Omeprazole
(KWORUUGOSLYAGD-UHFFFAOYSA-N)
Structure
- SMILES
- COc1ccc2c(c1)nc([n-]2)S(=O)Cc1ncc(c(c1C)OC)C.COc1ccc2c(c1)nc([n-]2)S(=O)Cc1ncc(c(c1C)OC)C.[Mg+2]
- Molecular Formula:
- C34H36MgN6O6S2
- Molecular Weight:
- 713.121
- Log P:
- 6.7890
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 0
- TPSA:
- 186.82
- CAS Number(s):
- 95382-33-5; 161796-78-7; 161973-10-0; 217087-09-7
Synonym(s)
1.
Omeprazole
2.
H 168-68
3.
Omeprazole Magnesium
4.
Omeprazole Sodium
5.
Prilosec
6.
H 168 68
7.
H 16868
8.
Magnesium, Omeprazole
9.
Sodium, Omeprazole
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug dose omission | FAERS: 6410 | US FAERS | |
| 2 | Malaise | FAERS: 2147 | US FAERS | |
| 3 | Dyspepsia | FAERS: 1824 | US FAERS | |
| 4 | Osteoporosis | FAERS: 1431 | US FAERS | |
| 5 | Vomiting | FAERS: 986 | US FAERS | |
| 6 | Pain | FAERS: 920 | US FAERS | |
| 7 | Intentional drug misuse | FAERS: 836 | US FAERS | |
| 8 | Abdominal discomfort | FAERS: 804 | US FAERS | |
| 9 | Aphagia | FAERS: 583 | US FAERS | |
| 10 | Drug ineffective | FAERS: 575 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 11 | Nausea | FAERS: 458 | US FAERS | |
| 12 | Chest Pain | FAERS: 457 | US FAERS | |
| 13 | Adverse event | FAERS: 453 | US FAERS | |
| 14 | Diabetes Mellitus | FAERS: 393 | US FAERS | |
| 15 | Cerebrovascular accident | FAERS: 378 | US FAERS | |
| 16 | Feeling abnormal | FAERS: 370 | US FAERS | |
| 17 | Throat irritation | FAERS: 346 | US FAERS | |
| 18 | Incorrect dose administered | FAERS: 316 | US FAERS | |
| 19 | Headache | FAERS: 308 | US FAERS | |
| 20 | Nasopharyngitis | FAERS: 303 | US FAERS | |
| 21 | Ulcer | FAERS: 284 | US FAERS | |
| 22 | Myocardial Infarction | FAERS: 281 | US FAERS | |
| 23 | Pneumonia | FAERS: 257 | US FAERS | |
| 24 | Weight decreased | FAERS: 240 | US FAERS | |
| 25 | Regurgitation | FAERS: 233 | US FAERS | |
| 26 | Oropharyngeal pain | FAERS: 205 | US FAERS | |
| 27 | Inappropriate schedule of drug administration | FAERS: 196 | US FAERS | |
| 28 | Dizziness | FAERS: 175 | US FAERS | |
| 29 | Dysphonia | FAERS: 175 | US FAERS | |
| 30 | Eructation | FAERS: 171 | US FAERS | |
| 31 | Flatulence | FAERS: 170 | US FAERS | |
| 32 | Burning sensation | FAERS: 163 | US FAERS | |
| 33 | Abdominal Pain | FAERS: 160 | US FAERS | |
| 34 | Wrong drug administered | FAERS: 159 | US FAERS | |
| 35 | Choking | FAERS: 158 | US FAERS | |
| 36 | Dysgeusia | FAERS: 153 | US FAERS | |
| 37 | Arthritis | FAERS: 152 | US FAERS | |
| 38 | Asthma | FAERS: 151 | US FAERS | |
| 39 | Memory impairment | FAERS: 149 | US FAERS | |
| 40 | Back Pain | FAERS: 146 | US FAERS | |
| 41 | Bronchitis | FAERS: 145 | US FAERS | |
| 42 | Hernia | FAERS: 138 | US FAERS | |
| 43 | Anxiety | FAERS: 135 | US FAERS | |
| 44 | Sleep disorder due to general medical condition, insomnia type | FAERS: 134 | US FAERS | |
| 45 | Fatigue | FAERS: 128 | US FAERS | |
| 46 | Chest discomfort | FAERS: 125 | US FAERS | |
| 47 | Discomfort | FAERS: 121 | US FAERS | |
| 48 | Influenza | FAERS: 118 | US FAERS | |
| 49 | Hyperchlorhydria | FAERS: 114 | US FAERS | |
| 50 | Visual Impairment | FAERS: 114 | US FAERS | |
| 51 | Gastritis | FAERS: 112 | US FAERS | |
| 52 | Cataract | FAERS: 105 | US FAERS | |
| 53 | Sleep disorder due to a general medical condition | FAERS: 105 | US FAERS | |
| 54 | Gastric ulcer | FAERS: 104 | US FAERS | |
| 55 | Arthralgia | FAERS: 103 | US FAERS | |
| 56 | Constipation | FAERS: 97 | US FAERS | |
| 57 | Asthenia | FAERS: 94 | US FAERS | |
| 58 | Amnesia | FAERS: 90 | US FAERS | |
| 59 | Back disorder | FAERS: 86 | US FAERS | |
| 60 | Stress | FAERS: 80 | US FAERS | |
| 61 | Laryngitis | FAERS: 77 | US FAERS | |
| 62 | Drug prescribing error | FAERS: 75 | US FAERS | |
| 63 | Blindness | FAERS: 74 | US FAERS | |
| 64 | Palpitations | FAERS: 70 | US FAERS | |
| 65 | Sinusitis | FAERS: 70 | US FAERS | |
| 66 | Aphonia | FAERS: 68 | US FAERS | |
| 67 | Diverticulitis | FAERS: 68 | US FAERS | |
| 68 | Blood cholesterol increased | FAERS: 66 | US FAERS | |
| 69 | Fibromyalgia | FAERS: 65 | US FAERS | |
| 70 | Pruritus | FAERS: 65 | US FAERS | |
| 71 | Limb injury | FAERS: 61 | US FAERS | |
| 72 | Multiple allergies | FAERS: 60 | US FAERS | |
| 73 | Irritable Bowel Syndrome | FAERS: 59 | US FAERS | |
| 74 | Joint injury | FAERS: 58 | US FAERS | |
| 75 | Retching | FAERS: 58 | US FAERS | |
| 76 | Rheumatoid Arthritis | FAERS: 58 | US FAERS | |
| 77 | Therapeutic response unexpected | FAERS: 57 | US FAERS | |
| 78 | Nervousness | FAERS: 56 | US FAERS | |
| 79 | Hypersensitivity | FAERS: 55 | US FAERS | |
| 80 | Impaired work ability | FAERS: 54 | US FAERS | |
| 81 | Myalgia | FAERS: 54 | US FAERS | |
| 82 | Somnolence | FAERS: 53 | US FAERS | |
| 83 | Multiple Sclerosis | FAERS: 52 | US FAERS | |
| 84 | Thrombosis | FAERS: 52 | US FAERS | |
| 85 | Infection | FAERS: 51 | US FAERS | |
| 86 | Bone density decreased | FAERS: 50 | US FAERS | |
| 87 | Macular degeneration | FAERS: 50 | US FAERS | |
| 88 | Musculoskeletal Pain | FAERS: 50 | US FAERS | |
| 89 | Ankle Fracture | FAERS: 49 | US FAERS | |
| 90 | Osteopenia | FAERS: 49 | US FAERS | |
| 91 | General physical health deterioration | FAERS: 46 | US FAERS | |
| 92 | Fracture | FAERS: 45 | US FAERS | |
| 93 | Musculoskeletal discomfort | FAERS: 45 | US FAERS | |
| 94 | Neck Pain | FAERS: 45 | US FAERS | |
| 95 | Glaucoma | FAERS: 44 | US FAERS | |
| 96 | Incorrect drug administration duration | FAERS: 44 | US FAERS | |
| 97 | Tremor | FAERS: 44 | US FAERS | |
| 98 | Urinary tract infection | FAERS: 44 | US FAERS | |
| 99 | Medication Error | FAERS: 43 | US FAERS | |
| 100 | Wrong technique in drug usage process | FAERS: 43 | US FAERS | |
| 101 | Alopecia | FAERS: 42 | US FAERS | |
| 102 | Pancreatitis | FAERS: 42 | US FAERS | |
| 103 | Dehydration | FAERS: 41 | US FAERS | |
| 104 | Activities of daily living impaired | FAERS: 40 | US FAERS | |
| 105 | Disease recurrence | FAERS: 40 | US FAERS | |
| 106 | Urticaria | FAERS: 40 | US FAERS | |
| 107 | Blood glucose increased | FAERS: 39 | US FAERS | |
| 108 | Arthropathy | FAERS: 38 | US FAERS | |
| 109 | Throat cancer | FAERS: 38 | US FAERS | |
| 110 | Dementia | FAERS: 37 | US FAERS | |
| 111 | Nephrolithiasis | FAERS: 37 | US FAERS | |
| 112 | Increased upper airway secretion | FAERS: 36 | US FAERS | |
| 113 | Product taste abnormal | FAERS: 36 | US FAERS | |
| 114 | Mental impairment | FAERS: 35 | US FAERS | |
| 115 | Product quality issue | FAERS: 34 | US FAERS | |
| 116 | Abasia | FAERS: 33 | US FAERS | |
| 117 | Disability | FAERS: 33 | US FAERS | |
| 118 | Impaired gastric emptying | FAERS: 33 | US FAERS | |
| 119 | Deafness | FAERS: 32 | US FAERS | |
| 120 | Swelling | FAERS: 32 | US FAERS | |
| 121 | Apparent death | FAERS: 31 | US FAERS | |
| 122 | Gastrointestinal Pain | FAERS: 31 | US FAERS | |
| 123 | Pharyngolaryngeal Pain | FAERS: 31 | US FAERS | |
| 124 | Bone pain | FAERS: 30 | US FAERS | |
| 125 | Syncope | FAERS: 30 | US FAERS | |
| 126 | Circumstance or information capable of leading to medication error | FAERS: 29 | US FAERS | |
| 127 | Choking sensation | FAERS: 27 | US FAERS | |
| 128 | Drug exposure during pregnancy | FAERS: 27 | US FAERS | |
| 129 | Pancreatic carcinoma | FAERS: 27 | US FAERS | |
| 130 | Expired drug administered | FAERS: 26 | US FAERS | |
| 131 | Limb discomfort | FAERS: 26 | US FAERS | |
| 132 | Nerve injury | FAERS: 26 | US FAERS | |
| 133 | Chills | FAERS: 25 | US FAERS | |
| 134 | Crying | FAERS: 25 | US FAERS | |
| 135 | Maternal exposure during pregnancy | FAERS: 25 | US FAERS | |
| 136 | Peptic Ulcer | FAERS: 25 | US FAERS | |
| 137 | Aneurysm | FAERS: 24 | US FAERS | |
| 138 | Colitis | FAERS: 24 | US FAERS | |
| 139 | nervous system disorder | FAERS: 24 | US FAERS | |
| 140 | Flushing | FAERS: 23 | US FAERS | |
