Octreotide
(XQEJFZYLWPSJOV-XJQYZYIXSA-N)
Structure
- SMILES
- CC(=O)O.NCCCC[C@@H]1NC(=O)[C@H](NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CSSC[C@H](NC(=O)[C@@H](NC1=O)[C@H](O)C)C(=O)N[C@@H]([C@H](O)C)CO)NC(=O)[C@@H](Cc1ccccc1)N)Cc1c[nH]c2c1cccc2
- Molecular Formula:
- C51H70N10O12S2
- Molecular Weight:
- 1079.290
- Log P:
- 3.1119
- Hydrogen Bond Acceptor:
- 23
- Hydrogen Bond Donor:
- 14
- TPSA:
- 420.12
- CAS Number(s):
- 79517-01-4
Synonym(s)
1.
Octreotide
2.
Octreotide Acetate
3.
Compound 201-995
4.
Octreotide Acetate Salt
5.
SAN 201-995
6.
SM 201-995
7.
SMS 201-995
8.
Sandostatin
9.
Sandostatine
10.
Sandoz 201-995
11.
Compound 201 995
12.
Compound 201995
13.
SAN 201 995
14.
SAN 201995
15.
SM 201 995
16.
SM 201995
17.
SMS 201 995
18.
SMS 201995
19.
Sandoz 201 995
20.
Sandoz 201995
External Link(s)
| MeSH | D015282 |
| PubChem Compound | 6917964 |
| CHEMBL | CHEMBL1200480 |
| Therapeutic Target Database | D00TIG |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Needle issue | FAERS: 1570 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 2 | Fatigue | FAERS: 1251 Canada Vigilance: 152 | Canada Vigilance US FAERS | |
| 3 | Malaise | FAERS: 1146 Canada Vigilance: 101 | Canada Vigilance US FAERS | |
| 4 | Nausea | FAERS: 1026 Canada Vigilance: 115 | Canada Vigilance US FAERS | |
| 5 | Asthenia | FAERS: 982 Canada Vigilance: 134 | Canada Vigilance US FAERS | |
| 6 | Abdominal Pain | FAERS: 955 Canada Vigilance: 102 | Canada Vigilance US FAERS | |
| 7 | Pain | FAERS: 873 Canada Vigilance: 82 | Canada Vigilance US FAERS | |
| 8 | Injection site pain | FAERS: 831 Canada Vigilance: 91 | Canada Vigilance US FAERS | |
| 9 | Headache | FAERS: 773 Canada Vigilance: 50 | Canada Vigilance US FAERS | |
| 10 | Weight decreased | FAERS: 754 Canada Vigilance: 95 | Canada Vigilance US FAERS | |
| 11 | Vomiting | FAERS: 736 Canada Vigilance: 88 | Canada Vigilance US FAERS | |
| 12 | Malignant neoplasm progression | FAERS: 639 Canada Vigilance: 88 | Canada Vigilance US FAERS | |
| 13 | Inappropriate schedule of drug administration | FAERS: 633 | US FAERS | |
| 14 | Dizziness | FAERS: 613 Canada Vigilance: 45 | Canada Vigilance US FAERS | |
| 15 | Syringe issue | FAERS: 493 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 16 | Back Pain | FAERS: 457 Canada Vigilance: 47 | Canada Vigilance US FAERS | |
| 17 | Flushing | FAERS: 444 Canada Vigilance: 43 | Canada Vigilance US FAERS | |
| 18 | Arthralgia | FAERS: 424 Canada Vigilance: 41 | Canada Vigilance US FAERS | |
| 19 | Nasopharyngitis | FAERS: 388 Canada Vigilance: 31 | Canada Vigilance US FAERS | |
| 20 | Product quality issue | FAERS: 380 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 21 | General physical health deterioration | FAERS: 361 Canada Vigilance: 59 | Canada Vigilance US FAERS | |
| 22 | Flatulence | FAERS: 333 Canada Vigilance: 38 | Canada Vigilance US FAERS | |
| 23 | Abdominal discomfort | FAERS: 326 Canada Vigilance: 28 | Canada Vigilance US FAERS | |
| 24 | Drug ineffective | FAERS: 317 Canada Vigilance: 103 | Canada Vigilance US FAERS | |
| 25 | Constipation | FAERS: 310 Canada Vigilance: 36 | Canada Vigilance US FAERS | |
| 26 | Pneumonia | FAERS: 310 Canada Vigilance: 29 | Canada Vigilance US FAERS | |
| 27 | Chest Pain | FAERS: 308 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 28 | Blood glucose increased | FAERS: 295 Canada Vigilance: 44 | Canada Vigilance US FAERS | |
| 29 | Feeling abnormal | FAERS: 265 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 30 | Influenza | FAERS: 259 Canada Vigilance: 15 | Canada Vigilance US FAERS | |
| 31 | Anxiety | FAERS: 257 Canada Vigilance: 22 | Canada Vigilance US FAERS | |
| 32 | Musculoskeletal Pain | FAERS: 253 Canada Vigilance: 28 | Canada Vigilance US FAERS | |
| 33 | Alopecia | FAERS: 251 Canada Vigilance: 28 | Canada Vigilance US FAERS | |
| 34 | Injection site mass | FAERS: 237 Canada Vigilance: 17 | Canada Vigilance US FAERS | |
| 35 | Dehydration | FAERS: 233 Canada Vigilance: 27 | Canada Vigilance US FAERS | |
| 36 | Urinary tract infection | FAERS: 228 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 37 | Nephrolithiasis | FAERS: 217 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 38 | Intestinal Obstruction | FAERS: 216 Canada Vigilance: 42 | Canada Vigilance US FAERS | |
| 39 | Chills | FAERS: 208 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 40 | Cholelithiasis | FAERS: 208 Canada Vigilance: 17 | Canada Vigilance US FAERS | |
| 41 | Product use issue | FAERS: 207 | US FAERS | |
| 42 | Syncope | FAERS: 192 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 43 | Terminal state | FAERS: 191 Canada Vigilance: 53 | Canada Vigilance US FAERS | |
| 44 | Wrong technique in product usage process | FAERS: 189 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 45 | Stress | FAERS: 178 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 46 | Myalgia | FAERS: 170 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 47 | Diabetes Mellitus | FAERS: 167 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 48 | Erythema | FAERS: 164 Canada Vigilance: 15 | Canada Vigilance US FAERS | |
| 49 | Pruritus | FAERS: 163 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 50 | Cerebrovascular accident | FAERS: 160 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 51 | Infection | FAERS: 153 Canada Vigilance: 15 | Canada Vigilance US FAERS | |
| 52 | Joint swelling | FAERS: 145 Canada Vigilance: 15 | Canada Vigilance US FAERS | |
| 53 | Memory impairment | FAERS: 143 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 54 | Sepsis | FAERS: 142 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 55 | Incorrect dose administered | FAERS: 138 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 56 | Oropharyngeal pain | FAERS: 131 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 57 | Hypophagia | FAERS: 122 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 58 | Abasia | FAERS: 117 | US FAERS | |
| 59 | Inappropriate schedule of product administration | FAERS: 116 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 60 | Hypotension | FAERS: 114 Canada Vigilance: 27 | Canada Vigilance US FAERS | |
| 61 | Tremor | FAERS: 114 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 62 | Palpitations | FAERS: 113 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 63 | Product use in unapproved indication | FAERS: 112 Canada Vigilance: 15 | Canada Vigilance US FAERS | |
| 64 | Ascites | FAERS: 111 Canada Vigilance: 27 | Canada Vigilance US FAERS | |
| 65 | Disease Progression | FAERS: 111 Canada Vigilance: 28 | Canada Vigilance US FAERS | |
| 66 | Myocardial Infarction | FAERS: 110 Canada Vigilance: 15 | Canada Vigilance US FAERS | |
| 67 | Chest discomfort | FAERS: 107 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 68 | Feeling Cold | FAERS: 107 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 69 | Insulin-like growth factor increased | FAERS: 107 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 70 | Blood glucose decreased | FAERS: 106 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 71 | Peripheral swelling | FAERS: 104 Canada Vigilance: 22 | Canada Vigilance US FAERS | |
| 72 | Cystitis | FAERS: 103 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 73 | Blood growth hormone increased | FAERS: 101 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 74 | Amnesia | FAERS: 94 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 75 | Neck Pain | FAERS: 93 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 76 | Vertigo | FAERS: 92 | US FAERS | |
| 77 | Visual Impairment | FAERS: 92 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Lethargy | FAERS: 91 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 79 | Lower respiratory tract infection | FAERS: 91 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 80 | Musculoskeletal stiffness | FAERS: 90 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 81 | Dyspepsia | FAERS: 89 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 82 | Somnolence | FAERS: 87 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 83 | Pallor | FAERS: 85 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 84 | Flank Pain | FAERS: 84 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 85 | Accidental exposure to product | FAERS: 83 | US FAERS | |
| 86 | Burning sensation | FAERS: 83 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 87 | Gout | FAERS: 83 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 88 | Productive Cough | FAERS: 83 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 89 | Bronchitis | FAERS: 82 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 90 | Swelling | FAERS: 82 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 91 | Arthritis | FAERS: 81 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 92 | Discomfort | FAERS: 81 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 93 | Injection site erythema | FAERS: 81 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 94 | Nervousness | FAERS: 80 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 95 | Thrombosis | FAERS: 80 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 96 | Dysuria | FAERS: 78 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 97 | Injection site discomfort | FAERS: 77 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 98 | Musculoskeletal discomfort | FAERS: 77 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 99 | jaundice | FAERS: 76 Canada Vigilance: 20 | Canada Vigilance US FAERS | |
| 100 | Joint injury | FAERS: 71 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 101 | Musculoskeletal chest pain | FAERS: 71 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 102 | Bowel movement irregularity | FAERS: 68 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 103 | Incorrect route of drug administration | FAERS: 68 | US FAERS | |
| 104 | Injection Site Reaction | FAERS: 68 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 105 | Limb discomfort | FAERS: 68 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 106 | Night sweats | FAERS: 65 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 107 | Inflammation | FAERS: 63 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 108 | Bone pain | FAERS: 62 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 109 | Diverticulitis | FAERS: 62 | US FAERS | |
| 110 | Fracture | FAERS: 62 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 111 | Wheezing | FAERS: 62 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 112 | Pulmonary congestion | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 113 | Blood glucose abnormal | FAERS: 60 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 114 | Cellulitis | FAERS: 60 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 115 | Depressed mood | FAERS: 59 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 116 | Pulmonary Embolism | FAERS: 59 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 117 | Cachexia | FAERS: 58 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 118 | Osteoporosis | FAERS: 58 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 119 | Metastasis | FAERS: 57 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 120 | Cataract | FAERS: 55 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 121 | No adverse event | FAERS: 55 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 122 | Palliative Care | FAERS: 54 Canada Vigilance: 18 | Canada Vigilance US FAERS | |
