Sulfasalazine
(NCEXYHBECQHGNR-UHFFFAOYSA-N)
Structure
- SMILES
- OC(=O)c1cc(N=Nc2ccc(cc2)S(=O)(=O)Nc2ccccn2)ccc1O
- Type(s)
- Approved
- ATC code(s)
- A07EC01; G01AE10
- Molecular Formula:
- C18H14N4O5S
- Molecular Weight:
- 398.393
- Log P:
- 4.8554
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 3
- TPSA:
- 149.69
- CAS Number(s):
- 599-79-1; 737754-28-8
Synonym(s)
1.
Sulfasalazine
2.
Salicylazosulfapyridine
3.
Asulfidine
4.
Azulfadine
5.
Azulfidine
6.
Azulfidine EN
7.
Colo-Pleon
8.
Pleon
9.
Pyralin EN
10.
Salazopyrin
11.
Salazosulfapyridine
12.
Sulfasalazin medac
13.
Sulfasalazin-Heyl
14.
Sulfasalazine FNA
15.
Sulphasalazine
16.
Ucine
17.
Ulcol
18.
ratio-Sulfasalazine
19.
Colo Pleon
20.
Sulfasalazin Heyl
21.
ratio Sulfasalazine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 397 Canada Vigilance: 312 | Canada Vigilance US FAERS | |
| 2 | Nausea | FAERS: 135 Canada Vigilance: 23 | 4146729 6151882 19217336 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 3 | Headache | FAERS: 75 Canada Vigilance: 19 | 4146729 19217336 | CTD SIDER Canada Vigilance US FAERS |
| 4 | Malaise | FAERS: 66 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 5 | Abdominal discomfort | FAERS: 62 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 6 | Vomiting | FAERS: 55 Canada Vigilance: 10 | Canada Vigilance SIDER US FAERS | |
| 7 | Fatigue | FAERS: 53 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 8 | Hypersensitivity | FAERS: 52 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 9 | Arthralgia | FAERS: 41 Canada Vigilance: 2 | 4384520 | CTD SIDER Canada Vigilance US FAERS |
| 10 | Lymphadenopathy | FAERS: 39 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 11 | Drug effect incomplete | FAERS: 38 | US FAERS | |
| 12 | Drug exposure during pregnancy | FAERS: 36 | US FAERS | |
| 13 | Neutropenia | FAERS: 33 Canada Vigilance: 5 | 2571387 | CTD SIDER Canada Vigilance US FAERS |
| 14 | Pruritus | FAERS: 33 Canada Vigilance: 7 | 6146502 | CTD SIDER Canada Vigilance US FAERS |
| 15 | Urticaria | FAERS: 33 Canada Vigilance: 5 | 2859799 2880997 | CTD SIDER Canada Vigilance US FAERS |
| 16 | Agranulocytosis | FAERS: 32 Canada Vigilance: 2 | 2880997 4146729 6127975 | CTD SIDER Canada Vigilance US FAERS |
| 17 | Stevens-Johnson Syndrome | FAERS: 31 Canada Vigilance: 3 | 25811541 | CTD SIDER Canada Vigilance US FAERS |
| 18 | Dizziness | FAERS: 29 Canada Vigilance: 2 | 4146729 | CTD SIDER Canada Vigilance US FAERS |
| 19 | Pneumonia | FAERS: 29 Canada Vigilance: 1 | 2859799 2894766 | CTD SIDER Canada Vigilance US FAERS |
| 20 | Pancytopenia | FAERS: 28 | SIDER US FAERS | |
| 21 | Asthenia | FAERS: 27 | US FAERS | |
| 22 | Abdominal Pain | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 23 | Eosinophilia | FAERS: 24 Canada Vigilance: 2 | CTD SIDER Canada Vigilance US FAERS | |
| 24 | Erythema | FAERS: 24 Canada Vigilance: 3 | CTD SIDER Canada Vigilance US FAERS | |
| 25 | Weight decreased | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 26 | Leukopenia | FAERS: 23 Canada Vigilance: 5 | 4146729 12795783 | CTD SIDER Canada Vigilance US FAERS |
| 27 | Pain | FAERS: 22 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 28 | Chills | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 29 | White blood cell count decreased | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 30 | treatment failure | FAERS: 19 Canada Vigilance: 25 | Canada Vigilance US FAERS | |
| 31 | Cerebral Infarction | FAERS: 18 | US FAERS | |
| 32 | Hepatitis | FAERS: 18 Canada Vigilance: 1 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 33 | Toxic Epidermal Necrolysis | FAERS: 18 | SIDER US FAERS | |
| 34 | Alanine Aminotransferase Increased | FAERS: 17 | OFFSIDES US FAERS | |
| 35 | Rheumatoid Arthritis | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 36 | Feeling abnormal | FAERS: 15 | US FAERS | |
| 37 | Musculoskeletal stiffness | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 38 | Swelling | FAERS: 15 | US FAERS | |
| 39 | Thrombocytopenia | FAERS: 15 Canada Vigilance: 2 | 2572687 9776124 | CTD SIDER Canada Vigilance US FAERS |
| 40 | Oropharyngeal pain | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 41 | Alopecia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 42 | Chromaturia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 43 | Histiocytosis haematophagic | FAERS: 13 | OFFSIDES US FAERS | |
| 44 | Joint swelling | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Sepsis | FAERS: 13 | 11672959 | CTD US FAERS |
| 46 | Tachycardia | FAERS: 13 | US FAERS | |
| 47 | Transaminases increased | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Colitis | FAERS: 12 | CTD US FAERS | |
| 49 | Dyspepsia | FAERS: 12 Canada Vigilance: 1 | 6151882 | CTD SIDER Canada Vigilance US FAERS |
| 50 | Peripheral swelling | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 51 | Anti-neutrophil cytoplasmic antibody positive vasculitis | FAERS: 11 | US FAERS | |
| 52 | Drug ineffective for unapproved indication | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Dysgeusia | FAERS: 11 | US FAERS | |
| 54 | Infectious Mononucleosis | FAERS: 11 | US FAERS | |
| 55 | Myalgia | FAERS: 11 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 56 | Stomatitis | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 57 | jaundice | FAERS: 11 Canada Vigilance: 2 | 10394456 | CTD SIDER Canada Vigilance US FAERS |
| 58 | Arthropathy | FAERS: 10 | US FAERS | |
| 59 | Disseminated Intravascular Coagulation | FAERS: 10 | 8104747 | CTD OFFSIDES US FAERS |
| 60 | Infection | FAERS: 10 | SIDER US FAERS | |
| 61 | Lip swelling | FAERS: 10 | US FAERS | |
