Levofloxacin
(GSDSWSVVBLHKDQ-JTQLQIEISA-N)
Structure
- SMILES
- CN1CCN(CC1)c1c(F)cc2c3c1OC[C@@H](n3cc(c2=O)C(=O)O)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- A02BD10; J01MA12; J01RA05; S01AE05
- Molecular Formula:
- C18H20FN3O4
- Molecular Weight:
- 361.368
- Log P:
- 1.5469
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 1
- TPSA:
- 75.01
- CAS Number(s):
- 100986-85-4
Synonym(s)
1.
Levofloxacin
2.
Levaquin
3.
Levofloxacin Anhydrous
4.
Ofloxacin, (S)-Isomer
5.
Quixin
6.
Anhydrous, Levofloxacin
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Aortic Aneurysm | FAERS: 1828 | US FAERS | |
| 2 | Arthralgia | FAERS: 1786 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 3 | Rotator cuff syndrome | FAERS: 1047 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 4 | Pain | FAERS: 875 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 5 | Myalgia | FAERS: 805 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 6 | Dizziness | FAERS: 587 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 7 | Musculoskeletal Pain | FAERS: 538 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 8 | Asthenia | FAERS: 517 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 9 | Anxiety | FAERS: 506 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 10 | Nausea | FAERS: 494 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 11 | Fatigue | FAERS: 470 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 12 | Headache | FAERS: 466 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 13 | Pruritus | FAERS: 406 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 14 | Joint swelling | FAERS: 388 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 15 | Urticaria | FAERS: 354 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 16 | Feeling abnormal | FAERS: 326 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Tremor | FAERS: 326 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 18 | Burning sensation | FAERS: 304 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 19 | Hypersensitivity | FAERS: 297 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Back Pain | FAERS: 293 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 21 | Abasia | FAERS: 289 | US FAERS | |
| 22 | Joint injury | FAERS: 278 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Erythema | FAERS: 268 | US FAERS | |
| 24 | Malaise | FAERS: 261 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Vomiting | FAERS: 254 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 26 | Tenosynovitis | FAERS: 251 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 27 | Palpitations | FAERS: 241 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 28 | Swelling | FAERS: 235 | US FAERS | |
| 29 | Drug ineffective | FAERS: 234 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 30 | Musculoskeletal stiffness | FAERS: 225 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Tinnitus | FAERS: 214 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Epicondylitis | FAERS: 211 | US FAERS | |
| 33 | Visual Impairment | FAERS: 207 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Arthropathy | FAERS: 194 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 35 | Impaired work ability | FAERS: 191 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Bursitis | FAERS: 188 | US FAERS | |
| 37 | Ligament rupture | FAERS: 179 | US FAERS | |
| 38 | Chest Pain | FAERS: 172 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Activities of daily living impaired | FAERS: 168 | US FAERS | |
| 40 | nervous system disorder | FAERS: 142 | US FAERS | |
| 41 | Neck Pain | FAERS: 139 | US FAERS | |
| 42 | Weight decreased | FAERS: 137 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 43 | Arthritis | FAERS: 134 | US FAERS | |
| 44 | Abdominal Pain | FAERS: 129 | US FAERS | |
| 45 | Tachycardia | FAERS: 125 | US FAERS | |
| 46 | Joint stiffness | FAERS: 116 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Stevens-Johnson Syndrome | FAERS: 116 Canada Vigilance: 2 | 25811541 | CTD Canada Vigilance US FAERS |
| 48 | Adverse event | FAERS: 112 | US FAERS | |
| 49 | Chills | FAERS: 110 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Carpal Tunnel Syndrome | FAERS: 104 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Memory impairment | FAERS: 95 | US FAERS | |
| 52 | Agitation | FAERS: 92 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Delirium | FAERS: 89 | US FAERS | |
| 54 | Disorientation | FAERS: 86 | US FAERS | |
| 55 | Restlessness | FAERS: 85 | US FAERS | |
| 56 | Disability | FAERS: 83 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Alopecia | FAERS: 82 | US FAERS | |
| 58 | Amnesia | FAERS: 82 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Dysgeusia | FAERS: 81 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 60 | Periarthritis | FAERS: 81 | US FAERS | |
| 61 | Peripheral swelling | FAERS: 78 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 62 | Nervousness | FAERS: 77 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 63 | Chest discomfort | FAERS: 75 | US FAERS | |
| 64 | Hypotension | FAERS: 75 | US FAERS | |
| 65 | Abdominal discomfort | FAERS: 74 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 66 | Joint Range of Motion Decreased | FAERS: 74 | US FAERS | |
| 67 | Rash erythematous | FAERS: 72 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 68 | Syncope | FAERS: 72 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Toxicity to various agents | FAERS: 72 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Nerve injury | FAERS: 71 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | Muscle tightness | FAERS: 70 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 72 | Dehydration | FAERS: 67 | US FAERS | |
| 73 | Vertigo | FAERS: 66 | US FAERS | |
| 74 | Constipation | FAERS: 63 | US FAERS | |
| 75 | Bedridden | FAERS: 61 | US FAERS | |
| 76 | Crying | FAERS: 61 | US FAERS | |
| 77 | Inflammation | FAERS: 61 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 78 | Atrial Fibrillation | FAERS: 60 | US FAERS | |
| 79 | Dysphonia | FAERS: 59 | US FAERS | |
| 80 | Eye pain | FAERS: 58 | US FAERS | |
| 81 | Neuralgia | FAERS: 58 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 82 | Ageusia | FAERS: 57 | US FAERS | |
| 83 | Pneumonia | FAERS: 57 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 84 | Angioedema | FAERS: 56 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 85 | Bone pain | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 86 | Muscle strain | FAERS: 56 | US FAERS | |
| 87 | Toxic Epidermal Necrolysis | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 88 | Anaphylactic shock | FAERS: 55 | US FAERS | |
| 89 | Fibromyalgia | FAERS: 55 | US FAERS | |
| 90 | muscle injury | FAERS: 55 | US FAERS | |
| 91 | Impaired driving ability | FAERS: 54 | US FAERS | |
| 92 | Discomfort | FAERS: 52 | US FAERS | |
| 93 | Somnolence | FAERS: 50 | US FAERS | |
| 94 | Unevaluable event | FAERS: 50 | US FAERS | |
| 95 | Blindness | FAERS: 49 | US FAERS | |
| 96 | Deafness | FAERS: 49 | US FAERS | |
| 97 | Flushing | FAERS: 49 | US FAERS | |
| 98 | Lip swelling | FAERS: 49 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 99 | Presyncope | FAERS: 49 | US FAERS | |
| 100 | Synovitis | FAERS: 47 | US FAERS | |
| 101 | Anorexia | FAERS: 46 | US FAERS | |
| 102 | Joint sprain | FAERS: 46 | US FAERS | |
| 103 | Respiratory distress | FAERS: 46 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 104 | Cartilage injury | FAERS: 45 | US FAERS | |
| 105 | Infection | FAERS: 45 | US FAERS | |
| 106 | Product quality issue | FAERS: 45 | US FAERS | |
| 107 | Walking aid user | FAERS: 45 | US FAERS | |
| 108 | Paranoia | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 109 | Respiratory Failure | FAERS: 44 | US FAERS | |
| 110 | Sinusitis | FAERS: 43 | US FAERS | |
| 111 | Stress | FAERS: 43 | US FAERS | |
| 112 | Dyspepsia | FAERS: 42 | US FAERS | |
| 113 | Anosmia | FAERS: 41 | US FAERS | |
| 114 | Cardiac Arrest | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 115 | Hypokinesia | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 116 | Kounis Syndrome | FAERS: 41 | US FAERS | |
| 117 | Night sweats | FAERS: 41 | US FAERS | |
| 118 | Quality of life decreased | FAERS: 41 | US FAERS | |
| 119 | Overdose | FAERS: 40 | US FAERS | |
| 120 | Infusion site erythema | FAERS: 39 | US FAERS | |
| 121 | Myoclonus | FAERS: 39 | US FAERS | |
| 122 | Rhabdomyolysis | FAERS: 39 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 123 | Gait inability | FAERS: 38 | US FAERS | |
| 124 | Lethargy | FAERS: 38 | US FAERS | |
| 125 | Cerebrovascular accident | FAERS: 37 | US FAERS | |
| 126 | Musculoskeletal discomfort | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Myositis | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 128 | Rheumatoid Arthritis | FAERS: 37 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 129 | Anger | FAERS: 36 | US FAERS | |
