Varenicline
(TWYFGYXQSYOKLK-LREBCSMRSA-N)
Structure
- SMILES
- N1CC2CC(C1)c1c2cc2c(c1)nccn2.O[C@H]([C@H](C(=O)O)O)C(=O)O
- Molecular Formula:
- C17H19N3O6
- Molecular Weight:
- 361.349
- Log P:
- 0.0101
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 5
- TPSA:
- 152.87
- CAS Number(s):
- 375815-87-5
Synonym(s)
1.
Varenicline
2.
6,7,8,9-Tetrahydro-6,10-methano-6H-pyrazino(2,3-h)benzazepine
3.
Champix
4.
Chantix
5.
Varenicline Tartrate
External Link(s)
| MeSH | D000068580 |
| PubChem Compound | 9906942 |
| ChEBI | 84507 |
| CHEMBL | CHEMBL1201135 |
| KEGG | dr:D06282 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 7059 Canada Vigilance: 156 | Canada Vigilance US FAERS | |
| 2 | Anxiety | FAERS: 4374 Canada Vigilance: 104 | Canada Vigilance US FAERS | |
| 3 | Drug ineffective | FAERS: 3084 Canada Vigilance: 139 | Canada Vigilance US FAERS | |
| 4 | Suicide attempt | FAERS: 2360 Canada Vigilance: 20 | Canada Vigilance US FAERS | |
| 5 | Malaise | FAERS: 2268 Canada Vigilance: 36 | Canada Vigilance US FAERS | |
| 6 | Feeling abnormal | FAERS: 2193 Canada Vigilance: 64 | Canada Vigilance US FAERS | |
| 7 | Headache | FAERS: 2029 Canada Vigilance: 70 | Canada Vigilance US FAERS | |
| 8 | Vomiting | FAERS: 1868 Canada Vigilance: 58 | Canada Vigilance US FAERS | |
| 9 | Anger | FAERS: 1575 Canada Vigilance: 102 | Canada Vigilance US FAERS | |
| 10 | Dizziness | FAERS: 1394 Canada Vigilance: 58 | Canada Vigilance US FAERS | |
| 11 | Fatigue | FAERS: 1325 Canada Vigilance: 72 | Canada Vigilance US FAERS | |
| 12 | Agitation | FAERS: 1305 Canada Vigilance: 74 | Canada Vigilance US FAERS | |
| 13 | Mood swings | FAERS: 1037 Canada Vigilance: 39 | Canada Vigilance US FAERS | |
| 14 | Constipation | FAERS: 953 Canada Vigilance: 29 | Canada Vigilance US FAERS | |
| 15 | Completed Suicide | FAERS: 945 Canada Vigilance: 25 | Canada Vigilance US FAERS | |
| 16 | Abdominal discomfort | FAERS: 898 Canada Vigilance: 24 | Canada Vigilance US FAERS | |
| 17 | Depressed mood | FAERS: 858 Canada Vigilance: 65 | Canada Vigilance US FAERS | |
| 18 | Dysgeusia | FAERS: 818 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 19 | Somnolence | FAERS: 745 Canada Vigilance: 34 | Canada Vigilance US FAERS | |
| 20 | Flatulence | FAERS: 708 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 21 | Paranoia | FAERS: 701 Canada Vigilance: 21 | Canada Vigilance US FAERS | |
| 22 | Crying | FAERS: 669 Canada Vigilance: 49 | Canada Vigilance US FAERS | |
| 23 | Weight decreased | FAERS: 667 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 24 | Nervousness | FAERS: 635 Canada Vigilance: 28 | Canada Vigilance US FAERS | |
| 25 | Amnesia | FAERS: 634 Canada Vigilance: 33 | Canada Vigilance US FAERS | |
| 26 | Chest Pain | FAERS: 585 Canada Vigilance: 20 | Canada Vigilance US FAERS | |
| 27 | Memory impairment | FAERS: 559 Canada Vigilance: 18 | Canada Vigilance US FAERS | |
| 28 | Pain | FAERS: 543 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 29 | Stress | FAERS: 509 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 30 | Emotional disorder | FAERS: 487 Canada Vigilance: 27 | Canada Vigilance US FAERS | |
| 31 | Pruritus | FAERS: 480 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 32 | Tremor | FAERS: 471 Canada Vigilance: 21 | Canada Vigilance US FAERS | |
| 33 | Palpitations | FAERS: 464 Canada Vigilance: 25 | Canada Vigilance US FAERS | |
| 34 | Emotional distress | FAERS: 457 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 35 | Arthralgia | FAERS: 448 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 36 | Asthenia | FAERS: 440 Canada Vigilance: 23 | Canada Vigilance US FAERS | |
| 37 | Personality Change | FAERS: 433 Canada Vigilance: 19 | Canada Vigilance US FAERS | |
| 38 | Bipolar Disorder | FAERS: 378 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 39 | Hypersensitivity | FAERS: 365 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 40 | Myocardial Infarction | FAERS: 356 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 41 | Tobacco user | FAERS: 350 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 42 | Impaired driving ability | FAERS: 333 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 43 | Therapeutic response unexpected | FAERS: 320 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 44 | Back Pain | FAERS: 317 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 45 | Abdominal Pain | FAERS: 315 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 46 | Myalgia | FAERS: 314 Canada Vigilance: 19 | Canada Vigilance US FAERS | |
| 47 | Dyspepsia | FAERS: 293 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 48 | Hostility | FAERS: 289 Canada Vigilance: 18 | Canada Vigilance US FAERS | |
| 49 | Activities of daily living impaired | FAERS: 285 | US FAERS | |
| 50 | Urticaria | FAERS: 284 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 51 | Impaired work ability | FAERS: 242 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 52 | Cerebrovascular accident | FAERS: 233 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 53 | Restlessness | FAERS: 227 Canada Vigilance: 15 | Canada Vigilance US FAERS | |
| 54 | Diabetes Mellitus | FAERS: 225 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 55 | Incorrect dose administered | FAERS: 218 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Disorientation | FAERS: 211 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 57 | Chest discomfort | FAERS: 210 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 58 | Lethargy | FAERS: 206 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 59 | Drug withdrawal syndrome | FAERS: 201 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 60 | Visual Impairment | FAERS: 198 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 61 | Pneumonia | FAERS: 192 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 62 | Unevaluable event | FAERS: 192 | US FAERS | |
| 63 | Blood glucose increased | FAERS: 186 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 64 | Poor quality sleep | FAERS: 185 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 65 | Vertigo | FAERS: 181 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 66 | Drug dose omission | FAERS: 175 | US FAERS | |
| 67 | Intentional product misuse | FAERS: 169 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 68 | Apathy | FAERS: 164 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 69 | Nasopharyngitis | FAERS: 164 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 70 | Erythema | FAERS: 162 Canada Vigilance: 15 | Canada Vigilance US FAERS | |
| 71 | Pre-existing condition improved | FAERS: 155 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 72 | Violence-related symptom | FAERS: 154 Canada Vigilance: 18 | Canada Vigilance US FAERS | |
| 73 | Hypersomnia | FAERS: 153 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 74 | Oropharyngeal pain | FAERS: 148 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 75 | Overdose | FAERS: 148 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 76 | Somnambulism | FAERS: 145 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Middle insomnia | FAERS: 144 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Chills | FAERS: 143 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 79 | Swelling | FAERS: 142 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 80 | No adverse event | FAERS: 141 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 81 | Tinnitus | FAERS: 139 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 82 | Influenza | FAERS: 133 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Intentional self-injury | FAERS: 133 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 84 | Ageusia | FAERS: 132 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 85 | Physical assault | FAERS: 129 | US FAERS | |
| 86 | Screaming | FAERS: 127 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 87 | Frustration | FAERS: 119 | US FAERS | |
| 88 | Syncope | FAERS: 119 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 89 | Feeling jittery | FAERS: 118 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 90 | Mental impairment | FAERS: 115 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 91 | Alopecia | FAERS: 113 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 92 | Bronchitis | FAERS: 109 | US FAERS | |
| 93 | nervous system disorder | FAERS: 107 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 94 | Neck Pain | FAERS: 106 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 95 | Asthma | FAERS: 101 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 96 | Euphoric mood | FAERS: 101 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 97 | Night sweats | FAERS: 99 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 98 | Post-Traumatic Stress Disorder | FAERS: 98 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 99 | Dehydration | FAERS: 95 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 100 | Medication Error | FAERS: 95 | US FAERS | |
| 101 | Psychiatric symptom | FAERS: 94 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 102 | Blood cholesterol increased | FAERS: 91 | US FAERS | |
| 103 | Eye pain | FAERS: 91 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 104 | Epilepsy | FAERS: 90 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 105 | Mental status changes | FAERS: 90 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 106 | Discomfort | FAERS: 86 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 107 | Anorexia | FAERS: 84 | US FAERS | |
| 108 | Drug Dependence | FAERS: 83 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 109 | Epistaxis | FAERS: 83 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 110 | Feeling Cold | FAERS: 82 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 111 | Joint swelling | FAERS: 82 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 112 | Musculoskeletal Pain | FAERS: 82 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 113 | Lip swelling | FAERS: 80 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 114 | Negative thoughts | FAERS: 80 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 115 | Renal pain | FAERS: 80 | US FAERS | |
| 116 | Retching | FAERS: 80 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 117 | Stomatitis | FAERS: 80 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 118 | Hypotension | FAERS: 79 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 119 | Burning sensation | FAERS: 77 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 120 | Dysuria | FAERS: 76 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 121 | Delirium | FAERS: 75 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 122 | Schizophrenia | FAERS: 74 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 123 | Dysphonia | FAERS: 73 | US FAERS | |
| 124 | Thirst | FAERS: 73 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 125 | Throat irritation | FAERS: 72 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 126 | Anosmia | FAERS: 70 | US FAERS | |
| 127 | Drug effect incomplete | FAERS: 70 | US FAERS | |
| 128 | Dysarthria | FAERS: 69 | US FAERS | |
| 129 | Pancreatitis | FAERS: 69 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 130 | Cold sweat | FAERS: 66 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 131 | Sinusitis | FAERS: 66 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 132 | Tachycardia | FAERS: 65 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 133 | Blindness | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 134 | Anhedonia | FAERS: 62 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 135 | Dissociation | FAERS: 62 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 136 | Erectile dysfunction | FAERS: 61 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 137 | Panic Disorder | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 138 | Diplopia | FAERS: 60 | US FAERS | |