| 62 | Product use issue | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 63 | Respiratory Failure | FAERS: 10 | OFFSIDES US FAERS | |
| 64 | Anxiety | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Aspartate Aminotransferase Increased | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 66 | Blood creatine phosphokinase increased | FAERS: 9 | US FAERS | |
| 67 | Eosinophilic Pneumonia | FAERS: 9 | US FAERS | |
| 68 | Erythema Multiforme | FAERS: 9 | SIDER US FAERS | |
| 69 | Glomerulonephritis | FAERS: 9 | US FAERS | |
| 70 | Inflammation | FAERS: 9 Canada Vigilance: 1 | 17259377 22427801 | CTD Canada Vigilance US FAERS |
| 71 | Night sweats | FAERS: 9 | US FAERS | |
| 72 | Palpitations | FAERS: 9 | US FAERS | |
| 73 | Pharyngolaryngeal Pain | FAERS: 9 | US FAERS | |
| 74 | Polyneuropathy | FAERS: 9 | OFFSIDES US FAERS | |
| 75 | Product use in unapproved indication | FAERS: 9 | US FAERS | |
| 76 | Asthma | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Febrile Neutropenia | FAERS: 8 | US FAERS | |
| 78 | Leukocytosis | FAERS: 8 | 13680174 | CTD US FAERS |
| 79 | Pulmonary Fibrosis | FAERS: 8 | 16512452 | CTD US FAERS |
| 80 | Synovitis | FAERS: 8 | 2880997 | CTD US FAERS |
| 81 | Angioedema | FAERS: 7 | 2859799 | CTD SIDER US FAERS |
| 82 | Chest Pain | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 83 | Dehydration | FAERS: 7 | US FAERS | |
| 84 | Diabetes Mellitus | FAERS: 7 | US FAERS | |
| 85 | Eosinophilic myocarditis | FAERS: 7 | SIDER US FAERS | |
| 86 | Myocardial Infarction | FAERS: 7 | US FAERS | |
| 87 | Product quality issue | FAERS: 7 | US FAERS | |
| 88 | Product substitution issue | FAERS: 7 | US FAERS | |
| 89 | Purpura | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 90 | Rash erythematous | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 91 | Tinnitus | FAERS: 7 | SIDER US FAERS | |
| 92 | Ageusia | FAERS: 6 | OFFSIDES US FAERS | |
| 93 | Arthritis | FAERS: 6 Canada Vigilance: 2 | 2571387 8298382 19217336 | CTD Canada Vigilance US FAERS |
| 94 | Back Pain | FAERS: 6 | US FAERS | |
| 95 | Dermatitis | FAERS: 6 | 8105680 11672959 17032600 | CTD SIDER US FAERS |
| 96 | Eczema | FAERS: 6 | OFFSIDES US FAERS | |
| 97 | Hypotension | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 98 | Impaired work ability | FAERS: 6 | US FAERS | |
| 99 | Lymphocytosis | FAERS: 6 Canada Vigilance: 1 | 1362531 | CTD OFFSIDES Canada Vigilance US FAERS |
| 100 | Maternal exposure during pregnancy | FAERS: 6 | US FAERS | |
| 101 | Mononucleosis syndrome | FAERS: 6 | US FAERS | |
| 102 | Neck Pain | FAERS: 6 | US FAERS | |
| 103 | Oculomucocutaneous syndrome | FAERS: 6 | US FAERS | |
| 104 | Pericardial effusion | FAERS: 6 | US FAERS | |
| 105 | Pharmaceutical product complaint | FAERS: 6 | US FAERS | |
| 106 | Splenomegaly | FAERS: 6 Canada Vigilance: 1 | 18084702 26165751 | CTD Canada Vigilance US FAERS |
| 107 | Toxicity to various agents | FAERS: 6 | US FAERS | |
| 108 | Urinary tract infection | FAERS: 6 | SIDER US FAERS | |
| 109 | nervous system disorder | FAERS: 6 | SIDER US FAERS | |
| 110 | Altered state of consciousness | FAERS: 5 | US FAERS | |
| 111 | Cataract | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 112 | Cerebrovascular accident | FAERS: 5 | US FAERS | |
| 113 | Chest discomfort | FAERS: 5 | US FAERS | |
| 114 | Choking | FAERS: 5 | US FAERS | |
| 115 | Contraindicated product administered | FAERS: 5 | US FAERS | |
| 116 | Cytolytic hepatitis | FAERS: 5 | OFFSIDES US FAERS | |
| 117 | Dementia | FAERS: 5 | US FAERS | |
| 118 | Drug Dependence | FAERS: 5 | US FAERS | |
| 119 | Exfoliative rash | FAERS: 5 | US FAERS | |
| 120 | Eye pain | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 121 | Hepatosplenomegaly | FAERS: 5 | US FAERS | |
| 122 | Hepatotoxicity | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 123 | Joint Range of Motion Decreased | FAERS: 5 | US FAERS | |
| 124 | Lethargy | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 125 | Myocarditis | FAERS: 5 | 11672959 | CTD SIDER US FAERS |
| 126 | Pancreatitis | FAERS: 5 Canada Vigilance: 3 | 12235076 | CTD SIDER Canada Vigilance US FAERS |
| 127 | Petechiae | FAERS: 5 | SIDER US FAERS | |
| 128 | Pharyngitis | FAERS: 5 Canada Vigilance: 2 | 10394456 | CTD Canada Vigilance US FAERS |
| 129 | Rhabdomyolysis | FAERS: 5 | SIDER US FAERS | |
| 130 | Skin lesion | FAERS: 5 | US FAERS | |
| 131 | Tuberculosis | FAERS: 5 | US FAERS | |
| 132 | Urinary Retention | FAERS: 5 | US FAERS | |
| 133 | Wrong technique in drug usage process | FAERS: 5 | US FAERS | |
| 134 | Acute kidney injury | FAERS: 4 | US FAERS | |
| 135 | Anosmia | FAERS: 4 | OFFSIDES US FAERS | |
| 136 | Atrial Fibrillation | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 137 | Blindness | FAERS: 4 | US FAERS | |
| 138 | Blood alkaline phosphatase increased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 139 | Blood lactate dehydrogenase increased | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 140 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 141 | Cytopenia | FAERS: 4 | US FAERS | |
| 142 | Deep Vein Thrombosis | FAERS: 4 | US FAERS | |
| 143 | Depressed mood | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 144 | Disease recurrence | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 145 | Drug level increased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 146 | Dysarthria | FAERS: 4 | US FAERS | |
| 147 | Erythema Nodosum | FAERS: 4 | US FAERS | |
| 148 | False negative investigation result | FAERS: 4 | US FAERS | |
| 149 | Flatulence | FAERS: 4 | US FAERS | |
| 150 | Flushing | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Gastric ulcer | FAERS: 4 | US FAERS | |
