MetaADEDB: Drug

MetaADEDB 2.0 @ LMMD

Amiodarone

(IYIKLHRQXLHMJQ-UHFFFAOYSA-N)

Structure

SMILES: CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2
Type(s): Approved; Investigational
ATC code(s): C01BD01
Molecular Formula:: C25H29I2NO3
Molecular Weight:: 645.312
Log P:: 6.9362
Hydrogen Bond Acceptor:: 4
Hydrogen Bond Donor:: 0
TPSA:: 42.68
CAS Number(s):: 1951-25-3; 19774-82-4

Synonym(s)

Amiodarone

Amiobeta

Amiodarex

Amiodarona

Amiodarone Hydrochloride

Amiohexal

Aratac

Braxan

Corbionax

10.

Cordarex

11.

Cordarone

12.

Kordaron

13.

L-3428

14.

Ortacrone

15.

Rytmarone

16.

SKF 33134-A

17.

Tachydaron

18.

Trangorex

19.

Hydrochloride, Amiodarone

20.

L 3428

21.

L3428

22.

SKF 33134 A

23.

SKF 33134A

External Link(s)

MeSH	D000638
PubChem Compound	2157
BindingDB	18957
ChEBI	2663
CHEMBL	CHEMBL633
DrugBank	DB01118
DrugCentral	176
IUPHAR/BPS Guide to PHARMACOLOGY	2566
KEGG	cpd:C06823 dr:D02910
Therapeutic Target Database	D0L5WM
ZINC	3830212

Adverse Drug Event(s)

