Thyroxine
(YDTFRJLNMPSCFM-YDALLXLXSA-M)
Structure
- SMILES
- [O-]C(=O)[C@H](Cc1cc(I)c(c(c1)I)Oc1cc(I)c(c(c1)I)O)N.[Na+]
- Molecular Formula:
- C15H10I4NNaO4
- Molecular Weight:
- 798.852
- Log P:
- 3.9229
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 95.61
- CAS Number(s):
- 55-03-8; 1491-91-4; 25416-65-3; 50809-32-0
Synonym(s)
1.
Thyroxine
2.
L-Thyroxine
3.
Levothyroxine
4.
T4 Thyroid Hormone
5.
3,5,3',5'-Tetraiodothyronine
6.
Berlthyrox
7.
Dexnon
8.
Eferox
9.
Eltroxin
10.
Eltroxine
11.
Euthyrox
12.
Eutirox
13.
L-3,5,3',5'-Tetraiodothyronine
14.
L-Thyrox
15.
L-Thyroxin Henning
16.
L-Thyroxin beta
17.
L-Thyroxine Roche
18.
Levo-T
19.
Levothroid
20.
Levothyroid
21.
Levothyroxin Deladande
22.
Levothyroxin Delalande
23.
Levothyroxine Sodium
24.
Levoxine
25.
Levoxyl
26.
Lévothyrox
27.
Novothyral
28.
Novothyrox
29.
O-(4-Hydroxy-3,5-diiodophenyl) 3,5-diiodo-L-tyrosine
30.
O-(4-Hydroxy-3,5-diiodophenyl)-3,5-diiodotyrosine
31.
Oroxine
32.
Sodium Levothyroxine
33.
Synthroid
34.
Synthrox
35.
Thevier
36.
Thyrax
37.
Thyroxin
38.
Tiroidine
39.
Tiroxina Leo
40.
Unithroid
41.
L Thyrox
42.
L Thyroxin Henning
43.
L Thyroxin beta
44.
L Thyroxine
45.
L Thyroxine Roche
46.
Levo T
47.
Thyroid Hormone, T4
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 5383 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 2 | Headache | FAERS: 3165 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 3 | Vertigo | FAERS: 1935 | US FAERS | |
| 4 | Alopecia | FAERS: 1790 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 5 | Asthenia | FAERS: 1725 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 6 | Blood thyroid stimulating hormone increased | FAERS: 1622 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 7 | Dizziness | FAERS: 1608 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 8 | Myalgia | FAERS: 1591 | US FAERS | |
| 9 | Nausea | FAERS: 1454 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Arthralgia | FAERS: 1435 | US FAERS | |
| 11 | Palpitations | FAERS: 1403 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 12 | Anxiety | FAERS: 1057 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Malaise | FAERS: 1056 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 14 | Blood thyroid stimulating hormone decreased | FAERS: 910 | US FAERS | |
| 15 | Diffuse alopecia | FAERS: 874 | US FAERS | |
| 16 | Loss of personal independence in daily activities | FAERS: 798 | US FAERS | |
| 17 | Hyperthyroidism | FAERS: 773 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 18 | Amnesia | FAERS: 734 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Tachycardia | FAERS: 680 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Pain | FAERS: 640 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 21 | Weight decreased | FAERS: 592 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 22 | Feeling abnormal | FAERS: 582 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 23 | Product formulation issue | FAERS: 581 | US FAERS | |
| 24 | Blood thyroid stimulating hormone normal | FAERS: 556 | US FAERS | |
| 25 | Constipation | FAERS: 546 | US FAERS | |
| 26 | Abdominal Pain | FAERS: 540 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 27 | Memory impairment | FAERS: 518 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Tremor | FAERS: 493 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Drug ineffective | FAERS: 489 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 30 | Nervousness | FAERS: 477 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Somnolence | FAERS: 450 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 32 | Pruritus | FAERS: 422 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 33 | Visual Impairment | FAERS: 404 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Hypothyroidism | FAERS: 389 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 35 | Mood swings | FAERS: 379 | US FAERS | |
| 36 | Vomiting | FAERS: 373 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 37 | Depressed mood | FAERS: 369 | US FAERS | |
| 38 | Impaired work ability | FAERS: 346 | US FAERS | |
| 39 | Dyspepsia | FAERS: 317 | US FAERS | |
| 40 | Blood thyroid stimulating hormone | FAERS: 314 | US FAERS | |
| 41 | Apathy | FAERS: 312 | US FAERS | |
| 42 | Chest Pain | FAERS: 308 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 43 | Maternal exposure during pregnancy | FAERS: 302 | US FAERS | |
| 44 | Blood thyroid stimulating hormone abnormal | FAERS: 293 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Crying | FAERS: 288 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Stress | FAERS: 267 | US FAERS | |
| 47 | Dry skin | FAERS: 246 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Hypotension | FAERS: 228 | US FAERS | |
| 49 | Impaired driving ability | FAERS: 226 | US FAERS | |
| 50 | Tinnitus | FAERS: 220 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Feeling Cold | FAERS: 219 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Personal relationship issue | FAERS: 208 | US FAERS | |
| 53 | Back Pain | FAERS: 204 | US FAERS | |
| 54 | Hypersensitivity | FAERS: 194 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 55 | Chest discomfort | FAERS: 193 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 56 | General physical health deterioration | FAERS: 191 | US FAERS | |
| 57 | Urticaria | FAERS: 183 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 58 | Anger | FAERS: 176 | US FAERS | |
| 59 | Psychiatric symptom | FAERS: 169 | US FAERS | |
| 60 | Product quality issue | FAERS: 160 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 61 | Emotional distress | FAERS: 156 | US FAERS | |
| 62 | Product substitution issue | FAERS: 148 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 63 | Agitation | FAERS: 138 | US FAERS | |
| 64 | Musculoskeletal stiffness | FAERS: 137 | US FAERS | |
| 65 | Angina Pectoris | FAERS: 128 | US FAERS | |
| 66 | Blood cholesterol increased | FAERS: 124 | US FAERS | |
| 67 | Abdominal discomfort | FAERS: 116 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 68 | Gastrointestinal motility disorder | FAERS: 113 | US FAERS | |
| 69 | Impatience | FAERS: 111 | US FAERS | |
| 70 | Musculoskeletal Pain | FAERS: 111 | US FAERS | |
| 71 | Discomfort | FAERS: 110 | US FAERS | |
| 72 | Gastrointestinal Pain | FAERS: 109 | US FAERS | |
| 73 | Hypokinesia | FAERS: 109 | US FAERS | |
| 74 | Feeling jittery | FAERS: 107 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 75 | Eye pain | FAERS: 106 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 76 | Night sweats | FAERS: 106 | US FAERS | |
| 77 | Aphasia | FAERS: 103 | US FAERS | |
| 78 | Chills | FAERS: 103 | US FAERS | |
| 79 | Neck Pain | FAERS: 102 | US FAERS | |
| 80 | Syncope | FAERS: 102 | US FAERS | |
| 81 | Poor quality sleep | FAERS: 100 | US FAERS | |
| 82 | Dysgeusia | FAERS: 98 | US FAERS | |
| 83 | Middle insomnia | FAERS: 98 | US FAERS | |
| 84 | Pharmaceutical product complaint | FAERS: 98 | US FAERS | |
| 85 | Flatulence | FAERS: 97 | US FAERS | |
| 86 | Live Birth | FAERS: 95 | US FAERS | |
| 87 | Negative thoughts | FAERS: 95 | US FAERS | |
| 88 | Onychoclasis | FAERS: 93 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 89 | Peripheral swelling | FAERS: 93 | US FAERS | |
| 90 | Swelling | FAERS: 93 | US FAERS | |
| 91 | Burning sensation | FAERS: 85 | US FAERS | |
| 92 | Temperature intolerance | FAERS: 85 | US FAERS | |
| 93 | Dysphonia | FAERS: 84 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 94 | Emotional disorder | FAERS: 84 | US FAERS | |
| 95 | Mental impairment | FAERS: 84 | US FAERS | |
| 96 | Bone pain | FAERS: 83 | US FAERS | |
| 97 | Tension | FAERS: 83 | US FAERS | |
| 98 | Formication | FAERS: 82 | US FAERS | |
| 99 | Limb discomfort | FAERS: 82 | US FAERS | |
| 100 | Overdose | FAERS: 82 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 101 | Gamma-Glutamyltransferase Increased | FAERS: 81 | US FAERS | |
| 102 | Presyncope | FAERS: 80 | US FAERS | |
| 103 | Lethargy | FAERS: 78 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 104 | Blood triglycerides increased | FAERS: 77 | US FAERS | |
| 105 | Joint swelling | FAERS: 77 | US FAERS | |
| 106 | Anti-thyroid antibody positive | FAERS: 74 | US FAERS | |
| 107 | Reaction to drug excipients | FAERS: 72 | US FAERS | |
| 108 | Erythema | FAERS: 68 | US FAERS | |
| 109 | Atrial Fibrillation | FAERS: 67 | US FAERS | |
| 110 | Mental Fatigue | FAERS: 67 | US FAERS | |
| 111 | Adverse event | FAERS: 66 | US FAERS | |
| 112 | Diabetes Mellitus | FAERS: 65 | US FAERS | |
| 113 | Hypersomnia | FAERS: 63 | US FAERS | |
| 114 | Throat irritation | FAERS: 63 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 115 | Head discomfort | FAERS: 62 | US FAERS | |
| 116 | Thirst | FAERS: 62 | US FAERS | |
| 117 | Abnormal weight gain | FAERS: 58 | US FAERS | |
| 118 | Blood glucose increased | FAERS: 58 | US FAERS | |
| 119 | Bradycardia | FAERS: 57 | US FAERS | |
| 120 | Eye irritation | FAERS: 55 | US FAERS | |
| 121 | Oropharyngeal pain | FAERS: 55 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 122 | Feeling of body temperature change | FAERS: 54 | US FAERS | |
| 123 | Initial insomnia | FAERS: 54 | US FAERS | |
| 124 | Angioedema | FAERS: 53 | US FAERS | |
| 125 | Incorrect dose administered | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 126 | Unevaluable event | FAERS: 52 | US FAERS | |
| 127 | Eczema | FAERS: 50 | US FAERS | |
| 128 | Gait inability | FAERS: 50 | US FAERS | |
| 129 | Medication Error | FAERS: 50 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Cerebrovascular accident | FAERS: 49 | US FAERS | |
| 131 | Choking | FAERS: 47 | US FAERS | |
| 132 | Drug dispensing error | FAERS: 47 | US FAERS | |
| 133 | Drug dose omission | FAERS: 45 | US FAERS | |
