Simvastatin
(RYMZZMVNJRMUDD-HGQWONQESA-N)
Structure
- SMILES
- CCC(C(=O)O[C@H]1C[C@@H](C)C=C2[C@H]1[C@@H](CC[C@@H]1C[C@@H](O)CC(=O)O1)[C@H](C=C2)C)(C)C
- Type(s)
- Approved
- ATC code(s)
- A10BH51; C10AA01; C10BA02; C10BA04; C10BX01; C10BX04
- Molecular Formula:
- C25H38O5
- Molecular Weight:
- 418.566
- Log P:
- 4.5856
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 1
- TPSA:
- 72.83
- CAS Number(s):
- 79902-63-9
Synonym(s)
1.
Simvastatin
2.
MK-733
3.
Synvinolin
4.
Zocor
5.
MK 733
6.
MK733
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Myalgia | FAERS: 1583 Canada Vigilance: 36 | 24593216 | CTD SIDER Canada Vigilance US FAERS |
| 2 | Rhabdomyolysis | FAERS: 942 Canada Vigilance: 5 |
2017280
9002485 9160078 10322565 10620105 11149552 11173785 12131698 12380704 14712320 15358990 15389652 16235714 16334740 16537817 17615423 18487263 18653432 19087798 19099134 19112232 19252767 19376416 20546290 20726676 21125536 24927617 25041770 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 3 | Fatigue | FAERS: 667 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 4 | Asthenia | FAERS: 489 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 5 | Arthralgia | FAERS: 446 Canada Vigilance: 6 | 24593216 | CTD SIDER Canada Vigilance US FAERS |
| 6 | Blood creatine phosphokinase increased | FAERS: 368 Canada Vigilance: 10 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 7 | Pain | FAERS: 334 Canada Vigilance: 4 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 8 | Quality of life decreased | FAERS: 279 | OFFSIDES US FAERS | |
| 9 | Headache | FAERS: 239 Canada Vigilance: 6 | 9856031 | CTD SIDER Canada Vigilance US FAERS |
| 10 | Dizziness | FAERS: 231 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 11 | Nausea | FAERS: 230 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 12 | Myopathy | FAERS: 205 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 13 | Psychiatric symptom | FAERS: 198 | US FAERS | |
| 14 | Activities of daily living impaired | FAERS: 179 | US FAERS | |
| 15 | Amnesia | FAERS: 175 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 16 | Impaired work ability | FAERS: 171 | US FAERS | |
| 17 | Feeling abnormal | FAERS: 170 | OFFSIDES SIDER US FAERS | |
| 18 | Drug ineffective | FAERS: 162 Canada Vigilance: 14 | Canada Vigilance OFFSIDES US FAERS | |
| 19 | Malaise | FAERS: 161 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 20 | Abdominal Pain | FAERS: 159 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 21 | Back Pain | FAERS: 159 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 22 | Myositis | FAERS: 149 | CTD US FAERS | |
| 23 | Vomiting | FAERS: 144 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 24 | Chest Pain | FAERS: 130 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 25 | Musculoskeletal Pain | FAERS: 125 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 26 | Myocardial Infarction | FAERS: 124 Canada Vigilance: 1 | 11742885 | CTD Canada Vigilance US FAERS |
| 27 | Pruritus | FAERS: 123 Canada Vigilance: 3 | 17806197 | CTD SIDER Canada Vigilance US FAERS |
| 28 | Memory impairment | FAERS: 117 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 29 | Adverse event | FAERS: 112 | US FAERS | |
| 30 | Musculoskeletal stiffness | FAERS: 103 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Frustration | FAERS: 101 | US FAERS | |
| 32 | Abasia | FAERS: 95 | US FAERS | |
| 33 | Flatulence | FAERS: 94 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 34 | Alopecia | FAERS: 91 Canada Vigilance: 4 | 1644096 | CTD SIDER Canada Vigilance US FAERS |
| 35 | Weight decreased | FAERS: 88 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 36 | Cerebrovascular accident | FAERS: 86 | US FAERS | |
| 37 | Constipation | FAERS: 85 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 38 | Alanine Aminotransferase Increased | FAERS: 79 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 39 | Aspartate Aminotransferase Increased | FAERS: 77 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 40 | Blood cholesterol increased | FAERS: 75 | US FAERS | |
| 41 | Hypersensitivity | FAERS: 73 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 42 | Blood creatinine increased | FAERS: 70 | OFFSIDES US FAERS | |
| 43 | Product substitution issue | FAERS: 65 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 44 | Lethargy | FAERS: 63 | US FAERS | |
| 45 | Urticaria | FAERS: 63 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 46 | Somnolence | FAERS: 62 | US FAERS | |
| 47 | Acute kidney injury | FAERS: 61 Canada Vigilance: 4 | CTD Canada Vigilance US FAERS | |
| 48 | Autoimmune hepatitis | FAERS: 57 | US FAERS | |
| 49 | muscle injury | FAERS: 57 | US FAERS | |
| 50 | Anxiety | FAERS: 55 | OFFSIDES SIDER US FAERS | |
| 51 | Burning sensation | FAERS: 54 | OFFSIDES US FAERS | |
| 52 | Flushing | FAERS: 54 | SIDER US FAERS | |
| 53 | Pharmaceutical product complaint | FAERS: 54 | US FAERS | |
| 54 | Diabetes Mellitus | FAERS: 53 | SIDER US FAERS | |
| 55 | Neck Pain | FAERS: 53 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 56 | Chromaturia | FAERS: 52 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 57 | Discomfort | FAERS: 52 | SIDER US FAERS | |
| 58 | Palpitations | FAERS: 52 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 59 | Tinnitus | FAERS: 52 | US FAERS | |
| 60 | Abdominal discomfort | FAERS: 51 Canada Vigilance: 8 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 61 | Joint swelling | FAERS: 51 | US FAERS | |
| 62 | Erectile dysfunction | FAERS: 47 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 63 | Chest discomfort | FAERS: 46 | US FAERS | |
| 64 | Arthritis | FAERS: 45 | SIDER US FAERS | |
| 65 | Dyspepsia | FAERS: 45 | OFFSIDES SIDER US FAERS | |
| 66 | Pancreatitis | FAERS: 44 | 2017280 | CTD SIDER US FAERS |
| 67 | Product quality issue | FAERS: 44 | US FAERS | |
| 68 | Tremor | FAERS: 43 | SIDER US FAERS | |
| 69 | Chills | FAERS: 39 | SIDER US FAERS | |
| 70 | Erythema | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 71 | Dehydration | FAERS: 36 | OFFSIDES US FAERS | |
| 72 | Dermatomyositis | FAERS: 35 | 8162495 18853127 | CTD SIDER US FAERS |
| 73 | Blood glucose increased | FAERS: 34 | US FAERS | |
| 74 | Hepatitis | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 75 | Pulmonary Fibrosis | FAERS: 32 | 19080365 24593216 | CTD US FAERS |
| 76 | Swelling | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 77 | Syncope | FAERS: 32 | US FAERS | |
| 78 | Amyotrophic Lateral Sclerosis | FAERS: 31 | US FAERS | |
| 79 | Restless Legs Syndrome | FAERS: 31 | US FAERS | |
| 80 | Medication Error | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Drug exposure during pregnancy | FAERS: 29 | US FAERS | |
| 82 | Hypotension | FAERS: 29 | 2571051 11676178 | CTD US FAERS |
| 83 | Blood urea increased | FAERS: 28 | US FAERS | |
| 84 | Depressed mood | FAERS: 28 | US FAERS | |
| 85 | Partner stress | FAERS: 27 | US FAERS | |
| 86 | Transaminases increased | FAERS: 27 | SIDER US FAERS | |
| 87 | Vasculitis | FAERS: 27 | SIDER US FAERS | |
| 88 | Limb discomfort | FAERS: 26 | OFFSIDES US FAERS | |
| 89 | Acute myocardial infarction | FAERS: 23 | OFFSIDES US FAERS | |
| 90 | Urinary tract infection | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 91 | Visual Impairment | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 92 | Dysuria | FAERS: 22 | US FAERS | |
| 93 | Hypothyroidism | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 94 | Respiratory distress | FAERS: 22 | US FAERS | |
| 95 | Asthma | FAERS: 21 | US FAERS | |
| 96 | Bone pain | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 97 | Emotional distress | FAERS: 21 | OFFSIDES US FAERS | |
| 98 | Inappropriate schedule of drug administration | FAERS: 21 | US FAERS | |
| 99 | Muscle necrosis | FAERS: 21 | OFFSIDES US FAERS | |
| 100 | Pneumonia | FAERS: 21 | US FAERS | |
