MetaADEDB: Drug

MetaADEDB 2.0 @ LMMD

Sirolimus

(QFJCIRLUMZQUOT-HPLJOQBZSA-N)

Structure

SMILES: CO[C@@H]1C[C@@H](CC[C@H]1O)C[C@H]([C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@]2(O)O[C@@H](CC[C@H]2C)C[C@H](OC)/C(=C/C=C/C=C/[C@H](C[C@H](C(=O)[C@@H]([C@@H](/C(=C/[C@H](C(=O)C1)C)/C)O)OC)C)C)/C)C
Type(s): Approved; Investigational
ATC code(s): L04AA10; S01XA23
Molecular Formula:: C51H79NO13
Molecular Weight:: 914.172
Log P:: 6.1185
Hydrogen Bond Acceptor:: 14
Hydrogen Bond Donor:: 3
TPSA:: 195.43
CAS Number(s):: 53123-88-9

Synonym(s)

Sirolimus

Rapamycin

AY 22-989

I-2190A

Rapamune

AY 22 989

AY 22989

I 2190A

I2190A

External Link(s)

MeSH	D020123
PubChem Compound	5284616
BindingDB	50064359 36609
ChEBI	9168
CHEMBL	CHEMBL413
DrugBank	DB00877
DrugCentral	2446
IUPHAR/BPS Guide to PHARMACOLOGY	6031
KEGG	cpd:C07909 dr:D00753
ZINC	169289388

Adverse Drug Event(s)