| 141 | Joint swelling | FAERS: 23 | US FAERS | |
| 142 | Wheezing | FAERS: 23 | US FAERS | |
| 143 | Cholelithiasis | FAERS: 22 | US FAERS | |
| 144 | Intestinal Obstruction | FAERS: 22 | US FAERS | |
| 145 | Bipolar Disorder | FAERS: 21 | US FAERS | |
| 146 | Chromaturia | FAERS: 21 | US FAERS | |
| 147 | Drug ineffective for unapproved indication | FAERS: 21 | US FAERS | |
| 148 | Hepatitis C | FAERS: 21 | US FAERS | |
| 149 | Lymphoma | FAERS: 21 | US FAERS | |
| 150 | Vertigo | FAERS: 21 | US FAERS | |
| 151 | Angina Pectoris | FAERS: 20 | US FAERS | |
| 152 | Atrial Fibrillation | FAERS: 20 | US FAERS | |
| 153 | Drug administration error | FAERS: 20 | US FAERS | |
| 154 | Erythema | FAERS: 20 | US FAERS | |
| 155 | Gastrooesophageal sphincter insufficiency | FAERS: 20 | US FAERS | |
| 156 | Middle insomnia | FAERS: 20 | US FAERS | |
| 157 | Overdose | FAERS: 20 | US FAERS | |
| 158 | Rotator cuff syndrome | FAERS: 20 | US FAERS | |
| 159 | Tinnitus | FAERS: 20 | US FAERS | |
| 160 | Bedridden | FAERS: 19 | US FAERS | |
| 161 | Cardiac Arrest | FAERS: 19 | US FAERS | |
| 162 | Drug dispensing error | FAERS: 19 | US FAERS | |
| 163 | Gastric Bypass | FAERS: 19 | US FAERS | |
| 164 | Gout | FAERS: 19 | US FAERS | |
| 165 | Inflammation | FAERS: 19 | US FAERS | |
| 166 | Pharmaceutical product complaint | FAERS: 19 | US FAERS | |
| 167 | Intervertebral Disc Degeneration | FAERS: 18 | US FAERS | |
| 168 | Precancerous cells present | FAERS: 18 | US FAERS | |
| 169 | Blood glucose decreased | FAERS: 17 | US FAERS | |
| 170 | Blood magnesium decreased | FAERS: 17 | US FAERS | |
| 171 | Depressed mood | FAERS: 17 | US FAERS | |
| 172 | Dysgraphia | FAERS: 17 | US FAERS | |
| 173 | Gastric pH decreased | FAERS: 17 | US FAERS | |
| 174 | Lethargy | FAERS: 17 | US FAERS | |
| 175 | Agitation | FAERS: 16 | US FAERS | |
| 176 | Carpal Tunnel Syndrome | FAERS: 16 | US FAERS | |
| 177 | Hypokinesia | FAERS: 16 | US FAERS | |
| 178 | Hypotension | FAERS: 16 | US FAERS | |
| 179 | Post procedural complication | FAERS: 16 | US FAERS | |
| 180 | Post-Traumatic Stress Disorder | FAERS: 16 | US FAERS | |
| 181 | Cartilage injury | FAERS: 15 | US FAERS | |
| 182 | Cataract operation | FAERS: 15 | US FAERS | |
| 183 | Cystitis | FAERS: 15 | US FAERS | |
| 184 | Ear discomfort | FAERS: 15 | US FAERS | |
| 185 | Gastric infection | FAERS: 15 | US FAERS | |
| 186 | Scleroderma | FAERS: 15 | US FAERS | |
| 187 | Blood potassium decreased | FAERS: 14 | US FAERS | |
| 188 | Cyst | FAERS: 14 | US FAERS | |
| 189 | Epistaxis | FAERS: 14 | US FAERS | |
| 190 | Lip swelling | FAERS: 14 | US FAERS | |
| 191 | Musculoskeletal stiffness | FAERS: 14 | US FAERS | |
| 192 | Skeletal injury | FAERS: 14 | US FAERS | |
| 193 | Blood iron decreased | FAERS: 13 | US FAERS | |
| 194 | Dental caries | FAERS: 13 | US FAERS | |
| 195 | Epilepsy | FAERS: 13 | US FAERS | |
| 196 | Eye pain | FAERS: 13 | US FAERS | |
| 197 | Lymphadenopathy | FAERS: 13 | US FAERS | |
| 198 | Product substitution issue | FAERS: 13 | US FAERS | |
| 199 | Terminal state | FAERS: 13 | US FAERS | |
| 200 | Tooth Extraction | FAERS: 13 | US FAERS | |
| 201 | Accidental drug intake by child | FAERS: 12 | US FAERS | |
| 202 | Ageusia | FAERS: 12 | US FAERS | |
| 203 | Anorexia | FAERS: 12 | US FAERS | |
| 204 | Aphasia | FAERS: 12 | US FAERS | |
| 205 | Drug effect delayed | FAERS: 12 | US FAERS | |
| 206 | Dysuria | FAERS: 12 | US FAERS | |
| 207 | Epigastric discomfort | FAERS: 12 | US FAERS | |
| 208 | Gastrointestinal ulcer | FAERS: 12 | US FAERS | |
| 209 | Intracranial Aneurysm | FAERS: 12 | US FAERS | |
| 210 | Limb operation | FAERS: 12 | US FAERS | |
| 211 | Rebound effect | FAERS: 12 | US FAERS | |
| 212 | Sepsis | FAERS: 12 | US FAERS | |
| 213 | Tachycardia | FAERS: 12 | US FAERS | |
| 214 | Toothache | FAERS: 12 | US FAERS | |
| 215 | colonoscopy | FAERS: 12 | US FAERS | |
| 216 | jaundice | FAERS: 12 | US FAERS | |
| 217 | Diplopia | FAERS: 11 | US FAERS | |
| 218 | Drug effect incomplete | FAERS: 11 | US FAERS | |
| 219 | Feeling Cold | FAERS: 11 | US FAERS | |
| 220 | Feeling jittery | FAERS: 11 | US FAERS | |
| 221 | Foaming at mouth | FAERS: 11 | US FAERS | |
| 222 | Gastrectomy | FAERS: 11 | US FAERS | |
| 223 | Intervertebral disc disorder | FAERS: 11 | US FAERS | |
| 224 | Limb crushing injury | FAERS: 11 | US FAERS | |
| 225 | Musculoskeletal chest pain | FAERS: 11 | US FAERS | |
| 226 | Oral pain | FAERS: 11 | US FAERS | |
| 227 | Oropharyngeal discomfort | FAERS: 11 | US FAERS | |
| 228 | Perforated ulcer | FAERS: 11 | US FAERS | |
| 229 | Poor quality sleep | FAERS: 11 | US FAERS | |
| 230 | Pulmonary Fibrosis | FAERS: 11 | US FAERS | |
| 231 | Restlessness | FAERS: 11 | US FAERS | |
| 232 | Therapy cessation | FAERS: 11 | US FAERS | |
| 233 | Accidental overdose | FAERS: 10 | US FAERS | |
| 234 | Blood gastrin increased | FAERS: 10 | US FAERS | |
| 235 | Coronary Artery Disease | FAERS: 10 | US FAERS | |
| 236 | Counterfeit drug administered | FAERS: 10 | US FAERS | |
| 237 | Drug screen positive | FAERS: 10 | US FAERS | |
| 238 | Erectile dysfunction | FAERS: 10 | US FAERS | |
| 239 | Gastroenteritis | FAERS: 10 | US FAERS | |
| 240 | Gastrointestinal sounds abnormal | FAERS: 10 | US FAERS | |
| 241 | Hepatitis | FAERS: 10 | US FAERS | |
| 242 | Lower respiratory tract infection | FAERS: 10 | US FAERS | |
| 243 | Osteomyelitis | FAERS: 10 | US FAERS | |
| 244 | Pharyngitis | FAERS: 10 | US FAERS | |
| 245 | Pneumothorax | FAERS: 10 | US FAERS | |
| 246 | Precancerous mucosal lesion | FAERS: 10 | US FAERS | |
| 247 | Productive Cough | FAERS: 10 | US FAERS | |
| 248 | Psoriasis | FAERS: 10 | US FAERS | |
| 249 | Pulmonary Embolism | FAERS: 10 | US FAERS | |
| 250 | Renal pain | FAERS: 10 | US FAERS | |
| 251 | Thermal burn | FAERS: 10 | US FAERS | |
| 252 | Upper-airway cough syndrome | FAERS: 10 | US FAERS | |
| 253 | Vocal Cord Paralysis | FAERS: 10 | US FAERS | |
| 254 | Bowel movement irregularity | FAERS: 9 | US FAERS | |
| 255 | Drug Dependence | FAERS: 9 | US FAERS | |
| 256 | Gastric mucosal lesion | FAERS: 9 | US FAERS | |
| 257 | Hysterectomy | FAERS: 9 | US FAERS | |
| 258 | Immobile | FAERS: 9 | US FAERS | |
| 259 | Muscle strain | FAERS: 9 | US FAERS | |
| 260 | Pharyngeal erosion | FAERS: 9 | US FAERS | |
| 261 | Pulmonary congestion | FAERS: 9 | US FAERS | |
| 262 | Rash erythematous | FAERS: 9 | US FAERS | |
| 263 | Renal cyst | FAERS: 9 | US FAERS | |
| 264 | Respiratory Failure | FAERS: 9 | US FAERS | |
| 265 | Stomatitis | FAERS: 9 | US FAERS | |
| 266 | Tympanic Membrane Perforation | FAERS: 9 | US FAERS | |
| 267 | Walking aid user | FAERS: 9 | US FAERS | |
| 268 | Accidental exposure | FAERS: 8 | US FAERS | |
| 269 | Blood cholesterol abnormal | FAERS: 8 | US FAERS | |
| 270 | Cellulitis | FAERS: 8 | US FAERS | |
| 271 | Disorientation | FAERS: 8 | US FAERS | |
| 272 | Diverticulum | FAERS: 8 | US FAERS | |
| 273 | Drug withdrawal syndrome | FAERS: 8 | US FAERS | |
| 274 | Dry skin | FAERS: 8 | US FAERS | |
| 275 | Dyslexia | FAERS: 8 | US FAERS | |
| 276 | Emotional distress | FAERS: 8 | US FAERS | |
| 277 | Feeding tube complication | FAERS: 8 | US FAERS | |
| 278 | Food Allergy | FAERS: 8 | US FAERS | |
| 279 | General physical condition abnormal | FAERS: 8 | US FAERS | |
| 280 | Hepatomegaly | FAERS: 8 | US FAERS | |
| 281 | Hunger | FAERS: 8 | US FAERS | |
| 282 | Incorrect route of drug administration | FAERS: 8 | US FAERS | |
| 283 | Muscle tightness | FAERS: 8 | US FAERS | |
| 284 | Neutropenia | FAERS: 8 | US FAERS | |
| 285 | Night sweats | FAERS: 8 | US FAERS | |
| 286 | Restless Legs Syndrome | FAERS: 8 | US FAERS | |
| 287 | Sinus headache | FAERS: 8 | US FAERS | |
| 288 | Spinal column stenosis | FAERS: 8 | US FAERS | |