| 101 | Blood lactate dehydrogenase increased | FAERS: 20 | US FAERS | |
| 102 | Hepatotoxicity | FAERS: 20 | US FAERS | |
| 103 | Myoglobin blood increased | FAERS: 20 | OFFSIDES US FAERS | |
| 104 | Polymyositis | FAERS: 20 | 9174565 24593216 | CTD US FAERS |
| 105 | Respiratory Failure | FAERS: 20 | US FAERS | |
| 106 | Stress | FAERS: 20 | US FAERS | |
| 107 | Unevaluable event | FAERS: 20 | US FAERS | |
| 108 | Cataract | FAERS: 19 | 12518039 | CTD SIDER US FAERS |
| 109 | Inspiratory capacity decreased | FAERS: 19 | US FAERS | |
| 110 | Muscle tightness | FAERS: 19 | US FAERS | |
| 111 | Necrotising myositis | FAERS: 19 | US FAERS | |
| 112 | Oliguria | FAERS: 19 | US FAERS | |
| 113 | Periarthritis | FAERS: 19 | US FAERS | |
| 114 | Sepsis | FAERS: 19 | US FAERS | |
| 115 | Angina Pectoris | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 116 | Arthropathy | FAERS: 18 | US FAERS | |
| 117 | Coronary Artery Disease | FAERS: 18 | CTD US FAERS | |
| 118 | Dry skin | FAERS: 18 | US FAERS | |
| 119 | Epistaxis | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 120 | Hypophagia | FAERS: 18 | US FAERS | |
| 121 | Inflammation | FAERS: 18 | CTD SIDER US FAERS | |
| 122 | Lip swelling | FAERS: 18 | US FAERS | |
| 123 | Overdose | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 124 | Quadriplegia | FAERS: 18 | US FAERS | |
| 125 | Wrong technique in drug usage process | FAERS: 18 | US FAERS | |
| 126 | jaundice | FAERS: 18 | 17806197 | CTD SIDER US FAERS |
| 127 | Fibromyalgia | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 128 | Gout | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 129 | Hypoxia | FAERS: 17 | US FAERS | |
| 130 | Low density lipoprotein increased | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 131 | Middle insomnia | FAERS: 17 | OFFSIDES US FAERS | |
| 132 | No adverse event | FAERS: 17 | US FAERS | |
| 133 | Peripheral swelling | FAERS: 17 | US FAERS | |
| 134 | Vertigo | FAERS: 17 | SIDER US FAERS | |
| 135 | Blood triglycerides increased | FAERS: 16 | US FAERS | |
| 136 | Carpal Tunnel Syndrome | FAERS: 16 | US FAERS | |
| 137 | Diplopia | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 138 | Dysphonia | FAERS: 16 | OFFSIDES US FAERS | |
| 139 | Mental status changes | FAERS: 16 | US FAERS | |
| 140 | Poor quality sleep | FAERS: 16 | US FAERS | |
| 141 | Accidental overdose | FAERS: 15 | US FAERS | |
| 142 | Ageusia | FAERS: 15 | US FAERS | |
| 143 | Dermatitis | FAERS: 15 | SIDER US FAERS | |
| 144 | Dysarthria | FAERS: 15 Canada Vigilance: 3 | 15596782 | CTD Canada Vigilance US FAERS |
| 145 | Mental impairment | FAERS: 15 | US FAERS | |
| 146 | Muscle strain | FAERS: 15 | US FAERS | |
| 147 | Polymyalgia Rheumatica | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 148 | Polyneuropathy | FAERS: 15 | SIDER US FAERS | |
| 149 | Rash erythematous | FAERS: 15 | US FAERS | |
| 150 | Rotator cuff syndrome | FAERS: 15 | US FAERS | |
| 151 | Angioedema | FAERS: 14 | OFFSIDES SIDER US FAERS | |
| 152 | Aphasia | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 153 | Blood urine present | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Deafness | FAERS: 14 | OFFSIDES US FAERS | |
| 155 | Eosinophilia | FAERS: 14 | SIDER US FAERS | |
| 156 | Muscle Cramp | FAERS: 14 | 23858814 | CTD US FAERS |
| 157 | Neuralgia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 158 | Renal tubular necrosis | FAERS: 14 | OFFSIDES US FAERS | |
| 159 | Completed Suicide | FAERS: 13 | US FAERS | |
| 160 | Dementia | FAERS: 13 | US FAERS | |
| 161 | Myasthenia Gravis | FAERS: 13 Canada Vigilance: 1 | 16609346 | CTD Canada Vigilance US FAERS |
| 162 | Nocturia | FAERS: 13 | US FAERS | |
| 163 | Therapeutic response unexpected with drug substitution | FAERS: 13 | US FAERS | |
| 164 | Anorexia | FAERS: 12 | SIDER US FAERS | |
| 165 | Atrial Fibrillation | FAERS: 12 | 12955433 15477401 | CTD SIDER US FAERS |
| 166 | Blood alkaline phosphatase increased | FAERS: 12 | SIDER US FAERS | |
| 167 | Depressed Level of Consciousness | FAERS: 12 | US FAERS | |
| 168 | Disseminated Intravascular Coagulation | FAERS: 12 | US FAERS | |
| 169 | Dysgeusia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 170 | Enteritis | FAERS: 12 | US FAERS | |
| 171 | General physical health deterioration | FAERS: 12 | OFFSIDES US FAERS | |
| 172 | Nervousness | FAERS: 12 | US FAERS | |
| 173 | Night sweats | FAERS: 12 | US FAERS | |
| 174 | Personality Change | FAERS: 12 | US FAERS | |
| 175 | Proteinuria | FAERS: 12 | 1672961 1978916 18004065 | CTD SIDER US FAERS |
| 176 | Toxicity to various agents | FAERS: 12 | US FAERS | |
| 177 | Drug dose omission | FAERS: 11 | US FAERS | |
| 178 | Drug toxicity | FAERS: 11 | US FAERS | |
| 179 | Eye pain | FAERS: 11 | US FAERS | |
| 180 | Glycogen Storage Disease Type V | FAERS: 11 | US FAERS | |
| 181 | Idiopathic Pulmonary Fibrosis | FAERS: 11 | US FAERS | |
| 182 | Impaired driving ability | FAERS: 11 | US FAERS | |
| 183 | Joint stiffness | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 184 | Muscle Fatigue | FAERS: 11 | OFFSIDES US FAERS | |
| 185 | Muscle Rigidity | FAERS: 11 | US FAERS | |
| 186 | Nerve injury | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 187 | Pneumonitis | FAERS: 11 | US FAERS | |
| 188 | Restlessness | FAERS: 11 | US FAERS | |
| 189 | Septic Shock | FAERS: 11 | US FAERS | |
| 190 | Skin irritation | FAERS: 11 | US FAERS | |
| 191 | Subcutaneous Abscess | FAERS: 11 | US FAERS | |
| 192 | Symptom masked | FAERS: 11 | US FAERS | |
| 193 | Thrombocytopenia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 194 | Urinary Retention | FAERS: 11 | US FAERS | |
| 195 | Wrong technique in product usage process | FAERS: 11 | US FAERS | |
| 196 | nervous system disorder | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 197 | Abdominal rigidity | FAERS: 10 | US FAERS | |
| 198 | Acute psychosis | FAERS: 10 | US FAERS | |
| 199 | Aphonia | FAERS: 10 | US FAERS | |
| 200 | Blood creatine phosphokinase MB increased | FAERS: 10 | US FAERS | |
| 201 | Drug dispensing error | FAERS: 10 | US FAERS | |
| 202 | Exfoliative rash | FAERS: 10 | US FAERS | |
| 203 | Incorrect dose administered | FAERS: 10 | US FAERS | |
| 204 | Joint Instability | FAERS: 10 | US FAERS | |
| 205 | Malabsorption | FAERS: 10 | US FAERS | |
| 206 | Myelitis | FAERS: 10 | US FAERS | |
| 207 | Pregnancy | FAERS: 10 | SIDER US FAERS | |
| 208 | Product taste abnormal | FAERS: 10 | US FAERS | |
| 209 | Psoriasis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 210 | Spinal column stenosis | FAERS: 10 | US FAERS | |
| 211 | Tachycardia | FAERS: 10 | US FAERS | |
| 212 | Unresponsive to stimuli | FAERS: 10 | US FAERS | |
| 213 | Anhedonia | FAERS: 9 | OFFSIDES US FAERS | |
| 214 | Aortic Aneurysm | FAERS: 9 | 16414398 | CTD OFFSIDES US FAERS |
| 215 | Atrial tachycardia | FAERS: 9 | US FAERS | |
| 216 | Blood potassium decreased | FAERS: 9 | US FAERS | |
| 217 | Central pain syndrome | FAERS: 9 | US FAERS | |
| 218 | Cholelithiasis | FAERS: 9 | US FAERS | |
| 219 | Ectopic Pregnancy | FAERS: 9 | US FAERS | |
| 220 | Formication | FAERS: 9 | OFFSIDES US FAERS | |
| 221 | Hepatorenal Syndrome | FAERS: 9 | US FAERS | |
| 222 | Hypersomnia | FAERS: 9 | US FAERS | |
| 223 | Monoplegia | FAERS: 9 | US FAERS | |
| 224 | Muscle enzyme increased | FAERS: 9 | US FAERS | |
| 225 | Musculoskeletal discomfort | FAERS: 9 | SIDER US FAERS | |
| 226 | Nephrolithiasis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 227 | Ophthalmoplegia | FAERS: 9 | SIDER US FAERS | |
| 228 | Pleurisy | FAERS: 9 | US FAERS | |
| 229 | Productive Cough | FAERS: 9 | US FAERS | |
| 230 | Sinusitis | FAERS: 9 | SIDER US FAERS | |
| 231 | Skin necrosis | FAERS: 9 | US FAERS | |
| 232 | Skin reaction | FAERS: 9 | US FAERS | |
| 233 | Synovitis | FAERS: 9 | US FAERS | |
| 234 | Urinary Incontinence | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 235 | Agitation | FAERS: 8 | US FAERS | |