	Name	Number of Reports	Reference(s)	Data Source
1	Hyperthyroidism	FAERS: 250 Canada Vigilance: 60	View details 1759074 2935440 3756313 6246624 6291368 6407452 6613838 7726275 8058296 9855346 10499251 11014318 15588385 16323735 16649440 16858166	CTD SIDER Canada Vigilance US FAERS
2	Pulmonary Fibrosis	FAERS: 190 Canada Vigilance: 5	View details 2935440 6194402 6291368 11597910 12490602 12747577 12832656 23707191 25163675 26781185	CTD Canada Vigilance US FAERS
3	Asthenia	FAERS: 173 Canada Vigilance: 1		Canada Vigilance OFFSIDES SIDER US FAERS
4	Toxicity to various agents	FAERS: 160 Canada Vigilance: 1		Canada Vigilance US FAERS
5	Pulmonary toxicity	FAERS: 147		OFFSIDES SIDER US FAERS
6	Fatigue	FAERS: 144 Canada Vigilance: 1	9855346	CTD SIDER Canada Vigilance US FAERS
7	Wheezing	FAERS: 98		SIDER US FAERS
8	Dizziness	FAERS: 97 Canada Vigilance: 1	6849241 9855346 9924849	CTD OFFSIDES SIDER Canada Vigilance US FAERS
9	Hypothyroidism	FAERS: 97 Canada Vigilance: 10	View details 2590102 3976714 4085515 6305250 6407452 6486153 6613838 7726275 9855346 11716246 16320682 16858166 17991464 18020914 19015056 19640392 20635749 24729111	CTD SIDER Canada Vigilance US FAERS
10	Atrial Fibrillation	FAERS: 94	View details 1409197 1507842 1782940 2371197 2633456 4067122 4085515 6812745 7797846 8187370 8311367 8330477 8465724 8555895 8644602 9098591 9149614 9515876 9772688 9915382 10517649 10524732 10533631 10610746 10668291 10775011 11794432 11926860 12647553 12698686 14675007 15138971 15206999 15546305 15686794 15792261 15807838 15851230 15869686 15899738 16180181 16323735 16615278 16650263 16687421 16798157 17383295 17434635 17523411 17939344 18274029 18294935 18329740 18334037 18385185 18598099 18651412 19282313 19698954 20384650 24729111	CTD SIDER US FAERS
11	Blindness	FAERS: 93	9855346 15586652	CTD SIDER US FAERS
12	Respiratory Failure	FAERS: 83		OFFSIDES US FAERS
13	Pneumonia	FAERS: 78 Canada Vigilance: 3	View details 1595783 3997294 6409240 6861927 9855346 16131795 16858166	CTD SIDER Canada Vigilance US FAERS
14	Adverse event	FAERS: 75		US FAERS
15	Bradycardia	FAERS: 59 Canada Vigilance: 5	View details 2941121 3609047 3958352 4067758 6291368 6973297 8522712 8578750 9924849 11266201 11794432 12535818 12804730 15132370 16615729 16858166 17645632 18260841 18329740 22744888 24729111	CTD OFFSIDES SIDER Canada Vigilance US FAERS
16	Chest Pain	FAERS: 58		OFFSIDES US FAERS
17	Tremor	FAERS: 58 Canada Vigilance: 2	View details 1344923 2314744 2742365 3034178 4085515 6538658 6613838 6685151 9855346 16858166 20175957	CTD SIDER Canada Vigilance US FAERS
18	Weight decreased	FAERS: 58 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
19	Nausea	FAERS: 57 Canada Vigilance: 3	View details 1689330 2685081 4085515 6637851 7726275 8522712 17939344	CTD SIDER Canada Vigilance US FAERS
20	Visual Impairment	FAERS: 51 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
21	Hypotension	FAERS: 48 Canada Vigilance: 1	View details 1934231 3966317 4067758 7586313 8522712 9636919 9924849 11794432 12658206 12902100 14996582 15662287 15717136 16492484 17645632 19232340 19793107 20370763	CTD SIDER Canada Vigilance US FAERS
22	Palpitations	FAERS: 48		US FAERS
23	Cardiac Arrest	FAERS: 44 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
24	Pneumonitis	FAERS: 43 Canada Vigilance: 3		Canada Vigilance US FAERS
25	Syncope	FAERS: 39 Canada Vigilance: 3	View details 3190031 3709557 6849241 9149614 12698686 15792261 16492484	CTD Canada Vigilance US FAERS
26	Vomiting	FAERS: 39 Canada Vigilance: 2	View details 1689330 4067758 4085515 6326931 8522712 9748066 17939344	CTD SIDER Canada Vigilance US FAERS
27	Thyroiditis	FAERS: 38 Canada Vigilance: 4	18598099	CTD Canada Vigilance US FAERS
28	Drug ineffective	FAERS: 36 Canada Vigilance: 2		Canada Vigilance US FAERS
29	Chest discomfort	FAERS: 29 Canada Vigilance: 2		Canada Vigilance US FAERS
30	Drug toxicity	FAERS: 29		OFFSIDES US FAERS
31	Hepatotoxicity	FAERS: 27		US FAERS
32	Long QT Syndrome	FAERS: 27	View details 710760 1507842 1743800 1782940 2417848 2736564 3609047 3709557 4007880 6123639 6204284 6849241 7156952 7398728 7846927 8187370 8522712 10217665 10524732 11266201 11305536 11326361 11723026 11989578 12197602 12647553 12698686 12972125 14579055 15350150 15792261 15869686 16178046 16449812 16650263 17391786 17523411 17587605 18329740 18786527 19020191 20532436 24052561	CTD OFFSIDES US FAERS
33	Cataract	FAERS: 25	10172409	CTD OFFSIDES US FAERS
34	Alopecia	FAERS: 24 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
35	Keratopathy	FAERS: 23		SIDER US FAERS
36	Malaise	FAERS: 23 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
37	Tachycardia	FAERS: 23	View details 1267541 3962737 6780988 10975596 11238279 17645632 18598099	CTD SIDER US FAERS
38	Vertigo	FAERS: 23	2314744 7611956 9748066	CTD SIDER US FAERS
39	Pain	FAERS: 22	1689330 2590102 3592436	CTD SIDER US FAERS
40	Ventricular Fibrillation	FAERS: 22	View details 710760 1452930 1507842 1869328 2478745 2941121 3417974 3709557 6409240 6637851 7398728 7539890 7586313 7784241 8187370 8481255 8522712 8644602 8913906 9078198 10520795 10666663 11716246 12647553 15132370 15271008 16884506 17523411 18334037 20532436	CTD OFFSIDES SIDER US FAERS
41	Loss of personal independence in daily activities	FAERS: 21		US FAERS
42	Headache	FAERS: 20 Canada Vigilance: 1	9855346 10668291	CTD SIDER Canada Vigilance US FAERS
43	Ataxia	FAERS: 19	View details 1344923 2314744 3034178 3158188 4085515 6496340 6538658 6637851 6685151 9855346 10091644 16275201 18385185 20175957	CTD OFFSIDES SIDER US FAERS
44	Hypoxia	FAERS: 18		OFFSIDES US FAERS
45	Nervousness	FAERS: 18 Canada Vigilance: 1		Canada Vigilance US FAERS
46	Acute kidney injury	FAERS: 17	View details 2026392 4037586 8491409 12710596 17615423	CTD US FAERS
47	Constipation	FAERS: 17	6685151	CTD SIDER US FAERS
48	General physical health deterioration	FAERS: 17 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
49	Polyneuropathy	FAERS: 17		US FAERS
50	Anxiety	FAERS: 16 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
51	Erythema	FAERS: 16		OFFSIDES SIDER US FAERS
52	Pruritus	FAERS: 16 Canada Vigilance: 1	2648965 3190031	CTD SIDER Canada Vigilance US FAERS
53	Respiratory distress	FAERS: 16		US FAERS
54	Restlessness	FAERS: 16		US FAERS
55	jaundice	FAERS: 16	View details 2026392 2648965 3190031 3708949 7797846 10086516 16003525 18218290	CTD SIDER US FAERS
56	Alanine Aminotransferase Increased	FAERS: 15 Canada Vigilance: 2		Canada Vigilance OFFSIDES SIDER US FAERS
57	Infection	FAERS: 15		SIDER US FAERS
58	Lethargy	FAERS: 15		OFFSIDES US FAERS
59	Acute respiratory failure	FAERS: 14		OFFSIDES US FAERS
60	Arthralgia	FAERS: 14		US FAERS
