Naproxen
(CMWTZPSULFXXJA-VIFPVBQESA-N)
Structure
- SMILES
- COc1ccc2c(c1)ccc(c2)[C@@H](C(=O)O)C
- Type(s)
- Approved; Vet_approved
- ATC code(s)
- G02CC02; M01AE02; M01AE52; M01AE56; M02AA12
- Molecular Formula:
- C14H14O3
- Molecular Weight:
- 230.259
- Log P:
- 3.0365
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 46.53
- CAS Number(s):
- 22204-53-1; 26159-31-9
Synonym(s)
1.
Naproxen
2.
Aleve
3.
Anaprox
4.
Methoxypropiocin
5.
Naprosin
6.
Naprosyn
7.
Naproxen Sodium
8.
Proxen
9.
Sodium Naproxenate
10.
Synflex
11.
Naproxenate, Sodium
12.
Sodium, Naproxen
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 3500 Canada Vigilance: 33 | Canada Vigilance US FAERS | |
| 2 | Product use issue | FAERS: 2220 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Therapeutic response unexpected | FAERS: 1040 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Incorrect drug administration duration | FAERS: 705 | US FAERS | |
| 5 | Expired product administered | FAERS: 560 | US FAERS | |
| 6 | No adverse event | FAERS: 492 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Extra dose administered | FAERS: 483 | US FAERS | |
| 8 | Hypersensitivity | FAERS: 413 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 9 | Nausea | FAERS: 372 Canada Vigilance: 18 | 3391111 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 10 | Abdominal discomfort | FAERS: 351 Canada Vigilance: 13 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 11 | Product use in unapproved indication | FAERS: 349 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 12 | Pruritus | FAERS: 336 Canada Vigilance: 17 | Canada Vigilance SIDER US FAERS | |
| 13 | Dizziness | FAERS: 332 Canada Vigilance: 16 | 6882485 16109111 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 14 | Urticaria | FAERS: 332 Canada Vigilance: 20 | 11792017 | CTD SIDER Canada Vigilance US FAERS |
| 15 | Incorrect dose administered | FAERS: 321 | OFFSIDES US FAERS | |
| 16 | Drug effect incomplete | FAERS: 320 | US FAERS | |
| 17 | Medication Error | FAERS: 306 | US FAERS | |
| 18 | Headache | FAERS: 281 Canada Vigilance: 12 | 3391111 7954762 8104438 | CTD SIDER Canada Vigilance US FAERS |
| 19 | Pain | FAERS: 261 Canada Vigilance: 6 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 20 | Vomiting | FAERS: 231 Canada Vigilance: 10 | 3391111 | CTD SIDER Canada Vigilance US FAERS |
| 21 | Intentional product misuse | FAERS: 229 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Dyspepsia | FAERS: 196 Canada Vigilance: 13 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 23 | Wrong technique in product usage process | FAERS: 183 | US FAERS | |
| 24 | Gastric ulcer | FAERS: 175 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 25 | Malaise | FAERS: 163 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 26 | Feeling abnormal | FAERS: 160 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 27 | Somnolence | FAERS: 156 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 28 | Arthralgia | FAERS: 149 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 29 | Accidental exposure to product by child | FAERS: 145 | US FAERS | |
| 30 | Abdominal Pain | FAERS: 140 Canada Vigilance: 15 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 31 | Erythema | FAERS: 134 Canada Vigilance: 9 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 32 | Chest Pain | FAERS: 131 Canada Vigilance: 8 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 33 | Constipation | FAERS: 131 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 34 | Back Pain | FAERS: 129 Canada Vigilance: 3 | 6101782 | CTD Canada Vigilance US FAERS |
| 35 | Poor quality drug administered | FAERS: 127 | US FAERS | |
| 36 | Lip swelling | FAERS: 123 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 37 | Overdose | FAERS: 111 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Throat irritation | FAERS: 105 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 39 | Drug ineffective for unapproved indication | FAERS: 99 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 40 | Inappropriate schedule of drug administration | FAERS: 96 | OFFSIDES US FAERS | |
| 41 | Asthenia | FAERS: 95 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 42 | Fatigue | FAERS: 91 Canada Vigilance: 3 | 6882485 16109111 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 43 | Peripheral swelling | FAERS: 89 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 44 | Anaphylactic shock | FAERS: 86 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 45 | Drug effective for unapproved indication | FAERS: 84 | US FAERS | |
| 46 | Unevaluable event | FAERS: 83 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Circumstance or information capable of leading to medication error | FAERS: 82 | US FAERS | |
| 48 | Palpitations | FAERS: 82 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 49 | Product physical issue | FAERS: 81 | US FAERS | |
| 50 | Swelling | FAERS: 80 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 51 | Ulcer | FAERS: 77 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 52 | Myocardial Infarction | FAERS: 72 Canada Vigilance: 3 | 17255138 18624902 | CTD SIDER Canada Vigilance US FAERS |
| 53 | Adverse event | FAERS: 71 | OFFSIDES US FAERS | |
| 54 | Epistaxis | FAERS: 71 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 55 | Anxiety | FAERS: 70 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 56 | Drug Dependence | FAERS: 69 | US FAERS | |
| 57 | Chest discomfort | FAERS: 68 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Gastritis | FAERS: 68 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 59 | Product quality issue | FAERS: 66 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 60 | Tinnitus | FAERS: 65 Canada Vigilance: 6 | 9819544 16109111 | CTD SIDER Canada Vigilance US FAERS |
| 61 | Drug prescribing error | FAERS: 64 | US FAERS | |
| 62 | Incorrect product administration duration | FAERS: 62 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 63 | Product prescribing issue | FAERS: 62 | US FAERS | |
| 64 | Joint swelling | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Therapeutic response changed | FAERS: 59 | US FAERS | |
| 66 | Angioedema | FAERS: 58 Canada Vigilance: 5 | 10896977 20689124 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 67 | Product physical consistency issue | FAERS: 55 | US FAERS | |
| 68 | Burning sensation | FAERS: 54 | US FAERS | |
| 69 | Flatulence | FAERS: 51 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 70 | Acute kidney injury | FAERS: 50 Canada Vigilance: 1 | CTD Canada Vigilance US FAERS | |
| 71 | Tremor | FAERS: 50 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 72 | Duodenal Ulcer | FAERS: 45 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 73 | Dysgeusia | FAERS: 45 | US FAERS | |
| 74 | Myalgia | FAERS: 45 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 75 | Choking | FAERS: 44 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 76 | Drug effect delayed | FAERS: 44 | US FAERS | |
| 77 | Accidental exposure | FAERS: 41 | US FAERS | |
| 78 | Hypotension | FAERS: 41 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 79 | Product taste abnormal | FAERS: 41 | US FAERS | |
| 80 | Syncope | FAERS: 41 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 81 | Nervousness | FAERS: 40 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 82 | Cerebrovascular accident | FAERS: 38 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 83 | Product use complaint | FAERS: 38 | US FAERS | |
| 84 | Weight decreased | FAERS: 38 | SIDER US FAERS | |
| 85 | Diverticulitis | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 86 | Blood urine present | FAERS: 35 | US FAERS | |
| 87 | Rash erythematous | FAERS: 35 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 88 | Cardiac Arrest | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 89 | Arthritis | FAERS: 33 Canada Vigilance: 1 | CTD Canada Vigilance US FAERS | |
| 90 | Poor quality product administered | FAERS: 33 | US FAERS | |
| 91 | Wheezing | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 92 | Asthma | FAERS: 32 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 93 | Blood glucose increased | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 94 | Discomfort | FAERS: 31 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 95 | Intestinal Perforation | FAERS: 31 | US FAERS | |
| 96 | Wrong technique in drug usage process | FAERS: 30 | US FAERS | |
| 97 | Toothache | FAERS: 29 | US FAERS | |
