ambrisentan
(OUJTZYPIHDYQMC-LJQANCHMSA-N)
Structure
- SMILES
- COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1
- Type(s)
- Approved; Investigational
- ATC code(s)
- C02KX02; C02KX52
- Molecular Formula:
- C22H22N2O4
- Molecular Weight:
- 378.421
- Log P:
- 3.5156
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 81.54
- CAS Number(s):
- 177036-94-1
Synonym(s)
1.
ambrisentan
2.
(+)-(2S)-2-((4,6-dimethylpyrimidin-2-yl)oxy)-3-methoxy-3,3-diphenylpropanoic acid
3.
BSF 208075
4.
BSF-208075
5.
BSF208075
6.
LU 208075
7.
LU-208075
8.
LU208075
9.
Letairis
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pneumonia | FAERS: 2530 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 2 | Malaise | FAERS: 2147 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 3 | Unevaluable event | FAERS: 1978 | OFFSIDES US FAERS | |
| 4 | Dizziness | FAERS: 1913 | SIDER US FAERS | |
| 5 | Fatigue | FAERS: 1780 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 6 | Headache | FAERS: 1672 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 7 | Swelling | FAERS: 1363 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Peripheral swelling | FAERS: 1185 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 9 | Chest Pain | FAERS: 1057 | OFFSIDES SIDER US FAERS | |
| 10 | Nasopharyngitis | FAERS: 1023 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 11 | Syncope | FAERS: 898 | SIDER US FAERS | |
| 12 | Asthenia | FAERS: 777 | SIDER US FAERS | |
| 13 | Nausea | FAERS: 745 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 14 | Pulmonary arterial hypertension | FAERS: 744 | OFFSIDES US FAERS | |
| 15 | Hypotension | FAERS: 699 | SIDER US FAERS | |
| 16 | Drug ineffective | FAERS: 617 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 17 | Vomiting | FAERS: 613 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 18 | Pulmonary Hypertension | FAERS: 611 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 19 | Respiratory Failure | FAERS: 524 | OFFSIDES US FAERS | |
| 20 | Palpitations | FAERS: 503 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 21 | Pain | FAERS: 484 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Influenza | FAERS: 473 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 23 | Bronchitis | FAERS: 470 | OFFSIDES SIDER US FAERS | |
| 24 | Sinusitis | FAERS: 455 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 25 | Chest discomfort | FAERS: 378 | SIDER US FAERS | |
| 26 | Feeling abnormal | FAERS: 366 | US FAERS | |
| 27 | Flushing | FAERS: 347 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 28 | Constipation | FAERS: 345 | SIDER US FAERS | |
| 29 | Pruritus | FAERS: 342 | SIDER US FAERS | |
| 30 | Infection | FAERS: 309 | OFFSIDES SIDER US FAERS | |
| 31 | Weight decreased | FAERS: 308 | US FAERS | |
| 32 | Epistaxis | FAERS: 305 | SIDER US FAERS | |
| 33 | Atrial Fibrillation | FAERS: 298 | US FAERS | |
| 34 | Urinary tract infection | FAERS: 292 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 35 | Hypersensitivity | FAERS: 281 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 36 | Back Pain | FAERS: 280 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Myocardial Infarction | FAERS: 276 | US FAERS | |
| 38 | Dehydration | FAERS: 275 | US FAERS | |
| 39 | Right ventricular failure | FAERS: 268 | SIDER US FAERS | |
| 40 | Cerebrovascular accident | FAERS: 266 | US FAERS | |
| 41 | Fluid overload | FAERS: 258 | OFFSIDES US FAERS | |
| 42 | Drug dose omission | FAERS: 256 | US FAERS | |
| 43 | Sepsis | FAERS: 254 | US FAERS | |
| 44 | Arthralgia | FAERS: 237 | SIDER US FAERS | |
| 45 | Abdominal discomfort | FAERS: 233 | US FAERS | |
| 46 | Abdominal Pain | FAERS: 210 | SIDER US FAERS | |
| 47 | Hypoxia | FAERS: 204 | OFFSIDES US FAERS | |
| 48 | Product use issue | FAERS: 202 | US FAERS | |
| 49 | Oropharyngeal pain | FAERS: 200 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Cellulitis | FAERS: 199 | US FAERS | |
| 51 | Thrombosis | FAERS: 196 | US FAERS | |
| 52 | Asthma | FAERS: 190 | US FAERS | |
| 53 | Cardiac Arrest | FAERS: 188 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Joint swelling | FAERS: 186 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Disease Progression | FAERS: 184 | US FAERS | |
| 56 | Scleroderma | FAERS: 180 | US FAERS | |
| 57 | Pulmonary Fibrosis | FAERS: 172 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Presyncope | FAERS: 156 | US FAERS | |
| 59 | Tremor | FAERS: 156 | US FAERS | |
| 60 | Anxiety | FAERS: 143 | US FAERS | |
| 61 | Wheezing | FAERS: 137 | SIDER US FAERS | |
| 62 | Intentional dose omission | FAERS: 129 | US FAERS | |
| 63 | Arthritis | FAERS: 124 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Blood potassium decreased | FAERS: 124 | US FAERS | |
| 65 | General physical health deterioration | FAERS: 122 | US FAERS | |
| 66 | Visual Impairment | FAERS: 121 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Diabetes Mellitus | FAERS: 119 | US FAERS | |
| 68 | Erythema | FAERS: 119 | US FAERS | |
| 69 | Pulmonary Embolism | FAERS: 117 | US FAERS | |
| 70 | Chills | FAERS: 114 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | Pericardial effusion | FAERS: 109 | US FAERS | |
| 72 | Acute respiratory failure | FAERS: 108 | OFFSIDES US FAERS | |
| 73 | Oxygen supplementation | FAERS: 106 | OFFSIDES US FAERS | |
| 74 | Productive Cough | FAERS: 106 | US FAERS | |
| 75 | Cataract | FAERS: 103 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 76 | Somnolence | FAERS: 103 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Device related infection | FAERS: 98 | US FAERS | |
| 78 | Dyspepsia | FAERS: 97 | US FAERS | |
| 79 | Gout | FAERS: 96 | US FAERS | |
| 80 | Memory impairment | FAERS: 94 | US FAERS | |
| 81 | Myalgia | FAERS: 93 | SIDER US FAERS | |
| 82 | Blood count abnormal | FAERS: 85 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 83 | Lethargy | FAERS: 81 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Musculoskeletal Pain | FAERS: 81 | US FAERS | |
| 85 | Respiratory distress | FAERS: 81 | US FAERS | |
| 86 | Urticaria | FAERS: 80 | US FAERS | |
| 87 | Cystitis | FAERS: 79 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 88 | Intestinal Obstruction | FAERS: 78 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 89 | Ascites | FAERS: 76 | US FAERS | |
| 90 | Hysterectomy | FAERS: 75 | US FAERS | |
| 91 | Septic Shock | FAERS: 74 | OFFSIDES US FAERS | |
| 92 | Dysphonia | FAERS: 73 | US FAERS | |
| 93 | Intentional product use issue | FAERS: 73 | US FAERS | |
| 94 | Respiratory tract congestion | FAERS: 72 | US FAERS | |
| 95 | Tachycardia | FAERS: 72 | SIDER US FAERS | |
| 96 | Middle insomnia | FAERS: 71 | US FAERS | |
| 97 | Aspartate Aminotransferase Increased | FAERS: 70 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 98 | Pneumothorax | FAERS: 68 | US FAERS | |
| 99 | Blood glucose decreased | FAERS: 67 | US FAERS | |
| 100 | Abasia | FAERS: 66 | US FAERS | |
| 101 | Lower respiratory tract infection | FAERS: 66 | US FAERS | |
| 102 | Mechanical ventilation | FAERS: 66 | US FAERS | |
| 103 | Blood glucose increased | FAERS: 65 | US FAERS | |
| 104 | Diverticulitis | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 105 | Alopecia | FAERS: 63 | US FAERS | |
| 106 | Vertigo | FAERS: 60 | US FAERS | |
| 107 | Arthropathy | FAERS: 59 | US FAERS | |
| 108 | Back disorder | FAERS: 59 | US FAERS | |
| 109 | Upper respiratory tract congestion | FAERS: 59 | US FAERS | |
| 110 | Stress | FAERS: 58 | US FAERS | |
| 111 | Deafness | FAERS: 57 | US FAERS | |
| 112 | Nephrolithiasis | FAERS: 57 | US FAERS | |
| 113 | Product dose omission | FAERS: 54 | US FAERS | |
| 114 | Transaminases increased | FAERS: 54 | OFFSIDES SIDER US FAERS | |
| 115 | Cor pulmonale | FAERS: 53 | OFFSIDES US FAERS | |
| 116 | Neck Pain | FAERS: 53 | US FAERS | |
| 117 | Throat irritation | FAERS: 53 | US FAERS | |
| 118 | Tinnitus | FAERS: 53 | US FAERS | |
| 119 | Dementia | FAERS: 51 | US FAERS | |
| 120 | Pregnancy | FAERS: 51 | US FAERS | |
| 121 | Amnesia | FAERS: 50 | US FAERS | |
| 122 | Skin Ulcer | FAERS: 50 | SIDER US FAERS | |
| 123 | Alanine Aminotransferase Increased | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 124 | Dysuria | FAERS: 49 | US FAERS | |
| 125 | Cyanosis | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 126 | Oxygen saturation abnormal | FAERS: 48 | US FAERS | |
| 127 | Pancreatitis | FAERS: 48 | US FAERS | |
| 128 | Blood potassium increased | FAERS: 46 | OFFSIDES US FAERS | |
| 129 | Clostridium difficile infection | FAERS: 46 | US FAERS | |
| 130 | Joint injury | FAERS: 46 | US FAERS | |
| 131 | Angina Pectoris | FAERS: 45 | SIDER US FAERS | |
| 132 | Ankle Fracture | FAERS: 45 | OFFSIDES US FAERS | |
| 133 | Laryngitis | FAERS: 45 | US FAERS | |
| 134 | Limb injury | FAERS: 45 | US FAERS | |
| 135 | Pulmonary thrombosis | FAERS: 45 | US FAERS | |
| 136 | Respiratory arrest | FAERS: 45 | US FAERS | |
| 137 | Hernia | FAERS: 44 | US FAERS | |
| 138 | Mental status changes | FAERS: 44 | US FAERS | |
| 139 | Terminal state | FAERS: 44 | US FAERS | |
| 140 | Blindness | FAERS: 43 | US FAERS | |
| 141 | Colitis | FAERS: 43 | US FAERS | |
| 142 | Cholelithiasis | FAERS: 42 | US FAERS | |
| 143 | Disability | FAERS: 42 | US FAERS | |
| 144 | Hypersomnia | FAERS: 42 | US FAERS | |
| 145 | Nervousness | FAERS: 42 | US FAERS | |
| 146 | Oxygen consumption increased | FAERS: 42 | US FAERS | |
| 147 | Rheumatoid Arthritis | FAERS: 42 | US FAERS | |