61	Atrial Flutter	FAERS: 14	View details 3609047 4085515 7784241 9515876 10775011 12611038 14675007 14732753 15546305 15641295 15816331 16798157 20093999	CTD US FAERS
62	Hypersensitivity	FAERS: 14		SIDER US FAERS
63	Lupus-like syndrome	FAERS: 14		OFFSIDES US FAERS
64	Thrombophlebitis	FAERS: 14	View details 6861542 7116977 10533631 15526730 16144179 16858113	CTD SIDER US FAERS
65	Aspartate Aminotransferase Increased	FAERS: 13 Canada Vigilance: 3		Canada Vigilance SIDER US FAERS
66	Optic Neuropathy	FAERS: 13		US FAERS
67	Thrombocytopenia	FAERS: 12 Canada Vigilance: 1	10863591	CTD SIDER Canada Vigilance US FAERS
68	Abdominal Pain	FAERS: 11 Canada Vigilance: 1	3970484	CTD OFFSIDES SIDER Canada Vigilance US FAERS
69	Blood thyroid stimulating hormone increased	FAERS: 11 Canada Vigilance: 1		Canada Vigilance OFFSIDES SIDER US FAERS
70	Bronchitis	FAERS: 11		US FAERS
71	Cerebrovascular accident	FAERS: 11		US FAERS
72	Gait inability	FAERS: 11		US FAERS
73	Productive Cough	FAERS: 11		US FAERS
74	Pulmonary Hypertension	FAERS: 11 Canada Vigilance: 1		Canada Vigilance US FAERS
75	Urinary tract infection	FAERS: 11		US FAERS
76	Vitreous floaters	FAERS: 11		US FAERS
77	Macular degeneration	FAERS: 10		SIDER US FAERS
78	Medication Error	FAERS: 10		US FAERS
79	Nonspecific reaction	FAERS: 10		US FAERS
80	Abasia	FAERS: 9		US FAERS
81	Activities of daily living impaired	FAERS: 9		US FAERS
82	Agitation	FAERS: 9		SIDER US FAERS
83	Amnesia	FAERS: 9		US FAERS
84	Back Pain	FAERS: 9 Canada Vigilance: 1	15686794	CTD SIDER Canada Vigilance US FAERS
85	Blood creatinine increased	FAERS: 9 Canada Vigilance: 2		Canada Vigilance OFFSIDES US FAERS
86	Dehydration	FAERS: 9		OFFSIDES US FAERS
87	Extravasation	FAERS: 9		SIDER US FAERS
88	Feeling abnormal	FAERS: 9		SIDER US FAERS
89	Incorrect route of drug administration	FAERS: 9		US FAERS
90	Mental status changes	FAERS: 9		US FAERS
91	Myocardial Infarction	FAERS: 9	View details 1860199 7504440 8237837 8475360 9503180 10226092 10666663 10758969 12658206 12972125 15485438 16402609	CTD US FAERS
92	Overdose	FAERS: 9		US FAERS
93	Product substitution issue	FAERS: 9		US FAERS
94	Pulmonary Embolism	FAERS: 9		US FAERS
95	Therapy non-responder	FAERS: 9 Canada Vigilance: 2		Canada Vigilance US FAERS
96	Transaminases increased	FAERS: 9		OFFSIDES US FAERS
97	nervous system disorder	FAERS: 9		US FAERS
98	Acute Coronary Syndrome	FAERS: 8		OFFSIDES US FAERS
99	Eosinophilic Pneumonia	FAERS: 8		SIDER US FAERS
100	Leukocytosis	FAERS: 8	1360065	CTD US FAERS
101	Lymphoid tissue hyperplasia	FAERS: 8		US FAERS
102	Phlebitis	FAERS: 8 Canada Vigilance: 2	3665388 11794432 18274029	CTD OFFSIDES SIDER Canada Vigilance US FAERS
103	Post procedural complication	FAERS: 8		US FAERS
104	Product use issue	FAERS: 8		US FAERS
105	Respiratory arrest	FAERS: 8		US FAERS
106	Sinus bradycardia	FAERS: 8		SIDER US FAERS
107	Unevaluable event	FAERS: 8		US FAERS
108	treatment failure	FAERS: 8		US FAERS
109	Anaphylactic shock	FAERS: 7		SIDER US FAERS
110	Ascites	FAERS: 7	View details 3941726 3970484 6326931 16284489 17201899 18218290 19826976	CTD US FAERS
111	Atrial tachycardia	FAERS: 7 Canada Vigilance: 1		Canada Vigilance US FAERS
112	Cholestasis	FAERS: 7	View details 1360065 2648965 3190031 3962737 8775470 10086516 28188341	CTD US FAERS
113	Cyanosis	FAERS: 7		OFFSIDES US FAERS
114	Deposit eye	FAERS: 7		US FAERS
115	Electrocardiogram abnormal	FAERS: 7 Canada Vigilance: 1		Canada Vigilance US FAERS
116	Flushing	FAERS: 7 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
117	Injection site extravasation	FAERS: 7		US FAERS
118	No adverse event	FAERS: 7 Canada Vigilance: 1		Canada Vigilance US FAERS
119	Optic Neuritis	FAERS: 7 Canada Vigilance: 1	9855346 10668291	CTD SIDER Canada Vigilance US FAERS
120	Rhabdomyolysis	FAERS: 7	16537817 17615423 20726676	CTD SIDER US FAERS
121	Sepsis	FAERS: 7		US FAERS
122	Shock	FAERS: 7	8522712	CTD SIDER US FAERS
123	Sudden death	FAERS: 7		OFFSIDES US FAERS
124	Swelling	FAERS: 7		US FAERS
125	Abdominal discomfort	FAERS: 6		US FAERS
126	Accidental overdose	FAERS: 6		US FAERS
127	Angina Pectoris	FAERS: 6	4067758 6407452 9924849	CTD SIDER US FAERS
128	Asphyxia	FAERS: 6		US FAERS
129	Blood alkaline phosphatase increased	FAERS: 6		US FAERS
130	Cardiomegaly	FAERS: 6	6723573	CTD US FAERS
131	Cytolytic hepatitis	FAERS: 6		OFFSIDES US FAERS
132	Dysgeusia	FAERS: 6		SIDER US FAERS
133	Epistaxis	FAERS: 6		OFFSIDES US FAERS
134	Eye pain	FAERS: 6		US FAERS
135	Failure to Thrive	FAERS: 6		US FAERS
136	Fibrosis	FAERS: 6	View details 6326931 6706074 17201899 19826976 25163675	CTD SIDER US FAERS
137	Hypogonadism	FAERS: 6		US FAERS
138	Infusion Site Extravasation	FAERS: 6		US FAERS
139	Lung Injury	FAERS: 6	18801087 26477383 26781185	CTD US FAERS
140	Myalgia	FAERS: 6		US FAERS
141	Myoclonus	FAERS: 6	1344923 6890654	CTD US FAERS
142	Pallor	FAERS: 6		US FAERS
143	Pneumothorax	FAERS: 6		US FAERS
144	Rales	FAERS: 6		US FAERS
145	Urinary Incontinence	FAERS: 6		US FAERS
146	Atrioventricular Block	FAERS: 5 Canada Vigilance: 1	View details 854182 2935440 4053541 9924849 11203326 12903882	CTD OFFSIDES SIDER Canada Vigilance US FAERS
147	Cellulitis	FAERS: 5		SIDER US FAERS
148	Chronic respiratory failure	FAERS: 5		US FAERS
149	Delirium	FAERS: 5 Canada Vigilance: 1	View details 3337520 10401472 14609814 20439066	CTD SIDER Canada Vigilance US FAERS
150	Depressed Level of Consciousness	FAERS: 5		US FAERS
151	Diplopia	FAERS: 5 Canada Vigilance: 1		Canada Vigilance US FAERS
152	Disorientation	FAERS: 5		SIDER US FAERS
153	Eye irritation	FAERS: 5		US FAERS
154	Gamma-Glutamyltransferase Increased	FAERS: 5		US FAERS
155	Glaucoma	FAERS: 5		US FAERS
156	Hepatitis	FAERS: 5	6409240	CTD OFFSIDES SIDER US FAERS
157	Hypertensive crisis	FAERS: 5		US FAERS
158	Incorrect dose administered	FAERS: 5		OFFSIDES US FAERS
159	Inflammation	FAERS: 5	21984482 23707191	CTD SIDER US FAERS
160	Multi-organ disorder	FAERS: 5		US FAERS
161	Pancytopenia	FAERS: 5 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
162	Pulmonary congestion	FAERS: 5		US FAERS
163	Pulmonary function test decreased	FAERS: 5 Canada Vigilance: 1		Canada Vigilance US FAERS
164	Rash erythematous	FAERS: 5		US FAERS
165	Respiratory Depression	FAERS: 5		US FAERS
166	Supraventricular tachycardia	FAERS: 5		OFFSIDES US FAERS
167	Temperature intolerance	FAERS: 5		US FAERS
168	Thrombosis	FAERS: 5 Canada Vigilance: 1		Canada Vigilance US FAERS
169	Urticaria	FAERS: 5		SIDER US FAERS
170	Visual disturbance	FAERS: 5		SIDER US FAERS
171	Amaurosis	FAERS: 4		US FAERS
172	Basal cell carcinoma	FAERS: 4		US FAERS
173	Blood glucose increased	FAERS: 4		US FAERS
174	Blood potassium decreased	FAERS: 4		US FAERS
175	Bone pain	FAERS: 4		US FAERS
176	Bronchiectasis	FAERS: 4		US FAERS
177	Bronchospasm	FAERS: 4		SIDER US FAERS
178	Catheter site inflammation	FAERS: 4		US FAERS