| 98 | Toxicity to various agents | FAERS: 29 | US FAERS | |
| 99 | Chills | FAERS: 27 Canada Vigilance: 5 | 3391111 | CTD SIDER Canada Vigilance US FAERS |
| 100 | Foreign body trauma | FAERS: 27 | US FAERS | |
| 101 | Intentional product use issue | FAERS: 27 | US FAERS | |
| 102 | Intestinal Obstruction | FAERS: 27 | US FAERS | |
| 103 | Oropharyngeal pain | FAERS: 27 | OFFSIDES SIDER US FAERS | |
| 104 | Vertigo | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 105 | Dehydration | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 106 | Product package associated injury | FAERS: 26 | US FAERS | |
| 107 | Device ineffective | FAERS: 25 | US FAERS | |
| 108 | Drug screen positive | FAERS: 25 | US FAERS | |
| 109 | Flushing | FAERS: 25 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 110 | Metabolic acidosis | FAERS: 25 | OFFSIDES SIDER US FAERS | |
| 111 | Alopecia | FAERS: 24 | SIDER US FAERS | |
| 112 | Drug toxicity | FAERS: 24 | US FAERS | |
| 113 | Dysuria | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 114 | Product packaging issue | FAERS: 24 | US FAERS | |
| 115 | Thrombocytopenia | FAERS: 24 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 116 | Drug exposure during pregnancy | FAERS: 23 | US FAERS | |
| 117 | Epigastric discomfort | FAERS: 23 | US FAERS | |
| 118 | Failure of child resistant mechanism for pharmaceutical product | FAERS: 23 | US FAERS | |
| 119 | Stevens-Johnson Syndrome | FAERS: 23 | 25811541 | CTD SIDER US FAERS |
| 120 | Foreign body in respiratory tract | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 121 | Renal pain | FAERS: 22 | SIDER US FAERS | |
| 122 | Chromaturia | FAERS: 21 | US FAERS | |
| 123 | Product size issue | FAERS: 21 | US FAERS | |
| 124 | Suicide attempt | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 125 | Tachycardia | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 126 | Therapeutic product effect incomplete | FAERS: 21 | US FAERS | |
| 127 | Accidental exposure to product | FAERS: 20 | US FAERS | |
| 128 | Drug administration error | FAERS: 20 | US FAERS | |
| 129 | Feeling jittery | FAERS: 20 | US FAERS | |
| 130 | Gastrointestinal ulcer | FAERS: 20 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 131 | Inappropriate Prescribing | FAERS: 20 | US FAERS | |
| 132 | Musculoskeletal stiffness | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 133 | Atrial Fibrillation | FAERS: 19 | US FAERS | |
| 134 | Lethargy | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 135 | Accidental overdose | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 136 | Acute myocardial infarction | FAERS: 18 | OFFSIDES US FAERS | |
| 137 | Pharmaceutical product complaint | FAERS: 18 | US FAERS | |
| 138 | Pneumonia | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 139 | Product leakage | FAERS: 18 | US FAERS | |
| 140 | Agitation | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 141 | Dysarthria | FAERS: 17 | US FAERS | |
| 142 | Feeling Cold | FAERS: 17 | OFFSIDES US FAERS | |
| 143 | Maternal exposure during pregnancy | FAERS: 17 | US FAERS | |
| 144 | Musculoskeletal Pain | FAERS: 17 | US FAERS | |
| 145 | Pancreatitis | FAERS: 17 | SIDER US FAERS | |
| 146 | Product prescribing error | FAERS: 17 | US FAERS | |
| 147 | Skin lesion | FAERS: 17 | OFFSIDES US FAERS | |
| 148 | Abasia | FAERS: 16 | US FAERS | |
| 149 | Drug administered to patient of inappropriate age | FAERS: 16 | US FAERS | |
| 150 | Kounis Syndrome | FAERS: 16 | US FAERS | |
| 151 | Pre-existing condition improved | FAERS: 16 | US FAERS | |
| 152 | Shock | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 153 | Visual Impairment | FAERS: 16 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 154 | Disorientation | FAERS: 15 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 155 | Drug use for unknown indication | FAERS: 15 | US FAERS | |
| 156 | Oropharyngeal swelling | FAERS: 15 | US FAERS | |
| 157 | Poor quality sleep | FAERS: 15 | US FAERS | |
| 158 | Product substitution issue | FAERS: 15 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 159 | Therapeutic product effective for unapproved indication | FAERS: 15 | US FAERS | |
| 160 | Thrombosis | FAERS: 15 | US FAERS | |
| 161 | Toxic Epidermal Necrolysis | FAERS: 15 | SIDER US FAERS | |
| 162 | Blood creatinine increased | FAERS: 14 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 163 | Eructation | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 164 | Neck Pain | FAERS: 14 | SIDER US FAERS | |
| 165 | Pallor | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 166 | Product label issue | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 167 | Respiratory arrest | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 168 | Skin irritation | FAERS: 14 | US FAERS | |
| 169 | Angina Pectoris | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 170 | Blood urea increased | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 171 | Choking sensation | FAERS: 13 | OFFSIDES US FAERS | |
| 172 | Gastrointestinal Pain | FAERS: 13 | SIDER US FAERS | |
| 173 | Memory impairment | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 174 | Nephrolithiasis | FAERS: 13 | OFFSIDES SIDER US FAERS | |
| 175 | Peptic Ulcer | FAERS: 13 Canada Vigilance: 1 | 16897817 | CTD SIDER Canada Vigilance US FAERS |
| 176 | Retching | FAERS: 13 | US FAERS | |
| 177 | Tongue discomfort | FAERS: 13 | US FAERS | |
| 178 | Apparent death | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 179 | Cold sweat | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 180 | Deafness | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 181 | Mouth swelling | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 182 | Patient dissatisfaction with treatment | FAERS: 12 | US FAERS | |
| 183 | Purpura | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 184 | Blindness | FAERS: 11 | US FAERS | |
| 185 | Completed Suicide | FAERS: 11 | US FAERS | |
| 186 | Eye irritation | FAERS: 11 | US FAERS | |
| 187 | Hypoxia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 188 | Respiratory distress | FAERS: 11 | SIDER US FAERS | |
| 189 | Sepsis | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 190 | Stomatitis | FAERS: 11 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 191 | jaundice | FAERS: 11 | 3814977 | CTD SIDER US FAERS |
| 192 | Device use issue | FAERS: 10 | US FAERS | |
| 193 | Drug dispensing error | FAERS: 10 | US FAERS | |
| 194 | Inflammation | FAERS: 10 | 3291741 19517896 | CTD SIDER US FAERS |
| 195 | Limb discomfort | FAERS: 10 | OFFSIDES US FAERS | |
| 196 | Menorrhagia | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 197 | Product difficult to swallow | FAERS: 10 | US FAERS | |
| 198 | Productive Cough | FAERS: 10 | OFFSIDES US FAERS | |
| 199 | Sciatica | FAERS: 10 | US FAERS | |
| 200 | Thirst | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 201 | Urinary tract infection | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 202 | Wrong drug administered | FAERS: 10 | US FAERS | |
| 203 | Diverticulum | FAERS: 9 | US FAERS | |
| 204 | Dysphonia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 205 | Expired drug administered | FAERS: 9 | US FAERS | |
| 206 | Exposure during breast feeding | FAERS: 9 | US FAERS | |
| 207 | Histiocytosis haematophagic | FAERS: 9 | US FAERS | |
| 208 | Incoherent | FAERS: 9 | US FAERS | |
| 209 | Intercepted drug prescribing error | FAERS: 9 | US FAERS | |
| 210 | Intracranial Aneurysm | FAERS: 9 | US FAERS | |
| 211 | Oropharyngeal discomfort | FAERS: 9 | SIDER US FAERS | |
| 212 | Perforated ulcer | FAERS: 9 | US FAERS | |
| 213 | Product closure removal difficult | FAERS: 9 | US FAERS | |
| 214 | Product contamination physical | FAERS: 9 | US FAERS | |
| 215 | Pulmonary Embolism | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 216 | Allergy to chemicals | FAERS: 8 | US FAERS | |
| 217 | Blood count abnormal | FAERS: 8 | OFFSIDES US FAERS | |
| 218 | Bone pain | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 219 | Drug screen false positive | FAERS: 8 | US FAERS | |
| 220 | Eosinophilia | FAERS: 8 | 16514397 | CTD SIDER US FAERS |
| 221 | Gastrointestinal perforation | FAERS: 8 | US FAERS | |
| 222 | Gout | FAERS: 8 | US FAERS | |
| 223 | Impaired work ability | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 224 | Musculoskeletal discomfort | FAERS: 8 | SIDER US FAERS | |
| 225 | Non-cardiac chest pain | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 226 | Oral pain | FAERS: 8 | US FAERS | |