| 130 | General physical health deterioration | FAERS: 36 | US FAERS | |
| 131 | Thermal burn | FAERS: 36 | US FAERS | |
| 132 | Deep Vein Thrombosis | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 133 | Drug resistance | FAERS: 35 | US FAERS | |
| 134 | Thrombosis | FAERS: 35 | US FAERS | |
| 135 | Incorrect dose administered | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 136 | Limb injury | FAERS: 34 | US FAERS | |
| 137 | Urinary tract infection | FAERS: 34 | US FAERS | |
| 138 | Limb discomfort | FAERS: 33 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 139 | Middle insomnia | FAERS: 33 | US FAERS | |
| 140 | Photophobia | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 141 | Visual disturbance | FAERS: 33 | US FAERS | |
| 142 | Grip strength decreased | FAERS: 32 | US FAERS | |
| 143 | Mental status changes | FAERS: 32 | US FAERS | |
| 144 | Oropharyngeal pain | FAERS: 32 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 145 | Aphasia | FAERS: 31 | US FAERS | |
| 146 | Drug toxicity | FAERS: 31 | US FAERS | |
| 147 | Pulmonary Embolism | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 148 | Sepsis | FAERS: 31 | US FAERS | |
| 149 | Cold sweat | FAERS: 30 | US FAERS | |
| 150 | Diplopia | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Injection site erythema | FAERS: 30 | US FAERS | |
| 152 | Thrombocytopenia | FAERS: 30 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 153 | Bronchospasm | FAERS: 29 | US FAERS | |
| 154 | Medication Error | FAERS: 29 | US FAERS | |
| 155 | Polyneuropathy | FAERS: 29 | US FAERS | |
| 156 | Shock | FAERS: 29 | US FAERS | |
| 157 | Vitreous floaters | FAERS: 29 | US FAERS | |
| 158 | Asthma | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 159 | Epilepsy | FAERS: 28 | US FAERS | |
| 160 | Myocardial Infarction | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 161 | Back disorder | FAERS: 27 | US FAERS | |
| 162 | Emotional disorder | FAERS: 27 | US FAERS | |
| 163 | Bronchitis | FAERS: 26 | US FAERS | |
| 164 | Skin lesion | FAERS: 26 | US FAERS | |
| 165 | Status Epilepticus | FAERS: 26 | US FAERS | |
| 166 | Alanine Aminotransferase Increased | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 167 | Blood glucose decreased | FAERS: 25 | US FAERS | |
| 168 | Dysuria | FAERS: 25 | US FAERS | |
| 169 | Influenza | FAERS: 25 | US FAERS | |
| 170 | Internal injury | FAERS: 25 | US FAERS | |
| 171 | Meniscus injury | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 172 | Musculoskeletal chest pain | FAERS: 25 | US FAERS | |
| 173 | Temperature intolerance | FAERS: 25 | US FAERS | |
| 174 | Urinary Incontinence | FAERS: 25 | US FAERS | |
| 175 | Wheezing | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 176 | Chromaturia | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 177 | Drug prescribing error | FAERS: 24 | US FAERS | |
| 178 | Loss of personal independence in daily activities | FAERS: 24 | US FAERS | |
| 179 | Retching | FAERS: 24 | US FAERS | |
| 180 | Blood glucose increased | FAERS: 23 | US FAERS | |
| 181 | Colitis | FAERS: 23 | US FAERS | |
| 182 | Depressed Level of Consciousness | FAERS: 23 | US FAERS | |
| 183 | Drug dose omission | FAERS: 23 | US FAERS | |
| 184 | Hypophagia | FAERS: 23 | US FAERS | |
| 185 | Pallor | FAERS: 23 | US FAERS | |
| 186 | Wheelchair user | FAERS: 23 | US FAERS | |
| 187 | Acute kidney injury | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 188 | Feeling Cold | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 189 | Injection site pruritus | FAERS: 22 | US FAERS | |
| 190 | Mental impairment | FAERS: 22 | US FAERS | |
| 191 | Product use issue | FAERS: 22 | US FAERS | |
| 192 | Blood creatinine increased | FAERS: 21 | US FAERS | |
| 193 | Dysarthria | FAERS: 21 | US FAERS | |
| 194 | Eosinophilia | FAERS: 21 | US FAERS | |
| 195 | Feeling of body temperature change | FAERS: 21 | US FAERS | |
| 196 | Flatulence | FAERS: 21 | US FAERS | |
| 197 | Ligament injury | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 198 | Muscle Fatigue | FAERS: 21 | US FAERS | |
| 199 | Pneumonitis | FAERS: 21 | US FAERS | |
| 200 | Stomatitis | FAERS: 21 | US FAERS | |
| 201 | Tendon discomfort | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 202 | jaundice | FAERS: 21 | US FAERS | |
| 203 | treatment failure | FAERS: 21 | US FAERS | |
| 204 | Cholestasis | FAERS: 20 | US FAERS | |
| 205 | Dry skin | FAERS: 20 | US FAERS | |
| 206 | Emotional distress | FAERS: 20 | US FAERS | |
| 207 | Feeling jittery | FAERS: 20 | US FAERS | |
| 208 | Formication | FAERS: 20 | US FAERS | |
| 209 | Hyperventilation | FAERS: 20 | US FAERS | |
| 210 | Vanishing bile duct syndrome | FAERS: 20 | US FAERS | |
| 211 | Depressed mood | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 212 | Drug exposure during pregnancy | FAERS: 19 | US FAERS | |
| 213 | Hypoxia | FAERS: 19 | US FAERS | |
| 214 | Inappropriate schedule of drug administration | FAERS: 19 | US FAERS | |
| 215 | Leukopenia | FAERS: 19 | US FAERS | |
| 216 | Pharmaceutical product complaint | FAERS: 19 | US FAERS | |
| 217 | Post-Traumatic Stress Disorder | FAERS: 19 | US FAERS | |
| 218 | Ankle Fracture | FAERS: 18 | US FAERS | |
| 219 | Aspartate Aminotransferase Increased | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 220 | Bradycardia | FAERS: 18 | US FAERS | |
| 221 | Ear discomfort | FAERS: 18 | US FAERS | |
| 222 | Eye irritation | FAERS: 18 | US FAERS | |
| 223 | Gout | FAERS: 18 | US FAERS | |
| 224 | Immobile | FAERS: 18 | US FAERS | |
| 225 | Infusion site pruritus | FAERS: 18 | US FAERS | |
| 226 | Ligament pain | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 227 | Muscle Rigidity | FAERS: 18 | US FAERS | |
| 228 | Shoulder Pain | FAERS: 18 | US FAERS | |
| 229 | Throat irritation | FAERS: 18 | US FAERS | |
| 230 | Ventricular Fibrillation | FAERS: 18 | US FAERS | |
| 231 | Abscess | FAERS: 17 | US FAERS | |
| 232 | Unresponsive to stimuli | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 233 | Altered state of consciousness | FAERS: 16 | US FAERS | |
| 234 | Blood alkaline phosphatase increased | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 235 | Blood potassium decreased | FAERS: 16 | US FAERS | |
| 236 | Clostridium difficile colitis | FAERS: 16 | US FAERS | |
| 237 | Eosinophilic Pneumonia | FAERS: 16 | US FAERS | |
| 238 | Gastritis | FAERS: 16 | US FAERS | |
| 239 | Hepatitis | FAERS: 16 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 240 | Hyperacusis | FAERS: 16 | US FAERS | |
| 241 | Neutropenia | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 242 | Oral pain | FAERS: 16 | US FAERS | |
| 243 | Poor quality sleep | FAERS: 16 | US FAERS | |
| 244 | Product substitution issue | FAERS: 16 | US FAERS | |
| 245 | Skin Ulcer | FAERS: 16 | US FAERS | |
| 246 | Thirst | FAERS: 16 | US FAERS | |
| 247 | Blood creatine phosphokinase increased | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 248 | Extravasation | FAERS: 15 | US FAERS | |
| 249 | Induration | FAERS: 15 | US FAERS | |
| 250 | Lymphadenopathy | FAERS: 15 | US FAERS | |
| 251 | Multiple allergies | FAERS: 15 | US FAERS | |
| 252 | Neuropathy | FAERS: 15 | US FAERS | |
| 253 | Product use in unapproved indication | FAERS: 15 | US FAERS | |
| 254 | Psychiatric symptom | FAERS: 15 | US FAERS | |
| 255 | Synovial Cyst | FAERS: 15 | US FAERS | |
| 256 | White blood cell count decreased | FAERS: 15 | US FAERS | |
| 257 | Acute psychosis | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 258 | Bipolar Disorder | FAERS: 14 | US FAERS | |
| 259 | Choking sensation | FAERS: 14 | US FAERS | |
| 260 | Economic problem | FAERS: 14 | US FAERS | |
| 261 | Erythema Multiforme | FAERS: 14 | US FAERS | |
| 262 | Hyperpyrexia | FAERS: 14 | US FAERS | |
| 263 | Infusion Site Extravasation | FAERS: 14 | US FAERS | |
| 264 | Infusion site pain | FAERS: 14 | US FAERS | |
| 265 | Multiple Sclerosis | FAERS: 14 | US FAERS | |
| 266 | Pain of skin | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 267 | Pathogen resistance | FAERS: 14 | US FAERS | |
| 268 | Restless Legs Syndrome | FAERS: 14 | US FAERS | |
| 269 | Septic Shock | FAERS: 14 | US FAERS | |
| 270 | Cellulitis | FAERS: 13 | US FAERS | |
| 271 | Eosinophilic myocarditis | FAERS: 13 | US FAERS | |
| 272 | Epistaxis | FAERS: 13 | US FAERS | |
| 273 | Foreign body aspiration | FAERS: 13 | US FAERS | |
| 274 | Infusion site rash | FAERS: 13 | US FAERS | |
| 275 | Mood swings | FAERS: 13 | US FAERS | |
| 276 | Optic Neuritis | FAERS: 13 | US FAERS | |
| 277 | Phlebitis | FAERS: 13 | US FAERS | |
| 278 | Poisoning | FAERS: 13 | US FAERS | |
| 279 | Retinal Detachment | FAERS: 13 | US FAERS | |
| 280 | Sunburn | FAERS: 13 | US FAERS | |
| 281 | Acute respiratory failure | FAERS: 12 | US FAERS | |
| 282 | Blepharospasm | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 283 | Clostridium difficile infection | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 284 | Completed Suicide | FAERS: 12 | US FAERS | |