| 134 | Sense of oppression | FAERS: 45 | US FAERS | |
| 135 | Suicide attempt | FAERS: 45 | US FAERS | |
| 136 | Therapeutic response unexpected with drug substitution | FAERS: 45 | US FAERS | |
| 137 | Asthma | FAERS: 44 | US FAERS | |
| 138 | Flushing | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 139 | Muscle Fatigue | FAERS: 42 | US FAERS | |
| 140 | Exophthalmos | FAERS: 40 | US FAERS | |
| 141 | Alanine Aminotransferase Increased | FAERS: 38 | US FAERS | |
| 142 | Hyperacusis | FAERS: 38 | US FAERS | |
| 143 | Dehydration | FAERS: 37 | US FAERS | |
| 144 | Restlessness | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 145 | Sluggishness | FAERS: 36 | US FAERS | |
| 146 | Bedridden | FAERS: 35 | US FAERS | |
| 147 | Disorientation | FAERS: 35 | US FAERS | |
| 148 | Drug level above therapeutic | FAERS: 35 | US FAERS | |
| 149 | Acne | FAERS: 34 | US FAERS | |
| 150 | Fear of falling | FAERS: 34 | US FAERS | |
| 151 | Malabsorption | FAERS: 34 | US FAERS | |
| 152 | Arthropathy | FAERS: 33 | US FAERS | |
| 153 | Activities of daily living impaired | FAERS: 32 | US FAERS | |
| 154 | Asphyxia | FAERS: 32 | US FAERS | |
| 155 | Blindness | FAERS: 32 | US FAERS | |
| 156 | Menorrhagia | FAERS: 32 | US FAERS | |
| 157 | Musculoskeletal discomfort | FAERS: 32 | US FAERS | |
| 158 | Photophobia | FAERS: 32 | US FAERS | |
| 159 | Urinary tract infection | FAERS: 32 | US FAERS | |
| 160 | Cold sweat | FAERS: 31 | US FAERS | |
| 161 | Renal pain | FAERS: 31 | US FAERS | |
| 162 | Aspartate Aminotransferase Increased | FAERS: 30 | US FAERS | |
| 163 | Blood pressure fluctuation | FAERS: 30 | US FAERS | |
| 164 | Myocardial Infarction | FAERS: 30 | US FAERS | |
| 165 | Nasopharyngitis | FAERS: 30 | US FAERS | |
| 166 | Reaction to excipient | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 167 | Toxicity to various agents | FAERS: 30 | US FAERS | |
| 168 | Therapeutic response unexpected | FAERS: 29 | US FAERS | |
| 169 | Diplopia | FAERS: 28 | US FAERS | |
| 170 | Tri-iodothyronine free decreased | FAERS: 28 | US FAERS | |
| 171 | Wrong technique in product usage process | FAERS: 28 | US FAERS | |
| 172 | Diabetes mellitus inadequate control | FAERS: 27 | US FAERS | |
| 173 | Eructation | FAERS: 27 | US FAERS | |
| 174 | Lip swelling | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 175 | Low density lipoprotein increased | FAERS: 27 | US FAERS | |
| 176 | Pallor | FAERS: 27 | US FAERS | |
| 177 | Partner stress | FAERS: 27 | US FAERS | |
| 178 | Drug level below therapeutic | FAERS: 26 | US FAERS | |
| 179 | Joint stiffness | FAERS: 26 | US FAERS | |
| 180 | No adverse event | FAERS: 26 | US FAERS | |
| 181 | Blood creatinine increased | FAERS: 25 | US FAERS | |
| 182 | Drug effect incomplete | FAERS: 25 | US FAERS | |
| 183 | Hormone level abnormal | FAERS: 25 | US FAERS | |
| 184 | Inflammation | FAERS: 25 | US FAERS | |
| 185 | Monocyte count increased | FAERS: 25 | US FAERS | |
| 186 | Pneumonia | FAERS: 25 | US FAERS | |
| 187 | Thyroglobulin decreased | FAERS: 25 | US FAERS | |
| 188 | Ageusia | FAERS: 24 | US FAERS | |
| 189 | Epistaxis | FAERS: 24 | US FAERS | |
| 190 | Gastritis | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 191 | Product taste abnormal | FAERS: 24 | US FAERS | |
| 192 | Sciatica | FAERS: 24 | US FAERS | |
| 193 | Tri-iodothyronine free increased | FAERS: 24 | US FAERS | |
| 194 | nervous system disorder | FAERS: 24 | US FAERS | |
| 195 | Blood creatine phosphokinase increased | FAERS: 23 | US FAERS | |
| 196 | Impaired quality of life | FAERS: 23 | US FAERS | |
| 197 | Psoriasis | FAERS: 23 | US FAERS | |
| 198 | Dysgraphia | FAERS: 22 | US FAERS | |
| 199 | Fibromyalgia | FAERS: 22 | US FAERS | |
| 200 | Influenza | FAERS: 22 | US FAERS | |
| 201 | Muscle tightness | FAERS: 22 | US FAERS | |
| 202 | Sinusitis | FAERS: 22 | US FAERS | |
| 203 | Irritable Bowel Syndrome | FAERS: 21 | US FAERS | |
| 204 | Ocular discomfort | FAERS: 21 | US FAERS | |
| 205 | Restless Legs Syndrome | FAERS: 21 | US FAERS | |
| 206 | Trichorrhexis | FAERS: 21 | US FAERS | |
| 207 | Autoimmune thyroiditis | FAERS: 20 | US FAERS | |
| 208 | Deafness | FAERS: 20 | US FAERS | |
| 209 | Ear discomfort | FAERS: 20 | US FAERS | |
| 210 | Hyperchlorhydria | FAERS: 20 | US FAERS | |
| 211 | Neuralgia | FAERS: 20 | US FAERS | |
| 212 | Blood potassium increased | FAERS: 19 | US FAERS | |
| 213 | Cardiac discomfort | FAERS: 19 | US FAERS | |
| 214 | Dysuria | FAERS: 19 | US FAERS | |
| 215 | Epilepsy | FAERS: 19 | US FAERS | |
| 216 | Frustration tolerance decreased | FAERS: 19 | US FAERS | |
| 217 | Hypertensive crisis | FAERS: 19 | US FAERS | |
| 218 | Musculoskeletal chest pain | FAERS: 19 | US FAERS | |
| 219 | Personality Change | FAERS: 19 | US FAERS | |
| 220 | Anhedonia | FAERS: 18 | US FAERS | |
| 221 | Arthritis | FAERS: 18 | US FAERS | |
| 222 | Carpal Tunnel Syndrome | FAERS: 18 | US FAERS | |
| 223 | Choking sensation | FAERS: 18 | US FAERS | |
| 224 | Lymphadenopathy | FAERS: 18 | US FAERS | |
| 225 | Product physical issue | FAERS: 18 | US FAERS | |
| 226 | Product shape issue | FAERS: 18 | US FAERS | |
| 227 | Accidental drug intake by child | FAERS: 17 | US FAERS | |
| 228 | Bradyphrenia | FAERS: 17 | US FAERS | |
| 229 | Gestational Diabetes | FAERS: 17 | US FAERS | |
| 230 | High density lipoprotein increased | FAERS: 17 | US FAERS | |
| 231 | Intentional product misuse | FAERS: 17 | US FAERS | |
| 232 | Lymphocyte count increased | FAERS: 17 | US FAERS | |
| 233 | Osteoporosis | FAERS: 17 | US FAERS | |
| 234 | Pulmonary Embolism | FAERS: 17 | US FAERS | |
| 235 | Wheezing | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 236 | Asthenopia | FAERS: 16 | US FAERS | |
| 237 | Breast Feeding | FAERS: 16 | US FAERS | |
| 238 | Colitis | FAERS: 16 | US FAERS | |
| 239 | Drug abuse | FAERS: 16 | US FAERS | |
| 240 | Hunger | FAERS: 16 | US FAERS | |
| 241 | Migraine with Aura | FAERS: 16 | US FAERS | |
| 242 | Pelvic Pain | FAERS: 16 | US FAERS | |
| 243 | Polyuria | FAERS: 16 | US FAERS | |
| 244 | Poor quality drug administered | FAERS: 16 | US FAERS | |
| 245 | Sinus Tachycardia | FAERS: 16 | US FAERS | |
| 246 | Toothache | FAERS: 16 | US FAERS | |
| 247 | Accidental exposure to product by child | FAERS: 15 | US FAERS | |
| 248 | Aphonia | FAERS: 15 | US FAERS | |
| 249 | Euphoric mood | FAERS: 15 | US FAERS | |
| 250 | Expired product administered | FAERS: 15 | US FAERS | |
| 251 | Inappropriate schedule of drug administration | FAERS: 15 | US FAERS | |
| 252 | Physical disability | FAERS: 15 | US FAERS | |
| 253 | Rash erythematous | FAERS: 15 | US FAERS | |
| 254 | Retching | FAERS: 15 | US FAERS | |
| 255 | Accidental overdose | FAERS: 14 | US FAERS | |
| 256 | Facial paralysis | FAERS: 14 | US FAERS | |
| 257 | Food Allergy | FAERS: 14 | US FAERS | |
| 258 | Metrorrhagia | FAERS: 14 | US FAERS | |
| 259 | Paranoia | FAERS: 14 | US FAERS | |
| 260 | Bipolar Disorder | FAERS: 13 | US FAERS | |
| 261 | Cardiac Arrest | FAERS: 13 | US FAERS | |
| 262 | Depressed Level of Consciousness | FAERS: 13 | US FAERS | |
| 263 | Dysarthria | FAERS: 13 | US FAERS | |
| 264 | Exposure during breast feeding | FAERS: 13 | US FAERS | |
| 265 | Intellectual Disability | FAERS: 13 | US FAERS | |
| 266 | Low birth weight baby | FAERS: 13 | US FAERS | |
| 267 | Product measured potency issue | FAERS: 13 | US FAERS | |
| 268 | Respiratory distress | FAERS: 13 | US FAERS | |
| 269 | Urinary Incontinence | FAERS: 13 | US FAERS | |
| 270 | Vulvovaginal dryness | FAERS: 13 | US FAERS | |
| 271 | Wrong drug administered | FAERS: 13 | US FAERS | |
| 272 | Bulimia Nervosa | FAERS: 12 | US FAERS | |
| 273 | Cardiac Flutter | FAERS: 12 | US FAERS | |
| 274 | Lymphocyte count decreased | FAERS: 12 | US FAERS | |
| 275 | Morbid thoughts | FAERS: 12 | US FAERS | |
| 276 | Muscle strain | FAERS: 12 | US FAERS | |
| 277 | Pain of skin | FAERS: 12 | US FAERS | |
| 278 | Patient Isolation | FAERS: 12 | US FAERS | |
| 279 | Quality of life decreased | FAERS: 12 | US FAERS | |
| 280 | Supraventricular tachycardia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 281 | Thyroglobulin increased | FAERS: 12 | US FAERS | |
| 282 | Thyroid hormones increased | FAERS: 12 | US FAERS | |
| 283 | White blood cell count decreased | FAERS: 12 | US FAERS | |
| 284 | Altered state of consciousness | FAERS: 11 | US FAERS | |
| 285 | Circumstance or information capable of leading to medication error | FAERS: 11 | US FAERS | |
| 286 | Disability | FAERS: 11 | US FAERS | |
| 287 | Drug exposure during pregnancy | FAERS: 11 | US FAERS | |
| 288 | Erectile dysfunction | FAERS: 11 | US FAERS | |
| 289 | Libido disorder | FAERS: 11 | US FAERS | |
| 290 | Limb injury | FAERS: 11 | US FAERS | |
| 291 | Nodule | FAERS: 11 | US FAERS | |
| 292 | Phobia of driving | FAERS: 11 | US FAERS | |
| 293 | Shock | FAERS: 11 | US FAERS | |
| 294 | Temperature regulation disorder | FAERS: 11 | US FAERS | |
| 295 | Therapy change | FAERS: 11 | US FAERS | |
| 296 | Total cholesterol/HDL ratio increased | FAERS: 11 | US FAERS | |
| 297 | Cyanosis | FAERS: 10 | US FAERS | |
| 298 | Cystitis | FAERS: 10 | US FAERS | |
| 299 | Drug level changed | FAERS: 10 | US FAERS | |
| 300 | Drug prescribing error | FAERS: 10 | US FAERS | |
| 301 | General physical condition abnormal | FAERS: 10 | US FAERS | |
| 302 | Illness anxiety disorder | FAERS: 10 | US FAERS | |
| 303 | Inappropriate schedule of product administration | FAERS: 10 | US FAERS | |
| 304 | Intentional product use issue | FAERS: 10 | US FAERS | |
| 305 | Muscle Rigidity | FAERS: 10 | US FAERS | |
| 306 | Neutrophil count decreased | FAERS: 10 | US FAERS | |
| 307 | Overweight | FAERS: 10 | US FAERS | |
| 308 | Panic Disorder | FAERS: 10 | US FAERS | |
| 309 | Periarthritis | FAERS: 10 | US FAERS | |