	Name	Number of Reports	Reference(s)	Data Source
1	Product use in unapproved indication	FAERS: 161 Canada Vigilance: 12		Canada Vigilance US FAERS
2	Product use issue	FAERS: 144 Canada Vigilance: 5		Canada Vigilance US FAERS
3	Malaise	FAERS: 94		SIDER US FAERS
4	Pneumonia	FAERS: 78 Canada Vigilance: 1	15219060	CTD SIDER Canada Vigilance US FAERS
5	Nasopharyngitis	FAERS: 53		OFFSIDES US FAERS
6	Liver transplant rejection	FAERS: 41		OFFSIDES US FAERS
7	Pneumonitis	FAERS: 41 Canada Vigilance: 15		Canada Vigilance US FAERS
8	Drug ineffective	FAERS: 38		OFFSIDES US FAERS
9	Blood creatinine increased	FAERS: 35 Canada Vigilance: 4		Canada Vigilance OFFSIDES SIDER US FAERS
10	Cerebrovascular accident	FAERS: 35		US FAERS
11	Fatigue	FAERS: 33		US FAERS
12	Drug ineffective for unapproved indication	FAERS: 32 Canada Vigilance: 3		Canada Vigilance US FAERS
13	Vomiting	FAERS: 32		SIDER US FAERS
14	Stomatitis	FAERS: 31 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
15	Headache	FAERS: 30		SIDER US FAERS
16	Nausea	FAERS: 30		SIDER US FAERS
17	Proteinuria	FAERS: 30 Canada Vigilance: 14	View details 15112032 16314786 16426332 16912706 16954170 17147461 17175308 17175309 17362756 17452413 17889121 18261172 18442299 18567692 18622299 18631865 18690929 19054382 19100416 19356053 19671594 19925471 19926370 20055793 24971338	CTD SIDER Canada Vigilance US FAERS
18	Immunosuppressant drug level increased	FAERS: 29 Canada Vigilance: 1		Canada Vigilance US FAERS
19	Diabetes Mellitus	FAERS: 27		SIDER US FAERS
20	Infection	FAERS: 27 Canada Vigilance: 2	20815021	CTD OFFSIDES SIDER Canada Vigilance US FAERS
21	Myocardial Infarction	FAERS: 26	17920355	CTD US FAERS
22	Toxicity to various agents	FAERS: 26		SIDER US FAERS
23	Drug level increased	FAERS: 25		US FAERS
24	Pain	FAERS: 25 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
25	Blood cholesterol increased	FAERS: 24		SIDER US FAERS
26	Dehydration	FAERS: 24		OFFSIDES SIDER US FAERS
27	Disease Progression	FAERS: 24 Canada Vigilance: 1		Canada Vigilance US FAERS
28	Sepsis	FAERS: 22 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
29	Weight decreased	FAERS: 22 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
30	Pericardial effusion	FAERS: 21 Canada Vigilance: 3		Canada Vigilance OFFSIDES SIDER US FAERS
31	Peripheral swelling	FAERS: 21		US FAERS
32	Asthenia	FAERS: 20		SIDER US FAERS
33	Respiratory Failure	FAERS: 20 Canada Vigilance: 1		Canada Vigilance US FAERS
34	Hypotension	FAERS: 17 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
35	Immunosuppression	FAERS: 16		OFFSIDES US FAERS
36	Thrombocytopenia	FAERS: 16 Canada Vigilance: 3	10221490 12742468 12795665	CTD SIDER Canada Vigilance US FAERS
37	Arthralgia	FAERS: 15		SIDER US FAERS
38	Blood triglycerides increased	FAERS: 15		OFFSIDES SIDER US FAERS
39	Urinary tract infection	FAERS: 15		SIDER US FAERS
40	Acne	FAERS: 14 Canada Vigilance: 1		Canada Vigilance OFFSIDES SIDER US FAERS
41	Bronchitis	FAERS: 14		SIDER US FAERS
42	Thrombosis	FAERS: 14	View details 15032417 15364828 15919358 17097164 17145250 17711654 19567381	CTD SIDER US FAERS
43	Blindness	FAERS: 13		US FAERS
44	Sinusitis	FAERS: 13		SIDER US FAERS
45	Hernia	FAERS: 12		OFFSIDES SIDER US FAERS
46	Abdominal Pain	FAERS: 11		SIDER US FAERS
47	Feeling abnormal	FAERS: 11		SIDER US FAERS
48	Nephrotic Syndrome	FAERS: 11 Canada Vigilance: 1	16504675 18927120	CTD OFFSIDES SIDER Canada Vigilance US FAERS
49	Renal tubular necrosis	FAERS: 11		OFFSIDES SIDER US FAERS
50	Transaminases increased	FAERS: 11		US FAERS
51	Cellulitis	FAERS: 10 Canada Vigilance: 2		Canada Vigilance OFFSIDES SIDER US FAERS
52	Drug exposure during pregnancy	FAERS: 10		US FAERS
53	Drug level decreased	FAERS: 10 Canada Vigilance: 1		Canada Vigilance US FAERS
54	Influenza	FAERS: 10		SIDER US FAERS
55	Memory impairment	FAERS: 10		US FAERS
56	Post procedural complication	FAERS: 10		OFFSIDES US FAERS
57	Tremor	FAERS: 10		SIDER US FAERS
58	Cataract	FAERS: 9		SIDER US FAERS
59	Chest Pain	FAERS: 9		SIDER US FAERS
60	Chills	FAERS: 9		SIDER US FAERS
61	Complications of transplant surgery	FAERS: 9		OFFSIDES US FAERS
62	General physical health deterioration	FAERS: 9 Canada Vigilance: 1		Canada Vigilance US FAERS
63	Hypoxia	FAERS: 9		OFFSIDES US FAERS
64	Intestinal Obstruction	FAERS: 9		US FAERS
65	Myalgia	FAERS: 9		SIDER US FAERS
66	Pulmonary toxicity	FAERS: 9		OFFSIDES US FAERS
67	Skin Ulcer	FAERS: 9		SIDER US FAERS
68	Abdominal discomfort	FAERS: 8		US FAERS
69	Amnesia	FAERS: 8		US FAERS
70	Anxiety	FAERS: 8		SIDER US FAERS
71	Arthropathy	FAERS: 8		SIDER US FAERS
72	Cardiac Arrest	FAERS: 8		US FAERS
73	Deep Vein Thrombosis	FAERS: 8		SIDER US FAERS
74	Drug dose omission	FAERS: 8		US FAERS
75	Erythema Nodosum	FAERS: 8		OFFSIDES US FAERS
76	Ileus	FAERS: 8		SIDER US FAERS
77	Intentional product misuse	FAERS: 8		US FAERS
78	Leukopenia	FAERS: 8 Canada Vigilance: 1	10221490 12742468 17690032	CTD SIDER Canada Vigilance US FAERS
79	Product quality issue	FAERS: 8 Canada Vigilance: 1		Canada Vigilance US FAERS
80	Visual Impairment	FAERS: 8		SIDER US FAERS
81	Wrong technique in product usage process	FAERS: 8 Canada Vigilance: 1		Canada Vigilance US FAERS
82	Accidental overdose	FAERS: 7 Canada Vigilance: 1		Canada Vigilance US FAERS
83	Ascites	FAERS: 7 Canada Vigilance: 1		Canada Vigilance OFFSIDES SIDER US FAERS
84	Aspartate Aminotransferase Increased	FAERS: 7 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
85	Bronchopneumonia	FAERS: 7		OFFSIDES US FAERS
86	Colitis	FAERS: 7		US FAERS
87	Cystitis	FAERS: 7		US FAERS
88	Drug level below therapeutic	FAERS: 7 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
89	Drug toxicity	FAERS: 7		OFFSIDES US FAERS
90	Dyspepsia	FAERS: 7		SIDER US FAERS
91	Eczema	FAERS: 7 Canada Vigilance: 1		Canada Vigilance US FAERS
92	Focal glomerulosclerosis	FAERS: 7		OFFSIDES US FAERS
93	Gastroenteritis	FAERS: 7 Canada Vigilance: 2		Canada Vigilance OFFSIDES SIDER US FAERS
94	Immunosuppressant drug level decreased	FAERS: 7 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
95	Inflammation	FAERS: 7	20358864	CTD US FAERS
96	Laryngitis	FAERS: 7		US FAERS
97	Lymphoma	FAERS: 7		SIDER US FAERS
98	Medication Error	FAERS: 7 Canada Vigilance: 2		Canada Vigilance US FAERS
99	Neutropenia	FAERS: 7		SIDER US FAERS
100	Pancreatitis	FAERS: 7		SIDER US FAERS
101	Pulmonary Fibrosis	FAERS: 7 Canada Vigilance: 1	28624451	CTD SIDER Canada Vigilance US FAERS
102	Acute myocardial infarction	FAERS: 6		US FAERS