| 285 | Cyanosis | FAERS: 12 | US FAERS | |
| 286 | Dementia | FAERS: 12 | US FAERS | |
| 287 | Hypersomnia | FAERS: 12 | US FAERS | |
| 288 | Initial insomnia | FAERS: 12 | US FAERS | |
| 289 | Leukocytosis | FAERS: 12 | US FAERS | |
| 290 | Myosclerosis | FAERS: 12 | US FAERS | |
| 291 | Nodule | FAERS: 12 | US FAERS | |
| 292 | Pharyngolaryngeal Pain | FAERS: 12 | US FAERS | |
| 293 | Product counterfeit | FAERS: 12 | US FAERS | |
| 294 | Purpura | FAERS: 12 | US FAERS | |
| 295 | Screaming | FAERS: 12 | US FAERS | |
| 296 | Angina Pectoris | FAERS: 11 | US FAERS | |
| 297 | Bursa injury | FAERS: 11 | US FAERS | |
| 298 | Choking | FAERS: 11 | US FAERS | |
| 299 | Cystitis | FAERS: 11 | US FAERS | |
| 300 | Ecchymosis | FAERS: 11 | US FAERS | |
| 301 | Gastrointestinal Pain | FAERS: 11 | US FAERS | |
| 302 | Head discomfort | FAERS: 11 | US FAERS | |
| 303 | Hepatotoxicity | FAERS: 11 | US FAERS | |
| 304 | Infusion site reaction | FAERS: 11 | US FAERS | |
| 305 | Post procedural complication | FAERS: 11 | US FAERS | |
| 306 | Respiratory arrest | FAERS: 11 | US FAERS | |
| 307 | Sensory level abnormal | FAERS: 11 | US FAERS | |
| 308 | Suicide attempt | FAERS: 11 | US FAERS | |
| 309 | Toothache | FAERS: 11 | US FAERS | |
| 310 | Acute myocardial infarction | FAERS: 10 | US FAERS | |
| 311 | Aphonia | FAERS: 10 | US FAERS | |
| 312 | Deformity | FAERS: 10 | US FAERS | |
| 313 | Diabetes Mellitus | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 314 | Drug administration error | FAERS: 10 | US FAERS | |
| 315 | Drug dispensing error | FAERS: 10 | US FAERS | |
| 316 | Gamma-Glutamyltransferase Increased | FAERS: 10 | US FAERS | |
| 317 | Hallucinations, mixed | FAERS: 10 | US FAERS | |
| 318 | Incoherent | FAERS: 10 | US FAERS | |
| 319 | Injection Site Reaction | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 320 | Myasthenia Gravis | FAERS: 10 | US FAERS | |
| 321 | Myopathy | FAERS: 10 | US FAERS | |
| 322 | Neuralgic Amyotrophy | FAERS: 10 | US FAERS | |
| 323 | Petechiae | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 324 | Polyarthritis | FAERS: 10 | US FAERS | |
| 325 | Skin reaction | FAERS: 10 | US FAERS | |
| 326 | Sneezing | FAERS: 10 | US FAERS | |
| 327 | Vasculitis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 328 | Vitreous Detachment | FAERS: 10 | US FAERS | |
| 329 | Accidental overdose | FAERS: 9 | US FAERS | |
| 330 | Anaphylactoid Reaction | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 331 | Blood pressure fluctuation | FAERS: 9 | US FAERS | |
| 332 | Blood sodium decreased | FAERS: 9 | US FAERS | |
| 333 | Blood urea increased | FAERS: 9 | US FAERS | |
| 334 | Cyst | FAERS: 9 | US FAERS | |
| 335 | Dermatitis | FAERS: 9 | US FAERS | |
| 336 | Dissociation | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 337 | Eczema | FAERS: 9 | US FAERS | |
| 338 | Erectile dysfunction | FAERS: 9 | US FAERS | |
| 339 | Genital burning sensation | FAERS: 9 | US FAERS | |
| 340 | Impaired quality of life | FAERS: 9 | US FAERS | |
| 341 | Neuritis | FAERS: 9 | US FAERS | |
| 342 | Osmotic demyelination syndrome | FAERS: 9 | US FAERS | |
| 343 | Renal pain | FAERS: 9 | US FAERS | |
| 344 | Sciatica | FAERS: 9 | US FAERS | |
| 345 | Supraventricular tachycardia | FAERS: 9 | US FAERS | |
| 346 | Time perception altered | FAERS: 9 | US FAERS | |
| 347 | Transaminases increased | FAERS: 9 | US FAERS | |
| 348 | Wrong technique in drug usage process | FAERS: 9 | US FAERS | |
| 349 | Ataxia | FAERS: 8 | US FAERS | |
| 350 | Blepharitis | FAERS: 8 | US FAERS | |
| 351 | Candidiasis | FAERS: 8 | US FAERS | |
| 352 | Cataract | FAERS: 8 | US FAERS | |
| 353 | Cholelithiasis | FAERS: 8 | US FAERS | |
| 354 | Disease recurrence | FAERS: 8 | US FAERS | |
| 355 | Diverticulitis | FAERS: 8 | US FAERS | |
| 356 | Drug abuse | FAERS: 8 | US FAERS | |
| 357 | Dystonia | FAERS: 8 | US FAERS | |
| 358 | Facial Pain | FAERS: 8 | US FAERS | |
| 359 | Guillain-Barre Syndrome | FAERS: 8 | US FAERS | |
| 360 | Hemiplegia | FAERS: 8 | US FAERS | |
| 361 | Hepatomegaly | FAERS: 8 | US FAERS | |
| 362 | Incontinence | FAERS: 8 | US FAERS | |
| 363 | Intentional drug misuse | FAERS: 8 | US FAERS | |
| 364 | Mitochondrial toxicity | FAERS: 8 | US FAERS | |
| 365 | Mixed liver injury | FAERS: 8 | US FAERS | |
| 366 | Multiple Chemical Sensitivity | FAERS: 8 | US FAERS | |
| 367 | Nasopharyngitis | FAERS: 8 | US FAERS | |
| 368 | Oral candidiasis | FAERS: 8 | US FAERS | |
| 369 | Oropharyngeal swelling | FAERS: 8 | US FAERS | |
| 370 | Pancreatic enzymes increased | FAERS: 8 | US FAERS | |
| 371 | Pancreatitis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 372 | Purpura Fulminans | FAERS: 8 | US FAERS | |
| 373 | Sinus Tachycardia | FAERS: 8 | US FAERS | |
| 374 | Therapy non-responder | FAERS: 8 | US FAERS | |
| 375 | Vulvovaginal mycotic infection | FAERS: 8 | US FAERS | |
| 376 | Anuria | FAERS: 7 | US FAERS | |
| 377 | Aphagia | FAERS: 7 | US FAERS | |
| 378 | Autoimmune hepatitis | FAERS: 7 | US FAERS | |
| 379 | Autonomic nervous system imbalance | FAERS: 7 | US FAERS | |
| 380 | Bronchial Obstruction | FAERS: 7 | US FAERS | |
| 381 | Candida endophthalmitis | FAERS: 7 | US FAERS | |
| 382 | Dysentery | FAERS: 7 | US FAERS | |
| 383 | Electrolyte imbalance | FAERS: 7 | US FAERS | |
| 384 | Eructation | FAERS: 7 | US FAERS | |
| 385 | Erythema Nodosum | FAERS: 7 | US FAERS | |
| 386 | Food Allergy | FAERS: 7 | US FAERS | |
| 387 | Frustration | FAERS: 7 | US FAERS | |
| 388 | Hernia | FAERS: 7 | US FAERS | |
| 389 | Hoarseness | FAERS: 7 | US FAERS | |
| 390 | Hypoaesthesia facial | FAERS: 7 | US FAERS | |
| 391 | Irritable Bowel Syndrome | FAERS: 7 | US FAERS | |
| 392 | Lymphomatoid Papulosis | FAERS: 7 | US FAERS | |
| 393 | Monoplegia | FAERS: 7 | US FAERS | |
| 394 | Muscle Cramp | FAERS: 7 | US FAERS | |
| 395 | No adverse event | FAERS: 7 | US FAERS | |
| 396 | No reaction on previous exposure to drug | FAERS: 7 | US FAERS | |
| 397 | Nodular rash | FAERS: 7 | US FAERS | |
| 398 | Obsessive-Compulsive Disorder | FAERS: 7 | US FAERS | |
| 399 | Ocular icterus | FAERS: 7 | US FAERS | |
| 400 | Papule | FAERS: 7 | US FAERS | |
| 401 | Polymyalgia Rheumatica | FAERS: 7 | US FAERS | |
| 402 | Poor peripheral circulation | FAERS: 7 | US FAERS | |
| 403 | Prescribed overdose | FAERS: 7 | US FAERS | |
| 404 | Splenomegaly | FAERS: 7 | US FAERS | |
| 405 | Tongue discomfort | FAERS: 7 | US FAERS | |
| 406 | Vocal Cord Paralysis | FAERS: 7 | US FAERS | |
| 407 | Wrong technique in product usage process | FAERS: 7 | US FAERS | |
| 408 | Akinesia | FAERS: 6 | US FAERS | |
| 409 | Allodynia | FAERS: 6 | US FAERS | |
| 410 | Atelectasis | FAERS: 6 | US FAERS | |
| 411 | Blood cholesterol increased | FAERS: 6 | US FAERS | |
| 412 | Blood urine present | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 413 | Cardiac Flutter | FAERS: 6 | US FAERS | |
| 414 | Clostridium colitis | FAERS: 6 | US FAERS | |
| 415 | Conjunctivitis | FAERS: 6 | US FAERS | |
| 416 | Conversion disorder | FAERS: 6 | US FAERS | |
| 417 | Disseminated Intravascular Coagulation | FAERS: 6 | US FAERS | |
| 418 | Drug ineffective for unapproved indication | FAERS: 6 | US FAERS | |
| 419 | Dysgraphia | FAERS: 6 | US FAERS | |
| 420 | Electrocardiogram QT interval abnormal | FAERS: 6 | US FAERS | |
| 421 | Escherichia sepsis | FAERS: 6 | US FAERS | |
| 422 | Euphoric mood | FAERS: 6 | US FAERS | |
| 423 | Exophthalmos | FAERS: 6 | US FAERS | |
| 424 | Expired product administered | FAERS: 6 | US FAERS | |
| 425 | Fixed drug eruption | FAERS: 6 | US FAERS | |
| 426 | Gangrene | FAERS: 6 | US FAERS | |
| 427 | General physical condition decreased | FAERS: 6 | US FAERS | |
| 428 | Graft infection | FAERS: 6 | US FAERS | |
| 429 | Head titubation | FAERS: 6 | US FAERS | |
| 430 | Hypertransaminasaemia | FAERS: 6 | US FAERS | |
| 431 | Hypogeusia | FAERS: 6 | US FAERS | |
| 432 | Inadequate analgesia | FAERS: 6 | US FAERS | |
| 433 | Injection site extravasation | FAERS: 6 | US FAERS | |
| 434 | Laceration | FAERS: 6 | US FAERS | |
| 435 | Leukocytoclastic vasculitis | FAERS: 6 | US FAERS | |
| 436 | Lupus-like syndrome | FAERS: 6 | US FAERS | |
| 437 | Malnutrition | FAERS: 6 | US FAERS | |
| 438 | Mouth swelling | FAERS: 6 | US FAERS | |
| 439 | Nonspecific reaction | FAERS: 6 | US FAERS | |
| 440 | Pancytopenia | FAERS: 6 | US FAERS | |
| 441 | Personality Change | FAERS: 6 | US FAERS | |
| 442 | Physical disability | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 443 | Pneumothorax | FAERS: 6 | US FAERS | |
| 444 | Prurigo | FAERS: 6 | US FAERS | |
| 445 | Radial nerve palsy | FAERS: 6 | US FAERS | |
| 446 | Rhonchi | FAERS: 6 | US FAERS | |
| 447 | Sense of oppression | FAERS: 6 | US FAERS | |
| 448 | Skeletal injury | FAERS: 6 | US FAERS | |
| 449 | Skin laceration | FAERS: 6 | US FAERS | |
| 450 | Sleep disorder due to general medical condition, insomnia type | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 451 | Sopor | FAERS: 6 | US FAERS | |