| 310 | Product solubility abnormal | FAERS: 10 | US FAERS | |
| 311 | Sneezing | FAERS: 10 | US FAERS | |
| 312 | Alopecia Areata | FAERS: 9 | US FAERS | |
| 313 | Ankle Fracture | FAERS: 9 | US FAERS | |
| 314 | Antisocial Personality Disorder | FAERS: 9 | US FAERS | |
| 315 | Blood creatine increased | FAERS: 9 | US FAERS | |
| 316 | Chromaturia | FAERS: 9 | US FAERS | |
| 317 | Congenital Hypothyroidism | FAERS: 9 | US FAERS | |
| 318 | Fear-related avoidance of activities | FAERS: 9 | US FAERS | |
| 319 | Grip strength decreased | FAERS: 9 | US FAERS | |
| 320 | Hemiparesis | FAERS: 9 | US FAERS | |
| 321 | Hepatitis | FAERS: 9 | US FAERS | |
| 322 | Hypertrichosis | FAERS: 9 | US FAERS | |
| 323 | Infection | FAERS: 9 | US FAERS | |
| 324 | Intestinal Obstruction | FAERS: 9 | US FAERS | |
| 325 | Morose | FAERS: 9 | US FAERS | |
| 326 | Skin reaction | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 327 | Thyroid Neoplasm | FAERS: 9 | US FAERS | |
| 328 | Thyroxine free abnormal | FAERS: 9 | US FAERS | |
| 329 | Urinary Retention | FAERS: 9 | US FAERS | |
| 330 | Abulia | FAERS: 8 | US FAERS | |
| 331 | Acute kidney injury | FAERS: 8 | US FAERS | |
| 332 | Allergic reaction to excipient | FAERS: 8 | US FAERS | |
| 333 | Anosmia | FAERS: 8 | US FAERS | |
| 334 | Blood alkaline phosphatase increased | FAERS: 8 | US FAERS | |
| 335 | Blood parathyroid hormone increased | FAERS: 8 | US FAERS | |
| 336 | Cataract | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 337 | Congenital hyperthyroidism | FAERS: 8 | US FAERS | |
| 338 | Drug level fluctuating | FAERS: 8 | US FAERS | |
| 339 | Eye Burns | FAERS: 8 | US FAERS | |
| 340 | Gastric ulcer | FAERS: 8 | US FAERS | |
| 341 | Gastroenteritis | FAERS: 8 | US FAERS | |
| 342 | Glossitis | FAERS: 8 | US FAERS | |
| 343 | Hyperventilation | FAERS: 8 | US FAERS | |
| 344 | Lactose Intolerance | FAERS: 8 | US FAERS | |
| 345 | Nocturia | FAERS: 8 | US FAERS | |
| 346 | Oropharyngeal discomfort | FAERS: 8 | US FAERS | |
| 347 | Pericarditis | FAERS: 8 | US FAERS | |
| 348 | Pharyngitis | FAERS: 8 | US FAERS | |
| 349 | Pre-existing condition improved | FAERS: 8 | US FAERS | |
| 350 | Rheumatoid Arthritis | FAERS: 8 | US FAERS | |
| 351 | Saliva altered | FAERS: 8 | US FAERS | |
| 352 | Tachyarrhythmia | FAERS: 8 | US FAERS | |
| 353 | Walking aid user | FAERS: 8 | US FAERS | |
| 354 | treatment failure | FAERS: 8 | US FAERS | |
| 355 | Abasia | FAERS: 7 | US FAERS | |
| 356 | Blood 25-hydroxycholecalciferol decreased | FAERS: 7 | US FAERS | |
| 357 | Blood alkaline phosphatase decreased | FAERS: 7 | US FAERS | |
| 358 | Blood count abnormal | FAERS: 7 | US FAERS | |
| 359 | Blood glucose decreased | FAERS: 7 | US FAERS | |
| 360 | Cholelithiasis | FAERS: 7 | US FAERS | |
| 361 | Clumsiness | FAERS: 7 | US FAERS | |
| 362 | Coronary Artery Disease | FAERS: 7 | US FAERS | |
| 363 | Creatinine renal clearance decreased | FAERS: 7 | US FAERS | |
| 364 | Decreased immune responsiveness | FAERS: 7 | US FAERS | |
| 365 | Drug toxicity | FAERS: 7 | US FAERS | |
| 366 | Dysentery | FAERS: 7 | US FAERS | |
| 367 | Ecchymosis | FAERS: 7 | US FAERS | |
| 368 | Emotional poverty | FAERS: 7 | US FAERS | |
| 369 | Fracture | FAERS: 7 | US FAERS | |
| 370 | Gingivitis | FAERS: 7 | US FAERS | |
| 371 | Gluten sensitivity | FAERS: 7 | US FAERS | |
| 372 | Idiosyncratic drug reaction | FAERS: 7 | US FAERS | |
| 373 | Incorrect product storage | FAERS: 7 | US FAERS | |
| 374 | Infarction | FAERS: 7 | US FAERS | |
| 375 | Intentional drug misuse | FAERS: 7 | US FAERS | |
| 376 | Intestinal transit time abnormal | FAERS: 7 | US FAERS | |
| 377 | Joint injury | FAERS: 7 | US FAERS | |
| 378 | Lipase increased | FAERS: 7 | US FAERS | |
| 379 | Maternal exposure timing unspecified | FAERS: 7 | US FAERS | |
| 380 | Neutropenia | FAERS: 7 | US FAERS | |
| 381 | Phlebitis | FAERS: 7 | US FAERS | |
| 382 | Pre-Eclampsia | FAERS: 7 | US FAERS | |
| 383 | Product counterfeit | FAERS: 7 | US FAERS | |
| 384 | Product use issue | FAERS: 7 | US FAERS | |
| 385 | Sjogren's Syndrome | FAERS: 7 | US FAERS | |
| 386 | Somatic symptom disorder | FAERS: 7 | US FAERS | |
| 387 | Stomatitis | FAERS: 7 | US FAERS | |
| 388 | Suspected counterfeit product | FAERS: 7 | US FAERS | |
| 389 | Tension Headache | FAERS: 7 | US FAERS | |
| 390 | Thermal burn | FAERS: 7 | US FAERS | |
| 391 | Tongue discomfort | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 392 | Vitamin D Deficiency | FAERS: 7 | US FAERS | |
| 393 | Apparent death | FAERS: 6 | US FAERS | |
| 394 | Atrial Flutter | FAERS: 6 | US FAERS | |
| 395 | Blepharospasm | FAERS: 6 | US FAERS | |
| 396 | Blood prolactin increased | FAERS: 6 | US FAERS | |
| 397 | Blood sodium decreased | FAERS: 6 | US FAERS | |
| 398 | Body temperature fluctuation | FAERS: 6 | US FAERS | |
| 399 | Bowel movement irregularity | FAERS: 6 | US FAERS | |
| 400 | Cholestasis | FAERS: 6 | US FAERS | |
| 401 | Choreoathetosis | FAERS: 6 | US FAERS | |
| 402 | Cortisol increased | FAERS: 6 | US FAERS | |
| 403 | Dark circles under eyes | FAERS: 6 | US FAERS | |
| 404 | Delirium | FAERS: 6 | US FAERS | |
| 405 | Dermatitis | FAERS: 6 | US FAERS | |
| 406 | Diplegia | FAERS: 6 | US FAERS | |
| 407 | Epicondylitis | FAERS: 6 | US FAERS | |
| 408 | Gastric pH decreased | FAERS: 6 | US FAERS | |
| 409 | Glaucoma | FAERS: 6 | US FAERS | |
| 410 | Hernia | FAERS: 6 | US FAERS | |
| 411 | Hypothalamo-pituitary disorder | FAERS: 6 | US FAERS | |
| 412 | Ligament pain | FAERS: 6 | US FAERS | |
| 413 | Monocyte count decreased | FAERS: 6 | US FAERS | |
| 414 | Monoplegia | FAERS: 6 | US FAERS | |
| 415 | Mouth swelling | FAERS: 6 | US FAERS | |
| 416 | Myocarditis | FAERS: 6 | US FAERS | |
| 417 | Nephrolithiasis | FAERS: 6 | US FAERS | |
| 418 | Obesity | FAERS: 6 | US FAERS | |
| 419 | Osteopenia | FAERS: 6 | US FAERS | |
| 420 | Polydipsia | FAERS: 6 | US FAERS | |
| 421 | Polyhydramnios | FAERS: 6 | US FAERS | |
| 422 | Product size issue | FAERS: 6 | US FAERS | |
| 423 | Protein total decreased | FAERS: 6 | US FAERS | |
| 424 | Proteinuria | FAERS: 6 | US FAERS | |
| 425 | Pulmonary pain | FAERS: 6 | US FAERS | |
| 426 | Respiratory Failure | FAERS: 6 | US FAERS | |
| 427 | Skin lesion | FAERS: 6 | US FAERS | |
| 428 | Snoring | FAERS: 6 | US FAERS | |
| 429 | Synovial Cyst | FAERS: 6 | US FAERS | |
| 430 | Transaminases increased | FAERS: 6 | US FAERS | |
| 431 | Tri-iodothyronine abnormal | FAERS: 6 | US FAERS | |
| 432 | jaundice | FAERS: 6 | US FAERS | |
| 433 | Acute myocardial infarction | FAERS: 5 | US FAERS | |
| 434 | Adjustment disorder with depressed mood | FAERS: 5 | US FAERS | |
| 435 | Agoraphobia | FAERS: 5 | US FAERS | |
| 436 | Blood cholesterol | FAERS: 5 | US FAERS | |
| 437 | Blood creatinine decreased | FAERS: 5 | US FAERS | |
| 438 | Blood potassium decreased | FAERS: 5 | US FAERS | |
| 439 | Blood urea increased | FAERS: 5 | US FAERS | |
| 440 | Bone density decreased | FAERS: 5 | US FAERS | |
| 441 | Breast tenderness | FAERS: 5 | US FAERS | |
| 442 | Cerebral disorder | FAERS: 5 | US FAERS | |
| 443 | Conjunctivitis | FAERS: 5 | US FAERS | |
| 444 | Depression suicidal | FAERS: 5 | US FAERS | |
| 445 | Disease Progression | FAERS: 5 | US FAERS | |
| 446 | Disease recurrence | FAERS: 5 | US FAERS | |
| 447 | Drug administration error | FAERS: 5 | US FAERS | |
| 448 | Ear congestion | FAERS: 5 | US FAERS | |
| 449 | Economic problem | FAERS: 5 | US FAERS | |
| 450 | Expired drug administered | FAERS: 5 | US FAERS | |
| 451 | Extra dose administered | FAERS: 5 | US FAERS | |
| 452 | Feelings of worthlessness | FAERS: 5 | US FAERS | |
| 453 | Fibrin D dimer increased | FAERS: 5 | US FAERS | |
| 454 | Food craving | FAERS: 5 | US FAERS | |
| 455 | Heat Stroke | FAERS: 5 | US FAERS | |
| 456 | Hemiplegia | FAERS: 5 | US FAERS | |
| 457 | Hepatomegaly | FAERS: 5 | US FAERS | |
| 458 | Hyperphagia | FAERS: 5 | US FAERS | |
| 459 | Hyporeflexia | FAERS: 5 | US FAERS | |
| 460 | Hypoxia | FAERS: 5 | US FAERS | |
| 461 | Immobile | FAERS: 5 | US FAERS | |
| 462 | Inappropriate affect | FAERS: 5 | US FAERS | |
| 463 | Incoherent | FAERS: 5 | US FAERS | |
| 464 | Infertility | FAERS: 5 | US FAERS | |
| 465 | Intercepted drug dispensing error | FAERS: 5 | US FAERS | |
| 466 | Iron deficiency | FAERS: 5 | US FAERS | |
| 467 | Maternal exposure before pregnancy | FAERS: 5 | US FAERS | |
| 468 | Mental status changes | FAERS: 5 | US FAERS | |
| 469 | Nerve injury | FAERS: 5 | US FAERS | |
| 470 | Oral pain | FAERS: 5 | US FAERS | |
| 471 | Performance status decreased | FAERS: 5 | US FAERS | |
| 472 | Persistent depressive disorder | FAERS: 5 | US FAERS | |
| 473 | Polyarthritis | FAERS: 5 | US FAERS | |
| 474 | Product dose omission | FAERS: 5 | US FAERS | |
| 475 | Product packaging issue | FAERS: 5 | US FAERS | |
| 476 | Productive Cough | FAERS: 5 | US FAERS | |
| 477 | Pulmonary Hypertension | FAERS: 5 | US FAERS | |
| 478 | Pyelonephritis | FAERS: 5 | US FAERS | |
| 479 | Rosacea | FAERS: 5 | US FAERS | |
| 480 | Scab | FAERS: 5 | US FAERS | |
| 481 | Skin irritation | FAERS: 5 | US FAERS | |
| 482 | Slow response to stimuli | FAERS: 5 | US FAERS | |
| 483 | Status Epilepticus | FAERS: 5 | US FAERS | |
| 484 | Sudden onset of sleep | FAERS: 5 | US FAERS | |
| 485 | Tetany | FAERS: 5 | US FAERS | |
| 486 | Therapeutic product effect decreased | FAERS: 5 | US FAERS | |
| 487 | Thrombosis | FAERS: 5 | US FAERS | |
| 488 | Thyroiditis | FAERS: 5 | US FAERS | |
| 489 | Trismus | FAERS: 5 | US FAERS | |
| 490 | Vulvovaginal burning sensation | FAERS: 5 | US FAERS | |
| 491 | Vulvovaginal mycotic infection | FAERS: 5 | US FAERS | |
| 492 | Wrong technique in drug usage process | FAERS: 5 | US FAERS | |
| 493 | Adnexa uteri pain | FAERS: 4 | US FAERS | |