103	Alanine Aminotransferase Increased	FAERS: 6 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
104	Anuria	FAERS: 6		US FAERS
105	Blood glucose increased	FAERS: 6		US FAERS
106	Bone pain	FAERS: 6		SIDER US FAERS
107	Disease recurrence	FAERS: 6		OFFSIDES US FAERS
108	Fluid overload	FAERS: 6		OFFSIDES SIDER US FAERS
109	Malignant neoplasm progression	FAERS: 6		US FAERS
110	Medication residue present	FAERS: 6		US FAERS
111	Metrorrhagia	FAERS: 6		SIDER US FAERS
112	Pancytopenia	FAERS: 6		SIDER US FAERS
113	Pneumothorax	FAERS: 6		SIDER US FAERS
114	Protein urine present	FAERS: 6		SIDER US FAERS
115	Pruritus	FAERS: 6		SIDER US FAERS
116	Therapeutic response unexpected	FAERS: 6		OFFSIDES US FAERS
117	Angioedema	FAERS: 5	15147436 17377381	CTD OFFSIDES SIDER US FAERS
118	Back Pain	FAERS: 5		SIDER US FAERS
119	Blood count abnormal	FAERS: 5		US FAERS
120	Blood creatine increased	FAERS: 5		OFFSIDES US FAERS
121	Blood urea increased	FAERS: 5		OFFSIDES SIDER US FAERS
122	Clostridium difficile colitis	FAERS: 5		US FAERS
123	Concomitant disease progression	FAERS: 5		OFFSIDES US FAERS
124	Dementia	FAERS: 5		US FAERS
125	Depressed Level of Consciousness	FAERS: 5		US FAERS
126	Diabetic Foot	FAERS: 5		OFFSIDES US FAERS
127	Erythema	FAERS: 5 Canada Vigilance: 1		Canada Vigilance US FAERS
128	Gangrene	FAERS: 5		OFFSIDES US FAERS
129	Gastritis	FAERS: 5		SIDER US FAERS
130	Hypersensitivity	FAERS: 5 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
131	Joint swelling	FAERS: 5		US FAERS
132	Limb injury	FAERS: 5		US FAERS
133	Lung transplant rejection	FAERS: 5		US FAERS
134	Lymphocele	FAERS: 5	12364859 12795665 17656338	CTD OFFSIDES SIDER US FAERS
135	Malabsorption	FAERS: 5 Canada Vigilance: 1		Canada Vigilance US FAERS
136	Mental status changes	FAERS: 5		US FAERS
137	Product substitution issue	FAERS: 5		US FAERS
138	Pulmonary Embolism	FAERS: 5		SIDER US FAERS
139	Pulmonary Hypertension	FAERS: 5		US FAERS
140	Septic Shock	FAERS: 5 Canada Vigilance: 1		Canada Vigilance US FAERS
141	Swelling	FAERS: 5		US FAERS
142	Abdominal cavity drainage	FAERS: 4		US FAERS
143	Alopecia	FAERS: 4		US FAERS
144	Atelectasis	FAERS: 4		OFFSIDES SIDER US FAERS
145	Atrial Flutter	FAERS: 4		US FAERS
146	Blood creatinine abnormal	FAERS: 4		US FAERS
147	Chest discomfort	FAERS: 4		US FAERS
148	Dysarthria	FAERS: 4		US FAERS
149	Dysgeusia	FAERS: 4		US FAERS
150	Hepatitis C	FAERS: 4		OFFSIDES US FAERS
151	Hip surgery	FAERS: 4		US FAERS
152	Lymphadenopathy	FAERS: 4		SIDER US FAERS
153	Metastasis	FAERS: 4		US FAERS
154	Overdose	FAERS: 4		US FAERS
155	Pericarditis	FAERS: 4		US FAERS
156	Pleurisy	FAERS: 4		US FAERS
157	Polyneuropathy	FAERS: 4		US FAERS
158	Poor peripheral circulation	FAERS: 4		OFFSIDES US FAERS
159	Respiratory distress	FAERS: 4		US FAERS
160	Right ventricular failure	FAERS: 4		US FAERS
161	Squamous cell carcinoma	FAERS: 4		SIDER US FAERS
162	Tooth Loss	FAERS: 4		US FAERS
163	Transmission of drug via semen	FAERS: 4		OFFSIDES US FAERS
164	Upper respiratory tract inflammation	FAERS: 4		US FAERS
165	White blood cell count decreased	FAERS: 4		US FAERS
166	jaundice	FAERS: 4		US FAERS
167	lymphangiosarcoma	FAERS: 4		US FAERS
168	Acidosis	FAERS: 3		SIDER US FAERS
169	Acute respiratory failure	FAERS: 3		US FAERS
170	Alveolitis	FAERS: 3		OFFSIDES US FAERS
171	Aneurysm	FAERS: 3		US FAERS
172	Aphagia	FAERS: 3		US FAERS
173	Aphthous Stomatitis	FAERS: 3		OFFSIDES US FAERS
174	Arteriosclerosis	FAERS: 3		OFFSIDES US FAERS
175	Azoospermia	FAERS: 3		OFFSIDES SIDER US FAERS
176	Blood chloride decreased	FAERS: 3		US FAERS
177	Blood glucose decreased	FAERS: 3		US FAERS
178	Cardiac Tamponade	FAERS: 3	16048611	CTD US FAERS
179	Cholestasis	FAERS: 3 Canada Vigilance: 1	20417810	CTD Canada Vigilance US FAERS
180	Circumstance or information capable of leading to medication error	FAERS: 3		US FAERS
181	Clostridium difficile infection	FAERS: 3		US FAERS
182	Constipation	FAERS: 3		SIDER US FAERS
183	Cytolytic hepatitis	FAERS: 3		US FAERS
184	Deafness	FAERS: 3		SIDER US FAERS
185	Decreased immune responsiveness	FAERS: 3		OFFSIDES US FAERS
186	Diabetic ulcer	FAERS: 3		US FAERS
187	Diffuse Large B-Cell Lymphoma	FAERS: 3		OFFSIDES US FAERS
188	Dizziness	FAERS: 3 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
189	Drug administered to patient of inappropriate age	FAERS: 3		US FAERS
190	Dysuria	FAERS: 3		OFFSIDES SIDER US FAERS
191	Endocarditis	FAERS: 3		OFFSIDES US FAERS
192	Epistaxis	FAERS: 3		SIDER US FAERS
193	Expired product administered	FAERS: 3		US FAERS
194	Failure to Thrive	FAERS: 3		US FAERS
195	Folliculitis	FAERS: 3		OFFSIDES US FAERS
196	Gastric ulcer	FAERS: 3		US FAERS
197	Gastroenteritis norovirus	FAERS: 3		US FAERS
198	Gout	FAERS: 3		SIDER US FAERS
199	Graft dysfunction	FAERS: 3		OFFSIDES US FAERS
200	Graft loss	FAERS: 3		OFFSIDES SIDER US FAERS
201	Hepatitis B	FAERS: 3		US FAERS
202	Hypokinesia	FAERS: 3		US FAERS
203	Inappropriate schedule of drug administration	FAERS: 3		US FAERS
204	Joint injury	FAERS: 3		US FAERS
205	Lobar Pneumonia	FAERS: 3		US FAERS
206	Lower respiratory tract infection	FAERS: 3 Canada Vigilance: 1		Canada Vigilance US FAERS
207	Lymphopenia	FAERS: 3		US FAERS
208	Musculoskeletal Pain	FAERS: 3		US FAERS
209	Necrosis	FAERS: 3	25445804	CTD US FAERS
210	Nephrectomy	FAERS: 3		OFFSIDES US FAERS
211	Nephrosclerosis	FAERS: 3		US FAERS
212	No adverse event	FAERS: 3		US FAERS
213	Oliguria	FAERS: 3		SIDER US FAERS
214	Oropharyngeal pain	FAERS: 3		US FAERS
215	Palpitations	FAERS: 3		SIDER US FAERS
216	Poor quality drug administered	FAERS: 3		OFFSIDES US FAERS
217	Pre-existing condition improved	FAERS: 3		US FAERS
218	Prescribed overdose	FAERS: 3		US FAERS
219	Product container issue	FAERS: 3		US FAERS
220	Product packaging issue	FAERS: 3		US FAERS
221	Renal Cell Carcinoma	FAERS: 3		US FAERS
222	Renal pain	FAERS: 3		SIDER US FAERS
223	Respiratory arrest	FAERS: 3		US FAERS
224	Skin lesion	FAERS: 3		US FAERS
225	Sputum culture positive	FAERS: 3		OFFSIDES US FAERS
226	Stenotrophomonas infection	FAERS: 3		US FAERS
227	Stress	FAERS: 3		US FAERS
228	Throat irritation	FAERS: 3		US FAERS
229	Tuberculosis	FAERS: 3		SIDER US FAERS
230	Unevaluable event	FAERS: 3		US FAERS
231	Urticaria	FAERS: 3		US FAERS
232	Ventricular Dysfunction	FAERS: 3	21357504	CTD US FAERS
233	Wound evisceration	FAERS: 3		OFFSIDES US FAERS
234	Wound necrosis	FAERS: 3		OFFSIDES US FAERS
235	nervous system disorder	FAERS: 3		SIDER US FAERS
236	Abdominal Infection	FAERS: 2		US FAERS
