Ruxolitinib phosphate
(JFMWPOCYMYGEDM-XFULWGLBSA-N)
Structure
- SMILES
- OP(=O)(O)O.N#CC[C@@H](n1ncc(c1)c1ncnc2c1cc[nH]2)C1CCCC1
- Molecular Formula:
- C17H21N6O4P
- Molecular Weight:
- 404.360
- Log P:
- 2.5378
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 4
- TPSA:
- 170.75
- CAS Number(s):
- 1092939-17-7
Synonym(s)
1.
Ruxolitinib phosphate
External Link(s)
| PubChem Compound | 25127112 |
| BindingDB | 50391992 |
| ChEBI | 66917 |
| CHEMBL | CHEMBL1795071 |
| KEGG | dr:D09960 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 611 Canada Vigilance: 19 | Canada Vigilance US FAERS | |
| 2 | Drug dose omission | FAERS: 504 | US FAERS | |
| 3 | Pneumonia | FAERS: 480 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 4 | Myelofibrosis | FAERS: 412 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 5 | Splenomegaly | FAERS: 380 Canada Vigilance: 17 | Canada Vigilance US FAERS | |
| 6 | Headache | FAERS: 355 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 7 | Malaise | FAERS: 336 Canada Vigilance: 18 | Canada Vigilance US FAERS | |
| 8 | Asthenia | FAERS: 315 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 9 | Dizziness | FAERS: 300 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 10 | Inappropriate schedule of product administration | FAERS: 280 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 11 | Thrombocytopenia | FAERS: 266 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 12 | Blood count abnormal | FAERS: 246 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 13 | Nausea | FAERS: 213 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 14 | Drug ineffective | FAERS: 196 Canada Vigilance: 19 | Canada Vigilance US FAERS | |
| 15 | Infection | FAERS: 196 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 16 | Pruritus | FAERS: 192 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 17 | Product dose omission | FAERS: 191 | US FAERS | |
| 18 | Pain | FAERS: 176 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 19 | Inappropriate schedule of drug administration | FAERS: 172 | US FAERS | |
| 20 | Abdominal Pain | FAERS: 168 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 21 | Platelet count abnormal | FAERS: 166 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 22 | White blood cell count decreased | FAERS: 151 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 23 | Urinary tract infection | FAERS: 138 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 24 | Nasopharyngitis | FAERS: 137 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 25 | Epistaxis | FAERS: 134 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 26 | Memory impairment | FAERS: 129 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 27 | Sepsis | FAERS: 129 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Incorrect dose administered | FAERS: 126 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Abdominal discomfort | FAERS: 124 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 30 | Arthralgia | FAERS: 124 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 31 | Constipation | FAERS: 123 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 32 | Vomiting | FAERS: 114 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Peripheral swelling | FAERS: 112 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 34 | Weight decreased | FAERS: 111 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 35 | Product use in unapproved indication | FAERS: 109 | US FAERS | |
| 36 | White blood cell count abnormal | FAERS: 109 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Influenza | FAERS: 105 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 38 | Bone pain | FAERS: 97 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 39 | Tuberculosis | FAERS: 97 | US FAERS | |
| 40 | Disease Progression | FAERS: 96 | US FAERS | |
| 41 | Back Pain | FAERS: 92 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 42 | Night sweats | FAERS: 92 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 43 | Pancytopenia | FAERS: 92 | US FAERS | |
| 44 | Flatulence | FAERS: 90 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 45 | Feeling abnormal | FAERS: 87 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 46 | General physical health deterioration | FAERS: 86 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 47 | Blood lactate dehydrogenase increased | FAERS: 79 | US FAERS | |
| 48 | Primary Myelofibrosis | FAERS: 75 | US FAERS | |
| 49 | Cerebrovascular accident | FAERS: 74 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Myalgia | FAERS: 72 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Cytopenia | FAERS: 71 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Stomatitis | FAERS: 70 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 53 | Blast cell count increased | FAERS: 68 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 54 | Blood creatinine increased | FAERS: 68 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Somnolence | FAERS: 67 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 56 | Product use issue | FAERS: 66 | US FAERS | |
| 57 | Thrombosis | FAERS: 66 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 58 | Basal cell carcinoma | FAERS: 65 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Chest Pain | FAERS: 62 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 60 | Alopecia | FAERS: 61 | US FAERS | |
| 61 | Blood lactate dehydrogenase abnormal | FAERS: 61 | US FAERS | |
| 62 | Squamous cell carcinoma | FAERS: 61 | US FAERS | |
| 63 | Myocardial Infarction | FAERS: 60 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 64 | Neutropenia | FAERS: 60 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 65 | Bronchitis | FAERS: 58 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 66 | Respiratory Failure | FAERS: 57 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Chills | FAERS: 55 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 68 | Oropharyngeal pain | FAERS: 53 | US FAERS | |
| 69 | Toxicity to various agents | FAERS: 51 | US FAERS | |
| 70 | Wrong technique in product usage process | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | Skin lesion | FAERS: 50 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 72 | Hypotension | FAERS: 49 | US FAERS | |
| 73 | Therapeutic response unexpected | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Haematotoxicity | FAERS: 47 | US FAERS | |
| 75 | Leukocytosis | FAERS: 47 | US FAERS | |
| 76 | Blast cells present | FAERS: 45 | US FAERS | |
| 77 | Blood alkaline phosphatase increased | FAERS: 45 | US FAERS | |
| 78 | Dehydration | FAERS: 44 | US FAERS | |
| 79 | Pulmonary Embolism | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Blood potassium increased | FAERS: 43 | US FAERS | |
| 81 | Concomitant disease aggravated | FAERS: 43 | US FAERS | |
| 82 | Leukopenia | FAERS: 43 | US FAERS | |
| 83 | Aspartate Aminotransferase Increased | FAERS: 42 | US FAERS | |
| 84 | Gout | FAERS: 42 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 85 | Erythema | FAERS: 40 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 86 | Sinusitis | FAERS: 40 | US FAERS | |
| 87 | Gamma-Glutamyltransferase Increased | FAERS: 38 | US FAERS | |
| 88 | Alanine Aminotransferase Increased | FAERS: 36 | US FAERS | |
| 89 | Ascites | FAERS: 36 | US FAERS | |
| 90 | Cellulitis | FAERS: 36 | US FAERS | |
| 91 | No adverse event | FAERS: 36 | US FAERS | |
| 92 | Acute kidney injury | FAERS: 35 | US FAERS | |
| 93 | Dysuria | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 94 | Acne | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Anxiety | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Joint swelling | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 97 | Septic Shock | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 98 | Therapy non-responder | FAERS: 32 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 99 | Depressed mood | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 100 | Full blood count decreased | FAERS: 31 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 101 | Dyspepsia | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 102 | Hepatomegaly | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 103 | Palpitations | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 104 | Pulmonary Hypertension | FAERS: 30 | US FAERS | |
| 105 | Visual Impairment | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 106 | Amnesia | FAERS: 29 | US FAERS | |
| 107 | Atrial Fibrillation | FAERS: 28 | US FAERS | |
| 108 | Cystitis | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 109 | Dry skin | FAERS: 28 | US FAERS | |