| 227 | Radiculopathy | FAERS: 8 | US FAERS | |
| 228 | Regurgitation | FAERS: 8 | US FAERS | |
| 229 | Restlessness | FAERS: 8 | US FAERS | |
| 230 | Stress | FAERS: 8 | OFFSIDES US FAERS | |
| 231 | Amnesia | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 232 | Anger | FAERS: 7 | US FAERS | |
| 233 | Auricular swelling | FAERS: 7 | US FAERS | |
| 234 | Blood sodium decreased | FAERS: 7 | US FAERS | |
| 235 | Cyanosis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 236 | Duodenitis | FAERS: 7 | US FAERS | |
| 237 | Euphoric mood | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 238 | Hyperventilation | FAERS: 7 | US FAERS | |
| 239 | Intentional self-injury | FAERS: 7 | US FAERS | |
| 240 | Nasopharyngitis | FAERS: 7 | OFFSIDES US FAERS | |
| 241 | Oral pruritus | FAERS: 7 | US FAERS | |
| 242 | Pancreatic carcinoma | FAERS: 7 | US FAERS | |
| 243 | Physical product label issue | FAERS: 7 | US FAERS | |
| 244 | Product container issue | FAERS: 7 | US FAERS | |
| 245 | Product storage error | FAERS: 7 | US FAERS | |
| 246 | Restless Legs Syndrome | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 247 | Skin Ulcer | FAERS: 7 | SIDER US FAERS | |
| 248 | Skin reaction | FAERS: 7 | US FAERS | |
| 249 | Urinary Incontinence | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 250 | Anorexia | FAERS: 6 | SIDER US FAERS | |
| 251 | Arthropathy | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 252 | Ascites | FAERS: 6 | US FAERS | |
| 253 | Blood potassium increased | FAERS: 6 | US FAERS | |
| 254 | Depressed Level of Consciousness | FAERS: 6 | US FAERS | |
| 255 | Duodenal ulcer perforation | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 256 | Erosive Duodenitis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 257 | Erythema Multiforme | FAERS: 6 | SIDER US FAERS | |
| 258 | Eye pain | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 259 | Gastrointestinal inflammation | FAERS: 6 | US FAERS | |
| 260 | Incontinence | FAERS: 6 | OFFSIDES US FAERS | |
| 261 | Initial insomnia | FAERS: 6 | US FAERS | |
| 262 | Intentional drug misuse | FAERS: 6 | OFFSIDES US FAERS | |
| 263 | Lymphadenopathy | FAERS: 6 | SIDER US FAERS | |
| 264 | Musculoskeletal chest pain | FAERS: 6 | OFFSIDES US FAERS | |
| 265 | Pain of skin | FAERS: 6 | US FAERS | |
| 266 | Palmar erythema | FAERS: 6 | US FAERS | |
| 267 | Petechiae | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 268 | Product coating issue | FAERS: 6 | US FAERS | |
| 269 | Product commingling | FAERS: 6 | US FAERS | |
| 270 | Product packaging quantity issue | FAERS: 6 | US FAERS | |
| 271 | Product solubility abnormal | FAERS: 6 | US FAERS | |
| 272 | Proteinuria | FAERS: 6 Canada Vigilance: 1 | 503131 2179759 2764314 | CTD SIDER Canada Vigilance US FAERS |
| 273 | Renal tubular necrosis | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 274 | Sinus Tachycardia | FAERS: 6 | US FAERS | |
| 275 | Sneezing | FAERS: 6 | US FAERS | |
| 276 | Urinary Retention | FAERS: 6 | SIDER US FAERS | |
| 277 | Activities of daily living impaired | FAERS: 5 | US FAERS | |
| 278 | Acute psychosis | FAERS: 5 | US FAERS | |
| 279 | Allergic reaction to excipient | FAERS: 5 | US FAERS | |
| 280 | Aspartate Aminotransferase Increased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 281 | Blood cholesterol increased | FAERS: 5 | US FAERS | |
| 282 | Bradycardia | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 283 | Bronchiectasis | FAERS: 5 | US FAERS | |
| 284 | Cardiac discomfort | FAERS: 5 | US FAERS | |
| 285 | Contraindicated product administered | FAERS: 5 | US FAERS | |
| 286 | Crying | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 287 | Drug abuse | FAERS: 5 | US FAERS | |
| 288 | Dry skin | FAERS: 5 | SIDER US FAERS | |
| 289 | Ear discomfort | FAERS: 5 | OFFSIDES US FAERS | |
| 290 | Economic problem | FAERS: 5 | US FAERS | |
| 291 | Emotional distress | FAERS: 5 | OFFSIDES US FAERS | |
| 292 | Hallucinations, mixed | FAERS: 5 | US FAERS | |
| 293 | Hemiplegia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 294 | Hunger | FAERS: 5 | US FAERS | |
| 295 | Incorrect product storage | FAERS: 5 | US FAERS | |
| 296 | Increased tendency to bruise | FAERS: 5 | US FAERS | |
| 297 | Infection | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 298 | Influenza | FAERS: 5 | SIDER US FAERS | |
| 299 | Laboratory test interference | FAERS: 5 | US FAERS | |
| 300 | Medical device discomfort | FAERS: 5 | US FAERS | |
| 301 | Medication residue present | FAERS: 5 | US FAERS | |
| 302 | Mental impairment | FAERS: 5 | OFFSIDES US FAERS | |
| 303 | Middle insomnia | FAERS: 5 | US FAERS | |
| 304 | Multiple allergies | FAERS: 5 | US FAERS | |
| 305 | Muscle tightness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 306 | Neuralgia | FAERS: 5 | SIDER US FAERS | |
| 307 | Nocturia | FAERS: 5 | SIDER US FAERS | |
| 308 | Occult blood positive | FAERS: 5 | US FAERS | |
| 309 | Presyncope | FAERS: 5 | US FAERS | |
| 310 | Product container seal issue | FAERS: 5 | US FAERS | |
| 311 | Product label confusion | FAERS: 5 | US FAERS | |
| 312 | Product packaging confusion | FAERS: 5 | US FAERS | |
| 313 | Pseudoporphyria | FAERS: 5 | SIDER US FAERS | |
| 314 | Psoriasis | FAERS: 5 | US FAERS | |
| 315 | Pulmonary Fibrosis | FAERS: 5 | US FAERS | |
| 316 | Rheumatoid Arthritis | FAERS: 5 | US FAERS | |
| 317 | Synovial Cyst | FAERS: 5 | US FAERS | |
| 318 | Therapeutic product effect decreased | FAERS: 5 | US FAERS | |
| 319 | Abdominal rigidity | FAERS: 4 | US FAERS | |
| 320 | Agranulocytosis | FAERS: 4 | SIDER US FAERS | |
| 321 | Altered state of consciousness | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 322 | Aneurysm | FAERS: 4 | US FAERS | |
| 323 | Aortic Aneurysm | FAERS: 4 | US FAERS | |
| 324 | Atrial Flutter | FAERS: 4 | US FAERS | |
| 325 | Blood iron decreased | FAERS: 4 | OFFSIDES US FAERS | |
| 326 | Brain Death | FAERS: 4 | OFFSIDES US FAERS | |
| 327 | Cardiac Flutter | FAERS: 4 | US FAERS | |
| 328 | Cerebral disorder | FAERS: 4 | US FAERS | |
| 329 | Cheilitis | FAERS: 4 | US FAERS | |
| 330 | Chemical burn of gastrointestinal tract | FAERS: 4 | US FAERS | |
| 331 | Cholestasis | FAERS: 4 | SIDER US FAERS | |
| 332 | Cleft Palate | FAERS: 4 | 11489592 | CTD US FAERS |
| 333 | Delirium | FAERS: 4 | US FAERS | |
| 334 | Depressed mood | FAERS: 4 | US FAERS | |
| 335 | Dermatitis | FAERS: 4 | SIDER US FAERS | |
| 336 | Diplopia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 337 | Disseminated Intravascular Coagulation | FAERS: 4 | US FAERS | |
| 338 | Drug resistance | FAERS: 4 | US FAERS | |
| 339 | Ecchymosis | FAERS: 4 | SIDER US FAERS | |
| 340 | Enteritis | FAERS: 4 | US FAERS | |
| 341 | Epilepsy | FAERS: 4 | US FAERS | |
| 342 | Fibromyalgia | FAERS: 4 | US FAERS | |
| 343 | Fixed eruption | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 344 | Flank Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 345 | Gastroenteritis | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 346 | Gastrointestinal mucosal disorder | FAERS: 4 | US FAERS | |
| 347 | Glycosuria | FAERS: 4 | SIDER US FAERS | |
| 348 | Guillain-Barre Syndrome | FAERS: 4 | US FAERS | |
| 349 | Head discomfort | FAERS: 4 | US FAERS | |
| 350 | Heart alternation | FAERS: 4 | US FAERS | |
| 351 | Helicobacter pylori identification test positive | FAERS: 4 | US FAERS | |
| 352 | Hepatomegaly | FAERS: 4 | US FAERS | |
| 353 | Hepatotoxicity | FAERS: 4 | OFFSIDES US FAERS | |
| 354 | Hypersomnia | FAERS: 4 | US FAERS | |
| 355 | Hypoaesthesia facial | FAERS: 4 | OFFSIDES US FAERS | |
| 356 | Hypothyroidism | FAERS: 4 | US FAERS | |
| 357 | Impaired driving ability | FAERS: 4 | OFFSIDES US FAERS | |
| 358 | Inappropriate schedule of product administration | FAERS: 4 | US FAERS | |
| 359 | Incorrect drug administration rate | FAERS: 4 | US FAERS | |
| 360 | Inflammatory marker increased | FAERS: 4 | US FAERS | |
| 361 | Injury asphyxiation | FAERS: 4 | US FAERS | |
| 362 | Intestinal gangrene | FAERS: 4 | US FAERS | |
| 363 | Irritable Bowel Syndrome | FAERS: 4 | US FAERS | |
| 364 | Joint stiffness | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 365 | Laceration | FAERS: 4 | US FAERS | |
| 366 | Maternal exposure timing unspecified | FAERS: 4 | US FAERS | |
| 367 | Metrorrhagia | FAERS: 4 | SIDER US FAERS | |
| 368 | Night sweats | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 369 | Ocular discomfort | FAERS: 4 | US FAERS | |
| 370 | Oropharyngeal blistering | FAERS: 4 | US FAERS | |
| 371 | Ototoxicity | FAERS: 4 | US FAERS | |