| 123 | Pancreatitis | FAERS: 53 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 124 | Sciatica | FAERS: 53 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 125 | Tachycardia | FAERS: 53 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 126 | Lymphadenopathy | FAERS: 51 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 127 | Dementia | FAERS: 50 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 128 | Joint stiffness | FAERS: 50 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 129 | Drug exposure during pregnancy | FAERS: 49 | US FAERS | |
| 130 | Sneezing | FAERS: 49 | US FAERS | |
| 131 | Hypersensitivity | FAERS: 48 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 132 | Food Poisoning | FAERS: 46 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 133 | Sinusitis | FAERS: 46 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 134 | Wrong technique in drug usage process | FAERS: 45 | US FAERS | |
| 135 | Gastroenteritis | FAERS: 44 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 136 | Gastrointestinal sounds abnormal | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 137 | Hepatomegaly | FAERS: 44 | US FAERS | |
| 138 | Hormone level abnormal | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 139 | Injection site bruising | FAERS: 44 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 140 | Liver Abscess | FAERS: 43 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 141 | Angina Pectoris | FAERS: 42 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 142 | Ankle Fracture | FAERS: 42 | US FAERS | |
| 143 | Blood potassium decreased | FAERS: 42 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 144 | Epistaxis | FAERS: 42 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 145 | Pharyngitis | FAERS: 42 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 146 | Post procedural complication | FAERS: 42 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 147 | Dysgeusia | FAERS: 41 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 148 | Emotional distress | FAERS: 41 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 149 | Labyrinthitis | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 150 | Blood chromogranin A increased | FAERS: 40 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 151 | Drug administration error | FAERS: 40 | US FAERS | |
| 152 | Head discomfort | FAERS: 40 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 153 | Poor quality sleep | FAERS: 40 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 154 | Blood glucose fluctuation | FAERS: 39 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 155 | Blood pressure fluctuation | FAERS: 39 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 156 | Eye pain | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 157 | Gastrointestinal motility disorder | FAERS: 39 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 158 | Blood sodium decreased | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 159 | Gastrointestinal Pain | FAERS: 38 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 160 | Hernia | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 161 | Pancreatic carcinoma | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 162 | Throat irritation | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 163 | Skin irritation | FAERS: 37 | US FAERS | |
| 164 | Blood creatinine increased | FAERS: 36 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 165 | Diplopia | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 166 | Intestinal resection | FAERS: 35 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 167 | Atrial Fibrillation | FAERS: 34 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 168 | Concomitant disease aggravated | FAERS: 34 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 169 | Diabetes mellitus inadequate control | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 170 | Limb injury | FAERS: 34 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 171 | Disorientation | FAERS: 33 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 172 | Intestinal Perforation | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 173 | Maternal exposure during pregnancy | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 174 | Blindness | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 175 | Incorrect drug administration duration | FAERS: 32 | US FAERS | |
| 176 | Urticaria | FAERS: 32 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 177 | Abdominal mass | FAERS: 31 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 178 | Cholangitis | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 179 | Emotional disorder | FAERS: 31 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 180 | Respiratory Failure | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 181 | Activities of daily living impaired | FAERS: 30 | US FAERS | |
| 182 | Bile Duct Stenosis | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 183 | Chromaturia | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 184 | Medication Error | FAERS: 30 | US FAERS | |
| 185 | Rhinitis | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 186 | Septic Shock | FAERS: 30 | US FAERS | |
| 187 | Skin lesion | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 188 | Superficial injury of eye | FAERS: 30 | US FAERS | |
| 189 | Malnutrition | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 190 | Urinary Incontinence | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 191 | Abscess | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 192 | Colectomy | FAERS: 28 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 193 | Device occlusion | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 194 | Incision site complication | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 195 | Secretion discharge | FAERS: 28 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 196 | Bradycardia | FAERS: 27 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 197 | Central nervous system lesion | FAERS: 27 | US FAERS | |
| 198 | Dry skin | FAERS: 27 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 199 | Rectal tenesmus | FAERS: 27 | US FAERS | |
| 200 | Blood growth hormone abnormal | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 201 | Deep Vein Thrombosis | FAERS: 26 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 202 | Facial Pain | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 203 | Hypersomnia | FAERS: 26 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 204 | Ocular icterus | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 205 | Oral fungal infection | FAERS: 26 | US FAERS | |
| 206 | Pancreatic Cyst | FAERS: 26 | US FAERS | |
| 207 | Subileus | FAERS: 26 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 208 | Unresponsive to stimuli | FAERS: 26 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 209 | Urinary Retention | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 210 | Cardiac Arrest | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 211 | Cholecystitis | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 212 | Crying | FAERS: 25 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 213 | Renal pain | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 214 | Aphagia | FAERS: 24 | US FAERS | |
| 215 | Blood cholesterol increased | FAERS: 24 | US FAERS | |
| 216 | Cardiomegaly | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 217 | Deafness | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 218 | Thyroid Neoplasm | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 219 | Abdominal adhesions | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 220 | Blood urine present | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 221 | Cyst | FAERS: 23 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 222 | Eyelid infection | FAERS: 23 | US FAERS | |
| 223 | Product leakage | FAERS: 23 | US FAERS | |
| 224 | Biliary Colic | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 225 | Increased upper airway secretion | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 226 | Localised intraabdominal fluid collection | FAERS: 22 | US FAERS | |
| 227 | Meningitis | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 228 | Poor peripheral circulation | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 229 | Restlessness | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 230 | Waist circumference increased | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 231 | Blood creatinine decreased | FAERS: 21 | US FAERS | |
| 232 | Bronchoscopy | FAERS: 21 | US FAERS | |
| 233 | Gastrointestinal inflammation | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 234 | Neuralgia | FAERS: 21 | US FAERS | |
| 235 | Nodule | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 236 | White blood cell count decreased | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 237 | Abdominal cavity drainage | FAERS: 20 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 238 | Aphonia | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 239 | Delirium | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 240 | Hunger | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 241 | Hypokinesia | FAERS: 20 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 242 | Portal Vein Thrombosis | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 243 | Post procedural infection | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 244 | Respiratory arrest | FAERS: 20 | US FAERS | |
| 245 | Stomatitis | FAERS: 20 | US FAERS | |
| 246 | Cyanosis | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 247 | Epigastric discomfort | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 248 | Eyelid Function Disorder | FAERS: 19 | US FAERS | |
| 249 | Obstruction | FAERS: 19 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 250 | Oral mucosal erythema | FAERS: 19 | US FAERS | |
| 251 | Pancreatic Neoplasm | FAERS: 19 | US FAERS | |
| 252 | Thirst | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 253 | Thrombocytopenia | FAERS: 19 | US FAERS | |
| 254 | Tinnitus | FAERS: 19 | US FAERS | |
| 255 | Blood count abnormal | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 256 | Blood potassium increased | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 257 | Cholecystitis infective | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 258 | Injection site warmth | FAERS: 18 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 259 | Oral candidiasis | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 260 | Anal Fissure | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 261 | Bursitis | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 262 | Device leakage | FAERS: 17 | US FAERS | |
| 263 | General physical condition abnormal | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 264 | Hepatectomy | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 265 | Hordeolum | FAERS: 17 | US FAERS | |
| 266 | Hypothyroidism | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 267 | Infrequent bowel movements | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 268 | Menorrhagia | FAERS: 17 | US FAERS | |