| 110 | Inflammation | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 111 | Neutrophil count decreased | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 112 | Blood erythropoietin abnormal | FAERS: 27 | US FAERS | |
| 113 | Medication Error | FAERS: 27 | US FAERS | |
| 114 | Syncope | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 115 | Tremor | FAERS: 27 | US FAERS | |
| 116 | Hypersensitivity | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 117 | Increased tendency to bruise | FAERS: 26 | US FAERS | |
| 118 | Lymphocyte count decreased | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 119 | MYELODYSPLASTIC SYNDROME | FAERS: 26 | US FAERS | |
| 120 | Arthritis | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 121 | Blood cholesterol increased | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 122 | Diverticulitis | FAERS: 25 | US FAERS | |
| 123 | Musculoskeletal Pain | FAERS: 25 | US FAERS | |
| 124 | Squamous cell carcinoma of skin | FAERS: 25 | US FAERS | |
| 125 | Burning sensation | FAERS: 24 | US FAERS | |
| 126 | Dementia | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Thrombocytosis | FAERS: 24 | US FAERS | |
| 128 | Blood glucose increased | FAERS: 23 | US FAERS | |
| 129 | Disease risk factor | FAERS: 23 | US FAERS | |
| 130 | Dysgeusia | FAERS: 23 | US FAERS | |
| 131 | Intentional product misuse | FAERS: 23 | US FAERS | |
| 132 | Vertigo | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 133 | Dysphonia | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 134 | Diabetes Mellitus | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 135 | Lymphadenopathy | FAERS: 21 | US FAERS | |
| 136 | Skin Ulcer | FAERS: 21 | US FAERS | |
| 137 | Blood urea increased | FAERS: 20 | US FAERS | |
| 138 | Swelling | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 139 | Feeling Cold | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 140 | Hunger | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 141 | Limb injury | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 142 | Nephrolithiasis | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 143 | Cerebral Infarction | FAERS: 17 | US FAERS | |
| 144 | Chest discomfort | FAERS: 17 | US FAERS | |
| 145 | Drug ineffective for unapproved indication | FAERS: 17 | US FAERS | |
| 146 | Ileus | FAERS: 17 | US FAERS | |
| 147 | Joint injury | FAERS: 17 | US FAERS | |
| 148 | Lower respiratory tract infection | FAERS: 17 | US FAERS | |
| 149 | Lymphoma | FAERS: 17 | US FAERS | |
| 150 | Malignant neoplasm progression | FAERS: 17 | US FAERS | |
| 151 | Petechiae | FAERS: 17 | US FAERS | |
| 152 | Pneumonitis | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 153 | Splenic Infarction | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Tinnitus | FAERS: 17 | US FAERS | |
| 155 | Aphasia | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 156 | Cardiac Arrest | FAERS: 16 | US FAERS | |
| 157 | Cholelithiasis | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 158 | Diffuse Large B-Cell Lymphoma | FAERS: 16 | US FAERS | |
| 159 | Musculoskeletal chest pain | FAERS: 16 | US FAERS | |
| 160 | Product administered to patient of inappropriate age | FAERS: 16 | US FAERS | |
| 161 | Adverse event | FAERS: 15 | US FAERS | |
| 162 | Angina Pectoris | FAERS: 15 | US FAERS | |
| 163 | Blood iron decreased | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 164 | Eye pain | FAERS: 15 | US FAERS | |
| 165 | Gastritis | FAERS: 15 | US FAERS | |
| 166 | Gastroenteritis | FAERS: 15 | US FAERS | |
| 167 | Neck Pain | FAERS: 15 | US FAERS | |
| 168 | Portal Hypertension | FAERS: 15 | US FAERS | |
| 169 | Splenic Rupture | FAERS: 15 | US FAERS | |
| 170 | Tachycardia | FAERS: 15 | US FAERS | |
| 171 | Asthma | FAERS: 14 | US FAERS | |
| 172 | Decreased immune responsiveness | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 173 | Full blood count increased | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 174 | Lethargy | FAERS: 14 | US FAERS | |
| 175 | Neuralgia | FAERS: 14 | US FAERS | |
| 176 | Pericardial effusion | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 177 | Portal Vein Thrombosis | FAERS: 14 | US FAERS | |
| 178 | Product physical issue | FAERS: 14 | US FAERS | |
| 179 | Productive Cough | FAERS: 14 | US FAERS | |
| 180 | Terminal state | FAERS: 14 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 181 | jaundice | FAERS: 14 | US FAERS | |
| 182 | Drug administered to patient of inappropriate age | FAERS: 13 | US FAERS | |
| 183 | Drug administration error | FAERS: 13 | US FAERS | |
| 184 | Drug effect incomplete | FAERS: 13 | US FAERS | |
| 185 | Full blood count abnormal | FAERS: 13 | US FAERS | |
| 186 | Head discomfort | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 187 | Intentional product use issue | FAERS: 13 | US FAERS | |
| 188 | Transaminases increased | FAERS: 13 | US FAERS | |
| 189 | Chromaturia | FAERS: 12 | US FAERS | |
| 190 | Clostridium difficile infection | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 191 | Deep Vein Thrombosis | FAERS: 12 | US FAERS | |
| 192 | Discomfort | FAERS: 12 | US FAERS | |
| 193 | Disorientation | FAERS: 12 | US FAERS | |
| 194 | Febrile Neutropenia | FAERS: 12 | US FAERS | |
| 195 | Hepatosplenomegaly | FAERS: 12 | US FAERS | |
| 196 | Immunosuppression | FAERS: 12 | US FAERS | |
| 197 | Poor quality sleep | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 198 | Rash erythematous | FAERS: 12 | US FAERS | |
| 199 | Skin irritation | FAERS: 12 | US FAERS | |
| 200 | Tooth Infection | FAERS: 12 | US FAERS | |
| 201 | Blood glucose decreased | FAERS: 11 | US FAERS | |
| 202 | Blood product transfusion dependent | FAERS: 11 | US FAERS | |
| 203 | Bowen's Disease | FAERS: 11 | US FAERS | |
| 204 | Deafness | FAERS: 11 | US FAERS | |
| 205 | Eye Infection | FAERS: 11 | US FAERS | |
| 206 | Fracture | FAERS: 11 | US FAERS | |
| 207 | Gastric ulcer | FAERS: 11 | US FAERS | |
| 208 | General physical condition abnormal | FAERS: 11 | US FAERS | |
| 209 | Hypersomnia | FAERS: 11 | US FAERS | |
| 210 | Pallor | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 211 | Polyneuropathy | FAERS: 11 | US FAERS | |
| 212 | Respiratory distress | FAERS: 11 | US FAERS | |
| 213 | Splenectomy | FAERS: 11 | US FAERS | |
| 214 | Sudden death | FAERS: 11 | US FAERS | |
| 215 | Transplant | FAERS: 11 | US FAERS | |
| 216 | Urticaria | FAERS: 11 | US FAERS | |
| 217 | Ankle Fracture | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 218 | Aortic Aneurysm | FAERS: 10 | US FAERS | |
| 219 | Blood iron increased | FAERS: 10 | US FAERS | |
| 220 | Blood triglycerides increased | FAERS: 10 | US FAERS | |
| 221 | Cachexia | FAERS: 10 | US FAERS | |
| 222 | Clostridium difficile colitis | FAERS: 10 | US FAERS | |
| 223 | Cytokine storm | FAERS: 10 | US FAERS | |
| 224 | Dental caries | FAERS: 10 | US FAERS | |
| 225 | Diplopia | FAERS: 10 | US FAERS | |
| 226 | Disease recurrence | FAERS: 10 | US FAERS | |
| 227 | Hypoxia | FAERS: 10 | US FAERS | |
| 228 | Limb discomfort | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 229 | Musculoskeletal stiffness | FAERS: 10 | US FAERS | |
| 230 | Onychoclasis | FAERS: 10 | US FAERS | |
| 231 | Pancreatic carcinoma | FAERS: 10 | US FAERS | |
| 232 | Peritonitis | FAERS: 10 | US FAERS | |
| 233 | Stem cell transplant | FAERS: 10 | US FAERS | |
| 234 | Amylase increased | FAERS: 9 | US FAERS | |
| 235 | Appendicitis | FAERS: 9 | US FAERS | |
| 236 | Blood sodium decreased | FAERS: 9 | US FAERS | |
| 237 | Concomitant disease progression | FAERS: 9 | US FAERS | |
| 238 | Delirium | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 239 | Dengue Fever | FAERS: 9 | US FAERS | |
| 240 | Disseminated Intravascular Coagulation | FAERS: 9 | US FAERS | |
| 241 | Early satiety | FAERS: 9 | US FAERS | |
| 242 | Electrolyte imbalance | FAERS: 9 | US FAERS | |
| 243 | Enterocolitis | FAERS: 9 | US FAERS | |
| 244 | Escherichia urinary tract infection | FAERS: 9 | US FAERS | |
| 245 | Gait inability | FAERS: 9 | US FAERS | |
| 246 | Hepatitis B | FAERS: 9 | US FAERS | |
| 247 | Intestinal Obstruction | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 248 | Iron Overload | FAERS: 9 | US FAERS | |
| 249 | Irritable Bowel Syndrome | FAERS: 9 | US FAERS | |
| 250 | Mental impairment | FAERS: 9 | US FAERS | |
| 251 | Nervousness | FAERS: 9 | US FAERS | |
| 252 | Oral pain | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 253 | Post procedural complication | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 254 | Rheumatoid Arthritis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 255 | Stress | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 256 | Abscess | FAERS: 8 | US FAERS | |
