
1051	Contusions		17931375	CTD
1052	Coronary Aneurysm		19182299	CTD
1053	Coronary Occlusion		15882162 16243122	CTD
1054	Coronary Thrombosis		View details 2204011 3569071 8221869 15882162 16243122 17913265 17955717 20504888	CTD
1055	Creatinine urine decreased			OFFSIDES
1056	Crohn Disease		1352765	CTD
1057	Culture positive			OFFSIDES
1058	Cyst			OFFSIDES
1059	Cytokine Release Syndrome			OFFSIDES
1060	Cytomegalovirus Infections		28432120	CTD
1061	Deafness Neurosensory			OFFSIDES
1062	Debridement			OFFSIDES
1063	Dental Fistula			OFFSIDES
1064	Dental abscess			OFFSIDES
1065	Dental caries			OFFSIDES
1066	Dermoid Cyst			OFFSIDES
1067	Diabetic ulcer			OFFSIDES
1068	Diarrhea			OFFSIDES
1069	Dilatation intrahepatic duct acquired			OFFSIDES
1070	Diverticulosis			OFFSIDES
1071	Drowsiness			OFFSIDES
1072	Drug withdrawal headache			OFFSIDES
1073	Ear tube insertion			OFFSIDES
1074	Edema		10736429	CTD
1075	Electrocardiogram poor R-wave progression			OFFSIDES
1076	Electromechanical dissociation			OFFSIDES
1077	Endodontic procedure			OFFSIDES
1078	Engraftment syndrome			OFFSIDES
1079	Enuresis			OFFSIDES
1080	Epidural lipomatosis			OFFSIDES
1081	Erectile dysfunction		3650484	CTD OFFSIDES
1082	Esophageal Stenosis			OFFSIDES
1083	Eustachian tube disorder			OFFSIDES
1084	Extracorporeal Circulation	Canada Vigilance: 1		Canada Vigilance
1085	Extremity contracture			OFFSIDES
1086	Eye laser surgery			OFFSIDES
1087	Eyelid margin crusting			OFFSIDES
1088	Factor Xa activity test	Canada Vigilance: 1		Canada Vigilance
1089	Familial cerebral cavernous malformation		16859253	CTD
1090	Fatty Liver			OFFSIDES
1091	Febrile Neutropenia			OFFSIDES
1092	Femoral Neuropathy		View details 219731 224344 696156 1309622 1916586 2174952 3013803 3234663 4326840 4338821 4351955 4452704 8592921 12918901	CTD
1093	Fever		8638872	CTD
1094	Fistula repair			OFFSIDES
1095	Gastric Bypass			OFFSIDES
1096	Gastrointestinal Hemorrhage		9890845	CTD
1097	Gastrointestinal toxicity			OFFSIDES
1098	Gingival erythema			OFFSIDES
1099	Gingivectomy			OFFSIDES
1100	Glomerulonephritis, Membranoproliferative		8441232 9111513	CTD
1101	Graft Occlusion, Vascular		View details 435052 2123154 9074376 9824039 10209835 10391290 11041470 11136681 15282674 18093673 20504888	CTD
1102	Granulocytosis			OFFSIDES
1103	Heart Diseases		View details 2968585 3810521 8031563 8644608 10217969 12407843 12902121 19156386	CTD
1104	Hematoma, Epidural, Spinal		697611 10914357 12227717	CTD
1105	Hematoma		View details 696156 1309622 1398304 1845603 1916586 2174952 3013803 3234663 3783118 4326840 5161937 5366031 7167388 7179208 8592921 9875937 10493364 10823439 11204326 11451857 11797033 12222545 12706461 12716030 12768994 12918901 15464942 17316348 18654047 19309387 19837550	CTD
1106	Hematuria		3573184 8225663	CTD
1107	Hemianopsia		16148626	CTD
1108	Hemorrhage		View details 373351 389337 451885 1273617 1635495 1944711 2029354 2521748 2544816 2795766 3401113 4024857 4464499 4811051 5041701 5087933 5366031 6615052 6696638 6729870 7179208 7411781 7431459 7666265 8196729 8225663 8947449 8950779 9570173 9890845 9932617 10630659 11279659 11382373 11401186 11762651 11771214 15020349 15087598 15156309 16537665 17764540 18654047 19576363 20601855 21138266 25325928	CTD
1109	Hepatoblastoma			OFFSIDES
1110	Hiccough			OFFSIDES
1111	Hilar lymphadenopathy			OFFSIDES
1112	Hip surgery			OFFSIDES
1113	Hyperkalemia		View details 10624973 10726030 11975115 15875438	CTD
1114	Hyperpigmentation			OFFSIDES
1115	Hyperplasia		8313565	CTD
1116	Hypesthesia		4351955	CTD
1117	Hypocalcemia		16678734	CTD
1118	Hyponatremia		9365341	CTD