| 269 | Retching | FAERS: 17 | US FAERS | |
| 270 | Toothache | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 271 | Bladder Neoplasm | FAERS: 16 | US FAERS | |
| 272 | Carcinoid crisis | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 273 | Depressed Level of Consciousness | FAERS: 16 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 274 | Device malfunction | FAERS: 16 | US FAERS | |
| 275 | Eating disorder symptom | FAERS: 16 | US FAERS | |
| 276 | Hyperphagia | FAERS: 16 | US FAERS | |
| 277 | Injection site extravasation | FAERS: 16 | US FAERS | |
| 278 | Lactose Intolerance | FAERS: 16 | US FAERS | |
| 279 | Muscle strain | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 280 | Muscle tightness | FAERS: 16 | US FAERS | |
| 281 | Osteomyelitis | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 282 | Pyelonephritis | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 283 | Subcutaneous Abscess | FAERS: 16 | US FAERS | |
| 284 | Thyroidectomy | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 285 | VIIth nerve paralysis | FAERS: 16 | US FAERS | |
| 286 | Anorectal discomfort | FAERS: 15 | US FAERS | |
| 287 | Blood iron decreased | FAERS: 15 | US FAERS | |
| 288 | Device related infection | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 289 | Dysphonia | FAERS: 15 | US FAERS | |
| 290 | Eructation | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 291 | Eye Infection | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 292 | Gastritis | FAERS: 15 | US FAERS | |
| 293 | Insulin-like growth factor decreased | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 294 | Lymphoma | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 295 | Mood swings | FAERS: 15 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 296 | Non-cardiac chest pain | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 297 | Acne | FAERS: 14 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 298 | Asthma | FAERS: 14 | US FAERS | |
| 299 | Colitis | FAERS: 14 | US FAERS | |
| 300 | Concomitant disease progression | FAERS: 14 | US FAERS | |
| 301 | Gamma radiation therapy | FAERS: 14 | US FAERS | |
| 302 | Injection site scar | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 303 | Injury associated with device | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 304 | Neutropenia | FAERS: 14 | US FAERS | |
| 305 | Ocular discomfort | FAERS: 14 | US FAERS | |
| 306 | Overweight | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 307 | Pancreatic duct obstruction | FAERS: 14 | US FAERS | |
| 308 | Peritonitis | FAERS: 14 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 309 | Skin Ulcer | FAERS: 14 | US FAERS | |
| 310 | Abdominal symptom | FAERS: 13 | US FAERS | |
| 311 | Aortic Aneurysm | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 312 | Aphasia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 313 | Bone density decreased | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 314 | Choking | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 315 | Epilepsy | FAERS: 13 | US FAERS | |
| 316 | Gastrointestinal carcinoma | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 317 | Ileus | FAERS: 13 | US FAERS | |
| 318 | Incorrect product storage | FAERS: 13 | US FAERS | |
| 319 | Labile blood pressure | FAERS: 13 | US FAERS | |
| 320 | Lip swelling | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 321 | Pericardial effusion | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 322 | Phlebitis | FAERS: 13 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 323 | Radial pulse increased | FAERS: 13 | US FAERS | |
| 324 | Acoustic Neuroma | FAERS: 12 | US FAERS | |
| 325 | Blood electrolytes abnormal | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 326 | Gastrointestinal disorder postoperative | FAERS: 12 | US FAERS | |
| 327 | Hyperthyroidism | FAERS: 12 | US FAERS | |
| 328 | Incisional hernia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 329 | Renal Colic | FAERS: 12 | US FAERS | |
| 330 | Scab | FAERS: 12 | US FAERS | |
| 331 | Abdominal Abscess | FAERS: 11 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 332 | Abdominal rigidity | FAERS: 11 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 333 | Basal cell carcinoma | FAERS: 11 | US FAERS | |
| 334 | Cerebral Infarction | FAERS: 11 | US FAERS | |
| 335 | Clostridium difficile infection | FAERS: 11 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 336 | Drug dispensing error | FAERS: 11 | US FAERS | |
| 337 | Drug dose omission | FAERS: 11 | US FAERS | |
| 338 | Fibromyalgia | FAERS: 11 | US FAERS | |
| 339 | Frustration | FAERS: 11 | US FAERS | |
| 340 | Injection site abscess | FAERS: 11 | US FAERS | |
| 341 | Laceration | FAERS: 11 | US FAERS | |
| 342 | Postoperative wound complication | FAERS: 11 | US FAERS | |
| 343 | Quality of life decreased | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 344 | Respiratory tract congestion | FAERS: 11 | US FAERS | |
| 345 | Sluggishness | FAERS: 11 | US FAERS | |
| 346 | Ulcer | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 347 | Wrong technique in device usage process | FAERS: 11 | US FAERS | |
| 348 | Anger | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 349 | Apathy | FAERS: 10 | US FAERS | |
| 350 | Blood blister | FAERS: 10 | US FAERS | |
| 351 | Carcinoid Heart Disease | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 352 | Cold sweat | FAERS: 10 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 353 | Disease recurrence | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 354 | Embolism | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 355 | Encephalitis | FAERS: 10 | US FAERS | |
| 356 | Gait inability | FAERS: 10 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 357 | Incorrect dose administered by device | FAERS: 10 | US FAERS | |
| 358 | Loose tooth | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 359 | Monoplegia | FAERS: 10 | US FAERS | |
| 360 | Nerve injury | FAERS: 10 | US FAERS | |
| 361 | Nipple pain | FAERS: 10 | US FAERS | |
| 362 | Pancreatic Insufficiency | FAERS: 10 | US FAERS | |
| 363 | Product storage error | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 364 | Psoriasis | FAERS: 10 | US FAERS | |
| 365 | Renal cyst | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 366 | Vulvovaginal pruritus | FAERS: 10 | US FAERS | |
| 367 | Acromegaly | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 368 | Agitation | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 369 | Altered state of consciousness | FAERS: 9 | US FAERS | |
| 370 | Asphyxia | FAERS: 9 | US FAERS | |
| 371 | Biliary dilatation | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 372 | Cataract operation | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 373 | Excoriation | FAERS: 9 | US FAERS | |
| 374 | Gastric ulcer | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 375 | Gastrointestinal infection | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 376 | Gastrointestinal stoma complication | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 377 | Glaucoma | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 378 | Hemiparesis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 379 | Hemiplegia | FAERS: 9 | US FAERS | |
| 380 | Hydronephrosis | FAERS: 9 | US FAERS | |
| 381 | Hyperkeratosis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 382 | Incontinence | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 383 | Injection site inflammation | FAERS: 9 | US FAERS | |
| 384 | Intervertebral Disc Degeneration | FAERS: 9 | US FAERS | |
| 385 | Macular degeneration | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 386 | Metastases to stomach | FAERS: 9 | US FAERS | |
| 387 | Metastatic Neoplasm | FAERS: 9 | US FAERS | |
| 388 | Overdose | FAERS: 9 | US FAERS | |
| 389 | Pancreatic carcinoma recurrent | FAERS: 9 | US FAERS | |
| 390 | Paracentesis | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 391 | Pelvic discomfort | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 392 | Peritoneal Infection | FAERS: 9 | US FAERS | |
| 393 | Respiratory distress | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 394 | Retroperitoneal lymphadenopathy | FAERS: 9 | US FAERS | |
| 395 | Rheumatoid Arthritis | FAERS: 9 | US FAERS | |
| 396 | Skin hypertrophy | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 397 | Thermal burn | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 398 | Throat cancer | FAERS: 9 | US FAERS | |
| 399 | Tooth Loss | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 400 | Abdominal Infection | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 401 | Abdominal tenderness | FAERS: 8 | US FAERS | |
| 402 | Accidental overdose | FAERS: 8 | US FAERS | |
| 403 | Acute kidney injury | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 404 | Arteriosclerosis | FAERS: 8 | US FAERS | |
| 405 | Blood magnesium decreased | FAERS: 8 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 406 | Blood thyroid stimulating hormone decreased | FAERS: 8 | US FAERS | |
| 407 | Bone lesion | FAERS: 8 | US FAERS | |
| 408 | Colonoscopy abnormal | FAERS: 8 | US FAERS | |
| 409 | Conjunctivitis | FAERS: 8 | US FAERS | |
| 410 | Drug prescribing error | FAERS: 8 | US FAERS | |
| 411 | Full blood count increased | FAERS: 8 | US FAERS | |
| 412 | Gastrointestinal viral infection | FAERS: 8 | US FAERS | |
| 413 | Hepatic congestion | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 414 | Hyperacusis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 415 | Hypoxia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 416 | Hysterectomy | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 417 | Injection site injury | FAERS: 8 | US FAERS | |
| 418 | Injection site nodule | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 419 | Medical device complication | FAERS: 8 | US FAERS | |
| 420 | Pelvic Pain | FAERS: 8 | US FAERS | |
| 421 | Presyncope | FAERS: 8 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 422 | Procedural complication | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 423 | Product deposit | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 424 | Pulmonary Hypertension | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 425 | Tachyphrenia | FAERS: 8 | US FAERS | |
| 426 | Therapy non-responder | FAERS: 8 | US FAERS | |
| 427 | Urinary tract obstruction | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 428 | Vitamin D Deficiency | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 429 | Walking aid user | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 430 | Wrong patient received medication | FAERS: 8 | US FAERS | |
| 431 | 5-hydroxyindolacetic acid in urine increased | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 432 | 5-hydroxyindolacetic acid increased | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 433 | Alanine Aminotransferase Increased | FAERS: 7 | US FAERS | |
| 434 | Aortic occlusion | FAERS: 7 | US FAERS | |
| 435 | Asthenopia | FAERS: 7 | US FAERS | |