| 139 | Drug administration error | FAERS: 59 | US FAERS | |
| 140 | Musculoskeletal stiffness | FAERS: 59 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 141 | Formication | FAERS: 58 | US FAERS | |
| 142 | Oropharyngeal blistering | FAERS: 58 | US FAERS | |
| 143 | Visual disturbance | FAERS: 58 | US FAERS | |
| 144 | Intentional drug misuse | FAERS: 57 | US FAERS | |
| 145 | Morbid thoughts | FAERS: 57 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 146 | Tension | FAERS: 57 | US FAERS | |
| 147 | Tobacco withdrawal symptoms | FAERS: 57 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 148 | Oral pain | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 149 | Adverse event | FAERS: 55 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 150 | Urinary tract infection | FAERS: 55 | US FAERS | |
| 151 | Altered state of consciousness | FAERS: 54 | US FAERS | |
| 152 | Arthropathy | FAERS: 54 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 153 | Back disorder | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Hyperphagia | FAERS: 54 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 155 | Impatience | FAERS: 54 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 156 | Infection | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 157 | Atrial Fibrillation | FAERS: 52 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 158 | Multiple Sclerosis | FAERS: 52 | US FAERS | |
| 159 | Eructation | FAERS: 51 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 160 | Bone pain | FAERS: 50 | US FAERS | |
| 161 | Drug dispensing error | FAERS: 50 | US FAERS | |
| 162 | Restless Legs Syndrome | FAERS: 50 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 163 | Thrombosis | FAERS: 50 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 164 | Angina Pectoris | FAERS: 49 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 165 | Hypoaesthesia facial | FAERS: 49 | US FAERS | |
| 166 | Alanine Aminotransferase Increased | FAERS: 48 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 167 | Cardiac Arrest | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 168 | Drug screen positive | FAERS: 48 | US FAERS | |
| 169 | Hunger | FAERS: 48 | US FAERS | |
| 170 | Inappropriate schedule of drug administration | FAERS: 48 | US FAERS | |
| 171 | Acne | FAERS: 47 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 172 | Bedridden | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 173 | Initial insomnia | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 174 | Psoriasis | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 175 | Aphasia | FAERS: 46 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 176 | Presyncope | FAERS: 46 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 177 | Nocturia | FAERS: 45 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 178 | Toothache | FAERS: 45 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 179 | Wheezing | FAERS: 45 | US FAERS | |
| 180 | Alcohol interaction | FAERS: 44 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 181 | Drug screen false positive | FAERS: 44 | US FAERS | |
| 182 | Dry skin | FAERS: 43 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 183 | Head discomfort | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 184 | Hypothyroidism | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 185 | Angioedema | FAERS: 42 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 186 | Circumstance or information capable of leading to medication error | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 187 | Nicotine Dependence | FAERS: 42 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 188 | Arthritis | FAERS: 41 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 189 | Lymphadenopathy | FAERS: 41 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 190 | Bipolar I disorder | FAERS: 40 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 191 | Joint injury | FAERS: 40 | US FAERS | |
| 192 | Abasia | FAERS: 39 | US FAERS | |
| 193 | Blood creatine phosphokinase increased | FAERS: 39 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 194 | Blood urine present | FAERS: 39 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 195 | Depressed Level of Consciousness | FAERS: 39 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 196 | Obsessive-Compulsive Disorder | FAERS: 39 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 197 | Tachyphrenia | FAERS: 39 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 198 | Gastritis | FAERS: 38 | US FAERS | |
| 199 | Intentional product use issue | FAERS: 38 | US FAERS | |
| 200 | Lower respiratory tract infection | FAERS: 37 | US FAERS | |
| 201 | Menorrhagia | FAERS: 37 | US FAERS | |
| 202 | Pallor | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 203 | Fracture | FAERS: 36 | US FAERS | |
| 204 | Joint stiffness | FAERS: 36 | US FAERS | |
| 205 | Acute myocardial infarction | FAERS: 35 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 206 | Alcohol abuse | FAERS: 35 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 207 | Aphagia | FAERS: 35 | US FAERS | |
| 208 | Depression suicidal | FAERS: 35 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 209 | Drug prescribing error | FAERS: 35 | US FAERS | |
| 210 | Feelings of worthlessness | FAERS: 35 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 211 | Polyuria | FAERS: 35 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 212 | Skin reaction | FAERS: 35 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 213 | Wrong technique in drug usage process | FAERS: 35 | US FAERS | |
| 214 | Blood glucose decreased | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 215 | Flat affect | FAERS: 34 | US FAERS | |
| 216 | Hepatitis | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 217 | Product use issue | FAERS: 34 | US FAERS | |
| 218 | Productive Cough | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 219 | Aspartate Aminotransferase Increased | FAERS: 33 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 220 | Bradyphrenia | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 221 | Conversion disorder | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 222 | Flushing | FAERS: 33 | US FAERS | |
| 223 | Food craving | FAERS: 33 | US FAERS | |
| 224 | Deafness | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 225 | Deep Vein Thrombosis | FAERS: 32 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 226 | Enuresis | FAERS: 32 | US FAERS | |
| 227 | Homicide | FAERS: 31 | US FAERS | |
| 228 | Rash erythematous | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 229 | Acute psychosis | FAERS: 30 | US FAERS | |
| 230 | Fibromyalgia | FAERS: 30 | US FAERS | |
| 231 | Hyperventilation | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 232 | Irritable Bowel Syndrome | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 233 | Limb injury | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 234 | Partner stress | FAERS: 30 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 235 | Pharyngolaryngeal Pain | FAERS: 30 | US FAERS | |
| 236 | Product quality issue | FAERS: 30 | US FAERS | |
| 237 | Pulmonary Embolism | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 238 | Stevens-Johnson Syndrome | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 239 | Neuralgia | FAERS: 29 | US FAERS | |
| 240 | Photophobia | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 241 | Rheumatoid Arthritis | FAERS: 29 | US FAERS | |
| 242 | Urinary Incontinence | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 243 | Aphthous Stomatitis | FAERS: 28 | US FAERS | |
| 244 | Blood triglycerides increased | FAERS: 28 | US FAERS | |
| 245 | Choking | FAERS: 28 | US FAERS | |
| 246 | Eye irritation | FAERS: 28 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 247 | General physical health deterioration | FAERS: 28 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 248 | Hypophagia | FAERS: 28 | US FAERS | |
| 249 | Musculoskeletal chest pain | FAERS: 28 | US FAERS | |
| 250 | Diabetes mellitus inadequate control | FAERS: 27 | US FAERS | |
| 251 | Hyperthyroidism | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 252 | Muscle tightness | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 253 | Urinary Retention | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 254 | Cerebral Infarction | FAERS: 26 | US FAERS | |
| 255 | Expired drug administered | FAERS: 26 | US FAERS | |
| 256 | Inflammation | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 257 | Nephrolithiasis | FAERS: 26 | US FAERS | |
| 258 | Obsessive thoughts | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 259 | Apparent death | FAERS: 25 | US FAERS | |
| 260 | Disease recurrence | FAERS: 25 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 261 | Gastrointestinal Pain | FAERS: 25 | US FAERS | |
| 262 | Polydipsia | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 263 | Sexual Dysfunction | FAERS: 25 | US FAERS | |
| 264 | Skin lesion | FAERS: 25 | US FAERS | |
| 265 | Sleep Talking | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 266 | Tongue blistering | FAERS: 25 | US FAERS | |
| 267 | VIIth nerve paralysis | FAERS: 25 | US FAERS | |
| 268 | Agoraphobia | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 269 | Gamma-Glutamyltransferase Increased | FAERS: 24 | US FAERS | |
| 270 | Laziness | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 271 | Performance status decreased | FAERS: 24 | US FAERS | |
| 272 | Aphonia | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 273 | Hallucinations, mixed | FAERS: 23 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 274 | Hypokinesia | FAERS: 23 | US FAERS | |
| 275 | Infarction | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 276 | Limb discomfort | FAERS: 23 | US FAERS | |
| 277 | Peripheral swelling | FAERS: 23 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 278 | Alcohol poisoning | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 279 | Asphyxia | FAERS: 22 | US FAERS | |
| 280 | Blood potassium decreased | FAERS: 22 | US FAERS | |
| 281 | Dependence | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 282 | Gastric ulcer | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 283 | Hernia | FAERS: 22 | US FAERS | |
| 284 | Metrorrhagia | FAERS: 22 | US FAERS | |
| 285 | Rhabdomyolysis | FAERS: 22 | US FAERS | |
| 286 | Therapeutic response changed | FAERS: 22 | US FAERS | |
| 287 | Blood pressure fluctuation | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 288 | Chromaturia | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 289 | Dermatitis | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 290 | Drug abuse | FAERS: 21 | US FAERS | |
| 291 | Dysphemia | FAERS: 21 | US FAERS | |
| 292 | Expired product administered | FAERS: 21 | US FAERS | |
| 293 | Feeling of body temperature change | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 294 | Laceration | FAERS: 21 | US FAERS | |
| 295 | Ear discomfort | FAERS: 20 | US FAERS | |
| 296 | Ileus | FAERS: 20 | US FAERS | |
| 297 | Pharyngitis | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 298 | Respiratory Failure | FAERS: 20 | US FAERS | |
| 299 | Thermal burn | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 300 | Ulcer | FAERS: 20 | US FAERS | |
| 301 | Abnormal sleep-related event | FAERS: 19 | US FAERS | |
| 302 | Cataract | FAERS: 19 | US FAERS | |
| 303 | Catatonia | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 304 | Cystitis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 305 | Dementia | FAERS: 19 | US FAERS | |
| 306 | Drug exposure during pregnancy | FAERS: 19 | US FAERS | |
| 307 | Incorrect drug administration duration | FAERS: 19 | US FAERS | |