| 494 | Anaphylactic shock | FAERS: 4 | US FAERS | |
| 495 | Anembryonic gestation | FAERS: 4 | US FAERS | |
| 496 | Anorectal discomfort | FAERS: 4 | US FAERS | |
| 497 | Anorexia | FAERS: 4 | US FAERS | |
| 498 | Antibody test abnormal | FAERS: 4 | US FAERS | |
| 499 | Apallic syndrome | FAERS: 4 | US FAERS | |
| 500 | Bed rest | FAERS: 4 | US FAERS | |
| 501 | Bilirubin conjugated increased | FAERS: 4 | US FAERS | |
| 502 | Blood iron decreased | FAERS: 4 | US FAERS | |
| 503 | Blood phosphorus decreased | FAERS: 4 | US FAERS | |
| 504 | Blood triglycerides abnormal | FAERS: 4 | US FAERS | |
| 505 | Bradykinesia | FAERS: 4 | US FAERS | |
| 506 | Bruxism | FAERS: 4 | US FAERS | |
| 507 | Cellulitis | FAERS: 4 | US FAERS | |
| 508 | Claustrophobia | FAERS: 4 | US FAERS | |
| 509 | Completed Suicide | FAERS: 4 | US FAERS | |
| 510 | Conversion disorder | FAERS: 4 | US FAERS | |
| 511 | Cytomegalovirus test positive | FAERS: 4 | US FAERS | |
| 512 | Deep Vein Thrombosis | FAERS: 4 | US FAERS | |
| 513 | Drug effect delayed | FAERS: 4 | US FAERS | |
| 514 | Drug level increased | FAERS: 4 | US FAERS | |
| 515 | Drug resistance | FAERS: 4 | US FAERS | |
| 516 | Dyspareunia | FAERS: 4 | US FAERS | |
| 517 | Endometriosis | FAERS: 4 | US FAERS | |
| 518 | Enuresis | FAERS: 4 | US FAERS | |
| 519 | Erysipelas | FAERS: 4 | US FAERS | |
| 520 | Flank Pain | FAERS: 4 | US FAERS | |
| 521 | Foreign body sensation in eyes | FAERS: 4 | US FAERS | |
| 522 | Gamma-glutamyltransferase decreased | FAERS: 4 | US FAERS | |
| 523 | Gene Mutation | FAERS: 4 | US FAERS | |
| 524 | Growth retardation | FAERS: 4 | US FAERS | |
| 525 | Hypohidrosis | FAERS: 4 | US FAERS | |
| 526 | Hypophagia | FAERS: 4 | US FAERS | |
| 527 | Impaired self-care | FAERS: 4 | US FAERS | |
| 528 | Intercepted medication error | FAERS: 4 | US FAERS | |
| 529 | Labile blood pressure | FAERS: 4 | US FAERS | |
| 530 | Mastication disorder | FAERS: 4 | US FAERS | |
| 531 | Maternal exposure during delivery | FAERS: 4 | US FAERS | |
| 532 | Medication residue | FAERS: 4 | US FAERS | |
| 533 | Mineral deficiency | FAERS: 4 | US FAERS | |
| 534 | Myopia | FAERS: 4 | US FAERS | |
| 535 | Neonatal disorder | FAERS: 4 | US FAERS | |
| 536 | Neonatal thyrotoxicosis | FAERS: 4 | US FAERS | |
| 537 | Noninfective gingivitis | FAERS: 4 | US FAERS | |
| 538 | Nonspecific reaction | FAERS: 4 | US FAERS | |
| 539 | Oligohydramnios | FAERS: 4 | US FAERS | |
| 540 | Oral fungal infection | FAERS: 4 | US FAERS | |
| 541 | Pericardial effusion | FAERS: 4 | US FAERS | |
| 542 | Poisoning | FAERS: 4 | US FAERS | |
| 543 | Post procedural complication | FAERS: 4 | US FAERS | |
| 544 | Pregnancy | FAERS: 4 | US FAERS | |
| 545 | Product use complaint | FAERS: 4 | US FAERS | |
| 546 | Pulmonary Fibrosis | FAERS: 4 | US FAERS | |
| 547 | Regurgitation | FAERS: 4 | US FAERS | |
| 548 | Rhabdomyolysis | FAERS: 4 | US FAERS | |
| 549 | Rhinitis | FAERS: 4 | US FAERS | |
| 550 | Sexual Dysfunction | FAERS: 4 | US FAERS | |
| 551 | Sexual inhibition | FAERS: 4 | US FAERS | |
| 552 | Skin Wrinkling | FAERS: 4 | US FAERS | |
| 553 | Somnambulism | FAERS: 4 | US FAERS | |
| 554 | Stevens-Johnson Syndrome | FAERS: 4 | US FAERS | |
| 555 | Strabismus | FAERS: 4 | US FAERS | |
| 556 | Stress at work | FAERS: 4 | US FAERS | |
| 557 | Tachyphrenia | FAERS: 4 | US FAERS | |
| 558 | Thrombocytopenia | FAERS: 4 | US FAERS | |
| 559 | Thrombophlebitis | FAERS: 4 | US FAERS | |
| 560 | Thyroid atrophy | FAERS: 4 | US FAERS | |
| 561 | Thyroid hormones decreased | FAERS: 4 | US FAERS | |
| 562 | Time perception altered | FAERS: 4 | US FAERS | |
| 563 | Transferrin saturation increased | FAERS: 4 | US FAERS | |
| 564 | Tri-iodothyronine free abnormal | FAERS: 4 | US FAERS | |
| 565 | Vaginal Discharge | FAERS: 4 | US FAERS | |
| 566 | Vasculitis | FAERS: 4 | US FAERS | |
| 567 | Violence-related symptom | FAERS: 4 | US FAERS | |
| 568 | Vitreous Detachment | FAERS: 4 | US FAERS | |
| 569 | Yawning | FAERS: 4 | US FAERS | |
| 570 | Abdominal mass | FAERS: 3 | US FAERS | |
| 571 | Abortion early | FAERS: 3 | US FAERS | |
| 572 | Anal Fissure | FAERS: 3 | US FAERS | |
| 573 | Ascites | FAERS: 3 | US FAERS | |
| 574 | Atrioventricular Block | FAERS: 3 | US FAERS | |
| 575 | Aversion | FAERS: 3 | US FAERS | |
| 576 | Biliary Colic | FAERS: 3 | US FAERS | |
| 577 | Blood chloride decreased | FAERS: 3 | US FAERS | |
| 578 | Blood cholesterol abnormal | FAERS: 3 | US FAERS | |
| 579 | Blood glucose fluctuation | FAERS: 3 | US FAERS | |
| 580 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 581 | Blood parathyroid hormone decreased | FAERS: 3 | US FAERS | |
| 582 | Blood phosphorus increased | FAERS: 3 | US FAERS | |
| 583 | Blood sodium increased | FAERS: 3 | US FAERS | |
| 584 | Blood uric acid decreased | FAERS: 3 | US FAERS | |
| 585 | Blood urine present | FAERS: 3 | US FAERS | |
| 586 | Bronchial Obstruction | FAERS: 3 | US FAERS | |
| 587 | Bronchitis | FAERS: 3 | US FAERS | |
| 588 | Cachexia | FAERS: 3 | US FAERS | |
| 589 | Cardiomegaly | FAERS: 3 | US FAERS | |
| 590 | Carotid pulse abnormal | FAERS: 3 | US FAERS | |
| 591 | Cervicobrachial syndrome | FAERS: 3 | US FAERS | |
| 592 | Coagulation factor IX level increased | FAERS: 3 | US FAERS | |
| 593 | Coagulation factor VIII level increased | FAERS: 3 | US FAERS | |
| 594 | Coagulation factor X level increased | FAERS: 3 | US FAERS | |
| 595 | Dementia | FAERS: 3 | US FAERS | |
| 596 | Dermatitis acneiform | FAERS: 3 | US FAERS | |
| 597 | Diabetes Insipidus | FAERS: 3 | US FAERS | |
| 598 | Drug exposure via breast milk | FAERS: 3 | US FAERS | |
| 599 | Dysphemia | FAERS: 3 | US FAERS | |
| 600 | Dystonia | FAERS: 3 | US FAERS | |
| 601 | Electrocardiogram abnormal | FAERS: 3 | US FAERS | |
| 602 | Eosinophilia | FAERS: 3 | US FAERS | |
| 603 | Exposure via father | FAERS: 3 | US FAERS | |
| 604 | Eyelid Function Disorder | FAERS: 3 | US FAERS | |
| 605 | Facial Neuralgia | FAERS: 3 | US FAERS | |
| 606 | Facial Pain | FAERS: 3 | US FAERS | |
| 607 | Fasciitis | FAERS: 3 | US FAERS | |
| 608 | Foreign body in respiratory tract | FAERS: 3 | US FAERS | |
| 609 | Foreign body trauma | FAERS: 3 | US FAERS | |
| 610 | Gastric Dilatation | FAERS: 3 | US FAERS | |
| 611 | Gastrointestinal carcinoma | FAERS: 3 | US FAERS | |
| 612 | Hirsutism | FAERS: 3 | US FAERS | |
| 613 | Hypercapnia | FAERS: 3 | US FAERS | |
| 614 | Hyperreflexia | FAERS: 3 | US FAERS | |
| 615 | Hypomania | FAERS: 3 | US FAERS | |
| 616 | Hypometabolism | FAERS: 3 | US FAERS | |
| 617 | Incontinence | FAERS: 3 | US FAERS | |
| 618 | Incorrect drug dosage form administered | FAERS: 3 | US FAERS | |
| 619 | Increased tendency to bruise | FAERS: 3 | US FAERS | |
| 620 | Increased upper airway secretion | FAERS: 3 | US FAERS | |
| 621 | Intentional self-injury | FAERS: 3 | US FAERS | |
| 622 | Investigation abnormal | FAERS: 3 | US FAERS | |
| 623 | Laziness | FAERS: 3 | US FAERS | |
| 624 | Leukopenia | FAERS: 3 | US FAERS | |
| 625 | Lichen Planus | FAERS: 3 | US FAERS | |
| 626 | Living Alone | FAERS: 3 | US FAERS | |
| 627 | Menopause | FAERS: 3 | US FAERS | |
| 628 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 629 | Milk Allergy | FAERS: 3 | US FAERS | |
| 630 | Multiple Sclerosis | FAERS: 3 | US FAERS | |
| 631 | Mydriasis | FAERS: 3 | US FAERS | |
| 632 | Narcolepsy | FAERS: 3 | US FAERS | |
| 633 | Neonatal tachycardia | FAERS: 3 | US FAERS | |
| 634 | Ocular Rosacea | FAERS: 3 | US FAERS | |
| 635 | Oral pruritus | FAERS: 3 | US FAERS | |
| 636 | Oropharyngeal swelling | FAERS: 3 | US FAERS | |
| 637 | Osteitis | FAERS: 3 | US FAERS | |
| 638 | Plasminogen activator inhibitor increased | FAERS: 3 | US FAERS | |
| 639 | Prescribed overdose | FAERS: 3 | US FAERS | |
| 640 | Product blister packaging issue | FAERS: 3 | US FAERS | |
| 641 | Product complaint | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 642 | Product dispensing error | FAERS: 3 | US FAERS | |
| 643 | Product packaging confusion | FAERS: 3 | US FAERS | |
| 644 | Product storage error | FAERS: 3 | US FAERS | |
| 645 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 646 | Psychomotor skills impaired | FAERS: 3 | US FAERS | |
| 647 | Renal Colic | FAERS: 3 | US FAERS | |
| 648 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 649 | Respiratory tract congestion | FAERS: 3 | US FAERS | |
| 650 | Rheumatic disorder | FAERS: 3 | US FAERS | |
| 651 | Rotator cuff syndrome | FAERS: 3 | US FAERS | |
| 652 | Sarcoidosis | FAERS: 3 | US FAERS | |
| 653 | Screaming | FAERS: 3 | US FAERS | |
| 654 | Secretion discharge | FAERS: 3 | US FAERS | |
| 655 | Sepsis | FAERS: 3 | US FAERS | |
| 656 | Skin discomfort | FAERS: 3 | US FAERS | |
| 657 | Stillbirth | FAERS: 3 | US FAERS | |
| 658 | Subileus | FAERS: 3 | US FAERS | |
| 659 | Suppressed lactation | FAERS: 3 | US FAERS | |
| 660 | Tablet physical issue | FAERS: 3 | US FAERS | |
| 661 | Tendon discomfort | FAERS: 3 | US FAERS | |
| 662 | Therapy cessation | FAERS: 3 | US FAERS | |
| 663 | Thermophobia | FAERS: 3 | US FAERS | |
| 664 | Ultrasound antenatal screen | FAERS: 3 | US FAERS | |
| 665 | Uterine Cancer | FAERS: 3 | US FAERS | |
| 666 | Vestibular Neuronitis | FAERS: 3 | US FAERS | |
| 667 | Von Willebrand's factor activity increased | FAERS: 3 | US FAERS | |
| 668 | Von Willebrand's factor antigen increased | FAERS: 3 | US FAERS | |
| 669 | Xerosis | FAERS: 3 | US FAERS | |
| 670 | Abscess | FAERS: 2 | US FAERS | |
| 671 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 672 | Acidosis | FAERS: 2 | US FAERS | |
| 673 | Acute psychosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 674 | Allergy to chemicals | FAERS: 2 | US FAERS | |
| 675 | Alpha 2 globulin increased | FAERS: 2 | US FAERS | |