| 372 | Paranoia | FAERS: 4 | OFFSIDES US FAERS | |
| 373 | Penile swelling | FAERS: 4 | US FAERS | |
| 374 | Poisoning | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 375 | Product closure issue | FAERS: 4 | US FAERS | |
| 376 | Product expiration date issue | FAERS: 4 | US FAERS | |
| 377 | Product lot number issue | FAERS: 4 | US FAERS | |
| 378 | Product packaging difficult to open | FAERS: 4 | US FAERS | |
| 379 | Respiratory Failure | FAERS: 4 | OFFSIDES US FAERS | |
| 380 | Serum sickness-like reaction | FAERS: 4 | US FAERS | |
| 381 | Similar reaction on previous exposure to drug | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 382 | Sinusitis | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 383 | Skin hypertrophy | FAERS: 4 | OFFSIDES US FAERS | |
| 384 | Skin tightness | FAERS: 4 | US FAERS | |
| 385 | Sunburn | FAERS: 4 | SIDER US FAERS | |
| 386 | Therapeutic product effect delayed | FAERS: 4 | US FAERS | |
| 387 | Therapeutic product effect variable | FAERS: 4 | US FAERS | |
| 388 | Therapeutic product ineffective | FAERS: 4 | US FAERS | |
| 389 | Tongue pruritus | FAERS: 4 | US FAERS | |
| 390 | Visual disturbance | FAERS: 4 | SIDER US FAERS | |
| 391 | Wrong product administered | FAERS: 4 | US FAERS | |
| 392 | Abscess | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 393 | Accidental drug intake by child | FAERS: 3 | US FAERS | |
| 394 | Acne | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 395 | Alanine Aminotransferase Increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 396 | Amniotic Band Syndrome | FAERS: 3 | US FAERS | |
| 397 | Anencephaly | FAERS: 3 | US FAERS | |
| 398 | Anophthalmos | FAERS: 3 | US FAERS | |
| 399 | Aphagia | FAERS: 3 | US FAERS | |
| 400 | Blood alkaline phosphatase increased | FAERS: 3 | US FAERS | |
| 401 | Blood blister | FAERS: 3 | US FAERS | |
| 402 | Blood glucose decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 403 | Blood pressure immeasurable | FAERS: 3 | US FAERS | |
| 404 | Bronchospasm | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 405 | Cachexia | FAERS: 3 | US FAERS | |
| 406 | Callus formation delayed | FAERS: 3 | US FAERS | |
| 407 | Cardiac Death | FAERS: 3 | US FAERS | |
| 408 | Cataract | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 409 | Cellulitis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 410 | Craniorachischisis | FAERS: 3 | US FAERS | |
| 411 | Craniosynostosis | FAERS: 3 | US FAERS | |
| 412 | Diabetes Mellitus | FAERS: 3 | SIDER US FAERS | |
| 413 | Diaphragmatic Hernia | FAERS: 3 | US FAERS | |
| 414 | Drooling | FAERS: 3 | US FAERS | |
| 415 | Drug effect variable | FAERS: 3 | US FAERS | |
| 416 | Eczema | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 417 | Electrolyte imbalance | FAERS: 3 | US FAERS | |
| 418 | Encephalocele | FAERS: 3 | US FAERS | |
| 419 | Epidermal necrosis | FAERS: 3 | US FAERS | |
| 420 | Fixed drug eruption | FAERS: 3 | SIDER US FAERS | |
| 421 | Fluid overload | FAERS: 3 | US FAERS | |
| 422 | Formication | FAERS: 3 | OFFSIDES US FAERS | |
| 423 | Gait inability | FAERS: 3 | US FAERS | |
| 424 | Gastrointestinal motility disorder | FAERS: 3 | US FAERS | |
| 425 | Gastroschisis | FAERS: 3 | US FAERS | |
| 426 | General physical health deterioration | FAERS: 3 | OFFSIDES US FAERS | |
| 427 | Genital rash | FAERS: 3 | US FAERS | |
| 428 | Glossitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 429 | Helicobacter test positive | FAERS: 3 | US FAERS | |
| 430 | Hemiparesis | FAERS: 3 | OFFSIDES US FAERS | |
| 431 | Hydrocephalus | FAERS: 3 | US FAERS | |
| 432 | Hypometabolism | FAERS: 3 | US FAERS | |
| 433 | Hypophagia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 434 | Hypoplastic Left Heart Syndrome | FAERS: 3 | US FAERS | |
| 435 | Hypospadias | FAERS: 3 | OFFSIDES US FAERS | |
| 436 | Impatience | FAERS: 3 | US FAERS | |
| 437 | Incorrect route of drug administration | FAERS: 3 | US FAERS | |
| 438 | Intercepted medication error | FAERS: 3 | US FAERS | |
| 439 | Intestinal Atresia | FAERS: 3 | US FAERS | |
| 440 | Leukocytoclastic vasculitis | FAERS: 3 | US FAERS | |
| 441 | Leukopenia | FAERS: 3 | SIDER US FAERS | |
| 442 | Liquid product physical issue | FAERS: 3 | US FAERS | |
| 443 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 444 | Lumbar radiculopathy | FAERS: 3 | US FAERS | |
| 445 | Mental status changes | FAERS: 3 | OFFSIDES US FAERS | |
| 446 | Microphthalmos | FAERS: 3 | US FAERS | |
| 447 | Monoplegia | FAERS: 3 | US FAERS | |
| 448 | Muscle strain | FAERS: 3 | OFFSIDES US FAERS | |
| 449 | Nasal discomfort | FAERS: 3 | US FAERS | |
| 450 | Nerve injury | FAERS: 3 | US FAERS | |
| 451 | Nonspecific reaction | FAERS: 3 | US FAERS | |
| 452 | Ocular icterus | FAERS: 3 | OFFSIDES US FAERS | |
| 453 | Oliguria | FAERS: 3 | 2179759 | CTD SIDER US FAERS |
| 454 | Oral mucosal eruption | FAERS: 3 | US FAERS | |
| 455 | Papule | FAERS: 3 | US FAERS | |
| 456 | Persistent left superior vena cava | FAERS: 3 | US FAERS | |
| 457 | Pharyngolaryngeal Pain | FAERS: 3 | US FAERS | |
| 458 | Polyuria | FAERS: 3 | SIDER US FAERS | |
| 459 | Product administration error | FAERS: 3 | US FAERS | |
| 460 | Product contamination microbial | FAERS: 3 | US FAERS | |
| 461 | Product quality control issue | FAERS: 3 | US FAERS | |
| 462 | Product shape issue | FAERS: 3 | US FAERS | |
| 463 | Protein urine present | FAERS: 3 | SIDER US FAERS | |
| 464 | Pulmonary Valve Stenosis | FAERS: 3 | US FAERS | |
| 465 | Pyuria | FAERS: 3 | SIDER US FAERS | |
| 466 | Renal Colic | FAERS: 3 | US FAERS | |
| 467 | Renal cyst | FAERS: 3 | OFFSIDES US FAERS | |
| 468 | Septic Shock | FAERS: 3 | US FAERS | |
| 469 | Skin Induration | FAERS: 3 | OFFSIDES US FAERS | |
| 470 | Spina Bifida | FAERS: 3 | US FAERS | |
| 471 | Stridor | FAERS: 3 | OFFSIDES US FAERS | |
| 472 | Therapeutic product ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 473 | Thermal burn | FAERS: 3 | US FAERS | |
| 474 | Throat cancer | FAERS: 3 | US FAERS | |
| 475 | Transaminases increased | FAERS: 3 | US FAERS | |
| 476 | Troponin increased | FAERS: 3 | US FAERS | |
| 477 | Vascular rupture | FAERS: 3 | US FAERS | |
| 478 | Vasculitis | FAERS: 3 | CTD SIDER US FAERS | |
| 479 | Vital functions abnormal | FAERS: 3 | US FAERS | |
| 480 | Abnormal weight gain | FAERS: 2 | US FAERS | |
| 481 | Acute left ventricular failure | FAERS: 2 | US FAERS | |
| 482 | Anaphylactoid Reaction | FAERS: 2 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 483 | Aphasia | FAERS: 2 | US FAERS | |
| 484 | Arterial Injury | FAERS: 2 | US FAERS | |
| 485 | Arteriosclerosis | FAERS: 2 | OFFSIDES US FAERS | |
| 486 | Asphyxia | FAERS: 2 | US FAERS | |
| 487 | Asthenopia | FAERS: 2 | US FAERS | |
| 488 | Back disorder | FAERS: 2 | US FAERS | |
| 489 | Benzodiazepine drug level | FAERS: 2 | US FAERS | |
| 490 | Blood creatine increased | FAERS: 2 | US FAERS | |
| 491 | Blood electrolytes abnormal | FAERS: 2 | US FAERS | |
| 492 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 493 | Body fat disorder | FAERS: 2 | US FAERS | |
| 494 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 495 | Candidiasis | FAERS: 2 | US FAERS | |
| 496 | Cardiac stress test abnormal | FAERS: 2 | US FAERS | |
| 497 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 498 | Cerebral Thrombosis | FAERS: 2 | US FAERS | |
| 499 | Cerebral vasoconstriction | FAERS: 2 | US FAERS | |
| 500 | Cholestatic liver injury | FAERS: 2 | US FAERS | |
| 501 | Colitis | FAERS: 2 | SIDER US FAERS | |
| 502 | Colonic Stenosis | FAERS: 2 | US FAERS | |
| 503 | Complications of maternal exposure to therapeutic drugs | FAERS: 2 | US FAERS | |
| 504 | Coronary Artery Disease | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 505 | Dark circles under eyes | FAERS: 2 | US FAERS | |
| 506 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 507 | Device adhesion issue | FAERS: 2 | US FAERS | |
| 508 | Device malfunction | FAERS: 2 | US FAERS | |
| 509 | Device use error | FAERS: 2 | US FAERS | |
| 510 | Disability | FAERS: 2 | US FAERS | |
| 511 | Drug dose omission | FAERS: 2 | US FAERS | |
| 512 | Drug level increased | FAERS: 2 | US FAERS | |
| 513 | Emergency Care | FAERS: 2 | US FAERS | |
| 514 | Eosinophilic colitis | FAERS: 2 | US FAERS | |
| 515 | Episcleritis | FAERS: 2 | US FAERS | |
| 516 | Erectile dysfunction | FAERS: 2 | OFFSIDES US FAERS | |
| 517 | Excoriation | FAERS: 2 | US FAERS | |
| 518 | Exsanguination | FAERS: 2 | US FAERS | |
| 519 | Extravasation | FAERS: 2 | US FAERS | |