| 308 | Nerve injury | FAERS: 19 | US FAERS | |
| 309 | Pain of skin | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 310 | Cardiac Flutter | FAERS: 18 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 311 | Colitis | FAERS: 18 | US FAERS | |
| 312 | Coronary Artery Disease | FAERS: 18 | US FAERS | |
| 313 | Drug effect delayed | FAERS: 18 | US FAERS | |
| 314 | Economic problem | FAERS: 18 | US FAERS | |
| 315 | Eczema | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 316 | Grip strength decreased | FAERS: 18 | US FAERS | |
| 317 | Hysterectomy | FAERS: 18 | US FAERS | |
| 318 | Increased upper airway secretion | FAERS: 18 | US FAERS | |
| 319 | Skin irritation | FAERS: 18 | US FAERS | |
| 320 | Skin laceration | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 321 | Sluggishness | FAERS: 18 | US FAERS | |
| 322 | Ventricular Fibrillation | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 323 | Ankle Fracture | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 324 | Blood potassium increased | FAERS: 17 | US FAERS | |
| 325 | Dysgraphia | FAERS: 17 | US FAERS | |
| 326 | Gingivitis | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 327 | Inappropriate affect | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 328 | Incoherent | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 329 | Poisoning | FAERS: 17 | US FAERS | |
| 330 | Wrong technique in product usage process | FAERS: 17 | US FAERS | |
| 331 | Aneurysm | FAERS: 16 | US FAERS | |
| 332 | Cyanosis | FAERS: 16 | US FAERS | |
| 333 | Flight of ideas | FAERS: 16 | US FAERS | |
| 334 | Laryngitis | FAERS: 16 | US FAERS | |
| 335 | Musculoskeletal discomfort | FAERS: 16 | US FAERS | |
| 336 | Quality of life decreased | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 337 | Schizoaffective Disorder | FAERS: 16 | US FAERS | |
| 338 | Smoker | FAERS: 16 | US FAERS | |
| 339 | Supraventricular tachycardia | FAERS: 16 | US FAERS | |
| 340 | Vasculitis | FAERS: 16 | US FAERS | |
| 341 | Glossitis | FAERS: 15 | US FAERS | |
| 342 | Muscle strain | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 343 | Mydriasis | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 344 | Rotator cuff syndrome | FAERS: 15 | US FAERS | |
| 345 | Sudden death | FAERS: 15 | US FAERS | |
| 346 | Urine output increased | FAERS: 15 | US FAERS | |
| 347 | Blood glucose abnormal | FAERS: 14 | US FAERS | |
| 348 | Bowel movement irregularity | FAERS: 14 | US FAERS | |
| 349 | Cerebral disorder | FAERS: 14 | US FAERS | |
| 350 | Electrocardiogram abnormal | FAERS: 14 | US FAERS | |
| 351 | Hypomania | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 352 | Intestinal Obstruction | FAERS: 14 | US FAERS | |
| 353 | Loss of personal independence in daily activities | FAERS: 14 Canada Vigilance: 15 | Canada Vigilance US FAERS | |
| 354 | Maternal exposure during pregnancy | FAERS: 14 | US FAERS | |
| 355 | Product dose omission | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 356 | Pulmonary congestion | FAERS: 14 | US FAERS | |
| 357 | Sunburn | FAERS: 14 | US FAERS | |
| 358 | Throat cancer | FAERS: 14 | US FAERS | |
| 359 | Unresponsive to stimuli | FAERS: 14 | US FAERS | |
| 360 | Abstains from alcohol | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 361 | Bradycardia | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 362 | Bronchospasm | FAERS: 13 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 363 | Choking sensation | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 364 | Diverticulitis | FAERS: 13 | US FAERS | |
| 365 | Elevated mood | FAERS: 13 | US FAERS | |
| 366 | Epigastric discomfort | FAERS: 13 | US FAERS | |
| 367 | Erythema Multiforme | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 368 | Exfoliative rash | FAERS: 13 | US FAERS | |
| 369 | Facial Pain | FAERS: 13 | US FAERS | |
| 370 | Hypoventilation | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 371 | Monoplegia | FAERS: 13 | US FAERS | |
| 372 | Nasal discomfort | FAERS: 13 | US FAERS | |
| 373 | Respiratory arrest | FAERS: 13 | US FAERS | |
| 374 | Staring | FAERS: 13 | US FAERS | |
| 375 | Boredom | FAERS: 12 | US FAERS | |
| 376 | Bruxism | FAERS: 12 | US FAERS | |
| 377 | Dystonia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 378 | Gastric Bypass | FAERS: 12 | US FAERS | |
| 379 | Hemiparesis | FAERS: 12 | US FAERS | |
| 380 | Menopause | FAERS: 12 | US FAERS | |
| 381 | Myositis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 382 | Oral candidiasis | FAERS: 12 | US FAERS | |
| 383 | Respiratory distress | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 384 | Sepsis | FAERS: 12 | US FAERS | |
| 385 | Toxicity to various agents | FAERS: 12 | US FAERS | |
| 386 | furuncle | FAERS: 12 | US FAERS | |
| 387 | jaundice | FAERS: 12 | US FAERS | |
| 388 | Alcohol Intolerance | FAERS: 11 | US FAERS | |
| 389 | Arthropod bite | FAERS: 11 | US FAERS | |
| 390 | Ataxia | FAERS: 11 | US FAERS | |
| 391 | Blood alcohol increased | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 392 | Cyst | FAERS: 11 | US FAERS | |
| 393 | Drug Tolerance | FAERS: 11 | US FAERS | |
| 394 | Gout | FAERS: 11 | US FAERS | |
| 395 | Hypoxia | FAERS: 11 | US FAERS | |
| 396 | Migraine with Aura | FAERS: 11 | US FAERS | |
| 397 | Ocular vascular disorder | FAERS: 11 | US FAERS | |
| 398 | Polyneuropathy | FAERS: 11 | US FAERS | |
| 399 | Product taste abnormal | FAERS: 11 | US FAERS | |
| 400 | Respiratory tract congestion | FAERS: 11 | US FAERS | |
| 401 | Skin Ulcer | FAERS: 11 | US FAERS | |
| 402 | Tension Headache | FAERS: 11 | US FAERS | |
| 403 | Thrombocytopenia | FAERS: 11 | US FAERS | |
| 404 | Tongue biting | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 405 | Transaminases increased | FAERS: 11 | US FAERS | |
| 406 | Trigeminal Neuralgia | FAERS: 11 | US FAERS | |
| 407 | Vitreous floaters | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 408 | Appendicitis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 409 | Asthenopia | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 410 | Atrioventricular Block | FAERS: 10 | US FAERS | |
| 411 | Bipolar II disorder | FAERS: 10 | US FAERS | |
| 412 | Blepharospasm | FAERS: 10 | US FAERS | |
| 413 | Blood creatinine increased | FAERS: 10 | US FAERS | |
| 414 | Blood urea increased | FAERS: 10 | US FAERS | |
| 415 | Borderline Personality Disorder | FAERS: 10 | US FAERS | |
| 416 | Breast tenderness | FAERS: 10 | US FAERS | |
| 417 | Cardiac discomfort | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 418 | Cataract operation | FAERS: 10 | US FAERS | |
| 419 | Delusional perception | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 420 | Disability | FAERS: 10 | US FAERS | |
| 421 | Frustration tolerance decreased | FAERS: 10 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 422 | Gambling | FAERS: 10 | US FAERS | |
| 423 | General physical condition abnormal | FAERS: 10 | US FAERS | |
| 424 | Guillain-Barre Syndrome | FAERS: 10 | US FAERS | |
| 425 | Hepatomegaly | FAERS: 10 | US FAERS | |
| 426 | Hormone level abnormal | FAERS: 10 | US FAERS | |
| 427 | Hypertensive crisis | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 428 | Immobile | FAERS: 10 | US FAERS | |
| 429 | Intracranial Aneurysm | FAERS: 10 | US FAERS | |
| 430 | Labyrinthitis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 431 | Ocular icterus | FAERS: 10 | US FAERS | |
| 432 | Physical abuse | FAERS: 10 | US FAERS | |
| 433 | Pneumothorax | FAERS: 10 | US FAERS | |
| 434 | Premenstrual syndrome | FAERS: 10 | US FAERS | |
| 435 | Rectal tenesmus | FAERS: 10 | US FAERS | |
| 436 | Sinus headache | FAERS: 10 | US FAERS | |
| 437 | Sjogren's Syndrome | FAERS: 10 | US FAERS | |
| 438 | Vitamin D Deficiency | FAERS: 10 | US FAERS | |
| 439 | Aortic Aneurysm | FAERS: 9 | US FAERS | |
| 440 | Ascites | FAERS: 9 | US FAERS | |
| 441 | Blood sodium decreased | FAERS: 9 | US FAERS | |
| 442 | Carotid artery occlusion | FAERS: 9 | US FAERS | |
| 443 | Carpal Tunnel Syndrome | FAERS: 9 | US FAERS | |
| 444 | Claustrophobia | FAERS: 9 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 445 | Delusional disorder, persecutory type | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 446 | Diabetic Ketoacidosis | FAERS: 9 | US FAERS | |
| 447 | Disturbance in sexual arousal | FAERS: 9 | US FAERS | |
| 448 | Drooling | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 449 | Gangrene | FAERS: 9 | US FAERS | |
| 450 | Gastric mucosal lesion | FAERS: 9 | US FAERS | |
| 451 | Hypervigilance | FAERS: 9 | US FAERS | |
| 452 | Myocarditis | FAERS: 9 | US FAERS | |
| 453 | Pharmaceutical product complaint | FAERS: 9 | US FAERS | |
| 454 | Product dispensing error | FAERS: 9 | US FAERS | |
| 455 | Protein total decreased | FAERS: 9 | US FAERS | |
| 456 | Psychiatric decompensation | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 457 | Sinus Tachycardia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 458 | Skeletal injury | FAERS: 9 | US FAERS | |
| 459 | Sneezing | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 460 | White blood cell count decreased | FAERS: 9 | US FAERS | |
| 461 | Anaphylactic shock | FAERS: 8 | US FAERS | |
| 462 | Blood thyroid stimulating hormone increased | FAERS: 8 | US FAERS | |
| 463 | Candidiasis | FAERS: 8 | US FAERS | |
| 464 | Carbon Monoxide Poisoning | FAERS: 8 | US FAERS | |
| 465 | Conjunctivitis | FAERS: 8 | US FAERS | |
| 466 | Disease Progression | FAERS: 8 | US FAERS | |
| 467 | Excoriation | FAERS: 8 | US FAERS | |
| 468 | Gastrointestinal sounds abnormal | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 469 | Glaucoma | FAERS: 8 | US FAERS | |
| 470 | Histrionic Personality Disorder | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 471 | Hyperchlorhydria | FAERS: 8 | US FAERS | |
| 472 | Hypogeusia | FAERS: 8 | US FAERS | |
| 473 | Macular degeneration | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 474 | Motion Sickness | FAERS: 8 | US FAERS | |
| 475 | Mouth swelling | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 476 | Oropharyngeal discomfort | FAERS: 8 | US FAERS | |
| 477 | Overweight | FAERS: 8 | US FAERS | |
| 478 | Petechiae | FAERS: 8 | US FAERS | |
| 479 | Prescription drug used without a prescription | FAERS: 8 | US FAERS | |
| 480 | Pulmonary thrombosis | FAERS: 8 | US FAERS | |
| 481 | Retinal Detachment | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 482 | Snoring | FAERS: 8 | US FAERS | |
| 483 | Therapeutic product effect incomplete | FAERS: 8 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 484 | Abdominal rigidity | FAERS: 7 | US FAERS | |
| 485 | Accidental drug intake by child | FAERS: 7 | US FAERS | |
| 486 | Acute kidney injury | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 487 | Agitated depression | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 488 | Alopecia Areata | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 489 | Atrial Flutter | FAERS: 7 | US FAERS | |
| 490 | Auricular swelling | FAERS: 7 | US FAERS | |
| 491 | Belligerence | FAERS: 7 | US FAERS | |
| 492 | Blood alkaline phosphatase increased | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 493 | Cheilitis | FAERS: 7 | US FAERS | |
| 494 | Cholelithiasis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 495 | Delusional disorder, unspecified type | FAERS: 7 | US FAERS | |
| 496 | Dental caries | FAERS: 7 | US FAERS | |
| 497 | Duodenitis | FAERS: 7 | US FAERS | |
| 498 | Emotional poverty | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 499 | Erection increased | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 500 | Facial Paresis | FAERS: 7 | US FAERS | |
| 501 | Flank Pain | FAERS: 7 | US FAERS | |
| 502 | Gastroenteritis | FAERS: 7 | US FAERS | |
| 503 | Hepatitis C | FAERS: 7 | US FAERS | |