179	Cholelithiasis	FAERS: 4		US FAERS
180	Device pacing issue	FAERS: 4		US FAERS
181	Discomfort	FAERS: 4		SIDER US FAERS
182	Disease Progression	FAERS: 4		US FAERS
183	Drug dispensing error	FAERS: 4		US FAERS
184	Dysphonia	FAERS: 4		US FAERS
185	Eczema	FAERS: 4		SIDER US FAERS
186	Electrocardiogram RR interval prolonged	FAERS: 4		US FAERS
187	Electrocardiogram U-wave abnormality	FAERS: 4		US FAERS
188	Eosinophilia	FAERS: 4		SIDER US FAERS
189	Hepatomegaly	FAERS: 4	View details 2026392 3941726 3946978 3970484 6326931 6706074 7514624 7797846 15265979 16149155 28108177	CTD SIDER US FAERS
190	Impaired driving ability	FAERS: 4		US FAERS
191	Influenza	FAERS: 4		US FAERS
192	Infusion site erythema	FAERS: 4		US FAERS
193	Infusion site phlebitis	FAERS: 4		US FAERS
194	Iritis	FAERS: 4		US FAERS
195	Lip swelling	FAERS: 4		US FAERS
196	Nerve injury	FAERS: 4		US FAERS
197	Neuritis	FAERS: 4		US FAERS
198	Neuropathy	FAERS: 4		SIDER US FAERS
199	Photophobia	FAERS: 4	4085515 6291368	CTD SIDER US FAERS
200	Radiculopathy	FAERS: 4		US FAERS
201	Right atrial dilatation	FAERS: 4		US FAERS
202	Septic Shock	FAERS: 4		OFFSIDES US FAERS
203	Somnolence	FAERS: 4		US FAERS
204	Sudden Cardiac Death	FAERS: 4		US FAERS
205	Suicide attempt	FAERS: 4		US FAERS
206	Systemic Inflammatory Response Syndrome	FAERS: 4		US FAERS
207	Thyroid Neoplasm	FAERS: 4		SIDER US FAERS
208	Unresponsive to stimuli	FAERS: 4		OFFSIDES US FAERS
209	Ventricular Dysfunction	FAERS: 4	1452930 9309756	CTD US FAERS
210	Wrong technique in drug usage process	FAERS: 4		US FAERS
211	Acute left ventricular failure	FAERS: 3		US FAERS
212	Altered state of consciousness	FAERS: 3		US FAERS
213	Alveolitis	FAERS: 3		SIDER US FAERS
214	Angioedema	FAERS: 3 Canada Vigilance: 1	11117281 16394364	CTD OFFSIDES SIDER Canada Vigilance US FAERS
215	Anhedonia	FAERS: 3		US FAERS
216	Anorexia	FAERS: 3	6637851	CTD OFFSIDES SIDER US FAERS
217	Atelectasis	FAERS: 3		US FAERS
218	Bedridden	FAERS: 3		US FAERS
219	Blood pressure immeasurable	FAERS: 3		US FAERS
220	Blood sodium decreased	FAERS: 3		US FAERS
221	Blood urea increased	FAERS: 3 Canada Vigilance: 1		Canada Vigilance US FAERS
222	Chills	FAERS: 3		US FAERS
223	Cholecystitis	FAERS: 3		US FAERS
224	Chromaturia	FAERS: 3		US FAERS
225	Cogwheel Rigidity	FAERS: 3		US FAERS
226	Completed Suicide	FAERS: 3		US FAERS
227	Congenital Hypothyroidism	FAERS: 3	7726275	CTD US FAERS
228	Corneal dystrophy	FAERS: 3		US FAERS
229	Depressed mood	FAERS: 3		US FAERS
230	Device malfunction	FAERS: 3		US FAERS
231	Diffuse alveolar damage	FAERS: 3		US FAERS
232	Drug exposure during pregnancy	FAERS: 3		US FAERS
233	Dysgraphia	FAERS: 3		US FAERS
234	Ejection Fraction Decreased	FAERS: 3		US FAERS
235	Emotional distress	FAERS: 3		OFFSIDES SIDER US FAERS
236	Erectile dysfunction	FAERS: 3	2941121	CTD SIDER US FAERS
237	Granuloma	FAERS: 3		SIDER US FAERS
238	Guillain-Barre Syndrome	FAERS: 3		US FAERS
239	Hallucinations, mixed	FAERS: 3		US FAERS
240	Hepatic congestion	FAERS: 3		US FAERS
241	Hypokinesia	FAERS: 3		SIDER US FAERS
242	Infusion site swelling	FAERS: 3		US FAERS
243	Injection site erythema	FAERS: 3		US FAERS
244	Injection site pain	FAERS: 3		US FAERS
245	Interleukin level increased	FAERS: 3		US FAERS
246	Keratitis	FAERS: 3		US FAERS
247	Kounis Syndrome	FAERS: 3		US FAERS
248	Left atrial dilatation	FAERS: 3		US FAERS
249	Leukopenia	FAERS: 3 Canada Vigilance: 1		Canada Vigilance US FAERS
250	Lumbar radiculopathy	FAERS: 3		US FAERS
251	Lung consolidation	FAERS: 3		US FAERS
252	Malabsorption	FAERS: 3		US FAERS
253	Memory impairment	FAERS: 3		US FAERS
254	Mental impairment	FAERS: 3		US FAERS
255	Mixed liver injury	FAERS: 3		US FAERS
256	Musculoskeletal stiffness	FAERS: 3		US FAERS
257	Myopathy	FAERS: 3 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
258	Nocturia	FAERS: 3		US FAERS
259	Obesity	FAERS: 3		US FAERS
260	Ocular icterus	FAERS: 3		OFFSIDES US FAERS
261	Oliguria	FAERS: 3		US FAERS
262	Optic Atrophy	FAERS: 3	1578863	CTD US FAERS
263	Oropharyngeal pain	FAERS: 3		US FAERS
264	Pancreatitis	FAERS: 3	8679841	CTD SIDER US FAERS
265	Pericardial effusion	FAERS: 3	3997294	CTD US FAERS
266	Pharmaceutical product complaint	FAERS: 3		US FAERS
267	Presyncope	FAERS: 3		US FAERS
268	Product quality issue	FAERS: 3		US FAERS
269	Product use in unapproved indication	FAERS: 3		US FAERS
270	Quality of life decreased	FAERS: 3		US FAERS
271	Restrictive pulmonary disease	FAERS: 3		OFFSIDES US FAERS
272	Retinal Detachment	FAERS: 3		US FAERS
273	Skin necrosis	FAERS: 3		SIDER US FAERS
274	Tachyarrhythmia	FAERS: 3		US FAERS
275	Unmasking of previously unidentified disease	FAERS: 3		US FAERS
276	Wrong drug administered	FAERS: 3		US FAERS
277	Acute Lung Injury	FAERS: 2		US FAERS
278	Acute myocardial infarction	FAERS: 2		OFFSIDES US FAERS
279	Acute prerenal failure	FAERS: 2		US FAERS
280	Administration site extravasation	FAERS: 2 Canada Vigilance: 2		Canada Vigilance US FAERS
281	Ammonia increased	FAERS: 2		US FAERS
282	Angiodysplasia	FAERS: 2		US FAERS
283	Anuria	FAERS: 2		OFFSIDES US FAERS
284	Aortic Aneurysm	FAERS: 2		US FAERS
285	Apathy	FAERS: 2		US FAERS
286	Arteriosclerosis	FAERS: 2		US FAERS
287	Arthritis	FAERS: 2		US FAERS
288	Astigmatism	FAERS: 2		US FAERS
289	Atrial thrombosis	FAERS: 2		US FAERS
290	Autoimmune thyroiditis	FAERS: 2		US FAERS
291	Axonal neuropathy	FAERS: 2		US FAERS
292	Back disorder	FAERS: 2		US FAERS
293	Blood potassium increased	FAERS: 2		US FAERS
294	Blood pressure fluctuation	FAERS: 2		US FAERS
295	Blood thyroid stimulating hormone decreased	FAERS: 2		US FAERS
296	Bronchopneumopathy	FAERS: 2		US FAERS
297	Burning sensation	FAERS: 2		US FAERS
298	Butterfly rash	FAERS: 2		US FAERS
299	Cachexia	FAERS: 2		US FAERS
300	Cataract operation complication	FAERS: 2		US FAERS
301	Cerebellar infarction	FAERS: 2		US FAERS
302	Cerebral Infarction	FAERS: 2	2371197	CTD US FAERS
303	Cerebral atrophy	FAERS: 2		OFFSIDES US FAERS
304	Cholestatic liver injury	FAERS: 2		US FAERS
305	Clostridium difficile colitis	FAERS: 2		OFFSIDES US FAERS
306	Cornea verticillata	FAERS: 2		US FAERS
307	Corneal Opacity	FAERS: 2		US FAERS
308	Coronary Artery Disease	FAERS: 2	6973297	CTD US FAERS
309	Crying	FAERS: 2		US FAERS
310	Deep Vein Thrombosis	FAERS: 2		US FAERS
311	Dementia	FAERS: 2		US FAERS
312	Dermatitis	FAERS: 2		SIDER US FAERS
313	Difficult to wean from ventilator	FAERS: 2		US FAERS
314	Disseminated Intravascular Coagulation	FAERS: 2		US FAERS
315	Drug prescribing error	FAERS: 2		US FAERS
316	Dry skin	FAERS: 2		US FAERS
317	Dyspepsia	FAERS: 2 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
318	Electrocardiogram ST-T segment abnormal	FAERS: 2		US FAERS
319	Essential Tremor	FAERS: 2		US FAERS
320	Exposure via breast milk	FAERS: 2		US FAERS
321	Facial Paresis	FAERS: 2		US FAERS