| 257 | Acute respiratory failure | FAERS: 8 | US FAERS | |
| 258 | Arthropathy | FAERS: 8 | US FAERS | |
| 259 | Basophil percentage increased | FAERS: 8 | US FAERS | |
| 260 | Blood urine present | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 261 | Bronchopulmonary Aspergillosis | FAERS: 8 | US FAERS | |
| 262 | Cataract | FAERS: 8 | US FAERS | |
| 263 | Cholangitis | FAERS: 8 | US FAERS | |
| 264 | Colitis | FAERS: 8 | US FAERS | |
| 265 | Crying | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 266 | Ear discomfort | FAERS: 8 | US FAERS | |
| 267 | Endocarditis | FAERS: 8 | US FAERS | |
| 268 | Food Poisoning | FAERS: 8 | US FAERS | |
| 269 | Gastrointestinal infection | FAERS: 8 | US FAERS | |
| 270 | Hepatitis | FAERS: 8 | US FAERS | |
| 271 | Hepatotoxicity | FAERS: 8 | US FAERS | |
| 272 | Laceration | FAERS: 8 | US FAERS | |
| 273 | Overdose | FAERS: 8 | US FAERS | |
| 274 | Protein total decreased | FAERS: 8 | US FAERS | |
| 275 | Pulmonary congestion | FAERS: 8 | US FAERS | |
| 276 | Restless Legs Syndrome | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 277 | Toothache | FAERS: 8 | US FAERS | |
| 278 | Wrong technique in drug usage process | FAERS: 8 | US FAERS | |
| 279 | furuncle | FAERS: 8 | US FAERS | |
| 280 | Acute Coronary Syndrome | FAERS: 7 | US FAERS | |
| 281 | Agitation | FAERS: 7 | US FAERS | |
| 282 | Altered state of consciousness | FAERS: 7 | US FAERS | |
| 283 | Back disorder | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 284 | Blindness | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 285 | Cardiomegaly | FAERS: 7 | US FAERS | |
| 286 | Cholecystitis infective | FAERS: 7 | US FAERS | |
| 287 | Dermatitis | FAERS: 7 | US FAERS | |
| 288 | Disease complication | FAERS: 7 | US FAERS | |
| 289 | Drug prescribing error | FAERS: 7 | US FAERS | |
| 290 | Encephalitis | FAERS: 7 | US FAERS | |
| 291 | Flank Pain | FAERS: 7 | US FAERS | |
| 292 | Gastroenteritis norovirus | FAERS: 7 | US FAERS | |
| 293 | Gastrointestinal ulcer | FAERS: 7 | US FAERS | |
| 294 | Glaucoma | FAERS: 7 | US FAERS | |
| 295 | Hospice Care | FAERS: 7 | US FAERS | |
| 296 | Large intestine perforation | FAERS: 7 | US FAERS | |
| 297 | Laryngitis | FAERS: 7 | US FAERS | |
| 298 | Lip swelling | FAERS: 7 | US FAERS | |
| 299 | Lymphopenia | FAERS: 7 | US FAERS | |
| 300 | Meningitis | FAERS: 7 | US FAERS | |
| 301 | Muscle strain | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 302 | Musculoskeletal discomfort | FAERS: 7 | US FAERS | |
| 303 | Nodule | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 304 | Osteomyelitis | FAERS: 7 | US FAERS | |
| 305 | Pancreatitis | FAERS: 7 | US FAERS | |
| 306 | Product prescribing error | FAERS: 7 | US FAERS | |
| 307 | Product quality issue | FAERS: 7 | US FAERS | |
| 308 | Product taste abnormal | FAERS: 7 | US FAERS | |
| 309 | Pulmonary Fibrosis | FAERS: 7 | US FAERS | |
| 310 | Respiratory arrest | FAERS: 7 | US FAERS | |
| 311 | Restlessness | FAERS: 7 | US FAERS | |
| 312 | Secretion discharge | FAERS: 7 | US FAERS | |
| 313 | Splenitis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 314 | Ulcer | FAERS: 7 | US FAERS | |
| 315 | Unevaluable event | FAERS: 7 | US FAERS | |
| 316 | Viral upper respiratory tract infection | FAERS: 7 | US FAERS | |
| 317 | Abasia | FAERS: 6 | US FAERS | |
| 318 | Actinic keratosis | FAERS: 6 | US FAERS | |
| 319 | Ataxia | FAERS: 6 | US FAERS | |
| 320 | Bicytopenia | FAERS: 6 | US FAERS | |
| 321 | Bladder pain | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 322 | Blood blister | FAERS: 6 | US FAERS | |
| 323 | Blood triglycerides abnormal | FAERS: 6 | US FAERS | |
| 324 | Bone marrow reticulin fibrosis | FAERS: 6 | US FAERS | |
| 325 | Bradycardia | FAERS: 6 | US FAERS | |
| 326 | Drug resistance | FAERS: 6 | US FAERS | |
| 327 | Ecchymosis | FAERS: 6 | US FAERS | |
| 328 | Embolism | FAERS: 6 | US FAERS | |
| 329 | Epilepsy | FAERS: 6 | US FAERS | |
| 330 | Escherichia infection | FAERS: 6 | US FAERS | |
| 331 | Escherichia sepsis | FAERS: 6 | US FAERS | |
| 332 | Facial paralysis | FAERS: 6 | US FAERS | |
| 333 | Fibrosis | FAERS: 6 | US FAERS | |
| 334 | Gastric Dilatation | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 335 | Gingivitis | FAERS: 6 | US FAERS | |
| 336 | Guillain-Barre Syndrome | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 337 | Hernia | FAERS: 6 | US FAERS | |
| 338 | Hyperkeratosis | FAERS: 6 | US FAERS | |
| 339 | Iron deficiency | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 340 | Metamyelocyte count increased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 341 | Nocturia | FAERS: 6 | US FAERS | |
| 342 | Osteoporosis | FAERS: 6 | US FAERS | |
| 343 | Respiratory tract congestion | FAERS: 6 | US FAERS | |
| 344 | Subcutaneous Abscess | FAERS: 6 | US FAERS | |
| 345 | Therapeutic product effect incomplete | FAERS: 6 | US FAERS | |
| 346 | Therapy cessation | FAERS: 6 | US FAERS | |
| 347 | Therapy change | FAERS: 6 | US FAERS | |
| 348 | Therapy partial responder | FAERS: 6 | US FAERS | |
| 349 | Accidental overdose | FAERS: 5 | US FAERS | |
| 350 | Acute myocardial infarction | FAERS: 5 | US FAERS | |
| 351 | Arthropod bite | FAERS: 5 | US FAERS | |
| 352 | Cold sweat | FAERS: 5 | US FAERS | |
| 353 | Creatinine renal clearance decreased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 354 | Cytomegalovirus hepatitis | FAERS: 5 | US FAERS | |
| 355 | Dermatitis acneiform | FAERS: 5 | US FAERS | |
| 356 | Drug withdrawal syndrome | FAERS: 5 | US FAERS | |
| 357 | Eructation | FAERS: 5 | US FAERS | |
| 358 | Facial Pain | FAERS: 5 | US FAERS | |
| 359 | Graft versus host disease in liver | FAERS: 5 | US FAERS | |
| 360 | Granuloma | FAERS: 5 | US FAERS | |
| 361 | Hemiparesis | FAERS: 5 | US FAERS | |
| 362 | Histiocytosis haematophagic | FAERS: 5 | US FAERS | |
| 363 | Intestinal Perforation | FAERS: 5 | US FAERS | |
| 364 | Lymphocytosis | FAERS: 5 | US FAERS | |
| 365 | Malignant transformation | FAERS: 5 | US FAERS | |
| 366 | Myelocyte count increased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 367 | Onychomycosis | FAERS: 5 | US FAERS | |
| 368 | Oral candidiasis | FAERS: 5 | US FAERS | |
| 369 | Oral fungal infection | FAERS: 5 | US FAERS | |
| 370 | Oral mucosal eruption | FAERS: 5 | US FAERS | |
| 371 | Paranasal sinus discomfort | FAERS: 5 | US FAERS | |
| 372 | Performance status decreased | FAERS: 5 | US FAERS | |
| 373 | Peripheral arterial occlusive disease | FAERS: 5 | US FAERS | |
| 374 | Phlebitis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 375 | Platelet Transfusion | FAERS: 5 | US FAERS | |
| 376 | Polyarthritis | FAERS: 5 | US FAERS | |
| 377 | Poor peripheral circulation | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 378 | Quality of life decreased | FAERS: 5 | US FAERS | |
| 379 | Rebound effect | FAERS: 5 | US FAERS | |
| 380 | Renal cyst | FAERS: 5 | US FAERS | |
| 381 | Scab | FAERS: 5 | US FAERS | |
| 382 | Throat irritation | FAERS: 5 | US FAERS | |
| 383 | Tongue blistering | FAERS: 5 | US FAERS | |
| 384 | Upper-airway cough syndrome | FAERS: 5 | US FAERS | |
| 385 | Urinary Incontinence | FAERS: 5 | US FAERS | |
| 386 | Urinary Retention | FAERS: 5 | US FAERS | |
| 387 | Wheezing | FAERS: 5 | US FAERS | |
| 388 | Wound Infection | FAERS: 5 | US FAERS | |
| 389 | treatment failure | FAERS: 5 | US FAERS | |
| 390 | Adenocarcinoma | FAERS: 4 | US FAERS | |
| 391 | Ageusia | FAERS: 4 | US FAERS | |
| 392 | Anal abscess | FAERS: 4 | US FAERS | |
| 393 | Anisocytosis | FAERS: 4 | US FAERS | |
| 394 | Anuria | FAERS: 4 | US FAERS | |
| 395 | Apathy | FAERS: 4 | US FAERS | |
| 396 | Atelectasis | FAERS: 4 | US FAERS | |
| 397 | Atrioventricular Block | FAERS: 4 | US FAERS | |
| 398 | Bladder Neoplasm | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 399 | Blood albumin decreased | FAERS: 4 | US FAERS | |
| 400 | Blood cholesterol abnormal | FAERS: 4 | US FAERS | |
| 401 | Blood glucose fluctuation | FAERS: 4 | US FAERS | |
| 402 | Blood potassium abnormal | FAERS: 4 | US FAERS | |
| 403 | Body temperature fluctuation | FAERS: 4 | US FAERS | |
| 404 | Bone density abnormal | FAERS: 4 | US FAERS | |
| 405 | Bone lesion | FAERS: 4 | US FAERS | |
| 406 | Bone marrow myelogram abnormal | FAERS: 4 | US FAERS | |
| 407 | Cardiac Tamponade | FAERS: 4 | US FAERS | |
| 408 | Cardiac dysfunction | FAERS: 4 | US FAERS | |
| 409 | Cerebral atrophy | FAERS: 4 | US FAERS | |
| 410 | Cholecystitis | FAERS: 4 | US FAERS | |
| 411 | Cytomegalovirus chorioretinitis | FAERS: 4 | US FAERS | |
| 412 | Diabetic Nephropathy | FAERS: 4 | US FAERS | |
| 413 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 414 | Dry gangrene | FAERS: 4 | US FAERS | |