| 152 | General physical condition abnormal | FAERS: 4 | US FAERS | |
| 153 | Heparin-induced thrombocytopenia | FAERS: 4 | US FAERS | |
| 154 | Hepatomegaly | FAERS: 4 | 12587019 18084702 | CTD US FAERS |
| 155 | Human herpes virus 6 serology | FAERS: 4 | US FAERS | |
| 156 | Human herpes virus 6 serology positive | FAERS: 4 | OFFSIDES US FAERS | |
| 157 | Hypoxia | FAERS: 4 | US FAERS | |
| 158 | Lower respiratory tract inflammation | FAERS: 4 | US FAERS | |
| 159 | Lymphadenitis | FAERS: 4 | US FAERS | |
| 160 | Nasopharyngitis | FAERS: 4 | OFFSIDES US FAERS | |
| 161 | Nephrotic Syndrome | FAERS: 4 | 1977483 | CTD OFFSIDES SIDER US FAERS |
| 162 | Oral candidiasis | FAERS: 4 | US FAERS | |
| 163 | Pericarditis | FAERS: 4 Canada Vigilance: 1 | 8101983 9167028 17440739 | CTD SIDER Canada Vigilance US FAERS |
| 164 | Pleurisy | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 165 | Pleuropericarditis | FAERS: 4 | US FAERS | |
| 166 | Product taste abnormal | FAERS: 4 | US FAERS | |
| 167 | Proteinuria | FAERS: 4 | 7551669 | CTD SIDER US FAERS |
| 168 | Pulmonary Eosinophilia | FAERS: 4 | US FAERS | |
| 169 | Sinus Tachycardia | FAERS: 4 | US FAERS | |
| 170 | Skin irritation | FAERS: 4 | US FAERS | |
| 171 | Stress | FAERS: 4 | OFFSIDES US FAERS | |
| 172 | Thrombosis | FAERS: 4 | US FAERS | |
| 173 | Tremor | FAERS: 4 | US FAERS | |
| 174 | Vasculitis | FAERS: 4 | SIDER US FAERS | |
| 175 | Wheezing | FAERS: 4 | US FAERS | |
| 176 | Wrong technique in product usage process | FAERS: 4 | US FAERS | |
| 177 | Abasia | FAERS: 3 | US FAERS | |
| 178 | Agitation | FAERS: 3 | US FAERS | |
| 179 | Alveolitis | FAERS: 3 | US FAERS | |
| 180 | Amyotrophic Lateral Sclerosis | FAERS: 3 | US FAERS | |
| 181 | Ankylosing spondylitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 182 | Anorexia | FAERS: 3 | SIDER US FAERS | |
| 183 | Antiphospholipid Syndrome | FAERS: 3 | US FAERS | |
| 184 | Autoimmune neutropenia | FAERS: 3 | US FAERS | |
| 185 | Blood creatine phosphokinase MB increased | FAERS: 3 | US FAERS | |
| 186 | Blood creatinine increased | FAERS: 3 | US FAERS | |
| 187 | Bone pain | FAERS: 3 | US FAERS | |
| 188 | Bronchiectasis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 189 | Burning sensation | FAERS: 3 | US FAERS | |
| 190 | Cellulitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 191 | Crying | FAERS: 3 | US FAERS | |
| 192 | Disease Progression | FAERS: 3 | US FAERS | |
| 193 | Drug dose omission | FAERS: 3 | US FAERS | |
| 194 | Drug exposure via breast milk | FAERS: 3 | US FAERS | |
| 195 | Dry skin | FAERS: 3 | US FAERS | |
| 196 | False positive investigation result | FAERS: 3 | US FAERS | |
| 197 | Full blood count decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 198 | Gastrointestinal Pain | FAERS: 3 | SIDER US FAERS | |
| 199 | Gingivitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 200 | Granulocyte count decreased | FAERS: 3 | US FAERS | |
| 201 | Hepatitis B | FAERS: 3 | US FAERS | |
| 202 | Hyperpyrexia | FAERS: 3 | US FAERS | |
| 203 | Hypophagia | FAERS: 3 | US FAERS | |
| 204 | Ileus | FAERS: 3 | US FAERS | |
| 205 | Incorrect dose administered | FAERS: 3 | OFFSIDES US FAERS | |
| 206 | Influenza | FAERS: 3 | US FAERS | |
| 207 | Intestinal Perforation | FAERS: 3 | US FAERS | |
| 208 | Lung Abscess | FAERS: 3 | US FAERS | |
| 209 | Lymph node palpable | FAERS: 3 | US FAERS | |
| 210 | Lymphocyte stimulation test positive | FAERS: 3 | US FAERS | |
| 211 | Maternal exposure timing unspecified | FAERS: 3 | US FAERS | |
| 212 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 213 | Nephrolithiasis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 214 | Neutropenic sepsis | FAERS: 3 | OFFSIDES US FAERS | |
| 215 | No adverse event | FAERS: 3 | US FAERS | |
| 216 | Nodule | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 217 | Oral pain | FAERS: 3 | US FAERS | |
| 218 | Osteomyelitis | FAERS: 3 | US FAERS | |
| 219 | Placental Insufficiency | FAERS: 3 | OFFSIDES US FAERS | |
| 220 | Pneumothorax | FAERS: 3 | OFFSIDES US FAERS | |
| 221 | Poor quality drug administered | FAERS: 3 | US FAERS | |
| 222 | Posterior reversible encephalopathy syndrome | FAERS: 3 | US FAERS | |
| 223 | Psoriasis | FAERS: 3 | 12587019 | CTD OFFSIDES US FAERS |
| 224 | Pulmonary toxicity | FAERS: 3 | US FAERS | |
| 225 | Reaction to drug excipients | FAERS: 3 | US FAERS | |
| 226 | Restlessness | FAERS: 3 | US FAERS | |
| 227 | Retching | FAERS: 3 | US FAERS | |
| 228 | Rheumatoid factor increased | FAERS: 3 | US FAERS | |
| 229 | Septic Shock | FAERS: 3 | OFFSIDES US FAERS | |
| 230 | Sinusitis | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 231 | Status Epilepticus | FAERS: 3 | 19050416 | CTD US FAERS |
| 232 | Stillbirth | FAERS: 3 | US FAERS | |
| 233 | Trismus | FAERS: 3 | US FAERS | |
| 234 | Ultrasound liver abnormal | FAERS: 3 | US FAERS | |
| 235 | Vaginal Discharge | FAERS: 3 | US FAERS | |
| 236 | Visual Impairment | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 237 | Vitiligo | FAERS: 3 | US FAERS | |
| 238 | Abscess sweat gland | FAERS: 2 | US FAERS | |
| 239 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 240 | Acute psychosis | FAERS: 2 | US FAERS | |
| 241 | Amylase increased | FAERS: 2 | US FAERS | |
| 242 | Anaphylactic shock | FAERS: 2 | SIDER US FAERS | |
| 243 | Anuria | FAERS: 2 | SIDER US FAERS | |
| 244 | Apathy | FAERS: 2 | OFFSIDES US FAERS | |
| 245 | Aphasia | FAERS: 2 | 7913503 | CTD US FAERS |
| 246 | Atrioventricular Septal Defect | FAERS: 2 | US FAERS | |
| 247 | Autoimmune hepatitis | FAERS: 2 | US FAERS | |
| 248 | Bedridden | FAERS: 2 | US FAERS | |
| 249 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 250 | Blood urine present | FAERS: 2 | US FAERS | |