322	Gastrointestinal sounds abnormal	FAERS: 2		US FAERS
323	Head discomfort	FAERS: 2		US FAERS
324	Hepatic necrosis	FAERS: 2		US FAERS
325	Hepatojugular reflux	FAERS: 2		OFFSIDES US FAERS
326	Idiopathic Pulmonary Fibrosis	FAERS: 2 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
327	Idiosyncratic drug reaction	FAERS: 2		US FAERS
328	Infusion site mass	FAERS: 2		US FAERS
329	Infusion site necrosis	FAERS: 2		US FAERS
330	Infusion site pain	FAERS: 2		US FAERS
331	Infusion site rash	FAERS: 2		US FAERS
332	Infusion site reaction	FAERS: 2		US FAERS
333	Injection site inflammation	FAERS: 2		US FAERS
334	Injection site thrombosis	FAERS: 2		US FAERS
335	Intercepted drug dispensing error	FAERS: 2		US FAERS
336	Intestinal Perforation	FAERS: 2		US FAERS
337	Iodine allergy	FAERS: 2		US FAERS
338	Large intestine perforation	FAERS: 2		US FAERS
339	Leukocytoclastic vasculitis	FAERS: 2		US FAERS
340	Leukoencephalopathy	FAERS: 2		US FAERS
341	Liver scan abnormal	FAERS: 2		US FAERS
342	MYELODYSPLASTIC SYNDROME	FAERS: 2		US FAERS
343	Metabolic acidosis	FAERS: 2		US FAERS
344	Monocytosis	FAERS: 2		US FAERS
345	Musculoskeletal discomfort	FAERS: 2		US FAERS
346	Myocarditis	FAERS: 2	17442434	CTD US FAERS
347	Nasopharyngitis	FAERS: 2		US FAERS
348	Neonatal disorder	FAERS: 2		US FAERS
349	Nystagmus	FAERS: 2		US FAERS
350	Papilloma	FAERS: 2		OFFSIDES US FAERS
351	Peripheral arterial occlusive disease	FAERS: 2		US FAERS
352	Peripheral swelling	FAERS: 2		US FAERS
353	Poisoning	FAERS: 2		US FAERS
354	Poor peripheral circulation	FAERS: 2		US FAERS
355	Portal Hypertension	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
356	Product prescribing error	FAERS: 2		US FAERS
357	Prurigo	FAERS: 2		US FAERS
358	Renal cyst	FAERS: 2		US FAERS
359	Sinoatrial Block	FAERS: 2	477263 2099248 4008111	CTD SIDER US FAERS
360	Sinus Arrhythmia	FAERS: 2		US FAERS
361	Sinusitis	FAERS: 2		US FAERS
362	Skin irritation	FAERS: 2		US FAERS
363	Skin lesion	FAERS: 2		US FAERS
364	Soft tissue necrosis	FAERS: 2		US FAERS
365	Splenomegaly	FAERS: 2	3970484 17201899	CTD US FAERS
366	Troponin increased	FAERS: 2		US FAERS
367	Urine iodine increased	FAERS: 2		US FAERS
368	Vasoplegia syndrome	FAERS: 2		US FAERS
369	Water Intoxication	FAERS: 2		US FAERS
370	Abdominal tenderness	FAERS: 1		US FAERS
371	Abscess	FAERS: 1		US FAERS
372	Accidental exposure to product	FAERS: 1		US FAERS
373	Actinic keratosis	FAERS: 1		US FAERS
374	Acute vestibular syndrome	FAERS: 1		US FAERS
375	Adams-Stokes Syndrome	FAERS: 1		US FAERS
376	Administration site reaction	FAERS: 1		US FAERS
377	Ageusia	FAERS: 1		US FAERS
378	Anaphylactoid Reaction	FAERS: 1		SIDER US FAERS
379	Angiogram pulmonary abnormal	FAERS: 1		US FAERS
380	Antibody test positive	FAERS: 1		US FAERS
381	Aphagia	FAERS: 1		US FAERS
382	Aphasia	FAERS: 1		US FAERS
383	Aphonia	FAERS: 1		US FAERS
384	Arterial thrombosis	FAERS: 1		US FAERS
385	Asthenopia	FAERS: 1		US FAERS
386	Asthma	FAERS: 1		US FAERS
387	Atypical pneumonia	FAERS: 1		US FAERS
388	Bacteriuria	FAERS: 1		US FAERS
389	Basal ganglion degeneration	FAERS: 1		US FAERS
390	Bilevel positive airway pressure	FAERS: 1		US FAERS
391	Biopsy bone marrow abnormal	FAERS: 1		US FAERS
392	Biopsy liver abnormal	FAERS: 1		US FAERS
393	Blood albumin decreased	FAERS: 1		US FAERS
394	Blood cholesterol increased	FAERS: 1		US FAERS
395	Blood creatine phosphokinase increased	FAERS: 1		US FAERS
396	Blood gases abnormal	FAERS: 1		US FAERS
397	Blood iron decreased	FAERS: 1		US FAERS
398	Blood lactate dehydrogenase increased	FAERS: 1		US FAERS
399	Blood thyroid stimulating hormone abnormal	FAERS: 1		US FAERS
400	Blood triglycerides increased	FAERS: 1		US FAERS
401	Bone marrow toxicity	FAERS: 1		US FAERS
402	Bradykinesia	FAERS: 1		SIDER US FAERS
403	Bronchiolitis	FAERS: 1		US FAERS
404	Bronchomalacia	FAERS: 1		US FAERS
405	Bronchopneumonia	FAERS: 1		US FAERS
406	Bronchopulmonary disease	FAERS: 1		US FAERS
407	Bronchoscopy abnormal	FAERS: 1		US FAERS
408	Bullous lung disease	FAERS: 1		US FAERS
409	Calcinosis	FAERS: 1		US FAERS
410	Candidiasis	FAERS: 1		US FAERS
411	Carbon dioxide increased	FAERS: 1		US FAERS
412	Cardiac Flutter	FAERS: 1		US FAERS
413	Cardiac Hypertrophy	FAERS: 1		OFFSIDES US FAERS
414	Cardiac Tamponade	FAERS: 1		OFFSIDES US FAERS
415	Cardiac ablation	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
416	Cardioactive drug level above therapeutic	FAERS: 1		US FAERS
417	Cardioactive drug level increased	FAERS: 1		OFFSIDES US FAERS
418	Carotid artery occlusion	FAERS: 1		US FAERS
419	Catatonia	FAERS: 1		US FAERS
420	Catheter related complication	FAERS: 1		US FAERS
421	Catheter related infection	FAERS: 1		US FAERS
422	Catheter site infection	FAERS: 1		US FAERS
423	Cerebral ataxia	FAERS: 1		US FAERS
424	Chemical injury	FAERS: 1		US FAERS
425	Chest wall pain	FAERS: 1		US FAERS
426	Choking sensation	FAERS: 1		OFFSIDES US FAERS
427	Cholangitis	FAERS: 1	6706074	CTD US FAERS
428	Cholecystitis infective	FAERS: 1		US FAERS
429	Chorioretinitis	FAERS: 1		US FAERS
430	Chronotropic incompetence	FAERS: 1		US FAERS
431	Coagulation factor V level decreased	FAERS: 1		US FAERS
432	Cognitive deterioration	FAERS: 1		US FAERS
433	Colectomy	FAERS: 1		US FAERS
434	Colitis	FAERS: 1		US FAERS
435	Colonic Pseudo-Obstruction	FAERS: 1		US FAERS
436	Complication associated with device	FAERS: 1		US FAERS
437	Concomitant disease aggravated	FAERS: 1		US FAERS
438	Continuous Positive Airway Pressure	FAERS: 1		US FAERS
439	Corneal degeneration	FAERS: 1		SIDER US FAERS
440	Corneal pigmentation	FAERS: 1		US FAERS
441	Cutaneous contour deformity	FAERS: 1		US FAERS
442	Deafness	FAERS: 1		US FAERS
443	Device use error	FAERS: 1		US FAERS
444	Diabetes Mellitus	FAERS: 1		US FAERS
445	Disease recurrence	FAERS: 1		US FAERS
446	Diverticulitis	FAERS: 1		US FAERS
447	Documented hypersensitivity to administered product	FAERS: 1		US FAERS
448	Drooling	FAERS: 1		US FAERS
449	Drug abuser	FAERS: 1		US FAERS
450	Drug abuse	FAERS: 1		US FAERS
451	Drug chemical incompatibility	FAERS: 1		US FAERS
452	Drug dose omission	FAERS: 1		US FAERS
453	Drug level below therapeutic	FAERS: 1		US FAERS
454	Drug level decreased	FAERS: 1		US FAERS
455	Drug screen false positive	FAERS: 1		US FAERS
456	Drug screen positive	FAERS: 1		US FAERS
457	Dysarthria	FAERS: 1		US FAERS
458	Dyschromatopsia	FAERS: 1		US FAERS
459	Dysuria	FAERS: 1		US FAERS
460	Early retirement	FAERS: 1		US FAERS
461	Economic problem	FAERS: 1		US FAERS
462	Electrocardiogram ST segment abnormal	FAERS: 1		US FAERS
463	Electrocardiogram ST-T change	FAERS: 1		US FAERS
464	Electrocardiogram change	FAERS: 1		US FAERS
465	Electrolyte imbalance	FAERS: 1		US FAERS
466	Electromechanical dissociation	FAERS: 1		US FAERS
467	Embolism	FAERS: 1		US FAERS
468	Emotional disorder	FAERS: 1		US FAERS