| 148 | Sarcoidosis | FAERS: 42 | OFFSIDES US FAERS | |
| 149 | Bone pain | FAERS: 41 | US FAERS | |
| 150 | Cardiomegaly | FAERS: 41 | US FAERS | |
| 151 | Non-cardiac chest pain | FAERS: 41 | OFFSIDES SIDER US FAERS | |
| 152 | Wrong technique in product usage process | FAERS: 41 | US FAERS | |
| 153 | Blood iron decreased | FAERS: 40 | US FAERS | |
| 154 | Dysgeusia | FAERS: 40 | US FAERS | |
| 155 | Musculoskeletal chest pain | FAERS: 40 | US FAERS | |
| 156 | Acute kidney injury | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 157 | Ear discomfort | FAERS: 39 | OFFSIDES US FAERS | |
| 158 | Feeling Cold | FAERS: 39 | US FAERS | |
| 159 | Overdose | FAERS: 39 | US FAERS | |
| 160 | Chemotherapy | FAERS: 38 | US FAERS | |
| 161 | Idiopathic Pulmonary Fibrosis | FAERS: 38 | US FAERS | |
| 162 | Flatulence | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 163 | Pulmonary congestion | FAERS: 37 | OFFSIDES US FAERS | |
| 164 | Sinus headache | FAERS: 37 | SIDER US FAERS | |
| 165 | Aphonia | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 166 | Secretion discharge | FAERS: 35 | US FAERS | |
| 167 | Chromaturia | FAERS: 34 | US FAERS | |
| 168 | Coronary Artery Disease | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 169 | Dry skin | FAERS: 33 | US FAERS | |
| 170 | Gastritis | FAERS: 33 | SIDER US FAERS | |
| 171 | Angioedema | FAERS: 32 | OFFSIDES SIDER US FAERS | |
| 172 | Blood creatinine increased | FAERS: 32 | US FAERS | |
| 173 | Burning sensation | FAERS: 32 | US FAERS | |
| 174 | Increased upper airway secretion | FAERS: 32 | US FAERS | |
| 175 | Lip swelling | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 176 | Therapy cessation | FAERS: 32 | US FAERS | |
| 177 | Tooth Infection | FAERS: 32 | US FAERS | |
| 178 | Head discomfort | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 179 | Laceration | FAERS: 31 | US FAERS | |
| 180 | Limb operation | FAERS: 31 | US FAERS | |
| 181 | Post procedural complication | FAERS: 31 | US FAERS | |
| 182 | Ulcer | FAERS: 31 | US FAERS | |
| 183 | Accidental overdose | FAERS: 30 | US FAERS | |
| 184 | Ocular icterus | FAERS: 30 | OFFSIDES US FAERS | |
| 185 | Activities of daily living impaired | FAERS: 29 | US FAERS | |
| 186 | Blood urine present | FAERS: 29 | US FAERS | |
| 187 | Hip surgery | FAERS: 29 | US FAERS | |
| 188 | Transplant | FAERS: 29 | US FAERS | |
| 189 | Adverse event | FAERS: 28 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 190 | Blood sodium decreased | FAERS: 28 | US FAERS | |
| 191 | Continuous Positive Airway Pressure | FAERS: 28 | US FAERS | |
| 192 | Disease complication | FAERS: 28 | US FAERS | |
| 193 | Fibromyalgia | FAERS: 28 | US FAERS | |
| 194 | Maternal exposure during pregnancy | FAERS: 28 | US FAERS | |
| 195 | Medical device complication | FAERS: 28 | US FAERS | |
| 196 | Pharyngitis | FAERS: 28 | SIDER US FAERS | |
| 197 | Ammonia increased | FAERS: 27 | US FAERS | |
| 198 | Atrial Flutter | FAERS: 27 | US FAERS | |
| 199 | Bedridden | FAERS: 27 | US FAERS | |
| 200 | Discomfort | FAERS: 27 | SIDER US FAERS | |
| 201 | Paranasal sinus hypersecretion | FAERS: 27 | US FAERS | |
| 202 | Pulmonary function test decreased | FAERS: 27 | US FAERS | |
| 203 | White blood cell count decreased | FAERS: 27 | US FAERS | |
| 204 | Hepatitis C | FAERS: 26 | OFFSIDES US FAERS | |
| 205 | Night sweats | FAERS: 26 | US FAERS | |
| 206 | Pulmonary arterial pressure increased | FAERS: 25 | US FAERS | |
| 207 | Supraventricular tachycardia | FAERS: 25 | US FAERS | |
| 208 | Disorientation | FAERS: 24 | US FAERS | |
| 209 | Eye Infection | FAERS: 24 | US FAERS | |
| 210 | Inflammation | FAERS: 24 | US FAERS | |
| 211 | Pruritus allergic | FAERS: 24 | US FAERS | |
| 212 | Sneezing | FAERS: 24 | US FAERS | |
| 213 | Carbon dioxide increased | FAERS: 23 | US FAERS | |
| 214 | Gastroenteritis | FAERS: 23 | US FAERS | |
| 215 | Musculoskeletal stiffness | FAERS: 23 | US FAERS | |
| 216 | Thrombocytopenia | FAERS: 23 | US FAERS | |
| 217 | Tooth Extraction | FAERS: 23 | US FAERS | |
| 218 | Toothache | FAERS: 23 | US FAERS | |
| 219 | colonoscopy | FAERS: 23 | US FAERS | |
| 220 | Gastric infection | FAERS: 22 | US FAERS | |
| 221 | Retching | FAERS: 22 | US FAERS | |
| 222 | Lymphadenopathy | FAERS: 21 | US FAERS | |
| 223 | Lymphoma | FAERS: 21 | US FAERS | |
| 224 | Muscle strain | FAERS: 21 | US FAERS | |
| 225 | Oxygen Consumption | FAERS: 21 | US FAERS | |
| 226 | Pneumonitis | FAERS: 21 | US FAERS | |
| 227 | Bradycardia | FAERS: 20 | US FAERS | |
| 228 | Cardiac ablation | FAERS: 20 | US FAERS | |
| 229 | Chronic respiratory failure | FAERS: 20 | OFFSIDES US FAERS | |
| 230 | Deep Vein Thrombosis | FAERS: 20 | US FAERS | |
| 231 | Electrolyte imbalance | FAERS: 20 | US FAERS | |
| 232 | Poor quality sleep | FAERS: 20 | US FAERS | |
| 233 | Unresponsive to stimuli | FAERS: 20 | OFFSIDES US FAERS | |
| 234 | Agitation | FAERS: 19 | US FAERS | |
| 235 | Ear congestion | FAERS: 19 | US FAERS | |
| 236 | Eye irritation | FAERS: 19 | US FAERS | |
| 237 | Hypercapnia | FAERS: 19 | US FAERS | |
| 238 | Intestinal Perforation | FAERS: 19 | OFFSIDES US FAERS | |
| 239 | Loss of personal independence in daily activities | FAERS: 19 | US FAERS | |
| 240 | Osteoporosis | FAERS: 19 | US FAERS | |
| 241 | Pleurisy | FAERS: 19 | US FAERS | |
| 242 | Upper-airway cough syndrome | FAERS: 19 | US FAERS | |
| 243 | Wheelchair user | FAERS: 19 | US FAERS | |
| 244 | nervous system disorder | FAERS: 19 | SIDER US FAERS | |
| 245 | Gastric ulcer | FAERS: 18 | US FAERS | |
| 246 | Limb discomfort | FAERS: 18 | US FAERS | |
| 247 | Sluggishness | FAERS: 18 | US FAERS | |
| 248 | Transplant evaluation | FAERS: 18 | US FAERS | |
| 249 | Blood glucose abnormal | FAERS: 17 | US FAERS | |
| 250 | Glaucoma | FAERS: 17 | US FAERS | |
| 251 | Intra-abdominal fluid collection | FAERS: 17 | US FAERS | |
| 252 | Medication Error | FAERS: 17 | US FAERS | |
| 253 | Mental impairment | FAERS: 17 | US FAERS | |
| 254 | Rhinitis | FAERS: 17 | SIDER US FAERS | |
| 255 | Sciatica | FAERS: 17 | US FAERS | |
| 256 | Abscess | FAERS: 16 | OFFSIDES US FAERS | |
| 257 | Acute myocardial infarction | FAERS: 16 | US FAERS | |
| 258 | Catheter placement | FAERS: 16 | US FAERS | |
| 259 | Cholecystitis | FAERS: 16 | US FAERS | |
| 260 | Delirium | FAERS: 16 | US FAERS | |
| 261 | Eye pain | FAERS: 16 | US FAERS | |
| 262 | Hepatic Encephalopathy | FAERS: 16 | US FAERS | |
| 263 | Pancreatic carcinoma | FAERS: 16 | US FAERS | |
| 264 | Paranasal sinus discomfort | FAERS: 16 | US FAERS | |
| 265 | Viral upper respiratory tract infection | FAERS: 16 | US FAERS | |
| 266 | Apparent death | FAERS: 15 | US FAERS | |
| 267 | Blood potassium abnormal | FAERS: 15 | US FAERS | |
| 268 | Blood pressure fluctuation | FAERS: 15 | US FAERS | |
| 269 | Diabetes mellitus inadequate control | FAERS: 15 | OFFSIDES US FAERS | |
| 270 | Feeling jittery | FAERS: 15 | US FAERS | |
| 271 | Product packaging issue | FAERS: 15 | US FAERS | |
| 272 | Rotator cuff syndrome | FAERS: 15 | US FAERS | |
| 273 | Sudden death | FAERS: 15 | US FAERS | |
| 274 | Choking | FAERS: 14 | US FAERS | |
| 275 | Cyst | FAERS: 14 | US FAERS | |
| 276 | Depressed mood | FAERS: 14 | US FAERS | |
| 277 | Device dislocation | FAERS: 14 | US FAERS | |
| 278 | Emotional disorder | FAERS: 14 | US FAERS | |
| 279 | Intentional product misuse | FAERS: 14 | US FAERS | |
| 280 | Intracranial Aneurysm | FAERS: 14 | US FAERS | |
| 281 | Menorrhagia | FAERS: 14 | US FAERS | |
| 282 | Nasal discomfort | FAERS: 14 | US FAERS | |
| 283 | Osteomyelitis | FAERS: 14 | US FAERS | |
| 284 | Rash erythematous | FAERS: 14 | US FAERS | |
| 285 | Temperature intolerance | FAERS: 14 | US FAERS | |
| 286 | Therapeutic procedure | FAERS: 14 | US FAERS | |
| 287 | Walking distance test abnormal | FAERS: 14 | US FAERS | |
| 288 | Biopsy | FAERS: 13 | US FAERS | |
| 289 | Blood magnesium decreased | FAERS: 13 | US FAERS | |
| 290 | Cardiac Flutter | FAERS: 13 | OFFSIDES US FAERS | |
| 291 | Food Poisoning | FAERS: 13 | US FAERS | |
| 292 | Gait inability | FAERS: 13 | US FAERS | |
| 293 | Hepatitis | FAERS: 13 | SIDER US FAERS | |
| 294 | Mastectomy | FAERS: 13 | US FAERS | |
| 295 | Musculoskeletal discomfort | FAERS: 13 | SIDER US FAERS | |
| 296 | Oral pain | FAERS: 13 | US FAERS | |
| 297 | Photophobia | FAERS: 13 | US FAERS | |
| 298 | Poor peripheral circulation | FAERS: 13 | US FAERS | |
| 299 | Restlessness | FAERS: 13 | US FAERS | |
| 300 | Sjogren's Syndrome | FAERS: 13 | US FAERS | |
| 301 | Sudden Cardiac Death | FAERS: 13 | US FAERS | |
| 302 | Urinary Retention | FAERS: 13 | US FAERS | |
| 303 | Diastolic dysfunction | FAERS: 12 | US FAERS | |
| 304 | Dysarthria | FAERS: 12 | US FAERS | |
| 305 | Endocarditis | FAERS: 12 | US FAERS | |
| 306 | Food Allergy | FAERS: 12 | US FAERS | |
| 307 | Gastric Bypass | FAERS: 12 | US FAERS | |
| 308 | Hepatomegaly | FAERS: 12 | US FAERS | |
| 309 | Hypophagia | FAERS: 12 | US FAERS | |
| 310 | Inappropriate schedule of drug administration | FAERS: 12 | US FAERS | |
| 311 | Incontinence | FAERS: 12 | US FAERS | |
| 312 | Leukocytosis | FAERS: 12 | US FAERS | |
| 313 | Mood swings | FAERS: 12 | US FAERS | |
| 314 | Neuralgia | FAERS: 12 | US FAERS | |
| 315 | No adverse event | FAERS: 12 | US FAERS | |
| 316 | Pallor | FAERS: 12 | US FAERS | |
| 317 | Restless Legs Syndrome | FAERS: 12 | US FAERS | |
| 318 | Sensitivity to weather change | FAERS: 12 | US FAERS | |
| 319 | Shock | FAERS: 12 | SIDER US FAERS | |