| 504 | Hyperacusis | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 505 | Intentional dose omission | FAERS: 7 | US FAERS | |
| 506 | Loose tooth | FAERS: 7 | US FAERS | |
| 507 | Loss of dreaming | FAERS: 7 | US FAERS | |
| 508 | Low density lipoprotein increased | FAERS: 7 | US FAERS | |
| 509 | Multiple drug overdose intentional | FAERS: 7 | US FAERS | |
| 510 | Ocular discomfort | FAERS: 7 | US FAERS | |
| 511 | Oral mucosal exfoliation | FAERS: 7 | US FAERS | |
| 512 | Physical disability | FAERS: 7 | US FAERS | |
| 513 | Poor peripheral circulation | FAERS: 7 | US FAERS | |
| 514 | Pregnancy | FAERS: 7 | US FAERS | |
| 515 | Product prescribing error | FAERS: 7 | US FAERS | |
| 516 | Pulmonary Fibrosis | FAERS: 7 | US FAERS | |
| 517 | Sexual abuse | FAERS: 7 | US FAERS | |
| 518 | Accidental exposure | FAERS: 6 | US FAERS | |
| 519 | Acute Coronary Syndrome | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 520 | Alcohol problem | FAERS: 6 | US FAERS | |
| 521 | Altered visual depth perception | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 522 | Bed rest | FAERS: 6 | US FAERS | |
| 523 | Bladder pain | FAERS: 6 | US FAERS | |
| 524 | Blood cholesterol abnormal | FAERS: 6 | US FAERS | |
| 525 | Blood pressure inadequately controlled | FAERS: 6 | US FAERS | |
| 526 | Breast Cyst | FAERS: 6 | US FAERS | |
| 527 | Gastric Dilatation | FAERS: 6 | US FAERS | |
| 528 | Grief reaction | FAERS: 6 | US FAERS | |
| 529 | Hemicephalalgia | FAERS: 6 | US FAERS | |
| 530 | Hypothalamo-pituitary disorder | FAERS: 6 | US FAERS | |
| 531 | Incontinence | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 532 | Intervertebral Disc Degeneration | FAERS: 6 | US FAERS | |
| 533 | Joint Range of Motion Decreased | FAERS: 6 | US FAERS | |
| 534 | Leukocytosis | FAERS: 6 | US FAERS | |
| 535 | Ligament rupture | FAERS: 6 | US FAERS | |
| 536 | Lyme Disease | FAERS: 6 | US FAERS | |
| 537 | Meningitis | FAERS: 6 | US FAERS | |
| 538 | Metamorphopsia | FAERS: 6 | US FAERS | |
| 539 | Muscle Rigidity | FAERS: 6 | US FAERS | |
| 540 | Myopathy | FAERS: 6 | US FAERS | |
| 541 | Obesity | FAERS: 6 | US FAERS | |
| 542 | Ocular Hypertension | FAERS: 6 | US FAERS | |
| 543 | Optic Neuritis | FAERS: 6 | US FAERS | |
| 544 | Osteoporosis | FAERS: 6 | US FAERS | |
| 545 | Peptic Ulcer | FAERS: 6 | US FAERS | |
| 546 | Phobia of driving | FAERS: 6 | US FAERS | |
| 547 | Piloerection | FAERS: 6 | US FAERS | |
| 548 | Product label issue | FAERS: 6 | US FAERS | |
| 549 | Pyelonephritis | FAERS: 6 | US FAERS | |
| 550 | Rhinalgia | FAERS: 6 | US FAERS | |
| 551 | Scab | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 552 | Secretion discharge | FAERS: 6 | US FAERS | |
| 553 | Sense of oppression | FAERS: 6 | US FAERS | |
| 554 | Shoplifting | FAERS: 6 | US FAERS | |
| 555 | Smoke sensitivity | FAERS: 6 | US FAERS | |
| 556 | Stress at work | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 557 | Stupor | FAERS: 6 | US FAERS | |
| 558 | Subileus | FAERS: 6 | US FAERS | |
| 559 | Sudden onset of sleep | FAERS: 6 | US FAERS | |
| 560 | Temperature intolerance | FAERS: 6 | US FAERS | |
| 561 | Tooth Loss | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 562 | Vaginal Discharge | FAERS: 6 | US FAERS | |
| 563 | Angioplasty | FAERS: 5 | US FAERS | |
| 564 | Autoimmune thyroiditis | FAERS: 5 | US FAERS | |
| 565 | Blood testosterone decreased | FAERS: 5 | US FAERS | |
| 566 | Brief psychotic disorder with marked stressors | FAERS: 5 | US FAERS | |
| 567 | Caffeine consumption | FAERS: 5 | US FAERS | |
| 568 | Cardiovascular insufficiency | FAERS: 5 | US FAERS | |
| 569 | Cellulitis | FAERS: 5 | US FAERS | |
| 570 | Chorea | FAERS: 5 | US FAERS | |
| 571 | Cluster Headache | FAERS: 5 | US FAERS | |
| 572 | Cytolytic hepatitis | FAERS: 5 | US FAERS | |
| 573 | Diverticulum | FAERS: 5 | US FAERS | |
| 574 | Ear congestion | FAERS: 5 | US FAERS | |
| 575 | Enteritis | FAERS: 5 | US FAERS | |
| 576 | False positive investigation result | FAERS: 5 | US FAERS | |
| 577 | Food Poisoning | FAERS: 5 | US FAERS | |
| 578 | Gastrointestinal motility disorder | FAERS: 5 | US FAERS | |
| 579 | Gastrointestinal obstruction | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 580 | Genital infection fungal | FAERS: 5 | US FAERS | |
| 581 | Glycosuria | FAERS: 5 | US FAERS | |
| 582 | Head titubation | FAERS: 5 | US FAERS | |
| 583 | Hemiplegia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 584 | Implantable defibrillator insertion | FAERS: 5 | US FAERS | |
| 585 | Left Ventricular Hypertrophy | FAERS: 5 | US FAERS | |
| 586 | Libido disorder | FAERS: 5 | US FAERS | |
| 587 | Limb operation | FAERS: 5 | US FAERS | |
| 588 | Mallory-Weiss Syndrome | FAERS: 5 | US FAERS | |
| 589 | Meningioma | FAERS: 5 | US FAERS | |
| 590 | Mutism | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 591 | Negativism | FAERS: 5 | US FAERS | |
| 592 | Nodule | FAERS: 5 | US FAERS | |
| 593 | Paranasal sinus hypersecretion | FAERS: 5 | US FAERS | |
| 594 | Parotitis | FAERS: 5 | US FAERS | |
| 595 | Pelvic Pain | FAERS: 5 | US FAERS | |
| 596 | Pericardial effusion | FAERS: 5 | US FAERS | |
| 597 | Pericarditis | FAERS: 5 | US FAERS | |
| 598 | Pleuritic pain | FAERS: 5 | US FAERS | |
| 599 | Priapism | FAERS: 5 | US FAERS | |
| 600 | Product packaging issue | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 601 | Product use in unapproved indication | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 602 | Proteinuria | FAERS: 5 | US FAERS | |
| 603 | Pulmonary Infarction | FAERS: 5 | US FAERS | |
| 604 | Regurgitation | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 605 | Rhinitis | FAERS: 5 | US FAERS | |
| 606 | Sciatica | FAERS: 5 | US FAERS | |
| 607 | Sinus bradycardia | FAERS: 5 | US FAERS | |
| 608 | Suspected counterfeit product | FAERS: 5 | US FAERS | |
| 609 | Therapy cessation | FAERS: 5 | US FAERS | |
| 610 | Tonsillectomy | FAERS: 5 | US FAERS | |
| 611 | Tonsillitis | FAERS: 5 | US FAERS | |
| 612 | Tooth Extraction | FAERS: 5 | US FAERS | |
| 613 | Tooth Infection | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 614 | Trismus | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 615 | Vitiligo | FAERS: 5 | US FAERS | |
| 616 | Abdominal tenderness | FAERS: 4 | US FAERS | |
| 617 | Accidental overdose | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 618 | Anaphylactoid Reaction | FAERS: 4 | US FAERS | |
| 619 | Anorgasmia | FAERS: 4 | US FAERS | |
| 620 | Anuria | FAERS: 4 | US FAERS | |
| 621 | Aversion | FAERS: 4 | US FAERS | |
| 622 | Blood blister | FAERS: 4 | US FAERS | |
| 623 | Blood carbon monoxide increased | FAERS: 4 | US FAERS | |
| 624 | Breast cancer stage III | FAERS: 4 | US FAERS | |
| 625 | Bulimia Nervosa | FAERS: 4 | US FAERS | |
| 626 | Cardiomegaly | FAERS: 4 | US FAERS | |
| 627 | Cerebral Thrombosis | FAERS: 4 | US FAERS | |
| 628 | Cholecystitis | FAERS: 4 | US FAERS | |
| 629 | Clumsiness | FAERS: 4 | US FAERS | |
| 630 | Dissociative disorder | FAERS: 4 | US FAERS | |
| 631 | Duodenal Ulcer | FAERS: 4 | US FAERS | |
| 632 | Dysentery | FAERS: 4 | US FAERS | |
| 633 | Ectopic Pregnancy | FAERS: 4 | US FAERS | |
| 634 | Educational problem | FAERS: 4 | US FAERS | |
| 635 | Eosinophilia | FAERS: 4 | US FAERS | |
| 636 | Ex-tobacco user | FAERS: 4 | US FAERS | |
| 637 | Extraocular Muscle Paresis | FAERS: 4 | US FAERS | |
| 638 | Eye Infection | FAERS: 4 | US FAERS | |
| 639 | Eye inflammation | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 640 | Food Allergy | FAERS: 4 | US FAERS | |
| 641 | Gallbladder pain | FAERS: 4 | US FAERS | |
| 642 | Gastrointestinal inflammation | FAERS: 4 | US FAERS | |
| 643 | Genital Herpes | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 644 | Genital rash | FAERS: 4 | US FAERS | |
| 645 | Impaired self-care | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 646 | Increased tendency to bruise | FAERS: 4 | US FAERS | |
| 647 | Intermittent Explosive Disorder | FAERS: 4 | US FAERS | |
| 648 | Intervertebral disc disorder | FAERS: 4 | US FAERS | |
| 649 | Ketoacidosis | FAERS: 4 | US FAERS | |
| 650 | Large intestine perforation | FAERS: 4 | US FAERS | |
| 651 | Lichen Planus | FAERS: 4 | US FAERS | |
| 652 | Lupus-like syndrome | FAERS: 4 | US FAERS | |
| 653 | Lymphoma | FAERS: 4 | US FAERS | |
| 654 | Morose | FAERS: 4 | US FAERS | |
| 655 | Multiple drug overdose | FAERS: 4 | US FAERS | |
| 656 | Multiple sclerosis relapse | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 657 | Muscle Fatigue | FAERS: 4 | US FAERS | |
| 658 | Narcolepsy | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 659 | Nephrotic Syndrome | FAERS: 4 | US FAERS | |
| 660 | Non-cardiac chest pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 661 | Nystagmus | FAERS: 4 | US FAERS | |
| 662 | Opiates positive | FAERS: 4 | US FAERS | |
| 663 | Parasomnia | FAERS: 4 | US FAERS | |
| 664 | Pelvic discomfort | FAERS: 4 | US FAERS | |
| 665 | Peripheral arterial occlusive disease | FAERS: 4 | US FAERS | |
| 666 | Polyarthritis | FAERS: 4 | US FAERS | |
| 667 | Polymyositis | FAERS: 4 | US FAERS | |
| 668 | Poor quality drug administered | FAERS: 4 | US FAERS | |
| 669 | Psychomotor skills impaired | FAERS: 4 | US FAERS | |
| 670 | Pulmonary Hypertension | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 671 | Rectal fissure | FAERS: 4 | US FAERS | |
| 672 | Renal Colic | FAERS: 4 | US FAERS | |
| 673 | SLE arthritis | FAERS: 4 | US FAERS | |
| 674 | Scotoma | FAERS: 4 | US FAERS | |
| 675 | Serotonin Syndrome | FAERS: 4 | US FAERS | |
| 676 | Spinal column stenosis | FAERS: 4 | US FAERS | |
| 677 | Spousal Abuse | FAERS: 4 | US FAERS | |
| 678 | Status Epilepticus | FAERS: 4 | US FAERS | |
| 679 | Sudden Cardiac Death | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 680 | Tetany | FAERS: 4 | US FAERS | |
| 681 | Thought insertion | FAERS: 4 | US FAERS | |
| 682 | Thyroid Neoplasm | FAERS: 4 | US FAERS | |
| 683 | Thyroiditis | FAERS: 4 | US FAERS | |
| 684 | Toxic Epidermal Necrolysis | FAERS: 4 | US FAERS | |
| 685 | Tracheitis | FAERS: 4 | US FAERS | |
| 686 | Trichotillomania | FAERS: 4 | US FAERS | |
| 687 | Urethral syndrome | FAERS: 4 | US FAERS | |
| 688 | Vascular rupture | FAERS: 4 | US FAERS | |
| 689 | Venous Insufficiency | FAERS: 4 | US FAERS | |
| 690 | Venous occlusion | FAERS: 4 | US FAERS | |
| 691 | Vocal Cord Paralysis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 692 | Walking aid user | FAERS: 4 | US FAERS | |
| 693 | White blood cell count abnormal | FAERS: 4 | US FAERS | |
| 694 | Wrong drug administered | FAERS: 4 | US FAERS | |
| 695 | ovarian neoplasm | FAERS: 4 | US FAERS | |
| 696 | Abdominal adhesions | FAERS: 3 | US FAERS | |
| 697 | Allergy to arthropod sting | FAERS: 3 | US FAERS | |
| 698 | Amphetamines positive | FAERS: 3 | US FAERS | |
| 699 | Anal Fissure | FAERS: 3 | US FAERS | |
| 700 | Angle Closure Glaucoma | FAERS: 3 | US FAERS | |
| 701 | Anorectal discomfort | FAERS: 3 | US FAERS | |
| 702 | Aortic occlusion | FAERS: 3 | US FAERS | |
| 703 | Arterial bypass operation | FAERS: 3 | US FAERS | |
| 704 | Autonomic nervous system imbalance | FAERS: 3 | US FAERS | |
| 705 | Blood albumin decreased | FAERS: 3 | US FAERS | |
| 706 | Blood alcohol abnormal | FAERS: 3 | US FAERS | |
| 707 | Blood amylase increased | FAERS: 3 | US FAERS | |
| 708 | Blood cholesterol | FAERS: 3 | US FAERS | |
| 709 | Blood ethanol increased | FAERS: 3 | US FAERS | |
| 710 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 711 | Blood thyroid stimulating hormone decreased | FAERS: 3 | US FAERS | |
| 712 | Blood urea nitrogen/creatinine ratio increased | FAERS: 3 | US FAERS | |
| 713 | Blunted affect | FAERS: 3 | US FAERS | |
| 714 | Brain Hypoxia | FAERS: 3 | US FAERS | |
| 715 | Breast discomfort | FAERS: 3 | US FAERS | |
| 716 | Bursitis | FAERS: 3 | US FAERS | |