469	Endocarditis	FAERS: 1		OFFSIDES US FAERS
470	Endotracheal intubation complication	FAERS: 1		US FAERS
471	Enuresis	FAERS: 1		US FAERS
472	Epilepsy	FAERS: 1		US FAERS
473	Erythema Multiforme	FAERS: 1		SIDER US FAERS
474	Escherichia test positive	FAERS: 1		US FAERS
475	Exophthalmos	FAERS: 1		US FAERS
476	Expiratory reserve volume abnormal	FAERS: 1		US FAERS
477	Facial wasting	FAERS: 1		US FAERS
478	Female sexual arousal disorder	FAERS: 1		US FAERS
479	Flatulence	FAERS: 1		OFFSIDES US FAERS
480	Fluid overload	FAERS: 1		OFFSIDES US FAERS
481	Food Poisoning	FAERS: 1		US FAERS
482	Food aversion	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
483	Formication	FAERS: 1		US FAERS
484	General physical condition abnormal	FAERS: 1		US FAERS
485	Granuloma Annulare	FAERS: 1		US FAERS
486	Heart alternation	FAERS: 1		US FAERS
487	Heparin-induced thrombocytopenia	FAERS: 1		OFFSIDES US FAERS
488	Hepatic Encephalopathy	FAERS: 1	View details 3941726 3970484 4067758 10193175 17201899	CTD US FAERS
489	Hepatorenal Syndrome	FAERS: 1		US FAERS
490	Herpes simplex meningitis	FAERS: 1		US FAERS
491	Hilar lymphadenopathy	FAERS: 1		US FAERS
492	Hordeolum	FAERS: 1		US FAERS
493	Hunger	FAERS: 1		US FAERS
494	Hypercapnia	FAERS: 1		US FAERS
495	Hypersomnia	FAERS: 1		US FAERS
496	Hypertrophic Cardiomyopathy	FAERS: 1		US FAERS
497	Hypoplastic Left Heart Syndrome	FAERS: 1		US FAERS
498	Hypothalamo-pituitary disorder	FAERS: 1		US FAERS
499	Hypoventilation	FAERS: 1		US FAERS
500	Ileus	FAERS: 1		US FAERS
501	Immobile	FAERS: 1		US FAERS
502	Immune thrombocytopenic purpura	FAERS: 1		US FAERS
503	Immunosuppression	FAERS: 1		US FAERS
504	Impaired gastric emptying	FAERS: 1		US FAERS
505	Impaired quality of life	FAERS: 1		US FAERS
506	Implant site infection	FAERS: 1		US FAERS
507	Incorrect drug administration duration	FAERS: 1		US FAERS
508	Incorrect drug administration rate	FAERS: 1		US FAERS
509	Infusion site cellulitis	FAERS: 1		US FAERS
510	Infusion site infection	FAERS: 1		US FAERS
511	Infusion site inflammation	FAERS: 1		US FAERS
512	Injection site discharge	FAERS: 1		US FAERS
513	Injection site phlebitis	FAERS: 1		US FAERS
514	Injection site warmth	FAERS: 1		US FAERS
515	Intentional misuse	FAERS: 1		US FAERS
516	Intestinal Obstruction	FAERS: 1		OFFSIDES US FAERS
517	Joint Range of Motion Decreased	FAERS: 1		OFFSIDES US FAERS
518	Keratoconus	FAERS: 1		US FAERS
519	Lid lag	FAERS: 1		US FAERS
520	Limb injury	FAERS: 1		US FAERS
521	Limb operation	FAERS: 1		US FAERS
522	Lipoma	FAERS: 1		US FAERS
523	Liver transplant rejection	FAERS: 1		US FAERS
524	Lower respiratory tract infection	FAERS: 1		US FAERS
525	Lung infection pseudomonal	FAERS: 1		US FAERS
526	Lymphadenopathy	FAERS: 1		US FAERS
527	Lymphopenia	FAERS: 1		US FAERS
528	Macular fibrosis	FAERS: 1		US FAERS
529	Malnutrition	FAERS: 1		US FAERS
530	Marasmus	FAERS: 1		US FAERS
531	Maternal exposure during breast feeding	FAERS: 1		US FAERS
532	Maternal exposure during pregnancy	FAERS: 1		US FAERS
533	Maternal exposure timing unspecified	FAERS: 1		US FAERS
534	Mechanical ventilation	FAERS: 1		US FAERS
535	Medical induction of coma	FAERS: 1		US FAERS
536	Migraine with Aura	FAERS: 1		US FAERS
537	Mitral Valve Stenosis	FAERS: 1		US FAERS
538	Mouth swelling	FAERS: 1		US FAERS
539	Multiple allergies	FAERS: 1		US FAERS
540	Multiple drug overdose	FAERS: 1		US FAERS
541	Muscle Rigidity	FAERS: 1		US FAERS
542	Musculoskeletal Pain	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
543	Musculoskeletal chest pain	FAERS: 1		OFFSIDES US FAERS
544	Mycosis Fungoides	FAERS: 1		US FAERS
545	Myopia	FAERS: 1		US FAERS
546	Myosclerosis	FAERS: 1		US FAERS
547	Myositis	FAERS: 1	16159992	CTD US FAERS
548	Nasogastric output abnormal	FAERS: 1		US FAERS
549	Nephrotic Syndrome	FAERS: 1	3813306	CTD US FAERS
550	Neurological decompensation	FAERS: 1		US FAERS
551	Neurological examination abnormal	FAERS: 1		US FAERS
552	Neutropenia	FAERS: 1		SIDER US FAERS
553	No reaction on previous exposure to drug	FAERS: 1		US FAERS
554	Nodule	FAERS: 1		US FAERS
555	Optic nerve infarction	FAERS: 1		US FAERS
556	Oral pain	FAERS: 1		US FAERS
557	Orchitis	FAERS: 1		SIDER US FAERS
558	Osteoma	FAERS: 1		US FAERS
559	Osteoporosis	FAERS: 1		US FAERS
560	Oxygen saturation abnormal	FAERS: 1		US FAERS
561	Oxygen supplementation	FAERS: 1		US FAERS
562	PCO2 decreased	FAERS: 1		US FAERS
563	PO2 abnormal	FAERS: 1		US FAERS
564	PO2 decreased	FAERS: 1		US FAERS
565	Pancreatic Cyst	FAERS: 1		US FAERS
566	Paradoxical drug reaction	FAERS: 1		US FAERS
567	Paranoia	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
568	Paraplegia	FAERS: 1		US FAERS
569	Pathological fracture	FAERS: 1		US FAERS
570	Peripheral artery occlusion	FAERS: 1		US FAERS
571	Peripheral motor neuropathy	FAERS: 1		US FAERS
572	Pharyngolaryngeal Pain	FAERS: 1		US FAERS
573	Physical product label issue	FAERS: 1		US FAERS
574	Placental Insufficiency	FAERS: 1		US FAERS
575	Pleuritic pain	FAERS: 1		US FAERS
576	Polyneuropathy chronic	FAERS: 1		US FAERS
577	Polyuria	FAERS: 1		US FAERS
578	Poor quality sleep	FAERS: 1		US FAERS
579	Post procedural infection	FAERS: 1		US FAERS
580	Potentiating drug interaction	FAERS: 1		US FAERS
581	Pregnancy	FAERS: 1		US FAERS
582	Presbyopia	FAERS: 1		US FAERS
583	Prescribed overdose	FAERS: 1		US FAERS
584	Procedural site reaction	FAERS: 1		US FAERS
585	Product administration error	FAERS: 1		US FAERS
586	Product contamination physical	FAERS: 1		US FAERS
587	Product label confusion	FAERS: 1		US FAERS
588	Product physical issue	FAERS: 1		US FAERS
589	Progressive supranuclear palsy	FAERS: 1		US FAERS
590	Prostatitis Escherichia coli	FAERS: 1		US FAERS
591	Protein total decreased	FAERS: 1		US FAERS
592	Proteinuria	FAERS: 1		US FAERS
593	Pseudomonas test positive	FAERS: 1		US FAERS
594	Psoriasis	FAERS: 1		US FAERS
595	Pulmonary Eosinophilia	FAERS: 1		US FAERS
596	Pulmonary sepsis	FAERS: 1		US FAERS
597	Pulmonary vascular disorder	FAERS: 1		US FAERS
598	Punctate keratitis	FAERS: 1		US FAERS
599	Pyelocaliectasis	FAERS: 1		US FAERS
600	Quadriparesis	FAERS: 1		US FAERS
601	Radiation Pneumonitis	FAERS: 1		US FAERS
602	Rash scaly	FAERS: 1		US FAERS
603	Reaction to drug excipients	FAERS: 1		US FAERS
604	Respiratory muscle weakness	FAERS: 1		US FAERS
605	Respiratory tract congestion	FAERS: 1		US FAERS
606	Restless Legs Syndrome	FAERS: 1		US FAERS
607	Retinal Vein Occlusion	FAERS: 1		US FAERS
608	Retinitis Pigmentosa	FAERS: 1		US FAERS
609	Rheumatic Heart Disease	FAERS: 1		US FAERS
610	Sarcoidosis	FAERS: 1		US FAERS
611	Scan abdomen abnormal	FAERS: 1		US FAERS
612	Scleroderma	FAERS: 1		US FAERS
613	Scotoma	FAERS: 1		SIDER US FAERS
614	Screaming	FAERS: 1		US FAERS
615	Secondary hypothyroidism	FAERS: 1		US FAERS
616	Sense of oppression	FAERS: 1		US FAERS