| 320 | Acne | FAERS: 11 | US FAERS | |
| 321 | Aphagia | FAERS: 11 | OFFSIDES US FAERS | |
| 322 | Atypical pneumonia | FAERS: 11 | US FAERS | |
| 323 | Ear tube insertion | FAERS: 11 | US FAERS | |
| 324 | Echocardiogram abnormal | FAERS: 11 | US FAERS | |
| 325 | Electrocardiogram abnormal | FAERS: 11 | US FAERS | |
| 326 | Eructation | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 327 | Flank Pain | FAERS: 11 | US FAERS | |
| 328 | Gangrene | FAERS: 11 | OFFSIDES US FAERS | |
| 329 | Incoherent | FAERS: 11 | OFFSIDES US FAERS | |
| 330 | Leukopenia | FAERS: 11 | US FAERS | |
| 331 | Lower respiratory tract congestion | FAERS: 11 | US FAERS | |
| 332 | Macular degeneration | FAERS: 11 | US FAERS | |
| 333 | Mineral supplementation | FAERS: 11 | US FAERS | |
| 334 | Product blister packaging issue | FAERS: 11 | US FAERS | |
| 335 | Wound Infection | FAERS: 11 | US FAERS | |
| 336 | jaundice | FAERS: 11 | US FAERS | |
| 337 | Allergic respiratory symptom | FAERS: 10 | US FAERS | |
| 338 | Anger | FAERS: 10 | US FAERS | |
| 339 | Aphasia | FAERS: 10 | US FAERS | |
| 340 | Blood alkaline phosphatase increased | FAERS: 10 | US FAERS | |
| 341 | Bronchospasm | FAERS: 10 | US FAERS | |
| 342 | Cardiac discomfort | FAERS: 10 | US FAERS | |
| 343 | Cholecystitis infective | FAERS: 10 | US FAERS | |
| 344 | Diplopia | FAERS: 10 | US FAERS | |
| 345 | Drug abuse | FAERS: 10 | US FAERS | |
| 346 | Fibrosis | FAERS: 10 | US FAERS | |
| 347 | Gastrointestinal infection | FAERS: 10 | US FAERS | |
| 348 | Hospice Care | FAERS: 10 | US FAERS | |
| 349 | Impaired gastric emptying | FAERS: 10 | US FAERS | |
| 350 | Iron deficiency | FAERS: 10 | US FAERS | |
| 351 | Polyuria | FAERS: 10 | US FAERS | |
| 352 | Product quality issue | FAERS: 10 | US FAERS | |
| 353 | Sinus operation | FAERS: 10 | US FAERS | |
| 354 | Spinal column stenosis | FAERS: 10 | US FAERS | |
| 355 | Thermal burn | FAERS: 10 | US FAERS | |
| 356 | Ventilation perfusion mismatch | FAERS: 10 | US FAERS | |
| 357 | Ageusia | FAERS: 9 | US FAERS | |
| 358 | Aortic Aneurysm | FAERS: 9 | US FAERS | |
| 359 | Arthropod bite | FAERS: 9 | US FAERS | |
| 360 | Clostridium difficile colitis | FAERS: 9 | US FAERS | |
| 361 | Compression fracture | FAERS: 9 | US FAERS | |
| 362 | Conjunctivitis | FAERS: 9 | US FAERS | |
| 363 | Lower respiratory tract inflammation | FAERS: 9 | US FAERS | |
| 364 | Menopause | FAERS: 9 | US FAERS | |
| 365 | Paracentesis | FAERS: 9 | US FAERS | |
| 366 | Post procedural infection | FAERS: 9 | US FAERS | |
| 367 | Procedural complication | FAERS: 9 | US FAERS | |
| 368 | Respiratory tract infection viral | FAERS: 9 | US FAERS | |
| 369 | Stomatitis | FAERS: 9 | US FAERS | |
| 370 | Suture insertion | FAERS: 9 | US FAERS | |
| 371 | Therapeutic response unexpected | FAERS: 9 | US FAERS | |
| 372 | Tuberculosis | FAERS: 9 | US FAERS | |
| 373 | Animal bite | FAERS: 8 | US FAERS | |
| 374 | Anuria | FAERS: 8 | OFFSIDES US FAERS | |
| 375 | Blood cholesterol increased | FAERS: 8 | US FAERS | |
| 376 | Choking sensation | FAERS: 8 | OFFSIDES US FAERS | |
| 377 | Cold sweat | FAERS: 8 | US FAERS | |
| 378 | Complication associated with device | FAERS: 8 | US FAERS | |
| 379 | Dialysis related complication | FAERS: 8 | US FAERS | |
| 380 | Gingivitis | FAERS: 8 | US FAERS | |
| 381 | Implantable defibrillator insertion | FAERS: 8 | US FAERS | |
| 382 | Nasal inflammation | FAERS: 8 | US FAERS | |
| 383 | Nocturia | FAERS: 8 | SIDER US FAERS | |
| 384 | Rhinovirus infection | FAERS: 8 | US FAERS | |
| 385 | Stem cell transplant | FAERS: 8 | US FAERS | |
| 386 | Thirst | FAERS: 8 | US FAERS | |
| 387 | Angioplasty | FAERS: 7 | US FAERS | |
| 388 | Anosmia | FAERS: 7 | US FAERS | |
| 389 | Appendicitis | FAERS: 7 | US FAERS | |
| 390 | Atrioventricular Block | FAERS: 7 | US FAERS | |
| 391 | Bilevel positive airway pressure | FAERS: 7 | US FAERS | |
| 392 | Bronchoscopy | FAERS: 7 | US FAERS | |
| 393 | Cataract operation | FAERS: 7 | US FAERS | |
| 394 | Catheter site infection | FAERS: 7 | US FAERS | |
| 395 | Device malfunction | FAERS: 7 | US FAERS | |
| 396 | Drug administration error | FAERS: 7 | US FAERS | |
| 397 | Dysentery | FAERS: 7 | US FAERS | |
| 398 | Embolism | FAERS: 7 | US FAERS | |
| 399 | Endarterectomy | FAERS: 7 | US FAERS | |
| 400 | Enterocolitis viral | FAERS: 7 | US FAERS | |
| 401 | Escherichia infection | FAERS: 7 | US FAERS | |
| 402 | Fracture | FAERS: 7 | US FAERS | |
| 403 | Full blood count decreased | FAERS: 7 | OFFSIDES US FAERS | |
| 404 | Ileus | FAERS: 7 | US FAERS | |
| 405 | Immobile | FAERS: 7 | US FAERS | |
| 406 | Large intestine perforation | FAERS: 7 | US FAERS | |
| 407 | Mesothelioma | FAERS: 7 | US FAERS | |
| 408 | Metastatic Neoplasm | FAERS: 7 | US FAERS | |
| 409 | Muscle Fatigue | FAERS: 7 | US FAERS | |
| 410 | Obesity | FAERS: 7 | US FAERS | |
| 411 | Pancytopenia | FAERS: 7 | US FAERS | |
| 412 | Pericarditis | FAERS: 7 | US FAERS | |
| 413 | Renal pain | FAERS: 7 | US FAERS | |
| 414 | Respiratory Therapy | FAERS: 7 | US FAERS | |
| 415 | Skin tightness | FAERS: 7 | US FAERS | |
| 416 | Therapy change | FAERS: 7 | US FAERS | |
| 417 | Thrombosis in device | FAERS: 7 | US FAERS | |
| 418 | Trigeminal Neuralgia | FAERS: 7 | US FAERS | |
| 419 | Vascular rupture | FAERS: 7 | US FAERS | |
| 420 | Wrong technique in drug usage process | FAERS: 7 | US FAERS | |
| 421 | Aneurysm | FAERS: 6 | US FAERS | |
| 422 | Basal cell carcinoma | FAERS: 6 | US FAERS | |
| 423 | Bladder Neoplasm | FAERS: 6 | US FAERS | |
| 424 | Blood gases abnormal | FAERS: 6 | US FAERS | |
| 425 | Brain natriuretic peptide abnormal | FAERS: 6 | US FAERS | |
| 426 | Calcinosis | FAERS: 6 | US FAERS | |
| 427 | Carbon dioxide abnormal | FAERS: 6 | US FAERS | |
| 428 | Carpal Tunnel Syndrome | FAERS: 6 | US FAERS | |
| 429 | Catheter site related reaction | FAERS: 6 | US FAERS | |
| 430 | Cerebral disorder | FAERS: 6 | US FAERS | |
| 431 | Colectomy | FAERS: 6 | US FAERS | |
| 432 | Crying | FAERS: 6 | US FAERS | |
| 433 | Depressed Level of Consciousness | FAERS: 6 | US FAERS | |
| 434 | Endometriosis | FAERS: 6 | US FAERS | |
| 435 | Extra dose administered | FAERS: 6 | US FAERS | |
| 436 | Fluid imbalance | FAERS: 6 | US FAERS | |
| 437 | Gastric Antral Vascular Ectasia | FAERS: 6 | US FAERS | |
| 438 | Gastrointestinal Pain | FAERS: 6 | SIDER US FAERS | |
| 439 | General physical condition abnormal | FAERS: 6 | US FAERS | |
| 440 | Hyperventilation | FAERS: 6 | US FAERS | |
| 441 | Incorrect dose administered | FAERS: 6 | US FAERS | |
| 442 | Initial insomnia | FAERS: 6 | US FAERS | |
| 443 | Lower respiratory tract infection bacterial | FAERS: 6 | US FAERS | |
| 444 | Malnutrition | FAERS: 6 | SIDER US FAERS | |
| 445 | Muscle tightness | FAERS: 6 | OFFSIDES US FAERS | |
| 446 | Onychoclasis | FAERS: 6 | US FAERS | |
| 447 | Overweight | FAERS: 6 | US FAERS | |
| 448 | Peritonitis | FAERS: 6 | US FAERS | |
| 449 | Phlebitis | FAERS: 6 | US FAERS | |
| 450 | Quality of life decreased | FAERS: 6 | US FAERS | |
| 451 | Rehabilitation therapy | FAERS: 6 | US FAERS | |
| 452 | Rosacea | FAERS: 6 | US FAERS | |
| 453 | Skin lesion | FAERS: 6 | US FAERS | |
| 454 | Splenomegaly | FAERS: 6 | US FAERS | |
| 455 | Sunburn | FAERS: 6 | US FAERS | |
| 456 | Ventricular Fibrillation | FAERS: 6 | US FAERS | |
| 457 | Walking aid user | FAERS: 6 | US FAERS | |
| 458 | Acute sinusitis | FAERS: 5 | US FAERS | |
| 459 | Asthenopia | FAERS: 5 | US FAERS | |
| 460 | Blood creatine increased | FAERS: 5 | US FAERS | |
| 461 | Brain natriuretic peptide increased | FAERS: 5 | US FAERS | |
| 462 | Breast Cyst | FAERS: 5 | US FAERS | |
| 463 | CREST Syndrome | FAERS: 5 | US FAERS | |
| 464 | Carotid artery occlusion | FAERS: 5 | US FAERS | |
| 465 | Catheter site pain | FAERS: 5 | US FAERS | |
| 466 | Diabetic Foot | FAERS: 5 | US FAERS | |
| 467 | Drug dispensing error | FAERS: 5 | US FAERS | |
| 468 | Drug exposure during pregnancy | FAERS: 5 | US FAERS | |
| 469 | Drug prescribing error | FAERS: 5 | US FAERS | |
| 470 | Eye inflammation | FAERS: 5 | US FAERS | |
| 471 | Failure to Thrive | FAERS: 5 | US FAERS | |
| 472 | Gamma-Glutamyltransferase Increased | FAERS: 5 | US FAERS | |
| 473 | Grief reaction | FAERS: 5 | US FAERS | |
| 474 | Hepatotoxicity | FAERS: 5 | SIDER US FAERS | |
| 475 | Hordeolum | FAERS: 5 | US FAERS | |
| 476 | Impaired work ability | FAERS: 5 | US FAERS | |
| 477 | Infectious colitis | FAERS: 5 | US FAERS | |
| 478 | Infusion site pain | FAERS: 5 | US FAERS | |
| 479 | Jugular vein distension | FAERS: 5 | US FAERS | |
| 480 | Ligament rupture | FAERS: 5 | US FAERS | |
| 481 | Lyme Disease | FAERS: 5 | US FAERS | |
| 482 | Meniscus injury | FAERS: 5 | US FAERS | |
| 483 | Metabolic acidosis | FAERS: 5 | US FAERS | |
| 484 | Mitral Valve Stenosis | FAERS: 5 | US FAERS | |
| 485 | Mouth swelling | FAERS: 5 | US FAERS | |
| 486 | Multiple Sclerosis | FAERS: 5 | US FAERS | |
| 487 | Nephrectomy | FAERS: 5 | OFFSIDES US FAERS | |
| 488 | Nerve injury | FAERS: 5 | US FAERS | |
| 489 | Otitis Media | FAERS: 5 | US FAERS | |
| 490 | Pelvic Pain | FAERS: 5 | US FAERS | |
| 491 | Peripheral arterial occlusive disease | FAERS: 5 | US FAERS | |
| 492 | Polyarthritis | FAERS: 5 | US FAERS | |
| 493 | Pulmonary pain | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 494 | Rectal Prolapse | FAERS: 5 | US FAERS | |
| 495 | Renal mass | FAERS: 5 | OFFSIDES US FAERS | |
| 496 | Respiratory tract irritation | FAERS: 5 | US FAERS | |