| 289 | Vascular occlusion | FAERS: 8 | US FAERS | |
| 290 | Vitamin D Deficiency | FAERS: 8 | US FAERS | |
| 291 | furuncle | FAERS: 8 | US FAERS | |
| 292 | Calcium deficiency | FAERS: 7 | US FAERS | |
| 293 | Chemotherapy | FAERS: 7 | US FAERS | |
| 294 | Device occlusion | FAERS: 7 | US FAERS | |
| 295 | Eye Infection | FAERS: 7 | US FAERS | |
| 296 | Eye irritation | FAERS: 7 | US FAERS | |
| 297 | Feeling of body temperature change | FAERS: 7 | US FAERS | |
| 298 | Full blood count decreased | FAERS: 7 | US FAERS | |
| 299 | Gastrointestinal infection | FAERS: 7 | US FAERS | |
| 300 | Heat Stroke | FAERS: 7 | US FAERS | |
| 301 | Hypersomnia | FAERS: 7 | US FAERS | |
| 302 | Impaired driving ability | FAERS: 7 | US FAERS | |
| 303 | Iron deficiency | FAERS: 7 | US FAERS | |
| 304 | Ligament rupture | FAERS: 7 | US FAERS | |
| 305 | Malabsorption | FAERS: 7 | US FAERS | |
| 306 | Meningitis | FAERS: 7 | US FAERS | |
| 307 | Multiple Myeloma | FAERS: 7 | US FAERS | |
| 308 | Neuralgia | FAERS: 7 | US FAERS | |
| 309 | No adverse event | FAERS: 7 | US FAERS | |
| 310 | Optic Neuritis | FAERS: 7 | US FAERS | |
| 311 | Reflux laryngitis | FAERS: 7 | US FAERS | |
| 312 | Skin Ulcer | FAERS: 7 | US FAERS | |
| 313 | Spinal fusion surgery | FAERS: 7 | US FAERS | |
| 314 | Suicide attempt | FAERS: 7 | US FAERS | |
| 315 | Therapeutic response unexpected with drug substitution | FAERS: 7 | US FAERS | |
| 316 | Therapy regimen changed | FAERS: 7 | US FAERS | |
| 317 | Abdominal rigidity | FAERS: 6 | US FAERS | |
| 318 | Anger | FAERS: 6 | US FAERS | |
| 319 | Angioedema | FAERS: 6 | US FAERS | |
| 320 | Aortic Aneurysm | FAERS: 6 | US FAERS | |
| 321 | Bladder Neoplasm | FAERS: 6 | US FAERS | |
| 322 | Blood glucose abnormal | FAERS: 6 | US FAERS | |
| 323 | Blood sodium decreased | FAERS: 6 | US FAERS | |
| 324 | Cardiac discomfort | FAERS: 6 | US FAERS | |
| 325 | Cervix carcinoma | FAERS: 6 | US FAERS | |
| 326 | Device related infection | FAERS: 6 | US FAERS | |
| 327 | Diabetes mellitus inadequate control | FAERS: 6 | US FAERS | |
| 328 | Duodenal Ulcer | FAERS: 6 | US FAERS | |
| 329 | Emotional disorder | FAERS: 6 | US FAERS | |
| 330 | Facial Pain | FAERS: 6 | US FAERS | |
| 331 | Gastrointestinal inflammation | FAERS: 6 | US FAERS | |
| 332 | Head discomfort | FAERS: 6 | US FAERS | |
| 333 | Hip surgery | FAERS: 6 | US FAERS | |
| 334 | Hyperthyroidism | FAERS: 6 | US FAERS | |
| 335 | Hyperventilation | FAERS: 6 | US FAERS | |
| 336 | Hypothyroidism | FAERS: 6 | US FAERS | |
| 337 | Joint sprain | FAERS: 6 | US FAERS | |
| 338 | Joint stiffness | FAERS: 6 | US FAERS | |
| 339 | Laryngeal neoplasm | FAERS: 6 | US FAERS | |
| 340 | Medical device complication | FAERS: 6 | US FAERS | |
| 341 | Nasal discomfort | FAERS: 6 | US FAERS | |
| 342 | Oropharyngeal blistering | FAERS: 6 | US FAERS | |
| 343 | Respiratory arrest | FAERS: 6 | US FAERS | |
| 344 | Rhabdomyolysis | FAERS: 6 | US FAERS | |
| 345 | Sciatica | FAERS: 6 | US FAERS | |
| 346 | Sjogren's Syndrome | FAERS: 6 | US FAERS | |
| 347 | Sneezing | FAERS: 6 | US FAERS | |
| 348 | Stevens-Johnson Syndrome | FAERS: 6 | US FAERS | |
| 349 | Toxic Epidermal Necrolysis | FAERS: 6 | US FAERS | |
| 350 | Unevaluable event | FAERS: 6 | US FAERS | |
| 351 | Abnormal sleep-related event | FAERS: 5 | US FAERS | |
| 352 | Apathy | FAERS: 5 | US FAERS | |
| 353 | Biopsy | FAERS: 5 | US FAERS | |
| 354 | Blood cholesterol | FAERS: 5 | US FAERS | |
| 355 | Blood count abnormal | FAERS: 5 | US FAERS | |
| 356 | Bradyphrenia | FAERS: 5 | US FAERS | |
| 357 | Bronchiolitis | FAERS: 5 | US FAERS | |
| 358 | CREST Syndrome | FAERS: 5 | US FAERS | |
| 359 | Candidiasis | FAERS: 5 | US FAERS | |
| 360 | Cardiac Flutter | FAERS: 5 | US FAERS | |
| 361 | Cholecystitis infective | FAERS: 5 | US FAERS | |
| 362 | Compression fracture | FAERS: 5 | US FAERS | |
| 363 | Cytolytic hepatitis | FAERS: 5 | US FAERS | |
| 364 | Electrolyte imbalance | FAERS: 5 | US FAERS | |
| 365 | Flank Pain | FAERS: 5 | US FAERS | |
| 366 | Food Poisoning | FAERS: 5 | US FAERS | |
| 367 | Foreign body trauma | FAERS: 5 | US FAERS | |
| 368 | Gamma-Glutamyltransferase Increased | FAERS: 5 | US FAERS | |
| 369 | Hypophagia | FAERS: 5 | US FAERS | |
| 370 | Intestinal Perforation | FAERS: 5 | US FAERS | |
| 371 | Intestinal resection | FAERS: 5 | US FAERS | |
| 372 | Laryngectomy | FAERS: 5 | US FAERS | |
| 373 | Lipase increased | FAERS: 5 | US FAERS | |
| 374 | Lyme Disease | FAERS: 5 | US FAERS | |
| 375 | Magnesium Deficiency | FAERS: 5 | US FAERS | |
| 376 | Menorrhagia | FAERS: 5 | US FAERS | |
| 377 | Monoplegia | FAERS: 5 | US FAERS | |
| 378 | Neck exploration | FAERS: 5 | US FAERS | |
| 379 | Non-cardiac chest pain | FAERS: 5 | US FAERS | |
| 380 | Obstruction | FAERS: 5 | US FAERS | |
| 381 | Oxygen supplementation | FAERS: 5 | US FAERS | |
| 382 | Photophobia | FAERS: 5 | US FAERS | |
| 383 | Polymyalgia Rheumatica | FAERS: 5 | US FAERS | |
| 384 | Pulmonary Hypertension | FAERS: 5 | US FAERS | |
| 385 | Retinal Degeneration | FAERS: 5 | US FAERS | |
| 386 | Schizophrenia | FAERS: 5 | US FAERS | |
| 387 | Spinal column injury | FAERS: 5 | US FAERS | |
| 388 | Supraventricular tachycardia | FAERS: 5 | US FAERS | |
| 389 | Teeth brittle | FAERS: 5 | US FAERS | |
| 390 | Therapeutic procedure | FAERS: 5 | US FAERS | |
| 391 | Tooth Loss | FAERS: 5 | US FAERS | |
| 392 | Uterine Cancer | FAERS: 5 | US FAERS | |
| 393 | Vitiligo | FAERS: 5 | US FAERS | |
| 394 | Abscess | FAERS: 4 | US FAERS | |
| 395 | Allergy to chemicals | FAERS: 4 | US FAERS | |
| 396 | Amyloidosis | FAERS: 4 | US FAERS | |
| 397 | Angioplasty | FAERS: 4 | US FAERS | |
| 398 | Anorectal discomfort | FAERS: 4 | US FAERS | |
| 399 | Anosmia | FAERS: 4 | US FAERS | |
| 400 | Appendicitis | FAERS: 4 | US FAERS | |
| 401 | Ataxia | FAERS: 4 | US FAERS | |
| 402 | Benign Neoplasm | FAERS: 4 | US FAERS | |
| 403 | Blood chromogranin A increased | FAERS: 4 | US FAERS | |
| 404 | Blood creatinine increased | FAERS: 4 | US FAERS | |
| 405 | Blood electrolytes abnormal | FAERS: 4 | US FAERS | |
| 406 | Blood triglycerides increased | FAERS: 4 | US FAERS | |
| 407 | Bronchospasm | FAERS: 4 | US FAERS | |
| 408 | Bruxism | FAERS: 4 | US FAERS | |
| 409 | Carbon Monoxide Poisoning | FAERS: 4 | US FAERS | |
| 410 | Cardiac assistance device user | FAERS: 4 | US FAERS | |
| 411 | Carotid artery occlusion | FAERS: 4 | US FAERS | |
| 412 | Central nervous system lesion | FAERS: 4 | US FAERS | |
| 413 | Chronic sinusitis | FAERS: 4 | US FAERS | |
| 414 | Deep Vein Thrombosis | FAERS: 4 | US FAERS | |
| 415 | Dermatitis | FAERS: 4 | US FAERS | |
| 416 | Drug screen false positive | FAERS: 4 | US FAERS | |
| 417 | Dysarthria | FAERS: 4 | US FAERS | |
| 418 | Eating disorder symptom | FAERS: 4 | US FAERS | |
| 419 | Economic problem | FAERS: 4 | US FAERS | |
| 420 | Electrocardiogram abnormal | FAERS: 4 | US FAERS | |
| 421 | Exposure via father | FAERS: 4 | US FAERS | |
| 422 | Gastric Antral Vascular Ectasia | FAERS: 4 | US FAERS | |
| 423 | Gastrointestinal motility disorder | FAERS: 4 | US FAERS | |
| 424 | Hepatic cancer stage IV | FAERS: 4 | US FAERS | |
| 425 | Incoherent | FAERS: 4 | US FAERS | |
| 426 | Infarction | FAERS: 4 | US FAERS | |
| 427 | Infrequent bowel movements | FAERS: 4 | US FAERS | |
| 428 | Intervertebral disc compression | FAERS: 4 | US FAERS | |
| 429 | Intervertebral disc injury | FAERS: 4 | US FAERS | |
| 430 | Labyrinthitis | FAERS: 4 | US FAERS | |
| 431 | Large intestine perforation | FAERS: 4 | US FAERS | |
| 432 | Laryngospasm | FAERS: 4 | US FAERS | |
| 433 | Malignant tumour excision | FAERS: 4 | US FAERS | |
| 434 | Mallory-Weiss Syndrome | FAERS: 4 | US FAERS | |
| 435 | Medication residue | FAERS: 4 | US FAERS | |