| 251 | Bone marrow toxicity | FAERS: 2 | US FAERS | |
| 252 | Bradykinesia | FAERS: 2 | US FAERS | |
| 253 | Central nervous system lesion | FAERS: 2 | US FAERS | |
| 254 | Cholestasis | FAERS: 2 | 11570976 16283166 | CTD SIDER US FAERS |
| 255 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 256 | Clostridium difficile colitis | FAERS: 2 | US FAERS | |
| 257 | Congenital diaphragmatic hernia | FAERS: 2 | US FAERS | |
| 258 | Constipation | FAERS: 2 | US FAERS | |
| 259 | Deafness | FAERS: 2 | SIDER US FAERS | |
| 260 | Device occlusion | FAERS: 2 | US FAERS | |
| 261 | Discomfort | FAERS: 2 | US FAERS | |
| 262 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 263 | Dysphonia | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 264 | Dysplasia | FAERS: 2 | US FAERS | |
| 265 | Economic problem | FAERS: 2 | US FAERS | |
| 266 | Electrocardiogram ST-T change | FAERS: 2 | US FAERS | |
| 267 | Enterocolitis | FAERS: 2 | US FAERS | |
| 268 | Eosinophilic colitis | FAERS: 2 | US FAERS | |
| 269 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 270 | Eye irritation | FAERS: 2 | US FAERS | |
| 271 | Feeling Cold | FAERS: 2 | OFFSIDES US FAERS | |
| 272 | Feeling jittery | FAERS: 2 | US FAERS | |
| 273 | Foreign body sensation in eyes | FAERS: 2 | US FAERS | |
| 274 | Gamma-Glutamyltransferase Increased | FAERS: 2 | OFFSIDES US FAERS | |
| 275 | Gastritis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 276 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 277 | Gingival Hypertrophy | FAERS: 2 | US FAERS | |
| 278 | Granuloma | FAERS: 2 | 6113258 11570976 | CTD OFFSIDES US FAERS |
| 279 | Hepatic necrosis | FAERS: 2 | SIDER US FAERS | |
| 280 | Hyperacusis | FAERS: 2 | US FAERS | |
| 281 | Idiopathic Pulmonary Fibrosis | FAERS: 2 | SIDER US FAERS | |
| 282 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 283 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 284 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 285 | Joint stiffness | FAERS: 2 | US FAERS | |
| 286 | Lupus-like syndrome | FAERS: 2 | US FAERS | |
| 287 | Medication Error | FAERS: 2 | US FAERS | |
| 288 | Medication residue | FAERS: 2 | US FAERS | |
| 289 | Mental status changes | FAERS: 2 | US FAERS | |
| 290 | Monoparesis | FAERS: 2 | US FAERS | |
| 291 | Monoplegia | FAERS: 2 | US FAERS | |
| 292 | Myelitis | FAERS: 2 | OFFSIDES US FAERS | |
| 293 | Nervousness | FAERS: 2 | US FAERS | |
| 294 | Neutrophil count decreased | FAERS: 2 | US FAERS | |
| 295 | Oligohydramnios | FAERS: 2 | US FAERS | |
| 296 | Oropharyngeal blistering | FAERS: 2 | US FAERS | |
| 297 | Paraparesis | FAERS: 2 | US FAERS | |
| 298 | Photophobia | FAERS: 2 Canada Vigilance: 1 | 19217336 | CTD Canada Vigilance US FAERS |
| 299 | Pneumonitis | FAERS: 2 | US FAERS | |
| 300 | Polydipsia | FAERS: 2 | US FAERS | |
| 301 | Pregnancy | FAERS: 2 | US FAERS | |
| 302 | Productive Cough | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 303 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 304 | Pulmonary granuloma | FAERS: 2 | US FAERS | |
| 305 | Pure white cell aplasia | FAERS: 2 | US FAERS | |
| 306 | Pyelonephritis | FAERS: 2 | OFFSIDES US FAERS | |
| 307 | Pyoderma Gangrenosum | FAERS: 2 | OFFSIDES US FAERS | |
| 308 | Rales | FAERS: 2 | US FAERS | |
| 309 | Renal cyst | FAERS: 2 | US FAERS | |
| 310 | Respiratory Depression | FAERS: 2 | US FAERS | |
| 311 | Schizoaffective Disorder | FAERS: 2 | US FAERS | |
| 312 | Scleroderma | FAERS: 2 | US FAERS | |
| 313 | Secretion discharge | FAERS: 2 | US FAERS | |
| 314 | Serum Sickness | FAERS: 2 | SIDER US FAERS | |
| 315 | Shock | FAERS: 2 | US FAERS | |
| 316 | Sjogren's Syndrome | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 317 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 318 | Skin necrosis | FAERS: 2 | US FAERS | |
| 319 | Syncope | FAERS: 2 | US FAERS | |
| 320 | Systemic Inflammatory Response Syndrome | FAERS: 2 | US FAERS | |
| 321 | Therapeutic response unexpected with drug substitution | FAERS: 2 | US FAERS | |
| 322 | Troponin increased | FAERS: 2 | US FAERS | |
| 323 | Unevaluable event | FAERS: 2 | US FAERS | |
| 324 | Ureterolithiasis | FAERS: 2 | US FAERS | |
| 325 | Ventricular hypertrophy | FAERS: 2 | US FAERS | |
| 326 | Vertigo | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 327 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 328 | Abscess | FAERS: 1 | US FAERS | |
| 329 | Accidental exposure | FAERS: 1 | OFFSIDES US FAERS | |
| 330 | Acne | FAERS: 1 | US FAERS | |
| 331 | Adverse event | FAERS: 1 | US FAERS | |
| 332 | Agnosia | FAERS: 1 | US FAERS | |
| 333 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 334 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 335 | Alopecia universalis | FAERS: 1 | US FAERS | |
| 336 | Amnesia | FAERS: 1 | US FAERS | |
| 337 | Amnestic Disorder | FAERS: 1 | US FAERS | |
| 338 | Anal Ulcer | FAERS: 1 | US FAERS | |
| 339 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 340 | Ankle Fracture | FAERS: 1 | OFFSIDES US FAERS | |
| 341 | Aphagia | FAERS: 1 | US FAERS | |
| 342 | Aphonia | FAERS: 1 | OFFSIDES US FAERS | |
| 343 | Apparent death | FAERS: 1 | US FAERS | |
| 344 | Arcus lipoides | FAERS: 1 | US FAERS | |
| 345 | Arteritis | FAERS: 1 | US FAERS | |
| 346 | Asthenopia | FAERS: 1 | OFFSIDES US FAERS | |
| 347 | Ataxia | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 348 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 349 | Bicytopenia | FAERS: 1 | US FAERS | |
| 350 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 351 | Blood count abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 352 | Blood fibrinogen increased | FAERS: 1 | US FAERS | |