| 236 | Anger | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 237 | Aphagia | FAERS: 8 | US FAERS | |
| 238 | Bradycardia | FAERS: 8 | OFFSIDES US FAERS | |
| 239 | Crying | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 240 | Denervation atrophy | FAERS: 8 | US FAERS | |
| 241 | Disorientation | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 242 | Dyspareunia | FAERS: 8 | US FAERS | |
| 243 | Gait inability | FAERS: 8 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 244 | Gastrointestinal carcinoma | FAERS: 8 | US FAERS | |
| 245 | Hypertensive crisis | FAERS: 8 | US FAERS | |
| 246 | Infection | FAERS: 8 | SIDER US FAERS | |
| 247 | Influenza | FAERS: 8 | US FAERS | |
| 248 | Inhibitory drug interaction | FAERS: 8 | US FAERS | |
| 249 | Initial insomnia | FAERS: 8 | US FAERS | |
| 250 | Loose tooth | FAERS: 8 | US FAERS | |
| 251 | Malignant neoplasm progression | FAERS: 8 | US FAERS | |
| 252 | Metabolic acidosis | FAERS: 8 | US FAERS | |
| 253 | Multiple Myeloma | FAERS: 8 | OFFSIDES US FAERS | |
| 254 | Painful ejaculation | FAERS: 8 | US FAERS | |
| 255 | Palindromic rheumatism | FAERS: 8 | US FAERS | |
| 256 | Renal cyst | FAERS: 8 | US FAERS | |
| 257 | Renal pain | FAERS: 8 | US FAERS | |
| 258 | Scleroderma | FAERS: 8 | US FAERS | |
| 259 | Transmission of drug via semen | FAERS: 8 | US FAERS | |
| 260 | Wrong drug administered | FAERS: 8 | US FAERS | |
| 261 | Anuria | FAERS: 7 | US FAERS | |
| 262 | Bursitis | FAERS: 7 | US FAERS | |
| 263 | Cardiac Arrest | FAERS: 7 | US FAERS | |
| 264 | Cardiac Flutter | FAERS: 7 | US FAERS | |
| 265 | Cholestasis | FAERS: 7 | 1857844 | CTD US FAERS |
| 266 | Deep Vein Thrombosis | FAERS: 7 | US FAERS | |
| 267 | Diplegia | FAERS: 7 | US FAERS | |
| 268 | Drug administration error | FAERS: 7 | US FAERS | |
| 269 | Eczema | FAERS: 7 | SIDER US FAERS | |
| 270 | Fracture | FAERS: 7 | US FAERS | |
| 271 | Hypokinesia | FAERS: 7 | US FAERS | |
| 272 | Hypomania | FAERS: 7 | US FAERS | |
| 273 | Joint sprain | FAERS: 7 | US FAERS | |
| 274 | Leukocytosis | FAERS: 7 | US FAERS | |
| 275 | Lipids abnormal | FAERS: 7 | US FAERS | |
| 276 | Maternal exposure during pregnancy | FAERS: 7 | US FAERS | |
| 277 | Mood swings | FAERS: 7 | US FAERS | |
| 278 | Petechiae | FAERS: 7 | US FAERS | |
| 279 | Pulmonary Embolism | FAERS: 7 | US FAERS | |
| 280 | Respiratory fatigue | FAERS: 7 | US FAERS | |
| 281 | Sciatica | FAERS: 7 | US FAERS | |
| 282 | Skin lesion | FAERS: 7 | US FAERS | |
| 283 | Snoring | FAERS: 7 | OFFSIDES US FAERS | |
| 284 | Tenosynovitis | FAERS: 7 | US FAERS | |
| 285 | Thrombocytopenic purpura | FAERS: 7 | US FAERS | |
| 286 | Vulvovaginal discomfort | FAERS: 7 | US FAERS | |
| 287 | Antiphospholipid antibodies positive | FAERS: 6 | US FAERS | |
| 288 | Blindness | FAERS: 6 | US FAERS | |
| 289 | Blood creatine increased | FAERS: 6 | OFFSIDES US FAERS | |
| 290 | Blood creatine phosphokinase abnormal | FAERS: 6 | US FAERS | |
| 291 | Blood potassium increased | FAERS: 6 | OFFSIDES US FAERS | |
| 292 | Bronchiolitis | FAERS: 6 | US FAERS | |
| 293 | Cerebellar Ataxia | FAERS: 6 | US FAERS | |
| 294 | Choking | FAERS: 6 | OFFSIDES US FAERS | |
| 295 | Chronic sinusitis | FAERS: 6 | US FAERS | |
| 296 | Deafness Neurosensory | FAERS: 6 | US FAERS | |
| 297 | Disability | FAERS: 6 | US FAERS | |
| 298 | Febrile Neutropenia | FAERS: 6 | US FAERS | |
| 299 | Flank Pain | FAERS: 6 | US FAERS | |
| 300 | Gamma-Glutamyltransferase Increased | FAERS: 6 | US FAERS | |
| 301 | Gastritis | FAERS: 6 | SIDER US FAERS | |
| 302 | Guillain-Barre Syndrome | FAERS: 6 | 15389662 | CTD US FAERS |
| 303 | Hepatic necrosis | FAERS: 6 | SIDER US FAERS | |
| 304 | Lichen Planus | FAERS: 6 | US FAERS | |
| 305 | Multiple Sclerosis | FAERS: 6 | US FAERS | |
| 306 | Nodular rash | FAERS: 6 | US FAERS | |
| 307 | Nodule | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 308 | Oropharyngeal pain | FAERS: 6 | OFFSIDES US FAERS | |
| 309 | Pancytopenia | FAERS: 6 | US FAERS | |
| 310 | Product use in unapproved indication | FAERS: 6 | US FAERS | |
| 311 | Sick Sinus Syndrome | FAERS: 6 | US FAERS | |
| 312 | Sinus bradycardia | FAERS: 6 | US FAERS | |
| 313 | Walking aid user | FAERS: 6 | US FAERS | |
| 314 | keratoacanthoma | FAERS: 6 | US FAERS | |
| 315 | Antinuclear antibody increased | FAERS: 5 | US FAERS | |
| 316 | Ataxia | FAERS: 5 | 20331937 | CTD US FAERS |
| 317 | Back disorder | FAERS: 5 | US FAERS | |
| 318 | Basal cell carcinoma | FAERS: 5 | US FAERS | |
| 319 | Blood bilirubin abnormal | FAERS: 5 | US FAERS | |
| 320 | Crush syndrome | FAERS: 5 | US FAERS | |
| 321 | Delusional disorder, persecutory type | FAERS: 5 | US FAERS | |
| 322 | Dental discomfort | FAERS: 5 | US FAERS | |
| 323 | Dissociation | FAERS: 5 | US FAERS | |
| 324 | Diverticulum | FAERS: 5 | US FAERS | |
| 325 | Drug prescribing error | FAERS: 5 | US FAERS | |
| 326 | Drug screen positive | FAERS: 5 | US FAERS | |
| 327 | Economic problem | FAERS: 5 | OFFSIDES US FAERS | |
| 328 | Eosinophilic Fasciitis | FAERS: 5 | US FAERS | |
| 329 | Eosinophilic Pneumonia | FAERS: 5 | US FAERS | |
| 330 | Eosinophilic pleural effusion | FAERS: 5 | US FAERS | |
| 331 | Hyperthyroidism | FAERS: 5 | US FAERS | |
| 332 | Hypoventilation | FAERS: 5 | US FAERS | |
| 333 | Immune-mediated adverse reaction | FAERS: 5 | US FAERS | |
| 334 | Impatience | FAERS: 5 | US FAERS | |
| 335 | Incontinence | FAERS: 5 | US FAERS | |
| 336 | Lipase increased | FAERS: 5 | US FAERS | |
| 337 | Malignant lymphoid neoplasm | FAERS: 5 | US FAERS | |
| 338 | Muscular Dystrophy | FAERS: 5 | US FAERS | |
| 339 | Nasopharyngitis | FAERS: 5 | OFFSIDES US FAERS | |
| 340 | Neuropathy | FAERS: 5 | US FAERS | |
| 341 | Onychoclasis | FAERS: 5 | US FAERS | |
| 342 | Onychomycosis | FAERS: 5 | US FAERS | |
| 343 | Osteopenia | FAERS: 5 | OFFSIDES US FAERS | |
| 344 | Osteoporosis | FAERS: 5 | OFFSIDES US FAERS | |
| 345 | Otitis Externa | FAERS: 5 | US FAERS | |
| 346 | Paranoia | FAERS: 5 | US FAERS | |
| 347 | Performance status decreased | FAERS: 5 | US FAERS | |
| 348 | Platelet count abnormal | FAERS: 5 | US FAERS | |
| 349 | Post procedural complication | FAERS: 5 | US FAERS | |
| 350 | Purpura | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 351 | Sinus polyp | FAERS: 5 | US FAERS | |
| 352 | Skin Ulcer | FAERS: 5 | US FAERS | |
| 353 | Spontaneous penile erection | FAERS: 5 | US FAERS | |
| 354 | Sternal injury | FAERS: 5 | US FAERS | |
| 355 | Stomatitis | FAERS: 5 | US FAERS | |
| 356 | Therapeutic response unexpected | FAERS: 5 | US FAERS | |
| 357 | Troponin increased | FAERS: 5 | US FAERS | |
| 358 | Ubiquinone decreased | FAERS: 5 | US FAERS | |
| 359 | Angioplasty | FAERS: 4 | US FAERS | |
| 360 | Antiphospholipid Syndrome | FAERS: 4 | US FAERS | |
| 361 | Arteriosclerosis | FAERS: 4 | OFFSIDES US FAERS | |
| 362 | Bedridden | FAERS: 4 | US FAERS | |
| 363 | Blood glucose abnormal | FAERS: 4 | US FAERS | |
| 364 | Blood magnesium decreased | FAERS: 4 | US FAERS | |
| 365 | Blood pressure immeasurable | FAERS: 4 | US FAERS | |
| 366 | Blood sodium decreased | FAERS: 4 | US FAERS | |
| 367 | Blood testosterone decreased | FAERS: 4 | US FAERS | |
| 368 | Cardiac discomfort | FAERS: 4 | US FAERS | |
| 369 | Cerebellar infarction | FAERS: 4 | US FAERS | |
| 370 | Complications of maternal exposure to therapeutic drugs | FAERS: 4 | US FAERS | |
| 371 | Congenital brain damage | FAERS: 4 | US FAERS | |
| 372 | Diabetes mellitus inadequate control | FAERS: 4 | US FAERS | |
| 373 | Diverticulitis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 374 | Exposure via body fluid | FAERS: 4 | US FAERS | |
| 375 | Feeling Cold | FAERS: 4 | US FAERS | |
| 376 | Immobile | FAERS: 4 | US FAERS | |
| 377 | Impaired quality of life | FAERS: 4 | US FAERS | |
| 378 | Increased tendency to bruise | FAERS: 4 | US FAERS | |
| 379 | Intentional drug misuse | FAERS: 4 | US FAERS | |