237	Acarodermatitis	FAERS: 2		US FAERS
238	Accidental exposure to product by child	FAERS: 2		US FAERS
239	Accidental exposure	FAERS: 2		US FAERS
240	Anal Ulcer	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
241	Apparent death	FAERS: 2		US FAERS
242	Atrial Fibrillation	FAERS: 2		SIDER US FAERS
243	Atrioventricular Block	FAERS: 2		US FAERS
244	Basal cell carcinoma	FAERS: 2		SIDER US FAERS
245	Biliary anastomosis complication	FAERS: 2		US FAERS
246	Blood alkaline phosphatase increased	FAERS: 2 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
247	Blood creatine phosphokinase increased	FAERS: 2		SIDER US FAERS
248	Blood phosphorus increased	FAERS: 2		US FAERS
249	Blood potassium increased	FAERS: 2		OFFSIDES US FAERS
250	Blood sodium decreased	FAERS: 2		US FAERS
251	Bowen's Disease	FAERS: 2		OFFSIDES US FAERS
252	Bronchiectasis	FAERS: 2		US FAERS
253	Bronchoalveolar lavage abnormal	FAERS: 2		US FAERS
254	Bronchopulmonary Aspergillosis	FAERS: 2		US FAERS
255	Bursitis	FAERS: 2		US FAERS
256	Chest wall pain	FAERS: 2		US FAERS
257	Choking	FAERS: 2		US FAERS
258	Chronic respiratory failure	FAERS: 2		US FAERS
259	Coronary Artery Disease	FAERS: 2		US FAERS
260	Creatinine renal clearance decreased	FAERS: 2		OFFSIDES US FAERS
261	Crying	FAERS: 2		US FAERS
262	Dental caries	FAERS: 2		US FAERS
263	Device related infection	FAERS: 2		US FAERS
264	Disorientation	FAERS: 2		US FAERS
265	Drug dispensing error	FAERS: 2		US FAERS
266	Drug effective for unapproved indication	FAERS: 2		US FAERS
267	Drug resistance	FAERS: 2		US FAERS
268	Dysphonia	FAERS: 2		US FAERS
269	Encephalitis	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
270	Febrile Neutropenia	FAERS: 2		US FAERS
271	Feeling of body temperature change	FAERS: 2		US FAERS
272	Full blood count decreased	FAERS: 2		US FAERS
273	Glomerulonephritis	FAERS: 2		OFFSIDES US FAERS
274	Graft versus host disease in lung	FAERS: 2		US FAERS
275	Hemiparesis	FAERS: 2		US FAERS
276	Hepatic artery thrombosis	FAERS: 2 Canada Vigilance: 1		Canada Vigilance OFFSIDES SIDER US FAERS
277	Hepatic necrosis	FAERS: 2		OFFSIDES SIDER US FAERS
278	Impaired work ability	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
279	Incorrect dose administered	FAERS: 2		US FAERS
280	Incorrect route of drug administration	FAERS: 2		US FAERS
281	Intentional product use issue	FAERS: 2		US FAERS
282	Intestinal Perforation	FAERS: 2		US FAERS
283	Intracranial Aneurysm	FAERS: 2		US FAERS
284	Laceration	FAERS: 2		US FAERS
285	Leukocytoclastic vasculitis	FAERS: 2		SIDER US FAERS
286	Leukoencephalopathy	FAERS: 2		US FAERS
287	Limb discomfort	FAERS: 2		US FAERS
288	Lip swelling	FAERS: 2		US FAERS
289	Lung Injury	FAERS: 2		US FAERS
290	Lymphomatoid Papulosis	FAERS: 2		US FAERS
291	Meningitis	FAERS: 2		US FAERS
292	Metabolic acidosis	FAERS: 2		US FAERS
293	Metastatic Neoplasm	FAERS: 2		OFFSIDES US FAERS
294	Neuralgia	FAERS: 2		US FAERS
295	Neuropathy	FAERS: 2		SIDER US FAERS
296	Neutrophil count decreased	FAERS: 2		US FAERS
297	Night sweats	FAERS: 2		US FAERS
298	Ovarian dysgerminoma stage unspecified	FAERS: 2		OFFSIDES US FAERS
299	Pancreatic carcinoma	FAERS: 2		US FAERS
300	Pancreatic enzymes increased	FAERS: 2		US FAERS
301	Patent ductus arteriosus	FAERS: 2		US FAERS
302	Pelvic Inflammatory Disease	FAERS: 2		US FAERS
303	Peptic Ulcer	FAERS: 2		US FAERS
304	Peritonitis	FAERS: 2 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
305	Procedural complication	FAERS: 2		US FAERS
306	Procedural hypotension	FAERS: 2		OFFSIDES US FAERS
307	Proctocolitis	FAERS: 2		OFFSIDES US FAERS
308	Product container seal issue	FAERS: 2		US FAERS
309	Product dose omission	FAERS: 2		US FAERS
310	Product preparation error	FAERS: 2		US FAERS
311	Productive Cough	FAERS: 2		US FAERS
312	Pulmonary congestion	FAERS: 2		OFFSIDES US FAERS
313	Pulmonary function test decreased	FAERS: 2		US FAERS
314	Pyelonephritis	FAERS: 2		OFFSIDES SIDER US FAERS
315	Quadriplegia	FAERS: 2		OFFSIDES US FAERS
316	Radiation injury	FAERS: 2		US FAERS
317	Red blood cell schistocytes present	FAERS: 2		OFFSIDES US FAERS
318	Renal tubular atrophy	FAERS: 2		OFFSIDES US FAERS
319	Restrictive pulmonary disease	FAERS: 2		OFFSIDES US FAERS
320	Retinal Degeneration	FAERS: 2		US FAERS
321	Sarcoma	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
322	Sciatica	FAERS: 2		US FAERS
323	Seroma	FAERS: 2		OFFSIDES US FAERS
324	Shock	FAERS: 2		SIDER US FAERS
325	Sneezing	FAERS: 2		US FAERS
326	Spermatozoa abnormal	FAERS: 2		US FAERS
327	Suicide attempt	FAERS: 2		US FAERS
328	Tachycardia	FAERS: 2		SIDER US FAERS
329	Ulcer	FAERS: 2	20815021	CTD US FAERS
330	Unresponsive to stimuli	FAERS: 2		US FAERS
331	Urinary tract infection enterococcal	FAERS: 2		OFFSIDES US FAERS
332	Urinoma	FAERS: 2		OFFSIDES US FAERS
333	Vertigo	FAERS: 2		US FAERS
334	Viral upper respiratory tract infection	FAERS: 2		US FAERS
335	treatment failure	FAERS: 2		US FAERS
336	Abasia	FAERS: 1		US FAERS
337	Abscess	FAERS: 1		SIDER US FAERS
338	Actinomycosis	FAERS: 1		US FAERS
339	Activities of daily living impaired	FAERS: 1		US FAERS
340	Acute kidney injury	FAERS: 1	View details 16316336 16889550 19376416 30236763	CTD US FAERS
341	Adverse event	FAERS: 1		US FAERS
342	Ageusia	FAERS: 1		US FAERS
343	Allergic colitis	FAERS: 1		US FAERS
344	Ammonia increased	FAERS: 1		US FAERS
345	Amyloidosis	FAERS: 1		US FAERS
346	Anger	FAERS: 1		US FAERS
347	Angina Pectoris	FAERS: 1		US FAERS
348	Angiomyolipoma	FAERS: 1		US FAERS
349	Anorexia	FAERS: 1		SIDER US FAERS
350	Antibody test positive	FAERS: 1		US FAERS
351	Aphonia	FAERS: 1		US FAERS
352	Arterial fibrosis	FAERS: 1		US FAERS
353	Arterial thrombosis	FAERS: 1		US FAERS
354	Aspergillosis	FAERS: 1		US FAERS
355	Asphyxia	FAERS: 1		US FAERS
356	Asthma	FAERS: 1		SIDER US FAERS
357	Atrial thrombosis	FAERS: 1		OFFSIDES US FAERS
358	Atypical pneumonia	FAERS: 1		US FAERS
359	BK virus infection	FAERS: 1		OFFSIDES US FAERS
360	Back disorder	FAERS: 1		US FAERS
361	Bedridden	FAERS: 1		US FAERS
362	Bicytopenia	FAERS: 1		US FAERS
363	Bile duct cancer recurrent	FAERS: 1		OFFSIDES US FAERS
364	Bipolar Disorder	FAERS: 1		US FAERS
365	Blood chloride increased	FAERS: 1		OFFSIDES US FAERS
366	Blood creatine abnormal	FAERS: 1		US FAERS
367	Blood creatinine decreased	FAERS: 1		OFFSIDES US FAERS
368	Blood growth hormone increased	FAERS: 1		US FAERS
369	Blood immunoglobulin G decreased	FAERS: 1		US FAERS
370	Blood iron decreased	FAERS: 1		US FAERS