| 353 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 354 | Blood pH increased | FAERS: 1 | US FAERS | |
| 355 | Blood parathyroid hormone increased | FAERS: 1 | US FAERS | |
| 356 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 357 | Blood thyroid stimulating hormone abnormal | FAERS: 1 | US FAERS | |
| 358 | Blood urea increased | FAERS: 1 | OFFSIDES US FAERS | |
| 359 | Bone erosion | FAERS: 1 | US FAERS | |
| 360 | Bone marrow depression | FAERS: 1 | SIDER US FAERS | |
| 361 | Bone marrow granuloma | FAERS: 1 | US FAERS | |
| 362 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 363 | Bronchitis | FAERS: 1 | US FAERS | |
| 364 | Bursitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 365 | Calcium deficiency | FAERS: 1 | US FAERS | |
| 366 | Candida sepsis | FAERS: 1 | US FAERS | |
| 367 | Carpal Tunnel Syndrome | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 368 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 369 | Cheilitis | FAERS: 1 | US FAERS | |
| 370 | Chemotherapy | FAERS: 1 | US FAERS | |
| 371 | Choanal Atresia | FAERS: 1 | US FAERS | |
| 372 | Cholangiolitis | FAERS: 1 | US FAERS | |
| 373 | Cholangitis | FAERS: 1 | 16514397 | CTD US FAERS |
| 374 | Cholecystitis | FAERS: 1 | US FAERS | |
| 375 | Chorea | FAERS: 1 | 1674893 | CTD US FAERS |
| 376 | Chronic granulomatous disease | FAERS: 1 | US FAERS | |
| 377 | Colectomy | FAERS: 1 | US FAERS | |
| 378 | Completed Suicide | FAERS: 1 | US FAERS | |
| 379 | Conjunctivitis | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 380 | Coombs test positive | FAERS: 1 | US FAERS | |
| 381 | Corneal defect | FAERS: 1 | US FAERS | |
| 382 | Corneal epithelium defect | FAERS: 1 | US FAERS | |
| 383 | Creatine phosphokinase decreased | FAERS: 1 | US FAERS | |
| 384 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 385 | Cystitis | FAERS: 1 | US FAERS | |
| 386 | Cytomegalovirus antigen positive | FAERS: 1 | US FAERS | |
| 387 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 388 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 389 | Depressed Level of Consciousness | FAERS: 1 | OFFSIDES US FAERS | |
| 390 | Disorientation | FAERS: 1 | US FAERS | |
| 391 | Documented hypersensitivity to administered product | FAERS: 1 | US FAERS | |
| 392 | Drug administration error | FAERS: 1 | US FAERS | |
| 393 | Drug screen positive | FAERS: 1 | US FAERS | |
| 394 | Drug toxicity | FAERS: 1 | US FAERS | |
| 395 | Drug-disease interaction | FAERS: 1 | US FAERS | |
| 396 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 397 | Dysgraphia | FAERS: 1 | US FAERS | |
| 398 | Dysphasia | FAERS: 1 | US FAERS | |
| 399 | Dysuria | FAERS: 1 | US FAERS | |
| 400 | Ear congestion | FAERS: 1 | US FAERS | |
| 401 | Educational problem | FAERS: 1 | US FAERS | |
| 402 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 403 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 404 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 405 | Emotional disorder | FAERS: 1 | US FAERS | |
| 406 | Encephalitis | FAERS: 1 | US FAERS | |
| 407 | Enteritis | FAERS: 1 | 11570976 | CTD US FAERS |
| 408 | Eosinophil percentage increased | FAERS: 1 | US FAERS | |
| 409 | Epidermal necrosis | FAERS: 1 | US FAERS | |
| 410 | Epididymitis | FAERS: 1 | US FAERS | |
| 411 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 412 | Epilepsy | FAERS: 1 | US FAERS | |
| 413 | Epistaxis | FAERS: 1 | US FAERS | |
| 414 | Exposure via partner | FAERS: 1 | US FAERS | |
| 415 | Exposure via skin contact | FAERS: 1 | US FAERS | |
| 416 | Eye Infection | FAERS: 1 | US FAERS | |
| 417 | Eye Redness | FAERS: 1 | US FAERS | |
| 418 | Eye inflammation | FAERS: 1 | US FAERS | |
| 419 | Facial Pain | FAERS: 1 | US FAERS | |
| 420 | Facial Paresis | FAERS: 1 | US FAERS | |
| 421 | Fasciitis | FAERS: 1 | US FAERS | |
| 422 | Fibromyalgia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 423 | Fixed drug eruption | FAERS: 1 | US FAERS | |
| 424 | Food aversion | FAERS: 1 | US FAERS | |
| 425 | Fracture | FAERS: 1 | US FAERS | |
| 426 | Gas Gangrene | FAERS: 1 | US FAERS | |
| 427 | Gastrectomy | FAERS: 1 | US FAERS | |
| 428 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 429 | General physical health deterioration | FAERS: 1 | OFFSIDES US FAERS | |
| 430 | Glaucoma | FAERS: 1 | US FAERS | |
| 431 | Glossitis | FAERS: 1 | US FAERS | |
| 432 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 433 | Guillain-Barre Syndrome | FAERS: 1 | SIDER US FAERS | |
| 434 | Haematinuria | FAERS: 1 | US FAERS | |
| 435 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 436 | Haptoglobin Decreased | FAERS: 1 | US FAERS | |
| 437 | Head discomfort | FAERS: 1 | US FAERS | |
| 438 | Hemiparesis | FAERS: 1 | US FAERS | |
| 439 | Hepatic Encephalopathy | FAERS: 1 | 10394456 16283166 | CTD US FAERS |
| 440 | Hilar lymphadenopathy | FAERS: 1 | US FAERS | |
| 441 | Hyaluronic acid increased | FAERS: 1 | US FAERS | |
| 442 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 443 | Hypersomnia | FAERS: 1 | US FAERS | |
| 444 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 445 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 446 | Hyperventilation | FAERS: 1 | OFFSIDES US FAERS | |
| 447 | Hypomania | FAERS: 1 | US FAERS | |
| 448 | Hypometabolism | FAERS: 1 | US FAERS | |
| 449 | Hypothermia neonatal | FAERS: 1 | US FAERS | |
| 450 | Hypothyroidism | FAERS: 1 Canada Vigilance: 1 | 12587019 | CTD Canada Vigilance US FAERS |
| 451 | Idiosyncratic drug reaction | FAERS: 1 | US FAERS | |
| 452 | Immobile | FAERS: 1 | OFFSIDES US FAERS | |