| 452 | Stasis dermatitis | FAERS: 6 | US FAERS | |
| 453 | Stridor | FAERS: 6 | US FAERS | |
| 454 | Tarsal Tunnel Syndrome | FAERS: 6 | US FAERS | |
| 455 | Torticollis | FAERS: 6 | US FAERS | |
| 456 | Troponin increased | FAERS: 6 | US FAERS | |
| 457 | Urinary Retention | FAERS: 6 | US FAERS | |
| 458 | VIIth nerve paralysis | FAERS: 6 | US FAERS | |
| 459 | Vascular purpura | FAERS: 6 | US FAERS | |
| 460 | Ventricular arrhythmia | FAERS: 6 | US FAERS | |
| 461 | Wrong drug administered | FAERS: 6 | US FAERS | |
| 462 | Acne | FAERS: 5 | US FAERS | |
| 463 | Apathy | FAERS: 5 | US FAERS | |
| 464 | Apparent death | FAERS: 5 | US FAERS | |
| 465 | Asthenopia | FAERS: 5 | US FAERS | |
| 466 | Blood blister | FAERS: 5 | US FAERS | |
| 467 | Blood glucose abnormal | FAERS: 5 | US FAERS | |
| 468 | Blood glucose fluctuation | FAERS: 5 | US FAERS | |
| 469 | Bunion | FAERS: 5 | US FAERS | |
| 470 | Capillaritis | FAERS: 5 | US FAERS | |
| 471 | Cardiac discomfort | FAERS: 5 | US FAERS | |
| 472 | Cardiac ventricular thrombosis | FAERS: 5 | US FAERS | |
| 473 | Cerebral Infarction | FAERS: 5 | US FAERS | |
| 474 | Clonus | FAERS: 5 | US FAERS | |
| 475 | Crystal nephropathy | FAERS: 5 | US FAERS | |
| 476 | Disease Progression | FAERS: 5 | US FAERS | |
| 477 | Electrocardiogram abnormal | FAERS: 5 | US FAERS | |
| 478 | Electroencephalogram abnormal | FAERS: 5 | US FAERS | |
| 479 | Enterocolitis bacterial | FAERS: 5 | US FAERS | |
| 480 | Febrile Neutropenia | FAERS: 5 | US FAERS | |
| 481 | Fixed eruption | FAERS: 5 | US FAERS | |
| 482 | Fracture | FAERS: 5 | US FAERS | |
| 483 | Gastrointestinal motility disorder | FAERS: 5 | US FAERS | |
| 484 | Gaze palsy | FAERS: 5 | US FAERS | |
| 485 | General physical condition abnormal | FAERS: 5 | US FAERS | |
| 486 | Impaired self-care | FAERS: 5 | US FAERS | |
| 487 | Incorrect drug administration rate | FAERS: 5 | US FAERS | |
| 488 | Increased tendency to bruise | FAERS: 5 | US FAERS | |
| 489 | Iron deficiency | FAERS: 5 | US FAERS | |
| 490 | Joint warmth | FAERS: 5 | US FAERS | |
| 491 | Laryngospasm | FAERS: 5 | US FAERS | |
| 492 | Lichen Planus | FAERS: 5 | US FAERS | |
| 493 | Ligamentitis | FAERS: 5 | US FAERS | |
| 494 | Mitochondrial cytopathy | FAERS: 5 | US FAERS | |
| 495 | Morbid thoughts | FAERS: 5 | US FAERS | |
| 496 | Mydriasis | FAERS: 5 | US FAERS | |
| 497 | Obstruction | FAERS: 5 | US FAERS | |
| 498 | Open wound | FAERS: 5 | US FAERS | |
| 499 | Panic Disorder | FAERS: 5 | US FAERS | |
| 500 | Pelvic Pain | FAERS: 5 | US FAERS | |
| 501 | Peripheral artery thrombosis | FAERS: 5 | US FAERS | |
| 502 | Posterior capsule rupture | FAERS: 5 | US FAERS | |
| 503 | Product label issue | FAERS: 5 | US FAERS | |
| 504 | Quadriparesis | FAERS: 5 | US FAERS | |
| 505 | Retinal Vein Occlusion | FAERS: 5 | US FAERS | |
| 506 | Stupor | FAERS: 5 | US FAERS | |
| 507 | Therapeutic product cross-reactivity | FAERS: 5 | US FAERS | |
| 508 | Trismus | FAERS: 5 | US FAERS | |
| 509 | Ulnar tunnel syndrome | FAERS: 5 | US FAERS | |
| 510 | Urinary hesitation | FAERS: 5 | US FAERS | |
| 511 | Vascular rupture | FAERS: 5 | US FAERS | |
| 512 | Vibratory sense increased | FAERS: 5 | US FAERS | |
| 513 | Vitreous opacities | FAERS: 5 | US FAERS | |
| 514 | pseudomembranous colitis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 515 | Acute polyneuropathy | FAERS: 4 | US FAERS | |
| 516 | Amyotrophic Lateral Sclerosis | FAERS: 4 | US FAERS | |
| 517 | Aneurysm | FAERS: 4 | US FAERS | |
| 518 | Anorectal discomfort | FAERS: 4 | US FAERS | |
| 519 | Ascites | FAERS: 4 | US FAERS | |
| 520 | Asphyxia | FAERS: 4 | US FAERS | |
| 521 | Band sensation | FAERS: 4 | US FAERS | |
| 522 | Bed rest | FAERS: 4 | US FAERS | |
| 523 | Blood creatine increased | FAERS: 4 | US FAERS | |
| 524 | Bradyphrenia | FAERS: 4 | US FAERS | |
| 525 | Central nervous system lesion | FAERS: 4 | US FAERS | |
| 526 | Cerebral disorder | FAERS: 4 | US FAERS | |
| 527 | Cheilitis | FAERS: 4 | US FAERS | |
| 528 | Chronic Fatigue Syndrome | FAERS: 4 | US FAERS | |
| 529 | Contraindicated drug administered | FAERS: 4 | US FAERS | |
| 530 | Documented hypersensitivity to administered drug | FAERS: 4 | US FAERS | |
| 531 | Enthesopathy | FAERS: 4 | US FAERS | |
| 532 | Full blood count abnormal | FAERS: 4 | US FAERS | |
| 533 | Gastroenteritis | FAERS: 4 | US FAERS | |
| 534 | Glossitis | FAERS: 4 | US FAERS | |
| 535 | Hepatic necrosis | FAERS: 4 | US FAERS | |
| 536 | Hormone level abnormal | FAERS: 4 | US FAERS | |
| 537 | Hypermobility syndrome | FAERS: 4 | US FAERS | |
| 538 | Hypertensive crisis | FAERS: 4 | US FAERS | |
| 539 | Hypothyroidism | FAERS: 4 | US FAERS | |
| 540 | Infusion site swelling | FAERS: 4 | US FAERS | |
| 541 | Infusion site urticaria | FAERS: 4 | US FAERS | |
| 542 | Macroglossia | FAERS: 4 | US FAERS | |
| 543 | Muscle Spasticity | FAERS: 4 | US FAERS | |
| 544 | Negative thoughts | FAERS: 4 | US FAERS | |
| 545 | Nephrolithiasis | FAERS: 4 | US FAERS | |
| 546 | Ophthalmoplegia | FAERS: 4 | US FAERS | |
| 547 | Orthosis user | FAERS: 4 | US FAERS | |
| 548 | Palmar erythema | FAERS: 4 | US FAERS | |
| 549 | Papilloma | FAERS: 4 | US FAERS | |
| 550 | Pharyngitis | FAERS: 4 | US FAERS | |
| 551 | Platelet aggregation abnormal | FAERS: 4 | US FAERS | |
| 552 | Polymyositis | FAERS: 4 | US FAERS | |
| 553 | Post-traumatic pain | FAERS: 4 | US FAERS | |
| 554 | Product size issue | FAERS: 4 | US FAERS | |
| 555 | Productive Cough | FAERS: 4 | US FAERS | |
| 556 | Proteinuria | FAERS: 4 | US FAERS | |
| 557 | Psoriasis | FAERS: 4 | US FAERS | |
| 558 | Rectal tenesmus | FAERS: 4 | US FAERS | |
| 559 | Scab | FAERS: 4 | US FAERS | |
| 560 | Serum Sickness | FAERS: 4 | US FAERS | |
| 561 | Similar reaction on previous exposure to drug | FAERS: 4 | US FAERS | |
| 562 | Skin tightness | FAERS: 4 | US FAERS | |
| 563 | Vitamin D Deficiency | FAERS: 4 | US FAERS | |
| 564 | Vulvovaginal pruritus | FAERS: 4 | US FAERS | |
| 565 | White matter lesion | FAERS: 4 | US FAERS | |
| 566 | effusion | FAERS: 4 | US FAERS | |
| 567 | furuncle | FAERS: 4 | US FAERS | |
| 568 | Abdominal rigidity | FAERS: 3 | US FAERS | |
| 569 | Abdominal tenderness | FAERS: 3 | US FAERS | |
| 570 | Accidental exposure | FAERS: 3 | US FAERS | |
| 571 | Acoustic Neuroma | FAERS: 3 | US FAERS | |
| 572 | Allergy to chemicals | FAERS: 3 | US FAERS | |
| 573 | Atrial Flutter | FAERS: 3 | US FAERS | |
| 574 | Bilirubin conjugated increased | FAERS: 3 | US FAERS | |
| 575 | Bipolar I disorder | FAERS: 3 | US FAERS | |
| 576 | Blood count abnormal | FAERS: 3 | US FAERS | |
| 577 | Blood immunoglobulin E increased | FAERS: 3 | US FAERS | |
| 578 | Blood magnesium decreased | FAERS: 3 | US FAERS | |
| 579 | Brain Death | FAERS: 3 | US FAERS | |
| 580 | Bronchial Hyperreactivity | FAERS: 3 | US FAERS | |
| 581 | Bruxism | FAERS: 3 | US FAERS | |
| 582 | Capillary Fragility | FAERS: 3 | US FAERS | |
| 583 | Capillary Leak Syndrome | FAERS: 3 | US FAERS | |
| 584 | Carotid Artery Thrombosis | FAERS: 3 | US FAERS | |
| 585 | Cerebral calcification | FAERS: 3 | US FAERS | |
| 586 | Chest wall pain | FAERS: 3 | US FAERS | |
| 587 | Chondromalacia | FAERS: 3 | US FAERS | |
| 588 | Claustrophobia | FAERS: 3 | US FAERS | |
| 589 | Deafness Neurosensory | FAERS: 3 | US FAERS | |
| 590 | Diabetes mellitus inadequate control | FAERS: 3 | US FAERS | |
| 591 | Documented hypersensitivity to administered product | FAERS: 3 | US FAERS | |
| 592 | Drooling | FAERS: 3 | US FAERS | |
| 593 | Drug screen positive | FAERS: 3 | US FAERS | |
| 594 | Dysbacteriosis | FAERS: 3 | US FAERS | |
| 595 | Dyslexia | FAERS: 3 | US FAERS | |
| 596 | Dysphemia | FAERS: 3 | US FAERS | |
| 597 | Educational problem | FAERS: 3 | US FAERS | |
| 598 | Embolism | FAERS: 3 | US FAERS | |
| 599 | Fasciitis | FAERS: 3 | US FAERS | |
| 600 | Gastrointestinal infection | FAERS: 3 | US FAERS | |
| 601 | Hepatic Encephalopathy | FAERS: 3 | US FAERS | |
| 602 | Hunger | FAERS: 3 | US FAERS | |
| 603 | Hyperreflexia | FAERS: 3 | US FAERS | |
| 604 | Hyporeflexia | FAERS: 3 | US FAERS | |
| 605 | Iliotibial Band Syndrome | FAERS: 3 | US FAERS | |
| 606 | Incorrect drug administration duration | FAERS: 3 | US FAERS | |
| 607 | Infective tenosynovitis | FAERS: 3 | US FAERS | |
| 608 | Infusion site phlebitis | FAERS: 3 | US FAERS | |
| 609 | Injection site pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 610 | Intentional product misuse | FAERS: 3 | US FAERS | |
| 611 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 612 | Joint capsule rupture | FAERS: 3 | US FAERS | |
| 613 | Lumbar radiculopathy | FAERS: 3 | US FAERS | |
| 614 | Medical device complication | FAERS: 3 | US FAERS | |
| 615 | Monocytosis | FAERS: 3 | US FAERS | |
| 616 | Nasal discomfort | FAERS: 3 | US FAERS | |
| 617 | Necrosis | FAERS: 3 | US FAERS | |
| 618 | Nephritis | FAERS: 3 | US FAERS | |