| 717 | Carbon dioxide decreased | FAERS: 3 | US FAERS | |
| 718 | Central nervous system lesion | FAERS: 3 | US FAERS | |
| 719 | Cervix carcinoma | FAERS: 3 | US FAERS | |
| 720 | Complex partial seizures | FAERS: 3 | US FAERS | |
| 721 | Dark circles under eyes | FAERS: 3 | US FAERS | |
| 722 | Dengue Fever | FAERS: 3 | US FAERS | |
| 723 | Diet refusal | FAERS: 3 | US FAERS | |
| 724 | Dissociative Identity Disorder | FAERS: 3 | US FAERS | |
| 725 | Dreamy state | FAERS: 3 | US FAERS | |
| 726 | Drug clearance decreased | FAERS: 3 | US FAERS | |
| 727 | Drug level increased | FAERS: 3 | US FAERS | |
| 728 | Drug toxicity | FAERS: 3 | US FAERS | |
| 729 | Dysthymic Disorder | FAERS: 3 | US FAERS | |
| 730 | Electrocardiogram change | FAERS: 3 | US FAERS | |
| 731 | Embolism | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 732 | Endocarditis | FAERS: 3 | US FAERS | |
| 733 | Enzyme abnormality | FAERS: 3 | US FAERS | |
| 734 | Excessive eye blinking | FAERS: 3 | US FAERS | |
| 735 | Executive dysfunction | FAERS: 3 | US FAERS | |
| 736 | Eye Burns | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 737 | Eye laser surgery | FAERS: 3 | US FAERS | |
| 738 | Facial paralysis | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 739 | Feeding disorder neonatal | FAERS: 3 | US FAERS | |
| 740 | Foaming at mouth | FAERS: 3 | US FAERS | |
| 741 | Food aversion | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 742 | Foreign body sensation in eyes | FAERS: 3 | US FAERS | |
| 743 | Genital burning sensation | FAERS: 3 | US FAERS | |
| 744 | Gestational Diabetes | FAERS: 3 | US FAERS | |
| 745 | Gingival blister | FAERS: 3 | US FAERS | |
| 746 | Hanging | FAERS: 3 | US FAERS | |
| 747 | Hyperplasia | FAERS: 3 | US FAERS | |
| 748 | Impaired gastric emptying | FAERS: 3 | US FAERS | |
| 749 | Incorrect drug dosage form administered | FAERS: 3 | US FAERS | |
| 750 | Incorrect product administration duration | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 751 | Increased viscosity of bronchial secretion | FAERS: 3 | US FAERS | |
| 752 | Intercepted drug dispensing error | FAERS: 3 | US FAERS | |
| 753 | Intervertebral disc compression | FAERS: 3 | US FAERS | |
| 754 | Intraocular pressure test abnormal | FAERS: 3 | US FAERS | |
| 755 | Investigation abnormal | FAERS: 3 | US FAERS | |
| 756 | Keratitis | FAERS: 3 | US FAERS | |
| 757 | Ketonuria | FAERS: 3 | US FAERS | |
| 758 | Lack of spontaneous speech | FAERS: 3 | US FAERS | |
| 759 | Ligament injury | FAERS: 3 | US FAERS | |
| 760 | Lipase increased | FAERS: 3 | US FAERS | |
| 761 | Lobar Pneumonia | FAERS: 3 | US FAERS | |
| 762 | Lymphadenitis | FAERS: 3 | US FAERS | |
| 763 | Mastication disorder | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 764 | Multiple allergies | FAERS: 3 | US FAERS | |
| 765 | Myocardial necrosis marker increased | FAERS: 3 | US FAERS | |
| 766 | Nipple pain | FAERS: 3 | US FAERS | |
| 767 | No adverse reaction | FAERS: 3 | US FAERS | |
| 768 | Nuchal Rigidity | FAERS: 3 | US FAERS | |
| 769 | Obstruction | FAERS: 3 | US FAERS | |
| 770 | Open wound | FAERS: 3 | US FAERS | |
| 771 | Ophthalmoplegia | FAERS: 3 | US FAERS | |
| 772 | Oral infection | FAERS: 3 | US FAERS | |
| 773 | Oral pruritus | FAERS: 3 | US FAERS | |
| 774 | Osteogenesis Imperfecta | FAERS: 3 | US FAERS | |
| 775 | Otitis Externa | FAERS: 3 | US FAERS | |
| 776 | Otitis Media | FAERS: 3 | US FAERS | |
| 777 | Palatitis | FAERS: 3 | US FAERS | |
| 778 | Pancreatic Cyst | FAERS: 3 | US FAERS | |
| 779 | Parkinsonian crisis | FAERS: 3 | US FAERS | |
| 780 | Peritonitis | FAERS: 3 | US FAERS | |
| 781 | Phantom pain | FAERS: 3 | US FAERS | |
| 782 | Photodermatosis | FAERS: 3 | US FAERS | |
| 783 | Plastic surgery to the face | FAERS: 3 | US FAERS | |
| 784 | Pleurisy | FAERS: 3 | US FAERS | |
| 785 | Posterior reversible encephalopathy syndrome | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 786 | Premature Menopause | FAERS: 3 | US FAERS | |
| 787 | Protein urine present | FAERS: 3 | US FAERS | |
| 788 | Psychological abuse | FAERS: 3 | US FAERS | |
| 789 | Psychotic symptom | FAERS: 3 | US FAERS | |
| 790 | Purpura | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 791 | Purulent discharge | FAERS: 3 | US FAERS | |
| 792 | Rectal polyp | FAERS: 3 | US FAERS | |
| 793 | Respiratory Depression | FAERS: 3 | US FAERS | |
| 794 | Retinal Artery Occlusion | FAERS: 3 | US FAERS | |
| 795 | Scleroderma | FAERS: 3 | US FAERS | |
| 796 | Sensation of blood flow | FAERS: 3 | US FAERS | |
| 797 | Septic Shock | FAERS: 3 | US FAERS | |
| 798 | Sexual inhibition | FAERS: 3 | US FAERS | |
| 799 | Shock | FAERS: 3 | US FAERS | |
| 800 | Skin discomfort | FAERS: 3 | US FAERS | |
| 801 | Sleep Paralysis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 802 | Soliloquy | FAERS: 3 | US FAERS | |
| 803 | Spinal deformity correction | FAERS: 3 | US FAERS | |
| 804 | Splenomegaly | FAERS: 3 | US FAERS | |
| 805 | Spondylitis | FAERS: 3 | US FAERS | |
| 806 | Suprapubic pain | FAERS: 3 | US FAERS | |
| 807 | Tachyarrhythmia | FAERS: 3 | US FAERS | |
| 808 | Theft | FAERS: 3 | US FAERS | |
| 809 | Therapeutic product effect delayed | FAERS: 3 | US FAERS | |
| 810 | Therapeutic response delayed | FAERS: 3 | US FAERS | |
| 811 | Thoracic vertebral fracture | FAERS: 3 | US FAERS | |
| 812 | Tonic clonic movements | FAERS: 3 | US FAERS | |
| 813 | Trichorrhexis | FAERS: 3 | US FAERS | |
| 814 | Troponin T increased | FAERS: 3 | US FAERS | |
| 815 | Tuberculosis | FAERS: 3 | US FAERS | |
| 816 | Upper-airway cough syndrome | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 817 | Urine cotinine test positive | FAERS: 3 | US FAERS | |
| 818 | Ventricular arrhythmia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 819 | Viral upper respiratory tract infection | FAERS: 3 | US FAERS | |
| 820 | Waist circumference increased | FAERS: 3 | US FAERS | |
| 821 | Water Intoxication | FAERS: 3 | US FAERS | |
| 822 | Weight | FAERS: 3 | US FAERS | |
| 823 | Zinc deficiency | FAERS: 3 | US FAERS | |
| 824 | muscle injury | FAERS: 3 | US FAERS | |
| 825 | treatment failure | FAERS: 3 | US FAERS | |
| 826 | Abscess | FAERS: 2 | US FAERS | |
| 827 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 828 | Acquired Immunodeficiency Syndrome | FAERS: 2 | US FAERS | |
| 829 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 830 | Acute sinusitis | FAERS: 2 | US FAERS | |
| 831 | Adenocarcinoma | FAERS: 2 | US FAERS | |
| 832 | Adjustment disorder with depressed mood | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 833 | Adnexa uteri pain | FAERS: 2 | US FAERS | |
| 834 | Akathisia | FAERS: 2 | US FAERS | |
| 835 | Amyotrophic Lateral Sclerosis | FAERS: 2 | US FAERS | |
| 836 | Anosognosia | FAERS: 2 | US FAERS | |
| 837 | Aortic Injury | FAERS: 2 | US FAERS | |
| 838 | Autophobia | FAERS: 2 | US FAERS | |
| 839 | Avoidant Personality Disorder | FAERS: 2 | US FAERS | |
| 840 | Bankruptcy | FAERS: 2 | US FAERS | |
| 841 | Benign Neoplasm | FAERS: 2 | US FAERS | |
| 842 | Benign Prostatic Hyperplasia | FAERS: 2 | US FAERS | |
| 843 | Blood creatine increased | FAERS: 2 | US FAERS | |
| 844 | Blood creatinine decreased | FAERS: 2 | US FAERS | |
| 845 | Blood electrolytes abnormal | FAERS: 2 | US FAERS | |
| 846 | Blood folate decreased | FAERS: 2 | US FAERS | |
| 847 | Blood glucose fluctuation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 848 | Blood parathyroid hormone decreased | FAERS: 2 | US FAERS | |
| 849 | Blood potassium abnormal | FAERS: 2 | US FAERS | |
| 850 | Bone density decreased | FAERS: 2 | US FAERS | |
| 851 | Bradykinesia | FAERS: 2 | US FAERS | |
| 852 | Bronchial Hyperreactivity | FAERS: 2 | US FAERS | |
| 853 | Calcinosis | FAERS: 2 | US FAERS | |
| 854 | Carcinoembryonic antigen increased | FAERS: 2 | US FAERS | |
| 855 | Cardiac stress test abnormal | FAERS: 2 | US FAERS | |
| 856 | Chemotherapy | FAERS: 2 | US FAERS | |
| 857 | Cholangitis | FAERS: 2 | US FAERS | |
| 858 | Chromatopsia | FAERS: 2 | US FAERS | |
| 859 | Chronic sinusitis | FAERS: 2 | US FAERS | |
| 860 | Clostridium difficile colitis | FAERS: 2 | US FAERS | |
| 861 | Colectomy | FAERS: 2 | US FAERS | |
| 862 | Complement factor C3 decreased | FAERS: 2 | US FAERS | |
| 863 | Corrective lens user | FAERS: 2 | US FAERS | |
| 864 | Creatinine renal clearance increased | FAERS: 2 | US FAERS | |
| 865 | Cyclothymic Disorder | FAERS: 2 | US FAERS | |
| 866 | Death of relative | FAERS: 2 | US FAERS | |
| 867 | Dermatitis acneiform | FAERS: 2 | US FAERS | |
| 868 | Dermatomyositis | FAERS: 2 | US FAERS | |
| 869 | Device Failure | FAERS: 2 | US FAERS | |
| 870 | Diabetes Insipidus | FAERS: 2 | US FAERS | |
| 871 | Diplegia | FAERS: 2 | US FAERS | |
| 872 | Drug abuser | FAERS: 2 | US FAERS | |
| 873 | Drug ineffective for unapproved indication | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 874 | Drug label confusion | FAERS: 2 | US FAERS | |
| 875 | Drug level changed | FAERS: 2 | US FAERS | |
| 876 | Drug withdrawal headache | FAERS: 2 | US FAERS | |
| 877 | Duodenal ulcer perforation | FAERS: 2 | US FAERS | |
| 878 | Dyslexia | FAERS: 2 | US FAERS | |
| 879 | Dysmorphism | FAERS: 2 | US FAERS | |
| 880 | Ecchymosis | FAERS: 2 | US FAERS | |
| 881 | Electrocardiogram ST segment abnormal | FAERS: 2 | US FAERS | |
| 882 | Emergency care examination | FAERS: 2 | US FAERS | |
| 883 | Endometriosis | FAERS: 2 | US FAERS | |
| 884 | Eosinophilic Fasciitis | FAERS: 2 | US FAERS | |
| 885 | Eosinophilic Pneumonia | FAERS: 2 | US FAERS | |
| 886 | Eustachian tube disorder | FAERS: 2 | US FAERS | |
| 887 | Exertional headache | FAERS: 2 | US FAERS | |
| 888 | Exposure via partner | FAERS: 2 | US FAERS | |
| 889 | Extra dose administered | FAERS: 2 | US FAERS | |
| 890 | Extremity necrosis | FAERS: 2 | US FAERS | |
| 891 | Eye allergy | FAERS: 2 | US FAERS | |
| 892 | Eye excision | FAERS: 2 | US FAERS | |
| 893 | Female Orgasmic Disorder | FAERS: 2 | US FAERS | |
| 894 | Gait inability | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 895 | Gamma-glutamyltransferase abnormal | FAERS: 2 | US FAERS | |
| 896 | Gastric infection | FAERS: 2 | US FAERS | |
| 897 | Gastroenteritis norovirus | FAERS: 2 | US FAERS | |
| 898 | Gastrointestinal gangrene | FAERS: 2 | US FAERS | |
| 899 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 900 | Gastrointestinal mucosal exfoliation | FAERS: 2 | US FAERS | |
| 901 | Gastrointestinal ulcer | FAERS: 2 | US FAERS | |
| 902 | Genital discomfort | FAERS: 2 | US FAERS | |
| 903 | Gingival Hypertrophy | FAERS: 2 | US FAERS | |
| 904 | Gingival Recession | FAERS: 2 | US FAERS | |
| 905 | Global Amnesia | FAERS: 2 | US FAERS | |
| 906 | Glomerulonephritis | FAERS: 2 | US FAERS | |
| 907 | Heat Exhaustion | FAERS: 2 | US FAERS | |
| 908 | Heat Stroke | FAERS: 2 | US FAERS | |
| 909 | Heat illness | FAERS: 2 | US FAERS | |
| 910 | Hepatitis B e antigen positive | FAERS: 2 | US FAERS | |
| 911 | Hepatitis B | FAERS: 2 | US FAERS | |
| 912 | Hepatitis C positive | FAERS: 2 | US FAERS | |
| 913 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 914 | Hip surgery | FAERS: 2 | US FAERS | |
| 915 | Hyperpyrexia | FAERS: 2 | US FAERS | |
| 916 | Hypertransaminasaemia | FAERS: 2 | US FAERS | |
| 917 | Hypertrichosis | FAERS: 2 | US FAERS | |
| 918 | Hyporeflexia | FAERS: 2 | US FAERS | |
| 919 | Illiteracy | FAERS: 2 | US FAERS | |
| 920 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 921 | Infrequent bowel movements | FAERS: 2 | US FAERS | |
| 922 | Inguinal mass | FAERS: 2 | US FAERS | |
| 923 | Inhibitory drug interaction | FAERS: 2 | US FAERS | |
| 924 | Intervertebral disc injury | FAERS: 2 | US FAERS | |
| 925 | Iritis | FAERS: 2 | US FAERS | |
| 926 | Joint sprain | FAERS: 2 | US FAERS | |
| 927 | Ketosis | FAERS: 2 | US FAERS | |
| 928 | Leprosy | FAERS: 2 | US FAERS | |
