apremilast
(IMOZEMNVLZVGJZ-QGZVFWFLSA-N)
Structure
- SMILES
- CCOc1cc(ccc1OC)[C@H](N1C(=O)c2c(C1=O)c(ccc2)NC(=O)C)CS(=O)(=O)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- L04AA32
- Molecular Formula:
- C22H24N2O7S
- Molecular Weight:
- 460.500
- Log P:
- 3.5259
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 1
- TPSA:
- 127.46
- CAS Number(s):
- 608141-41-9
Synonym(s)
1.
apremilast
2.
CC 10004
3.
CC-10004
4.
CC10004
5.
Otezla
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 9338 Canada Vigilance: 19 | Canada Vigilance SIDER US FAERS | |
| 2 | Headache | FAERS: 7497 Canada Vigilance: 12 | Canada Vigilance SIDER US FAERS | |
| 3 | Psoriasis | FAERS: 6155 Canada Vigilance: 17 | Canada Vigilance US FAERS | |
| 4 | Drug ineffective | FAERS: 5217 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 5 | Abdominal discomfort | FAERS: 2718 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 6 | Weight decreased | FAERS: 1908 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 7 | Vomiting | FAERS: 1732 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 8 | Drug dose omission | FAERS: 1556 | US FAERS | |
| 9 | Malaise | FAERS: 1333 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 10 | Fatigue | FAERS: 1140 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Arthralgia | FAERS: 1098 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Product dose omission | FAERS: 1068 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 13 | Pain | FAERS: 1021 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 14 | Pruritus | FAERS: 1012 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 15 | Dizziness | FAERS: 884 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 16 | Nasopharyngitis | FAERS: 804 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 17 | Therapy non-responder | FAERS: 760 | US FAERS | |
| 18 | Dyspepsia | FAERS: 527 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 19 | Abdominal Pain | FAERS: 526 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 20 | Back Pain | FAERS: 517 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 21 | Anxiety | FAERS: 463 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 22 | Feeling abnormal | FAERS: 451 | US FAERS | |
| 23 | Unevaluable event | FAERS: 425 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 24 | Influenza | FAERS: 424 | US FAERS | |
| 25 | Sinusitis | FAERS: 385 | US FAERS | |
| 26 | Asthenia | FAERS: 345 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Arthropathy | FAERS: 335 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 28 | Alopecia | FAERS: 325 | US FAERS | |
| 29 | Peripheral swelling | FAERS: 316 | US FAERS | |
| 30 | Flatulence | FAERS: 301 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 31 | Pneumonia | FAERS: 299 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 32 | Tremor | FAERS: 295 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 33 | Bronchitis | FAERS: 287 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Stress | FAERS: 284 | US FAERS | |
| 35 | Myalgia | FAERS: 275 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Memory impairment | FAERS: 274 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Constipation | FAERS: 266 | US FAERS | |
| 38 | Hypersensitivity | FAERS: 254 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 39 | Arthritis | FAERS: 226 | US FAERS | |
| 40 | Urinary tract infection | FAERS: 224 | US FAERS | |
| 41 | Urticaria | FAERS: 219 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Adverse event | FAERS: 213 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 43 | Infection | FAERS: 197 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 44 | Chest Pain | FAERS: 193 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Drug effect incomplete | FAERS: 193 | US FAERS | |
| 46 | Therapy cessation | FAERS: 189 | US FAERS | |
| 47 | Joint swelling | FAERS: 186 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 48 | Incorrect dose administered | FAERS: 184 | US FAERS | |
| 49 | Palpitations | FAERS: 173 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 50 | Oropharyngeal pain | FAERS: 171 | US FAERS | |
| 51 | Dry skin | FAERS: 168 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Tension Headache | FAERS: 167 | US FAERS | |
| 53 | Depressed mood | FAERS: 162 | US FAERS | |
| 54 | Musculoskeletal stiffness | FAERS: 151 | US FAERS | |
| 55 | Erythema | FAERS: 139 | US FAERS | |