| 497 | Spinal column injury | FAERS: 5 | US FAERS | |
| 498 | Spinal fusion surgery | FAERS: 5 | US FAERS | |
| 499 | Splenectomy | FAERS: 5 | US FAERS | |
| 500 | Urinary Incontinence | FAERS: 5 | US FAERS | |
| 501 | Uterine Cancer | FAERS: 5 | US FAERS | |
| 502 | VIIth nerve paralysis | FAERS: 5 | US FAERS | |
| 503 | Vasculitis | FAERS: 5 | US FAERS | |
| 504 | Waist circumference increased | FAERS: 5 | US FAERS | |
| 505 | skin abrasion | FAERS: 5 | US FAERS | |
| 506 | Acute Coronary Syndrome | FAERS: 4 | US FAERS | |
| 507 | Acute right ventricular failure | FAERS: 4 | US FAERS | |
| 508 | Amputation | FAERS: 4 | US FAERS | |
| 509 | Antibiotic therapy | FAERS: 4 | US FAERS | |
| 510 | Blood Pressure | FAERS: 4 | US FAERS | |
| 511 | Blood electrolytes decreased | FAERS: 4 | US FAERS | |
| 512 | Blood glucose fluctuation | FAERS: 4 | US FAERS | |
| 513 | Blood pressure inadequately controlled | FAERS: 4 | US FAERS | |
| 514 | Brain Death | FAERS: 4 | US FAERS | |
| 515 | Bronchiectasis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 516 | Bronchopneumonia | FAERS: 4 | US FAERS | |
| 517 | Bursitis | FAERS: 4 | US FAERS | |
| 518 | Candidiasis | FAERS: 4 | US FAERS | |
| 519 | Cardiac Tamponade | FAERS: 4 | US FAERS | |
| 520 | Cardiac assistance device user | FAERS: 4 | US FAERS | |
| 521 | Cardiac pacemaker evaluation | FAERS: 4 | US FAERS | |
| 522 | Catheter site erythema | FAERS: 4 | US FAERS | |
| 523 | Cholangiocarcinoma | FAERS: 4 | US FAERS | |
| 524 | Clostridium test positive | FAERS: 4 | US FAERS | |
| 525 | Critical Illness | FAERS: 4 | US FAERS | |
| 526 | Cystic Fibrosis | FAERS: 4 | US FAERS | |
| 527 | Device leakage | FAERS: 4 | US FAERS | |
| 528 | Device occlusion | FAERS: 4 | US FAERS | |
| 529 | Drug administered to patient of inappropriate age | FAERS: 4 | US FAERS | |
| 530 | Drug ineffective for unapproved indication | FAERS: 4 | US FAERS | |
| 531 | Electromechanical dissociation | FAERS: 4 | US FAERS | |
| 532 | Emergency Care | FAERS: 4 | US FAERS | |
| 533 | Eye laser surgery | FAERS: 4 | US FAERS | |
| 534 | Facial Pain | FAERS: 4 | US FAERS | |
| 535 | Febrile Neutropenia | FAERS: 4 | US FAERS | |
| 536 | Gastric Dilatation | FAERS: 4 | US FAERS | |
| 537 | Gastrointestinal carcinoma | FAERS: 4 | US FAERS | |
| 538 | Gastrointestinal sounds abnormal | FAERS: 4 | OFFSIDES US FAERS | |
| 539 | Glossitis | FAERS: 4 | US FAERS | |
| 540 | Hemiplegia | FAERS: 4 | US FAERS | |
| 541 | Humidity intolerance | FAERS: 4 | US FAERS | |
| 542 | Hyperparathyroidism | FAERS: 4 | US FAERS | |
| 543 | Hyperthyroidism | FAERS: 4 | US FAERS | |
| 544 | Hypokinesia | FAERS: 4 | US FAERS | |
| 545 | Inability to afford medication | FAERS: 4 | US FAERS | |
| 546 | Inappropriate schedule of product administration | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 547 | Infective pulmonary exacerbation of cystic fibrosis | FAERS: 4 | US FAERS | |
| 548 | Infusion site infection | FAERS: 4 | US FAERS | |
| 549 | Intervertebral Disc Degeneration | FAERS: 4 | US FAERS | |
| 550 | Irregular breathing | FAERS: 4 | US FAERS | |
| 551 | Irritable Bowel Syndrome | FAERS: 4 | US FAERS | |
| 552 | Labyrinthitis | FAERS: 4 | US FAERS | |
| 553 | Localised intraabdominal fluid collection | FAERS: 4 | OFFSIDES US FAERS | |
| 554 | Medical device implantation | FAERS: 4 | US FAERS | |
| 555 | Meningitis | FAERS: 4 | US FAERS | |
| 556 | Mixed Connective Tissue Disease | FAERS: 4 | US FAERS | |
| 557 | Narcolepsy | FAERS: 4 | US FAERS | |
| 558 | Oliguria | FAERS: 4 | US FAERS | |
| 559 | Oral candidiasis | FAERS: 4 | US FAERS | |
| 560 | Pain of skin | FAERS: 4 | US FAERS | |
| 561 | Palliative Care | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 562 | Paraplegia | FAERS: 4 | OFFSIDES US FAERS | |
| 563 | Peptic Ulcer | FAERS: 4 | US FAERS | |
| 564 | Personality Change | FAERS: 4 | US FAERS | |
| 565 | Pertussis | FAERS: 4 | US FAERS | |
| 566 | Post-Traumatic Stress Disorder | FAERS: 4 | US FAERS | |
| 567 | Pregnancy test positive | FAERS: 4 | US FAERS | |
| 568 | Protein urine present | FAERS: 4 | US FAERS | |
| 569 | Pulmonary endarterectomy | FAERS: 4 | US FAERS | |
| 570 | Rales | FAERS: 4 | SIDER US FAERS | |
| 571 | Retinal Detachment | FAERS: 4 | US FAERS | |
| 572 | Scab | FAERS: 4 | US FAERS | |
| 573 | Skeletal injury | FAERS: 4 | OFFSIDES US FAERS | |
| 574 | Skin reaction | FAERS: 4 | US FAERS | |
| 575 | Snoring | FAERS: 4 | US FAERS | |
| 576 | Spondylitis | FAERS: 4 | US FAERS | |
| 577 | Squamous cell carcinoma | FAERS: 4 | US FAERS | |
| 578 | Sudden onset of sleep | FAERS: 4 | US FAERS | |
| 579 | Therapeutic response changed | FAERS: 4 | US FAERS | |
| 580 | Therapy non-responder | FAERS: 4 | US FAERS | |
| 581 | Throat cancer | FAERS: 4 | US FAERS | |
| 582 | Thyroid Neoplasm | FAERS: 4 | US FAERS | |
| 583 | Thyroidectomy | FAERS: 4 | US FAERS | |
| 584 | Tobacco user | FAERS: 4 | US FAERS | |
| 585 | Tonsillectomy | FAERS: 4 | US FAERS | |
| 586 | Toxicity to various agents | FAERS: 4 | US FAERS | |
| 587 | Troponin increased | FAERS: 4 | US FAERS | |
| 588 | Vulvovaginal burning sensation | FAERS: 4 | US FAERS | |
| 589 | Vulvovaginal pruritus | FAERS: 4 | US FAERS | |
| 590 | Yawning | FAERS: 4 | US FAERS | |
| 591 | furuncle | FAERS: 4 | US FAERS | |
| 592 | intensive care | FAERS: 4 | US FAERS | |
| 593 | treatment failure | FAERS: 4 | US FAERS | |
| 594 | Abdominal mass | FAERS: 3 | US FAERS | |
| 595 | Abdominal rigidity | FAERS: 3 | US FAERS | |
| 596 | Acidosis | FAERS: 3 | US FAERS | |
| 597 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 598 | Ammonia abnormal | FAERS: 3 | US FAERS | |
| 599 | Anoxic Encephalopathy | FAERS: 3 | US FAERS | |
| 600 | Application site irritation | FAERS: 3 | US FAERS | |
| 601 | Asbestosis | FAERS: 3 | US FAERS | |
| 602 | Atelectasis | FAERS: 3 | US FAERS | |
| 603 | Autoimmune hepatitis | FAERS: 3 | SIDER US FAERS | |
| 604 | Biliary cirrhosis | FAERS: 3 | US FAERS | |
| 605 | Bladder discomfort | FAERS: 3 | US FAERS | |
| 606 | Bladder pain | FAERS: 3 | US FAERS | |
| 607 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 608 | Blood creatinine abnormal | FAERS: 3 | US FAERS | |
| 609 | Blood phosphorus decreased | FAERS: 3 | US FAERS | |
| 610 | Blood sodium abnormal | FAERS: 3 | US FAERS | |
| 611 | Blood sodium increased | FAERS: 3 | US FAERS | |
| 612 | Bowel movement irregularity | FAERS: 3 | US FAERS | |
| 613 | Brain Abscess | FAERS: 3 | US FAERS | |
| 614 | Brain Hypoxia | FAERS: 3 | US FAERS | |
| 615 | Bronchial secretion retention | FAERS: 3 | US FAERS | |
| 616 | Cardiac Death | FAERS: 3 | US FAERS | |
| 617 | Cardiac enzymes increased | FAERS: 3 | US FAERS | |
| 618 | Cardiac infection | FAERS: 3 | US FAERS | |
| 619 | Cardioactive drug level increased | FAERS: 3 | US FAERS | |
| 620 | Catheter site discharge | FAERS: 3 | US FAERS | |
| 621 | Cervix carcinoma | FAERS: 3 | US FAERS | |
| 622 | Cholestasis | FAERS: 3 | US FAERS | |
| 623 | Chronic sinusitis | FAERS: 3 | OFFSIDES US FAERS | |
| 624 | Debridement | FAERS: 3 | US FAERS | |
| 625 | Dental caries | FAERS: 3 | US FAERS | |
| 626 | Dermatitis | FAERS: 3 | SIDER US FAERS | |
| 627 | Device breakage | FAERS: 3 | US FAERS | |
| 628 | Device related sepsis | FAERS: 3 | US FAERS | |
| 629 | Diabetic Ketoacidosis | FAERS: 3 | US FAERS | |
| 630 | Diverticulum | FAERS: 3 | US FAERS | |
| 631 | Drug Dependence | FAERS: 3 | US FAERS | |
| 632 | Dysphemia | FAERS: 3 | US FAERS | |
| 633 | Early satiety | FAERS: 3 | US FAERS | |
| 634 | Eczema | FAERS: 3 | US FAERS | |
| 635 | Epilepsy | FAERS: 3 | US FAERS | |
| 636 | Escherichia urinary tract infection | FAERS: 3 | US FAERS | |
| 637 | Exposure to chemical pollution | FAERS: 3 | US FAERS | |
| 638 | Exposure to toxic agent | FAERS: 3 | US FAERS | |
| 639 | Feeding tube user | FAERS: 3 | US FAERS | |
| 640 | Gallbladder pain | FAERS: 3 | US FAERS | |
| 641 | Gastrectomy | FAERS: 3 | US FAERS | |
| 642 | Gastrointestinal viral infection | FAERS: 3 | US FAERS | |
| 643 | Gastrostomy | FAERS: 3 | US FAERS | |
| 644 | Hallucinations, mixed | FAERS: 3 | US FAERS | |
| 645 | Hearing aid user | FAERS: 3 | US FAERS | |
| 646 | Heat Exhaustion | FAERS: 3 | US FAERS | |
| 647 | Heat Stroke | FAERS: 3 | US FAERS | |
| 648 | Hemiparesis | FAERS: 3 | US FAERS | |
| 649 | Hepatic congestion | FAERS: 3 | SIDER US FAERS | |
| 650 | Hidradenitis | FAERS: 3 | US FAERS | |
| 651 | Human chorionic gonadotropin positive | FAERS: 3 | US FAERS | |
| 652 | Hyperacusis | FAERS: 3 | US FAERS | |
| 653 | Hypertensive emergency | FAERS: 3 | OFFSIDES US FAERS | |
| 654 | Hypertensive heart disease | FAERS: 3 | OFFSIDES US FAERS | |
| 655 | Hypoventilation | FAERS: 3 | US FAERS | |
| 656 | Impaired self-care | FAERS: 3 | US FAERS | |
| 657 | Impetigo | FAERS: 3 | US FAERS | |
| 658 | Incision site infection | FAERS: 3 | US FAERS | |
| 659 | Induration | FAERS: 3 | US FAERS | |
| 660 | Infected fistula | FAERS: 3 | US FAERS | |
| 661 | Infusion site erythema | FAERS: 3 | US FAERS | |
| 662 | Intervertebral disc disorder | FAERS: 3 | US FAERS | |
| 663 | Intestinal resection | FAERS: 3 | US FAERS | |
| 664 | Intravenous catheter management | FAERS: 3 | US FAERS | |
| 665 | Joint sprain | FAERS: 3 | US FAERS | |
| 666 | Labile blood pressure | FAERS: 3 | US FAERS | |
| 667 | Life expectancy shortened | FAERS: 3 | US FAERS | |
| 668 | Lip exfoliation | FAERS: 3 | US FAERS | |
| 669 | Mastitis | FAERS: 3 | US FAERS | |