| 929 | Leukopenia | FAERS: 2 | US FAERS | |
| 930 | Lid lag | FAERS: 2 | US FAERS | |
| 931 | Lip and/or oral cavity cancer | FAERS: 2 | US FAERS | |
| 932 | Lip exfoliation | FAERS: 2 | US FAERS | |
| 933 | Liver Abscess | FAERS: 2 | US FAERS | |
| 934 | Localised intraabdominal fluid collection | FAERS: 2 | US FAERS | |
| 935 | Lymphocyte count increased | FAERS: 2 | US FAERS | |
| 936 | Malabsorption | FAERS: 2 | US FAERS | |
| 937 | Maternal exposure timing unspecified | FAERS: 2 | US FAERS | |
| 938 | Medical device complication | FAERS: 2 | US FAERS | |
| 939 | Mental Retardation | FAERS: 2 | US FAERS | |
| 940 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 941 | Metastatic Neoplasm | FAERS: 2 | US FAERS | |
| 942 | Metastatic bronchial carcinoma | FAERS: 2 | US FAERS | |
| 943 | Miliaria | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 944 | Moaning | FAERS: 2 | US FAERS | |
| 945 | Multiple System Atrophy | FAERS: 2 | US FAERS | |
| 946 | Myasthenia Gravis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 947 | Myoclonus | FAERS: 2 | US FAERS | |
| 948 | Myopia | FAERS: 2 | US FAERS | |
| 949 | Nasal mucosal disorder | FAERS: 2 | US FAERS | |
| 950 | Necrosis | FAERS: 2 | US FAERS | |
| 951 | Nephrectomy | FAERS: 2 | US FAERS | |
| 952 | Neuropsychiatric syndrome | FAERS: 2 | US FAERS | |
| 953 | No reaction on previous exposure to drug | FAERS: 2 | US FAERS | |
| 954 | Nocturnal emission | FAERS: 2 | US FAERS | |
| 955 | Oliguria | FAERS: 2 | US FAERS | |
| 956 | Onychoclasis | FAERS: 2 | US FAERS | |
| 957 | Onychomycosis | FAERS: 2 | US FAERS | |
| 958 | Oral viral infection | FAERS: 2 | US FAERS | |
| 959 | Oropharyngeal spasm | FAERS: 2 | US FAERS | |
| 960 | Osteomyelitis | FAERS: 2 | US FAERS | |
| 961 | Oxygen supplementation | FAERS: 2 | US FAERS | |
| 962 | Pancreatic Insufficiency | FAERS: 2 | US FAERS | |
| 963 | Panic disorder with agoraphobia | FAERS: 2 | US FAERS | |
| 964 | Papilloma | FAERS: 2 | US FAERS | |
| 965 | Paranoid Personality Disorder | FAERS: 2 | US FAERS | |
| 966 | Paraplegia | FAERS: 2 | US FAERS | |
| 967 | Patient restraint | FAERS: 2 | US FAERS | |
| 968 | Perforated ulcer | FAERS: 2 | US FAERS | |
| 969 | Peripheral artery occlusion | FAERS: 2 | US FAERS | |
| 970 | Periphlebitis | FAERS: 2 | US FAERS | |
| 971 | Pertussis | FAERS: 2 | US FAERS | |
| 972 | Pharyngeal polyp | FAERS: 2 | US FAERS | |
| 973 | Pharyngeal swelling | FAERS: 2 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 974 | Pharyngolaryngeal discomfort | FAERS: 2 | US FAERS | |
| 975 | Phrenic nerve paralysis | FAERS: 2 | US FAERS | |
| 976 | Post inflammatory pigmentation change | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 977 | Post-traumatic neck syndrome | FAERS: 2 | US FAERS | |
| 978 | Precancerous cells present | FAERS: 2 | US FAERS | |
| 979 | Pregnancy test false positive | FAERS: 2 | US FAERS | |
| 980 | Pregnancy test positive | FAERS: 2 | US FAERS | |
| 981 | Pressure of speech | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 982 | Procedural complication | FAERS: 2 | US FAERS | |
| 983 | Proctitis | FAERS: 2 | US FAERS | |
| 984 | Psychiatric investigation | FAERS: 2 | US FAERS | |
| 985 | Pustular psoriasis | FAERS: 2 | US FAERS | |
| 986 | Pyuria | FAERS: 2 | US FAERS | |
| 987 | Radicular pain | FAERS: 2 | US FAERS | |
| 988 | Radiculopathy | FAERS: 2 | US FAERS | |
| 989 | Rales | FAERS: 2 | US FAERS | |
| 990 | Rectal Prolapse | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 991 | Reflux gastritis | FAERS: 2 | US FAERS | |
| 992 | Renal Cell Carcinoma | FAERS: 2 | US FAERS | |
| 993 | Renal aneurysm | FAERS: 2 | US FAERS | |
| 994 | Retinal Vein Occlusion | FAERS: 2 | US FAERS | |
| 995 | Rheumatoid factor increased | FAERS: 2 | US FAERS | |
| 996 | Rosacea | FAERS: 2 | US FAERS | |
| 997 | Sarcoidosis | FAERS: 2 | US FAERS | |
| 998 | Schizoid Personality Disorder | FAERS: 2 | US FAERS | |
| 999 | Sensorimotor disorder | FAERS: 2 | US FAERS | |
| 1000 | Sexual activity increased | FAERS: 2 | US FAERS | |
| 1001 | Simple Partial Seizures | FAERS: 2 | US FAERS | |
| 1002 | Sinus operation | FAERS: 2 | US FAERS | |
| 1003 | Skin hypertrophy | FAERS: 2 | US FAERS | |
| 1004 | Sleep disorder due to general medical condition, insomnia type | FAERS: 2 | US FAERS | |
| 1005 | Spinal fusion surgery | FAERS: 2 | US FAERS | |
| 1006 | Splenic Rupture | FAERS: 2 | US FAERS | |
| 1007 | Sputum retention | FAERS: 2 | US FAERS | |
| 1008 | Starvation | FAERS: 2 | US FAERS | |
| 1009 | Subcutaneous Abscess | FAERS: 2 | US FAERS | |
| 1010 | Synovitis | FAERS: 2 | US FAERS | |
| 1011 | Syphilis | FAERS: 2 | US FAERS | |
| 1012 | Tardive Dyskinesia | FAERS: 2 | US FAERS | |
| 1013 | Terminal state | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1014 | Thalamic infarction | FAERS: 2 | US FAERS | |
| 1015 | Therapeutic procedure | FAERS: 2 | US FAERS | |
| 1016 | Therapy regimen changed | FAERS: 2 | US FAERS | |
| 1017 | Thromboangiitis Obliterans | FAERS: 2 | US FAERS | |
| 1018 | Thrombotic stroke | FAERS: 2 | US FAERS | |
| 1019 | Time perception altered | FAERS: 2 | US FAERS | |
| 1020 | Tongue discomfort | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1021 | Tongue eruption | FAERS: 2 | US FAERS | |
| 1022 | Traumatic Brain Injury | FAERS: 2 | US FAERS | |
| 1023 | Troponin I increased | FAERS: 2 | US FAERS | |
| 1024 | Tympanic Membrane Perforation | FAERS: 2 | US FAERS | |
| 1025 | Underweight | FAERS: 2 | US FAERS | |
| 1026 | Unemployment | FAERS: 2 | US FAERS | |
| 1027 | Upper respiratory tract inflammation | FAERS: 2 | US FAERS | |
| 1028 | Upper respiratory tract irritation | FAERS: 2 | US FAERS | |
| 1029 | Urine cytology abnormal | FAERS: 2 | US FAERS | |
| 1030 | Vaginal Prolapse | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1031 | Vaginal mucosal blistering | FAERS: 2 | US FAERS | |
| 1032 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 1033 | Victim of homicide | FAERS: 2 | US FAERS | |
| 1034 | Visual brightness | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1035 | Vitamin D abnormal | FAERS: 2 | US FAERS | |
| 1036 | Vulvovaginal dryness | FAERS: 2 | US FAERS | |
| 1037 | Vulvovaginal mycotic infection | FAERS: 2 | US FAERS | |
| 1038 | Wheelchair user | FAERS: 2 | US FAERS | |
| 1039 | Wrong dose | FAERS: 2 | US FAERS | |
| 1040 | Yawning | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1041 | 5'nucleotidase increased | FAERS: 1 | US FAERS | |
| 1042 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 1043 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 1044 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 1045 | Abnormal withdrawal bleeding | FAERS: 1 | US FAERS | |
| 1046 | Abulia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1047 | Acromegaly | FAERS: 1 | US FAERS | |
| 1048 | Adjustment disorder with mixed anxiety and depressed mood | FAERS: 1 | US FAERS | |
| 1049 | Agnosia | FAERS: 1 | US FAERS | |
| 1050 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 1051 | Air Embolism | FAERS: 1 | US FAERS | |
| 1052 | Alanine aminotransferase decreased | FAERS: 1 | US FAERS | |
| 1053 | Alcohol test false positive | FAERS: 1 | US FAERS | |
| 1054 | Alkalosis | FAERS: 1 | US FAERS | |
| 1055 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 1056 | Allergy to arthropod bite | FAERS: 1 | US FAERS | |
| 1057 | Allodynia | FAERS: 1 | US FAERS | |
| 1058 | Amaurosis | FAERS: 1 | US FAERS | |
| 1059 | Ammonia abnormal | FAERS: 1 | US FAERS | |
| 1060 | Amnestic Disorder | FAERS: 1 | US FAERS | |
| 1061 | Amputation | FAERS: 1 | US FAERS | |
| 1062 | Anal inflammation | FAERS: 1 | US FAERS | |
| 1063 | Anal squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 1064 | Anencephaly | FAERS: 1 | US FAERS | |
| 1065 | Anticholinergic Syndrome | FAERS: 1 | US FAERS | |
| 1066 | Antinuclear antibody increased | FAERS: 1 | US FAERS | |
| 1067 | Application site rash | FAERS: 1 | US FAERS | |
| 1068 | Arterial Injury | FAERS: 1 | US FAERS | |
| 1069 | Aspartate aminotransferase decreased | FAERS: 1 | US FAERS | |
| 1070 | Aspergilloma | FAERS: 1 | US FAERS | |
| 1071 | Atelectasis | FAERS: 1 | US FAERS | |
| 1072 | Athetosis | FAERS: 1 | US FAERS | |
| 1073 | Atrial tachycardia | FAERS: 1 | US FAERS | |
| 1074 | Aura | FAERS: 1 | US FAERS | |
| 1075 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 1076 | Autoimmune thrombocytopenia | FAERS: 1 | US FAERS | |
| 1077 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 1078 | Autoscopy | FAERS: 1 | US FAERS | |
| 1079 | Azoospermia | FAERS: 1 | US FAERS | |
| 1080 | Balanitis | FAERS: 1 | US FAERS | |
| 1081 | Barbiturates positive | FAERS: 1 | US FAERS | |
| 1082 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 1083 | Basal ganglion degeneration | FAERS: 1 | US FAERS | |
| 1084 | Biliary Colic | FAERS: 1 | US FAERS | |
| 1085 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 1086 | Bladder cancer recurrent | FAERS: 1 | US FAERS | |
| 1087 | Bladder cyst | FAERS: 1 | US FAERS | |
| 1088 | Bladder spasm | FAERS: 1 | US FAERS | |
| 1089 | Bleeding time shortened | FAERS: 1 | US FAERS | |
| 1090 | Blepharitis | FAERS: 1 | US FAERS | |
| 1091 | Blood Pressure | FAERS: 1 | US FAERS | |
| 1092 | Blood albumin increased | FAERS: 1 | US FAERS | |
| 1093 | Blood alcohol decreased | FAERS: 1 | US FAERS | |
| 1094 | Blood chloride abnormal | FAERS: 1 | US FAERS | |
| 1095 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 1096 | Blood follicle stimulating hormone increased | FAERS: 1 | US FAERS | |
| 1097 | Blood homocysteine abnormal | FAERS: 1 | US FAERS | |
| 1098 | Blood ketone body | FAERS: 1 | US FAERS | |
| 1099 | Blood lactic acid | FAERS: 1 | US FAERS | |
| 1100 | Blood parathyroid hormone increased | FAERS: 1 | US FAERS | |
| 1101 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 1102 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 1103 | Blood triglycerides decreased | FAERS: 1 | US FAERS | |
| 1104 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 1105 | Bone atrophy | FAERS: 1 | US FAERS | |
| 1106 | Bone scan abnormal | FAERS: 1 | US FAERS | |
| 1107 | Bone swelling | FAERS: 1 | US FAERS | |
| 1108 | Brain Contusion | FAERS: 1 | US FAERS | |
| 1109 | Breast adenoma | FAERS: 1 | US FAERS | |
| 1110 | Breast infection | FAERS: 1 | US FAERS | |
| 1111 | Breath Holding | FAERS: 1 | US FAERS | |
| 1112 | Breath alcohol test positive | FAERS: 1 | US FAERS | |
| 1113 | Brief psychotic disorder, with postpartum onset | FAERS: 1 | US FAERS | |
| 1114 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 1115 | Bunion | FAERS: 1 | US FAERS | |
| 1116 | Burning Mouth Syndrome | FAERS: 1 | US FAERS | |
| 1117 | C-reactive protein abnormal | FAERS: 1 | US FAERS | |
| 1118 | Cachexia | FAERS: 1 | US FAERS | |
| 1119 | Capillaritis | FAERS: 1 | US FAERS | |
| 1120 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 1121 | Cardiac ventricular disorder | FAERS: 1 | US FAERS | |
| 1122 | Cartilage injury | FAERS: 1 | US FAERS | |
| 1123 | Catheter placement | FAERS: 1 | US FAERS | |
| 1124 | Caustic injury | FAERS: 1 | US FAERS | |
| 1125 | Central pain syndrome | FAERS: 1 | US FAERS | |
| 1126 | Cerebellar Ataxia | FAERS: 1 | US FAERS | |
| 1127 | Cerebral Arteriosclerosis | FAERS: 1 | US FAERS | |
| 1128 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 1129 | Cerebral artery perforation | FAERS: 1 | US FAERS | |
| 1130 | Cerebral cyst | FAERS: 1 | US FAERS | |
| 1131 | Cerebral hypoperfusion | FAERS: 1 | US FAERS | |
| 1132 | Cerebral sarcoidosis | FAERS: 1 | US FAERS | |
| 1133 | Cerebral vasoconstriction | FAERS: 1 | US FAERS | |
| 1134 | Cerebrospinal fistula | FAERS: 1 | US FAERS | |
| 1135 | Cervical dysplasia | FAERS: 1 | US FAERS | |
| 1136 | Charles Bonnet Syndrome | FAERS: 1 | US FAERS | |
| 1137 | Chemical injury | FAERS: 1 | US FAERS | |