| 380 | Intentional product use issue | FAERS: 4 | US FAERS | |
| 381 | Intervertebral Disc Degeneration | FAERS: 4 | 19912653 | CTD OFFSIDES US FAERS |
| 382 | Joint Range of Motion Decreased | FAERS: 4 | US FAERS | |
| 383 | Ligament rupture | FAERS: 4 | US FAERS | |
| 384 | Lower respiratory tract infection | FAERS: 4 | US FAERS | |
| 385 | Lupus-like syndrome | FAERS: 4 | SIDER US FAERS | |
| 386 | Myoglobin urine present | FAERS: 4 | US FAERS | |
| 387 | Myoglobinuria | FAERS: 4 | 18819764 19099134 | CTD US FAERS |
| 388 | Pemphigus | FAERS: 4 | US FAERS | |
| 389 | Photophobia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 390 | Priapism | FAERS: 4 | US FAERS | |
| 391 | Product availability issue | FAERS: 4 | US FAERS | |
| 392 | Renal Cell Carcinoma | FAERS: 4 | US FAERS | |
| 393 | Sexual Dysfunction | FAERS: 4 | SIDER US FAERS | |
| 394 | Skin Induration | FAERS: 4 | OFFSIDES US FAERS | |
| 395 | Sluggishness | FAERS: 4 | US FAERS | |
| 396 | Sneezing | FAERS: 4 | US FAERS | |
| 397 | Wheelchair user | FAERS: 4 | US FAERS | |
| 398 | Wheezing | FAERS: 4 | US FAERS | |
| 399 | White blood cell count decreased | FAERS: 4 | US FAERS | |
| 400 | treatment failure | FAERS: 4 | US FAERS | |
| 401 | Acute Coronary Syndrome | FAERS: 3 | OFFSIDES US FAERS | |
| 402 | Aldolase increased | FAERS: 3 | US FAERS | |
| 403 | Alopecia Areata | FAERS: 3 | US FAERS | |
| 404 | Alopecia totalis | FAERS: 3 | US FAERS | |
| 405 | Anaphylactic shock | FAERS: 3 | SIDER US FAERS | |
| 406 | Atrioventricular Block | FAERS: 3 | US FAERS | |
| 407 | Biopsy muscle abnormal | FAERS: 3 | US FAERS | |
| 408 | Blood albumin decreased | FAERS: 3 | US FAERS | |
| 409 | Blood alkaline phosphatase abnormal | FAERS: 3 | US FAERS | |
| 410 | Cellulitis | FAERS: 3 | OFFSIDES US FAERS | |
| 411 | Cold sweat | FAERS: 3 | US FAERS | |
| 412 | Colitis | FAERS: 3 | 17178392 | CTD US FAERS |
| 413 | Cutaneous T-cell dyscrasia | FAERS: 3 | US FAERS | |
| 414 | Device malfunction | FAERS: 3 | OFFSIDES US FAERS | |
| 415 | Disease Progression | FAERS: 3 | US FAERS | |
| 416 | Drug level increased | FAERS: 3 | US FAERS | |
| 417 | Ecchymosis | FAERS: 3 | US FAERS | |
| 418 | Enzyme abnormality | FAERS: 3 | US FAERS | |
| 419 | Epicondylitis | FAERS: 3 | US FAERS | |
| 420 | Erythema Nodosum | FAERS: 3 | US FAERS | |
| 421 | Flat affect | FAERS: 3 | US FAERS | |
| 422 | Fluid overload | FAERS: 3 | OFFSIDES US FAERS | |
| 423 | Food Poisoning | FAERS: 3 | US FAERS | |
| 424 | Gastric ulcer | FAERS: 3 | US FAERS | |
| 425 | General symptom | FAERS: 3 | US FAERS | |
| 426 | Gingivitis | FAERS: 3 | US FAERS | |
| 427 | Global Amnesia | FAERS: 3 | US FAERS | |
| 428 | Grip strength decreased | FAERS: 3 | US FAERS | |
| 429 | Hepatitis C | FAERS: 3 | US FAERS | |
| 430 | Hepatomegaly | FAERS: 3 Canada Vigilance: 1 | 28108177 | CTD Canada Vigilance US FAERS |
| 431 | Hyperacusis | FAERS: 3 | US FAERS | |
| 432 | Hypertransaminasaemia | FAERS: 3 | OFFSIDES US FAERS | |
| 433 | Hyporeflexia | FAERS: 3 | US FAERS | |
| 434 | Hypotonic urinary bladder | FAERS: 3 | US FAERS | |
| 435 | Joint injury | FAERS: 3 | US FAERS | |
| 436 | Mitochondrial toxicity | FAERS: 3 | US FAERS | |
| 437 | Myosclerosis | FAERS: 3 | US FAERS | |
| 438 | Myotonia | FAERS: 3 | US FAERS | |
| 439 | Nephrotic Syndrome | FAERS: 3 | 10444806 | CTD US FAERS |
| 440 | Neuritis | FAERS: 3 | US FAERS | |
| 441 | Neutropenic sepsis | FAERS: 3 | US FAERS | |
| 442 | Panic Disorder | FAERS: 3 | US FAERS | |
| 443 | Parakeratosis | FAERS: 3 | US FAERS | |
| 444 | Peripheral paralysis | FAERS: 3 | US FAERS | |
| 445 | Peroneal nerve injury | FAERS: 3 | US FAERS | |
| 446 | Pharyngolaryngeal Pain | FAERS: 3 | US FAERS | |
| 447 | Poisoning | FAERS: 3 | US FAERS | |
| 448 | Product use issue | FAERS: 3 | US FAERS | |
| 449 | Quadriparesis | FAERS: 3 | US FAERS | |
| 450 | Restrictive pulmonary disease | FAERS: 3 | US FAERS | |
| 451 | Retinal Detachment | FAERS: 3 | US FAERS | |
| 452 | Rheumatoid Arthritis | FAERS: 3 | US FAERS | |
| 453 | Rhinitis | FAERS: 3 | US FAERS | |
| 454 | Secretion discharge | FAERS: 3 | US FAERS | |
| 455 | Serositis | FAERS: 3 | US FAERS | |
| 456 | Stevens-Johnson Syndrome | FAERS: 3 | 25811541 | CTD SIDER US FAERS |
| 457 | Stress at work | FAERS: 3 | US FAERS | |
| 458 | Suicide attempt | FAERS: 3 | US FAERS | |
| 459 | Systemic Inflammatory Response Syndrome | FAERS: 3 | US FAERS | |
| 460 | Throat irritation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 461 | Thyroid Neoplasm | FAERS: 3 | US FAERS | |
| 462 | Toothache | FAERS: 3 | US FAERS | |
| 463 | Unmasking of previously unidentified disease | FAERS: 3 | US FAERS | |
| 464 | Urine output increased | FAERS: 3 | US FAERS | |
| 465 | Visual disturbance | FAERS: 3 | US FAERS | |
| 466 | Vitiligo | FAERS: 3 | US FAERS | |
| 467 | Abdominal tenderness | FAERS: 2 | US FAERS | |
| 468 | Amylase increased | FAERS: 2 | US FAERS | |
| 469 | Anaphylactoid Reaction | FAERS: 2 | US FAERS | |
| 470 | Anosmia | FAERS: 2 | US FAERS | |
| 471 | Apathy | FAERS: 2 | OFFSIDES US FAERS | |
| 472 | Appendicitis | FAERS: 2 | US FAERS | |
| 473 | Ascites | FAERS: 2 | US FAERS | |
| 474 | Aspartate aminotransferase abnormal | FAERS: 2 | US FAERS | |
| 475 | Benign Prostatic Hyperplasia | FAERS: 2 | US FAERS | |
| 476 | Bicuspid aortic valve | FAERS: 2 | US FAERS | |
| 477 | Bladder pain | FAERS: 2 | US FAERS | |
| 478 | Blood cholesterol abnormal | FAERS: 2 | US FAERS | |
| 479 | Blood creatine phosphokinase MB abnormal | FAERS: 2 | US FAERS | |
| 480 | Blood glucose decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 481 | Blood glucose fluctuation | FAERS: 2 | US FAERS | |
| 482 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 483 | Blood thyroid stimulating hormone increased | FAERS: 2 | OFFSIDES US FAERS | |
| 484 | Bronchitis | FAERS: 2 | SIDER US FAERS | |
| 485 | Candidiasis | FAERS: 2 | US FAERS | |
| 486 | Cardiac enzymes increased | FAERS: 2 | US FAERS | |
| 487 | Cataract operation | FAERS: 2 | US FAERS | |
| 488 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 489 | Cerebral hyperperfusion syndrome | FAERS: 2 | US FAERS | |
| 490 | Cervical myelopathy | FAERS: 2 | US FAERS | |
| 491 | Cheilitis | FAERS: 2 | US FAERS | |
| 492 | Cholestatic liver injury | FAERS: 2 | OFFSIDES US FAERS | |
| 493 | Chronic Fatigue Syndrome | FAERS: 2 | US FAERS | |
| 494 | Chylothorax | FAERS: 2 | US FAERS | |
| 495 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 496 | Cleft Palate | FAERS: 2 | US FAERS | |
| 497 | Clostridium difficile colitis | FAERS: 2 | US FAERS | |
| 498 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 499 | Coronary angioplasty | FAERS: 2 | US FAERS | |
| 500 | Cyst | FAERS: 2 | US FAERS | |
| 501 | Demyelination | FAERS: 2 | OFFSIDES US FAERS | |
| 502 | Diabetic Ketoacidosis | FAERS: 2 | US FAERS | |
| 503 | Drug Tolerance | FAERS: 2 | US FAERS | |
| 504 | Drug clearance decreased | FAERS: 2 | US FAERS | |
| 505 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 506 | Drug level above therapeutic | FAERS: 2 | US FAERS | |
| 507 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 508 | Duodenal Ulcer | FAERS: 2 | US FAERS | |
| 509 | Dysgraphia | FAERS: 2 | US FAERS | |
| 510 | Dysphasia | FAERS: 2 | US FAERS | |
| 511 | Ear congestion | FAERS: 2 | US FAERS | |
| 512 | Early satiety | FAERS: 2 | US FAERS | |
| 513 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 514 | Emotional disorder | FAERS: 2 | US FAERS | |
| 515 | Epidermal necrosis | FAERS: 2 | US FAERS | |
| 516 | Euphoric mood | FAERS: 2 | US FAERS | |
| 517 | Exposure via father | FAERS: 2 | US FAERS | |
| 518 | Folliculitis | FAERS: 2 | US FAERS | |
| 519 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 520 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 521 | Gastrointestinal motility disorder | FAERS: 2 | US FAERS | |
| 522 | Glycogen storage disease type II | FAERS: 2 | US FAERS | |