| 670 | Medical observation | FAERS: 3 | US FAERS | |
| 671 | Medical procedure | FAERS: 3 | US FAERS | |
| 672 | Multi-organ disorder | FAERS: 3 | US FAERS | |
| 673 | Nerve Block | FAERS: 3 | US FAERS | |
| 674 | Neutropenia | FAERS: 3 | US FAERS | |
| 675 | Oral fungal infection | FAERS: 3 | US FAERS | |
| 676 | Periorbital contusion | FAERS: 3 | US FAERS | |
| 677 | Physical disability | FAERS: 3 | US FAERS | |
| 678 | Poliomyelitis | FAERS: 3 | US FAERS | |
| 679 | Polymyositis | FAERS: 3 | US FAERS | |
| 680 | Pregnancy test false positive | FAERS: 3 | US FAERS | |
| 681 | Product physical issue | FAERS: 3 | US FAERS | |
| 682 | Product supply issue | FAERS: 3 | US FAERS | |
| 683 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 684 | Pulmonary arterial pressure abnormal | FAERS: 3 | US FAERS | |
| 685 | Pulmonary arterial pressure | FAERS: 3 | US FAERS | |
| 686 | Pulmonary hypertensive crisis | FAERS: 3 | US FAERS | |
| 687 | Pulmonary vascular disorder | FAERS: 3 | US FAERS | |
| 688 | Renal and pancreas transplant | FAERS: 3 | US FAERS | |
| 689 | Respiratory Depression | FAERS: 3 | US FAERS | |
| 690 | Respiratory fume inhalation disorder | FAERS: 3 | US FAERS | |
| 691 | Sick Sinus Syndrome | FAERS: 3 | US FAERS | |
| 692 | Splenic Rupture | FAERS: 3 | US FAERS | |
| 693 | Squamous cell carcinoma of skin | FAERS: 3 | US FAERS | |
| 694 | Stevens-Johnson Syndrome | FAERS: 3 | US FAERS | |
| 695 | Subacute hepatic failure | FAERS: 3 | US FAERS | |
| 696 | Swan ganz catheter placement | FAERS: 3 | US FAERS | |
| 697 | Systemic Scleroderma | FAERS: 3 | US FAERS | |
| 698 | Tension | FAERS: 3 | US FAERS | |
| 699 | Tinea Pedis | FAERS: 3 | US FAERS | |
| 700 | Toe operation | FAERS: 3 | US FAERS | |
| 701 | Ureteral stent insertion | FAERS: 3 | US FAERS | |
| 702 | Vascular procedure complication | FAERS: 3 | US FAERS | |
| 703 | Venous occlusion | FAERS: 3 | OFFSIDES US FAERS | |
| 704 | Vitamin D Deficiency | FAERS: 3 | US FAERS | |
| 705 | Vocal Cord Paralysis | FAERS: 3 | US FAERS | |
| 706 | Weaning failure | FAERS: 3 | US FAERS | |
| 707 | Abdominal adhesions | FAERS: 2 | OFFSIDES US FAERS | |
| 708 | Abdominal sepsis | FAERS: 2 | US FAERS | |
| 709 | Abscess sweat gland | FAERS: 2 | US FAERS | |
| 710 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 711 | Acute Chest Syndrome | FAERS: 2 | US FAERS | |
| 712 | Alcohol abuse | FAERS: 2 | US FAERS | |
| 713 | Alcohol poisoning | FAERS: 2 | US FAERS | |
| 714 | Allergic sinusitis | FAERS: 2 | US FAERS | |
| 715 | Allergy to chemicals | FAERS: 2 | US FAERS | |
| 716 | Ammonia | FAERS: 2 | US FAERS | |
| 717 | Apathy | FAERS: 2 | US FAERS | |
| 718 | Application site rash | FAERS: 2 | US FAERS | |
| 719 | Aquagenic pruritus | FAERS: 2 | US FAERS | |
| 720 | Arterial Injury | FAERS: 2 | US FAERS | |
| 721 | Arteriosclerosis | FAERS: 2 | US FAERS | |
| 722 | Arteriovenous fistula aneurysm | FAERS: 2 | US FAERS | |
| 723 | Arteriovenous fistula thrombosis | FAERS: 2 | US FAERS | |
| 724 | Arthropod sting | FAERS: 2 | US FAERS | |
| 725 | Atrial tachycardia | FAERS: 2 | US FAERS | |
| 726 | Atrioventricular Septal Defect | FAERS: 2 | US FAERS | |
| 727 | Bacterial sepsis | FAERS: 2 | US FAERS | |
| 728 | Barium swallow | FAERS: 2 | US FAERS | |
| 729 | Benign Neoplasm | FAERS: 2 | US FAERS | |
| 730 | Bipolar Disorder | FAERS: 2 | US FAERS | |
| 731 | Bladder dysfunction | FAERS: 2 | US FAERS | |
| 732 | Blepharitis | FAERS: 2 | US FAERS | |
| 733 | Blepharospasm | FAERS: 2 | US FAERS | |
| 734 | Blister rupture | FAERS: 2 | US FAERS | |
| 735 | Blood calcium abnormal | FAERS: 2 | US FAERS | |
| 736 | Blood carbon monoxide increased | FAERS: 2 | US FAERS | |
| 737 | Blood cholesterol abnormal | FAERS: 2 | US FAERS | |
| 738 | Blood creatinine decreased | FAERS: 2 | US FAERS | |
| 739 | Blood electrolytes abnormal | FAERS: 2 | US FAERS | |
| 740 | Blood immunoglobulin E increased | FAERS: 2 | US FAERS | |
| 741 | Blood testosterone decreased | FAERS: 2 | US FAERS | |
| 742 | Blood triglycerides abnormal | FAERS: 2 | US FAERS | |
| 743 | Blood urea increased | FAERS: 2 | US FAERS | |
| 744 | Body Temperature | FAERS: 2 | US FAERS | |
| 745 | Body temperature fluctuation | FAERS: 2 | US FAERS | |
| 746 | Borderline glaucoma | FAERS: 2 | US FAERS | |
| 747 | Bradyphrenia | FAERS: 2 | US FAERS | |
| 748 | Breast discomfort | FAERS: 2 | US FAERS | |
| 749 | Breast tenderness | FAERS: 2 | US FAERS | |
| 750 | Bronchial Obstruction | FAERS: 2 | US FAERS | |
| 751 | Bronchiolitis | FAERS: 2 | US FAERS | |
| 752 | Calcific deposits removal | FAERS: 2 | US FAERS | |
| 753 | Carbon Monoxide Poisoning | FAERS: 2 | US FAERS | |
| 754 | Cardiac Hypertrophy | FAERS: 2 | US FAERS | |
| 755 | Cardiac monitoring | FAERS: 2 | US FAERS | |
| 756 | Cardiac procedure complication | FAERS: 2 | US FAERS | |
| 757 | Cardio-respiratory distress | FAERS: 2 | US FAERS | |
| 758 | Cardiovascular insufficiency | FAERS: 2 | US FAERS | |
| 759 | Catheter management | FAERS: 2 | US FAERS | |
| 760 | Catheter site inflammation | FAERS: 2 | US FAERS | |
| 761 | Catheter site pruritus | FAERS: 2 | US FAERS | |
| 762 | Central venous catheter removal | FAERS: 2 | US FAERS | |
| 763 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 764 | Cerebral Thrombosis | FAERS: 2 | US FAERS | |
| 765 | Chordoma | FAERS: 2 | US FAERS | |
| 766 | Clubbing | FAERS: 2 | US FAERS | |
| 767 | Clumsiness | FAERS: 2 | US FAERS | |
| 768 | Coagulation test abnormal | FAERS: 2 | US FAERS | |
| 769 | Coital bleeding | FAERS: 2 | US FAERS | |
| 770 | Completed Suicide | FAERS: 2 | US FAERS | |
| 771 | Craniotomy | FAERS: 2 | US FAERS | |
| 772 | Cytopenia | FAERS: 2 | US FAERS | |
| 773 | Dengue Fever | FAERS: 2 | US FAERS | |
| 774 | Dental discomfort | FAERS: 2 | US FAERS | |
| 775 | Dermatomyositis | FAERS: 2 | US FAERS | |
| 776 | Device damage | FAERS: 2 | US FAERS | |
| 777 | Device power source issue | FAERS: 2 | US FAERS | |
| 778 | Dialysis device insertion | FAERS: 2 | OFFSIDES US FAERS | |
| 779 | Diplegia | FAERS: 2 | US FAERS | |
| 780 | Dissociation | FAERS: 2 | US FAERS | |
| 781 | Drug abuser | FAERS: 2 | US FAERS | |
| 782 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 783 | Drug therapy changed | FAERS: 2 | US FAERS | |
| 784 | Dyspareunia | FAERS: 2 | US FAERS | |
| 785 | Ecchymosis | FAERS: 2 | US FAERS | |
| 786 | Ejection fraction abnormal | FAERS: 2 | US FAERS | |
| 787 | Elbow operation | FAERS: 2 | US FAERS | |
| 788 | Elective procedure | FAERS: 2 | US FAERS | |
| 789 | Electrocardiogram change | FAERS: 2 | OFFSIDES US FAERS | |
| 790 | Embolic stroke | FAERS: 2 | US FAERS | |
| 791 | Endotracheal intubation complication | FAERS: 2 | US FAERS | |
| 792 | Enterococcal sepsis | FAERS: 2 | US FAERS | |
| 793 | Entropion | FAERS: 2 | US FAERS | |
| 794 | Enzyme level increased | FAERS: 2 | US FAERS | |
| 795 | Epigastric discomfort | FAERS: 2 | US FAERS | |
| 796 | Excessive cerumen production | FAERS: 2 | US FAERS | |
| 797 | Exposure via body fluid | FAERS: 2 | US FAERS | |
| 798 | Eyeglasses therapy | FAERS: 2 | US FAERS | |
| 799 | Eyelid margin crusting | FAERS: 2 | US FAERS | |
| 800 | Facial paralysis | FAERS: 2 | US FAERS | |
| 801 | Fat redistribution | FAERS: 2 | US FAERS | |
| 802 | Feeding tube complication | FAERS: 2 | US FAERS | |
| 803 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 804 | Femoral artery occlusion | FAERS: 2 | US FAERS | |
| 805 | Foaming at mouth | FAERS: 2 | US FAERS | |
| 806 | Foreign body aspiration | FAERS: 2 | US FAERS | |
| 807 | Formication | FAERS: 2 | US FAERS | |
| 808 | Full blood count abnormal | FAERS: 2 | US FAERS | |
| 809 | Gastrointestinal angiodysplasia | FAERS: 2 | US FAERS | |
| 810 | Gastrointestinal hypomotility | FAERS: 2 | US FAERS | |
| 811 | Gastrointestinal motility disorder | FAERS: 2 | US FAERS | |
| 812 | Gastrointestinal mucosal disorder | FAERS: 2 | US FAERS | |
| 813 | Gastrointestinal ulcer | FAERS: 2 | US FAERS | |
| 814 | Groin infection | FAERS: 2 | US FAERS | |
| 815 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 816 | Heat illness | FAERS: 2 | US FAERS | |
| 817 | Hepatic Infection | FAERS: 2 | US FAERS | |
| 818 | Hepatic cancer metastatic | FAERS: 2 | US FAERS | |
| 819 | Hepatic enzyme decreased | FAERS: 2 | US FAERS | |
| 820 | Hepatitis A | FAERS: 2 | US FAERS | |
| 821 | Hepatorenal Syndrome | FAERS: 2 | US FAERS | |
| 822 | Hunger | FAERS: 2 | US FAERS | |
| 823 | Hypertrophic Cardiomyopathy | FAERS: 2 | US FAERS | |
| 824 | Hypogeusia | FAERS: 2 | US FAERS | |
| 825 | Hypoperfusion | FAERS: 2 | US FAERS | |
| 826 | Hypothyroidism | FAERS: 2 | US FAERS | |
| 827 | Iatrogenic injury | FAERS: 2 | US FAERS | |
| 828 | Immune thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 829 | Incorrect drug administration rate | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 830 | Increased tendency to bruise | FAERS: 2 | US FAERS | |
| 831 | Increased viscosity of bronchial secretion | FAERS: 2 | US FAERS | |
| 832 | Increased viscosity of upper respiratory secretion | FAERS: 2 | US FAERS | |
| 833 | Infectious Mononucleosis | FAERS: 2 | US FAERS | |
| 834 | Influenza B virus test positive | FAERS: 2 | US FAERS | |
| 835 | Infusion site swelling | FAERS: 2 | US FAERS | |
| 836 | Intestinal cyst | FAERS: 2 | US FAERS | |
| 837 | Joint Instability | FAERS: 2 | US FAERS | |
| 838 | Joint stiffness | FAERS: 2 | US FAERS | |
| 839 | Keratomileusis | FAERS: 2 | US FAERS | |
| 840 | Laparotomy | FAERS: 2 | US FAERS | |