1119	Hypovolemia		4351955	CTD
1120	Implant site reaction			OFFSIDES
1121	Incontinence			OFFSIDES
1122	Infarction, Middle Cerebral Artery		10883918 11706099	CTD
1123	Inflammatory Bowel Diseases		9881830	CTD
1124	Infrequent bowel movements			OFFSIDES
1125	Infusion site mobility decreased			OFFSIDES
1126	Intervertebral Disc Degeneration			OFFSIDES
1127	Intervertebral disc disorder			OFFSIDES
1128	Intracranial Arterial Diseases		19842721	CTD
1129	Intracranial Embolism		6729870	CTD
1130	Intracranial Thrombosis		4714850 12637624	CTD
1131	Intraoperative Complications		795299	CTD
1132	Ischemia		View details 507970 3139897 3402234 8486459 8662173 8736020 10717596	CTD
1133	Jaw lesion excision			OFFSIDES
1134	Joint prosthesis user			OFFSIDES
1135	Kidney Diseases		3118260 7431459	CTD
1136	Kidney Failure			OFFSIDES
1137	Lacrimation			SIDER
1138	Lactose Intolerance			OFFSIDES
1139	Left Ventricular Hypertrophy			OFFSIDES
1140	Left atrial dilatation			OFFSIDES
1141	Leriche Syndrome		8659220	CTD
1142	Leukoencephalopathy			OFFSIDES
1143	Leukopenia neonatal			OFFSIDES
1144	Lip erosion			OFFSIDES
1145	Lipase			OFFSIDES
1146	Liver Cirrhosis, Experimental		16904936	CTD
1147	Liver diseases		8623174	CTD
1148	Loose tooth			OFFSIDES
1149	Lung Abscess			OFFSIDES
1150	Lung Neoplasms		20201787	CTD
1151	Lung hyperinflation			OFFSIDES
1152	Lupus Nephritis		4695164	CTD
1153	Lymphedema			OFFSIDES
1154	Lymphocyte count decreased			OFFSIDES
1155	Macroglossia			OFFSIDES
1156	Malignant ascites			OFFSIDES
1157	Malignant mesenteric neoplasm			OFFSIDES
1158	Mastication disorder			OFFSIDES
1159	Mechanical ventilation			OFFSIDES
1160	Medical device removal			OFFSIDES
1161	Meningioma			OFFSIDES
1162	Mesenteric Vascular Occlusion		20056052	CTD
1163	Mitral Valve Stenosis		18645060	CTD
1164	Mucosal erosion			OFFSIDES
1165	Multiple Myeloma			OFFSIDES
1166	Muscle Weakness		4351955	CTD OFFSIDES
1167	Myeloblastoma			OFFSIDES
1168	Myocardial Ischemia		9365341 18243369	CTD
1169	Myocardial Reperfusion Injury		10843908	CTD
1170	Neoplasm Invasiveness		26476401	CTD
1171	Nephrogenic Fibrosing Dermopathy			OFFSIDES
1172	Nephrostomy tube placement			OFFSIDES
1173	Nerve Degeneration		1493394	CTD
1174	Neural Tube Defects		10662605	CTD
1175	Neurologic Manifestations		6537834	CTD
1176	Neutrophil count abnormal			OFFSIDES
1177	Ocular Hypertension			OFFSIDES
1178	Ocular icterus			OFFSIDES
1179	Oculomucocutaneous syndrome			OFFSIDES
1180	Olfaction Disorders		19702217	CTD
1181	Open reduction of fracture			OFFSIDES
1182	Optic Neuropathy			OFFSIDES
1183	Oral Cavity Fistula			OFFSIDES
1184	Oral infection			OFFSIDES
1185	Osteopetrosis			OFFSIDES
1186	Osteosclerosis			OFFSIDES
1187	Pancreatic Insufficiency			OFFSIDES
1188	Papilledema		4714850	CTD
1189	Papilloma			OFFSIDES
1190	Paracentesis			OFFSIDES
1191	Paresis		10883918	CTD
1192	Periarthritis			OFFSIDES
1193	Pericarditis, Constrictive		4036989	CTD
1194	Pericarditis		4036989 7789375	CTD
1195	Periodontal operation			OFFSIDES
1196	Periodontitis			OFFSIDES
1197	Peripheral Vascular Diseases		3569071 15464942	CTD
1198	Physical disability			OFFSIDES
1199	Pigmentary retinopathy			OFFSIDES
1200	Pituitary Apoplexy		9365341 11958251 15251667	CTD
1201	Plaque, Atherosclerotic		7755771	CTD
1202	Plasmacytoma			OFFSIDES
1203	Platelet Transfusion			OFFSIDES
1204	Pleurodesis			OFFSIDES
1205	Poikilocytosis			OFFSIDES
1206	Polydactyly	Canada Vigilance: 1		Canada Vigilance
1207	Poor personal hygiene			OFFSIDES
1208	Post inflammatory pigmentation change			OFFSIDES
1209	Post procedural discomfort			OFFSIDES
1210	Postmenopausal bleeding			OFFSIDES