| 619 | Nephrotic Syndrome | FAERS: 3 | US FAERS | |
| 620 | Nipple pain | FAERS: 3 | US FAERS | |
| 621 | No adverse effect | FAERS: 3 | US FAERS | |
| 622 | Obsessive thoughts | FAERS: 3 | US FAERS | |
| 623 | Oral fungal infection | FAERS: 3 | US FAERS | |
| 624 | Palpable purpura | FAERS: 3 | US FAERS | |
| 625 | Paresis | FAERS: 3 | US FAERS | |
| 626 | Patellofemoral Pain Syndrome | FAERS: 3 | US FAERS | |
| 627 | Performance status decreased | FAERS: 3 | US FAERS | |
| 628 | Plague | FAERS: 3 | US FAERS | |
| 629 | Polydipsia | FAERS: 3 | US FAERS | |
| 630 | Post procedural infection | FAERS: 3 | US FAERS | |
| 631 | Product availability issue | FAERS: 3 | US FAERS | |
| 632 | Psychotic symptom | FAERS: 3 | US FAERS | |
| 633 | Purulence | FAERS: 3 | US FAERS | |
| 634 | Quadriplegia | FAERS: 3 | US FAERS | |
| 635 | Renal Colic | FAERS: 3 | US FAERS | |
| 636 | Respiratory Depression | FAERS: 3 | US FAERS | |
| 637 | Retinal Vascular Disorder | FAERS: 3 | US FAERS | |
| 638 | Reversed hot-cold sensation | FAERS: 3 | US FAERS | |
| 639 | Scotoma | FAERS: 3 | US FAERS | |
| 640 | Sexual Dysfunction | FAERS: 3 | US FAERS | |
| 641 | Sinus headache | FAERS: 3 | US FAERS | |
| 642 | Sinus operation | FAERS: 3 | US FAERS | |
| 643 | Staring | FAERS: 3 | US FAERS | |
| 644 | Tachyphrenia | FAERS: 3 | US FAERS | |
| 645 | Temperature regulation disorder | FAERS: 3 | US FAERS | |
| 646 | Tendon necrosis | FAERS: 3 | US FAERS | |
| 647 | Tension | FAERS: 3 | US FAERS | |
| 648 | Therapeutic product ineffective | FAERS: 3 | US FAERS | |
| 649 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 650 | Ulcer | FAERS: 3 | US FAERS | |
| 651 | Urethritis | FAERS: 3 | US FAERS | |
| 652 | Uterine Prolapse | FAERS: 3 | US FAERS | |
| 653 | Vaginal Discharge | FAERS: 3 | US FAERS | |
| 654 | Venous thrombosis limb | FAERS: 3 | US FAERS | |
| 655 | Xanthopsia | FAERS: 3 | US FAERS | |
| 656 | prostatitis | FAERS: 3 | US FAERS | |
| 657 | Acquired gene mutation | FAERS: 2 | US FAERS | |
| 658 | Acute sinusitis | FAERS: 2 | US FAERS | |
| 659 | Agoraphobia | FAERS: 2 | US FAERS | |
| 660 | Agranulocytosis | FAERS: 2 | US FAERS | |
| 661 | Akathisia | FAERS: 2 | US FAERS | |
| 662 | Amyloidosis | FAERS: 2 | US FAERS | |
| 663 | Ankle impingement | FAERS: 2 | US FAERS | |
| 664 | Anoxic Encephalopathy | FAERS: 2 | US FAERS | |
| 665 | Aortic Rupture | FAERS: 2 | US FAERS | |
| 666 | Apparent life threatening event | FAERS: 2 | US FAERS | |
| 667 | Arthrofibrosis | FAERS: 2 | US FAERS | |
| 668 | Arthropod bite | FAERS: 2 | US FAERS | |
| 669 | Atrial tachycardia | FAERS: 2 | US FAERS | |
| 670 | Autonomic neuropathy | FAERS: 2 | US FAERS | |
| 671 | Babesiosis | FAERS: 2 | US FAERS | |
| 672 | Bladder pain | FAERS: 2 | US FAERS | |
| 673 | Blood albumin increased | FAERS: 2 | US FAERS | |
| 674 | Blood amylase increased | FAERS: 2 | US FAERS | |
| 675 | Blood fibrinogen increased | FAERS: 2 | US FAERS | |
| 676 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 677 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 678 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 679 | Body temperature fluctuation | FAERS: 2 | US FAERS | |
| 680 | Bone infarction | FAERS: 2 | US FAERS | |
| 681 | Bone oedema | FAERS: 2 | US FAERS | |
| 682 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 683 | Catheter related complication | FAERS: 2 | US FAERS | |
| 684 | Cell Death | FAERS: 2 | US FAERS | |
| 685 | Cervicobrachial syndrome | FAERS: 2 | US FAERS | |
| 686 | Chromatopsia | FAERS: 2 | US FAERS | |
| 687 | Cluster Headache | FAERS: 2 | US FAERS | |
| 688 | Coccidioidomycosis | FAERS: 2 | US FAERS | |
| 689 | Concomitant disease aggravated | FAERS: 2 | US FAERS | |
| 690 | Creatinine renal clearance decreased | FAERS: 2 | US FAERS | |
| 691 | Cubital Tunnel Syndrome | FAERS: 2 | US FAERS | |
| 692 | Cutaneous sarcoidosis | FAERS: 2 | US FAERS | |
| 693 | Depression suicidal | FAERS: 2 | US FAERS | |
| 694 | Device malfunction | FAERS: 2 | US FAERS | |
| 695 | Dissociative Identity Disorder | FAERS: 2 | US FAERS | |
| 696 | Drug level decreased | FAERS: 2 | US FAERS | |
| 697 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 698 | Eczema impetiginous | FAERS: 2 | US FAERS | |
| 699 | Electrocardiogram QT corrected interval | FAERS: 2 | US FAERS | |
| 700 | Electrocardiogram change | FAERS: 2 | US FAERS | |
| 701 | Electromechanical dissociation | FAERS: 2 | US FAERS | |
| 702 | Encephalitis | FAERS: 2 | US FAERS | |
| 703 | Endophthalmitis | FAERS: 2 | US FAERS | |
| 704 | Enterocolitis | FAERS: 2 | US FAERS | |
| 705 | Erysipelas | FAERS: 2 | US FAERS | |
| 706 | Erythromelalgia | FAERS: 2 | US FAERS | |
| 707 | Escherichia infection | FAERS: 2 | US FAERS | |
| 708 | Exposure during breast feeding | FAERS: 2 | US FAERS | |
| 709 | Eye Infection | FAERS: 2 | US FAERS | |
| 710 | Eye infection intraocular | FAERS: 2 | US FAERS | |
| 711 | Fascial rupture | FAERS: 2 | US FAERS | |
| 712 | Flank Pain | FAERS: 2 | US FAERS | |
| 713 | Flat affect | FAERS: 2 | US FAERS | |
| 714 | Flight of ideas | FAERS: 2 | US FAERS | |
| 715 | Food craving | FAERS: 2 | US FAERS | |
| 716 | Foreign body sensation in eyes | FAERS: 2 | US FAERS | |
| 717 | Frustration tolerance decreased | FAERS: 2 | US FAERS | |
| 718 | Gastrointestinal carcinoma | FAERS: 2 | US FAERS | |
| 719 | Genital rash | FAERS: 2 | US FAERS | |
| 720 | Glaucoma | FAERS: 2 | US FAERS | |
| 721 | Granuloma | FAERS: 2 | US FAERS | |
| 722 | Hand-eye coordination impaired | FAERS: 2 | US FAERS | |
| 723 | Head Banging | FAERS: 2 | US FAERS | |
| 724 | Hip surgery | FAERS: 2 | US FAERS | |
| 725 | Histiocytosis haematophagic | FAERS: 2 | US FAERS | |
| 726 | Hypercreatininaemia | FAERS: 2 | US FAERS | |
| 727 | Hypoventilation | FAERS: 2 | US FAERS | |
| 728 | Idiosyncratic drug reaction | FAERS: 2 | US FAERS | |
| 729 | Ileus | FAERS: 2 | US FAERS | |
| 730 | Incision site complication | FAERS: 2 | US FAERS | |
| 731 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 732 | Inflammatory marker increased | FAERS: 2 | US FAERS | |
| 733 | Infusion site inflammation | FAERS: 2 | US FAERS | |
| 734 | Injection site streaking | FAERS: 2 | US FAERS | |
| 735 | Intercepted medication error | FAERS: 2 | US FAERS | |
| 736 | Intervertebral Disc Degeneration | FAERS: 2 | US FAERS | |
| 737 | Intervertebral disc disorder | FAERS: 2 | US FAERS | |
| 738 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 739 | Joint destruction | FAERS: 2 | US FAERS | |
| 740 | Laryngitis | FAERS: 2 | US FAERS | |
| 741 | Left Ventricular Hypertrophy | FAERS: 2 | US FAERS | |
| 742 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 743 | Lyme Disease | FAERS: 2 | US FAERS | |
| 744 | Lymphocyte count decreased | FAERS: 2 | US FAERS | |
| 745 | Macular degeneration | FAERS: 2 | US FAERS | |
| 746 | Malabsorption | FAERS: 2 | US FAERS | |
| 747 | Male sexual dysfunction | FAERS: 2 | US FAERS | |
| 748 | Mallory-Weiss Syndrome | FAERS: 2 | US FAERS | |
| 749 | Mechanical urticaria | FAERS: 2 | US FAERS | |
| 750 | Medial Tibial Stress Syndrome | FAERS: 2 | US FAERS | |
| 751 | Meningeal disorder | FAERS: 2 | US FAERS | |
| 752 | Metamorphopsia | FAERS: 2 | US FAERS | |
| 753 | Metastatic Neoplasm | FAERS: 2 | US FAERS | |
| 754 | Monocyte count increased | FAERS: 2 | US FAERS | |
| 755 | Multi-organ disorder | FAERS: 2 | US FAERS | |
| 756 | Multiple sclerosis relapse | FAERS: 2 | US FAERS | |
| 757 | Neurological examination abnormal | FAERS: 2 | US FAERS | |
| 758 | Ocular discomfort | FAERS: 2 | US FAERS | |
| 759 | Oculomucocutaneous syndrome | FAERS: 2 | US FAERS | |
| 760 | Oliguria | FAERS: 2 | US FAERS | |
| 761 | Opiates positive | FAERS: 2 | US FAERS | |
| 762 | Optic Neuropathy | FAERS: 2 | US FAERS | |
| 763 | Osteomyelitis | FAERS: 2 | US FAERS | |
| 764 | Osteoporosis | FAERS: 2 | US FAERS | |
| 765 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 766 | Perineal pain | FAERS: 2 | US FAERS | |
| 767 | Peripheral motor neuropathy | FAERS: 2 | US FAERS | |
| 768 | Pharyngeal swelling | FAERS: 2 | US FAERS | |
| 769 | Polyuria | FAERS: 2 | US FAERS | |
| 770 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 771 | Postural Orthostatic Tachycardia Syndrome | FAERS: 2 | US FAERS | |
| 772 | Pressure of speech | FAERS: 2 | US FAERS | |
| 773 | Procedural complication | FAERS: 2 | US FAERS | |
| 774 | Product complaint | FAERS: 2 | US FAERS | |
| 775 | Product outer packaging issue | FAERS: 2 | US FAERS | |
| 776 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 777 | Protein urine present | FAERS: 2 | US FAERS | |
| 778 | Pruritus allergic | FAERS: 2 | US FAERS | |
| 779 | Pseudolymphoma | FAERS: 2 | US FAERS | |
| 780 | Psychomotor skills impaired | FAERS: 2 | US FAERS | |
| 781 | Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 782 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 783 | Pulmonary toxicity | FAERS: 2 | US FAERS | |
| 784 | Pyuria | FAERS: 2 | US FAERS | |