| 415 | Dysarthria | FAERS: 4 | US FAERS | |
| 416 | Expired product administered | FAERS: 4 | US FAERS | |
| 417 | Extra dose administered | FAERS: 4 | US FAERS | |
| 418 | Gastrointestinal Pain | FAERS: 4 | US FAERS | |
| 419 | Genital Herpes | FAERS: 4 | US FAERS | |
| 420 | Graft versus host disease in lung | FAERS: 4 | US FAERS | |
| 421 | Hepatitis C | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 422 | Hordeolum | FAERS: 4 | US FAERS | |
| 423 | Hypertensive crisis | FAERS: 4 | US FAERS | |
| 424 | Hyperthyroidism | FAERS: 4 | US FAERS | |
| 425 | Hypophagia | FAERS: 4 | US FAERS | |
| 426 | Hypothyroidism | FAERS: 4 | US FAERS | |
| 427 | Incorrect product formulation administered | FAERS: 4 | US FAERS | |
| 428 | Infarction | FAERS: 4 | US FAERS | |
| 429 | Janus kinase 2 mutation | FAERS: 4 | US FAERS | |
| 430 | Joint stiffness | FAERS: 4 | US FAERS | |
| 431 | Leukoencephalopathy | FAERS: 4 | US FAERS | |
| 432 | Liver Abscess | FAERS: 4 | US FAERS | |
| 433 | Lymphadenitis | FAERS: 4 | US FAERS | |
| 434 | Malnutrition | FAERS: 4 | US FAERS | |
| 435 | Monocyte count decreased | FAERS: 4 | US FAERS | |
| 436 | Myositis | FAERS: 4 | US FAERS | |
| 437 | Nephritis | FAERS: 4 | US FAERS | |
| 438 | Neutropenic sepsis | FAERS: 4 | US FAERS | |
| 439 | Neutrophil percentage increased | FAERS: 4 | US FAERS | |
| 440 | Pain of skin | FAERS: 4 | US FAERS | |
| 441 | Pharyngitis | FAERS: 4 | US FAERS | |
| 442 | Pneumothorax | FAERS: 4 | US FAERS | |
| 443 | Poikilocytosis | FAERS: 4 | US FAERS | |
| 444 | Post procedural infection | FAERS: 4 | US FAERS | |
| 445 | Product packaging quantity issue | FAERS: 4 | US FAERS | |
| 446 | Product storage error | FAERS: 4 | US FAERS | |
| 447 | Product use complaint | FAERS: 4 | US FAERS | |
| 448 | Pulmonary thrombosis | FAERS: 4 | US FAERS | |
| 449 | Pyelonephritis | FAERS: 4 | US FAERS | |
| 450 | Rales | FAERS: 4 | US FAERS | |
| 451 | Renal pain | FAERS: 4 | US FAERS | |
| 452 | Retinal Detachment | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 453 | Rhinitis | FAERS: 4 | US FAERS | |
| 454 | Scleroderma | FAERS: 4 | US FAERS | |
| 455 | Skin reaction | FAERS: 4 | US FAERS | |
| 456 | Stent malfunction | FAERS: 4 | US FAERS | |
| 457 | Tooth Extraction | FAERS: 4 | US FAERS | |
| 458 | Unresponsive to stimuli | FAERS: 4 | US FAERS | |
| 459 | Upper respiratory tract inflammation | FAERS: 4 | US FAERS | |
| 460 | Wound Complication | FAERS: 4 | US FAERS | |
| 461 | nervous system disorder | FAERS: 4 | US FAERS | |
| 462 | prostatitis | FAERS: 4 | US FAERS | |
| 463 | Abdominal Infection | FAERS: 3 | US FAERS | |
| 464 | Acanthosis | FAERS: 3 | US FAERS | |
| 465 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 466 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 467 | Aphonia | FAERS: 3 | US FAERS | |
| 468 | Apparent death | FAERS: 3 | US FAERS | |
| 469 | Atypical pneumonia | FAERS: 3 | US FAERS | |
| 470 | BK virus infection | FAERS: 3 | US FAERS | |
| 471 | Bacterial sepsis | FAERS: 3 | US FAERS | |
| 472 | Bacterial test positive | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 473 | Bilirubin conjugated increased | FAERS: 3 | US FAERS | |
| 474 | Blood creatine increased | FAERS: 3 | US FAERS | |
| 475 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 476 | Blood fibrinogen decreased | FAERS: 3 | US FAERS | |
| 477 | Blood glucose abnormal | FAERS: 3 | US FAERS | |
| 478 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 479 | Bursitis | FAERS: 3 | US FAERS | |
| 480 | Catheter site induration | FAERS: 3 | US FAERS | |
| 481 | Catheter site pain | FAERS: 3 | US FAERS | |
| 482 | Cell marker increased | FAERS: 3 | US FAERS | |
| 483 | Cerebral Thrombosis | FAERS: 3 | US FAERS | |
| 484 | Cholestasis | FAERS: 3 | US FAERS | |
| 485 | Conjunctivitis | FAERS: 3 | US FAERS | |
| 486 | Coronary Artery Disease | FAERS: 3 | US FAERS | |
| 487 | Device related sepsis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 488 | Dysgraphia | FAERS: 3 | US FAERS | |
| 489 | Ear congestion | FAERS: 3 | US FAERS | |
| 490 | Endodontic procedure | FAERS: 3 | US FAERS | |
| 491 | Eosinophilia | FAERS: 3 | US FAERS | |
| 492 | Erythroblast count increased | FAERS: 3 | US FAERS | |
| 493 | Exfoliative rash | FAERS: 3 | US FAERS | |
| 494 | Eye irritation | FAERS: 3 | US FAERS | |
| 495 | Failure to Thrive | FAERS: 3 | US FAERS | |
| 496 | Febrile infection | FAERS: 3 | US FAERS | |
| 497 | Feeling jittery | FAERS: 3 | US FAERS | |
| 498 | Fluid overload | FAERS: 3 | US FAERS | |
| 499 | Flushing | FAERS: 3 | US FAERS | |
| 500 | Folliculitis | FAERS: 3 | US FAERS | |
| 501 | Gastric infection | FAERS: 3 | US FAERS | |
| 502 | Gastrointestinal carcinoma | FAERS: 3 | US FAERS | |
| 503 | Glossitis | FAERS: 3 | US FAERS | |
| 504 | Hemiplegia | FAERS: 3 | US FAERS | |
| 505 | Hepatic Encephalopathy | FAERS: 3 | US FAERS | |
| 506 | Hepatic Infection | FAERS: 3 | US FAERS | |
| 507 | Hepatitis E | FAERS: 3 | US FAERS | |
| 508 | Hidradenitis | FAERS: 3 | US FAERS | |
| 509 | Hyperphagia | FAERS: 3 | US FAERS | |
| 510 | Hypersplenism | FAERS: 3 | US FAERS | |
| 511 | Hypokinesia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 512 | Incontinence | FAERS: 3 | US FAERS | |
| 513 | Intestinal infarction | FAERS: 3 | US FAERS | |
| 514 | JC virus infection | FAERS: 3 | US FAERS | |
| 515 | Lipase increased | FAERS: 3 | US FAERS | |
| 516 | Lymph Node Tuberculosis | FAERS: 3 | US FAERS | |
| 517 | Lymphocyte count increased | FAERS: 3 | US FAERS | |
| 518 | Lymphocyte percentage decreased | FAERS: 3 | US FAERS | |
| 519 | Macular degeneration | FAERS: 3 | US FAERS | |
| 520 | Mallory-Weiss Syndrome | FAERS: 3 | US FAERS | |
| 521 | Mastitis | FAERS: 3 | US FAERS | |
| 522 | Meniscus injury | FAERS: 3 | US FAERS | |
| 523 | Mental status changes | FAERS: 3 | US FAERS | |
| 524 | Metabolic function test abnormal | FAERS: 3 | US FAERS | |
| 525 | Metastasis | FAERS: 3 | US FAERS | |
| 526 | Monoplegia | FAERS: 3 | US FAERS | |
| 527 | Mood swings | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 528 | Multiple System Atrophy | FAERS: 3 | US FAERS | |
| 529 | Muscle Fatigue | FAERS: 3 | US FAERS | |
| 530 | Myeloblast percentage increased | FAERS: 3 | US FAERS | |
| 531 | Nasal discomfort | FAERS: 3 | US FAERS | |
| 532 | Necrosis | FAERS: 3 | US FAERS | |
| 533 | Noninfective gingivitis | FAERS: 3 | US FAERS | |
| 534 | Nonspecific reaction | FAERS: 3 | US FAERS | |
| 535 | Obstruction | FAERS: 3 | US FAERS | |
| 536 | Oropharyngeal discomfort | FAERS: 3 | US FAERS | |
| 537 | Osteolysis | FAERS: 3 | US FAERS | |
| 538 | Panniculitis | FAERS: 3 | US FAERS | |
| 539 | Peptic Ulcer | FAERS: 3 | US FAERS | |
| 540 | Pericarditis | FAERS: 3 | US FAERS | |
| 541 | Plasmacytoma | FAERS: 3 | US FAERS | |
| 542 | Pleurisy | FAERS: 3 | US FAERS | |
| 543 | Precancerous skin lesion | FAERS: 3 | US FAERS | |
| 544 | Product dispensing error | FAERS: 3 | US FAERS | |
| 545 | Protein total increased | FAERS: 3 | US FAERS | |
| 546 | Proteinuria | FAERS: 3 | US FAERS | |
| 547 | Psychiatric symptom | FAERS: 3 | US FAERS | |
| 548 | Pulmonary sepsis | FAERS: 3 | US FAERS | |
| 549 | Red blood cell elliptocytes present | FAERS: 3 | US FAERS | |
| 550 | Reticulocyte count increased | FAERS: 3 | US FAERS | |
| 551 | Rosacea | FAERS: 3 | US FAERS | |
| 552 | Sciatica | FAERS: 3 | US FAERS | |
| 553 | Sebaceous hyperplasia | FAERS: 3 | US FAERS | |
| 554 | Sinus Arrhythmia | FAERS: 3 | US FAERS | |
| 555 | Sinus headache | FAERS: 3 | US FAERS | |
| 556 | Skin Induration | FAERS: 3 | US FAERS | |
| 557 | Skin Papilloma | FAERS: 3 | US FAERS | |
| 558 | Sneezing | FAERS: 3 | US FAERS | |
| 559 | Status Epilepticus | FAERS: 3 | US FAERS | |
| 560 | Tinea Pedis | FAERS: 3 | US FAERS | |
| 561 | Tonsillitis | FAERS: 3 | US FAERS | |
| 562 | Tooth Loss | FAERS: 3 | US FAERS | |
| 563 | Tympanic Membrane Perforation | FAERS: 3 | US FAERS | |
| 564 | Vasculitis | FAERS: 3 | US FAERS | |
| 565 | Vitreous floaters | FAERS: 3 | US FAERS | |
| 566 | leiomyosarcoma | FAERS: 3 | US FAERS | |
| 567 | Abnormal weight gain | FAERS: 2 | US FAERS | |
| 568 | Anger | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 569 | Anosmia | FAERS: 2 | US FAERS | |
| 570 | Aphagia | FAERS: 2 | US FAERS | |
| 571 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 572 | Bedridden | FAERS: 2 | US FAERS | |
| 573 | Benign Prostatic Hyperplasia | FAERS: 2 | US FAERS | |
| 574 | Bladder discomfort | FAERS: 2 | US FAERS | |
| 575 | Blast cell count decreased | FAERS: 2 | US FAERS | |
| 576 | Blood albumin increased | FAERS: 2 | US FAERS | |
| 577 | Blood bilirubin unconjugated increased | FAERS: 2 | US FAERS | |