| 676 | Amniotic fluid volume decreased | FAERS: 2 | US FAERS | |
| 677 | Aneurysm | FAERS: 2 | US FAERS | |
| 678 | Anti-transglutaminase antibody increased | FAERS: 2 | US FAERS | |
| 679 | Aspartate aminotransferase decreased | FAERS: 2 | US FAERS | |
| 680 | Ataxia | FAERS: 2 | US FAERS | |
| 681 | Autophobia | FAERS: 2 | US FAERS | |
| 682 | Back disorder | FAERS: 2 | US FAERS | |
| 683 | Biochemical pregnancy | FAERS: 2 | US FAERS | |
| 684 | Bipolar I disorder | FAERS: 2 | US FAERS | |
| 685 | Blood 1,25-dihydroxycholecalciferol decreased | FAERS: 2 | US FAERS | |
| 686 | Blood albumin decreased | FAERS: 2 | US FAERS | |
| 687 | Blood bicarbonate abnormal | FAERS: 2 | US FAERS | |
| 688 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 689 | Blood immunoglobulin A increased | FAERS: 2 | US FAERS | |
| 690 | Blood insulin abnormal | FAERS: 2 | US FAERS | |
| 691 | Blood iron increased | FAERS: 2 | US FAERS | |
| 692 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 693 | Blood magnesium increased | FAERS: 2 | US FAERS | |
| 694 | Blood prolactin decreased | FAERS: 2 | US FAERS | |
| 695 | Blood thrombin increased | FAERS: 2 | US FAERS | |
| 696 | Bone density abnormal | FAERS: 2 | US FAERS | |
| 697 | Boredom | FAERS: 2 | US FAERS | |
| 698 | Breast discomfort | FAERS: 2 | US FAERS | |
| 699 | Breech Presentation | FAERS: 2 | US FAERS | |
| 700 | Bronchial Hyperreactivity | FAERS: 2 | US FAERS | |
| 701 | Burning Mouth Syndrome | FAERS: 2 | US FAERS | |
| 702 | C-reactive protein abnormal | FAERS: 2 | US FAERS | |
| 703 | Carcinoembryonic antigen increased | FAERS: 2 | US FAERS | |
| 704 | Cardiac dysfunction | FAERS: 2 | US FAERS | |
| 705 | Cardiac enzymes increased | FAERS: 2 | US FAERS | |
| 706 | Cardiovascular insufficiency | FAERS: 2 | US FAERS | |
| 707 | Cell Death | FAERS: 2 | US FAERS | |
| 708 | Cheilitis | FAERS: 2 | US FAERS | |
| 709 | Cleft Palate | FAERS: 2 | US FAERS | |
| 710 | Corrective lens user | FAERS: 2 | US FAERS | |
| 711 | Cortisol decreased | FAERS: 2 | US FAERS | |
| 712 | Counterfeit drug administered | FAERS: 2 | US FAERS | |
| 713 | Creatinine urine decreased | FAERS: 2 | US FAERS | |
| 714 | Cronkhite-Canada Syndrome | FAERS: 2 | US FAERS | |
| 715 | Cyst | FAERS: 2 | US FAERS | |
| 716 | Dehydroepiandrosterone increased | FAERS: 2 | US FAERS | |
| 717 | Dengue Fever | FAERS: 2 | US FAERS | |
| 718 | Dependent Personality Disorder | FAERS: 2 | US FAERS | |
| 719 | Device loosening | FAERS: 2 | US FAERS | |
| 720 | Disseminated Intravascular Coagulation | FAERS: 2 | US FAERS | |
| 721 | Dissociation | FAERS: 2 | US FAERS | |
| 722 | Diverticulitis | FAERS: 2 | US FAERS | |
| 723 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 724 | Dyschezia | FAERS: 2 | US FAERS | |
| 725 | Dyslexia | FAERS: 2 | US FAERS | |
| 726 | Ectopic Pregnancy | FAERS: 2 | US FAERS | |
| 727 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 728 | Embolism | FAERS: 2 | US FAERS | |
| 729 | Endometrial Hyperplasia | FAERS: 2 | US FAERS | |
| 730 | Erythema Nodosum | FAERS: 2 | US FAERS | |
| 731 | Essential Hypertension | FAERS: 2 | US FAERS | |
| 732 | Extraocular Muscle Paresis | FAERS: 2 | US FAERS | |
| 733 | Eye Infection | FAERS: 2 | US FAERS | |
| 734 | Eye inflammation | FAERS: 2 | US FAERS | |
| 735 | Eyelid skin dryness | FAERS: 2 | US FAERS | |
| 736 | Eyelids pruritus | FAERS: 2 | US FAERS | |
| 737 | Facial asymmetry | FAERS: 2 | US FAERS | |
| 738 | Flat affect | FAERS: 2 | US FAERS | |
| 739 | Foaming at mouth | FAERS: 2 | US FAERS | |
| 740 | Food Poisoning | FAERS: 2 | US FAERS | |
| 741 | Frustration | FAERS: 2 | US FAERS | |
| 742 | Gangrene | FAERS: 2 | US FAERS | |
| 743 | Gastrointestinal hypomotility | FAERS: 2 | US FAERS | |
| 744 | Gastrointestinal sounds abnormal | FAERS: 2 | US FAERS | |
| 745 | Genital Herpes | FAERS: 2 | US FAERS | |
| 746 | Glycosuria | FAERS: 2 | US FAERS | |
| 747 | Gout | FAERS: 2 | US FAERS | |
| 748 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 749 | Hair growth rate abnormal | FAERS: 2 | US FAERS | |
| 750 | Hair injury | FAERS: 2 | US FAERS | |
| 751 | Hallucinations, mixed | FAERS: 2 | US FAERS | |
| 752 | Hemiparaesthesia | FAERS: 2 | US FAERS | |
| 753 | Hepatic calcification | FAERS: 2 | US FAERS | |
| 754 | Hepatitis A antibody positive | FAERS: 2 | US FAERS | |
| 755 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 756 | Hostility | FAERS: 2 | US FAERS | |
| 757 | Hydronephrosis | FAERS: 2 | US FAERS | |
| 758 | Hypertransaminasaemia | FAERS: 2 | US FAERS | |
| 759 | Hypogonadism | FAERS: 2 | US FAERS | |
| 760 | Hypopituitarism | FAERS: 2 | US FAERS | |
| 761 | Hyporesponsive to stimuli | FAERS: 2 | US FAERS | |
| 762 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 763 | Increased viscosity of upper respiratory secretion | FAERS: 2 | US FAERS | |
| 764 | Infectious Mononucleosis | FAERS: 2 | US FAERS | |
| 765 | Inflammatory pain | FAERS: 2 | US FAERS | |
| 766 | Injection site bruising | FAERS: 2 | US FAERS | |
| 767 | Injection site erythema | FAERS: 2 | US FAERS | |
| 768 | Injection site mass | FAERS: 2 | US FAERS | |
| 769 | Insurance issue | FAERS: 2 | US FAERS | |
| 770 | Intercepted drug administration error | FAERS: 2 | US FAERS | |
| 771 | Irregular sleep phase | FAERS: 2 | US FAERS | |
| 772 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 773 | Laryngeal discomfort | FAERS: 2 | US FAERS | |
| 774 | Lateral Medullary Syndrome | FAERS: 2 | US FAERS | |
| 775 | Magnesium Deficiency | FAERS: 2 | US FAERS | |
| 776 | Maternal exposure during breast feeding | FAERS: 2 | US FAERS | |
| 777 | Medication residue present | FAERS: 2 | US FAERS | |
| 778 | Meningioma | FAERS: 2 | US FAERS | |
| 779 | Metamorphopsia | FAERS: 2 | US FAERS | |
| 780 | Micturition frequency decreased | FAERS: 2 | US FAERS | |
| 781 | Misophonia | FAERS: 2 | US FAERS | |
| 782 | Moaning | FAERS: 2 | US FAERS | |
| 783 | Multiple Chemical Sensitivity | FAERS: 2 | US FAERS | |
| 784 | Multiple allergies | FAERS: 2 | US FAERS | |
| 785 | Multiple sclerosis relapse | FAERS: 2 | US FAERS | |
| 786 | Muscle Spasticity | FAERS: 2 | US FAERS | |
| 787 | Mutism | FAERS: 2 | US FAERS | |
| 788 | Myasthenia Gravis | FAERS: 2 | US FAERS | |
| 789 | Myoclonus | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 790 | Myositis | FAERS: 2 | US FAERS | |
| 791 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 792 | Neonatal aspiration | FAERS: 2 | US FAERS | |
| 793 | Neonatal intestinal dilatation | FAERS: 2 | US FAERS | |
| 794 | Nystagmus | FAERS: 2 | US FAERS | |
| 795 | Obsessive thoughts | FAERS: 2 | US FAERS | |
| 796 | Ocular vascular disorder | FAERS: 2 | US FAERS | |
| 797 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 798 | Oral infection | FAERS: 2 | US FAERS | |
| 799 | Paranoid Personality Disorder | FAERS: 2 | US FAERS | |
| 800 | Patent ductus arteriosus | FAERS: 2 | US FAERS | |
| 801 | Pathogen resistance | FAERS: 2 | US FAERS | |
| 802 | Periodontitis | FAERS: 2 | US FAERS | |
| 803 | Peripheral venous disease | FAERS: 2 | US FAERS | |
| 804 | Periphlebitis | FAERS: 2 | US FAERS | |
| 805 | Peritonitis | FAERS: 2 | US FAERS | |
| 806 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 807 | Phonophobia | FAERS: 2 | US FAERS | |
| 808 | Physical product label issue | FAERS: 2 | US FAERS | |
| 809 | Polymyalgia Rheumatica | FAERS: 2 | US FAERS | |
| 810 | Poor personal hygiene | FAERS: 2 | US FAERS | |
| 811 | Poor weight gain neonatal | FAERS: 2 | US FAERS | |
| 812 | Premenstrual syndrome | FAERS: 2 | US FAERS | |
| 813 | Product administration error | FAERS: 2 | US FAERS | |
| 814 | Product appearance confusion | FAERS: 2 | US FAERS | |
| 815 | Product commingling | FAERS: 2 | US FAERS | |
| 816 | Product difficult to swallow | FAERS: 2 | US FAERS | |
| 817 | Product label issue | FAERS: 2 | US FAERS | |
| 818 | Product lot number issue | FAERS: 2 | US FAERS | |
| 819 | Product prescribing error | FAERS: 2 | US FAERS | |
| 820 | Product tampering | FAERS: 2 | US FAERS | |
| 821 | Protein total increased | FAERS: 2 | US FAERS | |
| 822 | Protein-losing gastroenteropathy | FAERS: 2 | US FAERS | |
| 823 | Pseudostroke | FAERS: 2 | US FAERS | |
| 824 | Psychiatric decompensation | FAERS: 2 | US FAERS | |
| 825 | Pubic pain | FAERS: 2 | US FAERS | |
| 826 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 827 | Quadriplegia | FAERS: 2 | US FAERS | |
| 828 | Rales | FAERS: 2 | US FAERS | |
| 829 | Reaction to azo-dyes | FAERS: 2 | US FAERS | |
| 830 | Rectal tenesmus | FAERS: 2 | US FAERS | |
| 831 | Reverse tri-iodothyronine increased | FAERS: 2 | US FAERS | |
| 832 | Schizophrenia | FAERS: 2 | US FAERS | |
| 833 | Secondary hyperthyroidism | FAERS: 2 | US FAERS | |
| 834 | Senile dementia | FAERS: 2 | US FAERS | |
| 835 | Septic Shock | FAERS: 2 | US FAERS | |
| 836 | Sinus bradycardia | FAERS: 2 | US FAERS | |
| 837 | Sopor | FAERS: 2 | US FAERS | |
| 838 | Spinal column injury | FAERS: 2 | US FAERS | |
| 839 | Spinal column stenosis | FAERS: 2 | US FAERS | |
| 840 | Stupor | FAERS: 2 | US FAERS | |
| 841 | Sudden death | FAERS: 2 | US FAERS | |
| 842 | Synovitis | FAERS: 2 | US FAERS | |
| 843 | Therapeutic product effect increased | FAERS: 2 | US FAERS | |
| 844 | Therapeutic response changed | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 845 | Throat cancer | FAERS: 2 | US FAERS | |
| 846 | Thrombocytosis | FAERS: 2 | US FAERS | |
| 847 | Thyroglossal Cyst | FAERS: 2 | US FAERS | |
| 848 | Thyroid stimulating immunoglobulin increased | FAERS: 2 | US FAERS | |
| 849 | Thyroidectomy | FAERS: 2 | US FAERS | |
| 850 | Thyrotoxic periodic paralysis | FAERS: 2 | US FAERS | |
| 851 | Tonsillitis | FAERS: 2 | US FAERS | |
| 852 | Tooth Erosion | FAERS: 2 | US FAERS | |
| 853 | Torticollis | FAERS: 2 | US FAERS | |