| 436 | Cancer Pain | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 437 | Catheter site infection | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 438 | Dysarthria | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 439 | Electrolyte imbalance | FAERS: 7 | US FAERS | |
| 440 | Enterococcus test positive | FAERS: 7 | US FAERS | |
| 441 | Hepatic Infection | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 442 | Hepatic cancer metastatic | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 443 | Hip surgery | FAERS: 7 | US FAERS | |
| 444 | Hypothalamo-pituitary disorder | FAERS: 7 | US FAERS | |
| 445 | Incision site erythema | FAERS: 7 | US FAERS | |
| 446 | Incision site pain | FAERS: 7 | US FAERS | |
| 447 | Infarction | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 448 | Intracranial Aneurysm | FAERS: 7 | US FAERS | |
| 449 | MYELODYSPLASTIC SYNDROME | FAERS: 7 | US FAERS | |
| 450 | Meningioma | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 451 | Metastases to abdominal cavity | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 452 | Muscle Rigidity | FAERS: 7 | US FAERS | |
| 453 | Necrosis | FAERS: 7 | US FAERS | |
| 454 | Parenteral Nutrition | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 455 | Personality Change | FAERS: 7 | US FAERS | |
| 456 | Photophobia | FAERS: 7 | US FAERS | |
| 457 | Pneumothorax | FAERS: 7 | US FAERS | |
| 458 | Proteinuria | FAERS: 7 | US FAERS | |
| 459 | Rotator cuff syndrome | FAERS: 7 | US FAERS | |
| 460 | Small intestine carcinoma | FAERS: 7 | US FAERS | |
| 461 | Spinal column stenosis | FAERS: 7 | US FAERS | |
| 462 | Tooth Extraction | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 463 | Underweight | FAERS: 7 | US FAERS | |
| 464 | Viral upper respiratory tract infection | FAERS: 7 | US FAERS | |
| 465 | Wound Infection | FAERS: 7 | US FAERS | |
| 466 | furuncle | FAERS: 7 | US FAERS | |
| 467 | insulinoma | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 468 | nervous system disorder | FAERS: 7 | US FAERS | |
| 469 | Acute Coronary Syndrome | FAERS: 6 | US FAERS | |
| 470 | Arthropathy | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 471 | Bipolar Disorder | FAERS: 6 | US FAERS | |
| 472 | Blood cortisol decreased | FAERS: 6 | US FAERS | |
| 473 | Blood potassium abnormal | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 474 | Blood pressure inadequately controlled | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 475 | Breast infection | FAERS: 6 | US FAERS | |
| 476 | Carpal Tunnel Syndrome | FAERS: 6 | US FAERS | |
| 477 | Chondroma | FAERS: 6 | US FAERS | |
| 478 | Chronic sinusitis | FAERS: 6 | US FAERS | |
| 479 | Completed Suicide | FAERS: 6 | US FAERS | |
| 480 | Diabetes Insipidus | FAERS: 6 | US FAERS | |
| 481 | Drug Dependence | FAERS: 6 | US FAERS | |
| 482 | Gastric mucosal lesion | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 483 | Gastrostomy | FAERS: 6 | US FAERS | |
| 484 | Impaired gastric emptying | FAERS: 6 | US FAERS | |
| 485 | Infected cyst | FAERS: 6 | US FAERS | |
| 486 | Injection site hypersensitivity | FAERS: 6 | US FAERS | |
| 487 | Injection site infection | FAERS: 6 | US FAERS | |
| 488 | Injection site necrosis | FAERS: 6 | US FAERS | |
| 489 | Iritis | FAERS: 6 | US FAERS | |
| 490 | Irritable Bowel Syndrome | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 491 | Malabsorption | FAERS: 6 | US FAERS | |
| 492 | Mastitis | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 493 | Neutrophil count decreased | FAERS: 6 | US FAERS | |
| 494 | Obesity | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 495 | Oncologic complication | FAERS: 6 | US FAERS | |
| 496 | Open wound | FAERS: 6 | US FAERS | |
| 497 | Osteopenia | FAERS: 6 | US FAERS | |
| 498 | Oxygen supplementation | FAERS: 6 | US FAERS | |
| 499 | Periarticular disorder | FAERS: 6 | US FAERS | |
| 500 | Post procedural pneumonia | FAERS: 6 | US FAERS | |
| 501 | Product physical issue | FAERS: 6 | US FAERS | |
| 502 | Protein total decreased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 503 | Psychiatric symptom | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 504 | Pulmonary thrombosis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 505 | Radial nerve palsy | FAERS: 6 | US FAERS | |
| 506 | Renal mass | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 507 | Septic embolus | FAERS: 6 | US FAERS | |
| 508 | Skin tightness | FAERS: 6 | US FAERS | |
| 509 | Snoring | FAERS: 6 | US FAERS | |
| 510 | Splenectomy | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 511 | Therapeutic response unexpected | FAERS: 6 | US FAERS | |
| 512 | Tumour haemorrhage | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 513 | Vitreous floaters | FAERS: 6 | US FAERS | |
| 514 | Acinic cell carcinoma of salivary gland | FAERS: 5 | US FAERS | |
| 515 | Anal Fistula | FAERS: 5 | US FAERS | |
| 516 | Apparent death | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 517 | Application site pain | FAERS: 5 | US FAERS | |
| 518 | Avulsion fracture | FAERS: 5 | US FAERS | |
| 519 | Back disorder | FAERS: 5 | US FAERS | |
| 520 | Benign neoplasm of adrenal gland | FAERS: 5 | US FAERS | |
| 521 | Biliary tract infection | FAERS: 5 | US FAERS | |
| 522 | Blood albumin decreased | FAERS: 5 | US FAERS | |
| 523 | Blood alkaline phosphatase increased | FAERS: 5 | US FAERS | |
| 524 | Blood electrolytes decreased | FAERS: 5 | US FAERS | |
| 525 | Blood triglycerides increased | FAERS: 5 | US FAERS | |
| 526 | Breast tenderness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 527 | Cholelithotomy | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 528 | Circumstance or information capable of leading to medication error | FAERS: 5 | US FAERS | |
| 529 | Dental caries | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 530 | Drug resistance | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 531 | Ecchymosis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 532 | Exposure via father | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 533 | Facial paralysis | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 534 | Fistula discharge | FAERS: 5 | US FAERS | |
| 535 | Frustration tolerance decreased | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 536 | Full blood count decreased | FAERS: 5 | US FAERS | |
| 537 | Gallbladder pain | FAERS: 5 | US FAERS | |
| 538 | Gamma-Glutamyltransferase Increased | FAERS: 5 | US FAERS | |
| 539 | Gastrointestinal hypomotility | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 540 | Hepatitis | FAERS: 5 | US FAERS | |
| 541 | Hypopituitarism | FAERS: 5 | US FAERS | |
| 542 | Incorrect route of product administration | FAERS: 5 | US FAERS | |
| 543 | Increased bronchial secretion | FAERS: 5 | US FAERS | |
| 544 | Infectious Mononucleosis | FAERS: 5 | US FAERS | |
| 545 | Injection site cellulitis | FAERS: 5 | US FAERS | |
| 546 | Joint Range of Motion Decreased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 547 | Joint abscess | FAERS: 5 | US FAERS | |
| 548 | Mechanical ventilation | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 549 | Mental impairment | FAERS: 5 | US FAERS | |
| 550 | Metrorrhagia | FAERS: 5 | US FAERS | |
| 551 | Occult blood positive | FAERS: 5 | US FAERS | |
| 552 | Oral infection | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 553 | Osteolysis | FAERS: 5 | US FAERS | |
| 554 | Oxygen consumption decreased | FAERS: 5 | US FAERS | |
| 555 | Pain of skin | FAERS: 5 | US FAERS | |
| 556 | Pancreatic operation | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 557 | Product preparation error | FAERS: 5 | US FAERS | |
| 558 | Psychological Trauma | FAERS: 5 | US FAERS | |
| 559 | Renal tubular acidosis | FAERS: 5 | US FAERS | |
| 560 | Serum Sickness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 561 | Splenomegaly | FAERS: 5 | US FAERS | |
| 562 | Sudden death | FAERS: 5 | US FAERS | |
| 563 | Sunburn | FAERS: 5 | US FAERS | |
| 564 | Urine output increased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 565 | Urine potassium increased | FAERS: 5 | US FAERS | |
| 566 | Venous Injury | FAERS: 5 | US FAERS | |
| 567 | muscle injury | FAERS: 5 | US FAERS | |
| 568 | treatment failure | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 569 | Acute psychosis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 570 | Acute sinusitis | FAERS: 4 | US FAERS | |
| 571 | Adenomatous Polyposis Coli | FAERS: 4 | US FAERS | |
| 572 | Administration related reaction | FAERS: 4 | US FAERS | |
| 573 | Ageusia | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 574 | Aneurysm | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 575 | Appendicitis | FAERS: 4 | US FAERS | |
| 576 | Application site mass | FAERS: 4 | US FAERS | |
| 577 | Bile duct stent insertion | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 578 | Blood growth hormone decreased | FAERS: 4 | US FAERS | |
| 579 | Blood sodium abnormal | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 580 | Cardiac enzymes increased | FAERS: 4 | US FAERS | |
| 581 | Cardiac neoplasm unspecified | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 582 | Carotid artery occlusion | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 583 | Cerebral Palsy | FAERS: 4 | US FAERS | |
| 584 | Cerebral Thrombosis | FAERS: 4 | US FAERS | |
| 585 | Cholestasis | FAERS: 4 | US FAERS | |
| 586 | Cytoreductive Surgery | FAERS: 4 | US FAERS | |
| 587 | Decreased immune responsiveness | FAERS: 4 | US FAERS | |
| 588 | Device toxicity | FAERS: 4 | US FAERS | |
| 589 | Disseminated Intravascular Coagulation | FAERS: 4 | US FAERS | |
| 590 | Ear discomfort | FAERS: 4 | US FAERS | |
| 591 | Ejection Fraction Decreased | FAERS: 4 | US FAERS | |
| 592 | Erectile dysfunction | FAERS: 4 | US FAERS | |
| 593 | Expired product administered | FAERS: 4 | US FAERS | |
| 594 | Fat necrosis | FAERS: 4 | US FAERS | |
| 595 | Femoral artery occlusion | FAERS: 4 | US FAERS | |
| 596 | Folliculitis | FAERS: 4 | US FAERS | |
| 597 | Gastrointestinal cancer metastatic | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 598 | Gastrointestinal obstruction | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 599 | Impaired work ability | FAERS: 4 | US FAERS | |
| 600 | Incision site infection | FAERS: 4 | US FAERS | |
| 601 | Incorrect storage of drug | FAERS: 4 | US FAERS | |
| 602 | Injection site pruritus | FAERS: 4 | US FAERS | |
| 603 | Injection site thrombosis | FAERS: 4 | US FAERS | |
| 604 | Intervertebral disc disorder | FAERS: 4 | US FAERS | |
| 605 | Joint sprain | FAERS: 4 | US FAERS | |
| 606 | Jugular vein distension | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 607 | Laparotomy | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 608 | Lip and/or oral cavity cancer | FAERS: 4 | US FAERS | |
| 609 | Liquid product physical issue | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 610 | Malignant tumour excision | FAERS: 4 | US FAERS | |
| 611 | Multiple Sclerosis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 612 | Muscle Fatigue | FAERS: 4 | US FAERS | |
| 613 | Muscle necrosis | FAERS: 4 | US FAERS | |
| 614 | Myopathy | FAERS: 4 | US FAERS | |
| 615 | Oral pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 616 | Panic Disorder | FAERS: 4 | US FAERS | |
| 617 | Paresis | FAERS: 4 | US FAERS | |