617	Sinus Tachycardia	FAERS: 1		US FAERS
618	Sinus operation	FAERS: 1		US FAERS
619	Skin Ulcer	FAERS: 1		US FAERS
620	Skin hypertrophy	FAERS: 1		OFFSIDES US FAERS
621	Skin reaction	FAERS: 1		US FAERS
622	Somatostatin receptor scan abnormal	FAERS: 1		US FAERS
623	Squamous cell carcinoma of skin	FAERS: 1		US FAERS
624	Stevens-Johnson Syndrome	FAERS: 1	25811541	CTD SIDER US FAERS
625	Stridor	FAERS: 1		US FAERS
626	Sunburn	FAERS: 1		US FAERS
627	Superinfection lung	FAERS: 1		US FAERS
628	Synovitis	FAERS: 1		US FAERS
629	Systolic dysfunction	FAERS: 1		US FAERS
630	Tachyphrenia	FAERS: 1		US FAERS
631	Temperature regulation disorder	FAERS: 1		US FAERS
632	Terminal state	FAERS: 1		US FAERS
633	Therapeutic response changed	FAERS: 1		US FAERS
634	Therapy cessation	FAERS: 1		US FAERS
635	Thyroid atrophy	FAERS: 1		US FAERS
636	Thyrotoxic periodic paralysis	FAERS: 1		US FAERS
637	Tinnitus	FAERS: 1		SIDER US FAERS
638	Tracheomalacia	FAERS: 1		US FAERS
639	Ulcer	FAERS: 1		US FAERS
640	Urinary Retention	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
641	Vascular purpura	FAERS: 1		US FAERS
642	Vasculitis	FAERS: 1	8038483	CTD SIDER US FAERS
643	Venous thrombosis limb	FAERS: 1		US FAERS
644	Ventricular Flutter	FAERS: 1	7398728	CTD US FAERS
645	Ventricular arrhythmia	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
646	Ventricular hypokinesia	FAERS: 1		OFFSIDES US FAERS
647	Viral pericarditis	FAERS: 1		US FAERS
648	Viral upper respiratory tract infection	FAERS: 1		US FAERS
649	Wheelchair user	FAERS: 1		US FAERS
650	White blood cell count decreased	FAERS: 1		US FAERS
651	Wrong technique in product usage process	FAERS: 1		US FAERS
652	Xanthopsia	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
653	Xerophthalmia	FAERS: 1		US FAERS
654	Acanthosis			OFFSIDES
655	Acidosis		14559139	CTD
656	Acquired keratoderma			SIDER
657	Agranulocytosis			SIDER
658	Akinesia			SIDER
659	Alcoholic Intoxication			OFFSIDES
660	Amputation			OFFSIDES
661	Anemia, Hemolytic		1759074	CTD
662	Anemia		10863591 19015056	CTD
663	Anorectal discomfort			OFFSIDES
664	Anoxia			OFFSIDES
665	Anoxic Encephalopathy			OFFSIDES
666	Atherosclerosis			OFFSIDES
667	Aura			OFFSIDES
668	Autoimmune Diseases		17442434	CTD
669	Azotemia		16537817	CTD
670	Basal Ganglia Diseases		87654 9915382	CTD
671	Blood Coagulation Disorders		19483382	CTD
672	Blood albumin increased			OFFSIDES
673	Blood cholesterol			OFFSIDES
674	Blood creatine phosphokinase MB increased			OFFSIDES
675	Blood sodium			OFFSIDES
676	Body Temperature			OFFSIDES
677	Bone marrow depression			SIDER
678	Bone marrow granuloma			SIDER
679	Brain Diseases		3611965	CTD
680	Bundle-Branch Block		1823899	CTD
681	Cardiac valve abscess			OFFSIDES
682	Cardiomyopathies		2648965 7573102 10410811	CTD
683	Cardiomyopathy dilated with Woolly hair and keratoderma		21193976	CTD
684	Cardiomyopathy, Dilated		15710769 19225199	CTD
685	Cardiotoxicity		26259608	CTD OFFSIDES
686	Cardiovascular Diseases		6638439	CTD
687	Carotid Artery Thrombosis		18974383	CTD
688	Catalepsy		9808703	CTD
689	Cerebellar Ataxia		7611956 19265185	CTD SIDER
690	Cerebellar Diseases		2445709 4001701	CTD
691	Chemical and Drug Induced Liver Injury		View details 1479182 1689330 1868505 2026392 2488499 2648965 2941121 3190031 3246320 3395527 3708949 3756313 3946978 3962737 4067758 6291368 6706074 7797846 8491409 8744394 9446068 9594610 9660045 10193175 10395125 11171458 12069701 12208392 12402666 12506529 12848097 14559139 15265979 15799034 16149155 17201899 17487265 17939344 18218290 19826976 20175957 21984482 22258563 22331495 23042730 24014644 24085192 24535564 25448281 25663337 25900201 25934330 26477383 26946349 27485346 27765674 28069987 28437613	CTD
692	Chemical and Drug Induced Liver Injury, Chronic		16284489	CTD
693	Cholangiolitis			OFFSIDES
694	Chronic Obstructive Airway Disease			OFFSIDES
695	Chronic anxiety			SIDER
696	Chronic liver disease			SIDER
697	Clostridium colitis			OFFSIDES
698	Confabulation			OFFSIDES
699	Confusion		2941121	CTD
700	Congenital nystagmus	Canada Vigilance: 1		Canada Vigilance
701	Contusions		4085515	CTD
702	Corneal Diseases		View details 6291368 6685151 7726275 15973627 17201899	CTD
703	Culture positive			OFFSIDES
704	Demyelinating Diseases		17939344	CTD
705	Depressive disorder		10533558 18801834	CTD
706	Device capturing issue			SIDER
707	Device related infection			OFFSIDES
708	Diabetes Insipidus		3611965	CTD
709	Diastolic dysfunction			OFFSIDES
710	Distress			SIDER
711	Disturbance in sexual arousal			SIDER
712	Dog Diseases		10863591	CTD
713	Drug Eruptions		1860199 6682367 6685151	CTD
714	Drug administration error			OFFSIDES
715	Drug level fluctuating			OFFSIDES
716	Dyskinesia, Drug-Induced		1344923 3034178	CTD
717	Dyspnea		3799544	CTD
718	Ecchymosis			SIDER
719	Edema		7797846 17201899	CTD
720	Ejection fraction abnormal			OFFSIDES
721	Eosinophilic myocarditis			OFFSIDES
722	Epididymitis		9679920	CTD SIDER
723	Epididymo-orchitis			SIDER
724	Erosive gastritis			OFFSIDES
725	Erysipelas			OFFSIDES
726	Erythema Induratum			OFFSIDES
727	Esophageal and Gastric Varices		6326931 17201899 19826976	CTD
728	Exanthema Subitum			OFFSIDES
729	Exanthema		3158188 9855346	CTD
730	Exfoliative rash			OFFSIDES
731	Extremity contracture			OFFSIDES
732	Extremity necrosis			OFFSIDES
733	Eye Hemorrhage		3827710	CTD
734	Fatty Liver		View details 3946978 3962737 7797846 14986274 16284489 18603402 19826976 21163907 24489787 24535564 25448281 25663337 25900201 28962527	CTD
735	Fetal Diseases		14732753	CTD
736	Fetal Growth Retardation		7726275	CTD
737	Fever		8522712	CTD
738	Foot Ulcer		19423038	CTD
739	Foreign body sensation in eyes			SIDER
740	Gait Disorders, Neurologic		View details 3864421 7611956 7935225 19265185	CTD
741	Gangrene			OFFSIDES
742	Gastrointestinal Diseases		View details 3158188 3271193 6685151 16858166	CTD
743	Gastrointestinal Hemorrhage		19826976	CTD
744	Gastrointestinal Pain			SIDER
745	Glomerulonephritis		4037586	CTD
746	Goiter		7726275	CTD OFFSIDES
747	Granulocytosis			OFFSIDES
748	Granulomatous liver disease			SIDER
749	Gritty feeling in eyes			SIDER
750	Hamman-Rich syndrome			SIDER
751	Headache Disorders		11839867	CTD
752	Heart Block		6736449 7083920	CTD
753	Heart Diseases		1204304 19565059 19714493	CTD
754	Heart failure		View details 1680994 2685081 3303888 3378606 3708949 7539890 7784241 8522712 9636919 9924849 10334423 10666663 11377349 17939344 18334037 19282313	CTD
755	Heat exposure injury			OFFSIDES
756	Hematuria		8555895	CTD
757	Hemorrhage		View details 4085515 6137140 6409240 11076348	CTD
758	Hemosiderosis		18801087	CTD
759	Hepatic granuloma			SIDER
760	Hypercalcemia		6409240	CTD
761	Hypercholesterolemia		8137927 9751232	CTD
762	Hyperkeratosis			OFFSIDES SIDER
763	Hypocomplementaemia			OFFSIDES