| 453 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 454 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 455 | Incontinence | FAERS: 1 | US FAERS | |
| 456 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 457 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 458 | Infertility | FAERS: 1 | SIDER US FAERS | |
| 459 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 460 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 461 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 462 | Iron deficiency | FAERS: 1 | US FAERS | |
| 463 | Joint Instability | FAERS: 1 | US FAERS | |
| 464 | Joint injury | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 465 | Joint warmth | FAERS: 1 | US FAERS | |
| 466 | Keratopathy | FAERS: 1 | US FAERS | |
| 467 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 468 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 469 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 470 | Lichen Planus | FAERS: 1 | SIDER US FAERS | |
| 471 | Liver transplant rejection | FAERS: 1 | US FAERS | |
| 472 | Lymphocyte count decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 473 | Lymphocyte percentage increased | FAERS: 1 | US FAERS | |
| 474 | Lymphoma | FAERS: 1 | OFFSIDES US FAERS | |
| 475 | Lymphopenia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 476 | Macrocytosis | FAERS: 1 | US FAERS | |
| 477 | Macular degeneration | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 478 | Malabsorption | FAERS: 1 | OFFSIDES US FAERS | |
| 479 | Male Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 480 | Malignant lymphoid neoplasm | FAERS: 1 | US FAERS | |
| 481 | Matrix metalloproteinase-3 increased | FAERS: 1 | US FAERS | |
| 482 | Measles antibody positive | FAERS: 1 | US FAERS | |
| 483 | Measles | FAERS: 1 | US FAERS | |
| 484 | Megacolon | FAERS: 1 | US FAERS | |
| 485 | Memory impairment | FAERS: 1 | US FAERS | |
| 486 | Meningitis | FAERS: 1 | 1681789 | CTD SIDER US FAERS |
| 487 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 488 | Mixed liver injury | FAERS: 1 | US FAERS | |
| 489 | Mood swings | FAERS: 1 | US FAERS | |
| 490 | Mouth swelling | FAERS: 1 | US FAERS | |
| 491 | Mucosal exfoliation | FAERS: 1 | US FAERS | |
| 492 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 493 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 494 | Muscle necrosis | FAERS: 1 | US FAERS | |
| 495 | Muscle tightness | FAERS: 1 | US FAERS | |
| 496 | Muscular Dystrophy | FAERS: 1 | US FAERS | |
| 497 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 498 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 499 | Myotonic Dystrophy | FAERS: 1 | US FAERS | |
| 500 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 501 | Necrotising myositis | FAERS: 1 | US FAERS | |
| 502 | Negative thoughts | FAERS: 1 | US FAERS | |
| 503 | Nephritis | FAERS: 1 | 11672959 | CTD SIDER US FAERS |
| 504 | Nerve injury | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 505 | Nipah Virus Infection | FAERS: 1 | US FAERS | |
| 506 | No adverse reaction | FAERS: 1 | US FAERS | |
| 507 | Nocturia | FAERS: 1 | US FAERS | |
| 508 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 509 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 510 | Oculogyric crisis | FAERS: 1 | US FAERS | |
| 511 | Onychoclasis | FAERS: 1 | US FAERS | |
| 512 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 513 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 514 | Osteopenia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 515 | Osteoporosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 516 | Pallor | FAERS: 1 | SIDER US FAERS | |
| 517 | Pancreatic enlargement | FAERS: 1 | US FAERS | |
| 518 | Periorbital disorder | FAERS: 1 | US FAERS | |
| 519 | Pertussis | FAERS: 1 | US FAERS | |
| 520 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 521 | Polyarthritis | FAERS: 1 | US FAERS | |
| 522 | Polyuria | FAERS: 1 | SIDER US FAERS | |
| 523 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 524 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 525 | Post inflammatory pigmentation change | FAERS: 1 | US FAERS | |
| 526 | Post procedural complication | FAERS: 1 | US FAERS | |
| 527 | Postoperative fever | FAERS: 1 | US FAERS | |
| 528 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 529 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 530 | Product container seal issue | FAERS: 1 | US FAERS | |
| 531 | Product physical issue | FAERS: 1 | US FAERS | |
| 532 | Product residue present | FAERS: 1 | US FAERS | |
| 533 | Product shape issue | FAERS: 1 | US FAERS | |
| 534 | Product size issue | FAERS: 1 | US FAERS | |
| 535 | Product use complaint | FAERS: 1 | US FAERS | |
| 536 | Protein total decreased | FAERS: 1 | US FAERS | |
| 537 | Pseudolymphoma | FAERS: 1 | US FAERS | |
| 538 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 539 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 540 | Renal pain | FAERS: 1 | US FAERS | |
| 541 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 542 | Renal tubular necrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 543 | Renal vasculitis | FAERS: 1 | US FAERS | |
| 544 | Restrictive pulmonary disease | FAERS: 1 | US FAERS | |
| 545 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 546 | Scleritis | FAERS: 1 | US FAERS | |
| 547 | Scleromalacia | FAERS: 1 | US FAERS | |
| 548 | Sensitivity to weather change | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 549 | Seronegative arthritis | FAERS: 1 | US FAERS | |
| 550 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 551 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 552 | Sneezing | FAERS: 1 | US FAERS | |
| 553 | Soft tissue swelling | FAERS: 1 | US FAERS | |