| 520 | Facial Pain | FAERS: 2 | US FAERS | |
| 521 | Gallbladder pain | FAERS: 2 | US FAERS | |
| 522 | Gastrectomy | FAERS: 2 | US FAERS | |
| 523 | Gastric Dilatation | FAERS: 2 | US FAERS | |
| 524 | Gastric mucosal lesion | FAERS: 2 | US FAERS | |
| 525 | Gastrointestinal erosion | FAERS: 2 | US FAERS | |
| 526 | Genital burning sensation | FAERS: 2 | US FAERS | |
| 527 | Gluten sensitivity | FAERS: 2 | US FAERS | |
| 528 | Grip strength decreased | FAERS: 2 | US FAERS | |
| 529 | Hemicephalalgia | FAERS: 2 | US FAERS | |
| 530 | Hyperchlorhydria | FAERS: 2 | US FAERS | |
| 531 | Hypocoagulable state | FAERS: 2 | US FAERS | |
| 532 | Idiopathic urticaria | FAERS: 2 | US FAERS | |
| 533 | Ileal ulcer | FAERS: 2 | US FAERS | |
| 534 | Ileitis | FAERS: 2 | US FAERS | |
| 535 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 536 | Intercepted drug administration error | FAERS: 2 | US FAERS | |
| 537 | Iridocyclitis | FAERS: 2 | US FAERS | |
| 538 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 539 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 540 | Limb injury | FAERS: 2 | US FAERS | |
| 541 | Lip pruritus | FAERS: 2 | US FAERS | |
| 542 | Low birth weight baby | FAERS: 2 | US FAERS | |
| 543 | Lymphopenia | FAERS: 2 | US FAERS | |
| 544 | Macule | FAERS: 2 | US FAERS | |
| 545 | Mallory-Weiss Syndrome | FAERS: 2 | US FAERS | |
| 546 | Medical device site pain | FAERS: 2 | US FAERS | |
| 547 | Medication residue | FAERS: 2 | OFFSIDES US FAERS | |
| 548 | Meningitis | FAERS: 2 | US FAERS | |
| 549 | Micturition frequency decreased | FAERS: 2 | US FAERS | |
| 550 | Mood swings | FAERS: 2 | SIDER US FAERS | |
| 551 | Myocardial fibrosis | FAERS: 2 | US FAERS | |
| 552 | Necrosis | FAERS: 2 | SIDER US FAERS | |
| 553 | Neonatal anuria | FAERS: 2 | US FAERS | |
| 554 | Nephrectomy | FAERS: 2 | US FAERS | |
| 555 | Nephritis | FAERS: 2 | 285374 10870665 | CTD SIDER US FAERS |
| 556 | Neutropenia | FAERS: 2 | 8321735 | CTD US FAERS |
| 557 | Nipple pain | FAERS: 2 | US FAERS | |
| 558 | Oligohydramnios | FAERS: 2 | US FAERS | |
| 559 | Opiates positive | FAERS: 2 | US FAERS | |
| 560 | Optic Neuropathy | FAERS: 2 | US FAERS | |
| 561 | Oral mucosal erythema | FAERS: 2 | US FAERS | |
| 562 | Osteoporosis | FAERS: 2 | US FAERS | |
| 563 | Pancreatic enzymes increased | FAERS: 2 | US FAERS | |
| 564 | Patient-device incompatibility | FAERS: 2 | US FAERS | |
| 565 | Penile blister | FAERS: 2 | US FAERS | |
| 566 | Peritoneal Dialysis | FAERS: 2 | US FAERS | |
| 567 | Photophobia | FAERS: 2 | US FAERS | |
| 568 | Pleuritic pain | FAERS: 2 | US FAERS | |
| 569 | Polyarthritis | FAERS: 2 | US FAERS | |
| 570 | Pregnancy | FAERS: 2 | US FAERS | |
| 571 | Product counterfeit | FAERS: 2 | US FAERS | |
| 572 | Product name confusion | FAERS: 2 | US FAERS | |
| 573 | Pulmonary Eosinophilia | FAERS: 2 | SIDER US FAERS | |
| 574 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 575 | Pulmonary thrombosis | FAERS: 2 | US FAERS | |
| 576 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 577 | Reaction to excipient | FAERS: 2 | US FAERS | |
| 578 | Renal Cell Carcinoma | FAERS: 2 | US FAERS | |
| 579 | Renal tubular atrophy | FAERS: 2 | US FAERS | |
| 580 | Ruptured cerebral aneurysm | FAERS: 2 | US FAERS | |
| 581 | Scab | FAERS: 2 | US FAERS | |
| 582 | Single functional kidney | FAERS: 2 | US FAERS | |
| 583 | Sinus bradycardia | FAERS: 2 | OFFSIDES US FAERS | |
| 584 | Sluggishness | FAERS: 2 | US FAERS | |
| 585 | Spondylitis | FAERS: 2 | US FAERS | |
| 586 | Sudden death | FAERS: 2 | US FAERS | |
| 587 | Suspected counterfeit product | FAERS: 2 | US FAERS | |
| 588 | Tension | FAERS: 2 | SIDER US FAERS | |
| 589 | Thecal sac compression | FAERS: 2 | US FAERS | |
| 590 | Therapeutic response delayed | FAERS: 2 | US FAERS | |
| 591 | Therapy cessation | FAERS: 2 | US FAERS | |
| 592 | Trismus | FAERS: 2 | US FAERS | |
| 593 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 594 | Ventricular Dysfunction | FAERS: 2 | US FAERS | |
| 595 | Walking aid user | FAERS: 2 | US FAERS | |
| 596 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 597 | heart rate | FAERS: 2 | US FAERS | |
| 598 | Abdominal mass | FAERS: 1 | US FAERS | |
| 599 | Accidental death | FAERS: 1 | US FAERS | |
| 600 | Acidosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 601 | Adenoid Cystic Carcinoma | FAERS: 1 | US FAERS | |
| 602 | Ageusia | FAERS: 1 | US FAERS | |
| 603 | Alanine aminotransferase abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 604 | Alcohol abuse | FAERS: 1 | SIDER US FAERS | |
| 605 | Allergy to animal | FAERS: 1 | US FAERS | |
| 606 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 607 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 608 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 609 | Anal Fistula | FAERS: 1 | US FAERS | |
| 610 | Analgesia | FAERS: 1 | US FAERS | |
| 611 | Anastomotic ulcer | FAERS: 1 | US FAERS | |
| 612 | Ankylosing spondylitis | FAERS: 1 | US FAERS | |
| 613 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 614 | Apathy | FAERS: 1 | US FAERS | |
| 615 | Aphonia | FAERS: 1 | US FAERS | |
| 616 | Aphthous Stomatitis | FAERS: 1 | SIDER US FAERS | |
| 617 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 618 | Application site pain | FAERS: 1 | US FAERS | |
| 619 | Atelectasis | FAERS: 1 | US FAERS | |
| 620 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 621 | Autoimmune neuropathy | FAERS: 1 | US FAERS | |
| 622 | Bacterial culture positive | FAERS: 1 | US FAERS | |
| 623 | Bedridden | FAERS: 1 | US FAERS | |
| 624 | Biliary Colic | FAERS: 1 | US FAERS | |
| 625 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 626 | Bladder pain | FAERS: 1 | SIDER US FAERS | |
| 627 | Bladder spasm | FAERS: 1 | US FAERS | |
| 628 | Blister rupture | FAERS: 1 | US FAERS | |
| 629 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 630 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 631 | Blood glucose abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 632 | Blood magnesium abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 633 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 634 | Blood pH increased | FAERS: 1 | US FAERS | |
| 635 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 636 | Blood pressure ambulatory decreased | FAERS: 1 | US FAERS | |
| 637 | Blood viscosity abnormal | FAERS: 1 | US FAERS | |
| 638 | Bone swelling | FAERS: 1 | US FAERS | |
| 639 | Bradykinesia | FAERS: 1 | US FAERS | |
| 640 | Breast tenderness | FAERS: 1 | US FAERS | |
| 641 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 642 | Bronchial irritation | FAERS: 1 | US FAERS | |
| 643 | Bronchitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 644 | Bursitis | FAERS: 1 | OFFSIDES US FAERS | |
| 645 | Cancer Pain | FAERS: 1 | US FAERS | |
| 646 | Candida sepsis | FAERS: 1 | US FAERS | |
| 647 | Carcinoma | FAERS: 1 | SIDER US FAERS | |
| 648 | Cardiac ablation | FAERS: 1 | US FAERS | |
| 649 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 650 | Cardiac imaging procedure abnormal | FAERS: 1 | US FAERS | |
| 651 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 652 | Carotid pulse abnormal | FAERS: 1 | US FAERS | |
| 653 | Caustic injury | FAERS: 1 | US FAERS | |
| 654 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 655 | Chemical burn of respiratory tract | FAERS: 1 | US FAERS | |
| 656 | Chest wall pain | FAERS: 1 | US FAERS | |
| 657 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 658 | Cholelithiasis | FAERS: 1 | SIDER US FAERS | |
| 659 | Circumstance or information capable of leading to device use error | FAERS: 1 | US FAERS | |
| 660 | Clubbing | FAERS: 1 | US FAERS | |
| 661 | Coagulation test abnormal | FAERS: 1 | US FAERS | |
| 662 | Colonoscopy abnormal | FAERS: 1 | US FAERS | |
| 663 | Concomitant disease progression | FAERS: 1 | US FAERS | |
| 664 | Congenital neuropathy | FAERS: 1 | US FAERS | |
| 665 | Congenital renal disorder | FAERS: 1 | US FAERS | |
| 666 | Conjunctivitis | FAERS: 1 | SIDER US FAERS | |
| 667 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 668 | Corneal Perforation | FAERS: 1 | US FAERS | |
| 669 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 670 | Culture urine positive | FAERS: 1 | US FAERS | |
| 671 | Cystitis | FAERS: 1 | SIDER US FAERS | |
| 672 | Cytomegalovirus gastrointestinal infection | FAERS: 1 | US FAERS | |
| 673 | Deformity | FAERS: 1 | US FAERS | |
| 674 | Dermatitis Herpetiformis | FAERS: 1 | US FAERS | |
| 675 | Device related infection | FAERS: 1 | US FAERS | |