371	Blood iron increased	FAERS: 1		OFFSIDES US FAERS
372	Blood lactate dehydrogenase increased	FAERS: 1		OFFSIDES SIDER US FAERS
373	Blood magnesium decreased	FAERS: 1		US FAERS
374	Blood phosphorus decreased	FAERS: 1		OFFSIDES US FAERS
375	Blood potassium decreased	FAERS: 1		US FAERS
376	Blood sodium increased	FAERS: 1		US FAERS
377	Bone density abnormal	FAERS: 1		US FAERS
378	Bone infarction	FAERS: 1		US FAERS
379	Bone swelling	FAERS: 1		US FAERS
380	Bradycardia	FAERS: 1		US FAERS
381	Brain natriuretic peptide increased	FAERS: 1		US FAERS
382	Bullous lung disease	FAERS: 1		US FAERS
383	Cachexia	FAERS: 1		US FAERS
384	Candidiasis	FAERS: 1		US FAERS
385	Cardiomegaly	FAERS: 1	19321761 19397913 21357504	CTD SIDER US FAERS
386	Catheter related infection	FAERS: 1		OFFSIDES US FAERS
387	Catheter site discharge	FAERS: 1		US FAERS
388	Central nervous system lesion	FAERS: 1		US FAERS
389	Cheilitis	FAERS: 1		US FAERS
390	Cholelithiasis	FAERS: 1		US FAERS
391	Citrobacter infection	FAERS: 1		OFFSIDES US FAERS
392	Clostridium colitis	FAERS: 1		OFFSIDES US FAERS
393	Clubbing	FAERS: 1		US FAERS
394	Completed Suicide	FAERS: 1		US FAERS
395	Complication of device insertion	FAERS: 1		US FAERS
396	Complication of device removal	FAERS: 1		US FAERS
397	Conversion disorder	FAERS: 1		US FAERS
398	Cor pulmonale	FAERS: 1		US FAERS
399	Coronary artery insufficiency	FAERS: 1		OFFSIDES US FAERS
400	Cranial Nerve Infection	FAERS: 1		US FAERS
401	Creatine phosphokinase decreased	FAERS: 1		US FAERS
402	Critical Illness	FAERS: 1		US FAERS
403	Culture negative	FAERS: 1		US FAERS
404	Cystitis glandularis	FAERS: 1		US FAERS
405	Cytopenia	FAERS: 1		US FAERS
406	Dependence on oxygen therapy	FAERS: 1		US FAERS
407	Depressed mood	FAERS: 1		US FAERS
408	Depression suicidal	FAERS: 1		US FAERS
409	Dermatitis acneiform	FAERS: 1		US FAERS
410	Device Failure	FAERS: 1		OFFSIDES US FAERS
411	Device breakage	FAERS: 1		US FAERS
412	Device dislocation	FAERS: 1		US FAERS
413	Diabetes mellitus inadequate control	FAERS: 1		OFFSIDES US FAERS
414	Diabetic Ketoacidosis	FAERS: 1		US FAERS
415	Diabetic neuropathic ulcer	FAERS: 1		US FAERS
416	Discomfort	FAERS: 1		SIDER US FAERS
417	Diverticulitis	FAERS: 1		US FAERS
418	Drug administered in wrong device	FAERS: 1		US FAERS
419	Drug administration error	FAERS: 1		US FAERS
420	Drug effect incomplete	FAERS: 1		US FAERS
421	Drug level above therapeutic	FAERS: 1		US FAERS
422	Drug level fluctuating	FAERS: 1		OFFSIDES US FAERS
423	Drug withdrawal syndrome	FAERS: 1		US FAERS
424	Duodenal Obstruction	FAERS: 1		US FAERS
425	Ejection Fraction Decreased	FAERS: 1		OFFSIDES US FAERS
426	Elbow operation	FAERS: 1		US FAERS
427	Electrolyte imbalance	FAERS: 1		US FAERS
428	Emotional disorder	FAERS: 1		US FAERS
429	Empyema	FAERS: 1		US FAERS
430	Enterococcal infection	FAERS: 1		OFFSIDES US FAERS
431	Enterocolitis	FAERS: 1		SIDER US FAERS
432	Eosinophilia	FAERS: 1		US FAERS
433	Epilepsy	FAERS: 1		US FAERS
434	Epstein-Barr virus associated lymphoproliferative disorder	FAERS: 1		US FAERS
435	Escherichia urinary tract infection	FAERS: 1		OFFSIDES US FAERS
436	Excessive cerumen production	FAERS: 1		US FAERS
437	Expired drug administered	FAERS: 1		US FAERS
438	Eye Infection	FAERS: 1		US FAERS
439	Eye pain	FAERS: 1		US FAERS
440	Factor VIII inhibition	FAERS: 1		OFFSIDES US FAERS
441	False positive investigation result	FAERS: 1		US FAERS
442	Feeding disorder neonatal	FAERS: 1		US FAERS
443	Fibrin D dimer increased	FAERS: 1		US FAERS
444	Fibrosis	FAERS: 1		US FAERS
445	Flushing	FAERS: 1		US FAERS
446	Food Allergy	FAERS: 1		US FAERS
447	Fracture	FAERS: 1		US FAERS
448	Frustration tolerance decreased	FAERS: 1		US FAERS
449	Gait inability	FAERS: 1		US FAERS
450	Gamma-Glutamyltransferase Increased	FAERS: 1		US FAERS
451	Gastroenteritis sapovirus	FAERS: 1		US FAERS
452	Gastrointestinal arteriovenous malformation	FAERS: 1		US FAERS
453	Gastrointestinal wall thickening	FAERS: 1		US FAERS
454	Gingival Hypertrophy	FAERS: 1		US FAERS
455	Gingival discomfort	FAERS: 1		US FAERS
456	Growth retardation	FAERS: 1		US FAERS
457	Guillain-Barre Syndrome	FAERS: 1		US FAERS
458	Hemiplegia	FAERS: 1		US FAERS
459	Hepatic Infection	FAERS: 1		US FAERS
460	Hepatic cancer metastatic	FAERS: 1		OFFSIDES US FAERS
461	Hidradenitis	FAERS: 1		US FAERS
462	Histiocytosis haematophagic	FAERS: 1		US FAERS
463	Human herpes virus 6 serology	FAERS: 1		US FAERS
464	Hunger	FAERS: 1		US FAERS
465	Hydrocephalus	FAERS: 1		US FAERS
466	Hydronephrosis	FAERS: 1		OFFSIDES SIDER US FAERS
467	Hyperkeratosis	FAERS: 1		US FAERS
468	Hyperpyrexia	FAERS: 1		US FAERS
469	Hypertensive emergency	FAERS: 1		OFFSIDES US FAERS
470	Hypertransaminasaemia	FAERS: 1		US FAERS
471	Hypogeusia	FAERS: 1		OFFSIDES US FAERS
472	Hypophagia	FAERS: 1		US FAERS
473	Immunology test abnormal	FAERS: 1		US FAERS
474	Impaired gastric emptying	FAERS: 1		OFFSIDES US FAERS
475	Implant site infection	FAERS: 1		OFFSIDES US FAERS
476	Inappropriate schedule of product administration	FAERS: 1		US FAERS
477	Incisional hernia	FAERS: 1		OFFSIDES SIDER US FAERS
478	Incontinence	FAERS: 1		US FAERS
479	Incorrect drug administration duration	FAERS: 1		US FAERS
480	Incorrect storage of drug	FAERS: 1		US FAERS
481	Increased tendency to bruise	FAERS: 1		US FAERS
482	Infantile apnoeic attack	FAERS: 1		US FAERS
483	Jugular vein distension	FAERS: 1		OFFSIDES US FAERS
484	Lethargy	FAERS: 1		US FAERS
485	Ligament rupture	FAERS: 1		US FAERS
486	Limb crushing injury	FAERS: 1		US FAERS
487	Liver Abscess	FAERS: 1		OFFSIDES US FAERS
488	Loss of personal independence in daily activities	FAERS: 1		US FAERS
489	Low density lipoprotein increased	FAERS: 1		US FAERS
490	Lung consolidation	FAERS: 1		OFFSIDES US FAERS
491	Lung infection pseudomonal	FAERS: 1		US FAERS
492	Lung squamous cell carcinoma recurrent	FAERS: 1		US FAERS
493	Lymphocyte count decreased	FAERS: 1		US FAERS
494	MYELODYSPLASTIC SYNDROME	FAERS: 1		US FAERS
495	Malignant Fibrous Histiocytoma	FAERS: 1		US FAERS
496	Mediastinal mass	FAERS: 1		US FAERS
497	Medical device complication	FAERS: 1		US FAERS
498	Mental impairment	FAERS: 1		US FAERS
499	Metaplasia	FAERS: 1		US FAERS
500	Metastases to adrenals	FAERS: 1		US FAERS
501	Miscarriage of partner	FAERS: 1		US FAERS
502	Multi-organ disorder	FAERS: 1		US FAERS
503	Muscle Spasticity	FAERS: 1		US FAERS
504	Musculoskeletal chest pain	FAERS: 1		US FAERS
505	Mycobacterium abscessus Infection	FAERS: 1		OFFSIDES US FAERS
506	Myopathy	FAERS: 1		US FAERS