| 523 | Hepatitis B | FAERS: 2 | US FAERS | |
| 524 | Hyperventilation | FAERS: 2 | US FAERS | |
| 525 | Ileal ulcer | FAERS: 2 | US FAERS | |
| 526 | Impaired self-care | FAERS: 2 | US FAERS | |
| 527 | Incoherent | FAERS: 2 | US FAERS | |
| 528 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 529 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 530 | Insulin Resistance | FAERS: 2 | US FAERS | |
| 531 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 532 | Irregular breathing | FAERS: 2 | US FAERS | |
| 533 | Limb injury | FAERS: 2 | US FAERS | |
| 534 | Low birth weight baby | FAERS: 2 | US FAERS | |
| 535 | Lymphomatoid Papulosis | FAERS: 2 | US FAERS | |
| 536 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 537 | Medication residue present | FAERS: 2 | US FAERS | |
| 538 | Mitochondrial myopathy acquired | FAERS: 2 | US FAERS | |
| 539 | Mucosal atrophy | FAERS: 2 | US FAERS | |
| 540 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 541 | Myocardial necrosis marker increased | FAERS: 2 | US FAERS | |
| 542 | Nipple pain | FAERS: 2 | US FAERS | |
| 543 | No adverse effect | FAERS: 2 | US FAERS | |
| 544 | Non-cardiac chest pain | FAERS: 2 | US FAERS | |
| 545 | Ocular icterus | FAERS: 2 | OFFSIDES US FAERS | |
| 546 | Onychalgia | FAERS: 2 | US FAERS | |
| 547 | Optic Neuropathy | FAERS: 2 | US FAERS | |
| 548 | Oropharyngeal blistering | FAERS: 2 | US FAERS | |
| 549 | Osteomyelitis | FAERS: 2 | OFFSIDES US FAERS | |
| 550 | Pain of skin | FAERS: 2 | US FAERS | |
| 551 | Pallor | FAERS: 2 | OFFSIDES US FAERS | |
| 552 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 553 | Patent ductus arteriosus | FAERS: 2 | US FAERS | |
| 554 | Pelvic Pain | FAERS: 2 | US FAERS | |
| 555 | Peptic Ulcer | FAERS: 2 | US FAERS | |
| 556 | Peripheral embolism | FAERS: 2 | US FAERS | |
| 557 | Pleuropericarditis | FAERS: 2 | US FAERS | |
| 558 | Polyuria | FAERS: 2 | OFFSIDES US FAERS | |
| 559 | Presyncope | FAERS: 2 | US FAERS | |
| 560 | Product counterfeit | FAERS: 2 | US FAERS | |
| 561 | Rebound effect | FAERS: 2 | US FAERS | |
| 562 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 563 | Retinal Artery Occlusion | FAERS: 2 | US FAERS | |
| 564 | Retrograde amnesia | FAERS: 2 | US FAERS | |
| 565 | Shock | FAERS: 2 | US FAERS | |
| 566 | Similar reaction on previous exposure to drug | FAERS: 2 | US FAERS | |
| 567 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 568 | Sinus headache | FAERS: 2 | US FAERS | |
| 569 | Sleep disorder due to general medical condition, insomnia type | FAERS: 2 | US FAERS | |
| 570 | Spinal fusion surgery | FAERS: 2 | US FAERS | |
| 571 | Sudden death | FAERS: 2 | US FAERS | |
| 572 | Sudden onset of sleep | FAERS: 2 | US FAERS | |
| 573 | Temperature regulation disorder | FAERS: 2 | US FAERS | |
| 574 | Therapeutic product contamination | FAERS: 2 | US FAERS | |
| 575 | Therapy change | FAERS: 2 | US FAERS | |
| 576 | Thrombosis | FAERS: 2 | 16689755 | CTD US FAERS |
| 577 | Tongue discomfort | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 578 | Trismus | FAERS: 2 | US FAERS | |
| 579 | Vascular rupture | FAERS: 2 | US FAERS | |
| 580 | Venous thrombosis limb | FAERS: 2 | US FAERS | |
| 581 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 582 | Wound Infection | FAERS: 2 | US FAERS | |
| 583 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 584 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 585 | Abscess | FAERS: 1 | US FAERS | |
| 586 | Acanthosis | FAERS: 1 | US FAERS | |
| 587 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 588 | Accidental exposure | FAERS: 1 | US FAERS | |
| 589 | Acidosis | FAERS: 1 | US FAERS | |
| 590 | Acne | FAERS: 1 | US FAERS | |
| 591 | Acromegaly | FAERS: 1 | US FAERS | |
| 592 | Acute respiratory failure | FAERS: 1 | OFFSIDES US FAERS | |
| 593 | Acute sinusitis | FAERS: 1 | US FAERS | |
| 594 | Adjustment disorder with mixed anxiety and depressed mood | FAERS: 1 | US FAERS | |
| 595 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 596 | Alanine aminotransferase decreased | FAERS: 1 | US FAERS | |
| 597 | Allergy to arthropod bite | FAERS: 1 | US FAERS | |
| 598 | Allergy to arthropod sting | FAERS: 1 | US FAERS | |
| 599 | Amaurosis Fugax | FAERS: 1 | US FAERS | |
| 600 | Ammonia increased | FAERS: 1 | US FAERS | |
| 601 | Anal Fissure | FAERS: 1 | US FAERS | |
| 602 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 603 | Aneurysm | FAERS: 1 | US FAERS | |
| 604 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 605 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 606 | Anorgasmia | FAERS: 1 | US FAERS | |
| 607 | Anti-HBc IgG antibody positive | FAERS: 1 | US FAERS | |
| 608 | Antibody test positive | FAERS: 1 | US FAERS | |
| 609 | Anticonvulsant drug level increased | FAERS: 1 | US FAERS | |
| 610 | Aortic valve calcification | FAERS: 1 | US FAERS | |
| 611 | Apparent death | FAERS: 1 | US FAERS | |
| 612 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 613 | Arterial Injury | FAERS: 1 | US FAERS | |
| 614 | Arteriovenous fistula | FAERS: 1 | US FAERS | |
| 615 | Arthropod bite | FAERS: 1 | US FAERS | |
| 616 | Asphyxia | FAERS: 1 | US FAERS | |
| 617 | Atelectasis | FAERS: 1 | OFFSIDES US FAERS | |
| 618 | Atrial Flutter | FAERS: 1 | OFFSIDES US FAERS | |
| 619 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 620 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 621 | Axonal neuropathy | FAERS: 1 | US FAERS | |
| 622 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 623 | Beta-2 glycoprotein antibody positive | FAERS: 1 | US FAERS | |
| 624 | Biliary Colic | FAERS: 1 | US FAERS | |
| 625 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 626 | Blood albumin abnormal | FAERS: 1 | US FAERS | |
| 627 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 628 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 629 | Blood creatine phosphokinase BB increased | FAERS: 1 | US FAERS | |
| 630 | Blood creatine phosphokinase MB | FAERS: 1 | US FAERS | |
| 631 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 632 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 633 | Blood immunoglobulin A increased | FAERS: 1 | OFFSIDES US FAERS | |
| 634 | Blood immunoglobulin G increased | FAERS: 1 | US FAERS | |
| 635 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 636 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 637 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 638 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 639 | Blood testosterone abnormal | FAERS: 1 | US FAERS | |
| 640 | Blood uric acid abnormal | FAERS: 1 | US FAERS | |
| 641 | Blue Toe Syndrome | FAERS: 1 | US FAERS | |
| 642 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 643 | Brain Death | FAERS: 1 | US FAERS | |
| 644 | Breast tenderness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 645 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 646 | Bunion | FAERS: 1 | US FAERS | |
| 647 | Burning Mouth Syndrome | FAERS: 1 | US FAERS | |
| 648 | C-reactive protein | FAERS: 1 | US FAERS | |
| 649 | Cachexia | FAERS: 1 | US FAERS | |
| 650 | Carcinoma | FAERS: 1 | US FAERS | |
| 651 | Carotid Endarterectomy | FAERS: 1 | US FAERS | |
| 652 | Carotid artery occlusion | FAERS: 1 | OFFSIDES US FAERS | |
| 653 | Catheter sepsis | FAERS: 1 | US FAERS | |
| 654 | Caudal Regression Syndrome | FAERS: 1 | US FAERS | |
| 655 | Cerebral vasoconstriction | FAERS: 1 | US FAERS | |
| 656 | Choking sensation | FAERS: 1 | OFFSIDES US FAERS | |
| 657 | Cholecystitis | FAERS: 1 | US FAERS | |
| 658 | Chondrosarcoma | FAERS: 1 | US FAERS | |
| 659 | Cluster Headache | FAERS: 1 | US FAERS | |
| 660 | Cognitive deterioration | FAERS: 1 | US FAERS | |
| 661 | Compression fracture | FAERS: 1 | US FAERS | |
| 662 | Congenital choroid plexus cyst | FAERS: 1 | US FAERS | |
| 663 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 664 | Congenital hydronephrosis | FAERS: 1 | US FAERS | |