| 676 | Diabetic Nephropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 677 | Diaphragmalgia | FAERS: 1 | US FAERS | |
| 678 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 679 | Diverticular fistula | FAERS: 1 | US FAERS | |
| 680 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 681 | Drug abuser | FAERS: 1 | OFFSIDES US FAERS | |
| 682 | Drug effect faster than expected | FAERS: 1 | US FAERS | |
| 683 | Drug level above therapeutic | FAERS: 1 | US FAERS | |
| 684 | Drug screen negative | FAERS: 1 | US FAERS | |
| 685 | Drug withdrawal headache | FAERS: 1 | OFFSIDES US FAERS | |
| 686 | Duodenal perforation | FAERS: 1 | US FAERS | |
| 687 | Dysgraphia | FAERS: 1 | US FAERS | |
| 688 | Dysphemia | FAERS: 1 | US FAERS | |
| 689 | Dysplasia | FAERS: 1 | US FAERS | |
| 690 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 691 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 692 | Enlarged uvula | FAERS: 1 | US FAERS | |
| 693 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 694 | Enzyme level increased | FAERS: 1 | US FAERS | |
| 695 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 696 | Epinephrine decreased | FAERS: 1 | US FAERS | |
| 697 | Epinephrine increased | FAERS: 1 | US FAERS | |
| 698 | Erection increased | FAERS: 1 | US FAERS | |
| 699 | Escherichia infection | FAERS: 1 | US FAERS | |
| 700 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 701 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 702 | Eye Redness | FAERS: 1 | US FAERS | |
| 703 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 704 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 705 | Eyelid rash | FAERS: 1 | US FAERS | |
| 706 | Failure of implant | FAERS: 1 | US FAERS | |
| 707 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 708 | Fibrin increased | FAERS: 1 | US FAERS | |
| 709 | Fibrin | FAERS: 1 | US FAERS | |
| 710 | Fibrosis | FAERS: 1 | 10356706 15198071 | CTD US FAERS |
| 711 | Food Allergy | FAERS: 1 | US FAERS | |
| 712 | Foreign body aspiration | FAERS: 1 | US FAERS | |
| 713 | Fracture | FAERS: 1 | US FAERS | |
| 714 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 715 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 716 | Gangrene | FAERS: 1 | OFFSIDES US FAERS | |
| 717 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 718 | Gastric Fistula | FAERS: 1 | US FAERS | |
| 719 | Gastroduodenitis | FAERS: 1 | US FAERS | |
| 720 | Gastroenterostomy | FAERS: 1 | US FAERS | |
| 721 | Gastrointestinal arteriovenous malformation | FAERS: 1 | US FAERS | |
| 722 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 723 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 724 | Genital erythema | FAERS: 1 | US FAERS | |
| 725 | Genital pain | FAERS: 1 | US FAERS | |
| 726 | Genital swelling | FAERS: 1 | US FAERS | |
| 727 | Gingival erythema | FAERS: 1 | OFFSIDES US FAERS | |
| 728 | Glaucoma | FAERS: 1 | US FAERS | |
| 729 | Glomerulonephritis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 730 | Hepatic necrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 731 | Hepatitis | FAERS: 1 | SIDER US FAERS | |
| 732 | Hydronephrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 733 | Hypergeusia | FAERS: 1 | US FAERS | |
| 734 | Hyperoxaluria | FAERS: 1 | US FAERS | |
| 735 | Hypervigilance | FAERS: 1 | US FAERS | |
| 736 | Hypocapnia | FAERS: 1 | US FAERS | |
| 737 | Hypokinesia | FAERS: 1 | OFFSIDES US FAERS | |
| 738 | Hypoventilation | FAERS: 1 | US FAERS | |
| 739 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 740 | Idiosyncratic drug reaction | FAERS: 1 | US FAERS | |
| 741 | Ileus | FAERS: 1 | US FAERS | |
| 742 | Immobile | FAERS: 1 | US FAERS | |
| 743 | Immunosuppression | FAERS: 1 | US FAERS | |
| 744 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 745 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 746 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 747 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 748 | Infertility | FAERS: 1 | SIDER US FAERS | |
| 749 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 750 | Inhibitory drug interaction | FAERS: 1 | US FAERS | |
| 751 | Intentional device misuse | FAERS: 1 | US FAERS | |
| 752 | Intercapillary glomerulosclerosis | FAERS: 1 | US FAERS | |
| 753 | Intercepted product administration error | FAERS: 1 | US FAERS | |
| 754 | Intercepted product prescribing error | FAERS: 1 | US FAERS | |
| 755 | Intervertebral Disc Degeneration | FAERS: 1 | OFFSIDES US FAERS | |
| 756 | Intestinal resection | FAERS: 1 | US FAERS | |
| 757 | Intestinal transplant | FAERS: 1 | US FAERS | |
| 758 | Joint sprain | FAERS: 1 | OFFSIDES US FAERS | |
| 759 | Lichen Planus | FAERS: 1 | SIDER US FAERS | |
| 760 | Lipase increased | FAERS: 1 | US FAERS | |
| 761 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 762 | Lyme Disease | FAERS: 1 | US FAERS | |
| 763 | Lymphocyte transformation test positive | FAERS: 1 | US FAERS | |
| 764 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 765 | Lymphoma | FAERS: 1 | US FAERS | |
| 766 | Macular degeneration | FAERS: 1 | US FAERS | |
| 767 | Malabsorption | FAERS: 1 | US FAERS | |
| 768 | Medical device pain | FAERS: 1 | US FAERS | |
| 769 | Medication monitoring error | FAERS: 1 | US FAERS | |
| 770 | Medication overuse headache | FAERS: 1 | US FAERS | |
| 771 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 772 | Meniscus injury | FAERS: 1 | US FAERS | |
| 773 | Menstrual discomfort | FAERS: 1 | US FAERS | |
| 774 | Microalbuminuria | FAERS: 1 | US FAERS | |
| 775 | Microbiology test abnormal | FAERS: 1 | US FAERS | |
| 776 | Multiple Pregnancy | FAERS: 1 | US FAERS | |
| 777 | Mydriasis | FAERS: 1 | US FAERS | |
| 778 | Myocardial necrosis marker increased | FAERS: 1 | US FAERS | |
| 779 | Myositis | FAERS: 1 | US FAERS | |
| 780 | Nasal Polyps | FAERS: 1 | SIDER US FAERS | |
| 781 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 782 | Negative thoughts | FAERS: 1 | US FAERS | |
| 783 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 784 | Neonatal respiratory depression | FAERS: 1 | US FAERS | |
| 785 | Neonatal respiratory failure | FAERS: 1 | US FAERS | |
| 786 | Nerve Degeneration | FAERS: 1 | US FAERS | |
| 787 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 788 | Nuchal Rigidity | FAERS: 1 | SIDER US FAERS | |
| 789 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 790 | Obstruction | FAERS: 1 | US FAERS | |
| 791 | Optic Neuritis | FAERS: 1 | SIDER US FAERS | |
| 792 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 793 | Pain prophylaxis | FAERS: 1 | US FAERS | |
| 794 | Pancytopenia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 795 | Paraesthesia of genital male | FAERS: 1 | US FAERS | |
| 796 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 797 | Pelvic mass | FAERS: 1 | US FAERS | |
| 798 | Penile exfoliation | FAERS: 1 | US FAERS | |
| 799 | Peptic Ulcer Perforation | FAERS: 1 | US FAERS | |
| 800 | Periodontal infection | FAERS: 1 | US FAERS | |
| 801 | Periorbital contusion | FAERS: 1 | US FAERS | |
| 802 | Peripheral artery thrombosis | FAERS: 1 | US FAERS | |
| 803 | Peritoneal fluid analysis abnormal | FAERS: 1 | US FAERS | |
| 804 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 805 | Pharyngeal swelling | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 806 | Pharyngolaryngeal discomfort | FAERS: 1 | US FAERS | |
| 807 | Piloerection | FAERS: 1 | US FAERS | |
| 808 | Pleurisy | FAERS: 1 | OFFSIDES US FAERS | |
| 809 | Pneumonectomy | FAERS: 1 | US FAERS | |
| 810 | Polydipsia | FAERS: 1 | US FAERS | |
| 811 | Post procedural complication | FAERS: 1 | US FAERS | |
| 812 | Post procedural discharge | FAERS: 1 | US FAERS | |
| 813 | Post-traumatic pain | FAERS: 1 | US FAERS | |
| 814 | Predisposition to disease | FAERS: 1 | US FAERS | |
| 815 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 816 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 817 | Procedural complication | FAERS: 1 | US FAERS | |
| 818 | Product contamination | FAERS: 1 | US FAERS | |
| 819 | Product formulation issue | FAERS: 1 | US FAERS | |
| 820 | Product identification number issue | FAERS: 1 | US FAERS | |
| 821 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 822 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 823 | Protein total increased | FAERS: 1 | US FAERS | |
| 824 | Pseudolymphoma | FAERS: 1 | US FAERS | |
| 825 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 826 | Puncture site discharge | FAERS: 1 | US FAERS | |