1211	Postoperative Complications		View details 386676 3280884 3874423 7994280 8180327 8474653 12043784 16391376	CTD
1212	Postoperative Hemorrhage		11345711	CTD
1213	Postphlebitic Syndrome		8196729	CTD
1214	Pre-Eclampsia		19837457	CTD
1215	Precocious Puberty			OFFSIDES
1216	Pregnancy Complications, Hematologic		14712967	CTD
1217	Presbyopia			OFFSIDES
1218	Primary sequestrum			OFFSIDES
1219	Pulmonary Edema		8638872	CTD
1220	Pulmonary radiation injury			OFFSIDES
1221	Pulmonary toxicity			OFFSIDES
1222	Pulmonary vascular disorder			OFFSIDES
1223	Purulence			OFFSIDES
1224	Pyelitis		1255900	CTD
1225	Pyelonephritis		7667784	CTD
1226	Rales			OFFSIDES
1227	Reflex, Abnormal		4351955	CTD
1228	Renal Artery Obstruction		2318116	CTD
1229	Reperfusion Injury		10673075	CTD
1230	Respiratory Distress Syndrome, Adult		1848967 19309387	CTD
1231	Retinal Vein Occlusion		12623829	CTD
1232	Retinal vascular occlusion			OFFSIDES
1233	Retrobulbar Hemorrhage		18030123	CTD
1234	Rhinitis			SIDER
1235	Right Ventricular Dysfunction			OFFSIDES
1236	Sagittal Sinus Thrombosis		2219218	CTD
1237	Schizophrenia			OFFSIDES
1238	Scotoma		12623829	CTD
1239	Seizures		8638872	CTD
1240	Sequestrectomy			OFFSIDES
1241	Seroma			OFFSIDES
1242	Shock, Cardiogenic		5090805	CTD
1243	Sick Sinus Syndrome			OFFSIDES
1244	Sinus Thrombosis, Intracranial		View details 12269725 12763334 16038130 17660937	CTD
1245	Sinus bradycardia			OFFSIDES
1246	Sinus operation			OFFSIDES
1247	Sinus polyp			OFFSIDES
1248	Skin Induration			OFFSIDES
1249	Skin hypertrophy			OFFSIDES
1250	Skin tightness			OFFSIDES
1251	Skin toxicity			OFFSIDES
1252	Sopor			OFFSIDES
1253	Spasm		9367113	CTD
1254	Speech rehabilitation			OFFSIDES
1255	Spinal Cord Ischemia		1657813	CTD
1256	Stem cell transplant			OFFSIDES
1257	Subarachnoid Hemorrhage, Traumatic		19388349	CTD
1258	Subarachnoid Hemorrhage		9482190 18972074	CTD
1259	Subcutaneous Abscess			OFFSIDES
1260	Substance Withdrawal Syndrome		View details 1608405 7895349 8604621 12147970 12218542	CTD
1261	Sudden Cardiac Death			OFFSIDES
1262	Tendinitis			OFFSIDES
1263	Therapeutic product effect decreased	Canada Vigilance: 1		Canada Vigilance
1264	Thoracotomy			OFFSIDES
1265	Thromboembolism		View details 369234 441387 518011 1358714 1666193 1788719 2029354 2318116 3739889 6615052 6670686 7305655 7326845 8052960 8107919 8171941 8497841 8992808 9027018 9381213 9499523 9646784 11505079 11762651 16706967 17954999 19576363	CTD
1266	Thrombophilia		View details 2219218 9165476 11762651 16628723 17352667	CTD
1267	Tooth Extraction			OFFSIDES
1268	Tooth Loss			OFFSIDES
1269	Troponin I increased			OFFSIDES
1270	Urethral fistula			OFFSIDES
1271	Urinary tract infection fungal			OFFSIDES
1272	Urine osmolarity decreased			OFFSIDES
1273	Urine uric acid decreased			OFFSIDES
1274	Uterine Cancer			OFFSIDES
1275	Vascular Diseases		6463964 8313565	CTD
1276	Vascular calcification			OFFSIDES
1277	Vasculitis, Leukocytoclastic, Cutaneous		View details 502823 9739898 11072362 16089244	CTD
1278	Vasculitis		20337814	CTD
1279	Venoocclusive disease			OFFSIDES
1280	Venous Thromboembolism		View details 2658763 5041701 9570173 11762651 11827497 12131387 14712967 15156309 16313480 17764540 19625905 28689179	CTD
1281	Vertebral column mass			OFFSIDES
1282	Vertebrobasilar Insufficiency		1944711 9482190	CTD
1283	Wheelchair user			OFFSIDES
1284	Wound infection pseudomonas			OFFSIDES
1285	Wound infection staphylococcal			OFFSIDES
1286	anaphylaxis		15299161 19702217	CTD
1287	fibroma			OFFSIDES
1288	kyphosis			OFFSIDES
1289	prostatitis			OFFSIDES

Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329