| 665 | Contracted bladder | FAERS: 1 | US FAERS | |
| 666 | Contraindicated drug prescribed | FAERS: 1 | US FAERS | |
| 667 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 668 | Coronary vascular graft occlusion | FAERS: 1 | US FAERS | |
| 669 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 670 | Cyanosis | FAERS: 1 | US FAERS | |
| 671 | Cystitis | FAERS: 1 | US FAERS | |
| 672 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 673 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 674 | Delusional disorder, somatic type | FAERS: 1 | US FAERS | |
| 675 | Dental alveolar anomaly | FAERS: 1 | US FAERS | |
| 676 | Dental caries | FAERS: 1 | US FAERS | |
| 677 | Device occlusion | FAERS: 1 | OFFSIDES US FAERS | |
| 678 | Device related sepsis | FAERS: 1 | US FAERS | |
| 679 | Diabetic Nephropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 680 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 681 | Disease recurrence | FAERS: 1 | US FAERS | |
| 682 | Disease risk factor | FAERS: 1 | US FAERS | |
| 683 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 684 | Double stranded DNA antibody positive | FAERS: 1 | US FAERS | |
| 685 | Drooling | FAERS: 1 | US FAERS | |
| 686 | Drug Dependence | FAERS: 1 | US FAERS | |
| 687 | Drug dose titration not performed | FAERS: 1 | US FAERS | |
| 688 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 689 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 690 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 691 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 692 | Drug-disease interaction | FAERS: 1 | US FAERS | |
| 693 | Duodenal atresia | FAERS: 1 | US FAERS | |
| 694 | Dysphemia | FAERS: 1 | US FAERS | |
| 695 | Electrocardiogram abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 696 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 697 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 698 | Electromyogram abnormal | FAERS: 1 | US FAERS | |
| 699 | Embolism | FAERS: 1 | US FAERS | |
| 700 | Emergency Care | FAERS: 1 | US FAERS | |
| 701 | Eosinophilic cystitis | FAERS: 1 | US FAERS | |
| 702 | Epilepsy | FAERS: 1 | US FAERS | |
| 703 | Erection increased | FAERS: 1 | US FAERS | |
| 704 | Eructation | FAERS: 1 | US FAERS | |
| 705 | Escherichia infection | FAERS: 1 | US FAERS | |
| 706 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 707 | Escherichia test positive | FAERS: 1 | US FAERS | |
| 708 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 709 | Excoriation | FAERS: 1 | OFFSIDES US FAERS | |
| 710 | Exercise capacity decreased | FAERS: 1 | US FAERS | |
| 711 | Expired drug administered | FAERS: 1 | US FAERS | |
| 712 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 713 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 714 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 715 | Eyelid exfoliation | FAERS: 1 | US FAERS | |
| 716 | Eyelid infection | FAERS: 1 | US FAERS | |
| 717 | Facial Pain | FAERS: 1 | US FAERS | |
| 718 | Femoral arterial stenosis | FAERS: 1 | US FAERS | |
| 719 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 720 | Fine motor delay | FAERS: 1 | US FAERS | |
| 721 | Food craving | FAERS: 1 | US FAERS | |
| 722 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 723 | Full blood count increased | FAERS: 1 | US FAERS | |
| 724 | Fungal rash | FAERS: 1 | US FAERS | |
| 725 | Gangrene | FAERS: 1 | OFFSIDES US FAERS | |
| 726 | Gastrectomy | FAERS: 1 | US FAERS | |
| 727 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 728 | Genetic Polymorphism | FAERS: 1 | US FAERS | |
| 729 | Gingival Hypertrophy | FAERS: 1 | US FAERS | |
| 730 | Gingival Recession | FAERS: 1 | US FAERS | |
| 731 | Glaucoma | FAERS: 1 | US FAERS | |
| 732 | Glioblastoma | FAERS: 1 | OFFSIDES US FAERS | |
| 733 | Granuloma | FAERS: 1 | US FAERS | |
| 734 | Head discomfort | FAERS: 1 | US FAERS | |
| 735 | Heart valve stenosis | FAERS: 1 | US FAERS | |
| 736 | Heat Stroke | FAERS: 1 | US FAERS | |
| 737 | Heat illness | FAERS: 1 | US FAERS | |
| 738 | Hemiparesis | FAERS: 1 | US FAERS | |
| 739 | Hemiplegia | FAERS: 1 | US FAERS | |
| 740 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 741 | Hepatitis B antibody positive | FAERS: 1 | US FAERS | |
| 742 | Hepatitis B surface antigen positive | FAERS: 1 | US FAERS | |
| 743 | Hernia | FAERS: 1 | US FAERS | |
| 744 | High density lipoprotein abnormal | FAERS: 1 | US FAERS | |
| 745 | High density lipoprotein increased | FAERS: 1 | US FAERS | |
| 746 | Histone antibody positive | FAERS: 1 | US FAERS | |
| 747 | Homans' sign | FAERS: 1 | US FAERS | |
| 748 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 749 | Hostility | FAERS: 1 | US FAERS | |
| 750 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 751 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 752 | Hydropneumothorax | FAERS: 1 | US FAERS | |
| 753 | Hypercapnia | FAERS: 1 | US FAERS | |
| 754 | Hyperreflexia | FAERS: 1 | US FAERS | |
| 755 | Hypotrichosis | FAERS: 1 | US FAERS | |
| 756 | Hysterectomy | FAERS: 1 | US FAERS | |
| 757 | Iliac artery occlusion | FAERS: 1 | US FAERS | |
| 758 | Iliac artery stenosis | FAERS: 1 | US FAERS | |
| 759 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 760 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 761 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 762 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 763 | Induration | FAERS: 1 | US FAERS | |
| 764 | Intention tremor | FAERS: 1 | US FAERS | |
| 765 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 766 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 767 | Intervertebral disc disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 768 | Intestinal infarction | FAERS: 1 | US FAERS | |
| 769 | Iritis | FAERS: 1 | US FAERS | |
| 770 | Joint dislocation postoperative | FAERS: 1 | US FAERS | |
| 771 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 772 | Laceration | FAERS: 1 | US FAERS | |
| 773 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 774 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 775 | Legionella serology positive | FAERS: 1 | US FAERS | |
| 776 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 777 | Leukoplakia | FAERS: 1 | US FAERS | |
| 778 | Libido disorder | FAERS: 1 | US FAERS | |
| 779 | Lid lag | FAERS: 1 | US FAERS | |
| 780 | Ligament injury | FAERS: 1 | US FAERS | |
| 781 | Ligament pain | FAERS: 1 | US FAERS | |
| 782 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 783 | Liver Abscess | FAERS: 1 | US FAERS | |
| 784 | Liver palpable subcostal | FAERS: 1 | US FAERS | |
| 785 | Low density lipoprotein abnormal | FAERS: 1 | US FAERS | |
| 786 | Lung Injury | FAERS: 1 | US FAERS | |
| 787 | Lyme Disease | FAERS: 1 | US FAERS | |
| 788 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 789 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 790 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 791 | Lymphoid tissue hyperplasia | FAERS: 1 | US FAERS | |
| 792 | Lymphoma | FAERS: 1 | US FAERS | |
| 793 | MELAS Syndrome | FAERS: 1 | US FAERS | |
| 794 | Macular degeneration | FAERS: 1 | US FAERS | |
| 795 | Macule | FAERS: 1 | US FAERS | |
| 796 | Male sexual dysfunction | FAERS: 1 | US FAERS | |
| 797 | Mallet finger | FAERS: 1 | US FAERS | |
| 798 | Mastectomy | FAERS: 1 | US FAERS | |
| 799 | Maternal exposure before pregnancy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 800 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 801 | Medial Tibial Stress Syndrome | FAERS: 1 | US FAERS | |
| 802 | Mediastinal mass | FAERS: 1 | US FAERS | |
| 803 | Megacolon | FAERS: 1 | US FAERS | |
| 804 | Meibomianitis | FAERS: 1 | US FAERS | |
| 805 | Menorrhagia | FAERS: 1 | US FAERS | |
| 806 | Metabolic alkalosis | FAERS: 1 | US FAERS | |
| 807 | Metastases to adrenals | FAERS: 1 | US FAERS | |