| 854 | Total cholesterol/HDL ratio decreased | FAERS: 2 | US FAERS | |
| 855 | Transcription medication error | FAERS: 2 | US FAERS | |
| 856 | Transient psychosis | FAERS: 2 | US FAERS | |
| 857 | Trisomy 21 | FAERS: 2 | US FAERS | |
| 858 | Ulcer | FAERS: 2 | US FAERS | |
| 859 | Upper-airway cough syndrome | FAERS: 2 | US FAERS | |
| 860 | Urinary hesitation | FAERS: 2 | US FAERS | |
| 861 | Urinary tract discomfort | FAERS: 2 | US FAERS | |
| 862 | Urine flow decreased | FAERS: 2 | US FAERS | |
| 863 | Uterine Polyp | FAERS: 2 | US FAERS | |
| 864 | Vaginal Prolapse | FAERS: 2 | US FAERS | |
| 865 | Vascular pain | FAERS: 2 | US FAERS | |
| 866 | Vasospasm | FAERS: 2 | US FAERS | |
| 867 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 868 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 869 | Visual brightness | FAERS: 2 | US FAERS | |
| 870 | Vitamin D abnormal | FAERS: 2 | US FAERS | |
| 871 | Vitiligo | FAERS: 2 | US FAERS | |
| 872 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 873 | Vocal Cord Paralysis | FAERS: 2 | US FAERS | |
| 874 | Vulvovaginal discomfort | FAERS: 2 | US FAERS | |
| 875 | Wrong dose | FAERS: 2 | US FAERS | |
| 876 | Xerophthalmia | FAERS: 2 | US FAERS | |
| 877 | furuncle | FAERS: 2 | US FAERS | |
| 878 | muscle injury | FAERS: 2 | US FAERS | |
| 879 | ABO incompatibility | FAERS: 1 | US FAERS | |
| 880 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 881 | Accidental exposure | FAERS: 1 | US FAERS | |
| 882 | Acoustic Neuroma | FAERS: 1 | US FAERS | |
| 883 | Acral overgrowth | FAERS: 1 | US FAERS | |
| 884 | Action Tremor | FAERS: 1 | US FAERS | |
| 885 | Acute prerenal failure | FAERS: 1 | US FAERS | |
| 886 | Adjusted calcium decreased | FAERS: 1 | US FAERS | |
| 887 | Adjustment disorder with mixed anxiety and depressed mood | FAERS: 1 | US FAERS | |
| 888 | Agitated depression | FAERS: 1 | US FAERS | |
| 889 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 890 | Agraphia | FAERS: 1 | US FAERS | |
| 891 | Alcohol Intolerance | FAERS: 1 | US FAERS | |
| 892 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 893 | Allergic respiratory symptom | FAERS: 1 | US FAERS | |
| 894 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 895 | Alopecia totalis | FAERS: 1 | US FAERS | |
| 896 | Alopecia universalis | FAERS: 1 | US FAERS | |
| 897 | Amaurosis | FAERS: 1 | US FAERS | |
| 898 | Amniotic fluid volume increased | FAERS: 1 | US FAERS | |
| 899 | Amyloidosis | FAERS: 1 | US FAERS | |
| 900 | Anal fungal infection | FAERS: 1 | US FAERS | |
| 901 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 902 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 903 | Aniridia | FAERS: 1 | US FAERS | |
| 904 | Anisocytosis | FAERS: 1 | US FAERS | |
| 905 | Ankylosing spondylitis | FAERS: 1 | US FAERS | |
| 906 | Anorexia Nervosa | FAERS: 1 | US FAERS | |
| 907 | Anorgasmia | FAERS: 1 | US FAERS | |
| 908 | Anti-aquaporin-4 antibody | FAERS: 1 | US FAERS | |
| 909 | Anti-thyroid antibody negative | FAERS: 1 | US FAERS | |
| 910 | Anti-transglutaminase antibody | FAERS: 1 | US FAERS | |
| 911 | Antibody test positive | FAERS: 1 | US FAERS | |
| 912 | Antigliadin antibody positive | FAERS: 1 | US FAERS | |
| 913 | Antiphospholipid Syndrome | FAERS: 1 | US FAERS | |
| 914 | Anuria | FAERS: 1 | US FAERS | |
| 915 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 916 | Apolipoprotein A-I decreased | FAERS: 1 | US FAERS | |
| 917 | Apolipoprotein B increased | FAERS: 1 | US FAERS | |
| 918 | Appendicitis | FAERS: 1 | US FAERS | |
| 919 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 920 | Arteritis | FAERS: 1 | US FAERS | |
| 921 | Arthrodesis | FAERS: 1 | US FAERS | |
| 922 | Atelectasis | FAERS: 1 | US FAERS | |
| 923 | Atopy | FAERS: 1 | US FAERS | |
| 924 | Aura | FAERS: 1 | US FAERS | |
| 925 | Automatic bladder | FAERS: 1 | US FAERS | |
| 926 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 927 | Avoidant Personality Disorder | FAERS: 1 | US FAERS | |
| 928 | Bacterial Vaginosis | FAERS: 1 | US FAERS | |
| 929 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 930 | Belligerence | FAERS: 1 | US FAERS | |
| 931 | Benign Neoplasm | FAERS: 1 | US FAERS | |
| 932 | Benign neoplasm of thyroid gland | FAERS: 1 | US FAERS | |
| 933 | Beta 2 microglobulin increased | FAERS: 1 | US FAERS | |
| 934 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 935 | Bladder neck sclerosis | FAERS: 1 | US FAERS | |
| 936 | Bladder pain | FAERS: 1 | US FAERS | |
| 937 | Blepharochalasis | FAERS: 1 | US FAERS | |
| 938 | Blood 25-hydroxycholecalciferol increased | FAERS: 1 | US FAERS | |
| 939 | Blood albumin abnormal | FAERS: 1 | US FAERS | |
| 940 | Blood albumin increased | FAERS: 1 | US FAERS | |
| 941 | Blood alkaline phosphatase | FAERS: 1 | US FAERS | |
| 942 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 943 | Blood chloride abnormal | FAERS: 1 | US FAERS | |
| 944 | Blood chloride increased | FAERS: 1 | US FAERS | |
| 945 | Blood cortisol decreased | FAERS: 1 | US FAERS | |
| 946 | Blood cortisol increased | FAERS: 1 | US FAERS | |
| 947 | Blood creatine phosphokinase | FAERS: 1 | US FAERS | |
| 948 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 949 | Blood creatine phosphokinase abnormal | FAERS: 1 | US FAERS | |
| 950 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 951 | Blood fibrinogen increased | FAERS: 1 | US FAERS | |
| 952 | Blood folate abnormal | FAERS: 1 | US FAERS | |
| 953 | Blood folate decreased | FAERS: 1 | US FAERS | |
| 954 | Blood immunoglobulin E abnormal | FAERS: 1 | US FAERS | |
| 955 | Blood immunoglobulin E increased | FAERS: 1 | US FAERS | |
| 956 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 957 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 958 | Body Temperature | FAERS: 1 | US FAERS | |
| 959 | Bone decalcification | FAERS: 1 | US FAERS | |
| 960 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 961 | Breast Cyst | FAERS: 1 | US FAERS | |
| 962 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 963 | Bronchopneumopathy | FAERS: 1 | US FAERS | |
| 964 | Bursitis | FAERS: 1 | US FAERS | |
| 965 | Calcium deficiency | FAERS: 1 | US FAERS | |
| 966 | Campylobacter infection | FAERS: 1 | US FAERS | |
| 967 | Cardiac neoplasm unspecified | FAERS: 1 | US FAERS | |
| 968 | Cardiac ventricular disorder | FAERS: 1 | US FAERS | |
| 969 | Carditis | FAERS: 1 | US FAERS | |
| 970 | Carotid artery aneurysm | FAERS: 1 | US FAERS | |
| 971 | Cavernous Sinus Thrombosis | FAERS: 1 | US FAERS | |
| 972 | Cerebellar stroke | FAERS: 1 | US FAERS | |
| 973 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 974 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 975 | Cholangitis | FAERS: 1 | US FAERS | |
| 976 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 977 | Cholecystitis | FAERS: 1 | US FAERS | |
| 978 | Cholestasis of pregnancy | FAERS: 1 | US FAERS | |
| 979 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 980 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 981 | Chronic throat clearing | FAERS: 1 | US FAERS | |
| 982 | Claudication of jaw muscles | FAERS: 1 | US FAERS | |
| 983 | Cluster Headache | FAERS: 1 | US FAERS | |
| 984 | Coating in mouth | FAERS: 1 | US FAERS | |
| 985 | Complicated fracture | FAERS: 1 | US FAERS | |
| 986 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 987 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 988 | Congenital Hydrocephalus | FAERS: 1 | US FAERS | |
| 989 | Congenital cystic lung | FAERS: 1 | US FAERS | |
| 990 | Congenital teratoma | FAERS: 1 | US FAERS | |
| 991 | Conjunctival irritation | FAERS: 1 | US FAERS | |
| 992 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 993 | Craniosynostosis | FAERS: 1 | US FAERS | |
| 994 | Crystal urine present | FAERS: 1 | US FAERS | |
| 995 | Cutis Laxa | FAERS: 1 | US FAERS | |
| 996 | Dacryocystitis | FAERS: 1 | US FAERS | |
| 997 | Dacryostenosis congenital | FAERS: 1 | US FAERS | |
| 998 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 999 | Decreased eye contact | FAERS: 1 | US FAERS | |
| 1000 | Deformity | FAERS: 1 | US FAERS | |
| 1001 | Dental caries | FAERS: 1 | US FAERS | |
| 1002 | Dental cyst | FAERS: 1 | US FAERS | |
| 1003 | Dependence | FAERS: 1 | US FAERS | |
| 1004 | Depressive delusion | FAERS: 1 | US FAERS | |
| 1005 | Dermatitis Herpetiformis | FAERS: 1 | US FAERS | |
| 1006 | Device deposit issue | FAERS: 1 | US FAERS | |
| 1007 | Device material issue | FAERS: 1 | US FAERS | |
| 1008 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 1009 | Diabetic foetopathy | FAERS: 1 | US FAERS | |
| 1010 | Diaphragmatic Hernia | FAERS: 1 | US FAERS | |
| 1011 | Disease complication | FAERS: 1 | US FAERS | |
| 1012 | Disease susceptibility | FAERS: 1 | US FAERS | |
| 1013 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 1014 | Drug Dependence | FAERS: 1 | US FAERS | |
| 1015 | Drug effect variable | FAERS: 1 | US FAERS | |
| 1016 | Drug name confusion | FAERS: 1 | US FAERS | |
| 1017 | Drug screen negative | FAERS: 1 | US FAERS | |
| 1018 | Drug titration error | FAERS: 1 | US FAERS | |
| 1019 | Drug withdrawal convulsions | FAERS: 1 | US FAERS | |
| 1020 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 1021 | Duodenitis | FAERS: 1 | US FAERS | |
| 1022 | Dysmorphism | FAERS: 1 | US FAERS | |
| 1023 | Ear canal injury | FAERS: 1 | US FAERS | |
| 1024 | Educational problem | FAERS: 1 | US FAERS | |
| 1025 | Electrocardiogram J wave abnormal | FAERS: 1 | US FAERS | |
| 1026 | Electrocardiogram ST segment abnormal | FAERS: 1 | US FAERS | |
| 1027 | Electrocardiogram ST-T segment abnormal | FAERS: 1 | US FAERS | |
| 1028 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 1029 | Elevated mood | FAERS: 1 | US FAERS | |