| 1138 | Cheyne-Stokes Respiration | FAERS: 1 | US FAERS | |
| 1139 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 1140 | Cholestasis | FAERS: 1 | US FAERS | |
| 1141 | Chorioretinitis | FAERS: 1 | US FAERS | |
| 1142 | Choroiditis | FAERS: 1 | US FAERS | |
| 1143 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 1144 | Coagulation factor V level abnormal | FAERS: 1 | US FAERS | |
| 1145 | Colonoscopy abnormal | FAERS: 1 | US FAERS | |
| 1146 | Compression fracture | FAERS: 1 | US FAERS | |
| 1147 | Compulsive shopping | FAERS: 1 | US FAERS | |
| 1148 | Concomitant disease aggravated | FAERS: 1 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 1149 | Conduct Disorder | FAERS: 1 | US FAERS | |
| 1150 | Confabulation | FAERS: 1 | US FAERS | |
| 1151 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 1152 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 1153 | Contraindicated drug prescribed | FAERS: 1 | US FAERS | |
| 1154 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 1155 | Coronary artery embolism | FAERS: 1 | US FAERS | |
| 1156 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 1157 | Cycloplegia | FAERS: 1 | US FAERS | |
| 1158 | Decompression Sickness | FAERS: 1 | US FAERS | |
| 1159 | Decreased insulin requirement | FAERS: 1 | US FAERS | |
| 1160 | Delusional disorder, jealous type | FAERS: 1 | US FAERS | |
| 1161 | Delusional disorder, mixed type | FAERS: 1 | US FAERS | |
| 1162 | Dental discomfort | FAERS: 1 | US FAERS | |
| 1163 | Dependence on enabling machine or device | FAERS: 1 | US FAERS | |
| 1164 | Device related infection | FAERS: 1 | US FAERS | |
| 1165 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 1166 | Diabetic foot infection | FAERS: 1 | US FAERS | |
| 1167 | Diastolic hypertension | FAERS: 1 | US FAERS | |
| 1168 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 1169 | Documented hypersensitivity to administered product | FAERS: 1 | US FAERS | |
| 1170 | Drowning | FAERS: 1 | US FAERS | |
| 1171 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 1172 | Drug interaction inhibition | FAERS: 1 | US FAERS | |
| 1173 | Drug level below therapeutic | FAERS: 1 | US FAERS | |
| 1174 | Drug level decreased | FAERS: 1 | US FAERS | |
| 1175 | Drug withdrawal convulsions | FAERS: 1 | US FAERS | |
| 1176 | Dyschezia | FAERS: 1 | US FAERS | |
| 1177 | Dyschromatopsia | FAERS: 1 | US FAERS | |
| 1178 | Dyspareunia | FAERS: 1 | US FAERS | |
| 1179 | Dysphasia | FAERS: 1 | US FAERS | |
| 1180 | Early satiety | FAERS: 1 | US FAERS | |
| 1181 | Egocentrism | FAERS: 1 | US FAERS | |
| 1182 | Electroconvulsive Therapy | FAERS: 1 | US FAERS | |
| 1183 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 1184 | Embolic cerebral infarction | FAERS: 1 | US FAERS | |
| 1185 | Encephalitis | FAERS: 1 | US FAERS | |
| 1186 | Endoscopy abnormal | FAERS: 1 | US FAERS | |
| 1187 | Enlarged uvula | FAERS: 1 | US FAERS | |
| 1188 | Epicondylitis | FAERS: 1 | US FAERS | |
| 1189 | Epileptic aura | FAERS: 1 | US FAERS | |
| 1190 | Epstein-Barr virus antibody positive | FAERS: 1 | US FAERS | |
| 1191 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 1192 | Escherichia infection | FAERS: 1 | US FAERS | |
| 1193 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 1194 | Exaggerated startle response | FAERS: 1 | US FAERS | |
| 1195 | Exercise adequate | FAERS: 1 | US FAERS | |
| 1196 | Exercise tolerance increased | FAERS: 1 | US FAERS | |
| 1197 | Exophthalmos | FAERS: 1 | US FAERS | |
| 1198 | Exposure via father | FAERS: 1 | US FAERS | |
| 1199 | External ear pain | FAERS: 1 | US FAERS | |
| 1200 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 1201 | Eyelid pain | FAERS: 1 | US FAERS | |
| 1202 | Factor V Leiden mutation | FAERS: 1 | US FAERS | |
| 1203 | Failure of implant | FAERS: 1 | US FAERS | |
| 1204 | Familial Tremor | FAERS: 1 | US FAERS | |
| 1205 | Female sexual arousal disorder | FAERS: 1 | US FAERS | |
| 1206 | Female sexual dysfunction | FAERS: 1 | US FAERS | |
| 1207 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 1208 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 1209 | Foreign body aspiration | FAERS: 1 | US FAERS | |
| 1210 | Frontotemporal dementia | FAERS: 1 | US FAERS | |
| 1211 | Frostbite | FAERS: 1 | US FAERS | |
| 1212 | Gait deviation | FAERS: 1 | US FAERS | |
| 1213 | Gastrectomy | FAERS: 1 | US FAERS | |
| 1214 | Gastric hypertonia | FAERS: 1 | US FAERS | |
| 1215 | Gastrointestinal arteriovenous malformation | FAERS: 1 | US FAERS | |
| 1216 | Gastrointestinal cancer metastatic | FAERS: 1 | US FAERS | |
| 1217 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 1218 | Gastrointestinal endoscopic therapy | FAERS: 1 | US FAERS | |
| 1219 | Gene Mutation | FAERS: 1 | US FAERS | |
| 1220 | Genital cyst | FAERS: 1 | US FAERS | |
| 1221 | Genital discharge | FAERS: 1 | US FAERS | |
| 1222 | Genital erythema | FAERS: 1 | US FAERS | |
| 1223 | Gingival Hyperplasia | FAERS: 1 | US FAERS | |
| 1224 | Gingival graft | FAERS: 1 | US FAERS | |
| 1225 | Head Banging | FAERS: 1 | US FAERS | |
| 1226 | Hearing disability | FAERS: 1 | US FAERS | |
| 1227 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 1228 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 1229 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 1230 | Hepatitis C antibody positive | FAERS: 1 | US FAERS | |
| 1231 | Herpes Zoster Oticus | FAERS: 1 | US FAERS | |
| 1232 | Herpes simplex serology positive | FAERS: 1 | US FAERS | |
| 1233 | Hordeolum | FAERS: 1 | US FAERS | |
| 1234 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 1235 | Hyperexplexia | FAERS: 1 | US FAERS | |
| 1236 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 1237 | Hyperreflexia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1238 | Hypertrophic Cardiomyopathy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1239 | Hypochondriasis | FAERS: 1 | US FAERS | |
| 1240 | Hypohidrosis | FAERS: 1 | US FAERS | |
| 1241 | Hypometabolism | FAERS: 1 | US FAERS | |
| 1242 | Ideas of reference | FAERS: 1 | US FAERS | |
| 1243 | Ileitis | FAERS: 1 | US FAERS | |
| 1244 | Illogical thinking | FAERS: 1 | US FAERS | |
| 1245 | Impaired reasoning | FAERS: 1 | US FAERS | |
| 1246 | Impetigo | FAERS: 1 | US FAERS | |
| 1247 | Implant site inflammation | FAERS: 1 | US FAERS | |
| 1248 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 1249 | Inadequate lubrication | FAERS: 1 | US FAERS | |
| 1250 | Inappropriate schedule of product administration | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1251 | Incision site complication | FAERS: 1 | US FAERS | |
| 1252 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 1253 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 1254 | Infective exacerbation of chronic obstructive airways disease | FAERS: 1 | US FAERS | |
| 1255 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 1256 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 1257 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 1258 | Intercepted product administration error | FAERS: 1 | US FAERS | |
| 1259 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 1260 | Internal injury | FAERS: 1 | US FAERS | |
| 1261 | Intraocular pressure test | FAERS: 1 | US FAERS | |
| 1262 | Intrusive thoughts | FAERS: 1 | US FAERS | |
| 1263 | Intubation | FAERS: 1 | US FAERS | |
| 1264 | Iron deficiency | FAERS: 1 | US FAERS | |
| 1265 | Irregular sleep phase | FAERS: 1 | US FAERS | |
| 1266 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 1267 | Lactation Disorder | FAERS: 1 | US FAERS | |
| 1268 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 1269 | Laryngeal Obstruction | FAERS: 1 | US FAERS | |
| 1270 | Laryngeal discomfort | FAERS: 1 | US FAERS | |
| 1271 | Laryngospasm | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1272 | Left atrial dilatation | FAERS: 1 | US FAERS | |
| 1273 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 1274 | Leukoplakia | FAERS: 1 | US FAERS | |
| 1275 | Limb crushing injury | FAERS: 1 | US FAERS | |
| 1276 | Lipids | FAERS: 1 | US FAERS | |
| 1277 | Lipoma | FAERS: 1 | US FAERS | |
| 1278 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 1279 | Loss of visual contrast sensitivity | FAERS: 1 | US FAERS | |
| 1280 | Low birth weight baby | FAERS: 1 | US FAERS | |
| 1281 | Low density lipoprotein abnormal | FAERS: 1 | US FAERS | |
| 1282 | Lower respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 1283 | Lumbar hernia | FAERS: 1 | US FAERS | |
| 1284 | Lung carcinoma cell type unspecified stage I | FAERS: 1 | US FAERS | |
| 1285 | Lupus Nephritis | FAERS: 1 | US FAERS | |
| 1286 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 1287 | Macule | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1288 | Male sexual dysfunction | FAERS: 1 | US FAERS | |
| 1289 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 1290 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 1291 | Malignant tumour excision | FAERS: 1 | US FAERS | |
| 1292 | Malnutrition | FAERS: 1 | US FAERS | |
| 1293 | Malocclusion | FAERS: 1 | US FAERS | |
| 1294 | Man-in-the-barrel syndrome | FAERS: 1 | US FAERS | |
| 1295 | Masochism | FAERS: 1 | US FAERS | |
| 1296 | Mastitis | FAERS: 1 | US FAERS | |
| 1297 | Megacolon | FAERS: 1 | US FAERS | |
| 1298 | Meniscal degeneration | FAERS: 1 | US FAERS | |
| 1299 | Meniscus injury | FAERS: 1 | US FAERS | |
| 1300 | Menstrual discomfort | FAERS: 1 | US FAERS | |
| 1301 | Mesenteric vascular insufficiency | FAERS: 1 | US FAERS | |
| 1302 | Microalbuminuria | FAERS: 1 | US FAERS | |
| 1303 | Microbiology test abnormal | FAERS: 1 | US FAERS | |
| 1304 | Mitral valve sclerosis | FAERS: 1 | US FAERS | |
| 1305 | Mononeuritis | FAERS: 1 | US FAERS | |
| 1306 | Monoparesis | FAERS: 1 | US FAERS | |
| 1307 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 1308 | Mumps | FAERS: 1 | US FAERS | |
| 1309 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 1310 | Muscle enzyme increased | FAERS: 1 | US FAERS | |
| 1311 | Myasthenic Syndrome | FAERS: 1 | US FAERS | |
| 1312 | Mycotic allergy | FAERS: 1 | US FAERS | |
| 1313 | Myopericarditis | FAERS: 1 | US FAERS | |
| 1314 | Nail bed disorder | FAERS: 1 | US FAERS | |
| 1315 | Narcissistic Personality Disorder | FAERS: 1 | US FAERS | |
| 1316 | Nasal Polyps | FAERS: 1 | US FAERS | |
| 1317 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 1318 | Nephritis | FAERS: 1 | US FAERS | |
| 1319 | Nephrosclerosis | FAERS: 1 | US FAERS | |
| 1320 | Neuritis | FAERS: 1 | US FAERS | |
| 1321 | Neurological examination abnormal | FAERS: 1 | US FAERS | |
| 1322 | Neuropathy | FAERS: 1 | US FAERS | |
| 1323 | Neuropsychological test abnormal | FAERS: 1 | US FAERS | |
| 1324 | Neutropenia | FAERS: 1 | US FAERS | |
| 1325 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 1326 | No adverse effect | FAERS: 1 | US FAERS | |
| 1327 | Non-small cell lung cancer stage IIIB | FAERS: 1 | US FAERS | |
| 1328 | Non-small cell lung cancer stage III | FAERS: 1 | US FAERS | |
| 1329 | Occult blood positive | FAERS: 1 | US FAERS | |
| 1330 | Onycholysis | FAERS: 1 | US FAERS | |
| 1331 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 1332 | Optic nerve infarction | FAERS: 1 | US FAERS | |
| 1333 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 1334 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 1335 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 1336 | Orchitis | FAERS: 1 | US FAERS | |
| 1337 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 1338 | Oropharyngitis fungal | FAERS: 1 | US FAERS | |
| 1339 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 1340 | Osteitis | FAERS: 1 | US FAERS | |
| 1341 | Osteopenia | FAERS: 1 | US FAERS | |
| 1342 | Ototoxicity | FAERS: 1 | US FAERS | |
| 1343 | Oxygen consumption decreased | FAERS: 1 | US FAERS | |