| 436 | Menopause | FAERS: 4 | US FAERS | |
| 437 | Nephritis | FAERS: 4 | US FAERS | |
| 438 | Nonspecific reaction | FAERS: 4 | US FAERS | |
| 439 | Overweight | FAERS: 4 | US FAERS | |
| 440 | Pancreatic enzymes increased | FAERS: 4 | US FAERS | |
| 441 | Paraplegia | FAERS: 4 | US FAERS | |
| 442 | Paresis | FAERS: 4 | US FAERS | |
| 443 | Peripheral arterial occlusive disease | FAERS: 4 | US FAERS | |
| 444 | Poor quality drug administered | FAERS: 4 | US FAERS | |
| 445 | Presyncope | FAERS: 4 | US FAERS | |
| 446 | Pulmonary thrombosis | FAERS: 4 | US FAERS | |
| 447 | Quality of life decreased | FAERS: 4 | US FAERS | |
| 448 | Screaming | FAERS: 4 | US FAERS | |
| 449 | Septic Shock | FAERS: 4 | US FAERS | |
| 450 | Skin laceration | FAERS: 4 | US FAERS | |
| 451 | Somnambulism | FAERS: 4 | US FAERS | |
| 452 | Temporal Arteritis | FAERS: 4 | US FAERS | |
| 453 | Tension Headache | FAERS: 4 | US FAERS | |
| 454 | Tetany | FAERS: 4 | US FAERS | |
| 455 | Tongue blistering | FAERS: 4 | US FAERS | |
| 456 | Urinary Incontinence | FAERS: 4 | US FAERS | |
| 457 | Urinary Retention | FAERS: 4 | US FAERS | |
| 458 | White blood cell count decreased | FAERS: 4 | US FAERS | |
| 459 | Abdominal tenderness | FAERS: 3 | US FAERS | |
| 460 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 461 | Acidosis | FAERS: 3 | US FAERS | |
| 462 | Acute myocardial infarction | FAERS: 3 | US FAERS | |
| 463 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 464 | Allergic reaction to excipient | FAERS: 3 | US FAERS | |
| 465 | Allergic sinusitis | FAERS: 3 | US FAERS | |
| 466 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 467 | Amblyopia | FAERS: 3 | US FAERS | |
| 468 | Ammonia increased | FAERS: 3 | US FAERS | |
| 469 | Arteriosclerosis | FAERS: 3 | US FAERS | |
| 470 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 471 | Basal cell carcinoma | FAERS: 3 | US FAERS | |
| 472 | Blood alkaline phosphatase increased | FAERS: 3 | US FAERS | |
| 473 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 474 | Blood gases abnormal | FAERS: 3 | US FAERS | |
| 475 | Bradycardia | FAERS: 3 | US FAERS | |
| 476 | Breast cancer stage III | FAERS: 3 | US FAERS | |
| 477 | Breathing-related sleep disorder | FAERS: 3 | US FAERS | |
| 478 | Burning Mouth Syndrome | FAERS: 3 | US FAERS | |
| 479 | Bursitis | FAERS: 3 | US FAERS | |
| 480 | Cardiomegaly | FAERS: 3 | US FAERS | |
| 481 | Cauda Equina Syndrome | FAERS: 3 | US FAERS | |
| 482 | Cholestasis | FAERS: 3 | US FAERS | |
| 483 | Cold sweat | FAERS: 3 | US FAERS | |
| 484 | Cyst removal | FAERS: 3 | US FAERS | |
| 485 | Delirium | FAERS: 3 | US FAERS | |
| 486 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 487 | Device dislocation | FAERS: 3 | US FAERS | |
| 488 | Drug toxicity | FAERS: 3 | US FAERS | |
| 489 | Dysplasia | FAERS: 3 | US FAERS | |
| 490 | Dystonia | FAERS: 3 | US FAERS | |
| 491 | Ear congestion | FAERS: 3 | US FAERS | |
| 492 | Eczema | FAERS: 3 | US FAERS | |
| 493 | Endometriosis | FAERS: 3 | US FAERS | |
| 494 | Eosinophilia | FAERS: 3 | US FAERS | |
| 495 | Exposure to toxic agent | FAERS: 3 | US FAERS | |
| 496 | Gallbladder pain | FAERS: 3 | US FAERS | |
| 497 | Gastric Dilatation | FAERS: 3 | US FAERS | |
| 498 | Gastrinoma | FAERS: 3 | US FAERS | |
| 499 | Gastrointestinal bacterial infection | FAERS: 3 | US FAERS | |
| 500 | Gastrointestinal carcinoma | FAERS: 3 | US FAERS | |
| 501 | Gastrointestinal obstruction | FAERS: 3 | US FAERS | |
| 502 | Hearing disability | FAERS: 3 | US FAERS | |
| 503 | Hepatic Encephalopathy | FAERS: 3 | US FAERS | |
| 504 | Hernia pain | FAERS: 3 | US FAERS | |
| 505 | Hyperphagia | FAERS: 3 | US FAERS | |
| 506 | Hypoparathyroidism | FAERS: 3 | US FAERS | |
| 507 | Hypoxia | FAERS: 3 | US FAERS | |
| 508 | Implantable defibrillator insertion | FAERS: 3 | US FAERS | |
| 509 | Incorrect storage of drug | FAERS: 3 | US FAERS | |
| 510 | Internal fixation of spine | FAERS: 3 | US FAERS | |
| 511 | Laceration | FAERS: 3 | US FAERS | |
| 512 | Leukopenia | FAERS: 3 | US FAERS | |
| 513 | Malignant breast lump removal | FAERS: 3 | US FAERS | |
| 514 | Muscle Spasticity | FAERS: 3 | US FAERS | |
| 515 | Myopathy | FAERS: 3 | US FAERS | |
| 516 | Negative thoughts | FAERS: 3 | US FAERS | |
| 517 | Pallor | FAERS: 3 | US FAERS | |
| 518 | Pancytopenia | FAERS: 3 | US FAERS | |
| 519 | Panic Disorder | FAERS: 3 | US FAERS | |
| 520 | Paranasal sinus hypersecretion | FAERS: 3 | US FAERS | |
| 521 | Paranoia | FAERS: 3 | US FAERS | |
| 522 | Pelvic Pain | FAERS: 3 | US FAERS | |
| 523 | Periarthritis | FAERS: 3 | US FAERS | |
| 524 | Pericardial effusion | FAERS: 3 | US FAERS | |
| 525 | Personality Change | FAERS: 3 | US FAERS | |
| 526 | Pharyngeal polyp | FAERS: 3 | US FAERS | |
| 527 | Polydipsia | FAERS: 3 | US FAERS | |
| 528 | Polyneuropathy | FAERS: 3 | US FAERS | |
| 529 | Poor peripheral circulation | FAERS: 3 | US FAERS | |
| 530 | Pre-existing condition improved | FAERS: 3 | US FAERS | |
| 531 | Procedural complication | FAERS: 3 | US FAERS | |
| 532 | Prosthesis user | FAERS: 3 | US FAERS | |
| 533 | Proteinuria | FAERS: 3 | US FAERS | |
| 534 | Pyloric Stenosis | FAERS: 3 | US FAERS | |
| 535 | Rectal polyp | FAERS: 3 | US FAERS | |
| 536 | Reflux gastritis | FAERS: 3 | US FAERS | |
| 537 | Retinal Detachment | FAERS: 3 | US FAERS | |
| 538 | Retinal Vein Occlusion | FAERS: 3 | US FAERS | |
| 539 | Rosacea | FAERS: 3 | US FAERS | |
| 540 | Thirst | FAERS: 3 | US FAERS | |
| 541 | Thyroid Neoplasm | FAERS: 3 | US FAERS | |
| 542 | Thyroidectomy | FAERS: 3 | US FAERS | |
| 543 | Tooth Erosion | FAERS: 3 | US FAERS | |
| 544 | Transaminases increased | FAERS: 3 | US FAERS | |
| 545 | VIIth nerve paralysis | FAERS: 3 | US FAERS | |
| 546 | Visual disturbance | FAERS: 3 | US FAERS | |
| 547 | Vitreous Detachment | FAERS: 3 | US FAERS | |
| 548 | Wheelchair user | FAERS: 3 | US FAERS | |
| 549 | Abdominal wall infection | FAERS: 2 | US FAERS | |
| 550 | Acquired Immunodeficiency Syndrome | FAERS: 2 | US FAERS | |
| 551 | Allergy to animal | FAERS: 2 | US FAERS | |
| 552 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 553 | Anaphylactoid Reaction | FAERS: 2 | US FAERS | |
| 554 | Anorectal infection | FAERS: 2 | US FAERS | |
| 555 | Aphthous Stomatitis | FAERS: 2 | US FAERS | |
| 556 | Arthrodesis | FAERS: 2 | US FAERS | |
| 557 | Arthropod bite | FAERS: 2 | US FAERS | |
| 558 | Asphyxia | FAERS: 2 | US FAERS | |
| 559 | Auricular swelling | FAERS: 2 | US FAERS | |
| 560 | Autoimmune Pancreatitis | FAERS: 2 | US FAERS | |
| 561 | Bladder neck suspension | FAERS: 2 | US FAERS | |
| 562 | Bladder neoplasm surgery | FAERS: 2 | US FAERS | |
| 563 | Blood albumin decreased | FAERS: 2 | US FAERS | |
| 564 | Blood amylase increased | FAERS: 2 | US FAERS | |
| 565 | Blood cannabinoids | FAERS: 2 | US FAERS | |
| 566 | Blood pH increased | FAERS: 2 | US FAERS | |
| 567 | Blood potassium abnormal | FAERS: 2 | US FAERS | |
| 568 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 569 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 570 | Blood pressure inadequately controlled | FAERS: 2 | US FAERS | |
| 571 | Blood prolactin increased | FAERS: 2 | US FAERS | |
| 572 | Blood sodium abnormal | FAERS: 2 | US FAERS | |
| 573 | Blood testosterone decreased | FAERS: 2 | US FAERS | |
| 574 | Blood urea increased | FAERS: 2 | US FAERS | |
| 575 | Bone density abnormal | FAERS: 2 | US FAERS | |
| 576 | Bone fragmentation | FAERS: 2 | US FAERS | |
| 577 | Breast Cyst | FAERS: 2 | US FAERS | |
| 578 | Breast cancer recurrent | FAERS: 2 | US FAERS | |
| 579 | Breast discomfort | FAERS: 2 | US FAERS | |
| 580 | Bronchopneumonia | FAERS: 2 | US FAERS | |
| 581 | Bunion | FAERS: 2 | US FAERS | |
| 582 | Cachexia | FAERS: 2 | US FAERS | |