| 1030 | Encephalomyelitis | FAERS: 1 | US FAERS | |
| 1031 | Endolymphatic Hydrops | FAERS: 1 | US FAERS | |
| 1032 | Endometrial hypertrophy | FAERS: 1 | US FAERS | |
| 1033 | Endotracheal intubation complication | FAERS: 1 | US FAERS | |
| 1034 | Enlarged uvula | FAERS: 1 | US FAERS | |
| 1035 | Enterocolitis | FAERS: 1 | US FAERS | |
| 1036 | Enthesopathy | FAERS: 1 | US FAERS | |
| 1037 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 1038 | Epstein-Barr virus antibody positive | FAERS: 1 | US FAERS | |
| 1039 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 1040 | Escherichia test positive | FAERS: 1 | US FAERS | |
| 1041 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 1042 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 1043 | Excoriation | FAERS: 1 | US FAERS | |
| 1044 | Expiratory reserve volume decreased | FAERS: 1 | US FAERS | |
| 1045 | Exposure via blood | FAERS: 1 | US FAERS | |
| 1046 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 1047 | Exposure via skin contact | FAERS: 1 | US FAERS | |
| 1048 | Eye allergy | FAERS: 1 | US FAERS | |
| 1049 | Eyelid pain | FAERS: 1 | US FAERS | |
| 1050 | Fallopian tube obstruction | FAERS: 1 | US FAERS | |
| 1051 | Fear of weight gain | FAERS: 1 | US FAERS | |
| 1052 | Feeding disorder neonatal | FAERS: 1 | US FAERS | |
| 1053 | Fibroadenoma of breast | FAERS: 1 | US FAERS | |
| 1054 | Finger hypoplasia | FAERS: 1 | US FAERS | |
| 1055 | Flight of ideas | FAERS: 1 | US FAERS | |
| 1056 | Fontanelle depressed | FAERS: 1 | US FAERS | |
| 1057 | Fumbling | FAERS: 1 | US FAERS | |
| 1058 | Gastrointestinal disorder congenital | FAERS: 1 | US FAERS | |
| 1059 | Gastrointestinal hypermotility | FAERS: 1 | US FAERS | |
| 1060 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 1061 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 1062 | Gaze palsy | FAERS: 1 | US FAERS | |
| 1063 | General symptom | FAERS: 1 | US FAERS | |
| 1064 | Genital infection | FAERS: 1 | US FAERS | |
| 1065 | Genital tract inflammation | FAERS: 1 | US FAERS | |
| 1066 | Gingival blister | FAERS: 1 | US FAERS | |
| 1067 | Gingival erythema | FAERS: 1 | US FAERS | |
| 1068 | Glomerular Filtration Rate | FAERS: 1 | US FAERS | |
| 1069 | Granuloma Annulare | FAERS: 1 | US FAERS | |
| 1070 | Guttate psoriasis | FAERS: 1 | US FAERS | |
| 1071 | Hand prosthesis user | FAERS: 1 | US FAERS | |
| 1072 | Head circumference abnormal | FAERS: 1 | US FAERS | |
| 1073 | Head titubation | FAERS: 1 | US FAERS | |
| 1074 | Heart Sounds | FAERS: 1 | US FAERS | |
| 1075 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 1076 | Helicobacter test positive | FAERS: 1 | US FAERS | |
| 1077 | Hepatic Infection | FAERS: 1 | US FAERS | |
| 1078 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 1079 | Hepatitis A virus test positive | FAERS: 1 | US FAERS | |
| 1080 | Hepatitis B core antibody positive | FAERS: 1 | US FAERS | |
| 1081 | Hepatitis B | FAERS: 1 | US FAERS | |
| 1082 | Hepatitis E | FAERS: 1 | US FAERS | |
| 1083 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 1084 | Hernial eventration | FAERS: 1 | US FAERS | |
| 1085 | Herpes simplex test positive | FAERS: 1 | US FAERS | |
| 1086 | Hidradenitis | FAERS: 1 | US FAERS | |
| 1087 | Histrionic Personality Disorder | FAERS: 1 | US FAERS | |
| 1088 | House dust allergy | FAERS: 1 | US FAERS | |
| 1089 | Human chorionic gonadotropin decreased | FAERS: 1 | US FAERS | |
| 1090 | Hyperaldosteronism | FAERS: 1 | US FAERS | |
| 1091 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 1092 | Hyperkinesia | FAERS: 1 | US FAERS | |
| 1093 | Hyperlipasaemia | FAERS: 1 | US FAERS | |
| 1094 | Hypermetabolism | FAERS: 1 | US FAERS | |
| 1095 | Hypertensive emergency | FAERS: 1 | US FAERS | |
| 1096 | Hypervigilance | FAERS: 1 | US FAERS | |
| 1097 | Hypospadias | FAERS: 1 | US FAERS | |
| 1098 | Hypothalamic pituitary adrenal axis suppression | FAERS: 1 | US FAERS | |
| 1099 | Hypotrichosis | FAERS: 1 | US FAERS | |
| 1100 | Hypoventilation | FAERS: 1 | US FAERS | |
| 1101 | Hysterectomy | FAERS: 1 | US FAERS | |
| 1102 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 1103 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 1104 | Immunosuppression | FAERS: 1 | US FAERS | |
| 1105 | Impaired reasoning | FAERS: 1 | US FAERS | |
| 1106 | Impetigo | FAERS: 1 | US FAERS | |
| 1107 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 1108 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 1109 | Inferiority complex | FAERS: 1 | US FAERS | |
| 1110 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 1111 | Insulin Resistance | FAERS: 1 | US FAERS | |
| 1112 | Insulin-like growth factor increased | FAERS: 1 | US FAERS | |
| 1113 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 1114 | Intercepted product dispensing error | FAERS: 1 | US FAERS | |
| 1115 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 1116 | Intestinal intraepithelial lymphocytes increased | FAERS: 1 | US FAERS | |
| 1117 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 1118 | Intubation | FAERS: 1 | US FAERS | |
| 1119 | Iodine allergy | FAERS: 1 | US FAERS | |
| 1120 | Irregular breathing | FAERS: 1 | US FAERS | |
| 1121 | Jealous delusion | FAERS: 1 | US FAERS | |
| 1122 | Keratitis | FAERS: 1 | US FAERS | |
| 1123 | Ketonuria | FAERS: 1 | US FAERS | |
| 1124 | LDL/HDL ratio increased | FAERS: 1 | US FAERS | |
| 1125 | Lack of satiety | FAERS: 1 | US FAERS | |
| 1126 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 1127 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 1128 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 1129 | Laryngitis | FAERS: 1 | US FAERS | |
| 1130 | Laryngomalacia | FAERS: 1 | US FAERS | |
| 1131 | Laryngospasm | FAERS: 1 | US FAERS | |
| 1132 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 1133 | Leukocytosis | FAERS: 1 | US FAERS | |
| 1134 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 1135 | Levator syndrome | FAERS: 1 | US FAERS | |
| 1136 | Ligament rupture | FAERS: 1 | US FAERS | |
| 1137 | Light chain analysis abnormal | FAERS: 1 | US FAERS | |
| 1138 | Limb mass | FAERS: 1 | US FAERS | |
| 1139 | Lip erythema | FAERS: 1 | US FAERS | |
| 1140 | Lipohypertrophy | FAERS: 1 | US FAERS | |
| 1141 | Liver Abscess | FAERS: 1 | US FAERS | |
| 1142 | Low income | FAERS: 1 | US FAERS | |
| 1143 | Lyme Disease | FAERS: 1 | US FAERS | |
| 1144 | Lymphocyte count abnormal | FAERS: 1 | US FAERS | |
| 1145 | Lymphoid tissue hyperplasia | FAERS: 1 | US FAERS | |
| 1146 | Macrocephaly | FAERS: 1 | US FAERS | |
| 1147 | Macular degeneration | FAERS: 1 | US FAERS | |
| 1148 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 1149 | Malocclusion | FAERS: 1 | US FAERS | |
| 1150 | Manufacturing materials issue | FAERS: 1 | US FAERS | |
| 1151 | Measles | FAERS: 1 | US FAERS | |
| 1152 | Mechanical urticaria | FAERS: 1 | US FAERS | |
| 1153 | Mediastinal mass | FAERS: 1 | US FAERS | |
| 1154 | Medical device site hypersensitivity | FAERS: 1 | US FAERS | |
| 1155 | Medication tampering | FAERS: 1 | US FAERS | |
| 1156 | Metastases to pelvis | FAERS: 1 | US FAERS | |
| 1157 | Microcephaly | FAERS: 1 | US FAERS | |
| 1158 | Microcytosis | FAERS: 1 | US FAERS | |
| 1159 | Microgenia | FAERS: 1 | US FAERS | |
| 1160 | Microphthalmos | FAERS: 1 | US FAERS | |
| 1161 | Microvascular coronary artery disease | FAERS: 1 | US FAERS | |
| 1162 | Miliaria | FAERS: 1 | US FAERS | |
| 1163 | Mixed liver injury | FAERS: 1 | US FAERS | |
| 1164 | Mixed receptive-expressive language disorder | FAERS: 1 | US FAERS | |
| 1165 | Monoclonal immunoglobulin present | FAERS: 1 | US FAERS | |
| 1166 | Monoparesis | FAERS: 1 | US FAERS | |
| 1167 | Motion Sickness | FAERS: 1 | US FAERS | |
| 1168 | Mucosal pain | FAERS: 1 | US FAERS | |
| 1169 | Muscle hypertrophy | FAERS: 1 | US FAERS | |
| 1170 | Muscle necrosis | FAERS: 1 | US FAERS | |
| 1171 | Muscle tone disorder | FAERS: 1 | US FAERS | |
| 1172 | Muscular Dystrophy | FAERS: 1 | US FAERS | |
| 1173 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 1174 | Mycotic allergy | FAERS: 1 | US FAERS | |
| 1175 | Myocardial necrosis marker increased | FAERS: 1 | US FAERS | |
| 1176 | N-terminal prohormone brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 1177 | Nail discomfort | FAERS: 1 | US FAERS | |
| 1178 | Negativism | FAERS: 1 | US FAERS | |
| 1179 | Neonatal cardiac failure | FAERS: 1 | US FAERS | |
| 1180 | Neonatal hypotension | FAERS: 1 | US FAERS | |
| 1181 | Neonatal pneumonia | FAERS: 1 | US FAERS | |
| 1182 | Neonatal respiratory acidosis | FAERS: 1 | US FAERS | |
| 1183 | Neuritis | FAERS: 1 | US FAERS | |
| 1184 | Neuromuscular pain | FAERS: 1 | US FAERS | |
| 1185 | Neuropathy | FAERS: 1 | US FAERS | |
| 1186 | Neutrophilic dermatosis | FAERS: 1 | US FAERS | |
| 1187 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 1188 | Nodal osteoarthritis | FAERS: 1 | US FAERS | |
| 1189 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 1190 | Noninfective bronchitis | FAERS: 1 | US FAERS | |
| 1191 | Noninfective encephalitis | FAERS: 1 | US FAERS | |
| 1192 | Nuchal Rigidity | FAERS: 1 | US FAERS | |
| 1193 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 1194 | Ocular Hypertension | FAERS: 1 | US FAERS | |
| 1195 | Oliguria | FAERS: 1 | US FAERS | |
| 1196 | Onychomalacia | FAERS: 1 | US FAERS | |
| 1197 | Onychomycosis | FAERS: 1 | US FAERS | |
| 1198 | Opiates positive | FAERS: 1 | US FAERS | |
| 1199 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 1200 | Oral administration complication | FAERS: 1 | US FAERS | |
| 1201 | Oral contusion | FAERS: 1 | US FAERS | |
| 1202 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 1203 | Organic brain syndrome | FAERS: 1 | US FAERS | |
| 1204 | Orthosis user | FAERS: 1 | US FAERS | |