507	Nail Infection	FAERS: 1		OFFSIDES US FAERS
508	Neonatal hypotension	FAERS: 1		US FAERS
509	Nephrogenic Systemic Fibrosis	FAERS: 1		US FAERS
510	Nephrolithiasis	FAERS: 1		US FAERS
511	Nervousness	FAERS: 1		SIDER US FAERS
512	Neutropenic sepsis	FAERS: 1		US FAERS
513	Nodule	FAERS: 1		US FAERS
514	Norovirus test positive	FAERS: 1		US FAERS
515	Obstruction	FAERS: 1		OFFSIDES US FAERS
516	Ocular Toxicity	FAERS: 1		US FAERS
517	Oral candidiasis	FAERS: 1		SIDER US FAERS
518	Oral pain	FAERS: 1		US FAERS
519	Osteomyelitis	FAERS: 1		US FAERS
520	Osteoporosis	FAERS: 1		SIDER US FAERS
521	Ovarian adenoma	FAERS: 1		OFFSIDES US FAERS
522	Pain of skin	FAERS: 1		US FAERS
523	Paranoia	FAERS: 1		US FAERS
524	Pelvic abscess	FAERS: 1		OFFSIDES US FAERS
525	Periarthritis	FAERS: 1		US FAERS
526	Peripheral arterial occlusive disease	FAERS: 1		US FAERS
527	Peripheral occlusive disease	FAERS: 1		US FAERS
528	Peritoneal Dialysis	FAERS: 1		OFFSIDES US FAERS
529	Petechiae	FAERS: 1		US FAERS
530	Pharyngitis	FAERS: 1		SIDER US FAERS
531	Phlebitis	FAERS: 1		US FAERS
532	Photophobia	FAERS: 1		US FAERS
533	Plasmapheresis	FAERS: 1		OFFSIDES US FAERS
534	Pleuritic pain	FAERS: 1		US FAERS
535	Pneumocystis jiroveci pneumonia	FAERS: 1		US FAERS
536	Polydipsia	FAERS: 1		US FAERS
537	Poor quality product administered	FAERS: 1		US FAERS
538	Portal Vein Thrombosis	FAERS: 1		OFFSIDES US FAERS
539	Post procedural sepsis	FAERS: 1		US FAERS
540	Posterior reversible encephalopathy syndrome	FAERS: 1		US FAERS
541	Postoperative wound complication	FAERS: 1		OFFSIDES US FAERS
542	Pre-Eclampsia	FAERS: 1		US FAERS
543	Prescribed underdose	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
544	Prescription drug used without a prescription	FAERS: 1		US FAERS
545	Product dispensing error	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
546	Product label issue	FAERS: 1		US FAERS
547	Product prescribing error	FAERS: 1		US FAERS
548	Product solubility abnormal	FAERS: 1		US FAERS
549	Product storage error	FAERS: 1		US FAERS
550	Product taste abnormal	FAERS: 1		US FAERS
551	Prostatectomy	FAERS: 1		US FAERS
552	Prosthesis Implantation	FAERS: 1		US FAERS
553	Protein total decreased	FAERS: 1		US FAERS
554	Protein total increased	FAERS: 1		US FAERS
555	Pulmonary granuloma	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
556	Pulmonary necrosis	FAERS: 1		US FAERS
557	Pulmonary vasculitis	FAERS: 1		US FAERS
558	Purulence	FAERS: 1		OFFSIDES US FAERS
559	Pyelocaliectasis	FAERS: 1		US FAERS
560	Quadriparesis	FAERS: 1		US FAERS
561	Quality of life decreased	FAERS: 1		OFFSIDES US FAERS
562	Radiosensitisation therapy	FAERS: 1		US FAERS
563	Rash erythematous	FAERS: 1		US FAERS
564	Reaction to excipient	FAERS: 1		US FAERS
565	Renal Artery Stenosis	FAERS: 1		OFFSIDES US FAERS
566	Renal artery occlusion	FAERS: 1		US FAERS
567	Renal cancer metastatic	FAERS: 1		OFFSIDES US FAERS
568	Respiratory Depression	FAERS: 1		US FAERS
569	Respiratory syncytial virus bronchiolitis	FAERS: 1		US FAERS
570	Restlessness	FAERS: 1		US FAERS
571	Retching	FAERS: 1		US FAERS
572	Rhabdomyolysis	FAERS: 1	19376416	CTD US FAERS
573	Rhinitis	FAERS: 1		SIDER US FAERS
574	Sarcoidosis	FAERS: 1		US FAERS
575	Scleroderma	FAERS: 1		US FAERS
576	Serum Sickness	FAERS: 1		US FAERS
577	Skin necrosis	FAERS: 1		US FAERS
578	Skin toxicity	FAERS: 1		US FAERS
579	Soft Tissue Infection	FAERS: 1		OFFSIDES US FAERS
580	Soft tissue inflammation	FAERS: 1		US FAERS
581	Splenectomy	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
582	Splenic Infarction	FAERS: 1		US FAERS
583	Splenic Rupture	FAERS: 1		US FAERS
584	Splenic varices	FAERS: 1		US FAERS
585	Splenomegaly	FAERS: 1		US FAERS
586	Spontaneous cerebrospinal fluid leak syndrome	FAERS: 1		US FAERS
587	Squamous cell carcinoma of skin	FAERS: 1		OFFSIDES US FAERS
588	Stem cell transplant	FAERS: 1		US FAERS
589	Subcutaneous Abscess	FAERS: 1		OFFSIDES US FAERS
590	Sudden death	FAERS: 1		US FAERS
591	Therapy cessation	FAERS: 1		US FAERS
592	Therapy change	FAERS: 1		US FAERS
593	Therapy non-responder	FAERS: 1		US FAERS
594	Throat cancer	FAERS: 1		US FAERS
595	Thrombocytopenic purpura	FAERS: 1		SIDER US FAERS
596	Thrombophlebitis	FAERS: 1		SIDER US FAERS
597	Tongue blistering	FAERS: 1		US FAERS
598	Toothache	FAERS: 1		US FAERS
599	Toxic Shock Syndrome	FAERS: 1		US FAERS
600	Transplant	FAERS: 1		US FAERS
601	Tumour haemorrhage	FAERS: 1		US FAERS
602	Ultrasound scan abnormal	FAERS: 1		OFFSIDES US FAERS
603	Umbilical hernia	FAERS: 1		OFFSIDES US FAERS
604	Urinary tract infection staphylococcal	FAERS: 1		OFFSIDES US FAERS
605	Uterine Cancer	FAERS: 1		OFFSIDES US FAERS
606	Uveitis	FAERS: 1	1336536	CTD US FAERS
607	Vascular occlusion	FAERS: 1		US FAERS
608	Vasculitis gastrointestinal	FAERS: 1		OFFSIDES US FAERS
609	Venoocclusive disease	FAERS: 1		OFFSIDES US FAERS
610	Venous Thrombosis	FAERS: 1		US FAERS
611	Ventilation/perfusion scan abnormal	FAERS: 1		US FAERS
612	Viral pericarditis	FAERS: 1		US FAERS
613	Waist circumference increased	FAERS: 1		US FAERS
614	Wound Infection	FAERS: 1		OFFSIDES SIDER US FAERS
615	Wrong technique in device usage process	FAERS: 1		US FAERS
616	abdominal wall wound	FAERS: 1		US FAERS
617	furuncle	FAERS: 1		US FAERS
618	skin abrasion	FAERS: 1		US FAERS
619	Abdominal Abscess			OFFSIDES
620	Abdominal sepsis			OFFSIDES
621	Abdominal strangulated hernia			OFFSIDES
622	Abdominal wall infection			OFFSIDES
623	Abnormal vision			SIDER
624	Acid fast bacilli infection			OFFSIDES
625	Actinic keratosis			OFFSIDES
626	Acute Coronary Syndrome			OFFSIDES
627	Acute allograft rejection			SIDER
628	Adenocarcinoma			OFFSIDES
629	Adenoiditis			OFFSIDES
630	Agitation			SIDER
631	Albuminuria		16095517	CTD SIDER
632	Alopecia effluvium			OFFSIDES
633	Anaphylactic shock			SIDER
634	Anaphylactoid Reaction			SIDER
635	Anastomotic complication			OFFSIDES
636	Anastomotic stenosis			OFFSIDES
637	Anastomotic ulcer			OFFSIDES
638	Anemia		View details 16314788 17038905 17565578 18339148 18724224 19100499 19553912 20054028	CTD
639	Angioplasty			OFFSIDES
640	Antipsychotic drug level below therapeutic			OFFSIDES
641	Antipsychotic drug level increased			OFFSIDES
642	Antiviral drug level above therapeutic			OFFSIDES
643	Arteriopathic disease			OFFSIDES
644	Arteriovenous fistula			OFFSIDES
645	Arteriovenous graft thrombosis			OFFSIDES
646	Arthritis			OFFSIDES
647	Asymptomatic bacteriuria			OFFSIDES
648	Ataxia	Canada Vigilance: 1		Canada Vigilance
649	Atherosclerosis		17449502 19893993	CTD