| 583 | Carbon dioxide abnormal | FAERS: 2 | US FAERS | |
| 584 | Cartilage atrophy | FAERS: 2 | US FAERS | |
| 585 | Cataplexy | FAERS: 2 | US FAERS | |
| 586 | Cholelithotomy | FAERS: 2 | US FAERS | |
| 587 | Chronic Fatigue Syndrome | FAERS: 2 | US FAERS | |
| 588 | Cleft Palate | FAERS: 2 | US FAERS | |
| 589 | Clostridium difficile colitis | FAERS: 2 | US FAERS | |
| 590 | Colectomy | FAERS: 2 | US FAERS | |
| 591 | Completed Suicide | FAERS: 2 | US FAERS | |
| 592 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 593 | Coronary artery insufficiency | FAERS: 2 | US FAERS | |
| 594 | Coronary artery perforation | FAERS: 2 | US FAERS | |
| 595 | Cyanosis | FAERS: 2 | US FAERS | |
| 596 | Dacryostenosis acquired | FAERS: 2 | US FAERS | |
| 597 | Dark circles under eyes | FAERS: 2 | US FAERS | |
| 598 | Delusional perception | FAERS: 2 | US FAERS | |
| 599 | Device Failure | FAERS: 2 | US FAERS | |
| 600 | Dissociation | FAERS: 2 | US FAERS | |
| 601 | Drooling | FAERS: 2 | US FAERS | |
| 602 | Duodenitis | FAERS: 2 | US FAERS | |
| 603 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 604 | Emergency Care | FAERS: 2 | US FAERS | |
| 605 | Encephalitis | FAERS: 2 | US FAERS | |
| 606 | Endocarditis | FAERS: 2 | US FAERS | |
| 607 | Endoscopy upper gastrointestinal tract abnormal | FAERS: 2 | US FAERS | |
| 608 | Eosinophilic Fasciitis | FAERS: 2 | US FAERS | |
| 609 | Erythema Nodosum | FAERS: 2 | US FAERS | |
| 610 | Escherichia infection | FAERS: 2 | US FAERS | |
| 611 | Essential Hypertension | FAERS: 2 | US FAERS | |
| 612 | Executive dysfunction | FAERS: 2 | US FAERS | |
| 613 | Fibrosis | FAERS: 2 | US FAERS | |
| 614 | Fixed eruption | FAERS: 2 | US FAERS | |
| 615 | Food aversion | FAERS: 2 | US FAERS | |
| 616 | Gastric hypomotility | FAERS: 2 | US FAERS | |
| 617 | Gastric mucosa erythema | FAERS: 2 | US FAERS | |
| 618 | Gastric pH increased | FAERS: 2 | US FAERS | |
| 619 | Gastrointestinal hypermotility | FAERS: 2 | US FAERS | |
| 620 | Gastrointestinal mucosal disorder | FAERS: 2 | US FAERS | |
| 621 | General symptom | FAERS: 2 | US FAERS | |
| 622 | Genital discomfort | FAERS: 2 | US FAERS | |
| 623 | Gingival erythema | FAERS: 2 | US FAERS | |
| 624 | Glossitis | FAERS: 2 | US FAERS | |
| 625 | Grip strength decreased | FAERS: 2 | US FAERS | |
| 626 | Hemiparesis | FAERS: 2 | US FAERS | |
| 627 | Hepatitis B DNA increased | FAERS: 2 | US FAERS | |
| 628 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 629 | Hormone level abnormal | FAERS: 2 | US FAERS | |
| 630 | Hyperpyrexia | FAERS: 2 | US FAERS | |
| 631 | Impaired self-care | FAERS: 2 | US FAERS | |
| 632 | Impatience | FAERS: 2 | US FAERS | |
| 633 | Incorrect product administration duration | FAERS: 2 | US FAERS | |
| 634 | Infectious Mononucleosis | FAERS: 2 | US FAERS | |
| 635 | Insulin resistance syndrome | FAERS: 2 | US FAERS | |
| 636 | Intention tremor | FAERS: 2 | US FAERS | |
| 637 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 638 | Intentional self-injury | FAERS: 2 | US FAERS | |
| 639 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 640 | Labile blood pressure | FAERS: 2 | US FAERS | |
| 641 | Lacrimation decreased | FAERS: 2 | US FAERS | |
| 642 | Life expectancy shortened | FAERS: 2 | US FAERS | |
| 643 | Limb prosthesis user | FAERS: 2 | US FAERS | |
| 644 | Living in residential institution | FAERS: 2 | US FAERS | |
| 645 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 646 | Malignant melanoma stage II | FAERS: 2 | US FAERS | |
| 647 | Malnutrition | FAERS: 2 | US FAERS | |
| 648 | Mechanical ventilation | FAERS: 2 | US FAERS | |
| 649 | Meniscus removal | FAERS: 2 | US FAERS | |
| 650 | Mental Retardation | FAERS: 2 | US FAERS | |
| 651 | Metastatic Neoplasm | FAERS: 2 | US FAERS | |
| 652 | Mouth cyst | FAERS: 2 | US FAERS | |
| 653 | Muscular Dystrophy | FAERS: 2 | US FAERS | |
| 654 | Mycotic allergy | FAERS: 2 | US FAERS | |
| 655 | Myoclonus | FAERS: 2 | US FAERS | |
| 656 | Narcolepsy | FAERS: 2 | US FAERS | |
| 657 | Nasopharyngeal reflux | FAERS: 2 | US FAERS | |
| 658 | Nerve Degeneration | FAERS: 2 | US FAERS | |
| 659 | Obesity surgery | FAERS: 2 | US FAERS | |
| 660 | Obsessive-Compulsive Disorder | FAERS: 2 | US FAERS | |
| 661 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 662 | Oral infection | FAERS: 2 | US FAERS | |
| 663 | Oral mucosal exfoliation | FAERS: 2 | US FAERS | |
| 664 | Oropharyngeal candidiasis | FAERS: 2 | US FAERS | |
| 665 | Osteogenesis Imperfecta | FAERS: 2 | US FAERS | |
| 666 | Pancreatic Cyst | FAERS: 2 | US FAERS | |
| 667 | Peripheral nerve lesion | FAERS: 2 | US FAERS | |
| 668 | Pertussis | FAERS: 2 | US FAERS | |
| 669 | Petechiae | FAERS: 2 | US FAERS | |
| 670 | Physical disability | FAERS: 2 | US FAERS | |
| 671 | Post-traumatic neck syndrome | FAERS: 2 | US FAERS | |
| 672 | Postoperative adhesion | FAERS: 2 | US FAERS | |
| 673 | Potentiating drug interaction | FAERS: 2 | US FAERS | |
| 674 | Product label issue | FAERS: 2 | US FAERS | |
| 675 | Product use issue | FAERS: 2 | US FAERS | |
| 676 | Pseudoangina | FAERS: 2 | US FAERS | |
| 677 | Reaction to excipient | FAERS: 2 | US FAERS | |
| 678 | Renal Colic | FAERS: 2 | US FAERS | |
| 679 | Respiratory distress | FAERS: 2 | US FAERS | |
| 680 | Retinal Artery Occlusion | FAERS: 2 | US FAERS | |
| 681 | Rhinitis | FAERS: 2 | US FAERS | |
| 682 | Serum Sickness | FAERS: 2 | US FAERS | |
| 683 | Shock | FAERS: 2 | US FAERS | |
| 684 | Single functional kidney | FAERS: 2 | US FAERS | |
| 685 | Sinus operation | FAERS: 2 | US FAERS | |
| 686 | Sluggishness | FAERS: 2 | US FAERS | |
| 687 | Spinal fusion acquired | FAERS: 2 | US FAERS | |
| 688 | Splenic Rupture | FAERS: 2 | US FAERS | |
| 689 | Stillbirth | FAERS: 2 | US FAERS | |
| 690 | Sudden death | FAERS: 2 | US FAERS | |
| 691 | Sunburn | FAERS: 2 | US FAERS | |
| 692 | Tachyphylaxis | FAERS: 2 | US FAERS | |
| 693 | Temperature intolerance | FAERS: 2 | US FAERS | |
| 694 | Theft | FAERS: 2 | US FAERS | |
| 695 | Therapeutic response delayed | FAERS: 2 | US FAERS | |
| 696 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 697 | Tonsillitis | FAERS: 2 | US FAERS | |
| 698 | Transplant | FAERS: 2 | US FAERS | |
| 699 | Trigeminal Neuralgia | FAERS: 2 | US FAERS | |
| 700 | Tuberculosis | FAERS: 2 | US FAERS | |
| 701 | Upper respiratory tract inflammation | FAERS: 2 | US FAERS | |
| 702 | Vasculitis | FAERS: 2 | US FAERS | |
| 703 | Visceral congestion | FAERS: 2 | US FAERS | |
| 704 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 705 | Vulvovaginal pain | FAERS: 2 | US FAERS | |
| 706 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 707 | West Nile viral infection | FAERS: 2 | US FAERS | |
| 708 | Yawning | FAERS: 2 | US FAERS | |
| 709 | intensive care | FAERS: 2 | US FAERS | |
| 710 | kyphosis | FAERS: 2 | US FAERS | |
| 711 | prostatitis | FAERS: 2 | US FAERS | |
| 712 | treatment failure | FAERS: 2 | US FAERS | |
| 713 | Abscess of salivary gland | FAERS: 1 | US FAERS | |
| 714 | Achlorhydria | FAERS: 1 | US FAERS | |
| 715 | Acne | FAERS: 1 | US FAERS | |
| 716 | Acromegaly | FAERS: 1 | US FAERS | |
| 717 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 718 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 719 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 720 | Adiposis Dolorosa | FAERS: 1 | US FAERS | |
| 721 | Agoraphobia | FAERS: 1 | US FAERS | |
| 722 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 723 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 724 | Amputation | FAERS: 1 | US FAERS | |
| 725 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 726 | Animal bite | FAERS: 1 | US FAERS | |
| 727 | Antibiotic resistant Staphylococcus test | FAERS: 1 | US FAERS | |
| 728 | Antiphospholipid Syndrome | FAERS: 1 | US FAERS | |