| 1205 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 1206 | Osmolar gap increased | FAERS: 1 | US FAERS | |
| 1207 | Osteochondrosis | FAERS: 1 | US FAERS | |
| 1208 | Osteopetrosis | FAERS: 1 | US FAERS | |
| 1209 | Otitis Media | FAERS: 1 | US FAERS | |
| 1210 | Palatal swelling | FAERS: 1 | US FAERS | |
| 1211 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 1212 | Pancreatitis | FAERS: 1 | US FAERS | |
| 1213 | Pancytopenia | FAERS: 1 | US FAERS | |
| 1214 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 1215 | Paranasal sinus mucosal hypertrophy | FAERS: 1 | US FAERS | |
| 1216 | Paraplegia | FAERS: 1 | US FAERS | |
| 1217 | Pathological doubt | FAERS: 1 | US FAERS | |
| 1218 | Pelvic adhesions | FAERS: 1 | US FAERS | |
| 1219 | Pelvic discomfort | FAERS: 1 | US FAERS | |
| 1220 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 1221 | Peripheral nerve lesion | FAERS: 1 | US FAERS | |
| 1222 | Petechiae | FAERS: 1 | US FAERS | |
| 1223 | Phagophobia | FAERS: 1 | US FAERS | |
| 1224 | Pharyngeal swelling | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1225 | Physical assault | FAERS: 1 | US FAERS | |
| 1226 | Physical examination abnormal | FAERS: 1 | US FAERS | |
| 1227 | Pituitary enlargement | FAERS: 1 | US FAERS | |
| 1228 | Pityriasis Rubra Pilaris | FAERS: 1 | US FAERS | |
| 1229 | Placental Insufficiency | FAERS: 1 | US FAERS | |
| 1230 | Platelet distribution width increased | FAERS: 1 | US FAERS | |
| 1231 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 1232 | Pneumothorax | FAERS: 1 | US FAERS | |
| 1233 | Polydactyly | FAERS: 1 | US FAERS | |
| 1234 | Polymicrogyria | FAERS: 1 | US FAERS | |
| 1235 | Polymyositis | FAERS: 1 | US FAERS | |
| 1236 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 1237 | Portal tract inflammation | FAERS: 1 | US FAERS | |
| 1238 | Post procedural hypothyroidism | FAERS: 1 | US FAERS | |
| 1239 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 1240 | Precancerous cells present | FAERS: 1 | US FAERS | |
| 1241 | Pregnancy on contraceptive | FAERS: 1 | US FAERS | |
| 1242 | Primary Adrenal Insufficiency | FAERS: 1 | US FAERS | |
| 1243 | Procedural complication | FAERS: 1 | US FAERS | |
| 1244 | Product barcode issue | FAERS: 1 | US FAERS | |
| 1245 | Product coating issue | FAERS: 1 | US FAERS | |
| 1246 | Product container issue | FAERS: 1 | US FAERS | |
| 1247 | Product contamination | FAERS: 1 | US FAERS | |
| 1248 | Product distribution issue | FAERS: 1 | US FAERS | |
| 1249 | Product label confusion | FAERS: 1 | US FAERS | |
| 1250 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 1251 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 1252 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 1253 | Product supply issue | FAERS: 1 | US FAERS | |
| 1254 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 1255 | Progesterone decreased | FAERS: 1 | US FAERS | |
| 1256 | Protein Deficiency | FAERS: 1 | US FAERS | |
| 1257 | Protein urine present | FAERS: 1 | US FAERS | |
| 1258 | Prurigo | FAERS: 1 | US FAERS | |
| 1259 | Psychogenic erectile dysfunction | FAERS: 1 | US FAERS | |
| 1260 | Psychological Trauma | FAERS: 1 | US FAERS | |
| 1261 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 1262 | Pulmonary arterial hypertension | FAERS: 1 | US FAERS | |
| 1263 | Purpura | FAERS: 1 | US FAERS | |
| 1264 | Quadriparesis | FAERS: 1 | US FAERS | |
| 1265 | Radiculopathy | FAERS: 1 | US FAERS | |
| 1266 | Rebound psoriasis | FAERS: 1 | US FAERS | |
| 1267 | Red cell distribution width decreased | FAERS: 1 | US FAERS | |
| 1268 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 1269 | Renal dysplasia | FAERS: 1 | US FAERS | |
| 1270 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 1271 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 1272 | Resting Tremor | FAERS: 1 | US FAERS | |
| 1273 | Restrictive pulmonary disease | FAERS: 1 | US FAERS | |
| 1274 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 1275 | Retinal migraine | FAERS: 1 | US FAERS | |
| 1276 | Reverse tri-iodothyronine decreased | FAERS: 1 | US FAERS | |
| 1277 | Rheumatic Fever | FAERS: 1 | US FAERS | |
| 1278 | Rheumatoid factor increased | FAERS: 1 | US FAERS | |
| 1279 | Rheumatoid factor quantitative increased | FAERS: 1 | US FAERS | |
| 1280 | Rhinotracheitis | FAERS: 1 | US FAERS | |
| 1281 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 1282 | Risk of future pregnancy miscarriage | FAERS: 1 | US FAERS | |
| 1283 | Sacroiliitis | FAERS: 1 | US FAERS | |
| 1284 | Salivary gland pain | FAERS: 1 | US FAERS | |
| 1285 | Salpingitis | FAERS: 1 | US FAERS | |
| 1286 | Scarlet Fever | FAERS: 1 | US FAERS | |
| 1287 | Scleritis | FAERS: 1 | US FAERS | |
| 1288 | Scleroderma | FAERS: 1 | US FAERS | |
| 1289 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 1290 | Serum Sickness | FAERS: 1 | US FAERS | |
| 1291 | Sinus pain | FAERS: 1 | US FAERS | |
| 1292 | Skeletal dysplasia | FAERS: 1 | US FAERS | |
| 1293 | Skin Induration | FAERS: 1 | US FAERS | |
| 1294 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 1295 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 1296 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 1297 | Skin necrosis | FAERS: 1 | US FAERS | |
| 1298 | Skin texture abnormal | FAERS: 1 | US FAERS | |
| 1299 | Skin tightness | FAERS: 1 | US FAERS | |
| 1300 | Slow speech | FAERS: 1 | US FAERS | |
| 1301 | Specific gravity urine abnormal | FAERS: 1 | US FAERS | |
| 1302 | Spinal cord herniation | FAERS: 1 | US FAERS | |
| 1303 | Splenomegaly | FAERS: 1 | US FAERS | |
| 1304 | Spondylitis | FAERS: 1 | US FAERS | |
| 1305 | Staphylococcal pharyngitis | FAERS: 1 | US FAERS | |
| 1306 | Staring | FAERS: 1 | US FAERS | |
| 1307 | Steatohepatitis | FAERS: 1 | US FAERS | |
| 1308 | Stool analysis abnormal | FAERS: 1 | US FAERS | |
| 1309 | Stool chloride increased | FAERS: 1 | US FAERS | |
| 1310 | Stool pH decreased | FAERS: 1 | US FAERS | |
| 1311 | Submandibular mass | FAERS: 1 | US FAERS | |
| 1312 | Superinfection bacterial | FAERS: 1 | US FAERS | |
| 1313 | Syndactyly | FAERS: 1 | US FAERS | |
| 1314 | Tablet issue | FAERS: 1 | US FAERS | |
| 1315 | Talipes | FAERS: 1 | US FAERS | |
| 1316 | Teeth brittle | FAERS: 1 | US FAERS | |
| 1317 | Tenosynovitis | FAERS: 1 | US FAERS | |
| 1318 | Therapeutic drug monitoring analysis not performed | FAERS: 1 | US FAERS | |
| 1319 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 1320 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 1321 | Therapy partial responder | FAERS: 1 | US FAERS | |
| 1322 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 1323 | Thyroglobulin present | FAERS: 1 | US FAERS | |
| 1324 | Thyroid cancer metastatic | FAERS: 1 | US FAERS | |
| 1325 | Thyroid cancer stage IV | FAERS: 1 | US FAERS | |
| 1326 | Thyroid dermatopathy | FAERS: 1 | US FAERS | |
| 1327 | Thyroid gland scan abnormal | FAERS: 1 | US FAERS | |
| 1328 | Thyrotoxic cardiomyopathy | FAERS: 1 | US FAERS | |
| 1329 | Thyroxine free normal | FAERS: 1 | US FAERS | |
| 1330 | Tinea Capitis | FAERS: 1 | US FAERS | |
| 1331 | Tinea Pedis | FAERS: 1 | US FAERS | |
| 1332 | Tobacco user | FAERS: 1 | US FAERS | |
| 1333 | Tongue eruption | FAERS: 1 | US FAERS | |
| 1334 | Tongue erythema | FAERS: 1 | US FAERS | |
| 1335 | Total cholesterol/HDL ratio abnormal | FAERS: 1 | US FAERS | |
| 1336 | Tracheitis | FAERS: 1 | US FAERS | |
| 1337 | Tri-iodothyronine uptake abnormal | FAERS: 1 | US FAERS | |
| 1338 | Troponin increased | FAERS: 1 | US FAERS | |
| 1339 | Ultrasound Doppler abnormal | FAERS: 1 | US FAERS | |
| 1340 | Ultrasound abdomen abnormal | FAERS: 1 | US FAERS | |
| 1341 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 1342 | Underweight | FAERS: 1 | US FAERS | |
| 1343 | Unmasking of previously unidentified disease | FAERS: 1 | US FAERS | |
| 1344 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 1345 | Urinary sediment present | FAERS: 1 | US FAERS | |
| 1346 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 1347 | Urine albumin/creatinine ratio increased | FAERS: 1 | US FAERS | |
| 1348 | Urine output increased | FAERS: 1 | US FAERS | |
| 1349 | Uterine contractions during pregnancy | FAERS: 1 | US FAERS | |
| 1350 | Uveitis | FAERS: 1 | US FAERS | |
| 1351 | Uvulitis | FAERS: 1 | US FAERS | |
| 1352 | Vanishing bile duct syndrome | FAERS: 1 | US FAERS | |
| 1353 | Varicella Zoster Virus Infection | FAERS: 1 | US FAERS | |
| 1354 | Vascular compression | FAERS: 1 | US FAERS | |
| 1355 | Vascular insufficiency | FAERS: 1 | US FAERS | |
| 1356 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 1357 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 1358 | Ventricular hyperkinesia | FAERS: 1 | US FAERS | |
| 1359 | Very low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 1360 | Vibratory sense increased | FAERS: 1 | US FAERS | |
| 1361 | Viral myositis | FAERS: 1 | US FAERS | |
| 1362 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 1363 | Visceral congestion | FAERS: 1 | US FAERS | |
| 1364 | Visual acuity reduced transiently | FAERS: 1 | US FAERS | |
| 1365 | Visual disturbance | FAERS: 1 | US FAERS | |
| 1366 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 1367 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 1368 | Water Intoxication | FAERS: 1 | US FAERS | |
| 1369 | Water Pollution | FAERS: 1 | US FAERS | |
| 1370 | Weight | FAERS: 1 | US FAERS | |
| 1371 | Wheelchair user | FAERS: 1 | US FAERS | |
| 1372 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 1373 | Wrong product administered | FAERS: 1 | US FAERS | |
| 1374 | pH body fluid abnormal | FAERS: 1 | US FAERS | |
| 1375 | pH urine decreased | FAERS: 1 | US FAERS | |
| 1376 | Therapeutic product effect variable | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.