| 578 | Blood cholinesterase decreased | FAERS: 2 | US FAERS | |
| 579 | Blood lactate dehydrogenase | FAERS: 2 | US FAERS | |
| 580 | Blood magnesium increased | FAERS: 2 | US FAERS | |
| 581 | Blood sodium abnormal | FAERS: 2 | US FAERS | |
| 582 | Blood viscosity decreased | FAERS: 2 | US FAERS | |
| 583 | Bone Tuberculosis | FAERS: 2 | US FAERS | |
| 584 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 585 | Brain Abscess | FAERS: 2 | US FAERS | |
| 586 | Bronchiolitis | FAERS: 2 | US FAERS | |
| 587 | Cataract operation | FAERS: 2 | US FAERS | |
| 588 | Cerebral ventricular rupture | FAERS: 2 | US FAERS | |
| 589 | Choking | FAERS: 2 | US FAERS | |
| 590 | Clumsiness | FAERS: 2 | US FAERS | |
| 591 | Completed Suicide | FAERS: 2 | US FAERS | |
| 592 | Compression fracture | FAERS: 2 | US FAERS | |
| 593 | Critical Illness | FAERS: 2 | US FAERS | |
| 594 | Cystitis-like symptom | FAERS: 2 | US FAERS | |
| 595 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 596 | Depression suicidal | FAERS: 2 | US FAERS | |
| 597 | Differential white blood cell count abnormal | FAERS: 2 | US FAERS | |
| 598 | Eczema | FAERS: 2 | US FAERS | |
| 599 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 600 | Emotional disorder | FAERS: 2 | US FAERS | |
| 601 | Emotional distress | FAERS: 2 | US FAERS | |
| 602 | Epididymitis | FAERS: 2 | US FAERS | |
| 603 | Epstein-Barr virus test positive | FAERS: 2 | US FAERS | |
| 604 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 605 | Erysipelas | FAERS: 2 | US FAERS | |
| 606 | Erythroblastosis | FAERS: 2 | US FAERS | |
| 607 | Escherichia pyelonephritis | FAERS: 2 | US FAERS | |
| 608 | Excoriation | FAERS: 2 | US FAERS | |
| 609 | Febrile bone marrow aplasia | FAERS: 2 | US FAERS | |
| 610 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 611 | Food Allergy | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 612 | Food craving | FAERS: 2 | US FAERS | |
| 613 | Frustration tolerance decreased | FAERS: 2 | US FAERS | |
| 614 | Gastrointestinal bacterial infection | FAERS: 2 | US FAERS | |
| 615 | Gastrointestinal inflammation | FAERS: 2 | US FAERS | |
| 616 | General symptom | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 617 | Graft versus host disease in gastrointestinal tract | FAERS: 2 | US FAERS | |
| 618 | Graft versus host disease in skin | FAERS: 2 | US FAERS | |
| 619 | Granulocyte count increased | FAERS: 2 | US FAERS | |
| 620 | Haptoglobin Decreased | FAERS: 2 | US FAERS | |
| 621 | Hepatitis B DNA increased | FAERS: 2 | US FAERS | |
| 622 | Hip surgery | FAERS: 2 | US FAERS | |
| 623 | Hyperplasia | FAERS: 2 | US FAERS | |
| 624 | Idiopathic pneumonia syndrome | FAERS: 2 | US FAERS | |
| 625 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 626 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 627 | Intertrigo | FAERS: 2 | US FAERS | |
| 628 | Intra-abdominal fluid collection | FAERS: 2 | US FAERS | |
| 629 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 630 | Labyrinthitis | FAERS: 2 | US FAERS | |
| 631 | Left Ventricular Hypertrophy | FAERS: 2 | US FAERS | |
| 632 | Ligament rupture | FAERS: 2 | US FAERS | |
| 633 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 634 | Loss of proprioception | FAERS: 2 | US FAERS | |
| 635 | Low density lipoprotein increased | FAERS: 2 | US FAERS | |
| 636 | Lung neoplasm surgery | FAERS: 2 | US FAERS | |
| 637 | Lyme Disease | FAERS: 2 | US FAERS | |
| 638 | Lymph node abscess | FAERS: 2 | US FAERS | |
| 639 | Manufacturing product shipping issue | FAERS: 2 | US FAERS | |
| 640 | Marasmus | FAERS: 2 | US FAERS | |
| 641 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 642 | Megakaryocytes increased | FAERS: 2 | US FAERS | |
| 643 | Meningioma | FAERS: 2 | US FAERS | |
| 644 | Menopause | FAERS: 2 | US FAERS | |
| 645 | Mental disorder due to a general medical condition | FAERS: 2 | US FAERS | |
| 646 | Metamyelocyte count decreased | FAERS: 2 | US FAERS | |
| 647 | Metastases to stomach | FAERS: 2 | US FAERS | |
| 648 | Middle insomnia | FAERS: 2 | US FAERS | |
| 649 | Monocyte count increased | FAERS: 2 | US FAERS | |
| 650 | Monocytopenia | FAERS: 2 | US FAERS | |
| 651 | Monocytosis | FAERS: 2 | US FAERS | |
| 652 | Mouth swelling | FAERS: 2 | US FAERS | |
| 653 | Muscle tightness | FAERS: 2 | US FAERS | |
| 654 | Nasal mucosal disorder | FAERS: 2 | US FAERS | |
| 655 | Nephrotic Syndrome | FAERS: 2 | US FAERS | |
| 656 | Neutrophil count abnormal | FAERS: 2 | US FAERS | |
| 657 | Nystagmus | FAERS: 2 | US FAERS | |
| 658 | Ocular icterus | FAERS: 2 | US FAERS | |
| 659 | Oliguria | FAERS: 2 | US FAERS | |
| 660 | Oncologic complication | FAERS: 2 | US FAERS | |
| 661 | Orchitis | FAERS: 2 | US FAERS | |
| 662 | Osteorrhagia | FAERS: 2 | US FAERS | |
| 663 | Osteosclerosis | FAERS: 2 | US FAERS | |
| 664 | Otitis Externa | FAERS: 2 | US FAERS | |
| 665 | Otitis Media | FAERS: 2 | US FAERS | |
| 666 | Oxygen saturation abnormal | FAERS: 2 | US FAERS | |
| 667 | Oxygen saturation increased | FAERS: 2 | US FAERS | |
| 668 | Paranasal sinus mucosal hypertrophy | FAERS: 2 | US FAERS | |
| 669 | Paraparesis | FAERS: 2 | US FAERS | |
| 670 | Periodontitis | FAERS: 2 | US FAERS | |
| 671 | Peripheral venous disease | FAERS: 2 | US FAERS | |
| 672 | Perirectal abscess | FAERS: 2 | US FAERS | |
| 673 | Physical assault | FAERS: 2 | US FAERS | |
| 674 | Plasmablastic lymphoma | FAERS: 2 | US FAERS | |
| 675 | Pneumatosis intestinalis | FAERS: 2 | US FAERS | |
| 676 | Polyuria | FAERS: 2 | US FAERS | |
| 677 | Post procedural sepsis | FAERS: 2 | US FAERS | |
| 678 | Post procedural swelling | FAERS: 2 | US FAERS | |
| 679 | Posterior reversible encephalopathy syndrome | FAERS: 2 | US FAERS | |
| 680 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 681 | Procedural complication | FAERS: 2 | US FAERS | |
| 682 | Product container seal issue | FAERS: 2 | US FAERS | |
| 683 | Product difficult to swallow | FAERS: 2 | US FAERS | |
| 684 | Pulmonary arterial hypertension | FAERS: 2 | US FAERS | |
| 685 | Purpura | FAERS: 2 | US FAERS | |
| 686 | Pyoderma Gangrenosum | FAERS: 2 | US FAERS | |
| 687 | Red blood cell analysis abnormal | FAERS: 2 | US FAERS | |
| 688 | Refractory cytopenia with unilineage dysplasia | FAERS: 2 | US FAERS | |
| 689 | Restrictive pulmonary disease | FAERS: 2 | US FAERS | |
| 690 | Retching | FAERS: 2 | US FAERS | |
| 691 | Reticulocyte count decreased | FAERS: 2 | US FAERS | |
| 692 | Retinitis | FAERS: 2 | US FAERS | |
| 693 | Retroperitoneal lymphadenopathy | FAERS: 2 | US FAERS | |
| 694 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 695 | Rhinovirus infection | FAERS: 2 | US FAERS | |
| 696 | Rotator cuff syndrome | FAERS: 2 | US FAERS | |
| 697 | Shock | FAERS: 2 | US FAERS | |
| 698 | Skin graft infection | FAERS: 2 | US FAERS | |
| 699 | Skin squamous cell carcinoma recurrent | FAERS: 2 | US FAERS | |
| 700 | Sluggishness | FAERS: 2 | US FAERS | |
| 701 | Sodium retention | FAERS: 2 | US FAERS | |
| 702 | Soft Tissue Infection | FAERS: 2 | US FAERS | |
| 703 | Splenic necrosis | FAERS: 2 | US FAERS | |
| 704 | Splenic thrombosis | FAERS: 2 | US FAERS | |
| 705 | Staphylococcal abscess | FAERS: 2 | US FAERS | |
| 706 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 707 | Subdural Effusion | FAERS: 2 | US FAERS | |
| 708 | Sunburn | FAERS: 2 | US FAERS | |
| 709 | Therapeutic response changed | FAERS: 2 | US FAERS | |
| 710 | Thirst | FAERS: 2 | US FAERS | |
| 711 | Tongue discomfort | FAERS: 2 | US FAERS | |
| 712 | Transplantation complication | FAERS: 2 | US FAERS | |
| 713 | Trichophytosis | FAERS: 2 | US FAERS | |
| 714 | Trigeminal Neuralgia | FAERS: 2 | US FAERS | |
| 715 | Typhoid Fever | FAERS: 2 | US FAERS | |
| 716 | Urine output increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 717 | Uterine Cancer | FAERS: 2 | US FAERS | |
| 718 | Varicella Zoster Virus Infection | FAERS: 2 | US FAERS | |
| 719 | Vascular compression | FAERS: 2 | US FAERS | |
| 720 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 721 | Vessel perforation | FAERS: 2 | US FAERS | |
| 722 | Vulvovaginal rash | FAERS: 2 | US FAERS | |
| 723 | White matter lesion | FAERS: 2 | US FAERS | |
| 724 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 725 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 726 | Abdominal sepsis | FAERS: 1 | US FAERS | |
| 727 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 728 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 729 | Accidental death | FAERS: 1 | US FAERS | |
| 730 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 731 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 732 | Aicardi's syndrome | FAERS: 1 | US FAERS | |