| 785 | Radiation skin injury | FAERS: 2 | US FAERS | |
| 786 | Refusal of treatment by relative | FAERS: 2 | US FAERS | |
| 787 | Renal cyst | FAERS: 2 | US FAERS | |
| 788 | Respiratory fatigue | FAERS: 2 | US FAERS | |
| 789 | Rheumatoid factor increased | FAERS: 2 | US FAERS | |
| 790 | Schizophrenia | FAERS: 2 | US FAERS | |
| 791 | Scleritis | FAERS: 2 | US FAERS | |
| 792 | Secretion discharge | FAERS: 2 | US FAERS | |
| 793 | Sinus Tarsi Syndrome | FAERS: 2 | US FAERS | |
| 794 | Sinus bradycardia | FAERS: 2 | US FAERS | |
| 795 | Sjogren's Syndrome | FAERS: 2 | US FAERS | |
| 796 | Skin Induration | FAERS: 2 | US FAERS | |
| 797 | Skin irritation | FAERS: 2 | US FAERS | |
| 798 | Sluggishness | FAERS: 2 | US FAERS | |
| 799 | Squamous cell carcinoma | FAERS: 2 | US FAERS | |
| 800 | Staphylococcus test positive | FAERS: 2 | US FAERS | |
| 801 | Sudden death | FAERS: 2 | US FAERS | |
| 802 | Sudden onset of sleep | FAERS: 2 | US FAERS | |
| 803 | Symblepharon | FAERS: 2 | US FAERS | |
| 804 | Temporal Arteritis | FAERS: 2 | US FAERS | |
| 805 | Tongue blistering | FAERS: 2 | US FAERS | |
| 806 | Tracheobronchitis | FAERS: 2 | US FAERS | |
| 807 | Transaminases abnormal | FAERS: 2 | US FAERS | |
| 808 | Trichiasis | FAERS: 2 | US FAERS | |
| 809 | Trichorrhexis | FAERS: 2 | US FAERS | |
| 810 | Troponin I increased | FAERS: 2 | US FAERS | |
| 811 | Upper-airway cough syndrome | FAERS: 2 | US FAERS | |
| 812 | Urine flow decreased | FAERS: 2 | US FAERS | |
| 813 | Uveitis | FAERS: 2 | US FAERS | |
| 814 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 815 | Ventricular Dysfunction | FAERS: 2 | US FAERS | |
| 816 | Ventricular hypokinesia | FAERS: 2 | US FAERS | |
| 817 | Viral upper respiratory tract infection | FAERS: 2 | US FAERS | |
| 818 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 819 | Abdominal strangulated hernia | FAERS: 1 | US FAERS | |
| 820 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 821 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 822 | Acid fast bacilli infection | FAERS: 1 | US FAERS | |
| 823 | Acidosis | FAERS: 1 | US FAERS | |
| 824 | Acinetobacter test positive | FAERS: 1 | US FAERS | |
| 825 | Actinic keratosis | FAERS: 1 | US FAERS | |
| 826 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 827 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 828 | Administration site reaction | FAERS: 1 | US FAERS | |
| 829 | Agonal death struggle | FAERS: 1 | US FAERS | |
| 830 | Alcohol Intolerance | FAERS: 1 | US FAERS | |
| 831 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 832 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 833 | Alpha 2 globulin increased | FAERS: 1 | US FAERS | |
| 834 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 835 | Anal discomfort | FAERS: 1 | US FAERS | |
| 836 | Anhedonia | FAERS: 1 | US FAERS | |
| 837 | Anoxia | FAERS: 1 | US FAERS | |
| 838 | Anti-neutrophil cytoplasmic antibody positive vasculitis | FAERS: 1 | US FAERS | |
| 839 | Anti-thyroid antibody positive | FAERS: 1 | US FAERS | |
| 840 | Antibiotic level below therapeutic | FAERS: 1 | US FAERS | |
| 841 | Anticonvulsant drug level decreased | FAERS: 1 | US FAERS | |
| 842 | Antinuclear antibody increased | FAERS: 1 | US FAERS | |
| 843 | Antinuclear antibody negative | FAERS: 1 | US FAERS | |
| 844 | Aortic dissection rupture | FAERS: 1 | US FAERS | |
| 845 | Aphakia | FAERS: 1 | US FAERS | |
| 846 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 847 | Aponeurosis contusion | FAERS: 1 | US FAERS | |
| 848 | Appendicitis | FAERS: 1 | US FAERS | |
| 849 | Arachnoiditis | FAERS: 1 | US FAERS | |
| 850 | Arterial thrombosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 851 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 852 | Auricular swelling | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 853 | Autophony | FAERS: 1 | US FAERS | |
| 854 | Axonal neuropathy | FAERS: 1 | US FAERS | |
| 855 | Bacteria stool identified | FAERS: 1 | US FAERS | |
| 856 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 857 | Ballismus | FAERS: 1 | US FAERS | |
| 858 | Band neutrophil count increased | FAERS: 1 | US FAERS | |
| 859 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 860 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 861 | Biopsy muscle abnormal | FAERS: 1 | US FAERS | |
| 862 | Bladder spasm | FAERS: 1 | US FAERS | |
| 863 | Blastomycosis | FAERS: 1 | US FAERS | |
| 864 | Blood alkaline phosphatase decreased | FAERS: 1 | US FAERS | |
| 865 | Blood cortisol decreased | FAERS: 1 | US FAERS | |
| 866 | Blood creatine phosphokinase | FAERS: 1 | US FAERS | |
| 867 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 868 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 869 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 870 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 871 | Blood pressure orthostatic decreased | FAERS: 1 | US FAERS | |
| 872 | Blood testosterone abnormal | FAERS: 1 | US FAERS | |
| 873 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 874 | Blood testosterone free decreased | FAERS: 1 | US FAERS | |
| 875 | Blood testosterone increased | FAERS: 1 | US FAERS | |
| 876 | Bone density decreased | FAERS: 1 | US FAERS | |
| 877 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 878 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 879 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 880 | Burning feet syndrome | FAERS: 1 | US FAERS | |
| 881 | Bursitis infective staphylococcal | FAERS: 1 | US FAERS | |
| 882 | C-reactive protein abnormal | FAERS: 1 | US FAERS | |
| 883 | CD30 expression | FAERS: 1 | US FAERS | |
| 884 | Caffeine consumption | FAERS: 1 | US FAERS | |
| 885 | Calcinosis | FAERS: 1 | US FAERS | |
| 886 | Cardiac Death | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 887 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 888 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 889 | Catatonia | FAERS: 1 | US FAERS | |
| 890 | Catheter site erythema | FAERS: 1 | US FAERS | |
| 891 | Catheter site pruritus | FAERS: 1 | US FAERS | |
| 892 | Cauda Equina Syndrome | FAERS: 1 | US FAERS | |
| 893 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 894 | Chemical burn of skin | FAERS: 1 | US FAERS | |
| 895 | Chemical injury | FAERS: 1 | US FAERS | |
| 896 | Chloropsia | FAERS: 1 | US FAERS | |
| 897 | Cholangitis | FAERS: 1 | US FAERS | |
| 898 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 899 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 900 | Chorioretinitis | FAERS: 1 | US FAERS | |
| 901 | Chronic pigmented purpura | FAERS: 1 | US FAERS | |
| 902 | Clostridium difficile toxin test positive | FAERS: 1 | US FAERS | |
| 903 | Clostridium test positive | FAERS: 1 | US FAERS | |
| 904 | Clumsiness | FAERS: 1 | US FAERS | |
| 905 | Complication associated with device | FAERS: 1 | US FAERS | |
| 906 | Conduct Disorder | FAERS: 1 | US FAERS | |
| 907 | Confabulation | FAERS: 1 | US FAERS | |
| 908 | Congenital neuropathy | FAERS: 1 | US FAERS | |
| 909 | Conjunctival abrasion | FAERS: 1 | US FAERS | |
| 910 | Conjunctival scar | FAERS: 1 | US FAERS | |
| 911 | Contraindicated product prescribed | FAERS: 1 | US FAERS | |
| 912 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 913 | Cortisol deficiency | FAERS: 1 | US FAERS | |
| 914 | Cortisol increased | FAERS: 1 | US FAERS | |
| 915 | Crystal urine present | FAERS: 1 | US FAERS | |
| 916 | Culture wound positive | FAERS: 1 | US FAERS | |
| 917 | Cutis Laxa | FAERS: 1 | US FAERS | |
| 918 | Dacryocanaliculitis | FAERS: 1 | US FAERS | |
| 919 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 920 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 921 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 922 | Dehydroepiandrosterone decreased | FAERS: 1 | US FAERS | |
| 923 | Demyelination | FAERS: 1 | US FAERS | |
| 924 | Dental Plaque | FAERS: 1 | US FAERS | |
| 925 | Dental caries | FAERS: 1 | US FAERS | |
| 926 | Dermatitis Herpetiformis | FAERS: 1 | US FAERS | |
| 927 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 928 | Dermatomyositis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 929 | Device Failure | FAERS: 1 | US FAERS | |
| 930 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 931 | Diabetic foot infection | FAERS: 1 | US FAERS | |
| 932 | Diaphragmalgia | FAERS: 1 | US FAERS | |
| 933 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 934 | Diplegia | FAERS: 1 | US FAERS | |
| 935 | Disease risk factor | FAERS: 1 | US FAERS | |
| 936 | Diverticulum | FAERS: 1 | US FAERS | |
| 937 | Dropped head syndrome | FAERS: 1 | US FAERS | |
| 938 | Drug Dependence | FAERS: 1 | US FAERS | |
| 939 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 940 | Drug dose titration not performed | FAERS: 1 | US FAERS | |
| 941 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 942 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 943 | Drug level above therapeutic | FAERS: 1 | US FAERS | |