| 554 | Somnolence | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 555 | Sperm concentration decreased | FAERS: 1 | US FAERS | |
| 556 | Spermatozoa morphology abnormal | FAERS: 1 | US FAERS | |
| 557 | Spina Bifida | FAERS: 1 | US FAERS | |
| 558 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 559 | Stupor | FAERS: 1 | 8105680 | CTD US FAERS |
| 560 | Suicide attempt | FAERS: 1 | US FAERS | |
| 561 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 562 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 563 | Talipes | FAERS: 1 | US FAERS | |
| 564 | Temporal Arteritis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 565 | Tension | FAERS: 1 | US FAERS | |
| 566 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 567 | Therapy cessation | FAERS: 1 | US FAERS | |
| 568 | Therapy change | FAERS: 1 | US FAERS | |
| 569 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 570 | Thirst | FAERS: 1 | US FAERS | |
| 571 | Tonsillitis | FAERS: 1 | US FAERS | |
| 572 | Transaminases abnormal | FAERS: 1 | US FAERS | |
| 573 | Ulcer | FAERS: 1 | 25727887 25729217 | CTD US FAERS |
| 574 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 575 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 576 | Urine ketone body present | FAERS: 1 | US FAERS | |
| 577 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 578 | Venous stasis | FAERS: 1 | US FAERS | |
| 579 | Visual brightness | FAERS: 1 | US FAERS | |
| 580 | Vitamin B1 decreased | FAERS: 1 | US FAERS | |
| 581 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 582 | Wheelchair user | FAERS: 1 | US FAERS | |
| 583 | White blood cell count abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 584 | Wound Complication | FAERS: 1 | US FAERS | |
| 585 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 586 | pH urine abnormal | FAERS: 1 | US FAERS | |
| 587 | Abnormalities, Drug-Induced | 6133211 | CTD | |
| 588 | Acetonaemic vomiting | OFFSIDES | ||
| 589 | Acidosis | OFFSIDES | ||
| 590 | Acute bronchitis | OFFSIDES | ||
| 591 | Adenocarcinoma | OFFSIDES | ||
| 592 | Agammaglobulinemia | 25555 | CTD | |
| 593 | Albumin globulin ratio increased | OFFSIDES | ||
| 594 | Amyloidosis | OFFSIDES | ||
| 595 | Anaphylactoid Reaction | SIDER | ||
| 596 | Anemia, Hemolytic | CTD | ||
| 597 | Anemia, Macrocytic | 2571387 2879599 2882808 | CTD | |
| 598 | Anemia, Megaloblastic | CTD | ||
| 599 | Anemia | 2572687 6130169 | CTD | |
| 600 | Anti-Neutrophil Cytoplasmic Antibody-Associated Vasculitis | 10693882 | CTD | |
| 601 | Antiphospholipid antibodies positive | OFFSIDES | ||
| 602 | Aphthous Stomatitis | OFFSIDES | ||
| 603 | Arthritis, Psoriatic | 17408446 | CTD | |
| 604 | Ascites | OFFSIDES | ||
| 605 | Asthenozoospermia | 10689203 17166698 | CTD | |
| 606 | Atherosclerosis obliterans | OFFSIDES | ||
| 607 | Autoimmune Diseases | 7788172 7913503 | CTD | |
| 608 | Azoospermia | SIDER | ||
| 609 | B-cell lymphoma stage IV | OFFSIDES | ||
| 610 | Bacterial test positive | OFFSIDES | ||
| 611 | Band neutrophil percentage increased | OFFSIDES | ||
| 612 | Behcet Syndrome | 15870978 | CTD | |
| 613 | Beta 2 microglobulin increased | OFFSIDES | ||
| 614 | Blood 25-hydroxycholecalciferol decreased | OFFSIDES | ||
| 615 | Blood amylase increased | OFFSIDES | ||
| 616 | Blood and lymphatic system disorders | SIDER | ||
| 617 | Blood beta-D-glucan increased | OFFSIDES | ||
| 618 | Blood creatinine decreased | OFFSIDES | ||
| 619 | Blood glucose fluctuation | OFFSIDES | ||
| 620 | Blood lactate dehydrogenase decreased | OFFSIDES | ||
| 621 | Blood potassium increased | OFFSIDES | ||
| 622 | Bone Marrow Diseases | 19050416 | CTD | |
| 623 | Bone contusion | Canada Vigilance: 1 | Canada Vigilance | |
| 624 | Brain Diseases | 6124962 | CTD | |
| 625 | Bunion | OFFSIDES | ||
| 626 | C-reactive protein abnormal | OFFSIDES | ||
| 627 | Calculi | 8102080 | CTD | |
| 628 | Carcinoma, Transitional Cell | 12587019 | CTD | |
| 629 | Cardiac Tamponade | 2563191 2894766 | CTD | |
| 630 | Cauda Equina Syndrome | SIDER | ||
| 631 | Cell Death | OFFSIDES | ||
| 632 | Chemical and Drug Induced Liver Injury | CTD | ||
| 633 | Cholangitis, Sclerosing | 17116962 | CTD | |
| 634 | Citrobacter infection | OFFSIDES | ||
| 635 | Colon adenoma | OFFSIDES | ||
| 636 | Colonic Neoplasms | 1358165 | CTD | |
| 637 | Corneal abscess | OFFSIDES | ||
| 638 | Crohn Disease | CTD | ||
| 639 | Crystalluria | SIDER | ||
| 640 | Cyanosis | Canada Vigilance: 1 | 19187 | CTD OFFSIDES SIDER Canada Vigilance |
| 641 | Cytomegalovirus antibody positive | OFFSIDES | ||
| 642 | Diarrhea | 7944624 9805178 30408459 | CTD OFFSIDES | |
| 643 | Diffuse Large B-Cell Lymphoma | OFFSIDES | ||
| 644 | Distress | SIDER | ||
| 645 | Diuresis | SIDER | ||
| 646 | Drowsiness | SIDER | ||
| 647 | Drug Eruptions | CTD | ||
| 648 | Drug delivery system malfunction | OFFSIDES | ||
| 649 | Drug level below therapeutic | OFFSIDES | ||
| 650 | Dysmorphism | OFFSIDES | ||
| 651 | Ear and labyrinth disorders | SIDER | ||
| 652 | Edema | CTD | ||
| 653 | Electrocardiogram ST segment abnormal | OFFSIDES | ||
| 654 | Emotional distress | SIDER | ||
| 655 | Endophthalmitis | OFFSIDES | ||
| 656 | Endotoxemia | 29731490 | CTD | |
| 657 | Epstein-Barr virus antibody positive | OFFSIDES | ||
| 658 | Erysipelas | OFFSIDES | ||
| 659 | Exanthema | CTD | ||
| 660 | Factor II deficiency | SIDER | ||
| 661 | Fever | CTD | ||
| 662 | Gastrointestinal Diseases | 1972633 | CTD | |
| 663 | Gastrointestinal motility disorder | OFFSIDES | ||
| 664 | Glioblastoma | 15328202 | CTD | |
| 665 | Hamman-Rich syndrome | SIDER | ||
| 666 | Heinz bodies | Canada Vigilance: 1 | Canada Vigilance | |