| 827 | Purulence | FAERS: 1 | OFFSIDES US FAERS | |
| 828 | Quadruple vessel bypass graft | FAERS: 1 | US FAERS | |
| 829 | Radial pulse decreased | FAERS: 1 | US FAERS | |
| 830 | Radiation associated pain | FAERS: 1 | US FAERS | |
| 831 | Rectal abscess | FAERS: 1 | US FAERS | |
| 832 | Refusal of treatment by relative | FAERS: 1 | US FAERS | |
| 833 | Renal Replacement Therapy | FAERS: 1 | US FAERS | |
| 834 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 835 | Renin increased | FAERS: 1 | US FAERS | |
| 836 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 837 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 838 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 839 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 840 | Rhonchi | FAERS: 1 | US FAERS | |
| 841 | Scleroderma | FAERS: 1 | OFFSIDES US FAERS | |
| 842 | Secondary hypertension | FAERS: 1 | US FAERS | |
| 843 | Secretion discharge | FAERS: 1 | US FAERS | |
| 844 | Self-induced vomiting | FAERS: 1 | US FAERS | |
| 845 | Sense of oppression | FAERS: 1 | US FAERS | |
| 846 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 847 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 848 | Shock symptom | FAERS: 1 | US FAERS | |
| 849 | Silent myocardial infarction | FAERS: 1 | OFFSIDES US FAERS | |
| 850 | Sinus headache | FAERS: 1 | US FAERS | |
| 851 | Snoring | FAERS: 1 | US FAERS | |
| 852 | Somnambulism | FAERS: 1 | US FAERS | |
| 853 | Spinal column stenosis | FAERS: 1 | OFFSIDES US FAERS | |
| 854 | Splenic Rupture | FAERS: 1 | US FAERS | |
| 855 | Spondylosis | FAERS: 1 | US FAERS | |
| 856 | Spontaneous penile erection | FAERS: 1 | US FAERS | |
| 857 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 858 | Suspected product contamination | FAERS: 1 | US FAERS | |
| 859 | Syphilis | FAERS: 1 | US FAERS | |
| 860 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 861 | Systolic hypertension | FAERS: 1 | US FAERS | |
| 862 | Therapeutic product effect prolonged | FAERS: 1 | US FAERS | |
| 863 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 864 | Therapy partial responder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 865 | Tinea cruris | FAERS: 1 | US FAERS | |
| 866 | Tongue blistering | FAERS: 1 | US FAERS | |
| 867 | Transplant | FAERS: 1 | US FAERS | |
| 868 | Transplant evaluation | FAERS: 1 | US FAERS | |
| 869 | Unintentional use for unapproved indication | FAERS: 1 | US FAERS | |
| 870 | Urge Incontinence | FAERS: 1 | US FAERS | |
| 871 | Urinary Tract Pain | FAERS: 1 | US FAERS | |
| 872 | Urine alcohol test positive | FAERS: 1 | US FAERS | |
| 873 | Urine cannabinoids increased | FAERS: 1 | US FAERS | |
| 874 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 875 | Urine output increased | FAERS: 1 | SIDER US FAERS | |
| 876 | Urticaria Pigmentosa | FAERS: 1 | US FAERS | |
| 877 | Uveitis | FAERS: 1 | US FAERS | |
| 878 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 879 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 880 | Vaginal pain | FAERS: 1 | US FAERS | |
| 881 | Vascular procedure complication | FAERS: 1 | US FAERS | |
| 882 | Vein collapse | FAERS: 1 | US FAERS | |
| 883 | Vein pain | FAERS: 1 | US FAERS | |
| 884 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 885 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 886 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 887 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 888 | Wrong dose | FAERS: 1 | US FAERS | |
| 889 | Wrong technique in device usage process | FAERS: 1 | US FAERS | |
| 890 | furuncle | FAERS: 1 | US FAERS | |
| 891 | nervous system disorder | FAERS: 1 | SIDER US FAERS | |
| 892 | Abdominal tenderness | OFFSIDES | ||
| 893 | Abuse | OFFSIDES | ||
| 894 | Acid reflux | OFFSIDES | ||
| 895 | Acute Coronary Syndrome | OFFSIDES SIDER | ||
| 896 | Acute respiratory failure | OFFSIDES | ||
| 897 | Acute sinusitis | OFFSIDES | ||
| 898 | Adenocarcinoma | OFFSIDES | ||
| 899 | Adnexa uteri pain | OFFSIDES | ||
| 900 | Albuminuria | 2203262 | CTD SIDER | |
| 901 | Alcohol poisoning | OFFSIDES | ||
| 902 | Alcoholic Intoxication | OFFSIDES | ||
| 903 | Alkalosis | SIDER | ||
| 904 | Amblyopia | SIDER | ||
| 905 | Amenorrhea | OFFSIDES | ||
| 906 | Androgenetic Alopecia | OFFSIDES | ||
| 907 | Anemia, Hemolytic | 6882485 | CTD | |
| 908 | Anemia | 2787136 | CTD | |
| 909 | Angiodermatitis | SIDER | ||
| 910 | Anhidrosis | OFFSIDES | ||
| 911 | Ankle reconstruction | OFFSIDES | ||
| 912 | Anoxic Encephalopathy | OFFSIDES | ||
| 913 | Anticoagulation drug level below therapeutic | OFFSIDES | ||
| 914 | Anticonvulsant drug level decreased | OFFSIDES | ||
| 915 | Anticonvulsant drug level increased | OFFSIDES | ||
| 916 | Antinuclear antibody increased | OFFSIDES | ||
| 917 | Aortic Valve Stenosis | SIDER | ||
| 918 | Apnea | OFFSIDES | ||
| 919 | Arteriovenous graft thrombosis | OFFSIDES | ||
| 920 | Arthritis, Psoriatic | 3030337 | CTD | |
| 921 | Ataxia | Canada Vigilance: 1 | 2125432 | CTD OFFSIDES Canada Vigilance |
| 922 | Athetosis | OFFSIDES | ||
| 923 | Athletic Injuries | 3305036 | CTD | |
| 924 | Atrioventricular Block | OFFSIDES | ||
| 925 | Automatism | OFFSIDES | ||
| 926 | Azotemia | 503131 7143649 | CTD | |
| 927 | BK virus infection | OFFSIDES | ||
| 928 | Bacterial Infections | 12669766 | CTD | |
| 929 | Basal cell carcinoma | OFFSIDES | ||
| 930 | Biopsy | OFFSIDES | ||
| 931 | Blood Glucose | OFFSIDES | ||
| 932 | Blood alkaline phosphatase abnormal | OFFSIDES | ||
| 933 | Blood alkaline phosphatase | OFFSIDES | ||
| 934 | Blood and lymphatic system disorders | SIDER | ||
| 935 | Blood bicarbonate | OFFSIDES | ||
| 936 | Blood cholesterol | OFFSIDES | ||
| 937 | Blood pressure inadequately controlled | Canada Vigilance: 1 | Canada Vigilance | |
| 938 | Blood triglycerides increased | OFFSIDES | ||
| 939 | Blurred vision | OFFSIDES | ||
| 940 | Bone marrow necrosis | OFFSIDES | ||
| 941 | Bone scan abnormal | OFFSIDES | ||
| 942 | Bone trimming | OFFSIDES | ||
| 943 | Breast Feeding | SIDER | ||
| 944 | Bruxism | OFFSIDES | ||
| 945 | Calcinosis | OFFSIDES | ||
| 946 | Cardiac Tamponade | OFFSIDES | ||
| 947 | Carotid artery occlusion | OFFSIDES | ||
| 948 | Catalepsy | 12369252 | CTD | |
| 949 | Catatonia | 19666045 | CTD | |
| 950 | Cerebral artery stenosis | OFFSIDES | ||
| 951 | Cerebral hypoperfusion | OFFSIDES | ||
| 952 | Cerebrosclerosis | OFFSIDES | ||
| 953 | Cervicobrachial syndrome | OFFSIDES | ||
| 954 | Chemical and Drug Induced Liver Injury | CTD | ||
| 955 | Cholangitis | 16514397 | CTD | |
| 956 | Cholecystitis | SIDER | ||
| 957 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 958 | Chronic sinusitis | SIDER | ||
| 959 | Cicatrix | 10524703 | CTD | |
| 960 | Cognition Disorders | 12110471 | CTD | |
| 961 | Concomitant disease aggravated | Canada Vigilance: 1 | Canada Vigilance | |
| 962 | Congenital heart disease | OFFSIDES | ||
| 963 | Congenital pulmonary hypertension | OFFSIDES | ||
| 964 | Congenital pyelocaliectasis | OFFSIDES | ||
| 965 | Congenital tracheomalacia | OFFSIDES | ||
| 966 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 967 | Corneal Opacity | SIDER | ||
| 968 | Cystitis escherichia | OFFSIDES | ||
| 969 | Debridement | OFFSIDES | ||
| 970 | Demyelination | OFFSIDES | ||
| 971 | Dental caries | OFFSIDES | ||
| 972 | Dependence | OFFSIDES | ||
| 973 | Dependent Personality Disorder | OFFSIDES | ||
| 974 | Dermatitis, Irritant | 21319177 | CTD | |
| 975 | Diabetes | OFFSIDES | ||
| 976 | Diabetes Mellitus, Experimental | 23784744 | CTD | |
| 977 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 978 | Diarrhea | OFFSIDES | ||
| 979 | Disorders of Excessive Somnolence | 16109111 | CTD | |
| 980 | Diverticulosis | OFFSIDES | ||
| 981 | Drowsiness | SIDER | ||
| 982 | Drug Eruptions | 11792017 16514397 20684166 | CTD | |
| 983 | Drug delivery system malfunction | OFFSIDES | ||
| 984 | Dysphasia | OFFSIDES | ||
| 985 | Dysthymic Disorder | OFFSIDES | ||
| 986 | Ear and labyrinth disorders | SIDER | ||
| 987 | Ear tube insertion | OFFSIDES | ||
| 988 | Edema | 3814977 7735198 12269398 | CTD | |
| 989 | Electrocardiogram abnormal | SIDER | ||
| 990 | Emotional disorder | OFFSIDES | ||
| 991 | Endometrial Hyperplasia | OFFSIDES | ||
| 992 | Endometrial hypertrophy | OFFSIDES | ||
| 993 | Endometriosis | 15652904 | CTD | |
| 994 | Enlargement abdomen | SIDER | ||
| 995 | Enterobacter pneumonia | OFFSIDES | ||
| 996 | Enthesopathy | OFFSIDES | ||
| 997 | Epicondylitis | OFFSIDES | ||
| 998 | Epidermolysis Bullosa | SIDER | ||