764	Hypokalemic periodic paralysis		17178088	CTD
765	Hyponatremia		12000975 12013366 15189547	CTD
766	Hypotension, Orthostatic		3310943	CTD
767	Immunosuppressant drug level			OFFSIDES
768	Implantable defibrillator malfunction			OFFSIDES
769	Incessant ventricular tachycardia			SIDER
770	Incontinence			OFFSIDES
771	Increased tendency to bruise			SIDER
772	Induration			SIDER
773	Injection Site Reaction			SIDER
774	Intracranial Hypertension		4017601 15586652	CTD
775	Jaundice, Obstructive		7514624 8775470	CTD
776	Joint swelling	Canada Vigilance: 1		Canada Vigilance
777	Kidney Failure			OFFSIDES
778	Lens Diseases		15973627	CTD
779	Leukopenia neonatal			OFFSIDES
780	Livedo Reticularis			OFFSIDES
781	Liver Cirrhosis		View details 3941726 3962737 3970484 6326931 7514624 7626301 8436346 9594610 16149155 16284489 17201899 17939344 19565059 20175957	CTD
782	Liver Failure, Acute		View details 1752554 4067758 6323638 7797846	CTD
783	Liver Failure		1689330	CTD
784	Liver diseases		3414648 8522712 8679841	CTD
785	Low density lipoprotein increased	Canada Vigilance: 1		Canada Vigilance
786	Lower respiratory tract infection viral			OFFSIDES
787	Lung Diseases, Interstitial		View details 6291368 6409240 9855346 16858166 17243631 18516814 18753942	CTD
788	Lung diseases		View details 1452930 3158188 3303888 6685151 9515876 11334364 11755612 12587719 18834914 23912912	CTD
789	Lupus Erythematosus, Systemic		10577372 11926860	CTD
790	Medical device complication			OFFSIDES
791	Megacolon			OFFSIDES
792	Mental disorders		1344923 18077897	CTD
793	Metabolic Diseases		16858166	CTD
794	Metatarsalgia			OFFSIDES
795	Mitral valve disease mixed			OFFSIDES
796	Movement Disorders		9080035	CTD
797	Multiple Pulmonary Nodules		3310943	CTD
798	Muscle Weakness		3429219 6326931 17939344	CTD
799	Muscular Atrophy		90132	CTD
800	Mycoses		12754197 17974566	CTD
801	Myocardiac abscess			OFFSIDES
802	Myocardial Ischemia		3625789	CTD
803	Myocardial Stunning		16180181	CTD
804	Myocardial fibrosis			OFFSIDES
805	Myxedema		20635749	CTD
806	Necrosis		View details 2590102 11334364 17487265 21078785 21984482	CTD SIDER
807	Neisseria infection			OFFSIDES
808	Nephrogenic Fibrosing Dermopathy			OFFSIDES
809	Neurologic Manifestations		3271193	CTD
810	Neuromuscular Diseases		3997294 10859406	CTD
811	Neuromuscular Manifestations		1668551 6291368	CTD
812	Neurotoxicity Syndromes		19265185	CTD
813	Ocular discomfort			SIDER
814	Olfaction Disorders		17976411	CTD
815	Onycholysis			SIDER
816	Ophthalmoplegia		6890654	CTD
817	Optic Neuropathy, Ischemic		10070533	CTD
818	Orthopnea			OFFSIDES
819	Pacemaker complication			OFFSIDES
820	Papilledema		View details 2972746 3585402 3806132 3827710 10412703 11033139 11076348 12642303 12660594 15586652 15807838 16131795 17894292	CTD
821	Paresthesia		2314744 7935225 10859406	CTD
822	Parkinsonian Disorders		7753074 9808703	CTD
823	Paroxysmal ventricular tachycardia			SIDER
824	Peripheral Nervous System Diseases		View details 90132 203895 1344923 2158741 2842116 2989436 3034178 3303888 6291368 6302557 6305250 6538658 9294958 9855346 16397086 16858166 20175957	CTD
825	Photosensitivity Disorders		View details 2935440 3303888 3983058 4036210 4085515 6613838 7955506 9855346 16858166	CTD
826	Pigmentation Disorders		16461825	CTD
827	Pleurisy			SIDER
828	Polyserositis			SIDER
829	Postmenopausal bleeding			OFFSIDES
830	Postoperative Complications		1958681 11229410 12658206	CTD
831	Pregnancy Complications, Cardiovascular		7726275	CTD
832	Prenatal Exposure Delayed Effects		7726275	CTD
833	Prothrombin level decreased			OFFSIDES
834	Pseudotumor Cerebri		View details 3585402 3711927 3806132 12660594	CTD
835	Psychotic Disorders		18801834	CTD
836	Pustular psoriasis			SIDER
837	Reaction gastrointestinal			SIDER
838	Renal Colic			OFFSIDES
839	Renal Insufficiency		6409240 14559139 19640392	CTD
840	Respiratory Distress Syndrome, Adult		8607661	CTD
841	Respiratory Insufficiency		2842116 3799544 24729111	CTD
842	Retinal Artery Occlusion			OFFSIDES
843	Retinal artery embolism			OFFSIDES
844	Rosacea		2952013	CTD
845	Seizures		7681893	CTD
846	Serositis		3983058	CTD
847	Sick Sinus Syndrome		6409240 7148661	CTD
848	Sigmoiditis			OFFSIDES
849	Sinus Arrest, Cardiac		View details 3776867 3954116 3966317 6799078	CTD
850	Skin Diseases, Vascular		7955506 8038483 11755612	CTD
851	Skin Induration			OFFSIDES
852	Skin laceration			OFFSIDES
853	Skin tightness			OFFSIDES
854	Sleep Wake Disorders		6613838	CTD
855	Solar dermatitis			SIDER
856	Spontaneous bruising			SIDER
857	Substance Withdrawal Syndrome		6745293 18801834	CTD
858	Sweating			SIDER
859	Tachycardia, Ectopic Junctional		11229410 14732753	CTD
860	Tachycardia, Reciprocating		6609509 14732753	CTD
861	Tachycardia, Ventricular		View details 1452930 1869328 2685081 2807859 2941121 3122689 3136716 3190031 3303888 3310943 3392238 3417974 3941726 4007880 4036210 4085515 6204284 6291368 6409240 6637851 6695714 6846970 6973297 7125414 7148661 7271519 7509121 7539890 7586313 7631627 7679520 8504503 8522712 8578750 9149614 9380937 9515876 9583467 10217665 10412703 10520795 10666663 10670119 10690307 10756546 11229410 11266201 11326361 11716246 12380775 15138971 15206999 15271008 15792261 16054011 16687421 17117758 17201899 17243631 18334037 19225199 19299810 20370763	CTD
862	Thyroid Diseases		View details 3158188 6637851 6685151 19565059 19731979 26477383	CTD
863	Thyroid Nodule			SIDER
864	Thyrotoxicosis		View details 3592436 6305250 7658748 11716246 12647553 16320682 16556715 16798157 18020914 18334037 18598099 19584973	CTD
865	Tinea cruris			OFFSIDES
866	Torsades de Pointes		View details 710760 1423949 1507842 1743800 1782940 2120306 2690546 2736564 2774388 3609047 3709557 6123639 6137140 6695782 6849241 7056119 7156952 7398728 7628890 7679520 8187370 8230644 8421775 8522712 8628204 8842793 9141970 9309756 9515876 10217665 10392400 10524732 11141163 11266201 11305536 11334843 11733739 11989578 12647553 12678199 12698686 14579055 15132370 15226788 15274812 15792261 15869686 16178046 16449812 16650263 16860604 16884506 17148550 17467628 17523411 17716804 18294935 19358226 19465366 20064605 20455340 20532436	CTD
867	Toxic Epidermal Necrolysis			SIDER
868	Traumatic liver injury			SIDER
869	Vasculitis, Leukocytoclastic, Cutaneous		3983058 7955506 11755612	CTD
870	Vasoplegia		10670119	CTD
871	Venous Thrombosis			SIDER
872	Ventricular Dysfunction, Left		View details 2685081 3303888 7539890 9613163	CTD
873	Vision Disorders		View details 1578863 3158188 6613837 6637851 6725829 10412703 10668291 10680416 15586652 16461825	CTD
874	Vocal Cord Paralysis		10525613	CTD
875	Wolff-Parkinson-White Syndrome		4067758 6780988 6812745	CTD
876	bad taste			SIDER
877	colonoscopy			OFFSIDES

Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141