| 618 | Pathological fracture | FAERS: 4 | US FAERS | |
| 619 | Polyuria | FAERS: 4 | US FAERS | |
| 620 | Postoperative abscess | FAERS: 4 | US FAERS | |
| 621 | Prescribed overdose | FAERS: 4 | US FAERS | |
| 622 | Product solubility abnormal | FAERS: 4 | US FAERS | |
| 623 | Product substitution issue | FAERS: 4 | US FAERS | |
| 624 | Product use complaint | FAERS: 4 | US FAERS | |
| 625 | Pulmonary pain | FAERS: 4 | US FAERS | |
| 626 | Rectal Prolapse | FAERS: 4 | US FAERS | |
| 627 | Renal Cell Carcinoma | FAERS: 4 | US FAERS | |
| 628 | Rheumatic disorder | FAERS: 4 | US FAERS | |
| 629 | Shock | FAERS: 4 | US FAERS | |
| 630 | Tension | FAERS: 4 | US FAERS | |
| 631 | Thoracic cavity drainage | FAERS: 4 | US FAERS | |
| 632 | Thyroid hormone replacement therapy | FAERS: 4 | US FAERS | |
| 633 | Toxicity to various agents | FAERS: 4 | US FAERS | |
| 634 | Troponin increased | FAERS: 4 | US FAERS | |
| 635 | Ultrasound Doppler abnormal | FAERS: 4 | US FAERS | |
| 636 | Ultrasound scan abnormal | FAERS: 4 | US FAERS | |
| 637 | Vasculitis | FAERS: 4 | US FAERS | |
| 638 | Vitreous Detachment | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 639 | effusion | FAERS: 4 | US FAERS | |
| 640 | gallbladder neoplasm | FAERS: 4 | US FAERS | |
| 641 | ovarian neoplasm | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 642 | Adenocarcinoma | FAERS: 3 | US FAERS | |
| 643 | Alopecia Areata | FAERS: 3 | US FAERS | |
| 644 | Ammonia increased | FAERS: 3 | US FAERS | |
| 645 | Anuria | FAERS: 3 | US FAERS | |
| 646 | Aortic Valve Stenosis | FAERS: 3 | US FAERS | |
| 647 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 648 | Ataxia | FAERS: 3 | US FAERS | |
| 649 | Aura | FAERS: 3 | US FAERS | |
| 650 | Barium impaction | FAERS: 3 | US FAERS | |
| 651 | Benign Prostatic Hyperplasia | FAERS: 3 | US FAERS | |
| 652 | Biopsy | FAERS: 3 | US FAERS | |
| 653 | Bladder cancer recurrent | FAERS: 3 | US FAERS | |
| 654 | Blood prolactin increased | FAERS: 3 | US FAERS | |
| 655 | Blood thyroid stimulating hormone increased | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 656 | Cardiac ventricular disorder | FAERS: 3 | US FAERS | |
| 657 | Catheter placement | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 658 | Cerebral atrophy | FAERS: 3 | US FAERS | |
| 659 | Cholangiocarcinoma | FAERS: 3 | US FAERS | |
| 660 | Claustrophobia | FAERS: 3 | US FAERS | |
| 661 | Coronary Artery Disease | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 662 | Cytomegalovirus gastrointestinal infection | FAERS: 3 | US FAERS | |
| 663 | Dengue Fever | FAERS: 3 | US FAERS | |
| 664 | Device Failure | FAERS: 3 | US FAERS | |
| 665 | Device difficult to use | FAERS: 3 | US FAERS | |
| 666 | Drug administered at inappropriate site | FAERS: 3 | US FAERS | |
| 667 | Dumping Syndrome | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 668 | Dysentery | FAERS: 3 | US FAERS | |
| 669 | Dysgraphia | FAERS: 3 | US FAERS | |
| 670 | Eczema | FAERS: 3 | US FAERS | |
| 671 | Erysipelas | FAERS: 3 | US FAERS | |
| 672 | Escherichia infection | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 673 | Eye irritation | FAERS: 3 | US FAERS | |
| 674 | Fear of needles | FAERS: 3 | US FAERS | |
| 675 | Feeling jittery | FAERS: 3 | US FAERS | |
| 676 | Fibrosis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 677 | Food Allergy | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 678 | Full blood count abnormal | FAERS: 3 | US FAERS | |
| 679 | Gastrinoma | FAERS: 3 | US FAERS | |
| 680 | Gastrointestinal wall thickening | FAERS: 3 | US FAERS | |
| 681 | General physical condition decreased | FAERS: 3 | US FAERS | |
| 682 | Head deformity | FAERS: 3 | US FAERS | |
| 683 | Hypertensive crisis | FAERS: 3 | US FAERS | |
| 684 | Hypoaesthesia facial | FAERS: 3 | US FAERS | |
| 685 | Induration | FAERS: 3 | US FAERS | |
| 686 | Injection site calcification | FAERS: 3 | US FAERS | |
| 687 | Injection site granuloma | FAERS: 3 | US FAERS | |
| 688 | Intestinal metastasis | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 689 | Intra-abdominal pressure increased | FAERS: 3 | US FAERS | |
| 690 | Laziness | FAERS: 3 | US FAERS | |
| 691 | Leukopenia | FAERS: 3 | US FAERS | |
| 692 | Lipoma | FAERS: 3 | US FAERS | |
| 693 | Low birth weight baby | FAERS: 3 | US FAERS | |
| 694 | Mastication disorder | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 695 | Mental status changes | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 696 | Mesenteric neoplasm | FAERS: 3 | US FAERS | |
| 697 | Mineral deficiency | FAERS: 3 | US FAERS | |
| 698 | Mole excision | FAERS: 3 | US FAERS | |
| 699 | Myocardial fibrosis | FAERS: 3 | US FAERS | |
| 700 | Myocardial necrosis marker increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 701 | Nephritis | FAERS: 3 | US FAERS | |
| 702 | Nuchal Rigidity | FAERS: 3 | US FAERS | |
| 703 | Obsessive-Compulsive Disorder | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 704 | Osteochondritis | FAERS: 3 | US FAERS | |
| 705 | Otitis Media | FAERS: 3 | US FAERS | |
| 706 | Pancreatectomy | FAERS: 3 | US FAERS | |
| 707 | Pancytopenia | FAERS: 3 | US FAERS | |
| 708 | Parathyroidectomy | FAERS: 3 | US FAERS | |
| 709 | Patient-device incompatibility | FAERS: 3 | US FAERS | |
| 710 | Pelvic mass | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 711 | Peripheral artery stenosis | FAERS: 3 | US FAERS | |
| 712 | Pharmaceutical product complaint | FAERS: 3 | US FAERS | |
| 713 | Pituitary cyst | FAERS: 3 | US FAERS | |
| 714 | Polyneuropathy | FAERS: 3 | US FAERS | |
| 715 | Post procedural discharge | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 716 | Post procedural swelling | FAERS: 3 | US FAERS | |
| 717 | Product administration error | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 718 | Product dosage form issue | FAERS: 3 | US FAERS | |
| 719 | Product physical consistency issue | FAERS: 3 | US FAERS | |
| 720 | Protein urine present | FAERS: 3 | US FAERS | |
| 721 | Pulmonary Infarction | FAERS: 3 | US FAERS | |
| 722 | Rales | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 723 | Rash erythematous | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 724 | Rectal fissure | FAERS: 3 | US FAERS | |
| 725 | Retinal Detachment | FAERS: 3 | US FAERS | |
| 726 | Retinal vascular thrombosis | FAERS: 3 | US FAERS | |
| 727 | Retro-orbital neoplasm | FAERS: 3 | US FAERS | |
| 728 | Rhinalgia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 729 | Schizophrenia | FAERS: 3 | US FAERS | |
| 730 | Simple Partial Seizures | FAERS: 3 | US FAERS | |
| 731 | Solar lentigo | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 732 | Stupor | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 733 | Synovial Cyst | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 734 | Thyroiditis | FAERS: 3 | US FAERS | |
| 735 | Tooth Infection | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 736 | Transaminases increased | FAERS: 3 | US FAERS | |
| 737 | Tuberculosis | FAERS: 3 | US FAERS | |
| 738 | Unevaluable event | FAERS: 3 | US FAERS | |
| 739 | Urethral Obstruction | FAERS: 3 | US FAERS | |
| 740 | Uterine Cancer | FAERS: 3 | US FAERS | |
| 741 | Uterine Polyp | FAERS: 3 | US FAERS | |
| 742 | Uterine Prolapse | FAERS: 3 | US FAERS | |
| 743 | Uterine abscess | FAERS: 3 | US FAERS | |
| 744 | Ventricular hypertrophy | FAERS: 3 | US FAERS | |
| 745 | Vertebral column mass | FAERS: 3 | US FAERS | |
| 746 | Wound Complication | FAERS: 3 | US FAERS | |
| 747 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 748 | Administration site scar | FAERS: 2 | US FAERS | |
| 749 | Allergy to arthropod bite | FAERS: 2 | US FAERS | |
| 750 | Amaurosis | FAERS: 2 | US FAERS | |
| 751 | Ammonia abnormal | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 752 | Angiodysplasia | FAERS: 2 | US FAERS | |
| 753 | Anorexia | FAERS: 2 | US FAERS | |
| 754 | Anticoagulation drug level increased | FAERS: 2 | US FAERS | |
| 755 | Apallic syndrome | FAERS: 2 | US FAERS | |
| 756 | Artificial heart device user | FAERS: 2 | US FAERS | |
| 757 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 758 | Bedridden | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 759 | Biliary sphincterotomy | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 760 | Blood cholesterol abnormal | FAERS: 2 | US FAERS | |
| 761 | Blood corticotrophin abnormal | FAERS: 2 | US FAERS | |
| 762 | Blood cortisol abnormal | FAERS: 2 | US FAERS | |
| 763 | Blood creatinine abnormal | FAERS: 2 | US FAERS | |
| 764 | Blood gastrin increased | FAERS: 2 | US FAERS | |
| 765 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 766 | Blood parathyroid hormone decreased | FAERS: 2 | US FAERS | |
| 767 | Blood urea abnormal | FAERS: 2 | US FAERS | |
| 768 | Body height abnormal | FAERS: 2 | US FAERS | |
| 769 | Body temperature fluctuation | FAERS: 2 | US FAERS | |
| 770 | Bone density increased | FAERS: 2 | US FAERS | |
| 771 | Brain Death | FAERS: 2 | US FAERS | |
| 772 | Breakthrough Pain | FAERS: 2 | US FAERS | |
| 773 | Breast cancer stage II | FAERS: 2 | US FAERS | |
| 774 | Bronchopneumonia | FAERS: 2 | US FAERS | |
| 775 | Bronchospasm | FAERS: 2 | US FAERS | |
| 776 | Cardio-respiratory distress | FAERS: 2 | US FAERS | |
| 777 | Carotid artery perforation | FAERS: 2 | US FAERS | |
| 778 | Cartilage injury | FAERS: 2 | US FAERS | |
| 779 | Cell marker increased | FAERS: 2 | US FAERS | |
| 780 | Cerebral cyst | FAERS: 2 | US FAERS | |
| 781 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 782 | Chorea | FAERS: 2 | US FAERS | |
| 783 | Complication of device insertion | FAERS: 2 | US FAERS | |
| 784 | Congenital hearing disorder | FAERS: 2 | US FAERS | |
| 785 | Connective tissue inflammation | FAERS: 2 | US FAERS | |
| 786 | Contralateral breast cancer | FAERS: 2 | US FAERS | |
| 787 | Coronary angioplasty | FAERS: 2 | US FAERS | |
| 788 | Cyst removal | FAERS: 2 | US FAERS | |
| 789 | Deformity | FAERS: 2 | US FAERS | |
| 790 | Diabetic Nephropathy | FAERS: 2 | US FAERS | |
| 791 | Diplegia | FAERS: 2 | US FAERS | |
| 792 | Diverticular perforation | FAERS: 2 | US FAERS | |
| 793 | Diverticulum | FAERS: 2 | US FAERS | |
| 794 | Drug Tolerance | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 795 | Drug exposure before pregnancy | FAERS: 2 | US FAERS | |
| 796 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 797 | Drug level changed | FAERS: 2 | US FAERS | |
| 798 | Drug level decreased | FAERS: 2 | US FAERS | |
| 799 | Dysplasia | FAERS: 2 | US FAERS | |
| 800 | Endoscopic Retrograde Cholangiopancreatography | FAERS: 2 | US FAERS | |
| 801 | Erythema Multiforme | FAERS: 2 | US FAERS | |
| 802 | Escherichia urinary tract infection | FAERS: 2 | US FAERS | |
| 803 | Extra dose administered | FAERS: 2 | US FAERS | |
| 804 | Febrile Neutropenia | FAERS: 2 | US FAERS | |
| 805 | Fluid imbalance | FAERS: 2 | US FAERS | |
| 806 | Gangrene | FAERS: 2 | US FAERS | |
| 807 | Gastrointestinal hypermotility | FAERS: 2 | US FAERS | |
| 808 | Glucose tolerance increased | FAERS: 2 | US FAERS | |
| 809 | Granuloma | FAERS: 2 | US FAERS | |
| 810 | Head Banging | FAERS: 2 | US FAERS | |
| 811 | Hepatic artery occlusion | FAERS: 2 | US FAERS | |
| 812 | Hepatic necrosis | FAERS: 2 | US FAERS | |
| 813 | Hepatitis B | FAERS: 2 | US FAERS | |