| 733 | Alcohol Intolerance | FAERS: 1 | US FAERS | |
| 734 | Allergic respiratory symptom | FAERS: 1 | US FAERS | |
| 735 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 736 | Ammonia increased | FAERS: 1 | US FAERS | |
| 737 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 738 | Anal Fissure | FAERS: 1 | US FAERS | |
| 739 | Aneurysm | FAERS: 1 | US FAERS | |
| 740 | Angioedema | FAERS: 1 | US FAERS | |
| 741 | Animal bite | FAERS: 1 | US FAERS | |
| 742 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 743 | Antiphospholipid Syndrome | FAERS: 1 | US FAERS | |
| 744 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 745 | Appendicolith | FAERS: 1 | US FAERS | |
| 746 | Aquagenic pruritus | FAERS: 1 | US FAERS | |
| 747 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 748 | Arthropod sting | FAERS: 1 | US FAERS | |
| 749 | Asphyxia | FAERS: 1 | US FAERS | |
| 750 | Asthenopia | FAERS: 1 | US FAERS | |
| 751 | Asymptomatic viral hepatitis | FAERS: 1 | US FAERS | |
| 752 | Aura | FAERS: 1 | US FAERS | |
| 753 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 754 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 755 | Avulsion fracture | FAERS: 1 | US FAERS | |
| 756 | Bacteriuria | FAERS: 1 | US FAERS | |
| 757 | Band neutrophil count increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 758 | Base excess increased | FAERS: 1 | US FAERS | |
| 759 | Basophil count abnormal | FAERS: 1 | US FAERS | |
| 760 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 761 | Biopsy bone marrow abnormal | FAERS: 1 | US FAERS | |
| 762 | Biopsy | FAERS: 1 | US FAERS | |
| 763 | Blepharitis | FAERS: 1 | US FAERS | |
| 764 | Blood bilirubin decreased | FAERS: 1 | US FAERS | |
| 765 | Blood calcium abnormal | FAERS: 1 | US FAERS | |
| 766 | Blood chloride increased | FAERS: 1 | US FAERS | |
| 767 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 768 | Blood electrolytes increased | FAERS: 1 | US FAERS | |
| 769 | Blood erythropoietin decreased | FAERS: 1 | US FAERS | |
| 770 | Blood erythropoietin increased | FAERS: 1 | US FAERS | |
| 771 | Blood fibrinogen increased | FAERS: 1 | US FAERS | |
| 772 | Blood folate decreased | FAERS: 1 | US FAERS | |
| 773 | Blood lactate dehydrogenase decreased | FAERS: 1 | US FAERS | |
| 774 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 775 | Blood phosphorus abnormal | FAERS: 1 | US FAERS | |
| 776 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 777 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 778 | Blood uric acid abnormal | FAERS: 1 | US FAERS | |
| 779 | Bone abscess | FAERS: 1 | US FAERS | |
| 780 | Bone density decreased | FAERS: 1 | US FAERS | |
| 781 | Bone marrow necrosis | FAERS: 1 | US FAERS | |
| 782 | Bradykinesia | FAERS: 1 | US FAERS | |
| 783 | Bradyphrenia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 784 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 785 | Brain stem syndrome | FAERS: 1 | US FAERS | |
| 786 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 787 | Breast tenderness | FAERS: 1 | US FAERS | |
| 788 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 789 | Burning feet syndrome | FAERS: 1 | US FAERS | |
| 790 | C-reactive protein decreased | FAERS: 1 | US FAERS | |
| 791 | Campylobacter colitis | FAERS: 1 | US FAERS | |
| 792 | Candida pneumonia | FAERS: 1 | US FAERS | |
| 793 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 794 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 795 | Cardiac Hypertrophy | FAERS: 1 | US FAERS | |
| 796 | Cardiac autonomic neuropathy | FAERS: 1 | US FAERS | |
| 797 | Cardiac infection | FAERS: 1 | US FAERS | |
| 798 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 799 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 800 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 801 | Cheilitis | FAERS: 1 | US FAERS | |
| 802 | Chemotherapy | FAERS: 1 | US FAERS | |
| 803 | Choroiditis | FAERS: 1 | US FAERS | |
| 804 | Chronic graft versus host disease in liver | FAERS: 1 | US FAERS | |
| 805 | Chronic graft versus host disease in skin | FAERS: 1 | US FAERS | |
| 806 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 807 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 808 | Citrobacter sepsis | FAERS: 1 | US FAERS | |
| 809 | Clonal Evolution | FAERS: 1 | US FAERS | |
| 810 | Clonus | FAERS: 1 | US FAERS | |
| 811 | Coagulation test abnormal | FAERS: 1 | US FAERS | |
| 812 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 813 | Congenital thrombocyte disorder | FAERS: 1 | US FAERS | |
| 814 | Contrast media reaction | FAERS: 1 | US FAERS | |
| 815 | Conversion disorder | FAERS: 1 | US FAERS | |
| 816 | Coombs test positive | FAERS: 1 | US FAERS | |
| 817 | Cor pulmonale | FAERS: 1 | US FAERS | |
| 818 | Corneal Infection | FAERS: 1 | US FAERS | |
| 819 | Corneal Perforation | FAERS: 1 | US FAERS | |
| 820 | Corneal Scar | FAERS: 1 | US FAERS | |
| 821 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 822 | Cryptococcus test positive | FAERS: 1 | US FAERS | |
| 823 | Cystitis viral | FAERS: 1 | US FAERS | |
| 824 | Cystoscopy | FAERS: 1 | US FAERS | |
| 825 | Cytokine abnormal | FAERS: 1 | US FAERS | |
| 826 | Cytology abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 827 | Cytomegalovirus test positive | FAERS: 1 | US FAERS | |
| 828 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 829 | Deformity | FAERS: 1 | US FAERS | |
| 830 | Demyelination | FAERS: 1 | US FAERS | |
| 831 | Dependence | FAERS: 1 | US FAERS | |
| 832 | Dermo-hypodermitis | FAERS: 1 | US FAERS | |
| 833 | Device dependence | FAERS: 1 | US FAERS | |
| 834 | Device dislocation | FAERS: 1 | US FAERS | |
| 835 | Device related infection | FAERS: 1 | US FAERS | |
| 836 | Diabetic Retinopathy | FAERS: 1 | US FAERS | |
| 837 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 838 | Diastolic hypertension | FAERS: 1 | US FAERS | |
| 839 | Diffuse alopecia | FAERS: 1 | US FAERS | |
| 840 | Disease susceptibility | FAERS: 1 | US FAERS | |
| 841 | Diuretic therapy | FAERS: 1 | US FAERS | |
| 842 | Diverticular perforation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 843 | Drug Dependence | FAERS: 1 | US FAERS | |
| 844 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 845 | Drug level increased | FAERS: 1 | US FAERS | |
| 846 | Drug specific antibody present | FAERS: 1 | US FAERS | |
| 847 | Dyschezia | FAERS: 1 | US FAERS | |
| 848 | Dysentery | FAERS: 1 | US FAERS | |
| 849 | Dysponesis | FAERS: 1 | US FAERS | |
| 850 | Eating disorder symptom | FAERS: 1 | US FAERS | |
| 851 | Economic problem | FAERS: 1 | US FAERS | |
| 852 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 853 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 854 | Embolic stroke | FAERS: 1 | US FAERS | |
| 855 | Emergency care examination | FAERS: 1 | US FAERS | |
| 856 | Enteritis | FAERS: 1 | US FAERS | |
| 857 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 858 | Enuresis | FAERS: 1 | US FAERS | |
| 859 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 860 | Enzyme level increased | FAERS: 1 | US FAERS | |
| 861 | Epicondylitis | FAERS: 1 | US FAERS | |
| 862 | Epidermal necrosis | FAERS: 1 | US FAERS | |
| 863 | Epidural lipomatosis | FAERS: 1 | US FAERS | |
| 864 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 865 | Epiglottitis | FAERS: 1 | US FAERS | |
| 866 | Epstein-Barr virus antibody positive | FAERS: 1 | US FAERS | |
| 867 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 868 | Erythroblast count abnormal | FAERS: 1 | US FAERS | |
| 869 | Erythromelalgia | FAERS: 1 | US FAERS | |
| 870 | Exposure to body fluid | FAERS: 1 | US FAERS | |
| 871 | Exposure via body fluid | FAERS: 1 | US FAERS | |
| 872 | Exposure via skin contact | FAERS: 1 | US FAERS | |
| 873 | Factor XI Deficiency | FAERS: 1 | US FAERS | |
| 874 | Fanconi Syndrome | FAERS: 1 | US FAERS | |
| 875 | Fear of falling | FAERS: 1 | US FAERS | |
| 876 | Feeding tube user | FAERS: 1 | US FAERS | |
| 877 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 878 | Formication | FAERS: 1 | US FAERS | |
| 879 | Gamma-glutamyltransferase abnormal | FAERS: 1 | US FAERS | |
| 880 | Gangrene | FAERS: 1 | US FAERS | |
| 881 | Gas Gangrene | FAERS: 1 | US FAERS | |
| 882 | Gastric mucosal lesion | FAERS: 1 | US FAERS | |
| 883 | Gastrointestinal bacterial overgrowth | FAERS: 1 | US FAERS | |
| 884 | Gastrointestinal candidiasis | FAERS: 1 | US FAERS | |
| 885 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 886 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 887 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 888 | Gastrointestinal toxicity | FAERS: 1 | US FAERS | |
| 889 | Gastrointestinal viral infection | FAERS: 1 | US FAERS | |