| 999 | Epigastric pain | SIDER | ||
| 1000 | Erosive gastritis | OFFSIDES | ||
| 1001 | Erythema Nodosum | SIDER | ||
| 1002 | Eschar | OFFSIDES | ||
| 1003 | Exanthema | 4595271 6850193 | CTD | |
| 1004 | Exophthalmos | Canada Vigilance: 1 | Canada Vigilance | |
| 1005 | Extremity contracture | OFFSIDES | ||
| 1006 | Facial paralysis | Canada Vigilance: 1 | Canada Vigilance | |
| 1007 | Fat intolerance | OFFSIDES | ||
| 1008 | Fatty Liver | OFFSIDES | ||
| 1009 | Femoral artery occlusion | OFFSIDES | ||
| 1010 | Fetal Hypoxia | 533297 | CTD | |
| 1011 | Fever | 3391111 | CTD | |
| 1012 | Floppy iris syndrome | OFFSIDES | ||
| 1013 | Gambling | OFFSIDES | ||
| 1014 | Gamma-Glutamyltransferase Increased | Canada Vigilance: 1 | Canada Vigilance | |
| 1015 | Gastrointestinal Diseases | CTD | ||
| 1016 | Gastrointestinal Hemorrhage | CTD | ||
| 1017 | Head titubation | OFFSIDES | ||
| 1018 | Hearing Loss, Sudden | 7057085 | CTD | |
| 1019 | Heartburn | SIDER | ||
| 1020 | Hematuria | 2787136 | CTD | |
| 1021 | Hepatic Infarction | OFFSIDES | ||
| 1022 | Hepatic Infection | OFFSIDES | ||
| 1023 | Hepatitis C | OFFSIDES | ||
| 1024 | Hepatitis E | OFFSIDES | ||
| 1025 | Hepatosplenomegaly | SIDER | ||
| 1026 | Hilar lymphadenopathy | OFFSIDES | ||
| 1027 | Hoarseness | OFFSIDES | ||
| 1028 | Hyperammonemia | 18173932 | CTD | |
| 1029 | Hypercapnia | OFFSIDES | ||
| 1030 | Hyperkalemia | 3358393 3375885 | CTD | |
| 1031 | Hyperkeratosis | OFFSIDES | ||
| 1032 | Hypoalbuminemia | 2179759 18632553 | CTD | |
| 1033 | Hypoaldosteronism | 3375885 | CTD | |
| 1034 | Hypoglycemia | 18173932 | CTD | |
| 1035 | Hysterectomy | OFFSIDES | ||
| 1036 | Increased bronchial secretion | OFFSIDES | ||
| 1037 | Infant, Premature, Diseases | 533297 | CTD | |
| 1038 | Infective exacerbation of chronic obstructive airways disease | OFFSIDES | ||
| 1039 | Inflammatory Bowel Diseases | 16469680 | CTD | |
| 1040 | Influenza-like symptoms | SIDER | ||
| 1041 | Infusion site mobility decreased | OFFSIDES | ||
| 1042 | Intervertebral disc injury | OFFSIDES | ||
| 1043 | Intestinal Diseases | 16944022 | CTD | |
| 1044 | Intestinal Pseudo-Obstruction | 285374 | CTD | |
| 1045 | JC virus infection | OFFSIDES | ||
| 1046 | Juvenile pauciarticular chronic arthritis | 6829384 | CTD | |
| 1047 | Keratitis | SIDER | ||
| 1048 | Keratoconjunctivitis | SIDER | ||
| 1049 | Kidney Failure, Chronic | 1855326 3684403 | CTD | |
| 1050 | Kidney Failure | OFFSIDES | ||
| 1051 | Kidney Papillary Necrosis | CTD | ||
| 1052 | Lacrimal structural disorder | SIDER | ||
| 1053 | Laryngitis | SIDER | ||
| 1054 | Leishmaniasis | OFFSIDES | ||
| 1055 | Life expectancy shortened | OFFSIDES | ||
| 1056 | Lightheadedness | SIDER | ||
| 1057 | Lipids abnormal | OFFSIDES | ||
| 1058 | Liver Failure, Acute | 19539102 | CTD | |
| 1059 | Liver diseases | 16867024 | CTD | |
| 1060 | Loss of personal independence in daily activities | Canada Vigilance: 1 | Canada Vigilance | |
| 1061 | Low Back Pain | 3600707 18084859 | CTD | |
| 1062 | Lung Injury | OFFSIDES | ||
| 1063 | Lung consolidation | OFFSIDES | ||
| 1064 | Lupus Erythematosus | SIDER | ||
| 1065 | Lymphocyte count decreased | OFFSIDES | ||
| 1066 | Malignant neoplasm of spinal cord | OFFSIDES | ||
| 1067 | Malnutrition | SIDER | ||
| 1068 | Mastication disorder | OFFSIDES | ||
| 1069 | Mesenteric vascular insufficiency | OFFSIDES | ||
| 1070 | Metatarsalgia | OFFSIDES | ||
| 1071 | Migraine Disorders | 16109111 18803445 19708964 | CTD | |
| 1072 | Multiple drug overdose | OFFSIDES | ||
| 1073 | Multiple drug overdose intentional | OFFSIDES | ||
| 1074 | Muscle Rigidity | 3391111 | CTD | |
| 1075 | Nasal Flaring | OFFSIDES | ||
| 1076 | Nasal sinus drainage | OFFSIDES | ||
| 1077 | Neck stiffness | SIDER | ||
| 1078 | Necrolysis epidermal | SIDER | ||
| 1079 | Nephritic syndrome | SIDER | ||
| 1080 | Nephritis, Interstitial | CTD | ||
| 1081 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 1082 | Nephrosclerosis | SIDER | ||
| 1083 | Nephrotic Syndrome | CTD SIDER | ||
| 1084 | Neuritis | SIDER | ||
| 1085 | Obesity | 23784744 | CTD | |
| 1086 | Oculomucocutaneous syndrome | OFFSIDES | ||
| 1087 | Onychoclasis | OFFSIDES | ||
| 1088 | Open wound | OFFSIDES | ||
| 1089 | Ophthalmoplegia | Canada Vigilance: 1 | Canada Vigilance | |
| 1090 | Osteochondrosis | OFFSIDES | ||
| 1091 | Osteomyelitis | OFFSIDES | ||
| 1092 | Otitis Media | SIDER | ||
| 1093 | Pain, Postoperative | 9539056 | CTD | |
| 1094 | Panic Disorder | OFFSIDES | ||
| 1095 | Paraplegia | OFFSIDES | ||
| 1096 | Paresthesia | 6882485 16109111 | CTD | |
| 1097 | Parkinson Disease | 7640588 | CTD | |
| 1098 | Patellofemoral Pain Syndrome | OFFSIDES | ||
| 1099 | Periodontitis | OFFSIDES | ||
| 1100 | Peripheral Nervous System Diseases | 3030337 10870665 | CTD | |
| 1101 | Pharyngitis | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 1102 | Pinguecula | OFFSIDES | ||
| 1103 | Polysubstance dependence | OFFSIDES | ||
| 1104 | Porphyria Cutanea Tarda | SIDER | ||
| 1105 | Porphyria non-acute | SIDER | ||
| 1106 | Premature Birth | 7469626 | CTD | |
| 1107 | Primary sequestrum | OFFSIDES | ||
| 1108 | Proctitis herpes | OFFSIDES | ||
| 1109 | Proctocolitis | SIDER | ||
| 1110 | Pseudoparalysis | OFFSIDES | ||
| 1111 | Psychomotor skills impaired | OFFSIDES | ||
| 1112 | Pulmonary Edema | 3814977 | CTD | |
| 1113 | Pulmonary Hypertension | OFFSIDES | ||
| 1114 | Pulmonary function test decreased | SIDER | ||
| 1115 | Pulmonary malformation | OFFSIDES | ||
| 1116 | Pulmonary radiation injury | OFFSIDES | ||
| 1117 | Pyelonephritis | 3080108 | CTD OFFSIDES SIDER | |
| 1118 | Radiculitis | OFFSIDES | ||
| 1119 | Rales | OFFSIDES | ||
| 1120 | Rash papulosquamous | Canada Vigilance: 1 | Canada Vigilance | |
| 1121 | Reaction gastrointestinal | SIDER | ||
| 1122 | Recurrence | 16469680 | CTD | |
| 1123 | Redness | SIDER | ||
| 1124 | Renal Insufficiency | 503131 3814977 6953356 | CTD | |
| 1125 | Renal artery occlusion | OFFSIDES | ||
| 1126 | Respiratory Depression | SIDER | ||
| 1127 | Respiratory syncytial virus bronchiolitis | OFFSIDES | ||
| 1128 | Restrictive pulmonary disease | OFFSIDES | ||
| 1129 | Retinal Vein Occlusion | OFFSIDES | ||
| 1130 | Rhinitis | SIDER | ||
| 1131 | Right Ventricular Hypertrophy | OFFSIDES | ||
| 1132 | Schizophrenia | OFFSIDES | ||
| 1133 | Scleritis | SIDER | ||
| 1134 | Sequestrectomy | OFFSIDES | ||
| 1135 | Shoulder Pain | OFFSIDES | ||
| 1136 | Skeletal injury | OFFSIDES | ||
| 1137 | Skin Diseases, Vesiculobullous | 10524703 11963225 | CTD | |
| 1138 | Skin necrosis | SIDER | ||
| 1139 | Sleep Talking | OFFSIDES | ||
| 1140 | Soft Tissue Infection | OFFSIDES | ||
| 1141 | Spasm | 3391111 | CTD | |
| 1142 | Splenic Infarction | OFFSIDES | ||
| 1143 | Status Asthmaticus | Canada Vigilance: 1 | Canada Vigilance | |
| 1144 | Status Epilepticus | OFFSIDES | ||
| 1145 | Stomach Diseases | 9566780 | CTD | |
| 1146 | Stomach ache | SIDER | ||
| 1147 | Subcutaneous Emphysema | OFFSIDES | ||
| 1148 | Subcutaneous nodule | SIDER | ||
| 1149 | Substance Withdrawal Syndrome | 1675320 3298163 7954762 | CTD | |
| 1150 | Sweating | SIDER | ||
| 1151 | Swelling of eyelid | Canada Vigilance: 1 | Canada Vigilance | |
| 1152 | Synovitis | 6850193 | CTD | |
| 1153 | Tardive Dyskinesia | OFFSIDES | ||
| 1154 | Tendinitis | OFFSIDES | ||
| 1155 | Thrombophlebitis | SIDER | ||
| 1156 | Thrombosis in device | OFFSIDES | ||
| 1157 | Tooth Extraction | OFFSIDES | ||
| 1158 | Tooth Loss | OFFSIDES | ||
| 1159 | Tracheobronchitis | OFFSIDES | ||
| 1160 | Ulcerative stomatitis | SIDER | ||
| 1161 | Upper respiratory tract inflammation | Canada Vigilance: 1 | Canada Vigilance | |
| 1162 | Urethral fistula | OFFSIDES | ||
| 1163 | Urine cytomegalovirus positive | OFFSIDES | ||
| 1164 | Uterine spasm | SIDER | ||
| 1165 | Vaginal mycosis | OFFSIDES | ||
| 1166 | Vascular anomaly | SIDER | ||
| 1167 | Vascular purpura | SIDER | ||
| 1168 | Vasculitis, Leukocytoclastic, Cutaneous | 8794637 10870665 20684166 | CTD | |
| 1169 | Vasodilation procedure | SIDER | ||
| 1170 | Vasodilation | SIDER | ||
| 1171 | Ventricular Fibrillation | OFFSIDES | ||
| 1172 | Vitamin B 12 Deficiency | OFFSIDES | ||
| 1173 | Weight Gain | OFFSIDES | ||
| 1174 | Wheelchair user | OFFSIDES | ||
| 1175 | Xerosis | OFFSIDES | ||
| 1176 | Xerostomia | 16109111 | CTD | |
| 1177 | colonoscopy | OFFSIDES | ||
| 1178 | effusion | OFFSIDES | ||
| 1179 | muscle injury | OFFSIDES | ||
| 1180 | treatment failure | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.