| 808 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 809 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 810 | Mitochondrial cytopathy | FAERS: 1 | US FAERS | |
| 811 | Moaning | FAERS: 1 | US FAERS | |
| 812 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 813 | Monoparesis | FAERS: 1 | US FAERS | |
| 814 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 815 | Mouth swelling | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 816 | Multiple allergies | FAERS: 1 | US FAERS | |
| 817 | Muscle hypertrophy | FAERS: 1 | US FAERS | |
| 818 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 819 | Mydriasis | FAERS: 1 | US FAERS | |
| 820 | Myoclonus | FAERS: 1 | US FAERS | |
| 821 | Myoglobin blood decreased | FAERS: 1 | US FAERS | |
| 822 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 823 | Nasal inflammation | FAERS: 1 | US FAERS | |
| 824 | Necrosis | FAERS: 1 | CTD US FAERS | |
| 825 | Negative thoughts | FAERS: 1 | US FAERS | |
| 826 | Nephrectomy | FAERS: 1 | US FAERS | |
| 827 | Nephrosclerosis | FAERS: 1 | US FAERS | |
| 828 | Nerve root injury | FAERS: 1 | US FAERS | |
| 829 | Neuralgic Amyotrophy | FAERS: 1 | US FAERS | |
| 830 | Neuropathic pain | FAERS: 1 | US FAERS | |
| 831 | Neutropenia | FAERS: 1 | 21330348 | CTD US FAERS |
| 832 | New daily persistent headache | FAERS: 1 | US FAERS | |
| 833 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 834 | Obesity | FAERS: 1 | US FAERS | |
| 835 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 836 | Obstruction | FAERS: 1 | US FAERS | |
| 837 | Oligohydramnios | FAERS: 1 | US FAERS | |
| 838 | Oral pain | FAERS: 1 | US FAERS | |
| 839 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 840 | Otitis Media | FAERS: 1 | US FAERS | |
| 841 | Overweight | FAERS: 1 | OFFSIDES US FAERS | |
| 842 | PCO2 decreased | FAERS: 1 | US FAERS | |
| 843 | PO2 decreased | FAERS: 1 | US FAERS | |
| 844 | PO2 increased | FAERS: 1 | US FAERS | |
| 845 | Pancreatectomy | FAERS: 1 | US FAERS | |
| 846 | Pancreatic Pseudocyst | FAERS: 1 | US FAERS | |
| 847 | Papule | FAERS: 1 | US FAERS | |
| 848 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 849 | Paresis | FAERS: 1 | 19252767 | CTD US FAERS |
| 850 | Partial lung resection | FAERS: 1 | US FAERS | |
| 851 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 852 | Pericarditis | FAERS: 1 | US FAERS | |
| 853 | Perineal pain | FAERS: 1 | US FAERS | |
| 854 | Periorbital disorder | FAERS: 1 | US FAERS | |
| 855 | Physical Examination | FAERS: 1 | US FAERS | |
| 856 | Piloerection | FAERS: 1 | US FAERS | |
| 857 | Pityriasis Rosea | FAERS: 1 | US FAERS | |
| 858 | Polymyalgia | FAERS: 1 | US FAERS | |
| 859 | Polyneuropathy chronic | FAERS: 1 | US FAERS | |
| 860 | Portal fibrosis | FAERS: 1 | US FAERS | |
| 861 | Post procedural sepsis | FAERS: 1 | US FAERS | |
| 862 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 863 | Potentiating drug interaction | FAERS: 1 | US FAERS | |
| 864 | Pregnancy of partner | FAERS: 1 | US FAERS | |
| 865 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 866 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 867 | Procedural complication | FAERS: 1 | US FAERS | |
| 868 | Proctitis herpes | FAERS: 1 | US FAERS | |
| 869 | Product commingling | FAERS: 1 | US FAERS | |
| 870 | Product dispensing error | FAERS: 1 | US FAERS | |
| 871 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 872 | Product label issue | FAERS: 1 | US FAERS | |
| 873 | Product packaging issue | FAERS: 1 | US FAERS | |
| 874 | Product physical issue | FAERS: 1 | US FAERS | |
| 875 | Product size issue | FAERS: 1 | US FAERS | |
| 876 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 877 | Product tampering | FAERS: 1 | US FAERS | |
| 878 | Prostatectomy | FAERS: 1 | US FAERS | |
| 879 | Prostatic pain | FAERS: 1 | US FAERS | |
| 880 | Prostatism | FAERS: 1 | US FAERS | |
| 881 | Protein total decreased | FAERS: 1 | US FAERS | |
| 882 | Protein urine present | FAERS: 1 | SIDER US FAERS | |
| 883 | Pseudodementia | FAERS: 1 | US FAERS | |
| 884 | Pseudolymphoma | FAERS: 1 | US FAERS | |
| 885 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 886 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 887 | Pulmonary artery stenosis | FAERS: 1 | US FAERS | |
| 888 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 889 | Pulmonary vasculitis | FAERS: 1 | US FAERS | |
| 890 | Purulent discharge | FAERS: 1 | US FAERS | |
| 891 | Rectal discharge | FAERS: 1 | US FAERS | |
| 892 | Regurgitation of food | FAERS: 1 | US FAERS | |
| 893 | Renal Colic | FAERS: 1 | US FAERS | |
| 894 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 895 | Respiratory muscle weakness | FAERS: 1 | US FAERS | |
| 896 | Retching | FAERS: 1 | US FAERS | |
| 897 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 898 | Rheumatoid factor increased | FAERS: 1 | US FAERS | |
| 899 | Rickets | FAERS: 1 | US FAERS | |
| 900 | Rosacea | FAERS: 1 | US FAERS | |
| 901 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 902 | Sacroiliitis | FAERS: 1 | US FAERS | |
| 903 | Screaming | FAERS: 1 | US FAERS | |
| 904 | Senile dementia | FAERS: 1 | US FAERS | |
| 905 | Serum serotonin decreased | FAERS: 1 | US FAERS | |
| 906 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 907 | Skin hypertrophy | FAERS: 1 | OFFSIDES US FAERS | |
| 908 | Skin laceration | FAERS: 1 | US FAERS | |
| 909 | Slow speech | FAERS: 1 | US FAERS | |
| 910 | Soft tissue swelling | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 911 | Somatoform Disorder | FAERS: 1 | US FAERS | |
| 912 | Somnambulism | FAERS: 1 | US FAERS | |
| 913 | Spermatozoa abnormal | FAERS: 1 | US FAERS | |
| 914 | Splenectomy | FAERS: 1 | US FAERS | |
| 915 | Spondylitis | FAERS: 1 | OFFSIDES US FAERS | |
| 916 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 917 | Staring | FAERS: 1 | US FAERS | |
| 918 | Stillbirth | FAERS: 1 | US FAERS | |
| 919 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 920 | Surgical failure | FAERS: 1 | US FAERS | |
| 921 | Syringomyelia | FAERS: 1 | US FAERS | |
| 922 | Talipes | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 923 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 924 | Therapy cessation | FAERS: 1 | US FAERS | |
| 925 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 926 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 927 | Thyroidectomy | FAERS: 1 | US FAERS | |
| 928 | Tongue movement disturbance | FAERS: 1 | US FAERS | |
| 929 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 930 | Tooth Loss | FAERS: 1 | US FAERS | |
| 931 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 932 | Troponin I increased | FAERS: 1 | US FAERS | |
| 933 | Troponin T increased | FAERS: 1 | US FAERS | |
| 934 | Ulcer | FAERS: 1 | US FAERS | |
| 935 | Ultrasound prostate abnormal | FAERS: 1 | US FAERS | |
| 936 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 937 | Urinary tract infection enterococcal | FAERS: 1 | US FAERS | |
| 938 | Urinary tract infection staphylococcal | FAERS: 1 | US FAERS | |
| 939 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 940 | Urine amphetamine positive | FAERS: 1 | US FAERS | |
| 941 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 942 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 943 | Vaginal pain | FAERS: 1 | US FAERS | |
| 944 | Vascular bypass graft | FAERS: 1 | US FAERS | |
| 945 | Vascular calcification | FAERS: 1 | US FAERS | |
| 946 | Vascular insufficiency | FAERS: 1 | US FAERS | |
| 947 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 948 | Vein pain | FAERS: 1 | US FAERS | |
| 949 | Venous occlusion | FAERS: 1 | US FAERS | |
| 950 | Vertebral artery hypoplasia | FAERS: 1 | US FAERS | |
| 951 | Very low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 952 | Viral myositis | FAERS: 1 | US FAERS | |
| 953 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 954 | Vision correction operation | FAERS: 1 | US FAERS | |