| 890 | Gastrointestinal wall thickening | FAERS: 1 | US FAERS | |
| 891 | Gastrooesophageal cancer | FAERS: 1 | US FAERS | |
| 892 | Gelatinous transformation of the bone marrow | FAERS: 1 | US FAERS | |
| 893 | Gene Mutation | FAERS: 1 | US FAERS | |
| 894 | General physical condition decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 895 | Genital infection fungal | FAERS: 1 | US FAERS | |
| 896 | Genital labial operation | FAERS: 1 | US FAERS | |
| 897 | Giardiasis | FAERS: 1 | US FAERS | |
| 898 | Glioblastoma | FAERS: 1 | US FAERS | |
| 899 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 900 | Graft loss | FAERS: 1 | US FAERS | |
| 901 | Graft versus host disease in eye | FAERS: 1 | US FAERS | |
| 902 | Granulocytes maturation arrest | FAERS: 1 | US FAERS | |
| 903 | HER-2 positive breast cancer | FAERS: 1 | US FAERS | |
| 904 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 905 | Hepatic vascular thrombosis | FAERS: 1 | US FAERS | |
| 906 | Hepatic vein occlusion | FAERS: 1 | US FAERS | |
| 907 | Hepatitis B core antibody positive | FAERS: 1 | US FAERS | |
| 908 | Hepatitis B surface antigen positive | FAERS: 1 | US FAERS | |
| 909 | Hepatitis B virus test positive | FAERS: 1 | US FAERS | |
| 910 | Hepatopulmonary Syndrome | FAERS: 1 | US FAERS | |
| 911 | Herpes simplex serology positive | FAERS: 1 | US FAERS | |
| 912 | Herpes zoster infection neurological | FAERS: 1 | US FAERS | |
| 913 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 914 | Hypercapnia | FAERS: 1 | US FAERS | |
| 915 | Hypereosinophilic syndrome | FAERS: 1 | US FAERS | |
| 916 | Hyperleukocytosis | FAERS: 1 | US FAERS | |
| 917 | Hyperparathyroidism | FAERS: 1 | US FAERS | |
| 918 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 919 | Hypervigilance | FAERS: 1 | US FAERS | |
| 920 | Hyperviscosity syndrome | FAERS: 1 | US FAERS | |
| 921 | Hypobarism | FAERS: 1 | US FAERS | |
| 922 | Hypohidrosis | FAERS: 1 | US FAERS | |
| 923 | Hypoparathyroidism | FAERS: 1 | US FAERS | |
| 924 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 925 | Illness anxiety disorder | FAERS: 1 | US FAERS | |
| 926 | Immunoglobulin Therapy | FAERS: 1 | US FAERS | |
| 927 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 928 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 929 | Incision site infection | FAERS: 1 | US FAERS | |
| 930 | Incisional hernia | FAERS: 1 | US FAERS | |
| 931 | Incoherent | FAERS: 1 | US FAERS | |
| 932 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 933 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 934 | Increased viscosity of upper respiratory secretion | FAERS: 1 | US FAERS | |
| 935 | Infected dermal cyst | FAERS: 1 | US FAERS | |
| 936 | Infection reactivation | FAERS: 1 | US FAERS | |
| 937 | Infectious pleural effusion | FAERS: 1 | US FAERS | |
| 938 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 939 | Inguinal mass | FAERS: 1 | US FAERS | |
| 940 | Initial insomnia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 941 | Injection site bruising | FAERS: 1 | US FAERS | |
| 942 | Injection site phlebitis | FAERS: 1 | US FAERS | |
| 943 | Insurance issue | FAERS: 1 | US FAERS | |
| 944 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 945 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 946 | Intestinal congestion | FAERS: 1 | US FAERS | |
| 947 | Invasive Ductal Breast Carcinoma | FAERS: 1 | US FAERS | |
| 948 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 949 | Klebsiella sepsis | FAERS: 1 | US FAERS | |
| 950 | Klebsiella test positive | FAERS: 1 | US FAERS | |
| 951 | Large intestine erosion | FAERS: 1 | US FAERS | |
| 952 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 953 | Leukotriene increased | FAERS: 1 | US FAERS | |
| 954 | Libido disorder | FAERS: 1 | US FAERS | |
| 955 | Ligament pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 956 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 957 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 958 | Lipoma | FAERS: 1 | US FAERS | |
| 959 | Liposarcoma recurrent | FAERS: 1 | US FAERS | |
| 960 | Listeriosis | FAERS: 1 | US FAERS | |
| 961 | Liver function test decreased | FAERS: 1 | US FAERS | |
| 962 | Loose tooth | FAERS: 1 | US FAERS | |
| 963 | Lung carcinoma cell type unspecified stage I | FAERS: 1 | US FAERS | |
| 964 | Lung consolidation | FAERS: 1 | US FAERS | |
| 965 | Lung perforation | FAERS: 1 | US FAERS | |
| 966 | Lymph nodes scan abnormal | FAERS: 1 | US FAERS | |
| 967 | Lymphangitis | FAERS: 1 | US FAERS | |
| 968 | Lymphocyte count abnormal | FAERS: 1 | US FAERS | |
| 969 | Macrocytosis | FAERS: 1 | US FAERS | |
| 970 | Malabsorption | FAERS: 1 | US FAERS | |
| 971 | Mantle cell lymphoma recurrent | FAERS: 1 | US FAERS | |
| 972 | Mantle cell lymphoma | FAERS: 1 | US FAERS | |
| 973 | Mastication disorder | FAERS: 1 | US FAERS | |
| 974 | Mastocytosis | FAERS: 1 | US FAERS | |
| 975 | Medial Tibial Stress Syndrome | FAERS: 1 | US FAERS | |
| 976 | Mediastinal mass | FAERS: 1 | US FAERS | |
| 977 | Meningitis herpes | FAERS: 1 | US FAERS | |
| 978 | Mesenteric vascular insufficiency | FAERS: 1 | US FAERS | |
| 979 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 980 | Metapneumovirus infection | FAERS: 1 | US FAERS | |
| 981 | Metastases to salivary gland | FAERS: 1 | US FAERS | |
| 982 | Metatarsalgia | FAERS: 1 | US FAERS | |
| 983 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 984 | Mole excision | FAERS: 1 | US FAERS | |
| 985 | Motion Sickness | FAERS: 1 | US FAERS | |
| 986 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 987 | Multiple drug therapy | FAERS: 1 | US FAERS | |
| 988 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 989 | Muscle abscess | FAERS: 1 | US FAERS | |
| 990 | Mutagenic effect | FAERS: 1 | US FAERS | |
| 991 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 992 | Mycobacterium abscessus Infection | FAERS: 1 | US FAERS | |
| 993 | Mycobacterium tuberculosis complex test positive | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 994 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 995 | Mydriasis | FAERS: 1 | US FAERS | |
| 996 | Myeloblast count increased | FAERS: 1 | US FAERS | |
| 997 | Myeloblast present | FAERS: 1 | US FAERS | |
| 998 | Myelocytosis | FAERS: 1 | US FAERS | |
| 999 | Myocardial necrosis | FAERS: 1 | US FAERS | |
| 1000 | Myopathy | FAERS: 1 | US FAERS | |
| 1001 | N-terminal prohormone brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 1002 | Narcolepsy | FAERS: 1 | US FAERS | |
| 1003 | Nasal herpes | FAERS: 1 | US FAERS | |
| 1004 | Nephrosclerosis | FAERS: 1 | US FAERS | |
| 1005 | Nerve injury | FAERS: 1 | US FAERS | |
| 1006 | Neurological decompensation | FAERS: 1 | US FAERS | |
| 1007 | Neurological examination abnormal | FAERS: 1 | US FAERS | |
| 1008 | Neuromyelitis Optica | FAERS: 1 | US FAERS | |
| 1009 | Neutrophil percentage decreased | FAERS: 1 | US FAERS | |
| 1010 | Nodular rash | FAERS: 1 | US FAERS | |
| 1011 | Nodular vasculitis | FAERS: 1 | US FAERS | |
| 1012 | Non-Hodgkin's lymphoma unspecified histology indolent | FAERS: 1 | US FAERS | |
| 1013 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 1014 | Obesity | FAERS: 1 | US FAERS | |
| 1015 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 1016 | Occult blood positive | FAERS: 1 | US FAERS | |
| 1017 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 1018 | Onychalgia | FAERS: 1 | US FAERS | |
| 1019 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 1020 | Oral infection | FAERS: 1 | US FAERS | |
| 1021 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 1022 | Oral pruritus | FAERS: 1 | US FAERS | |
| 1023 | Orgasmic sensation decreased | FAERS: 1 | US FAERS | |
| 1024 | Osmotic demyelination syndrome | FAERS: 1 | US FAERS | |
| 1025 | Osteochondrosis | FAERS: 1 | US FAERS | |
| 1026 | Osteonecrosis of Jaw | FAERS: 1 | US FAERS | |
| 1027 | Osteoradionecrosis | FAERS: 1 | US FAERS | |
| 1028 | Overlap syndrome | FAERS: 1 | US FAERS | |
| 1029 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 1030 | Papilloma | FAERS: 1 | US FAERS | |
| 1031 | Papule | FAERS: 1 | US FAERS | |
| 1032 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 1033 | Paranoia | FAERS: 1 | US FAERS | |
| 1034 | Parasitic gastroenteritis | FAERS: 1 | US FAERS | |
| 1035 | Paternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 1036 | Pathological fracture | FAERS: 1 | US FAERS | |
| 1037 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 1038 | Penile swelling | FAERS: 1 | US FAERS | |
| 1039 | Periostitis | FAERS: 1 | US FAERS | |
| 1040 | Peripheral artery occlusion | FAERS: 1 | US FAERS | |