650	Autistic Disorder		21115397	CTD
651	Bacteria sputum identified			OFFSIDES
652	Bacteria urine identified			OFFSIDES
653	Bacterial pyelonephritis			OFFSIDES
654	Band neutrophil percentage increased			OFFSIDES
655	Basal ganglion degeneration			OFFSIDES
656	Benign neoplasm of skin			SIDER
657	Bile duct stent insertion			OFFSIDES
658	Biliary dilatation			OFFSIDES
659	Biopsy liver abnormal			OFFSIDES
660	Biopsy lung abnormal			OFFSIDES
661	Bipolar I disorder			OFFSIDES
662	Bladder Neoplasm			OFFSIDES
663	Bladder neck obstruction			OFFSIDES
664	Bladder pain			SIDER
665	Bladder spasm			OFFSIDES
666	Blood Glucose			OFFSIDES
667	Blood albumin increased			OFFSIDES
668	Blood and lymphatic system disorders			SIDER
669	Blood bicarbonate			OFFSIDES
670	Blood creatine phosphokinase MB increased			OFFSIDES
671	Blood folate abnormal			OFFSIDES
672	Blood gases abnormal			OFFSIDES
673	Blood glucose fluctuation			OFFSIDES
674	Blood immunoglobulin E			OFFSIDES
675	Blood pH decreased			OFFSIDES
676	Blood parathyroid hormone			OFFSIDES
677	Bone Resorption		26369790	CTD
678	Bone callus excessive			OFFSIDES
679	Bone marrow toxicity			OFFSIDES
680	Brain Diseases		17543796	CTD
681	Brain Infarction		17548556	CTD
682	Bronchiolitis	Canada Vigilance: 1		Canada Vigilance OFFSIDES
683	Calcinosis			OFFSIDES
684	Calciphylaxis			OFFSIDES
685	Candiduria			OFFSIDES
686	Capillary Leak Syndrome		10328196	CTD
687	Carcinogenicity			SIDER
688	Carcinoma		12417722	CTD SIDER
689	Cardiac Flutter			OFFSIDES
690	Cardiac ablation			OFFSIDES
691	Cardioactive drug level			OFFSIDES
692	Carotid Artery Injuries		20031680	CTD
693	Carotid bruit			OFFSIDES
694	Cataract operation			OFFSIDES
695	Cataract specified			SIDER
696	Catheter site erythema			OFFSIDES
697	Central line infection			OFFSIDES
698	Chemotherapeutic drug level increased			OFFSIDES
699	Cholecystitis			OFFSIDES
700	Cholestatic liver injury			OFFSIDES
701	Chronic left ventricular failure			OFFSIDES
702	Chronic ulcerative colitis			OFFSIDES
703	Circumoral paresthesia			SIDER
704	Cleft Palate			OFFSIDES
705	Cognition Disorders		26139607	CTD
706	Complement factor abnormal			OFFSIDES
707	Complex partial seizures			OFFSIDES
708	Congenital heart disease			OFFSIDES
709	Conjunctivitis			SIDER
710	Corneal Ulcer			OFFSIDES
711	Coronary Restenosis		15057437	CTD
712	Cramps of lower extremities			SIDER
713	Creatine Phosphokinase Increased			SIDER
714	Creatinine increased			SIDER
715	Culture positive			OFFSIDES
716	Culture wound positive			OFFSIDES
717	Cyclosporine toxicity			SIDER
718	Cyst			SIDER
719	Cytomegalovirus gastroenteritis			OFFSIDES
720	Cytomegalovirus hepatitis			OFFSIDES
721	Decreased tolerance			SIDER
722	Delayed Graft Function		20017105	CTD
723	Delayed engraftment			OFFSIDES
724	Demyelinating Diseases		18589148 20739560	CTD
725	Denervation atrophy			OFFSIDES
726	Dermatitis			SIDER
727	Device leakage			OFFSIDES
728	Diabetes			OFFSIDES
729	Diarrhea		15102967	CTD OFFSIDES
730	Differential white blood cell count abnormal			OFFSIDES
731	Dilatation intrahepatic duct acquired			OFFSIDES
732	Diverticular perforation			OFFSIDES
733	Drug Eruptions		15589473	CTD
734	Drug addict			OFFSIDES
735	Drug level changed			OFFSIDES
736	Dry gangrene			OFFSIDES
737	Duodenal perforation			OFFSIDES
738	Dysmorphism			OFFSIDES
739	Dysphemia			OFFSIDES
740	Dyspnoea exacerbated			OFFSIDES
741	Ecchymosis			SIDER
742	Edema		17362756 18589147	CTD
743	Electrocardiogram ST segment abnormal			OFFSIDES
744	Electrocardiogram ST-T change			OFFSIDES
745	Electromechanical dissociation			OFFSIDES
746	Embolic stroke			OFFSIDES
747	Endometrial Hyperplasia			OFFSIDES
748	Enlargement abdomen			SIDER
749	Epidermolysis			OFFSIDES
750	Epiglottitis			OFFSIDES
751	Erectile dysfunction			SIDER
752	Eructation			SIDER
753	Erysipelas			OFFSIDES
754	Erythema Infectiosum			OFFSIDES
755	Erythroid series abnormal			OFFSIDES
756	Eschar			OFFSIDES
757	Escherichia infection	Canada Vigilance: 1		Canada Vigilance OFFSIDES
758	Exanthema		15102967 18044728 20815021	CTD
759	Fever		18023106	CTD
760	Fibroadenoma of breast			OFFSIDES
761	Flatulence			SIDER
762	Foreign-Body Reaction		19564562	CTD
763	Fungus sputum test positive			OFFSIDES
764	Gastric hypomotility			OFFSIDES
765	Gastrointestinal Pain			SIDER
766	Gastrointestinal infection			OFFSIDES
767	Gastrointestinal ulcer			OFFSIDES
768	Gingival Hyperplasia			SIDER
769	Gingivitis			SIDER
770	Globulinuria			OFFSIDES
771	Glomerular vascular disorder			OFFSIDES
772	Glomerulonephritis, Membranoproliferative		15112032	CTD
773	Glossitis			OFFSIDES
774	Glycosuria			SIDER
775	Granuloma			OFFSIDES
776	Head and Neck Neoplasms		19435901	CTD
777	Heart-lung transplant rejection			OFFSIDES
778	Hemolytic-Uremic Syndrome		15625544 17288963	CTD
779	Hepatic Veno-Occlusive Disease		18776081	CTD
780	Hepatic artery stenosis			OFFSIDES
781	Hepatic congestion			OFFSIDES
782	Hepatic cyst infection			OFFSIDES
783	Hepatitis B surface antigen positive			OFFSIDES
784	Hepatitis	Canada Vigilance: 1		Canada Vigilance
785	Hepatotoxicity	Canada Vigilance: 1		Canada Vigilance SIDER
786	Hernia obstructive			OFFSIDES
787	Hernial eventration			OFFSIDES
788	High density lipoprotein abnormal			OFFSIDES
789	Hirsutism			SIDER
790	Hormone level abnormal			SIDER
791	Human herpesvirus 8 infection			OFFSIDES
792	Human polyomavirus infection			OFFSIDES
793	Huntington Disease		17921520	CTD
794	Hydropneumothorax			OFFSIDES
795	Hydrothorax			OFFSIDES
796	Hypercholesterolemia		View details 10221490 12742468 16316336 18589147 19057397	CTD
797	Hyperglycemia		20358864	CTD
798	Hyperkalemia		15102967	CTD
799	Hyperplasia		15919358 20031680	CTD
800	Hypertrichosis			OFFSIDES
801	Hypertriglyceridemia		View details 10221490 12742468 15102967 19057397	CTD
802	Hypertrophy		19211884	CTD
803	Hyperuricemia		12394605	CTD
804	Hypokalemia		View details 10221490 12742468 12742489 17347279 19656910	CTD
805	Idiopathic Pulmonary Fibrosis	Canada Vigilance: 1		Canada Vigilance
806	Immunosuppressant drug level			OFFSIDES
807	Impaired driving ability			OFFSIDES
808	Impaired self-care			OFFSIDES
809	Incision site complication			OFFSIDES
810	Infected lymphocele			OFFSIDES
811	Infestation			SIDER
812	Infusion site mobility decreased			OFFSIDES
813	Intestinal hypomotility			OFFSIDES
814	Intubation			OFFSIDES
815	Kidney Diseases		View details 12394605 12584269 12660339 15102967 17003813 17147461 17261434 17347279 17504225 18339148 19671594 19926370 20832541 21865292	CTD