| 841 | Lip and/or oral cavity cancer | FAERS: 2 | US FAERS | |
| 842 | Liver Abscess | FAERS: 2 | US FAERS | |
| 843 | Low density lipoprotein increased | FAERS: 2 | US FAERS | |
| 844 | Lower respiratory tract infection fungal | FAERS: 2 | US FAERS | |
| 845 | Lung cyst | FAERS: 2 | US FAERS | |
| 846 | Lung hyperinflation | FAERS: 2 | US FAERS | |
| 847 | Lymph node palpable | FAERS: 2 | US FAERS | |
| 848 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 849 | Macule | FAERS: 2 | US FAERS | |
| 850 | Marasmus | FAERS: 2 | US FAERS | |
| 851 | Mastoiditis | FAERS: 2 | US FAERS | |
| 852 | Measles | FAERS: 2 | US FAERS | |
| 853 | Medical induction of coma | FAERS: 2 | US FAERS | |
| 854 | Metastasis | FAERS: 2 | US FAERS | |
| 855 | Migraine with Aura | FAERS: 2 | US FAERS | |
| 856 | Miliaria | FAERS: 2 | US FAERS | |
| 857 | Monoparesis | FAERS: 2 | US FAERS | |
| 858 | Multiple sclerosis relapse | FAERS: 2 | US FAERS | |
| 859 | Myocardial necrosis marker increased | FAERS: 2 | US FAERS | |
| 860 | Myocarditis | FAERS: 2 | US FAERS | |
| 861 | N-terminal prohormone brain natriuretic peptide abnormal | FAERS: 2 | US FAERS | |
| 862 | Nasal turbinate abnormality | FAERS: 2 | US FAERS | |
| 863 | Necrosis | FAERS: 2 | US FAERS | |
| 864 | Negative thoughts | FAERS: 2 | US FAERS | |
| 865 | Nodule | FAERS: 2 | US FAERS | |
| 866 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 867 | Obstruction | FAERS: 2 | US FAERS | |
| 868 | Occult blood positive | FAERS: 2 | US FAERS | |
| 869 | Orchitis | FAERS: 2 | US FAERS | |
| 870 | Oropharyngeal discomfort | FAERS: 2 | US FAERS | |
| 871 | Oropharyngeal swelling | FAERS: 2 | US FAERS | |
| 872 | Pancreatectomy | FAERS: 2 | US FAERS | |
| 873 | Pancreatic Cyst | FAERS: 2 | US FAERS | |
| 874 | Pancreatic Insufficiency | FAERS: 2 | OFFSIDES US FAERS | |
| 875 | Pancreatic enlargement | FAERS: 2 | US FAERS | |
| 876 | Pancreatic enzymes increased | FAERS: 2 | US FAERS | |
| 877 | Paranoia | FAERS: 2 | US FAERS | |
| 878 | Paraparesis | FAERS: 2 | US FAERS | |
| 879 | Partial lung resection | FAERS: 2 | US FAERS | |
| 880 | Pelvic mass | FAERS: 2 | US FAERS | |
| 881 | Penile swelling | FAERS: 2 | US FAERS | |
| 882 | Performance status decreased | FAERS: 2 | US FAERS | |
| 883 | Perineal pain | FAERS: 2 | US FAERS | |
| 884 | Peritoneal Dialysis | FAERS: 2 | US FAERS | |
| 885 | Petechiae | FAERS: 2 | US FAERS | |
| 886 | Phonophobia | FAERS: 2 | US FAERS | |
| 887 | Plasmapheresis | FAERS: 2 | US FAERS | |
| 888 | Polydipsia | FAERS: 2 | US FAERS | |
| 889 | Portal Hypertension | FAERS: 2 | US FAERS | |
| 890 | Postoperative thrombosis | FAERS: 2 | US FAERS | |
| 891 | Precancerous cells present | FAERS: 2 | US FAERS | |
| 892 | Precancerous skin lesion | FAERS: 2 | US FAERS | |
| 893 | Pregnancy test negative | FAERS: 2 | US FAERS | |
| 894 | Premature Menopause | FAERS: 2 | US FAERS | |
| 895 | Procedural hypotension | FAERS: 2 | US FAERS | |
| 896 | Product availability issue | FAERS: 2 | US FAERS | |
| 897 | Product difficult to swallow | FAERS: 2 | US FAERS | |
| 898 | Product storage error | FAERS: 2 | US FAERS | |
| 899 | Product use complaint | FAERS: 2 | US FAERS | |
| 900 | Psoriasis | FAERS: 2 | US FAERS | |
| 901 | Pulmonary arteriopathy | FAERS: 2 | US FAERS | |
| 902 | Pulmonary sepsis | FAERS: 2 | US FAERS | |
| 903 | Purulent discharge | FAERS: 2 | US FAERS | |
| 904 | Pyloric sphincter insufficiency | FAERS: 2 | US FAERS | |
| 905 | Reflux gastritis | FAERS: 2 | US FAERS | |
| 906 | Regurgitation | FAERS: 2 | US FAERS | |
| 907 | Renal Cell Carcinoma | FAERS: 2 | US FAERS | |
| 908 | Renal hypertension | FAERS: 2 | US FAERS | |
| 909 | Renal tubular necrosis | FAERS: 2 | US FAERS | |
| 910 | Respiratory syncytial virus bronchitis | FAERS: 2 | US FAERS | |
| 911 | Respiratory tract inflammation | FAERS: 2 | US FAERS | |
| 912 | Rheumatic Fever | FAERS: 2 | US FAERS | |
| 913 | Right Ventricular Dysfunction | FAERS: 2 | US FAERS | |
| 914 | Ruptured cerebral aneurysm | FAERS: 2 | US FAERS | |
| 915 | Schizophrenia | FAERS: 2 | US FAERS | |
| 916 | Seasonal Affective Disorder | FAERS: 2 | US FAERS | |
| 917 | Sensation of blood flow | FAERS: 2 | US FAERS | |
| 918 | Sinus pain | FAERS: 2 | US FAERS | |
| 919 | Skin Papilloma | FAERS: 2 | US FAERS | |
| 920 | Skin Wrinkling | FAERS: 2 | US FAERS | |
| 921 | Skin irritation | FAERS: 2 | US FAERS | |
| 922 | Solar dermatitis | FAERS: 2 | US FAERS | |
| 923 | Somnambulism | FAERS: 2 | US FAERS | |
| 924 | Splenic thrombosis | FAERS: 2 | US FAERS | |
| 925 | Stenosis | FAERS: 2 | US FAERS | |
| 926 | Stent malfunction | FAERS: 2 | US FAERS | |
| 927 | Steroid therapy | FAERS: 2 | US FAERS | |
| 928 | Stridor | FAERS: 2 | US FAERS | |
| 929 | Subcutaneous Abscess | FAERS: 2 | US FAERS | |
| 930 | Superficial vein prominence | FAERS: 2 | US FAERS | |
| 931 | Sympathectomy | FAERS: 2 | US FAERS | |
| 932 | Synovial Cyst | FAERS: 2 | US FAERS | |
| 933 | Systemic lupus erythematosus rash | FAERS: 2 | US FAERS | |
| 934 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 935 | Therapeutic product ineffective | FAERS: 2 | US FAERS | |
| 936 | Therapy responder | FAERS: 2 | US FAERS | |
| 937 | Thoracic cavity drainage | FAERS: 2 | US FAERS | |
| 938 | Thromboembolectomy | FAERS: 2 | US FAERS | |
| 939 | Tooth Loss | FAERS: 2 | US FAERS | |
| 940 | Total lung capacity abnormal | FAERS: 2 | US FAERS | |
| 941 | Transfusion Reaction | FAERS: 2 | US FAERS | |
| 942 | Trichorrhexis | FAERS: 2 | US FAERS | |
| 943 | Tympanic Membrane Perforation | FAERS: 2 | US FAERS | |
| 944 | Umbilical hernia | FAERS: 2 | US FAERS | |
| 945 | Upper airway obstruction | FAERS: 2 | US FAERS | |
| 946 | Upper respiratory tract irritation | FAERS: 2 | US FAERS | |
| 947 | Urine output increased | FAERS: 2 | US FAERS | |
| 948 | Vascular device infection | FAERS: 2 | US FAERS | |
| 949 | Vascular pain | FAERS: 2 | US FAERS | |
| 950 | Vasodilation procedure | FAERS: 2 | US FAERS | |
| 951 | Vein collapse | FAERS: 2 | US FAERS | |
| 952 | Vena cava filter insertion | FAERS: 2 | US FAERS | |
| 953 | Venous Injury | FAERS: 2 | US FAERS | |
| 954 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 955 | Ventricular Dysfunction | FAERS: 2 | US FAERS | |
| 956 | Vulvovaginal swelling | FAERS: 2 | US FAERS | |
| 957 | White blood cell count abnormal | FAERS: 2 | US FAERS | |
| 958 | Wound dehiscence | FAERS: 2 | US FAERS | |
| 959 | Wrong dose | FAERS: 2 | US FAERS | |
| 960 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 961 | angiogram | FAERS: 2 | US FAERS | |
| 962 | heart rate | FAERS: 2 | US FAERS | |
| 963 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 964 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 965 | Abdominal cavity drainage | FAERS: 1 | US FAERS | |
| 966 | Abdominal panniculectomy | FAERS: 1 | US FAERS | |
| 967 | Accidental death | FAERS: 1 | US FAERS | |
| 968 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 969 | Acquired diaphragmatic eventration | FAERS: 1 | US FAERS | |
| 970 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 971 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 972 | Adenomatous Polyposis Coli | FAERS: 1 | US FAERS | |
| 973 | Adnexa uteri mass | FAERS: 1 | US FAERS | |
| 974 | Allergy to arthropod sting | FAERS: 1 | US FAERS | |
| 975 | Alveolitis | FAERS: 1 | US FAERS | |
| 976 | Ammonia decreased | FAERS: 1 | US FAERS | |
| 977 | Amniocentesis | FAERS: 1 | US FAERS | |
| 978 | Anastomotic ulcer | FAERS: 1 | US FAERS | |
| 979 | Angiodysplasia | FAERS: 1 | US FAERS | |
| 980 | Anhidrosis | FAERS: 1 | US FAERS | |
| 981 | Animal scratch | FAERS: 1 | US FAERS | |
| 982 | Ankylosing spondylitis | FAERS: 1 | US FAERS | |
| 983 | Antibiotic resistant Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 984 | Anticoagulant therapy | FAERS: 1 | US FAERS | |
| 985 | Anticoagulation drug level decreased | FAERS: 1 | US FAERS | |
| 986 | Antiphospholipid Syndrome | FAERS: 1 | US FAERS | |
| 987 | Aortic stent insertion | FAERS: 1 | US FAERS | |
| 988 | Aortic surgery | FAERS: 1 | US FAERS | |
| 989 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 990 | Application site discharge | FAERS: 1 | US FAERS | |
| 991 | Arterial therapeutic procedure | FAERS: 1 | US FAERS | |
| 992 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 993 | Arteriovenous fistula occlusion | FAERS: 1 | US FAERS | |
| 994 | Arteriovenous fistula site infection | FAERS: 1 | US FAERS | |
| 995 | Arteriovenous graft site infection | FAERS: 1 | US FAERS | |
| 996 | Asphyxia | FAERS: 1 | US FAERS | |
| 997 | Atrial pressure increased | FAERS: 1 | US FAERS | |
| 998 | Bacterial Vaginosis | FAERS: 1 | US FAERS | |
| 999 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 1000 | Biliary Colic | FAERS: 1 | US FAERS | |
| 1001 | Biliary tract infection fungal | FAERS: 1 | US FAERS | |
| 1002 | Bladder neoplasm surgery | FAERS: 1 | US FAERS | |
| 1003 | Bladder spasm | FAERS: 1 | US FAERS | |
| 1004 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 1005 | Blood blister | FAERS: 1 | OFFSIDES US FAERS | |
| 1006 | Blood carbon monoxide abnormal | FAERS: 1 | US FAERS | |
| 1007 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 1008 | Blood copper increased | FAERS: 1 | US FAERS | |
| 1009 | Blood lactic acid abnormal | FAERS: 1 | US FAERS | |
| 1010 | Blood magnesium abnormal | FAERS: 1 | US FAERS | |