| 814 | Hernia pain | FAERS: 2 | US FAERS | |
| 815 | Herpes Zoster Oticus | FAERS: 2 | US FAERS | |
| 816 | High density lipoprotein increased | FAERS: 2 | US FAERS | |
| 817 | High frequency ablation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 818 | Hypertensive cardiomyopathy | FAERS: 2 | US FAERS | |
| 819 | Hypertrophy | FAERS: 2 | US FAERS | |
| 820 | Hyperventilation | FAERS: 2 | US FAERS | |
| 821 | Implantable defibrillator insertion | FAERS: 2 | US FAERS | |
| 822 | Incoherent | FAERS: 2 | US FAERS | |
| 823 | Injection related reaction | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 824 | Injection site irritation | FAERS: 2 | US FAERS | |
| 825 | Intellectual Disability | FAERS: 2 | US FAERS | |
| 826 | Intra-abdominal fluid collection | FAERS: 2 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 827 | Intracranial mass | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 828 | Intraocular pressure test abnormal | FAERS: 2 | US FAERS | |
| 829 | Intussusception | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 830 | Invasive Ductal Breast Carcinoma | FAERS: 2 | US FAERS | |
| 831 | Itching scar | FAERS: 2 | US FAERS | |
| 832 | Labile hypertension | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 833 | Left Ventricular Hypertrophy | FAERS: 2 | US FAERS | |
| 834 | Left atrial dilatation | FAERS: 2 | US FAERS | |
| 835 | Leukocytosis | FAERS: 2 | US FAERS | |
| 836 | Lipase increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 837 | Lithotripsy | FAERS: 2 | US FAERS | |
| 838 | Liver transplant rejection | FAERS: 2 | US FAERS | |
| 839 | Lower respiratory tract inflammation | FAERS: 2 | US FAERS | |
| 840 | Lupus Nephritis | FAERS: 2 | US FAERS | |
| 841 | Lymphocyte count decreased | FAERS: 2 | US FAERS | |
| 842 | Lymphocyte count increased | FAERS: 2 | US FAERS | |
| 843 | Malabsorption from injection site | FAERS: 2 | US FAERS | |
| 844 | Malignant ascites | FAERS: 2 | US FAERS | |
| 845 | Maternal exposure timing unspecified | FAERS: 2 | US FAERS | |
| 846 | Medical device removal | FAERS: 2 | US FAERS | |
| 847 | Medication overuse headache | FAERS: 2 | US FAERS | |
| 848 | Megacolon | FAERS: 2 | US FAERS | |
| 849 | Metastases to diaphragm | FAERS: 2 | US FAERS | |
| 850 | Metastases to pelvis | FAERS: 2 | US FAERS | |
| 851 | Metastases to thorax | FAERS: 2 | US FAERS | |
| 852 | Migraine with Aura | FAERS: 2 | US FAERS | |
| 853 | Milk Allergy | FAERS: 2 | US FAERS | |
| 854 | Mitral Valve Stenosis | FAERS: 2 | US FAERS | |
| 855 | Multiple Endocrine Neoplasia Type 1 | FAERS: 2 | US FAERS | |
| 856 | Multiple Endocrine Neoplasia | FAERS: 2 | US FAERS | |
| 857 | Myasthenia Gravis | FAERS: 2 | US FAERS | |
| 858 | Mydriasis | FAERS: 2 | US FAERS | |
| 859 | Myositis | FAERS: 2 | US FAERS | |
| 860 | Nocturia | FAERS: 2 | US FAERS | |
| 861 | Oliguria | FAERS: 2 | US FAERS | |
| 862 | Onychoclasis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 863 | Optic Neuropathy | FAERS: 2 | US FAERS | |
| 864 | Osteosclerosis | FAERS: 2 | US FAERS | |
| 865 | Ovarian adenoma | FAERS: 2 | US FAERS | |
| 866 | Paranasal sinus hypersecretion | FAERS: 2 | US FAERS | |
| 867 | Paraplegia | FAERS: 2 | US FAERS | |
| 868 | Performance status decreased | FAERS: 2 | US FAERS | |
| 869 | Pericarditis | FAERS: 2 | US FAERS | |
| 870 | Peripheral embolism | FAERS: 2 | US FAERS | |
| 871 | Physical disability | FAERS: 2 | US FAERS | |
| 872 | Pituitary enlargement | FAERS: 2 | US FAERS | |
| 873 | Pituitary gland radiotherapy | FAERS: 2 | US FAERS | |
| 874 | Pleurisy | FAERS: 2 | US FAERS | |
| 875 | Pneumonitis | FAERS: 2 | US FAERS | |
| 876 | Polydipsia | FAERS: 2 | US FAERS | |
| 877 | Portal Hypertension | FAERS: 2 | US FAERS | |
| 878 | Portal vein dilatation | FAERS: 2 | US FAERS | |
| 879 | Post procedural bile leak | FAERS: 2 | US FAERS | |
| 880 | Post procedural hypothyroidism | FAERS: 2 | US FAERS | |
| 881 | Pre-Eclampsia | FAERS: 2 | US FAERS | |
| 882 | Precancerous cells present | FAERS: 2 | US FAERS | |
| 883 | Product container issue | FAERS: 2 | US FAERS | |
| 884 | Product label issue | FAERS: 2 | US FAERS | |
| 885 | Product packaging issue | FAERS: 2 | US FAERS | |
| 886 | Product reconstitution quality issue | FAERS: 2 | US FAERS | |
| 887 | Prognathism | FAERS: 2 | US FAERS | |
| 888 | Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 889 | Pulmonary vascular disorder | FAERS: 2 | US FAERS | |
| 890 | Radiation associated pain | FAERS: 2 | US FAERS | |
| 891 | Radiation necrosis | FAERS: 2 | US FAERS | |
| 892 | Rectal discharge | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 893 | Rectal polyp | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 894 | Renal abscess | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 895 | Shock symptom | FAERS: 2 | US FAERS | |
| 896 | Shoulder deformity | FAERS: 2 | US FAERS | |
| 897 | Silent myocardial infarction | FAERS: 2 | US FAERS | |
| 898 | Sinus bradycardia | FAERS: 2 | US FAERS | |
| 899 | Skeletal injury | FAERS: 2 | US FAERS | |
| 900 | Skin reaction | FAERS: 2 | US FAERS | |
| 901 | Soft tissue necrosis | FAERS: 2 | US FAERS | |
| 902 | Spinal cord herniation | FAERS: 2 | US FAERS | |
| 903 | Splenic Infarction | FAERS: 2 | US FAERS | |
| 904 | Splinter | FAERS: 2 | US FAERS | |
| 905 | Stem cell transplant | FAERS: 2 | US FAERS | |
| 906 | Stoma obstruction | FAERS: 2 | US FAERS | |
| 907 | Stress at work | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 908 | Sudden onset of sleep | FAERS: 2 | US FAERS | |
| 909 | Suicide attempt | FAERS: 2 | US FAERS | |
| 910 | Syphilis | FAERS: 2 | US FAERS | |
| 911 | Systolic hypertension | FAERS: 2 | US FAERS | |
| 912 | Temperature intolerance | FAERS: 2 | US FAERS | |
| 913 | Temporal Arteritis | FAERS: 2 | US FAERS | |
| 914 | Tension Headache | FAERS: 2 | US FAERS | |
| 915 | Thirst decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 916 | Thoracic vertebral fracture | FAERS: 2 | US FAERS | |
| 917 | Thrombophlebitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 918 | Thymoma | FAERS: 2 | US FAERS | |
| 919 | Tinea Pedis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 920 | Trismus | FAERS: 2 | US FAERS | |
| 921 | Trisomy 21 | FAERS: 2 | US FAERS | |
| 922 | Urinary straining | FAERS: 2 | US FAERS | |
| 923 | Urinary tract inflammation | FAERS: 2 | US FAERS | |
| 924 | Vascular compression | FAERS: 2 | US FAERS | |
| 925 | Venous occlusion | FAERS: 2 | US FAERS | |
| 926 | Vital functions abnormal | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 927 | Wound decomposition | FAERS: 2 | US FAERS | |
| 928 | Wrist deformity | FAERS: 2 | US FAERS | |
| 929 | Zinc deficiency | FAERS: 2 | US FAERS | |
| 930 | fibroma | FAERS: 2 | US FAERS | |
| 931 | 5-hydroxyindolacetic acid decreased | FAERS: 1 | US FAERS | |
| 932 | ATRIAL ENLARGEMENT | FAERS: 1 | US FAERS | |
| 933 | Abdominal hernia obstructive | FAERS: 1 | US FAERS | |
| 934 | Abdominal rebound tenderness | FAERS: 1 | US FAERS | |
| 935 | Abdominal sepsis | FAERS: 1 | US FAERS | |
| 936 | Abnormal clotting factor | FAERS: 1 | US FAERS | |
| 937 | Absent bowel movement | FAERS: 1 | US FAERS | |
| 938 | Abulia | FAERS: 1 | US FAERS | |
| 939 | Accidental needle stick | FAERS: 1 | US FAERS | |
| 940 | Acquired cystic kidney disease | FAERS: 1 | US FAERS | |
| 941 | Administration site extravasation | FAERS: 1 | US FAERS | |
| 942 | Adnexa uteri mass | FAERS: 1 | US FAERS | |
| 943 | Adrenalectomy | FAERS: 1 | US FAERS | |
| 944 | Alanine aminotransferase decreased | FAERS: 1 | US FAERS | |
| 945 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 946 | Alcohol problem | FAERS: 1 | US FAERS | |
| 947 | Alcohol withdrawal syndrome | FAERS: 1 | US FAERS | |
| 948 | Alpha 2 globulin decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 949 | Amino acid level decreased | FAERS: 1 | US FAERS | |
| 950 | Amniotic fluid volume decreased | FAERS: 1 | US FAERS | |
| 951 | Anal abscess | FAERS: 1 | US FAERS | |
| 952 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 953 | Animal bite | FAERS: 1 | US FAERS | |
| 954 | Anorexia Nervosa | FAERS: 1 | US FAERS | |
| 955 | Anti-GAD antibody positive | FAERS: 1 | US FAERS | |
| 956 | Antibody test positive | FAERS: 1 | US FAERS | |
| 957 | Anticonvulsant drug level decreased | FAERS: 1 | US FAERS | |
| 958 | Aortic Rupture | FAERS: 1 | US FAERS | |
| 959 | Apoptosis | FAERS: 1 | US FAERS | |
| 960 | Application site erythema | FAERS: 1 | US FAERS | |
| 961 | Application site induration | FAERS: 1 | US FAERS | |
| 962 | Application site reaction | FAERS: 1 | US FAERS | |
| 963 | Arterial thrombosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 964 | Arteriovenous fistula occlusion | FAERS: 1 | US FAERS | |
| 965 | Arteriovenous fistula site complication | FAERS: 1 | US FAERS | |
| 966 | Arthropod bite | FAERS: 1 | US FAERS | |
| 967 | Astrocytoma | FAERS: 1 | US FAERS | |
| 968 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 969 | Autoscopy | FAERS: 1 | US FAERS | |
| 970 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 971 | Barium swallow abnormal | FAERS: 1 | US FAERS | |
| 972 | Bile acid malabsorption | FAERS: 1 | US FAERS | |
| 973 | Biliary sepsis | FAERS: 1 | US FAERS | |
| 974 | Biliary tract infection bacterial | FAERS: 1 | US FAERS | |
| 975 | Biopsy breast abnormal | FAERS: 1 | US FAERS | |
| 976 | Bladder malposition acquired | FAERS: 1 | US FAERS | |
| 977 | Bladder pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 978 | Bladder prolapse | FAERS: 1 | US FAERS | |
| 979 | Bladder spasm | FAERS: 1 | US FAERS | |
| 980 | Blast cell count increased | FAERS: 1 | US FAERS | |
| 981 | Blighted ovum | FAERS: 1 | US FAERS | |
| 982 | Blood bilirubin decreased | FAERS: 1 | US FAERS | |
| 983 | Blood catecholamines increased | FAERS: 1 | US FAERS | |
| 984 | Blood cortisol increased | FAERS: 1 | US FAERS | |
| 985 | Blood follicle stimulating hormone increased | FAERS: 1 | US FAERS | |
| 986 | Blood glucagon increased | FAERS: 1 | US FAERS | |
| 987 | Blood growth hormone releasing hormone increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 988 | Blood insulin decreased | FAERS: 1 | US FAERS | |
| 989 | Blood iron increased | FAERS: 1 | US FAERS | |
| 990 | Blood magnesium abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 991 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 992 | Blood parathyroid hormone abnormal | FAERS: 1 | US FAERS | |
| 993 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 994 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 995 | Blood urea increased | FAERS: 1 | US FAERS | |
| 996 | Bone erosion | FAERS: 1 | US FAERS | |
| 997 | Bone marrow toxicity | FAERS: 1 | US FAERS | |
| 998 | Brain Abscess | FAERS: 1 | US FAERS | |
| 999 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 1000 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 1001 | Breast discomfort | FAERS: 1 | US FAERS | |
| 1002 | Breast engorgement | FAERS: 1 | US FAERS | |
| 1003 | Breast hyperplasia | FAERS: 1 | US FAERS | |
| 1004 | C-reactive protein abnormal | FAERS: 1 | US FAERS | |
| 1005 | Calcium deficiency | FAERS: 1 | US FAERS | |
| 1006 | Candidiasis | FAERS: 1 | US FAERS | |
| 1007 | Capillary Fragility | FAERS: 1 | US FAERS | |