| 729 | Antipsychotic drug level increased | FAERS: 1 | US FAERS | |
| 730 | Anuria | FAERS: 1 | US FAERS | |
| 731 | Aortic Injury | FAERS: 1 | US FAERS | |
| 732 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 733 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 734 | Application site discharge | FAERS: 1 | US FAERS | |
| 735 | Arterial Injury | FAERS: 1 | US FAERS | |
| 736 | Arterial therapeutic procedure | FAERS: 1 | US FAERS | |
| 737 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 738 | Astigmatism | FAERS: 1 | US FAERS | |
| 739 | Atelectasis | FAERS: 1 | US FAERS | |
| 740 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 741 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 742 | Aura | FAERS: 1 | US FAERS | |
| 743 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 744 | Autoimmune thrombocytopenia | FAERS: 1 | US FAERS | |
| 745 | Bed rest | FAERS: 1 | US FAERS | |
| 746 | Benign neoplasm of thyroid gland | FAERS: 1 | US FAERS | |
| 747 | Bile output increased | FAERS: 1 | US FAERS | |
| 748 | Biliary Dyskinesia | FAERS: 1 | US FAERS | |
| 749 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 750 | Biopsy bone marrow abnormal | FAERS: 1 | US FAERS | |
| 751 | Biopsy breast abnormal | FAERS: 1 | US FAERS | |
| 752 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 753 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 754 | Bladder pain | FAERS: 1 | US FAERS | |
| 755 | Bladder spasm | FAERS: 1 | US FAERS | |
| 756 | Blepharitis | FAERS: 1 | US FAERS | |
| 757 | Blood Pressure | FAERS: 1 | US FAERS | |
| 758 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 759 | Blood alkaline phosphatase abnormal | FAERS: 1 | US FAERS | |
| 760 | Blood alkaline phosphatase | FAERS: 1 | US FAERS | |
| 761 | Blood calcitonin | FAERS: 1 | US FAERS | |
| 762 | Blood calcium abnormal | FAERS: 1 | US FAERS | |
| 763 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 764 | Blood iron increased | FAERS: 1 | US FAERS | |
| 765 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 766 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 767 | Blood urea nitrogen/creatinine ratio increased | FAERS: 1 | US FAERS | |
| 768 | Blood urine present | FAERS: 1 | US FAERS | |
| 769 | Bone decalcification | FAERS: 1 | US FAERS | |
| 770 | Bone erosion | FAERS: 1 | US FAERS | |
| 771 | Bone formation decreased | FAERS: 1 | US FAERS | |
| 772 | Bone marrow depression | FAERS: 1 | US FAERS | |
| 773 | Breath Holding | FAERS: 1 | US FAERS | |
| 774 | Breech Presentation | FAERS: 1 | US FAERS | |
| 775 | Bronchial irritation | FAERS: 1 | US FAERS | |
| 776 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 777 | Budd-Chiari Syndrome | FAERS: 1 | US FAERS | |
| 778 | Bulimia Nervosa | FAERS: 1 | US FAERS | |
| 779 | Calcinosis | FAERS: 1 | US FAERS | |
| 780 | Campylobacter infection | FAERS: 1 | US FAERS | |
| 781 | Capsule issue | FAERS: 1 | US FAERS | |
| 782 | Capsule physical issue | FAERS: 1 | US FAERS | |
| 783 | Carcinoma in Situ | FAERS: 1 | US FAERS | |
| 784 | Carcinoma | FAERS: 1 | US FAERS | |
| 785 | Cardiac infection | FAERS: 1 | US FAERS | |
| 786 | Cardiac valve prosthesis user | FAERS: 1 | US FAERS | |
| 787 | Cardioactive drug level increased | FAERS: 1 | US FAERS | |
| 788 | Cardiovascular evaluation | FAERS: 1 | US FAERS | |
| 789 | Catheter related complication | FAERS: 1 | US FAERS | |
| 790 | Catheter related infection | FAERS: 1 | US FAERS | |
| 791 | Catheter site pain | FAERS: 1 | US FAERS | |
| 792 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 793 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 794 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 795 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 796 | Cervical dysplasia | FAERS: 1 | US FAERS | |
| 797 | Cervicobrachial syndrome | FAERS: 1 | US FAERS | |
| 798 | Cervix carcinoma recurrent | FAERS: 1 | US FAERS | |
| 799 | Cholecystitis | FAERS: 1 | US FAERS | |
| 800 | Cholecystostomy | FAERS: 1 | US FAERS | |
| 801 | Chorioretinitis | FAERS: 1 | US FAERS | |
| 802 | Claustrophobia | FAERS: 1 | US FAERS | |
| 803 | Clostridium colitis | FAERS: 1 | US FAERS | |
| 804 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 805 | Colon adenoma | FAERS: 1 | US FAERS | |
| 806 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 807 | Contrast media allergy | FAERS: 1 | US FAERS | |
| 808 | Corneal Infection | FAERS: 1 | US FAERS | |
| 809 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 810 | Dependence | FAERS: 1 | US FAERS | |
| 811 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 812 | Device malfunction | FAERS: 1 | US FAERS | |
| 813 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 814 | Diabetic Retinopathy | FAERS: 1 | US FAERS | |
| 815 | Diet refusal | FAERS: 1 | US FAERS | |
| 816 | Disease Progression | FAERS: 1 | US FAERS | |
| 817 | Disease complication | FAERS: 1 | US FAERS | |
| 818 | Drug abuse | FAERS: 1 | US FAERS | |
| 819 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 820 | Drug exposure before pregnancy | FAERS: 1 | US FAERS | |
| 821 | Drug resistance | FAERS: 1 | US FAERS | |
| 822 | Dysentery | FAERS: 1 | US FAERS | |
| 823 | Dysphemia | FAERS: 1 | US FAERS | |
| 824 | Early satiety | FAERS: 1 | US FAERS | |
| 825 | Enamel anomaly | FAERS: 1 | US FAERS | |
| 826 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 827 | Endometrial Hyperplasia | FAERS: 1 | US FAERS | |
| 828 | Endoscopy abnormal | FAERS: 1 | US FAERS | |
| 829 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 830 | Eosinophilic cystitis | FAERS: 1 | US FAERS | |
| 831 | Epiglottic carcinoma | FAERS: 1 | US FAERS | |
| 832 | Erosive Duodenitis | FAERS: 1 | US FAERS | |
| 833 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 834 | Exophthalmos | FAERS: 1 | US FAERS | |
| 835 | Extra dose administered | FAERS: 1 | US FAERS | |
| 836 | Extranodal marginal zone B-cell lymphoma (MALT type) | FAERS: 1 | US FAERS | |
| 837 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 838 | Extravasation | FAERS: 1 | US FAERS | |
| 839 | Eyelid exfoliation | FAERS: 1 | US FAERS | |
| 840 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 841 | Facial Paresis | FAERS: 1 | US FAERS | |
| 842 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 843 | False positive investigation result | FAERS: 1 | US FAERS | |
| 844 | Fasciitis | FAERS: 1 | US FAERS | |
| 845 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 846 | Flatback syndrome | FAERS: 1 | US FAERS | |
| 847 | Food craving | FAERS: 1 | US FAERS | |
| 848 | Foreign body aspiration | FAERS: 1 | US FAERS | |
| 849 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 850 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 851 | Formication | FAERS: 1 | US FAERS | |
| 852 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 853 | Frustration | FAERS: 1 | US FAERS | |
| 854 | Gastric hypertonia | FAERS: 1 | US FAERS | |
| 855 | Gastric polypectomy | FAERS: 1 | US FAERS | |
| 856 | Gastric ulcer helicobacter | FAERS: 1 | US FAERS | |
| 857 | Gastrointestinal anthrax | FAERS: 1 | US FAERS | |
| 858 | Gastrointestinal arteriovenous malformation | FAERS: 1 | US FAERS | |
| 859 | Gastrointestinal disorder postoperative | FAERS: 1 | US FAERS | |
| 860 | Gastrointestinal endoscopic therapy | FAERS: 1 | US FAERS | |
| 861 | Gastrointestinal mucosal exfoliation | FAERS: 1 | US FAERS | |
| 862 | Gastrointestinal stenosis | FAERS: 1 | US FAERS | |
| 863 | Genital Herpes | FAERS: 1 | US FAERS | |
| 864 | Gingivitis | FAERS: 1 | US FAERS | |
| 865 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 866 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 867 | Granuloma | FAERS: 1 | US FAERS | |
| 868 | Growth retardation | FAERS: 1 | US FAERS | |