| 56 | Pregnancy | FAERS: 134 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 57 | Cerebrovascular accident | FAERS: 126 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Discomfort | FAERS: 125 | US FAERS | |
| 59 | Mood swings | FAERS: 125 | US FAERS | |
| 60 | treatment failure | FAERS: 121 | US FAERS | |
| 61 | Somnolence | FAERS: 120 | US FAERS | |
| 62 | Dehydration | FAERS: 117 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 63 | Myocardial Infarction | FAERS: 112 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 64 | Swelling | FAERS: 112 | US FAERS | |
| 65 | Dysgeusia | FAERS: 107 | US FAERS | |
| 66 | Nephrolithiasis | FAERS: 107 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Neck Pain | FAERS: 102 | US FAERS | |
| 68 | Lethargy | FAERS: 99 | US FAERS | |
| 69 | Back disorder | FAERS: 95 | US FAERS | |
| 70 | Chills | FAERS: 95 | US FAERS | |
| 71 | Nervousness | FAERS: 95 | US FAERS | |
| 72 | Musculoskeletal Pain | FAERS: 94 | US FAERS | |
| 73 | Disease recurrence | FAERS: 93 | US FAERS | |
| 74 | Cellulitis | FAERS: 92 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 75 | Multiple allergies | FAERS: 92 | US FAERS | |
| 76 | Vertigo | FAERS: 87 | US FAERS | |
| 77 | Asthma | FAERS: 83 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 78 | Burning sensation | FAERS: 82 | US FAERS | |
| 79 | Chest discomfort | FAERS: 82 | US FAERS | |
| 80 | Blood glucose increased | FAERS: 81 | US FAERS | |
| 81 | Diabetes Mellitus | FAERS: 81 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 82 | Inflammation | FAERS: 78 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Atrial Fibrillation | FAERS: 72 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 84 | Productive Cough | FAERS: 72 | US FAERS | |
| 85 | Crying | FAERS: 69 | US FAERS | |
| 86 | Inappropriate schedule of drug administration | FAERS: 68 | US FAERS | |
| 87 | Retching | FAERS: 67 | US FAERS | |
| 88 | Tinnitus | FAERS: 67 | US FAERS | |
| 89 | Therapeutic product effect decreased | FAERS: 65 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 90 | Bone pain | FAERS: 63 | US FAERS | |
| 91 | Rebound psoriasis | FAERS: 63 | US FAERS | |
| 92 | Epistaxis | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 93 | Feeling jittery | FAERS: 60 | US FAERS | |
| 94 | Visual Impairment | FAERS: 60 | US FAERS | |
| 95 | Sinus headache | FAERS: 59 | US FAERS | |
| 96 | Anger | FAERS: 57 | US FAERS | |
| 97 | Amnesia | FAERS: 56 | US FAERS | |
| 98 | Diverticulitis | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 99 | Limb discomfort | FAERS: 56 | US FAERS | |
| 100 | Acne | FAERS: 55 | US FAERS | |
| 101 | Gout | FAERS: 55 | US FAERS | |
| 102 | Pancreatitis | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 103 | Eructation | FAERS: 53 | US FAERS | |
| 104 | Bowel movement irregularity | FAERS: 51 | US FAERS | |
| 105 | Disease Progression | FAERS: 51 | US FAERS | |
| 106 | Limb injury | FAERS: 51 | US FAERS | |
| 107 | Therapy partial responder | FAERS: 50 | US FAERS | |
| 108 | Irritable Bowel Syndrome | FAERS: 49 | US FAERS | |
| 109 | Dysphonia | FAERS: 48 | US FAERS | |
| 110 | Hypotension | FAERS: 47 | US FAERS | |
| 111 | Agitation | FAERS: 46 | US FAERS | |
| 112 | Sepsis | FAERS: 45 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 113 | Wrong technique in product usage process | FAERS: 45 | US FAERS | |
| 114 | Emotional disorder | FAERS: 44 | US FAERS | |
| 115 | Joint stiffness | FAERS: 44 | US FAERS | |
| 116 | Cystitis | FAERS: 43 | US FAERS | |
| 117 | Expired product administered | FAERS: 43 | US FAERS | |
| 118 | Skin lesion | FAERS: 43 | US FAERS | |
| 119 | Viral upper respiratory tract infection | FAERS: 43 | US FAERS | |
| 120 | Respiratory tract congestion | FAERS: 42 | US FAERS | |
| 121 | Skin Ulcer | FAERS: 42 | US FAERS | |
| 122 | Cataract | FAERS: 41 | US FAERS | |
| 123 | General physical health deterioration | FAERS: 41 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 124 | Loss of personal independence in daily activities | FAERS: 41 | US FAERS | |
| 125 | Sneezing | FAERS: 40 | US FAERS | |
| 126 | Blood cholesterol increased | FAERS: 39 | US FAERS | |
| 127 | Rheumatoid Arthritis | FAERS: 39 | US FAERS | |
| 128 | Gastrointestinal Pain | FAERS: 38 | US FAERS | |
| 129 | Lymphadenopathy | FAERS: 38 | US FAERS | |
| 130 | Night sweats | FAERS: 38 | US FAERS | |
| 131 | Thrombosis | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 132 | Fibromyalgia | FAERS: 37 | US FAERS | |
| 133 | Head discomfort | FAERS: 37 | US FAERS | |