| 667 | Hemorrhage | 25727887 25729217 | CTD | |
| 668 | Hepatic congestion | OFFSIDES | ||
| 669 | Hoarseness | OFFSIDES | ||
| 670 | Hyperemia | 22427801 25727887 | CTD | |
| 671 | Hyperplasia | 12587019 19234301 | CTD | |
| 672 | Hyperreflexia | OFFSIDES | ||
| 673 | Hypertensive emergency | OFFSIDES | ||
| 674 | Idiopathic intracranial hypertension with papilledema | 18070060 | CTD | |
| 675 | Ileal Stenosis | OFFSIDES | ||
| 676 | Immunosuppression | OFFSIDES | ||
| 677 | Impaired quality of life | Canada Vigilance: 1 | Canada Vigilance | |
| 678 | Increased skin sensitivity | SIDER | ||
| 679 | Infestation | SIDER | ||
| 680 | Inflammatory Bowel Diseases | CTD | ||
| 681 | Injection site irritation | OFFSIDES | ||
| 682 | Injury asphyxiation | OFFSIDES | ||
| 683 | Intervertebral disc compression | OFFSIDES | ||
| 684 | Jaundice, Obstructive | 2880997 | CTD | |
| 685 | Kidney Calculi | 7910643 | CTD | |
| 686 | Kidney Diseases | 9374926 15188168 | CTD | |
| 687 | Kidney Failure, Chronic | 1353741 | CTD | |
| 688 | Kidney Failure | OFFSIDES | ||
| 689 | Laryngitis | Canada Vigilance: 1 | Canada Vigilance | |
| 690 | Latent Tuberculosis | Canada Vigilance: 1 | Canada Vigilance | |
| 691 | Leukemia, Large Granular Lymphocytic | 12587019 | CTD | |
| 692 | Liver Cirrhosis, Experimental | 15633128 | CTD | |
| 693 | Liver Failure, Acute | CTD | ||
| 694 | Liver Failure | 13680174 | CTD | |
| 695 | Loss of personal independence in daily activities | Canada Vigilance: 3 | Canada Vigilance | |
| 696 | Lung diseases | 20084578 | CTD | |
| 697 | Lung infection pseudomonal | OFFSIDES | ||
| 698 | Lupus Erythematosus, Systemic | 2894766 6124962 9374926 | CTD | |
| 699 | Lupus Erythematosus | SIDER | ||
| 700 | Lymphatic Abnormalities | 12587019 | CTD | |
| 701 | Lymphatic Diseases | 11672959 17032600 18084702 | CTD | |
| 702 | Lymphocyte count abnormal | OFFSIDES | ||
| 703 | MYELODYSPLASTIC SYNDROME | SIDER | ||
| 704 | Malnutrition | SIDER | ||
| 705 | Massive Hepatic Necrosis | 1348259 16283166 | CTD | |
| 706 | Metatarsalgia | OFFSIDES | ||
| 707 | Methemoglobinemia | 4151648 | CTD | |
| 708 | Micronuclei, Chromosome-Defective | 12587019 | CTD | |
| 709 | Mixed Connective Tissue Disease | OFFSIDES | ||
| 710 | Monocyte percentage decreased | OFFSIDES | ||
| 711 | Mucocutaneous Lymph Node Syndrome | 1992637 | CTD | |
| 712 | Necrolysis epidermal | SIDER | ||
| 713 | Necrosis | 12377949 22427801 | CTD | |
| 714 | Neoplasm Metastasis | 19015640 | CTD | |
| 715 | Nephritis, Interstitial | CTD | ||
| 716 | Nephrosis | SIDER | ||
| 717 | Neuralgia | Canada Vigilance: 1 | Canada Vigilance | |
| 718 | Neuritis | SIDER | ||
| 719 | Neurotoxicity Syndromes | CTD | ||
| 720 | Neutropenic colitis | SIDER | ||
| 721 | Neutrophil count abnormal | OFFSIDES | ||
| 722 | Oligospermia | SIDER | ||
| 723 | Oliguria | SIDER | ||
| 724 | Open wound | OFFSIDES | ||
| 725 | Panic Disorder | OFFSIDES | ||
| 726 | Papilloma | 12587019 | CTD | |
| 727 | Paraproteinemias | 12235076 | CTD | |
| 728 | Paresis | 6146502 | CTD | |
| 729 | Paresthesia | 12763355 | CTD | |
| 730 | Peripheral Nervous System Diseases | 1351312 2858845 | CTD | |
| 731 | Peripheral occlusive disease | OFFSIDES | ||
| 732 | Pharyngeal lesion | OFFSIDES | ||
| 733 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 734 | Pituitary Diseases | 12587019 | CTD | |
| 735 | Pityriasis Lichenoides et Varioliformis Acuta | SIDER | ||
| 736 | Platelet count abnormal | OFFSIDES | ||
| 737 | Pneumocystis jiroveci pneumonia | OFFSIDES | ||
| 738 | Polyarteritis Nodosa | SIDER | ||
| 739 | Presbyopia | OFFSIDES | ||
| 740 | Proctocolitis | 19212915 | CTD OFFSIDES | |
| 741 | Product dose omission | Canada Vigilance: 1 | Canada Vigilance | |
| 742 | Protein total increased | OFFSIDES | ||
| 743 | Protein urine present | SIDER | ||
| 744 | Pseudarthrosis | OFFSIDES | ||
| 745 | Pseudomononucleosis | SIDER | ||
| 746 | Pterygium | OFFSIDES | ||
| 747 | Pulmonary congestion | OFFSIDES | ||
| 748 | Pustular psoriasis | OFFSIDES | ||
| 749 | Raynaud Disease | 6104805 6146597 | CTD | |
| 750 | Reaction gastrointestinal | SIDER | ||
| 751 | Rectosigmoid cancer | OFFSIDES | ||
| 752 | Recurrence | 22119283 | CTD | |
| 753 | Renal Insufficiency | 19509026 | CTD | |
| 754 | Renal abscess | OFFSIDES | ||
| 755 | Reticulocytosis | 19187 4146729 | CTD | |
| 756 | Rhinorrhea | OFFSIDES | ||
| 757 | Seizures | CTD | ||
| 758 | Skin Diseases, Vascular | 8298382 | CTD | |
| 759 | Skin laceration | OFFSIDES | ||
| 760 | Small Intestinal Stenosis | OFFSIDES | ||
| 761 | Spermatic Cord Torsion | 16626516 | CTD | |
| 762 | Spinal Diseases | 2573801 | CTD | |
| 763 | Spondylarthropathies | 8104747 9805178 | CTD | |
| 764 | Sputum retention | OFFSIDES | ||
| 765 | Stomach Neoplasms | 12587019 | CTD | |
| 766 | Sunburn | Canada Vigilance: 1 | Canada Vigilance | |
| 767 | Taste Disorders | SIDER | ||
| 768 | Therapeutic product effect decreased | Canada Vigilance: 2 | Canada Vigilance | |
| 769 | Therapeutic product effect incomplete | Canada Vigilance: 23 | Canada Vigilance | |
| 770 | Toxic pustuloderma | SIDER | ||
| 771 | Tympanic Membrane Perforation | OFFSIDES | ||
| 772 | Urolithiasis | 10349305 14550462 | CTD | |
| 773 | Urologic Neoplasms | 12587019 | CTD | |
| 774 | Vascular System Injuries | 19234301 | CTD | |
| 775 | Vascular purpura | SIDER | ||
| 776 | Vasculitis, Leukocytoclastic, Cutaneous | 7788172 | CTD | |
| 777 | Ventricular hypokinesia | OFFSIDES | ||
| 778 | Viral myocarditis | OFFSIDES | ||
| 779 | Wound Infection | OFFSIDES | ||
| 780 | anaphylaxis | 1972633 9597688 | CTD | |
| 781 | pseudomembranous colitis | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.