| 869 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 870 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 871 | Helicobacter test positive | FAERS: 1 | US FAERS | |
| 872 | Hemiplegia | FAERS: 1 | US FAERS | |
| 873 | Hepatic Infection | FAERS: 1 | US FAERS | |
| 874 | Hepatitis B | FAERS: 1 | US FAERS | |
| 875 | High density lipoprotein abnormal | FAERS: 1 | US FAERS | |
| 876 | High density lipoprotein increased | FAERS: 1 | US FAERS | |
| 877 | High frequency ablation | FAERS: 1 | US FAERS | |
| 878 | Holoprosencephaly | FAERS: 1 | US FAERS | |
| 879 | Homicide | FAERS: 1 | US FAERS | |
| 880 | Hospice Care | FAERS: 1 | US FAERS | |
| 881 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 882 | Hydropneumothorax | FAERS: 1 | US FAERS | |
| 883 | Hyperacusis | FAERS: 1 | US FAERS | |
| 884 | Hyperemesis Gravidarum | FAERS: 1 | US FAERS | |
| 885 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 886 | Hypocoagulable state | FAERS: 1 | US FAERS | |
| 887 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 888 | Hypothalamo-pituitary disorder | FAERS: 1 | US FAERS | |
| 889 | Hypoventilation | FAERS: 1 | US FAERS | |
| 890 | Idiopathic Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 891 | Ileitis | FAERS: 1 | US FAERS | |
| 892 | Ileus | FAERS: 1 | US FAERS | |
| 893 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 894 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 895 | Incontinence | FAERS: 1 | US FAERS | |
| 896 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 897 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 898 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 899 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 900 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 901 | Infantile spitting up | FAERS: 1 | US FAERS | |
| 902 | Infertility | FAERS: 1 | US FAERS | |
| 903 | Infusion Site Extravasation | FAERS: 1 | US FAERS | |
| 904 | Infusion site infection | FAERS: 1 | US FAERS | |
| 905 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 906 | Injection site irritation | FAERS: 1 | US FAERS | |
| 907 | Insulin Resistance | FAERS: 1 | US FAERS | |
| 908 | Intelligence test abnormal | FAERS: 1 | US FAERS | |
| 909 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 910 | Intentional misuse | FAERS: 1 | US FAERS | |
| 911 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 912 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 913 | Intestinal mucosal atrophy | FAERS: 1 | US FAERS | |
| 914 | Intracranial Hypotension | FAERS: 1 | US FAERS | |
| 915 | Intussusception | FAERS: 1 | US FAERS | |
| 916 | Irregular sleep phase | FAERS: 1 | US FAERS | |
| 917 | Joint deposit | FAERS: 1 | US FAERS | |
| 918 | Juvenile Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 919 | Kounis Syndrome | FAERS: 1 | US FAERS | |
| 920 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 921 | Lacrimal duct procedure | FAERS: 1 | US FAERS | |
| 922 | Laryngeal prosthesis user | FAERS: 1 | US FAERS | |
| 923 | Laryngoscopy | FAERS: 1 | US FAERS | |
| 924 | Larynx irritation | FAERS: 1 | US FAERS | |
| 925 | Laziness | FAERS: 1 | US FAERS | |
| 926 | Lentigo | FAERS: 1 | US FAERS | |
| 927 | Leukocytosis | FAERS: 1 | US FAERS | |
| 928 | Lichen Planus | FAERS: 1 | US FAERS | |
| 929 | Ligament injury | FAERS: 1 | US FAERS | |
| 930 | Lip Infection | FAERS: 1 | US FAERS | |
| 931 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 932 | Lipids abnormal | FAERS: 1 | US FAERS | |
| 933 | Lipoma | FAERS: 1 | US FAERS | |
| 934 | Liver Abscess | FAERS: 1 | US FAERS | |
| 935 | Localised intraabdominal fluid collection | FAERS: 1 | US FAERS | |
| 936 | Low density lipoprotein abnormal | FAERS: 1 | US FAERS | |
| 937 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 938 | Lower respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 939 | Lung Injury | FAERS: 1 | US FAERS | |
| 940 | Lung cyst | FAERS: 1 | US FAERS | |
| 941 | Lupus enteritis | FAERS: 1 | US FAERS | |
| 942 | Malignant dysphagia | FAERS: 1 | US FAERS | |
| 943 | Mantle cell lymphoma | FAERS: 1 | US FAERS | |
| 944 | Mastectomy | FAERS: 1 | US FAERS | |
| 945 | Mastitis | FAERS: 1 | US FAERS | |
| 946 | Mastoiditis | FAERS: 1 | US FAERS | |
| 947 | Medical device implantation | FAERS: 1 | US FAERS | |
| 948 | Medical device pain | FAERS: 1 | US FAERS | |
| 949 | Medical diet | FAERS: 1 | US FAERS | |
| 950 | Medical observation abnormal | FAERS: 1 | US FAERS | |
| 951 | Melanoma recurrent | FAERS: 1 | US FAERS | |
| 952 | Mental status changes | FAERS: 1 | US FAERS | |
| 953 | Mesenteric Panniculitis | FAERS: 1 | US FAERS | |
| 954 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 955 | Metaplasia | FAERS: 1 | US FAERS | |
| 956 | Metatarsalgia | FAERS: 1 | US FAERS | |
| 957 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 958 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 959 | Milk Allergy | FAERS: 1 | US FAERS | |
| 960 | Mineral supplementation | FAERS: 1 | US FAERS | |
| 961 | Mixed liver injury | FAERS: 1 | US FAERS | |
| 962 | Mononucleosis syndrome | FAERS: 1 | US FAERS | |
| 963 | Mood swings | FAERS: 1 | US FAERS | |
| 964 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 965 | Mouth swelling | FAERS: 1 | US FAERS | |
| 966 | Mucosal erosion | FAERS: 1 | US FAERS | |
| 967 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 968 | Mutism | FAERS: 1 | US FAERS | |
| 969 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 970 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 971 | Mydriasis | FAERS: 1 | US FAERS | |
| 972 | Myelitis | FAERS: 1 | US FAERS | |
| 973 | Myelofibrosis | FAERS: 1 | US FAERS | |
| 974 | Myositis | FAERS: 1 | US FAERS | |
| 975 | Myotonia | FAERS: 1 | US FAERS | |
| 976 | Nail Infection | FAERS: 1 | US FAERS | |
| 977 | Nasal Polyps | FAERS: 1 | US FAERS | |
| 978 | Nephrectomy | FAERS: 1 | US FAERS | |
| 979 | Nephritis allergic | FAERS: 1 | US FAERS | |
| 980 | Nephroangiosclerosis | FAERS: 1 | US FAERS | |
| 981 | Nephrosclerosis | FAERS: 1 | US FAERS | |
| 982 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 983 | Nerve Root Compression | FAERS: 1 | US FAERS | |
| 984 | Neurectomy | FAERS: 1 | US FAERS | |
| 985 | Neuroma | FAERS: 1 | US FAERS | |
| 986 | Neuropathy | FAERS: 1 | US FAERS | |
| 987 | Nipple pain | FAERS: 1 | US FAERS | |
| 988 | No adverse effect | FAERS: 1 | US FAERS | |
| 989 | Nocturia | FAERS: 1 | US FAERS | |
| 990 | Nuchal Rigidity | FAERS: 1 | US FAERS | |
| 991 | Obesity | FAERS: 1 | US FAERS | |
| 992 | Ocular icterus | FAERS: 1 | US FAERS | |
| 993 | Oligohydramnios | FAERS: 1 | US FAERS | |
| 994 | Oliguria | FAERS: 1 | US FAERS | |
| 995 | Onychoclasis | FAERS: 1 | US FAERS | |
| 996 | Open wound | FAERS: 1 | US FAERS | |
| 997 | Ophthalmoplegia | FAERS: 1 | US FAERS | |
| 998 | Oral discharge | FAERS: 1 | US FAERS | |
| 999 | Oropharyngeal spasm | FAERS: 1 | US FAERS | |
| 1000 | Oropharyngeal surgery | FAERS: 1 | US FAERS | |
| 1001 | Orthosis user | FAERS: 1 | US FAERS | |
| 1002 | Osteitis | FAERS: 1 | US FAERS | |
| 1003 | Oxygen Consumption | FAERS: 1 | US FAERS | |
| 1004 | Pain management | FAERS: 1 | US FAERS | |
| 1005 | Pancreatectomy | FAERS: 1 | US FAERS | |
| 1006 | Pancreatic duct obstruction | FAERS: 1 | US FAERS | |
| 1007 | Pancreatic operation | FAERS: 1 | US FAERS | |
| 1008 | Parent-child problem | FAERS: 1 | US FAERS | |
| 1009 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 1010 | Pathological fracture | FAERS: 1 | US FAERS | |
| 1011 | Patient-device incompatibility | FAERS: 1 | US FAERS | |
| 1012 | Pelvic floor dyssynergia | FAERS: 1 | US FAERS | |
| 1013 | Peptic Ulcer Perforation | FAERS: 1 | US FAERS | |
| 1014 | Periodontitis | FAERS: 1 | US FAERS | |
| 1015 | Phagophobia | FAERS: 1 | US FAERS | |