816	Labile blood pressure			OFFSIDES
817	Laboratory test interference			OFFSIDES
818	Lactic dehydrogenase activity increased			SIDER
819	Lentigo			OFFSIDES
820	Leukocytosis			SIDER
821	Liquid product physical issue	Canada Vigilance: 1		Canada Vigilance
822	Livedo Reticularis			OFFSIDES
823	Liver Cirrhosis, Experimental		10535884 17050028	CTD
824	Liver Cirrhosis		20511674	CTD
825	Liver graft loss	Canada Vigilance: 1		Canada Vigilance
826	Local reaction			SIDER
827	Low turnover osteopathy			OFFSIDES
828	Lower respiratory tract inflammation			OFFSIDES
829	Lung Abscess			OFFSIDES
830	Lung Diseases, Interstitial		12795665 15219060	CTD
831	Lymphedema		18339149	CTD
832	Magnesium Deficiency		19656910	CTD
833	Malignant Hypertension			OFFSIDES
834	Malnutrition			SIDER
835	Markedly reduced dietary intake			OFFSIDES
836	Mediastinitis			OFFSIDES
837	Melanoma, Experimental		19922502	CTD
838	Menorrhagia			SIDER
839	Mesothelioma		19853261	CTD
840	Microvascular Angina		19218771	CTD
841	Mood swings			SIDER
842	Morganella infection			OFFSIDES
843	Mouth Neoplasms		19435901	CTD
844	Multiple Myeloma		15070696	CTD
845	Multiple System Atrophy			OFFSIDES
846	Muscle necrosis			OFFSIDES
847	Muscle relaxant therapy			SIDER
848	Musculoskeletal discomfort			SIDER
849	Myeloma recurrence			OFFSIDES
850	Neointima		18838155	CTD
851	Neoplasm Invasiveness		21996746	CTD
852	Neoplasm Metastasis		19922502	CTD
853	Neoplasms, Experimental		19773376	CTD
854	Neoplasms		19384183	CTD
855	Nephrocalcinosis		8887267	CTD
856	Nephrostomy tube placement			OFFSIDES
857	Nephroureterectomy			OFFSIDES
858	Neurodermatitis			OFFSIDES
859	Neuromuscular blocking therapy			OFFSIDES
860	Neutrophil count abnormal			OFFSIDES
861	Nocturia			SIDER
862	Nodular regenerative hyperplasia			OFFSIDES
863	Nuchal Rigidity			OFFSIDES
864	Ocular icterus			OFFSIDES
865	Oligospermia		17845575	CTD
866	Optic Disc Edema			OFFSIDES
867	Oral Ulcer		18044728	CTD
868	Orbital apex syndrome			OFFSIDES
869	Otitis Media			SIDER
870	Oxygen saturation abnormal			OFFSIDES
871	PCO2 decreased			OFFSIDES
872	PCO2 increased			OFFSIDES
873	PO2 decreased			OFFSIDES
874	Pacemaker complication			OFFSIDES
875	Pancreatic Cyst			OFFSIDES
876	Parkinson Disease		19682553	CTD
877	Pelvic Pain			SIDER
878	Percutaneous Coronary Intervention			OFFSIDES
879	Perinephric collection			OFFSIDES
880	Perinephric effusion			OFFSIDES
881	Perirectal abscess			OFFSIDES
882	Pharyngolaryngeal Pain			OFFSIDES
883	Photodermatosis			OFFSIDES
884	Picornaviridae Infections		8971030	CTD
885	Polycystic Kidney Diseases		19321761	CTD
886	Polycystic Kidney, Autosomal Dominant		19651290	CTD
887	Polyomavirus interstitial nephritis			OFFSIDES
888	Polyomavirus-associated nephropathy			OFFSIDES
889	Polyploidy		24444656	CTD
890	Polyuria			SIDER
891	Positron emission tomogram abnormal			OFFSIDES
892	Post procedural pain			OFFSIDES
893	Post procedural urine leak			OFFSIDES
894	Postoperative Complications		11605780 17645704	CTD
895	Postoperative ileus			OFFSIDES
896	Postoperative infection			OFFSIDES
897	Precursor T-Cell Lymphoblastic Leukemia-Lymphoma		19246562	CTD
898	Prion Diseases		19183256	CTD
899	Procedural site reaction			OFFSIDES
900	Product preparation issue	Canada Vigilance: 1		Canada Vigilance
901	Product residue present	Canada Vigilance: 1		Canada Vigilance
902	Psoriasis		10328196	CTD
903	Pulmonary Fistula			OFFSIDES
904	Pulmonary artery thrombosis			OFFSIDES
905	Pulmonary vascular disorder			OFFSIDES
906	Pyuria			SIDER
907	Reflex Sympathetic Dystrophy		17575313 18212635	CTD
908	Refusal of treatment by relative			OFFSIDES
909	Renal abscess			OFFSIDES
910	Renal cyst			OFFSIDES
911	Renal graft loss			SIDER
912	Renal interstitial fibrosis			OFFSIDES
913	Renal lymphocele			OFFSIDES
914	Renal mass			OFFSIDES
915	Renal tubular disorder			OFFSIDES
916	Renal vein occlusion			OFFSIDES
917	Reperfusion Injury		11553517 17362745	CTD
918	Respiratory tract congestion			OFFSIDES
919	Reticulocyte count decreased			OFFSIDES
920	Retinal infiltrates			OFFSIDES
921	Retinal pigment epitheliopathy			OFFSIDES
922	Rheumatoid factor increased			OFFSIDES
923	Rhonchi			OFFSIDES
924	Romberg test positive	Canada Vigilance: 1		Canada Vigilance
925	Salmonella			OFFSIDES
926	Seizures		28215400	CTD
927	Serum triglycerides increased			SIDER
928	Skin Erosion			OFFSIDES
929	Skin Neoplasms		15233824	CTD
930	Skin carcinoma			SIDER
931	Skin hypertrophy			SIDER
932	Skin neoplasm excision			OFFSIDES
933	Skull X-ray abnormal			OFFSIDES
934	Sleep disorder due to general medical condition, insomnia type			OFFSIDES
935	Somnolence			SIDER
936	Splenic cyst			OFFSIDES
937	Staphylococcal abscess			OFFSIDES
938	Subileus			OFFSIDES
939	Surgical Wound Dehiscence		12196058	CTD
940	Suture rupture			OFFSIDES
941	Sweating			SIDER
942	Syncope			SIDER
943	T-Cell Lymphoma			OFFSIDES
944	Tension Headache			OFFSIDES
945	Tension			SIDER
946	Tetany			SIDER
947	Thrombotic Microangiopathies		View details 12603218 12830473 14724447 15147429 16310579 16421477 17531780 19120084	CTD
948	Tinnitus			SIDER
949	Transplant abscess			OFFSIDES
950	Triple Negative Breast Neoplasms		27255535	CTD
951	Troponin increased			OFFSIDES
952	Tuberous Sclerosis		18495876 21115397	CTD OFFSIDES
953	Tympanic Membrane Perforation			OFFSIDES
954	Uremia			SIDER
955	Ureteral necrosis			OFFSIDES
956	Ureterectomy			OFFSIDES
957	Ureteric fistula			OFFSIDES
958	Urinary Incontinence			SIDER
959	Urinary Retention			SIDER
960	Urinary anastomotic leak			OFFSIDES
961	Urinary sediment present			OFFSIDES
962	Urinary tract infection pseudomonal			OFFSIDES
963	Urine ketone body present			OFFSIDES
964	Urine output increased			OFFSIDES SIDER
965	Urine protein/creatinine ratio abnormal			OFFSIDES
966	Vascular calcification			OFFSIDES
967	Vascular graft complication			OFFSIDES
968	Vascular stenosis			OFFSIDES
969	Vasculitis, Leukocytoclastic, Cutaneous		View details 12352895 15307846 15589473 15667620 16623879	CTD
970	Venous Injury			OFFSIDES
971	Venous Thromboembolism			SIDER
972	Vertebral artery occlusion			OFFSIDES
973	Vibration test abnormal	Canada Vigilance: 1		Canada Vigilance
974	Weight Gain		19397913	CTD
975	Wound Complication			OFFSIDES
976	Wound Debridement			OFFSIDES
977	Wound abscess			OFFSIDES
978	Wound dehiscence			OFFSIDES
979	Wound infection staphylococcal			OFFSIDES
980	Xerosis			OFFSIDES
981	effusion			SIDER
982	melanoma		19282848	CTD
983	pH body fluid			OFFSIDES

Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329