| 944 | Drug level changed | FAERS: 1 | US FAERS | |
| 945 | Drug level increased | FAERS: 1 | US FAERS | |
| 946 | Duodenitis | FAERS: 1 | US FAERS | |
| 947 | Duodenogastric Reflux | FAERS: 1 | US FAERS | |
| 948 | Ear congestion | FAERS: 1 | US FAERS | |
| 949 | Ectopic Pregnancy | FAERS: 1 | US FAERS | |
| 950 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 951 | Elevated mood | FAERS: 1 | US FAERS | |
| 952 | Enamel anomaly | FAERS: 1 | US FAERS | |
| 953 | Endocarditis | FAERS: 1 | US FAERS | |
| 954 | Endotracheal intubation complication | FAERS: 1 | US FAERS | |
| 955 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 956 | Enterovirus test positive | FAERS: 1 | US FAERS | |
| 957 | Enuresis | FAERS: 1 | US FAERS | |
| 958 | Eosinophil percentage increased | FAERS: 1 | US FAERS | |
| 959 | Epidermolysis | FAERS: 1 | US FAERS | |
| 960 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 961 | Erythrodermic psoriasis | FAERS: 1 | US FAERS | |
| 962 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 963 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 964 | Excoriation | FAERS: 1 | US FAERS | |
| 965 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 966 | Exposure to unspecified agent | FAERS: 1 | US FAERS | |
| 967 | Extra dose administered | FAERS: 1 | US FAERS | |
| 968 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 969 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 970 | Eye inflammation | FAERS: 1 | US FAERS | |
| 971 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 972 | Eyelid pain | FAERS: 1 | US FAERS | |
| 973 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 974 | Facial Neuralgia | FAERS: 1 | US FAERS | |
| 975 | Facial Paresis | FAERS: 1 | US FAERS | |
| 976 | Facial paralysis | FAERS: 1 | US FAERS | |
| 977 | Factor VII Deficiency | FAERS: 1 | US FAERS | |
| 978 | Factor VIII Deficiency | FAERS: 1 | US FAERS | |
| 979 | False negative investigation result | FAERS: 1 | US FAERS | |
| 980 | False positive laboratory result | FAERS: 1 | US FAERS | |
| 981 | Fear of falling | FAERS: 1 | US FAERS | |
| 982 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 983 | Fibrosis | FAERS: 1 | US FAERS | |
| 984 | Filariasis | FAERS: 1 | US FAERS | |
| 985 | Fluid overload | FAERS: 1 | US FAERS | |
| 986 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 987 | Food Poisoning | FAERS: 1 | US FAERS | |
| 988 | Food aversion | FAERS: 1 | US FAERS | |
| 989 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 990 | Frostbite | FAERS: 1 | US FAERS | |
| 991 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 992 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 993 | Gastric infection | FAERS: 1 | US FAERS | |
| 994 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 995 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 996 | Gastrointestinal amyloidosis | FAERS: 1 | US FAERS | |
| 997 | Gastrointestinal bacterial infection | FAERS: 1 | US FAERS | |
| 998 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 999 | Gastrostomy | FAERS: 1 | US FAERS | |
| 1000 | General symptom | FAERS: 1 | US FAERS | |
| 1001 | Genital abscess | FAERS: 1 | US FAERS | |
| 1002 | Genital discomfort | FAERS: 1 | US FAERS | |
| 1003 | Genital erythema | FAERS: 1 | US FAERS | |
| 1004 | Gingival Recession | FAERS: 1 | US FAERS | |
| 1005 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 1006 | Glossopharyngeal nerve paralysis | FAERS: 1 | US FAERS | |
| 1007 | Guttate psoriasis | FAERS: 1 | US FAERS | |
| 1008 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 1009 | Hemiparesis | FAERS: 1 | US FAERS | |
| 1010 | Hepatitis C antibody positive | FAERS: 1 | US FAERS | |
| 1011 | Hepatitis C virus test positive | FAERS: 1 | US FAERS | |
| 1012 | Hidradenitis | FAERS: 1 | US FAERS | |
| 1013 | Histone antibody | FAERS: 1 | US FAERS | |
| 1014 | Hostility | FAERS: 1 | US FAERS | |
| 1015 | Human Ehrlichiosis | FAERS: 1 | US FAERS | |
| 1016 | Humoral immune defect | FAERS: 1 | US FAERS | |
| 1017 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 1018 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 1019 | Hypercreatinaemia | FAERS: 1 | US FAERS | |
| 1020 | Hyperkinesia | FAERS: 1 | US FAERS | |
| 1021 | Hyperoxaluria | FAERS: 1 | US FAERS | |
| 1022 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 1023 | Hypohidrosis | FAERS: 1 | US FAERS | |
| 1024 | Hypomania | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1025 | Hypoperfusion | FAERS: 1 | US FAERS | |
| 1026 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 1027 | Idiopathic angioedema | FAERS: 1 | US FAERS | |
| 1028 | Idiopathic urticaria | FAERS: 1 | US FAERS | |
| 1029 | Illogical thinking | FAERS: 1 | US FAERS | |
| 1030 | Immunosuppression | FAERS: 1 | US FAERS | |
| 1031 | Impatience | FAERS: 1 | US FAERS | |
| 1032 | Impetigo | FAERS: 1 | US FAERS | |
| 1033 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 1034 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 1035 | Incision site vesicles | FAERS: 1 | US FAERS | |
| 1036 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 1037 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 1038 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 1039 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 1040 | Increased viscosity of bronchial secretion | FAERS: 1 | US FAERS | |
| 1041 | Increased viscosity of nasal secretion | FAERS: 1 | US FAERS | |
| 1042 | Infarction | FAERS: 1 | US FAERS | |
| 1043 | Infection reactivation | FAERS: 1 | US FAERS | |
| 1044 | Inflammatory pain | FAERS: 1 | US FAERS | |
| 1045 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 1046 | Infusion site burning | FAERS: 1 | US FAERS | |
| 1047 | Infusion site irritation | FAERS: 1 | US FAERS | |
| 1048 | Infusion site streaking | FAERS: 1 | US FAERS | |
| 1049 | Injection site irritation | FAERS: 1 | US FAERS | |
| 1050 | Injection site thrombosis | FAERS: 1 | US FAERS | |
| 1051 | Injection site urticaria | FAERS: 1 | US FAERS | |
| 1052 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 1053 | Intentional misuse | FAERS: 1 | US FAERS | |
| 1054 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 1055 | Intercepted wrong patient selected | FAERS: 1 | US FAERS | |
| 1056 | Intervertebral disc compression | FAERS: 1 | US FAERS | |
| 1057 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 1058 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 1059 | Intraspinal abscess | FAERS: 1 | US FAERS | |
| 1060 | Iritis | FAERS: 1 | US FAERS | |
| 1061 | Japanese Spotted Fever | FAERS: 1 | US FAERS | |
| 1062 | Jugular vein distension | FAERS: 1 | US FAERS | |
| 1063 | Keratoconjunctivitis Sicca | FAERS: 1 | US FAERS | |
| 1064 | Klebsiella test positive | FAERS: 1 | US FAERS | |
| 1065 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 1066 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 1067 | Laryngeal neoplasm | FAERS: 1 | US FAERS | |
| 1068 | Laziness | FAERS: 1 | US FAERS | |
| 1069 | Lens dislocation | FAERS: 1 | US FAERS | |
| 1070 | Limb mass | FAERS: 1 | US FAERS | |
| 1071 | Limb operation | FAERS: 1 | US FAERS | |
| 1072 | Lip erosion | FAERS: 1 | US FAERS | |
| 1073 | Lipase increased | FAERS: 1 | US FAERS | |
| 1074 | Listeriosis | FAERS: 1 | US FAERS | |
| 1075 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 1076 | Local reaction | FAERS: 1 | US FAERS | |
| 1077 | Long QT Syndrome | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1078 | Lumbar puncture abnormal | FAERS: 1 | US FAERS | |
| 1079 | Lung Injury | FAERS: 1 | US FAERS | |
| 1080 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 1081 | Lymphangiosis carcinomatosa | FAERS: 1 | US FAERS | |
| 1082 | Lymphocyte percentage decreased | FAERS: 1 | US FAERS | |
| 1083 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 1084 | Lymphoma | FAERS: 1 | US FAERS | |
| 1085 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 1086 | Macrocytosis | FAERS: 1 | US FAERS | |
| 1087 | Magnesium Deficiency | FAERS: 1 | US FAERS | |
| 1088 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 1089 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 1090 | Medical device site reaction | FAERS: 1 | US FAERS | |
| 1091 | Megacolon | FAERS: 1 | US FAERS | |
| 1092 | Meningism | FAERS: 1 | US FAERS | |
| 1093 | Meningitis | FAERS: 1 | US FAERS | |
| 1094 | Mental disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 1095 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 1096 | Metastasis | FAERS: 1 | US FAERS | |
| 1097 | Metatarsalgia | FAERS: 1 | US FAERS | |
| 1098 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 1099 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 1100 | Miliaria | FAERS: 1 | US FAERS | |
| 1101 | Mitochondrial myopathy acquired | FAERS: 1 | US FAERS | |
| 1102 | Moaning | FAERS: 1 | US FAERS | |
| 1103 | Mononeuropathy Multiplex | FAERS: 1 | US FAERS | |
| 1104 | Monoparesis | FAERS: 1 | US FAERS | |