| 1041 | Personality Change | FAERS: 1 | US FAERS | |
| 1042 | Photophobia | FAERS: 1 | US FAERS | |
| 1043 | Physical disability | FAERS: 1 | US FAERS | |
| 1044 | Physical product label issue | FAERS: 1 | US FAERS | |
| 1045 | Platelet dysfunction | FAERS: 1 | US FAERS | |
| 1046 | Platelet function test abnormal | FAERS: 1 | US FAERS | |
| 1047 | Pneumobilia | FAERS: 1 | US FAERS | |
| 1048 | Pneumococcal sepsis | FAERS: 1 | US FAERS | |
| 1049 | Pneumoperitoneum | FAERS: 1 | US FAERS | |
| 1050 | Poisoning | FAERS: 1 | US FAERS | |
| 1051 | Polymerase Chain Reaction | FAERS: 1 | US FAERS | |
| 1052 | Polyserositis | FAERS: 1 | US FAERS | |
| 1053 | Poor personal hygiene | FAERS: 1 | US FAERS | |
| 1054 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 1055 | Portal vein pressure increased | FAERS: 1 | US FAERS | |
| 1056 | Portal venous gas | FAERS: 1 | US FAERS | |
| 1057 | Positron emission tomogram abnormal | FAERS: 1 | US FAERS | |
| 1058 | Post procedural contusion | FAERS: 1 | US FAERS | |
| 1059 | Post procedural discharge | FAERS: 1 | US FAERS | |
| 1060 | Post procedural pneumonia | FAERS: 1 | US FAERS | |
| 1061 | Post-traumatic pain | FAERS: 1 | US FAERS | |
| 1062 | Poverty of speech | FAERS: 1 | US FAERS | |
| 1063 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 1064 | Pregnancy of partner | FAERS: 1 | US FAERS | |
| 1065 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 1066 | Procalcitonin increased | FAERS: 1 | US FAERS | |
| 1067 | Product blister packaging issue | FAERS: 1 | US FAERS | |
| 1068 | Product label issue | FAERS: 1 | US FAERS | |
| 1069 | Product packaging issue | FAERS: 1 | US FAERS | |
| 1070 | Product supply issue | FAERS: 1 | US FAERS | |
| 1071 | Promyelocyte count increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1072 | Prostatitis Escherichia coli | FAERS: 1 | US FAERS | |
| 1073 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 1074 | Pseudarthrosis | FAERS: 1 | US FAERS | |
| 1075 | Psoas Abscess | FAERS: 1 | US FAERS | |
| 1076 | Pulmonary necrosis | FAERS: 1 | US FAERS | |
| 1077 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 1078 | Pulmonary renal syndrome | FAERS: 1 | US FAERS | |
| 1079 | Pulmonary toxicity | FAERS: 1 | US FAERS | |
| 1080 | Pulmonary venous thrombosis | FAERS: 1 | US FAERS | |
| 1081 | Puncture site bruise | FAERS: 1 | US FAERS | |
| 1082 | Purulence | FAERS: 1 | US FAERS | |
| 1083 | Pyelocaliectasis | FAERS: 1 | US FAERS | |
| 1084 | Pyruvate kinase increased | FAERS: 1 | US FAERS | |
| 1085 | Radiation neuropathy | FAERS: 1 | US FAERS | |
| 1086 | Radiation proctitis | FAERS: 1 | US FAERS | |
| 1087 | Radicular pain | FAERS: 1 | US FAERS | |
| 1088 | Rectal fissure | FAERS: 1 | US FAERS | |
| 1089 | Refractory cytopenia with multilineage dysplasia | FAERS: 1 | US FAERS | |
| 1090 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 1091 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 1092 | Renal Colic | FAERS: 1 | US FAERS | |
| 1093 | Renal aneurysm | FAERS: 1 | US FAERS | |
| 1094 | Renal cancer metastatic | FAERS: 1 | US FAERS | |
| 1095 | Renal mass | FAERS: 1 | US FAERS | |
| 1096 | Renal vein compression | FAERS: 1 | US FAERS | |
| 1097 | Reproductive tract anastomotic leak | FAERS: 1 | US FAERS | |
| 1098 | Reticulocytosis | FAERS: 1 | US FAERS | |
| 1099 | Retinal Vascular Disorder | FAERS: 1 | US FAERS | |
| 1100 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 1101 | Retinal pigment epitheliopathy | FAERS: 1 | US FAERS | |
| 1102 | Rheumatic Heart Disease | FAERS: 1 | US FAERS | |
| 1103 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 1104 | Salmonella sepsis | FAERS: 1 | US FAERS | |
| 1105 | Sarcoma | FAERS: 1 | US FAERS | |
| 1106 | Scedosporium infection | FAERS: 1 | US FAERS | |
| 1107 | Schizoaffective Disorder | FAERS: 1 | US FAERS | |
| 1108 | Seminoma | FAERS: 1 | US FAERS | |
| 1109 | Serositis | FAERS: 1 | US FAERS | |
| 1110 | Serum sickness-like reaction | FAERS: 1 | US FAERS | |
| 1111 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 1112 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 1113 | Sinus pain | FAERS: 1 | US FAERS | |
| 1114 | Sinusitis aspergillus | FAERS: 1 | US FAERS | |
| 1115 | Skin discomfort | FAERS: 1 | US FAERS | |
| 1116 | Skin test positive | FAERS: 1 | US FAERS | |
| 1117 | Skin tightness | FAERS: 1 | US FAERS | |
| 1118 | Solar dermatitis | FAERS: 1 | US FAERS | |
| 1119 | Somatoform Disorder | FAERS: 1 | US FAERS | |
| 1120 | Spinal column injury | FAERS: 1 | US FAERS | |
| 1121 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 1122 | Spleen palpable | FAERS: 1 | US FAERS | |
| 1123 | Splenic abscess | FAERS: 1 | US FAERS | |
| 1124 | Splenic varices | FAERS: 1 | US FAERS | |
| 1125 | Splenic vein thrombosis | FAERS: 1 | US FAERS | |
| 1126 | Squamous cell carcinoma of lung | FAERS: 1 | US FAERS | |
| 1127 | Starvation | FAERS: 1 | US FAERS | |
| 1128 | Streptococcal endocarditis | FAERS: 1 | US FAERS | |
| 1129 | Stress ulcer | FAERS: 1 | US FAERS | |
| 1130 | Stridor | FAERS: 1 | US FAERS | |
| 1131 | Superinfection bacterial | FAERS: 1 | US FAERS | |
| 1132 | Superinfection | FAERS: 1 | US FAERS | |
| 1133 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 1134 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 1135 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 1136 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 1137 | Systemic mycosis | FAERS: 1 | US FAERS | |
| 1138 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 1139 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 1140 | Therapeutic product effect decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1141 | Thermal burn | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1142 | Tongue cancer recurrent | FAERS: 1 | US FAERS | |
| 1143 | Tongue eruption | FAERS: 1 | US FAERS | |
| 1144 | Total lung capacity increased | FAERS: 1 | US FAERS | |
| 1145 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 1146 | Toxic anterior segment syndrome | FAERS: 1 | US FAERS | |
| 1147 | Tracheal Stenosis | FAERS: 1 | US FAERS | |
| 1148 | Transaminases abnormal | FAERS: 1 | US FAERS | |
| 1149 | Transfusion Reaction | FAERS: 1 | US FAERS | |
| 1150 | Trichophytic granuloma | FAERS: 1 | US FAERS | |
| 1151 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 1152 | Underweight | FAERS: 1 | US FAERS | |
| 1153 | Upper motor neurone lesion | FAERS: 1 | US FAERS | |
| 1154 | Urinary tract infection viral | FAERS: 1 | US FAERS | |
| 1155 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 1156 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 1157 | Urticaria Pigmentosa | FAERS: 1 | US FAERS | |
| 1158 | Uterine Prolapse | FAERS: 1 | US FAERS | |
| 1159 | Uveitis | FAERS: 1 | US FAERS | |
| 1160 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 1161 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 1162 | Varicella virus test positive | FAERS: 1 | US FAERS | |
| 1163 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 1164 | Vascular rupture | FAERS: 1 | US FAERS | |
| 1165 | Vascular stent stenosis | FAERS: 1 | US FAERS | |
| 1166 | Venoocclusive disease | FAERS: 1 | US FAERS | |
| 1167 | Venous aneurysm | FAERS: 1 | US FAERS | |
| 1168 | Venous occlusion | FAERS: 1 | US FAERS | |
| 1169 | Vertebral foraminal stenosis | FAERS: 1 | US FAERS | |
| 1170 | Vertebral lesion | FAERS: 1 | US FAERS | |
| 1171 | Vessel puncture site bruise | FAERS: 1 | US FAERS | |
| 1172 | Viral pharyngitis | FAERS: 1 | US FAERS | |
| 1173 | Visceral venous thrombosis | FAERS: 1 | US FAERS | |
| 1174 | Vitreous injury | FAERS: 1 | US FAERS | |
| 1175 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 1176 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 1177 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 1178 | West Nile viral infection | FAERS: 1 | US FAERS | |
| 1179 | Wheelchair user | FAERS: 1 | US FAERS | |
| 1180 | Wound abscess | FAERS: 1 | US FAERS | |
| 1181 | Wrong dose | FAERS: 1 | US FAERS | |
| 1182 | Xanthoma | FAERS: 1 | US FAERS | |
| 1183 | Zika Virus Infection | FAERS: 1 | US FAERS | |
| 1184 | Zygomycosis | FAERS: 1 | US FAERS | |
| 1185 | carbuncle | FAERS: 1 | US FAERS | |
| 1186 | keratoacanthoma | FAERS: 1 | US FAERS | |
| 1187 | liposarcoma | FAERS: 1 | US FAERS | |
| 1188 | General physical condition | Canada Vigilance: 1 | Canada Vigilance | |
| 1189 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 1190 | Red blood cell nucleated morphology present | Canada Vigilance: 1 | Canada Vigilance | |
| 1191 | Therapeutic product effect delayed | Canada Vigilance: 1 | Canada Vigilance | |
| 1192 | Up and down phenomenon | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.