| 1011 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 1012 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 1013 | Blood pressure orthostatic abnormal | FAERS: 1 | US FAERS | |
| 1014 | Bone Sarcoma | FAERS: 1 | US FAERS | |
| 1015 | Brain Contusion | FAERS: 1 | US FAERS | |
| 1016 | Breast discharge infected | FAERS: 1 | US FAERS | |
| 1017 | Bronchoalveolar Lavage | FAERS: 1 | US FAERS | |
| 1018 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 1019 | Calciphylaxis | FAERS: 1 | US FAERS | |
| 1020 | Capillary Fragility | FAERS: 1 | US FAERS | |
| 1021 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 1022 | Cardiac function test abnormal | FAERS: 1 | US FAERS | |
| 1023 | Cardiac septal defect repair | FAERS: 1 | US FAERS | |
| 1024 | Cardiac valve replacement complication | FAERS: 1 | OFFSIDES US FAERS | |
| 1025 | Cartilage injury | FAERS: 1 | US FAERS | |
| 1026 | Cataract operation complication | FAERS: 1 | US FAERS | |
| 1027 | Catatonia | FAERS: 1 | US FAERS | |
| 1028 | Catheter related infection | FAERS: 1 | US FAERS | |
| 1029 | Catheter site extravasation | FAERS: 1 | US FAERS | |
| 1030 | Catheter site swelling | FAERS: 1 | US FAERS | |
| 1031 | Central Nervous System Infection | FAERS: 1 | US FAERS | |
| 1032 | Cervical dysplasia | FAERS: 1 | US FAERS | |
| 1033 | Chronic right ventricular failure | FAERS: 1 | US FAERS | |
| 1034 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 1035 | Clostridial sepsis | FAERS: 1 | US FAERS | |
| 1036 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 1037 | Coronary angioplasty | FAERS: 1 | US FAERS | |
| 1038 | Corrective lens user | FAERS: 1 | US FAERS | |
| 1039 | Croup infectious | FAERS: 1 | US FAERS | |
| 1040 | Culture positive | FAERS: 1 | US FAERS | |
| 1041 | Culture urine positive | FAERS: 1 | US FAERS | |
| 1042 | Cyst removal | FAERS: 1 | US FAERS | |
| 1043 | Cystoscopy | FAERS: 1 | US FAERS | |
| 1044 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 1045 | Death of relative | FAERS: 1 | US FAERS | |
| 1046 | Deformity | FAERS: 1 | US FAERS | |
| 1047 | Dental Plaque | FAERS: 1 | US FAERS | |
| 1048 | Depression suicidal | FAERS: 1 | US FAERS | |
| 1049 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 1050 | Device Failure | FAERS: 1 | US FAERS | |
| 1051 | Device intolerance | FAERS: 1 | US FAERS | |
| 1052 | Device loosening | FAERS: 1 | US FAERS | |
| 1053 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 1054 | Diabetic ulcer | FAERS: 1 | US FAERS | |
| 1055 | Diaphragmatic Hernia | FAERS: 1 | US FAERS | |
| 1056 | Diffuse alveolar damage | FAERS: 1 | US FAERS | |
| 1057 | Diuretic therapy | FAERS: 1 | US FAERS | |
| 1058 | Drug delivery device implantation | FAERS: 1 | US FAERS | |
| 1059 | Drug level decreased | FAERS: 1 | US FAERS | |
| 1060 | Drug toxicity | FAERS: 1 | US FAERS | |
| 1061 | Dry gangrene | FAERS: 1 | US FAERS | |
| 1062 | Duodenal ulcer perforation | FAERS: 1 | US FAERS | |
| 1063 | Duodenitis | FAERS: 1 | US FAERS | |
| 1064 | Ear infection staphylococcal | FAERS: 1 | US FAERS | |
| 1065 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 1066 | Emotional distress | FAERS: 1 | US FAERS | |
| 1067 | Empyema | FAERS: 1 | US FAERS | |
| 1068 | Encephalitis | FAERS: 1 | US FAERS | |
| 1069 | Enlarged uvula | FAERS: 1 | US FAERS | |
| 1070 | Enteral Nutrition | FAERS: 1 | US FAERS | |
| 1071 | Enteritis | FAERS: 1 | US FAERS | |
| 1072 | Enterobacter sepsis | FAERS: 1 | US FAERS | |
| 1073 | Enterocutaneous Fistula | FAERS: 1 | US FAERS | |
| 1074 | Eosinophilic colitis | FAERS: 1 | US FAERS | |
| 1075 | Erythema Nodosum | FAERS: 1 | OFFSIDES US FAERS | |
| 1076 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 1077 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 1078 | Excoriation | FAERS: 1 | US FAERS | |
| 1079 | Exposure via inhalation | FAERS: 1 | US FAERS | |
| 1080 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 1081 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 1082 | Food aversion | FAERS: 1 | US FAERS | |
| 1083 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 1084 | Fracture pain | FAERS: 1 | US FAERS | |
| 1085 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 1086 | Gallbladder cancer stage IV | FAERS: 1 | US FAERS | |
| 1087 | Gastrointestinal angiodysplasia haemorrhagic | FAERS: 1 | US FAERS | |
| 1088 | Gastrointestinal arteriovenous malformation | FAERS: 1 | US FAERS | |
| 1089 | Gastrointestinal bacterial infection | FAERS: 1 | US FAERS | |
| 1090 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 1091 | General physical condition | FAERS: 1 | US FAERS | |
| 1092 | General symptom | FAERS: 1 | US FAERS | |
| 1093 | Genital abscess | FAERS: 1 | US FAERS | |
| 1094 | Gingival Recession | FAERS: 1 | US FAERS | |
| 1095 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 1096 | Glioblastoma | FAERS: 1 | US FAERS | |
| 1097 | Graft infection | FAERS: 1 | US FAERS | |
| 1098 | Granulomatous liver disease | FAERS: 1 | US FAERS | |
| 1099 | Heparin-induced thrombocytopenia | FAERS: 1 | US FAERS | |
| 1100 | Hepatoblastoma | FAERS: 1 | US FAERS | |
| 1101 | Hepatopulmonary Syndrome | FAERS: 1 | US FAERS | |
| 1102 | Hernia obstructive | FAERS: 1 | US FAERS | |
| 1103 | Histiocytosis | FAERS: 1 | US FAERS | |
| 1104 | Histoplasmosis | FAERS: 1 | US FAERS | |
| 1105 | House dust allergy | FAERS: 1 | US FAERS | |
| 1106 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 1107 | Hyperphagia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1108 | Hypertensive cardiomyopathy | FAERS: 1 | OFFSIDES US FAERS | |
| 1109 | Hypervigilance | FAERS: 1 | US FAERS | |
| 1110 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 1111 | Hypomania | FAERS: 1 | US FAERS | |
| 1112 | Hypothalamo-pituitary disorder | FAERS: 1 | US FAERS | |
| 1113 | Hysterosalpingo-oophorectomy | FAERS: 1 | US FAERS | |
| 1114 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 1115 | Impatience | FAERS: 1 | US FAERS | |
| 1116 | Implantable defibrillator replacement | FAERS: 1 | US FAERS | |
| 1117 | Incarcerated hernia | FAERS: 1 | US FAERS | |
| 1118 | Incision site pain | FAERS: 1 | US FAERS | |
| 1119 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 1120 | Incorrect product formulation administered | FAERS: 1 | US FAERS | |
| 1121 | Increased viscosity of nasal secretion | FAERS: 1 | US FAERS | |
| 1122 | Infarction | FAERS: 1 | US FAERS | |
| 1123 | Infected bite | FAERS: 1 | US FAERS | |
| 1124 | Infective exacerbation of chronic obstructive airways disease | FAERS: 1 | US FAERS | |
| 1125 | Influenza A virus test positive | FAERS: 1 | US FAERS | |
| 1126 | Infusion site cellulitis | FAERS: 1 | US FAERS | |
| 1127 | Inhibitory drug interaction | FAERS: 1 | OFFSIDES US FAERS | |
| 1128 | Injection site erythema | FAERS: 1 | US FAERS | |
| 1129 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 1130 | Injection site infection | FAERS: 1 | US FAERS | |
| 1131 | Injection site pain | FAERS: 1 | US FAERS | |
| 1132 | Injury associated with device | FAERS: 1 | US FAERS | |
| 1133 | Insulin Resistance | FAERS: 1 | US FAERS | |
| 1134 | Insurance issue | FAERS: 1 | US FAERS | |
| 1135 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 1136 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 1137 | Intestinal sepsis | FAERS: 1 | US FAERS | |
| 1138 | Intestinal transplant | FAERS: 1 | US FAERS | |
| 1139 | Intracardiac pressure increased | FAERS: 1 | US FAERS | |
| 1140 | Invasive Ductal Breast Carcinoma | FAERS: 1 | US FAERS | |
| 1141 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 1142 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 1143 | Left ventricle outflow tract obstruction | FAERS: 1 | US FAERS | |
| 1144 | Libido disorder | FAERS: 1 | US FAERS | |
| 1145 | Lip neoplasm malignant stage unspecified | FAERS: 1 | US FAERS | |
| 1146 | Live Birth | FAERS: 1 | US FAERS | |
| 1147 | Living in residential institution | FAERS: 1 | US FAERS | |
| 1148 | Local reaction | FAERS: 1 | US FAERS | |
| 1149 | Lower respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 1150 | Lupus Nephritis | FAERS: 1 | US FAERS | |
| 1151 | Lupus vasculitis | FAERS: 1 | US FAERS | |
| 1152 | Lymph node abscess | FAERS: 1 | US FAERS | |
| 1153 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 1154 | Malabsorption | FAERS: 1 | US FAERS | |
| 1155 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 1156 | Malignant anorectal neoplasm | FAERS: 1 | US FAERS | |
| 1157 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 1158 | Mass excision | FAERS: 1 | US FAERS | |
| 1159 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 1160 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 1161 | Mediastinitis | FAERS: 1 | US FAERS | |
| 1162 | Medical device removal | FAERS: 1 | US FAERS | |
| 1163 | Medical diet | FAERS: 1 | US FAERS | |
| 1164 | Mesenteritis | FAERS: 1 | US FAERS | |
| 1165 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 1166 | Metastases to adrenals | FAERS: 1 | US FAERS | |
| 1167 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 1168 | Multimorbidity | FAERS: 1 | US FAERS | |
| 1169 | Multiple Myeloma | FAERS: 1 | US FAERS | |
| 1170 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 1171 | Mycoplasma test positive | FAERS: 1 | US FAERS | |
| 1172 | Mydriasis | FAERS: 1 | US FAERS | |
| 1173 | Myelofibrosis | FAERS: 1 | US FAERS | |
| 1174 | Myocardial fibrosis | FAERS: 1 | US FAERS | |
| 1175 | Myoclonus | FAERS: 1 | US FAERS | |
| 1176 | Myopathy | FAERS: 1 | US FAERS | |
| 1177 | Near Drowning | FAERS: 1 | US FAERS | |