| 955 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 956 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 957 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 958 | Xanthopsia | FAERS: 1 | US FAERS | |
| 959 | furuncle | FAERS: 1 | US FAERS | |
| 960 | Ache | SIDER | ||
| 961 | Acute Lung Injury | 20452610 | CTD | |
| 962 | Albuminuria | 18569938 | CTD | |
| 963 | Altered bowel function | OFFSIDES | ||
| 964 | Animal bite | OFFSIDES | ||
| 965 | Antiacetylcholine receptor antibody positive | Canada Vigilance: 1 | Canada Vigilance | |
| 966 | Anxiety Disorders | 8345888 | CTD | |
| 967 | Arterial bypass operation | OFFSIDES | ||
| 968 | Atherosclerosis | 15780535 20519084 21241519 | CTD | |
| 969 | Autoantibody positive | Canada Vigilance: 1 | Canada Vigilance | |
| 970 | Azotemia | 16537817 | CTD | |
| 971 | Bacteria stool identified | OFFSIDES | ||
| 972 | Blood Glucose | OFFSIDES | ||
| 973 | Blood cholesterol | OFFSIDES | ||
| 974 | Blood folate abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 975 | Blood osmolarity decreased | OFFSIDES | ||
| 976 | Blood sodium increased | OFFSIDES | ||
| 977 | Blood sodium | OFFSIDES | ||
| 978 | Blood thyroid stimulating hormone | OFFSIDES | ||
| 979 | Bone lesion | OFFSIDES | ||
| 980 | Brain Concussion | OFFSIDES | ||
| 981 | Brain Edema | 19166837 | CTD | |
| 982 | Brain Infarction | 20493175 | CTD | |
| 983 | Brain Injuries | CTD | ||
| 984 | Brain Ischemia | 20433776 | CTD | |
| 985 | Breast Feeding | SIDER | ||
| 986 | Bruxism | OFFSIDES | ||
| 987 | Cardiomegaly | CTD | ||
| 988 | Cervicobrachial syndrome | OFFSIDES | ||
| 989 | Chemical and Drug Induced Liver Injury | CTD | ||
| 990 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 991 | Chronic left ventricular failure | OFFSIDES | ||
| 992 | Claustrophobia | OFFSIDES | ||
| 993 | Cognition Disorders | 16940411 20331937 20833152 | CTD | |
| 994 | Colorectal Neoplasms | 18521906 | CTD | |
| 995 | Compartment syndromes | CTD | ||
| 996 | Confabulation | OFFSIDES | ||
| 997 | Coronary Stenosis | 12637338 | CTD | |
| 998 | Creatine Phosphokinase Increased | SIDER | ||
| 999 | Cubital Tunnel Syndrome | OFFSIDES | ||
| 1000 | Cystic Fibrosis | 19747007 | CTD | |
| 1001 | Depressive disorder | CTD | ||
| 1002 | Diabetes | OFFSIDES | ||
| 1003 | Diarrhea | 30408459 | CTD | |
| 1004 | Diffuse Axonal Injury | 20833152 | CTD | |
| 1005 | Drug Overdose | 18819764 | CTD | |
| 1006 | Drug withdrawal headache | OFFSIDES | ||
| 1007 | Dyslipidemias | CTD | ||
| 1008 | Edema | 20126887 | CTD | |
| 1009 | Endometriosis | 23386644 | CTD | |
| 1010 | Erosive gastritis | OFFSIDES | ||
| 1011 | Erythema Multiforme | SIDER | ||
| 1012 | Exploratory operation | OFFSIDES | ||
| 1013 | Extravasation of Diagnostic and Therapeutic Materials | 15665042 | CTD | |
| 1014 | Eye Infection | OFFSIDES | ||
| 1015 | Eye irritation | Canada Vigilance: 1 | Canada Vigilance | |
| 1016 | Eyeball rupture | OFFSIDES | ||
| 1017 | Facial Neuralgia | OFFSIDES | ||
| 1018 | Facial Paresis | SIDER | ||
| 1019 | Fatty Liver | 11281188 | CTD | |
| 1020 | Feeding tube complication | OFFSIDES | ||
| 1021 | Fever | 24593216 | CTD | |
| 1022 | Fibrosis | CTD | ||
| 1023 | Gait Disorders, Neurologic | 10027656 | CTD | |
| 1024 | Gambling | OFFSIDES | ||
| 1025 | Glioma | 7834630 | CTD | |
| 1026 | Heart failure | 15380679 | CTD | |
| 1027 | Hemorrhage | 20126887 | CTD | |
| 1028 | Heparin-induced thrombocytopenia | OFFSIDES | ||
| 1029 | High serum cholesterol, familial | 12106856 | CTD | |
| 1030 | Hirsutism | Canada Vigilance: 1 | Canada Vigilance | |
| 1031 | Hypercholesterolemia |
1857844
1978916 2017280 2224231 2492189 2571051 7653497 7909021 8093380 8593127 9223394 9244616 9430375 9543095 9633944 10027656 10779001 11583721 14602771 15184351 15486036 15936011 17959387 18471454 24593216 | CTD | |
| 1032 | Hyperemia | 17521631 | CTD | |
| 1033 | Hyperhomocysteinemia | 18224302 | CTD | |
| 1034 | Hyperlipidemia, Familial Combined | 20152243 | CTD | |
| 1035 | Hyperlipoproteinemias | CTD | ||
| 1036 | Hyperplasia | 19024099 20359552 20403180 | CTD | |
| 1037 | Hypersensitive syndrome | SIDER | ||
| 1038 | Hypertriglyceridemia | CTD | ||
| 1039 | Hypoalphalipoproteinemias | 11498460 11757504 20152243 | CTD | |
| 1040 | Hypoparathyroidism | OFFSIDES | ||
| 1041 | Immunosuppression | OFFSIDES | ||
| 1042 | Infarction, Middle Cerebral Artery | 20451219 | CTD | |
| 1043 | Intracranial Aneurysm | 18309148 | CTD | |
| 1044 | Ischemia | 20846454 | CTD | |
| 1045 | Kidney Diseases | 20403180 | CTD | |
| 1046 | Kidney Failure, Chronic | 12410059 | CTD | |
| 1047 | Kidney Failure | OFFSIDES | ||
| 1048 | Lentigo maligna stage unspecified | OFFSIDES | ||
| 1049 | Leukopenia | SIDER | ||
| 1050 | Liver Cirrhosis | 11281188 | CTD | |
| 1051 | Liver diseases | 22031447 | CTD | |
| 1052 | Liver neoplasms | 25058030 28108177 | CTD | |
| 1053 | Long QT Syndrome | 15486036 | CTD | |
| 1054 | Lung Diseases, Obstructive | 22305382 | CTD | |
| 1055 | Lupus Erythematosus | SIDER | ||
| 1056 | Lymphocele | OFFSIDES | ||
| 1057 | Memory Loss | SIDER | ||
| 1058 | Menarche | SIDER | ||
| 1059 | Metaplasia | 20359552 | CTD | |
| 1060 | Metastatic pain | OFFSIDES | ||
| 1061 | Mitochondrial Myopathies | 12353945 | CTD | |
| 1062 | Mononeuropathies | 15273860 | CTD | |
| 1063 | Movement Disorders | 19166837 | CTD | |
| 1064 | Muscle Spasticity | Canada Vigilance: 1 | Canada Vigilance | |
| 1065 | Muscle Weakness | CTD OFFSIDES | ||
| 1066 | Myocardial Reperfusion Injury | 11742885 | CTD | |
| 1067 | Narcotic intoxication | OFFSIDES | ||
| 1068 | Neoplasm Metastasis | 21199873 | CTD | |
| 1069 | Neoplasms, Experimental | CTD | ||
| 1070 | Nephritis, Interstitial | 11064678 | CTD | |
| 1071 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 1072 | Orthopnea | OFFSIDES | ||
| 1073 | Osteitis Deformans | OFFSIDES | ||
| 1074 | Osteolysis | 21199873 | CTD | |
| 1075 | PCO2 increased | OFFSIDES | ||
| 1076 | Paresthesia | 10027656 | CTD | |
| 1077 | Peripheral Nervous System Diseases | 7745415 9671841 10027656 | CTD | |
| 1078 | Peripheral nerve palsy | SIDER | ||
| 1079 | Plaque, Atherosclerotic | 30342015 | CTD | |
| 1080 | Plasmacytoma | OFFSIDES | ||
| 1081 | Polycystic Ovary Syndrome | 17105841 | CTD | |
| 1082 | Porphyria Cutanea Tarda | 7631993 | CTD | |
| 1083 | Product prescribing error | Canada Vigilance: 1 | Canada Vigilance | |
| 1084 | Psychoses, Substance-Induced | 8345888 | CTD | |
| 1085 | Pulmonary Edema | CTD | ||
| 1086 | Pulmonary toxicity | OFFSIDES | ||
| 1087 | Raynaud Disease | 9759786 | CTD | |
| 1088 | Regurgitation | SIDER | ||
| 1089 | Renal Insufficiency | 12380704 19087798 | CTD | |
| 1090 | Reperfusion Injury | 11470468 21844074 21968084 | CTD | |
| 1091 | Skeletal survey abnormal | OFFSIDES | ||
| 1092 | Sleep Wake Disorders | 2224231 11675864 | CTD | |
| 1093 | Soliloquy | OFFSIDES | ||
| 1094 | Spinal Cord Injuries | 20403180 20851742 | CTD | |
| 1095 | Stridor | OFFSIDES | ||
| 1096 | Substance Withdrawal Syndrome | 18221806 | CTD | |
| 1097 | Tendinopathy | 26577051 | CTD | |
| 1098 | Testicular Diseases | 17200428 | CTD | |
| 1099 | Therapeutic product cross-reactivity | Canada Vigilance: 1 | Canada Vigilance | |
| 1100 | Therapeutic response changed | Canada Vigilance: 2 | Canada Vigilance | |
| 1101 | Thoracic vertebral fracture | OFFSIDES | ||
| 1102 | Thyroid cancer metastatic | OFFSIDES | ||
| 1103 | Tooth Extraction | OFFSIDES | ||
| 1104 | Toxic Epidermal Necrolysis | SIDER | ||
| 1105 | Upset stomach | SIDER | ||
| 1106 | Urinary Bladder Diseases | 20403180 | CTD | |
| 1107 | VIIth nerve paralysis | SIDER | ||
| 1108 | Vascular purpura | SIDER | ||
| 1109 | Ventricular hypokinesia | OFFSIDES | ||
| 1110 | Vertebroplasty | OFFSIDES | ||
| 1111 | Wound dehiscence | OFFSIDES | ||
| 1112 | Wound infection staphylococcal | OFFSIDES | ||
| 1113 | Wounds, Penetrating | 18316203 | CTD | |
| 1114 | Xerosis | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.