| 1105 | Myasthenic Syndrome | FAERS: 1 | US FAERS | |
| 1106 | Myelitis | FAERS: 1 | US FAERS | |
| 1107 | Myocarditis | FAERS: 1 | US FAERS | |
| 1108 | Myofascitis | FAERS: 1 | US FAERS | |
| 1109 | Narcolepsy | FAERS: 1 | US FAERS | |
| 1110 | Neurological eyelid disorder | FAERS: 1 | US FAERS | |
| 1111 | Neuroma | FAERS: 1 | US FAERS | |
| 1112 | Neutrophil count abnormal | FAERS: 1 | US FAERS | |
| 1113 | Nocturia | FAERS: 1 | US FAERS | |
| 1114 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 1115 | Nutritional condition abnormal | FAERS: 1 | US FAERS | |
| 1116 | Nystagmus | FAERS: 1 | US FAERS | |
| 1117 | Occult blood positive | FAERS: 1 | US FAERS | |
| 1118 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 1119 | Ocular vascular disorder | FAERS: 1 | US FAERS | |
| 1120 | Oculogyric crisis | FAERS: 1 | US FAERS | |
| 1121 | Onychoclasis | FAERS: 1 | US FAERS | |
| 1122 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 1123 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 1124 | Oral pruritus | FAERS: 1 | US FAERS | |
| 1125 | Oral pustule | FAERS: 1 | US FAERS | |
| 1126 | Orchitis | FAERS: 1 | US FAERS | |
| 1127 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 1128 | Orthodontic appliance user | FAERS: 1 | US FAERS | |
| 1129 | Osteitis | FAERS: 1 | US FAERS | |
| 1130 | Osteochondrosis | FAERS: 1 | US FAERS | |
| 1131 | Ototoxicity | FAERS: 1 | US FAERS | |
| 1132 | Parasomnia | FAERS: 1 | US FAERS | |
| 1133 | Parotitis | FAERS: 1 | US FAERS | |
| 1134 | Partner stress | FAERS: 1 | US FAERS | |
| 1135 | Patient Isolation | FAERS: 1 | US FAERS | |
| 1136 | Penile blister | FAERS: 1 | US FAERS | |
| 1137 | Penile erythema | FAERS: 1 | US FAERS | |
| 1138 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 1139 | Periorbital contusion | FAERS: 1 | US FAERS | |
| 1140 | Pertussis | FAERS: 1 | US FAERS | |
| 1141 | Phantom pain | FAERS: 1 | US FAERS | |
| 1142 | Pharyngolaryngeal discomfort | FAERS: 1 | US FAERS | |
| 1143 | Piloerection | FAERS: 1 | US FAERS | |
| 1144 | Pleurisy | FAERS: 1 | US FAERS | |
| 1145 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 1146 | Pneumococcal sepsis | FAERS: 1 | US FAERS | |
| 1147 | Poliomyelitis | FAERS: 1 | US FAERS | |
| 1148 | Polyarteritis Nodosa | FAERS: 1 | US FAERS | |
| 1149 | Portal fibrosis | FAERS: 1 | US FAERS | |
| 1150 | Post procedural pain | FAERS: 1 | US FAERS | |
| 1151 | Postoperative infection | FAERS: 1 | US FAERS | |
| 1152 | Pregnancy of partner | FAERS: 1 | US FAERS | |
| 1153 | Pregnancy | FAERS: 1 | US FAERS | |
| 1154 | Procedural nausea | FAERS: 1 | US FAERS | |
| 1155 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 1156 | Procedural vomiting | FAERS: 1 | US FAERS | |
| 1157 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 1158 | Product administration error | FAERS: 1 | US FAERS | |
| 1159 | Product appearance confusion | FAERS: 1 | US FAERS | |
| 1160 | Product dispensing error | FAERS: 1 | US FAERS | |
| 1161 | Product label confusion | FAERS: 1 | US FAERS | |
| 1162 | Product lot number issue | FAERS: 1 | US FAERS | |
| 1163 | Product name confusion | FAERS: 1 | US FAERS | |
| 1164 | Product packaging issue | FAERS: 1 | US FAERS | |
| 1165 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 1166 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 1167 | Psychological Trauma | FAERS: 1 | US FAERS | |
| 1168 | Pulmonary Eosinophilia | FAERS: 1 | US FAERS | |
| 1169 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 1170 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 1171 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 1172 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 1173 | Pulmonary trichosporonosis | FAERS: 1 | US FAERS | |
| 1174 | Purulent discharge | FAERS: 1 | US FAERS | |
| 1175 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 1176 | Pyoderma Gangrenosum | FAERS: 1 | US FAERS | |
| 1177 | Radial Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 1178 | Radial nerve compression | FAERS: 1 | US FAERS | |
| 1179 | Radiation injury | FAERS: 1 | US FAERS | |
| 1180 | Radiculopathy | FAERS: 1 | US FAERS | |
| 1181 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 1182 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 1183 | Recall phenomenon | FAERS: 1 | US FAERS | |
| 1184 | Rectal discharge | FAERS: 1 | US FAERS | |
| 1185 | Regurgitation | FAERS: 1 | US FAERS | |
| 1186 | Relapsing Fever | FAERS: 1 | US FAERS | |
| 1187 | Renal aneurysm | FAERS: 1 | US FAERS | |
| 1188 | Renal mass | FAERS: 1 | US FAERS | |
| 1189 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 1190 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 1191 | Resting Tremor | FAERS: 1 | US FAERS | |
| 1192 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 1193 | Retinal scar | FAERS: 1 | US FAERS | |
| 1194 | Retinal vascular thrombosis | FAERS: 1 | US FAERS | |
| 1195 | Rickets | FAERS: 1 | US FAERS | |
| 1196 | Romberg test positive | FAERS: 1 | US FAERS | |
| 1197 | Sacroiliitis | FAERS: 1 | US FAERS | |
| 1198 | Salt craving | FAERS: 1 | US FAERS | |
| 1199 | Sensory processing disorder | FAERS: 1 | US FAERS | |
| 1200 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 1201 | Skin nodule | FAERS: 1 | US FAERS | |
| 1202 | Sleep Talking | FAERS: 1 | US FAERS | |
| 1203 | Sleep disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 1204 | Slow speech | FAERS: 1 | US FAERS | |
| 1205 | Soft tissue necrosis | FAERS: 1 | US FAERS | |
| 1206 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 1207 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 1208 | Splenic Rupture | FAERS: 1 | US FAERS | |
| 1209 | Spondylitis | FAERS: 1 | US FAERS | |
| 1210 | Spondylolisthesis | FAERS: 1 | US FAERS | |
| 1211 | Status Asthmaticus | FAERS: 1 | US FAERS | |
| 1212 | Stenotrophomonas infection | FAERS: 1 | US FAERS | |
| 1213 | Stent malfunction | FAERS: 1 | US FAERS | |
| 1214 | Strabismus | FAERS: 1 | US FAERS | |
| 1215 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 1216 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 1217 | Superinfection | FAERS: 1 | US FAERS | |
| 1218 | Tendon sheath disorder | FAERS: 1 | US FAERS | |
| 1219 | Testicular mass | FAERS: 1 | US FAERS | |
| 1220 | Thirst decreased | FAERS: 1 | US FAERS | |
| 1221 | Thymoma | FAERS: 1 | US FAERS | |
| 1222 | Tilt table test positive | FAERS: 1 | US FAERS | |
| 1223 | Tongue exfoliation | FAERS: 1 | US FAERS | |
| 1224 | Tooth Infection | FAERS: 1 | US FAERS | |
| 1225 | Torus fracture | FAERS: 1 | US FAERS | |
| 1226 | Toxic Optic Neuropathy | FAERS: 1 | US FAERS | |
| 1227 | Toxic Shock Syndrome | FAERS: 1 | US FAERS | |
| 1228 | Transcription medication error | FAERS: 1 | US FAERS | |
| 1229 | Trigeminal Nerve Disorder | FAERS: 1 | US FAERS | |
| 1230 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 1231 | Tryptase increased | FAERS: 1 | US FAERS | |
| 1232 | Tuberculosis | FAERS: 1 | US FAERS | |
| 1233 | Ulnar Neuritis | FAERS: 1 | US FAERS | |
| 1234 | Underweight | FAERS: 1 | US FAERS | |
| 1235 | Unemployment | FAERS: 1 | US FAERS | |
| 1236 | Unequal Limb Length | FAERS: 1 | US FAERS | |
| 1237 | Upper respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 1238 | Urinary tract infection enterococcal | FAERS: 1 | US FAERS | |
| 1239 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 1240 | Urine ketone body present | FAERS: 1 | US FAERS | |
| 1241 | Urine output increased | FAERS: 1 | US FAERS | |
| 1242 | Uterovaginal prolapse | FAERS: 1 | US FAERS | |
| 1243 | Vaginal Prolapse | FAERS: 1 | US FAERS | |
| 1244 | Vaginal burning sensation | FAERS: 1 | US FAERS | |
| 1245 | Vaginal pain | FAERS: 1 | US FAERS | |
| 1246 | Vascular fragility | FAERS: 1 | US FAERS | |
| 1247 | Vascular insufficiency | FAERS: 1 | US FAERS | |
| 1248 | Vasospasm | FAERS: 1 | US FAERS | |
| 1249 | Vein pain | FAERS: 1 | US FAERS | |
| 1250 | Venous Injury | FAERS: 1 | US FAERS | |
| 1251 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 1252 | Vestibular Neuronitis | FAERS: 1 | US FAERS | |
| 1253 | Violence-related symptom | FAERS: 1 | US FAERS | |
| 1254 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 1255 | Vitamin B1 decreased | FAERS: 1 | US FAERS | |
| 1256 | Vitreous loss | FAERS: 1 | US FAERS | |
| 1257 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 1258 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 1259 | Wound Infection | FAERS: 1 | US FAERS | |
| 1260 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 1261 | fibroma | FAERS: 1 | US FAERS | |
| 1262 | heart rate | FAERS: 1 | US FAERS | |
| 1263 | Bacterial Infections | 22211524 | CTD | |
| 1264 | Chemical and Drug Induced Liver Injury | 22891208 24085192 24865821 | CTD | |
| 1265 | Hepatorenal Syndrome | Canada Vigilance: 1 | Canada Vigilance | |
| 1266 | Injection site inflammation | Canada Vigilance: 1 | Canada Vigilance | |
| 1267 | Product prescribing error | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.