| 1008 | Carbohydrate antigen 19-9 increased | FAERS: 1 | US FAERS | |
| 1009 | Carcinoma | FAERS: 1 | US FAERS | |
| 1010 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 1011 | Cardiac Hypertrophy | FAERS: 1 | US FAERS | |
| 1012 | Cardiac function test abnormal | FAERS: 1 | US FAERS | |
| 1013 | Cardiac procedure complication | FAERS: 1 | US FAERS | |
| 1014 | Cardiac valve rupture | FAERS: 1 | US FAERS | |
| 1015 | Catarrh | FAERS: 1 | US FAERS | |
| 1016 | Catheter related infection | FAERS: 1 | US FAERS | |
| 1017 | Catheter site cellulitis | FAERS: 1 | US FAERS | |
| 1018 | Catheter site discharge | FAERS: 1 | US FAERS | |
| 1019 | Catheter site swelling | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1020 | Cervical polyp | FAERS: 1 | US FAERS | |
| 1021 | Choledocholithotomy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1022 | Chromatopsia | FAERS: 1 | US FAERS | |
| 1023 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 1024 | Clumsiness | FAERS: 1 | US FAERS | |
| 1025 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 1026 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 1027 | Contrast media allergy | FAERS: 1 | US FAERS | |
| 1028 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 1029 | Dermatitis acneiform | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1030 | Dermatitis | FAERS: 1 | US FAERS | |
| 1031 | Device breakage | FAERS: 1 | US FAERS | |
| 1032 | Device connection issue | FAERS: 1 | US FAERS | |
| 1033 | Device use error | FAERS: 1 | US FAERS | |
| 1034 | Device use issue | FAERS: 1 | US FAERS | |
| 1035 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 1036 | Diaphragmatic Hernia | FAERS: 1 | US FAERS | |
| 1037 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 1038 | Dilatation intrahepatic duct acquired | FAERS: 1 | US FAERS | |
| 1039 | Disability | FAERS: 1 | US FAERS | |
| 1040 | Disease complication | FAERS: 1 | US FAERS | |
| 1041 | Drain site complication | FAERS: 1 | US FAERS | |
| 1042 | Drowning | FAERS: 1 | US FAERS | |
| 1043 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 1044 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 1045 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 1046 | Drug level below therapeutic | FAERS: 1 | US FAERS | |
| 1047 | Drug level increased | FAERS: 1 | US FAERS | |
| 1048 | Drug toxicity | FAERS: 1 | US FAERS | |
| 1049 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 1050 | Duodenal Ulcer | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1051 | Duodenitis | FAERS: 1 | US FAERS | |
| 1052 | Dyschezia | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 1053 | Dysmorphism | FAERS: 1 | US FAERS | |
| 1054 | Dysphemia | FAERS: 1 | US FAERS | |
| 1055 | Ear congestion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1056 | Early satiety | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1057 | Ectopic Pregnancy | FAERS: 1 | US FAERS | |
| 1058 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 1059 | Embolic cerebral infarction | FAERS: 1 | US FAERS | |
| 1060 | Empty Sella Syndrome | FAERS: 1 | US FAERS | |
| 1061 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 1062 | Endometrial hypertrophy | FAERS: 1 | US FAERS | |
| 1063 | Endoscopy abnormal | FAERS: 1 | US FAERS | |
| 1064 | Enteritis | FAERS: 1 | US FAERS | |
| 1065 | Enterocolitis | FAERS: 1 | US FAERS | |
| 1066 | Eschar | FAERS: 1 | US FAERS | |
| 1067 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 1068 | Excessive cerumen production | FAERS: 1 | US FAERS | |
| 1069 | Exophthalmos | FAERS: 1 | US FAERS | |
| 1070 | Expired drug administered | FAERS: 1 | US FAERS | |
| 1071 | Exposure via partner | FAERS: 1 | US FAERS | |
| 1072 | Exposure via skin contact | FAERS: 1 | US FAERS | |
| 1073 | Extravasation | FAERS: 1 | US FAERS | |
| 1074 | Eye inflammation | FAERS: 1 | US FAERS | |
| 1075 | Fascial infection | FAERS: 1 | US FAERS | |
| 1076 | Fasciitis | FAERS: 1 | US FAERS | |
| 1077 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 1078 | Fibroadenoma of breast | FAERS: 1 | US FAERS | |
| 1079 | Fluid overload | FAERS: 1 | US FAERS | |
| 1080 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 1081 | Fracture pain | FAERS: 1 | US FAERS | |
| 1082 | Free prostate-specific antigen decreased | FAERS: 1 | US FAERS | |
| 1083 | Free prostate-specific antigen increased | FAERS: 1 | US FAERS | |
| 1084 | Gamma-glutamyltransferase decreased | FAERS: 1 | US FAERS | |
| 1085 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 1086 | Gastric infection | FAERS: 1 | US FAERS | |
| 1087 | Gastrocardiac syndrome | FAERS: 1 | US FAERS | |
| 1088 | Gastroduodenitis | FAERS: 1 | US FAERS | |
| 1089 | Gastrointestinal angiodysplasia haemorrhagic | FAERS: 1 | US FAERS | |
| 1090 | Gastrointestinal angiodysplasia | FAERS: 1 | US FAERS | |
| 1091 | Gastrointestinal bacterial infection | FAERS: 1 | US FAERS | |
| 1092 | General symptom | FAERS: 1 | US FAERS | |
| 1093 | Gestational Diabetes | FAERS: 1 | US FAERS | |
| 1094 | Gigantism | FAERS: 1 | US FAERS | |
| 1095 | Gingival Recession | FAERS: 1 | US FAERS | |
| 1096 | Glasgow coma scale abnormal | FAERS: 1 | US FAERS | |
| 1097 | Glioblastoma | FAERS: 1 | US FAERS | |
| 1098 | Glossitis | FAERS: 1 | US FAERS | |
| 1099 | Grip strength decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1100 | Hearing disability | FAERS: 1 | US FAERS | |
| 1101 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 1102 | Hepatic artery thrombosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1103 | Hepatic venous pressure gradient | FAERS: 1 | US FAERS | |
| 1104 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 1105 | Hernial eventration | FAERS: 1 | US FAERS | |
| 1106 | Hippocampal sclerosis | FAERS: 1 | US FAERS | |
| 1107 | Human epidermal growth factor receptor decreased | FAERS: 1 | US FAERS | |
| 1108 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 1109 | Hyperaldosteronism | FAERS: 1 | US FAERS | |
| 1110 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 1111 | Hypertensive emergency | FAERS: 1 | US FAERS | |
| 1112 | Hypoperfusion | FAERS: 1 | US FAERS | |
| 1113 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 1114 | Idiosyncratic drug reaction | FAERS: 1 | US FAERS | |
| 1115 | Ileal ulcer | FAERS: 1 | US FAERS | |
| 1116 | Iliac artery occlusion | FAERS: 1 | US FAERS | |
| 1117 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 1118 | Immunosuppression | FAERS: 1 | US FAERS | |
| 1119 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 1120 | Implant site pain | FAERS: 1 | US FAERS | |
| 1121 | Incision site abscess | FAERS: 1 | US FAERS | |
| 1122 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 1123 | Incorrect product formulation administered | FAERS: 1 | US FAERS | |
| 1124 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 1125 | Increased viscosity of upper respiratory secretion | FAERS: 1 | US FAERS | |
| 1126 | Infectious peritonitis | FAERS: 1 | US FAERS | |
| 1127 | Infusion site erythema | FAERS: 1 | US FAERS | |
| 1128 | Infusion site pain | FAERS: 1 | US FAERS | |
| 1129 | Injection site atrophy | FAERS: 1 | US FAERS | |
| 1130 | Injection site coldness | FAERS: 1 | US FAERS | |
| 1131 | Injection site cyst | FAERS: 1 | US FAERS | |
| 1132 | Injection site discharge | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1133 | Injection site fibrosis | FAERS: 1 | US FAERS | |
| 1134 | Injection site scab | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1135 | Injection site streaking | FAERS: 1 | US FAERS | |
| 1136 | Injection site vesicles | FAERS: 1 | US FAERS | |
| 1137 | Insulin Resistance | FAERS: 1 | US FAERS | |
| 1138 | Insulin tolerance test abnormal | FAERS: 1 | US FAERS | |
| 1139 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 1140 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 1141 | Intercepted product administration error | FAERS: 1 | US FAERS | |
| 1142 | Intercepted product storage error | FAERS: 1 | US FAERS | |
| 1143 | Intestinal scarring | FAERS: 1 | US FAERS | |
| 1144 | Intestinal varices | FAERS: 1 | US FAERS | |
| 1145 | Intraductal papillary mucinous neoplasm | FAERS: 1 | US FAERS | |
| 1146 | Intubation | FAERS: 1 | US FAERS | |
| 1147 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 1148 | Keratoconjunctivitis Sicca | FAERS: 1 | US FAERS | |
| 1149 | Ketonuria | FAERS: 1 | US FAERS | |
| 1150 | Large intestinal stenosis | FAERS: 1 | US FAERS | |
| 1151 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 1152 | Laryngitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1153 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 1154 | Life expectancy shortened | FAERS: 1 | US FAERS | |
| 1155 | Limb mass | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1156 | Lipodystrophy acquired | FAERS: 1 | US FAERS | |
| 1157 | Liver scan abnormal | FAERS: 1 | US FAERS | |
| 1158 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 1159 | Lower Urinary Tract Symptoms | FAERS: 1 | US FAERS | |
| 1160 | Lumbar puncture abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1161 | Lymph Node Tuberculosis | FAERS: 1 | US FAERS | |
| 1162 | Lymphatic system neoplasm | FAERS: 1 | US FAERS | |
| 1163 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 1164 | Lymphoid tissue hyperplasia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1165 | Lymphostasis | FAERS: 1 | US FAERS | |
| 1166 | Malignant Bowel Obstruction | FAERS: 1 | US FAERS | |
| 1167 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 1168 | Malignant breast lump removal | FAERS: 1 | US FAERS | |
| 1169 | Malignant mesenteric neoplasm | FAERS: 1 | US FAERS | |
| 1170 | Malignant neoplasm of spinal cord | FAERS: 1 | US FAERS | |
| 1171 | Mass excision | FAERS: 1 | US FAERS | |
| 1172 | Mastectomy | FAERS: 1 | US FAERS | |
| 1173 | Mediastinal mass | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1174 | Melanosis coli | FAERS: 1 | US FAERS | |
| 1175 | Meniscus injury | FAERS: 1 | US FAERS | |
| 1176 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 1177 | Mesenteric lymphadenopathy | FAERS: 1 | US FAERS | |
| 1178 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 1179 | Metastases to gallbladder | FAERS: 1 | US FAERS | |
| 1180 | Metastases to muscle | FAERS: 1 | US FAERS | |
| 1181 | Metastases to salivary gland | FAERS: 1 | US FAERS | |
| 1182 | Metastatic pain | FAERS: 1 | US FAERS | |
| 1183 | Metatarsalgia | FAERS: 1 | US FAERS | |
| 1184 | Microcytosis | FAERS: 1 | US FAERS | |
| 1185 | Miliaria | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1186 | Moaning | FAERS: 1 | US FAERS | |
| 1187 | Mucosal erosion | FAERS: 1 | US FAERS | |
| 1188 | Multiple sclerosis relapse | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1189 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 1190 | Muscle abscess | FAERS: 1 | US FAERS | |
| 1191 | Muscular Dystrophy | FAERS: 1 | US FAERS | |
| 1192 | Mycoplasma test positive | FAERS: 1 | US FAERS | |
| 1193 | Myelofibrosis | FAERS: 1 | US FAERS | |
| 1194 | Myoclonus | FAERS: 1 | US FAERS | |
| 1195 | Myopia | FAERS: 1 | US FAERS | |
| 1196 | Necrolytic Migratory Erythema | FAERS: 1 | US FAERS | |
| 1197 | Nephrocalcinosis | FAERS: 1 | US FAERS | |
| 1198 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 1199 | Nerve Root Compression | FAERS: 1 | US FAERS | |