| 1344 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 1345 | PCO2 increased | FAERS: 1 | US FAERS | |
| 1346 | PO2 decreased | FAERS: 1 | US FAERS | |
| 1347 | PO2 increased | FAERS: 1 | US FAERS | |
| 1348 | Palmar erythema | FAERS: 1 | US FAERS | |
| 1349 | Pancreatic Fistula | FAERS: 1 | US FAERS | |
| 1350 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 1351 | Pancreatic enzymes abnormal | FAERS: 1 | US FAERS | |
| 1352 | Panniculitis | FAERS: 1 | US FAERS | |
| 1353 | Papule | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1354 | Paramnesia | FAERS: 1 | US FAERS | |
| 1355 | Paraparesis | FAERS: 1 | US FAERS | |
| 1356 | Parotid duct obstruction | FAERS: 1 | US FAERS | |
| 1357 | Patent ductus arteriosus | FAERS: 1 | US FAERS | |
| 1358 | Patient Isolation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1359 | Pelvic Inflammatory Disease | FAERS: 1 | US FAERS | |
| 1360 | Pelvic venous thrombosis | FAERS: 1 | US FAERS | |
| 1361 | Pemphigus | FAERS: 1 | US FAERS | |
| 1362 | Periarthritis | FAERS: 1 | US FAERS | |
| 1363 | Periodontal operation | FAERS: 1 | US FAERS | |
| 1364 | Periodontitis | FAERS: 1 | US FAERS | |
| 1365 | Periorbital contusion | FAERS: 1 | US FAERS | |
| 1366 | Periorbital disorder | FAERS: 1 | US FAERS | |
| 1367 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 1368 | Peripheral paralysis | FAERS: 1 | US FAERS | |
| 1369 | Peritonsillar Abscess | FAERS: 1 | US FAERS | |
| 1370 | Peritonsillitis | FAERS: 1 | US FAERS | |
| 1371 | Personal relationship issue | FAERS: 1 | US FAERS | |
| 1372 | Pharyngitis bacterial | FAERS: 1 | US FAERS | |
| 1373 | Pharyngotonsillitis | FAERS: 1 | US FAERS | |
| 1374 | Phimosis | FAERS: 1 | US FAERS | |
| 1375 | Phlebitis | FAERS: 1 | US FAERS | |
| 1376 | Phototherapy | FAERS: 1 | US FAERS | |
| 1377 | Physical deconditioning | FAERS: 1 | US FAERS | |
| 1378 | Pierre Robin Syndrome | FAERS: 1 | US FAERS | |
| 1379 | Pityriasis Rubra Pilaris | FAERS: 1 | US FAERS | |
| 1380 | Plasma cell myeloma recurrent | FAERS: 1 | US FAERS | |
| 1381 | Pneumonectomy | FAERS: 1 | US FAERS | |
| 1382 | Pneumonitis | FAERS: 1 | US FAERS | |
| 1383 | Polyhydramnios | FAERS: 1 | US FAERS | |
| 1384 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 1385 | Poor personal hygiene | FAERS: 1 | US FAERS | |
| 1386 | Post procedural complication | FAERS: 1 | US FAERS | |
| 1387 | Post procedural discomfort | FAERS: 1 | US FAERS | |
| 1388 | Post procedural infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1389 | Post procedural urine leak | FAERS: 1 | US FAERS | |
| 1390 | Post-Traumatic Headache | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1391 | Post-traumatic pain | FAERS: 1 | US FAERS | |
| 1392 | Potentiating drug interaction | FAERS: 1 | US FAERS | |
| 1393 | Premature Ejaculation | FAERS: 1 | US FAERS | |
| 1394 | Prescribed overdose | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1395 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 1396 | Primary Hypothyroidism | FAERS: 1 | US FAERS | |
| 1397 | Product label confusion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1398 | Product lot number issue | FAERS: 1 | US FAERS | |
| 1399 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 1400 | Product selection error | FAERS: 1 | US FAERS | |
| 1401 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 1402 | Prolapse repair | FAERS: 1 | US FAERS | |
| 1403 | Prostate examination abnormal | FAERS: 1 | US FAERS | |
| 1404 | Prostatic pain | FAERS: 1 | US FAERS | |
| 1405 | Protein S Deficiency | FAERS: 1 | US FAERS | |
| 1406 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 1407 | Pulmonary necrosis | FAERS: 1 | US FAERS | |
| 1408 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 1409 | Purulence | FAERS: 1 | US FAERS | |
| 1410 | Quadriplegia | FAERS: 1 | US FAERS | |
| 1411 | Radiation skin injury | FAERS: 1 | US FAERS | |
| 1412 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 1413 | Reaction to food additive | FAERS: 1 | US FAERS | |
| 1414 | Rebound effect | FAERS: 1 | US FAERS | |
| 1415 | Rectal discharge | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1416 | Reduced facial expression | FAERS: 1 | US FAERS | |
| 1417 | Renal and pancreas transplant | FAERS: 1 | US FAERS | |
| 1418 | Renal cyst | FAERS: 1 | US FAERS | |
| 1419 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 1420 | Renal vein compression | FAERS: 1 | US FAERS | |
| 1421 | Residual urine volume increased | FAERS: 1 | US FAERS | |
| 1422 | Respiratory fatigue | FAERS: 1 | US FAERS | |
| 1423 | Respiratory fume inhalation disorder | FAERS: 1 | US FAERS | |
| 1424 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 1425 | Reticulocyte count decreased | FAERS: 1 | US FAERS | |
| 1426 | Retrograde amnesia | FAERS: 1 | US FAERS | |
| 1427 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 1428 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 1429 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 1430 | Ruptured ectopic pregnancy | FAERS: 1 | US FAERS | |
| 1431 | Saliva altered | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1432 | Salivary gland pain | FAERS: 1 | US FAERS | |
| 1433 | Sarcoma | FAERS: 1 | US FAERS | |
| 1434 | Seasonal Affective Disorder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1435 | Secondary tic | FAERS: 1 | US FAERS | |
| 1436 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 1437 | Selective Mutism | FAERS: 1 | US FAERS | |
| 1438 | Self Mutilation | FAERS: 1 | US FAERS | |
| 1439 | Semen analysis abnormal | FAERS: 1 | US FAERS | |
| 1440 | Seminoma | FAERS: 1 | US FAERS | |
| 1441 | Senile dementia | FAERS: 1 | US FAERS | |
| 1442 | Separation Anxiety Disorder | FAERS: 1 | US FAERS | |
| 1443 | Seronegative arthritis | FAERS: 1 | US FAERS | |
| 1444 | Serum Sickness | FAERS: 1 | US FAERS | |
| 1445 | Sexually active | FAERS: 1 | US FAERS | |
| 1446 | Sigmoiditis | FAERS: 1 | US FAERS | |
| 1447 | Silent myocardial infarction | FAERS: 1 | US FAERS | |
| 1448 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 1449 | Sinus pain | FAERS: 1 | US FAERS | |
| 1450 | Sinus polyp | FAERS: 1 | US FAERS | |
| 1451 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 1452 | Skin tightness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1453 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 1454 | Slow speech | FAERS: 1 | US FAERS | |
| 1455 | Small intestinal anastomosis | FAERS: 1 | US FAERS | |
| 1456 | Social alcohol drinker | FAERS: 1 | US FAERS | |
| 1457 | Somatoform Disorder | FAERS: 1 | US FAERS | |
| 1458 | Sperm count decreased | FAERS: 1 | US FAERS | |
| 1459 | Spermatozoa abnormal | FAERS: 1 | US FAERS | |
| 1460 | Spina Bifida | FAERS: 1 | US FAERS | |
| 1461 | Spinal column injury | FAERS: 1 | US FAERS | |
| 1462 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 1463 | Stent malfunction | FAERS: 1 | US FAERS | |
| 1464 | Stillbirth | FAERS: 1 | US FAERS | |
| 1465 | Strabismus | FAERS: 1 | US FAERS | |
| 1466 | Streptococcus test positive | FAERS: 1 | US FAERS | |
| 1467 | Stridor | FAERS: 1 | US FAERS | |
| 1468 | Stubbornness | FAERS: 1 | US FAERS | |
| 1469 | Subcutaneous nodule | FAERS: 1 | US FAERS | |
| 1470 | Substance-induced mood disorder | FAERS: 1 | US FAERS | |
| 1471 | Suicide threat | FAERS: 1 | US FAERS | |
| 1472 | Superficial injury of eye | FAERS: 1 | US FAERS | |
| 1473 | Suture insertion | FAERS: 1 | US FAERS | |
| 1474 | Swollen tear duct | FAERS: 1 | US FAERS | |
| 1475 | Symmetrical drug-related intertriginous and flexural exanthema | FAERS: 1 | US FAERS | |
| 1476 | Therapeutic product effect decreased | FAERS: 1 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 1477 | Therapeutic product effect prolonged | FAERS: 1 | US FAERS | |
| 1478 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 1479 | Therapy change | FAERS: 1 | US FAERS | |
| 1480 | Thirst decreased | FAERS: 1 | US FAERS | |
| 1481 | Thoracic outlet surgery | FAERS: 1 | US FAERS | |
| 1482 | Thrombectomy | FAERS: 1 | US FAERS | |
| 1483 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 1484 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 1485 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 1486 | Toe operation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1487 | Tongue movement disturbance | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1488 | Tongue spasm | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1489 | Total cholesterol/HDL ratio decreased | FAERS: 1 | US FAERS | |
| 1490 | Total lung capacity increased | FAERS: 1 | US FAERS | |
| 1491 | Transcription medication error | FAERS: 1 | US FAERS | |
| 1492 | Transient psychosis | FAERS: 1 | US FAERS | |
| 1493 | Trisomy 21 | FAERS: 1 | US FAERS | |
| 1494 | Troponin increased | FAERS: 1 | US FAERS | |
| 1495 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 1496 | Typhoid Fever | FAERS: 1 | US FAERS | |
| 1497 | Ultrasound scan abnormal | FAERS: 1 | US FAERS | |
| 1498 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 1499 | Urethral abscess | FAERS: 1 | US FAERS | |
| 1500 | Urethral perforation | FAERS: 1 | US FAERS | |
| 1501 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 1502 | Urine alcohol test positive | FAERS: 1 | US FAERS | |
| 1503 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 1504 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 1505 | Uveitis | FAERS: 1 | US FAERS | |
| 1506 | Vascular insufficiency | FAERS: 1 | US FAERS | |
| 1507 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 1508 | Vascular pain | FAERS: 1 | US FAERS | |
| 1509 | Vasospasm | FAERS: 1 | US FAERS | |
| 1510 | Vein pain | FAERS: 1 | US FAERS | |
| 1511 | Vena cava injury | FAERS: 1 | US FAERS | |
| 1512 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 1513 | Verbigeration | FAERS: 1 | US FAERS | |
| 1514 | Victim of sexual abuse | FAERS: 1 | US FAERS | |
| 1515 | Viral load increased | FAERS: 1 | US FAERS | |
| 1516 | Viral pharyngitis | FAERS: 1 | US FAERS | |
| 1517 | Visual acuity tests abnormal | FAERS: 1 | US FAERS | |
| 1518 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 1519 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 1520 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 1521 | Vulvovaginal rash | FAERS: 1 | US FAERS | |
| 1522 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 1523 | Wart excision | FAERS: 1 | US FAERS | |
| 1524 | White matter lesion | FAERS: 1 | US FAERS | |
| 1525 | skin abrasion | FAERS: 1 | US FAERS | |
| 1526 | Cardiac Death | Canada Vigilance: 1 | Canada Vigilance | |
| 1527 | Coma scale abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 1528 | Drug resistance | Canada Vigilance: 1 | Canada Vigilance | |
| 1529 | Eyelids pruritus | Canada Vigilance: 1 | Canada Vigilance | |
| 1530 | Hypertrophy of tongue papillae | Canada Vigilance: 1 | Canada Vigilance | |
| 1531 | Onychalgia | Canada Vigilance: 1 | Canada Vigilance | |
| 1532 | Paradoxical drug reaction | Canada Vigilance: 1 | Canada Vigilance | |
| 1533 | Paternal exposure during pregnancy | Canada Vigilance: 1 | Canada Vigilance | |
| 1534 | Personality change due to a general medical condition | Canada Vigilance: 1 | Canada Vigilance | |
| 1535 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 1536 | Product physical issue | Canada Vigilance: 1 | Canada Vigilance | |
| 1537 | Product residue present | Canada Vigilance: 1 | Canada Vigilance | |
| 1538 | Radiation associated pain | Canada Vigilance: 1 | Canada Vigilance | |
| 1539 | Sadism | Canada Vigilance: 1 | Canada Vigilance | |
| 1540 | Swelling of eyelid | Canada Vigilance: 2 | Canada Vigilance | |
| 1541 | Tongue erythema | Canada Vigilance: 1 | Canada Vigilance | |
| 1542 | Urine ketone body present | Canada Vigilance: 1 | Canada Vigilance | |
| 1543 | Vaginal exfoliation | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.