| 1178 | Nephritis | FAERS: 1 | US FAERS | |
| 1179 | Neuralgic Amyotrophy | FAERS: 1 | US FAERS | |
| 1180 | Neuroma | FAERS: 1 | US FAERS | |
| 1181 | Noninfective encephalitis | FAERS: 1 | US FAERS | |
| 1182 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 1183 | Ocular vascular disorder | FAERS: 1 | US FAERS | |
| 1184 | Oncologic complication | FAERS: 1 | US FAERS | |
| 1185 | Onychalgia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1186 | Oral infection | FAERS: 1 | US FAERS | |
| 1187 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 1188 | Oral pruritus | FAERS: 1 | US FAERS | |
| 1189 | Oropharyngeal blistering | FAERS: 1 | OFFSIDES US FAERS | |
| 1190 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 1191 | Osteopenia | FAERS: 1 | US FAERS | |
| 1192 | Ovarian cancer stage IV | FAERS: 1 | US FAERS | |
| 1193 | Oxygen consumption decreased | FAERS: 1 | US FAERS | |
| 1194 | POEMS Syndrome | FAERS: 1 | US FAERS | |
| 1195 | Panic Disorder | FAERS: 1 | US FAERS | |
| 1196 | Parotitis | FAERS: 1 | US FAERS | |
| 1197 | Pelvic Infection | FAERS: 1 | US FAERS | |
| 1198 | Pelvic Inflammatory Disease | FAERS: 1 | US FAERS | |
| 1199 | Pelvic abscess | FAERS: 1 | US FAERS | |
| 1200 | Pemphigus | FAERS: 1 | US FAERS | |
| 1201 | Percutaneous Coronary Intervention | FAERS: 1 | US FAERS | |
| 1202 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 1203 | Peripheral paralysis | FAERS: 1 | US FAERS | |
| 1204 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 1205 | Perirectal abscess | FAERS: 1 | US FAERS | |
| 1206 | Peritoneal hernia | FAERS: 1 | US FAERS | |
| 1207 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 1208 | Pleuropericarditis | FAERS: 1 | US FAERS | |
| 1209 | Pneumonectomy | FAERS: 1 | US FAERS | |
| 1210 | Pneumonia Pseudomonas aeruginosa | FAERS: 1 | US FAERS | |
| 1211 | Poisoning | FAERS: 1 | US FAERS | |
| 1212 | Portal hypertensive gastropathy | FAERS: 1 | US FAERS | |
| 1213 | Post procedural bile leak | FAERS: 1 | US FAERS | |
| 1214 | Post procedural discomfort | FAERS: 1 | US FAERS | |
| 1215 | Post procedural sepsis | FAERS: 1 | US FAERS | |
| 1216 | Post vaccination syndrome | FAERS: 1 | US FAERS | |
| 1217 | Postoperative respiratory failure | FAERS: 1 | US FAERS | |
| 1218 | Precocious Puberty | FAERS: 1 | US FAERS | |
| 1219 | Pregnancy with contraceptive device | FAERS: 1 | US FAERS | |
| 1220 | Prerenal failure | FAERS: 1 | US FAERS | |
| 1221 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 1222 | Pressure of speech | FAERS: 1 | US FAERS | |
| 1223 | Primary Biliary Cholangitis | FAERS: 1 | US FAERS | |
| 1224 | Primary amyloidosis | FAERS: 1 | US FAERS | |
| 1225 | Probiotic therapy | FAERS: 1 | US FAERS | |
| 1226 | Procedural pneumothorax | FAERS: 1 | US FAERS | |
| 1227 | Proctitis | FAERS: 1 | US FAERS | |
| 1228 | Product container issue | FAERS: 1 | US FAERS | |
| 1229 | Product dispensing error | FAERS: 1 | US FAERS | |
| 1230 | Product preparation error | FAERS: 1 | US FAERS | |
| 1231 | Product preparation issue | FAERS: 1 | US FAERS | |
| 1232 | Product prescribing error | FAERS: 1 | US FAERS | |
| 1233 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 1234 | Progressive supranuclear palsy | FAERS: 1 | US FAERS | |
| 1235 | Protein total decreased | FAERS: 1 | US FAERS | |
| 1236 | Proteus test positive | FAERS: 1 | US FAERS | |
| 1237 | Pseudolymphoma | FAERS: 1 | US FAERS | |
| 1238 | Pseudomonas test positive | FAERS: 1 | US FAERS | |
| 1239 | Psychiatric evaluation | FAERS: 1 | US FAERS | |
| 1240 | Pulmonary arterial pressure decreased | FAERS: 1 | US FAERS | |
| 1241 | Pulmonary arterial wedge pressure abnormal | FAERS: 1 | US FAERS | |
| 1242 | Pulmonary physical examination abnormal | FAERS: 1 | US FAERS | |
| 1243 | Puncture site reaction | FAERS: 1 | US FAERS | |
| 1244 | Purpura | FAERS: 1 | US FAERS | |
| 1245 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 1246 | Quadriplegia | FAERS: 1 | US FAERS | |
| 1247 | Radiation interaction | FAERS: 1 | US FAERS | |
| 1248 | Radiation sickness syndrome | FAERS: 1 | US FAERS | |
| 1249 | Respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 1250 | Restrictive pulmonary disease | FAERS: 1 | US FAERS | |
| 1251 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 1252 | Retinal infarction | FAERS: 1 | US FAERS | |
| 1253 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 1254 | Rhinalgia | FAERS: 1 | US FAERS | |
| 1255 | Right ventricle outflow tract obstruction | FAERS: 1 | US FAERS | |
| 1256 | Scleroderma associated digital ulcer | FAERS: 1 | US FAERS | |
| 1257 | Screaming | FAERS: 1 | US FAERS | |
| 1258 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 1259 | Septic embolus | FAERS: 1 | US FAERS | |
| 1260 | Shunt infection | FAERS: 1 | US FAERS | |
| 1261 | Shunt malfunction | FAERS: 1 | US FAERS | |
| 1262 | Shunt occlusion | FAERS: 1 | US FAERS | |
| 1263 | Sickle Cell Trait | FAERS: 1 | US FAERS | |
| 1264 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 1265 | Skin laceration | FAERS: 1 | US FAERS | |
| 1266 | Skin neoplasm excision | FAERS: 1 | US FAERS | |
| 1267 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 1268 | Slow speech | FAERS: 1 | US FAERS | |
| 1269 | Small Intestinal Stenosis | FAERS: 1 | US FAERS | |
| 1270 | Small cell lung cancer metastatic | FAERS: 1 | US FAERS | |
| 1271 | Soft tissue mass | FAERS: 1 | US FAERS | |
| 1272 | Soliloquy | FAERS: 1 | US FAERS | |
| 1273 | Splenic embolism | FAERS: 1 | US FAERS | |
| 1274 | Spondylolisthesis | FAERS: 1 | US FAERS | |
| 1275 | Squamous cell carcinoma of lung | FAERS: 1 | US FAERS | |
| 1276 | Status Asthmaticus | FAERS: 1 | US FAERS | |
| 1277 | Sternal injury | FAERS: 1 | US FAERS | |
| 1278 | Steroid withdrawal syndrome | FAERS: 1 | US FAERS | |
| 1279 | Stoma site pain | FAERS: 1 | US FAERS | |
| 1280 | Stool analysis abnormal | FAERS: 1 | US FAERS | |
| 1281 | Strangulated umbilical hernia | FAERS: 1 | US FAERS | |
| 1282 | Subcutaneous Emphysema | FAERS: 1 | US FAERS | |
| 1283 | Syphilis | FAERS: 1 | US FAERS | |
| 1284 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 1285 | Systolic dysfunction | FAERS: 1 | US FAERS | |
| 1286 | T-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 1287 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 1288 | Teeth brittle | FAERS: 1 | US FAERS | |
| 1289 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 1290 | Tension Headache | FAERS: 1 | US FAERS | |
| 1291 | Thoracotomy | FAERS: 1 | US FAERS | |
| 1292 | Thrombectomy | FAERS: 1 | US FAERS | |
| 1293 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 1294 | Thymectomy | FAERS: 1 | US FAERS | |
| 1295 | Thyroid therapy | FAERS: 1 | US FAERS | |
| 1296 | Tracheitis | FAERS: 1 | US FAERS | |
| 1297 | Tracheobronchial stent insertion | FAERS: 1 | US FAERS | |
| 1298 | Tracheostomy infection | FAERS: 1 | US FAERS | |
| 1299 | Traumatic liver injury | FAERS: 1 | SIDER US FAERS | |
| 1300 | Ultrasound Doppler abnormal | FAERS: 1 | US FAERS | |
| 1301 | Unemployment | FAERS: 1 | US FAERS | |
| 1302 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 1303 | Uterine contractions during pregnancy | FAERS: 1 | US FAERS | |
| 1304 | Vaccination site swelling | FAERS: 1 | US FAERS | |
| 1305 | Vaginal cancer recurrent | FAERS: 1 | US FAERS | |
| 1306 | Vascular access site complication | FAERS: 1 | US FAERS | |
| 1307 | Vascular access site infection | FAERS: 1 | US FAERS | |
| 1308 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 1309 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 1310 | Vertebral lesion | FAERS: 1 | US FAERS | |
| 1311 | Vessel perforation | FAERS: 1 | US FAERS | |
| 1312 | Victim of homicide | FAERS: 1 | US FAERS | |
| 1313 | Viral sinusitis | FAERS: 1 | US FAERS | |
| 1314 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 1315 | Vulvitis | FAERS: 1 | US FAERS | |
| 1316 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 1317 | Weight | FAERS: 1 | US FAERS | |
| 1318 | White matter lesion | FAERS: 1 | US FAERS | |
| 1319 | Wound closure | FAERS: 1 | US FAERS | |
| 1320 | cancer surgery | FAERS: 1 | US FAERS | |
| 1321 | diagnostic procedure | FAERS: 1 | OFFSIDES US FAERS | |
| 1322 | hypertensive nephropathy | FAERS: 1 | US FAERS | |
| 1323 | Agonal rhythm | Canada Vigilance: 1 | Canada Vigilance | |
| 1324 | Anorexia | SIDER | ||
| 1325 | Arterial insufficiency | OFFSIDES | ||
| 1326 | Blood and lymphatic system disorders | SIDER | ||
| 1327 | Blood potassium | OFFSIDES | ||
| 1328 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 1329 | Chronic left ventricular failure | OFFSIDES | ||
| 1330 | Complication of device insertion | OFFSIDES | ||
| 1331 | Congenital heart disease | OFFSIDES | ||
| 1332 | Diverticular perforation | OFFSIDES | ||
| 1333 | Dyspnoea exacerbated | SIDER | ||
| 1334 | Facial Neuralgia | OFFSIDES | ||
| 1335 | Hydropneumothorax | OFFSIDES | ||
| 1336 | Hypertransaminasaemia | OFFSIDES | ||
| 1337 | Hypocoagulable state | OFFSIDES | ||
| 1338 | Infestation | SIDER | ||
| 1339 | Kidney Failure | OFFSIDES | ||
| 1340 | Legionella | OFFSIDES | ||
| 1341 | Megacolon | OFFSIDES | ||
| 1342 | Muscle Weakness | OFFSIDES | ||
| 1343 | Prothrombin time abnormal | OFFSIDES | ||
| 1344 | Sperm concentration decreased | SIDER | ||
| 1345 | Sperm count decreased | SIDER | ||
| 1346 | Upper respiratory tract infection bacterial | OFFSIDES | ||
| 1347 | Weight Gain | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.