| 1200 | Neuroendocrine cell hyperplasia of infancy | FAERS: 1 | US FAERS | |
| 1201 | Noninfective encephalitis | FAERS: 1 | US FAERS | |
| 1202 | Noninfective gingivitis | FAERS: 1 | US FAERS | |
| 1203 | Nonspecific reaction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1204 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 1205 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 1206 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 1207 | Oral discharge | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1208 | Orchitis | FAERS: 1 | US FAERS | |
| 1209 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 1210 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 1211 | Oropharyngeal swelling | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1212 | Osteitis | FAERS: 1 | US FAERS | |
| 1213 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 1214 | Palmar erythema | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1215 | Palpatory finding abnormal | FAERS: 1 | US FAERS | |
| 1216 | Pancreastatin increased | FAERS: 1 | US FAERS | |
| 1217 | Pancreatic Pseudocyst | FAERS: 1 | US FAERS | |
| 1218 | Pancreatic leak | FAERS: 1 | US FAERS | |
| 1219 | Pancreatitis bacterial | FAERS: 1 | US FAERS | |
| 1220 | Panniculitis | FAERS: 1 | US FAERS | |
| 1221 | Papilloma | FAERS: 1 | US FAERS | |
| 1222 | Papule | FAERS: 1 | US FAERS | |
| 1223 | Paraneoplastic retinopathy | FAERS: 1 | US FAERS | |
| 1224 | Paraparesis | FAERS: 1 | US FAERS | |
| 1225 | Parathyroid hormone-related protein increased | FAERS: 1 | US FAERS | |
| 1226 | Parotitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1227 | Paternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 1228 | Pelvic fluid collection | FAERS: 1 | US FAERS | |
| 1229 | Perineal pain | FAERS: 1 | US FAERS | |
| 1230 | Periorbital contusion | FAERS: 1 | US FAERS | |
| 1231 | Peripancreatic fluid collection | FAERS: 1 | US FAERS | |
| 1232 | Peripheral artery thrombosis | FAERS: 1 | US FAERS | |
| 1233 | Peritoneal lesion | FAERS: 1 | US FAERS | |
| 1234 | Periumbilical abscess | FAERS: 1 | US FAERS | |
| 1235 | Petechiae | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1236 | Photosensitivity allergic reaction | FAERS: 1 | US FAERS | |
| 1237 | Placental Insufficiency | FAERS: 1 | US FAERS | |
| 1238 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 1239 | Pleural Infection | FAERS: 1 | US FAERS | |
| 1240 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 1241 | Pneumococcal sepsis | FAERS: 1 | US FAERS | |
| 1242 | Poisoning | FAERS: 1 | US FAERS | |
| 1243 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 1244 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 1245 | Postoperative adhesion | FAERS: 1 | US FAERS | |
| 1246 | Postural Orthostatic Tachycardia Syndrome | FAERS: 1 | US FAERS | |
| 1247 | Priapism | FAERS: 1 | US FAERS | |
| 1248 | Primary Hyperthyroidism | FAERS: 1 | US FAERS | |
| 1249 | Procedural dizziness | FAERS: 1 | US FAERS | |
| 1250 | Product complaint | FAERS: 1 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 1251 | Product contamination | FAERS: 1 | US FAERS | |
| 1252 | Product dose omission | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1253 | Product prescribing error | FAERS: 1 | US FAERS | |
| 1254 | Product size issue | FAERS: 1 | US FAERS | |
| 1255 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 1256 | Prostatic cyst | FAERS: 1 | US FAERS | |
| 1257 | Prostatic varices | FAERS: 1 | US FAERS | |
| 1258 | Protein C Deficiency | FAERS: 1 | US FAERS | |
| 1259 | Protein Deficiency | FAERS: 1 | US FAERS | |
| 1260 | Pseudolymphoma | FAERS: 1 | US FAERS | |
| 1261 | Pubic pain | FAERS: 1 | US FAERS | |
| 1262 | Pulmonary Valve Stenosis | FAERS: 1 | US FAERS | |
| 1263 | Puncture site reaction | FAERS: 1 | US FAERS | |
| 1264 | Purulent discharge | FAERS: 1 | US FAERS | |
| 1265 | Pyoderma Gangrenosum | FAERS: 1 | US FAERS | |
| 1266 | Q Fever | FAERS: 1 | US FAERS | |
| 1267 | Quadranopia | FAERS: 1 | US FAERS | |
| 1268 | Quadriplegia | FAERS: 1 | US FAERS | |
| 1269 | Radiation skin injury | FAERS: 1 | US FAERS | |
| 1270 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 1271 | Rectal polypectomy | FAERS: 1 | US FAERS | |
| 1272 | Reflux gastritis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1273 | Refusal of treatment by relative | FAERS: 1 | US FAERS | |
| 1274 | Regurgitation | FAERS: 1 | US FAERS | |
| 1275 | Renal Artery Stenosis | FAERS: 1 | US FAERS | |
| 1276 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 1277 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 1278 | Respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 1279 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 1280 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 1281 | Retinoblastoma | FAERS: 1 | US FAERS | |
| 1282 | Rickets | FAERS: 1 | US FAERS | |
| 1283 | Scotoma | FAERS: 1 | US FAERS | |
| 1284 | Screaming | FAERS: 1 | US FAERS | |
| 1285 | Secretory adenoma of pituitary | FAERS: 1 | US FAERS | |
| 1286 | Seroma | FAERS: 1 | US FAERS | |
| 1287 | Sight disability | FAERS: 1 | US FAERS | |
| 1288 | Single functional kidney | FAERS: 1 | US FAERS | |
| 1289 | Sinus headache | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1290 | Sinus pain | FAERS: 1 | US FAERS | |
| 1291 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 1292 | Skin necrosis | FAERS: 1 | US FAERS | |
| 1293 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 1294 | Small Intestinal Stenosis | FAERS: 1 | US FAERS | |
| 1295 | Smooth muscle cell neoplasm | FAERS: 1 | US FAERS | |
| 1296 | Soft tissue mass | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1297 | Sphincter of Oddi Dysfunction | FAERS: 1 | US FAERS | |
| 1298 | Spinal column injury | FAERS: 1 | US FAERS | |
| 1299 | Spinal cord infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1300 | Splenic necrosis | FAERS: 1 | US FAERS | |
| 1301 | Splenic neoplasm malignancy unspecified | FAERS: 1 | US FAERS | |
| 1302 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 1303 | Stenosis | FAERS: 1 | US FAERS | |
| 1304 | Stent malfunction | FAERS: 1 | US FAERS | |
| 1305 | Stoma complication | FAERS: 1 | US FAERS | |
| 1306 | Stoma site pain | FAERS: 1 | US FAERS | |
| 1307 | Strabismus | FAERS: 1 | US FAERS | |
| 1308 | Streptococcus test positive | FAERS: 1 | US FAERS | |
| 1309 | Stroke in evolution | FAERS: 1 | US FAERS | |
| 1310 | Superior Vena Cava Syndrome | FAERS: 1 | US FAERS | |
| 1311 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 1312 | Surgical Stapling | FAERS: 1 | US FAERS | |
| 1313 | Suture rupture | FAERS: 1 | US FAERS | |
| 1314 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 1315 | Teeth brittle | FAERS: 1 | US FAERS | |
| 1316 | Therapeutic product contamination | FAERS: 1 | US FAERS | |
| 1317 | Therapeutic product effect decreased | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 1318 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 1319 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 1320 | Thyroglobulin increased | FAERS: 1 | US FAERS | |
| 1321 | Thyroid cancer metastatic | FAERS: 1 | US FAERS | |
| 1322 | Tinea cruris | FAERS: 1 | US FAERS | |
| 1323 | Tongue biting | FAERS: 1 | US FAERS | |
| 1324 | Transfusion-related circulatory overload | FAERS: 1 | US FAERS | |
| 1325 | Traumatic fracture | FAERS: 1 | US FAERS | |
| 1326 | Trichodynia | FAERS: 1 | US FAERS | |
| 1327 | Tricuspid valve thickening | FAERS: 1 | US FAERS | |
| 1328 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 1329 | Trousseau's syndrome | FAERS: 1 | US FAERS | |
| 1330 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 1331 | Upper airway obstruction | FAERS: 1 | US FAERS | |
| 1332 | Upper respiratory tract congestion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1333 | Ureteral stent insertion | FAERS: 1 | US FAERS | |
| 1334 | Urinary bladder polyp | FAERS: 1 | US FAERS | |
| 1335 | Uveitis | FAERS: 1 | US FAERS | |
| 1336 | Vascular encephalopathy | FAERS: 1 | US FAERS | |
| 1337 | Vascular procedure complication | FAERS: 1 | US FAERS | |
| 1338 | Vascular pseudoaneurysm ruptured | FAERS: 1 | US FAERS | |
| 1339 | Vascular rupture | FAERS: 1 | US FAERS | |
| 1340 | Vasospasm | FAERS: 1 | US FAERS | |
| 1341 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 1342 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 1343 | Vertebral foraminal stenosis | FAERS: 1 | US FAERS | |
| 1344 | Vipoma | FAERS: 1 | US FAERS | |
| 1345 | Vitamin E Deficiency | FAERS: 1 | US FAERS | |
| 1346 | Vitrectomy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1347 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 1348 | Wheelchair user | FAERS: 1 | US FAERS | |
| 1349 | Wound infection bacterial | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1350 | Wound infection staphylococcal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1351 | Wrong patient received product | FAERS: 1 | US FAERS | |
| 1352 | Xanthopsia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1353 | heart rate | FAERS: 1 | US FAERS | |
| 1354 | jejunitis | FAERS: 1 | US FAERS | |
| 1355 | keratoacanthoma | FAERS: 1 | US FAERS | |
| 1356 | kyphosis | FAERS: 1 | US FAERS | |
| 1357 | prostatitis | FAERS: 1 | US FAERS | |
| 1358 | Amyotrophic Lateral Sclerosis | Canada Vigilance: 1 | Canada Vigilance | |
| 1359 | Anosmia | Canada Vigilance: 1 | Canada Vigilance | |
| 1360 | Biloma | Canada Vigilance: 1 | Canada Vigilance | |
| 1361 | Blood calcitonin increased | Canada Vigilance: 1 | Canada Vigilance | |
| 1362 | Clostridium difficile colitis | Canada Vigilance: 1 | Canada Vigilance | |
| 1363 | Complication associated with device | Canada Vigilance: 1 | Canada Vigilance | |
| 1364 | Epicondylitis | Canada Vigilance: 1 | Canada Vigilance | |
| 1365 | Gastrointestinal stenosis | Canada Vigilance: 1 | Canada Vigilance | |
| 1366 | Hepatobiliary procedural complication | Canada Vigilance: 1 | Canada Vigilance | |
| 1367 | Incorrect product administration duration | Canada Vigilance: 1 | Canada Vigilance | |
| 1368 | Loss of personal independence in daily activities | Canada Vigilance: 1 | Canada Vigilance | |
| 1369 | Pancreaticoduodenectomy | Canada Vigilance: 1 | Canada Vigilance | |
| 1370 | Peripheral artery occlusion | Canada Vigilance: 1 | Canada Vigilance | |
| 1371 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 1372 | Product preparation issue | Canada Vigilance: 1 | Canada Vigilance | |
| 1373 | Product selection error | Canada Vigilance: 1 | Canada Vigilance | |
| 1374 | Sedation complication | Canada Vigilance: 1 | Canada Vigilance | |
| 1375 | Skin laceration | Canada Vigilance: 1 | Canada Vigilance | |
| 1376 | Skin neoplasm excision | Canada Vigilance: 1 | Canada Vigilance | |
| 1377 | Spinal Stenosis | Canada Vigilance: 1 | Canada Vigilance | |
| 1378 | Swelling of eyelid | Canada Vigilance: 1 | Canada Vigilance | |
| 1379 | Tachyphylaxis | Canada Vigilance: 1 | Canada Vigilance | |
| 1380 | Ultrasound abdomen abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 1381 | White Coat Hypertension | Canada Vigilance: 1 | Canada Vigilance | |
| 1382 | skin abrasion | Canada Vigilance: 2 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.