| 1016 | Pharyngeal Stenosis | FAERS: 1 | US FAERS | |
| 1017 | Pharyngeal cancer recurrent | FAERS: 1 | US FAERS | |
| 1018 | Pharyngeal dyskinesia | FAERS: 1 | US FAERS | |
| 1019 | Pharyngeal lesion | FAERS: 1 | US FAERS | |
| 1020 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 1021 | Phlebitis | FAERS: 1 | US FAERS | |
| 1022 | Physical assault | FAERS: 1 | US FAERS | |
| 1023 | Pneumonitis | FAERS: 1 | US FAERS | |
| 1024 | Poisoning | FAERS: 1 | US FAERS | |
| 1025 | Polyarthritis | FAERS: 1 | US FAERS | |
| 1026 | Polyuria | FAERS: 1 | US FAERS | |
| 1027 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 1028 | Post procedural infection | FAERS: 1 | US FAERS | |
| 1029 | Post procedural pneumonia | FAERS: 1 | US FAERS | |
| 1030 | Post-Traumatic Headache | FAERS: 1 | US FAERS | |
| 1031 | Post-tussive vomiting | FAERS: 1 | US FAERS | |
| 1032 | Posterior capsule opacification | FAERS: 1 | US FAERS | |
| 1033 | Postoperative respiratory distress | FAERS: 1 | US FAERS | |
| 1034 | Precancerous skin lesion | FAERS: 1 | US FAERS | |
| 1035 | Pregnancy | FAERS: 1 | US FAERS | |
| 1036 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 1037 | Product contamination physical | FAERS: 1 | US FAERS | |
| 1038 | Product counterfeit | FAERS: 1 | US FAERS | |
| 1039 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 1040 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 1041 | Product packaging issue | FAERS: 1 | US FAERS | |
| 1042 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 1043 | Product physical issue | FAERS: 1 | US FAERS | |
| 1044 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 1045 | Product tampering | FAERS: 1 | US FAERS | |
| 1046 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 1047 | Prosthesis Implantation | FAERS: 1 | US FAERS | |
| 1048 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 1049 | Pubic pain | FAERS: 1 | US FAERS | |
| 1050 | Purpura | FAERS: 1 | US FAERS | |
| 1051 | Pylorus dilatation | FAERS: 1 | US FAERS | |
| 1052 | Radial nerve palsy | FAERS: 1 | US FAERS | |
| 1053 | Radiation injury | FAERS: 1 | US FAERS | |
| 1054 | Radical Neck Dissection | FAERS: 1 | US FAERS | |
| 1055 | Radical hysterectomy | FAERS: 1 | US FAERS | |
| 1056 | Radiotherapy to breast | FAERS: 1 | US FAERS | |
| 1057 | Rales | FAERS: 1 | US FAERS | |
| 1058 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 1059 | Rectal abscess | FAERS: 1 | US FAERS | |
| 1060 | Rectal discharge | FAERS: 1 | US FAERS | |
| 1061 | Rectal spasm | FAERS: 1 | US FAERS | |
| 1062 | Regurgitation of food | FAERS: 1 | US FAERS | |
| 1063 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 1064 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 1065 | Respiratory tract ulceration | FAERS: 1 | US FAERS | |
| 1066 | Retinal infarction | FAERS: 1 | US FAERS | |
| 1067 | Rheumatoid factor increased | FAERS: 1 | US FAERS | |
| 1068 | Rickets | FAERS: 1 | US FAERS | |
| 1069 | Saliva altered | FAERS: 1 | US FAERS | |
| 1070 | Scleritis | FAERS: 1 | US FAERS | |
| 1071 | Scotoma | FAERS: 1 | US FAERS | |
| 1072 | Scrotal Infection | FAERS: 1 | US FAERS | |
| 1073 | Self-induced vomiting | FAERS: 1 | US FAERS | |
| 1074 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 1075 | Sight disability | FAERS: 1 | US FAERS | |
| 1076 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 1077 | Skin Erosion | FAERS: 1 | US FAERS | |
| 1078 | Skin irritation | FAERS: 1 | US FAERS | |
| 1079 | Skin lesion | FAERS: 1 | US FAERS | |
| 1080 | Skin neoplasm excision | FAERS: 1 | US FAERS | |
| 1081 | Skin test negative | FAERS: 1 | US FAERS | |
| 1082 | Sleep disorder due to general medical condition, parasomnia type | FAERS: 1 | US FAERS | |
| 1083 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 1084 | Small intestinal bacterial overgrowth | FAERS: 1 | US FAERS | |
| 1085 | Small intestine carcinoma | FAERS: 1 | US FAERS | |
| 1086 | Snoring | FAERS: 1 | US FAERS | |
| 1087 | Sperm concentration decreased | FAERS: 1 | US FAERS | |
| 1088 | Spinal cord herniation | FAERS: 1 | US FAERS | |
| 1089 | Splinter | FAERS: 1 | US FAERS | |
| 1090 | Spondylitis | FAERS: 1 | US FAERS | |
| 1091 | Spondylolisthesis | FAERS: 1 | US FAERS | |
| 1092 | Staphylococcal osteomyelitis | FAERS: 1 | US FAERS | |
| 1093 | Starvation | FAERS: 1 | US FAERS | |
| 1094 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 1095 | Stent malfunction | FAERS: 1 | US FAERS | |
| 1096 | Stridor | FAERS: 1 | US FAERS | |
| 1097 | Sudden Visual Loss | FAERS: 1 | US FAERS | |
| 1098 | Superior Vena Cava Syndrome | FAERS: 1 | US FAERS | |
| 1099 | Supplementation therapy | FAERS: 1 | US FAERS | |
| 1100 | Suprapubic pain | FAERS: 1 | US FAERS | |
| 1101 | Suture insertion | FAERS: 1 | US FAERS | |
| 1102 | Suture related complication | FAERS: 1 | US FAERS | |
| 1103 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 1104 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 1105 | Tension | FAERS: 1 | US FAERS | |
| 1106 | Therapeutic product effect variable | FAERS: 1 | US FAERS | |
| 1107 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 1108 | Therapeutic product ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 1109 | Therapy change | FAERS: 1 | US FAERS | |
| 1110 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 1111 | Thirst decreased | FAERS: 1 | US FAERS | |
| 1112 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 1113 | Thrombosed varicose vein | FAERS: 1 | US FAERS | |
| 1114 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 1115 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 1116 | Thyroiditis | FAERS: 1 | US FAERS | |
| 1117 | Toe operation | FAERS: 1 | US FAERS | |
| 1118 | Tongue biting | FAERS: 1 | US FAERS | |
| 1119 | Tongue carcinoma stage IV | FAERS: 1 | US FAERS | |
| 1120 | Tongue dysplasia | FAERS: 1 | US FAERS | |
| 1121 | Tonsillectomy | FAERS: 1 | US FAERS | |
| 1122 | Tooth Infection | FAERS: 1 | US FAERS | |
| 1123 | Torticollis | FAERS: 1 | US FAERS | |
| 1124 | Total lung capacity increased | FAERS: 1 | US FAERS | |
| 1125 | Transmission of drug via semen | FAERS: 1 | US FAERS | |
| 1126 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 1127 | Trismus | FAERS: 1 | US FAERS | |
| 1128 | Trisomy 21 | FAERS: 1 | US FAERS | |
| 1129 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 1130 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 1131 | Upper airway obstruction | FAERS: 1 | US FAERS | |
| 1132 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 1133 | Vagal nerve stimulator implantation | FAERS: 1 | US FAERS | |
| 1134 | Vascular calcification | FAERS: 1 | US FAERS | |
| 1135 | Vascular dissection | FAERS: 1 | US FAERS | |
| 1136 | Vascular stenosis | FAERS: 1 | US FAERS | |
| 1137 | Vascular stent insertion | FAERS: 1 | US FAERS | |
| 1138 | Vein pain | FAERS: 1 | US FAERS | |
| 1139 | Venous occlusion | FAERS: 1 | US FAERS | |
| 1140 | Venous valve ruptured | FAERS: 1 | US FAERS | |
| 1141 | Vitamin B1 decreased | FAERS: 1 | US FAERS | |
| 1142 | Vitamin B12 abnormal | FAERS: 1 | US FAERS | |
| 1143 | Vitamin D abnormal | FAERS: 1 | US FAERS | |
| 1144 | Vocal cord cyst | FAERS: 1 | US FAERS | |
| 1145 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 1146 | Wolff-Parkinson-White Syndrome | FAERS: 1 | US FAERS | |
| 1147 | Wound Infection | FAERS: 1 | US FAERS | |
| 1148 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 1149 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 1150 | X-ray with contrast upper gastrointestinal tract | FAERS: 1 | US FAERS | |
| 1151 | diagnostic procedure | FAERS: 1 | US FAERS | |
| 1152 | effusion | FAERS: 1 | US FAERS | |
| 1153 | fibroma | FAERS: 1 | US FAERS | |
| 1154 | muscle injury | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.