| 134 | Inappropriate schedule of product administration | FAERS: 37 | US FAERS | |
| 135 | Musculoskeletal discomfort | FAERS: 35 | US FAERS | |
| 136 | Rash erythematous | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 137 | Therapeutic product effect incomplete | FAERS: 34 | US FAERS | |
| 138 | Restlessness | FAERS: 33 | US FAERS | |
| 139 | Throat irritation | FAERS: 33 | US FAERS | |
| 140 | Colitis | FAERS: 32 | US FAERS | |
| 141 | Eczema | FAERS: 32 | US FAERS | |
| 142 | Gait inability | FAERS: 32 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 143 | Gastritis | FAERS: 32 | US FAERS | |
| 144 | Hepatitis C | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 145 | Hypersomnia | FAERS: 32 | US FAERS | |
| 146 | Joint injury | FAERS: 32 | US FAERS | |
| 147 | Hernia | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 148 | Muscle tightness | FAERS: 31 | US FAERS | |
| 149 | Dysuria | FAERS: 30 | US FAERS | |
| 150 | Lower respiratory tract infection | FAERS: 30 | US FAERS | |
| 151 | Muscle strain | FAERS: 30 | US FAERS | |
| 152 | Tooth Infection | FAERS: 30 | US FAERS | |
| 153 | Laryngitis | FAERS: 29 | US FAERS | |
| 154 | Skin irritation | FAERS: 29 | US FAERS | |
| 155 | Syncope | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 156 | Therapeutic response unexpected | FAERS: 29 | US FAERS | |
| 157 | Toothache | FAERS: 29 | US FAERS | |
| 158 | Onychoclasis | FAERS: 28 | US FAERS | |
| 159 | Tachycardia | FAERS: 28 | US FAERS | |
| 160 | Blood glucose decreased | FAERS: 27 | US FAERS | |
| 161 | Dementia | FAERS: 27 | US FAERS | |
| 162 | Eye Infection | FAERS: 27 | US FAERS | |
| 163 | Lip swelling | FAERS: 27 | US FAERS | |
| 164 | Renal pain | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 165 | Thirst | FAERS: 27 | US FAERS | |
| 166 | Flushing | FAERS: 26 | US FAERS | |
| 167 | Tuberculosis | FAERS: 26 | US FAERS | |
| 168 | Apathy | FAERS: 25 | US FAERS | |
| 169 | Chromaturia | FAERS: 25 | US FAERS | |
| 170 | Disorientation | FAERS: 25 | US FAERS | |
| 171 | Pain of skin | FAERS: 25 | US FAERS | |
| 172 | Poor quality sleep | FAERS: 25 | US FAERS | |
| 173 | Scab | FAERS: 25 | US FAERS | |
| 174 | Blood potassium decreased | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 175 | Menorrhagia | FAERS: 24 | US FAERS | |
| 176 | Papule | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 177 | Drug administration error | FAERS: 23 | US FAERS | |
| 178 | Secretion discharge | FAERS: 23 | US FAERS | |
| 179 | Ageusia | FAERS: 22 | US FAERS | |
| 180 | Cold sweat | FAERS: 22 | US FAERS | |
| 181 | Ear discomfort | FAERS: 22 | US FAERS | |
| 182 | Gastric ulcer | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 183 | Gastrointestinal sounds abnormal | FAERS: 22 | US FAERS | |
| 184 | Stomatitis | FAERS: 22 | US FAERS | |
| 185 | Therapy change | FAERS: 22 | US FAERS | |
| 186 | Wheezing | FAERS: 22 | US FAERS | |
| 187 | Blood creatinine increased | FAERS: 21 | US FAERS | |
| 188 | Intestinal Obstruction | FAERS: 21 | US FAERS | |
| 189 | Mycobacterium tuberculosis complex test positive | FAERS: 21 | US FAERS | |
| 190 | Neuralgia | FAERS: 21 | US FAERS | |
| 191 | Pulmonary congestion | FAERS: 21 | US FAERS | |
| 192 | Squamous cell carcinoma of skin | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 193 | Ulcer | FAERS: 21 | US FAERS | |
| 194 | Ankle Fracture | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 195 | Aphonia | FAERS: 20 | US FAERS | |
| 196 | Blood iron decreased | FAERS: 20 | US FAERS | |
| 197 | Eye pain | FAERS: 20 | US FAERS | |
| 198 | Laceration | FAERS: 20 | US FAERS | |
| 199 | Negative thoughts | FAERS: 20 | US FAERS | |
| 200 | Upper-airway cough syndrome | FAERS: 20 | US FAERS | |
| 201 | Blindness | FAERS: 19 | US FAERS | |
| 202 | Blood glucose abnormal | FAERS: 19 | US FAERS | |
| 203 | Blood urine present | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 204 | Depression suicidal | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 205 | Dermatitis | FAERS: 19 | SIDER US FAERS | |
| 206 | Epigastric discomfort | FAERS: 19 | US FAERS | |
| 207 | Feeling Cold | FAERS: 19 | US FAERS | |
| 208 | Medication Error | FAERS: 19 | US FAERS | |
| 209 | Rotator cuff syndrome | FAERS: 19 | US FAERS | |
| 210 | Sciatica | FAERS: 19 | US FAERS | |
| 211 | furuncle | FAERS: 19 | US FAERS | |
| 212 | Fracture | FAERS: 18 | US FAERS | |
| 213 | Lymphoma | FAERS: 18 | US FAERS | |
| 214 | Oral pain | FAERS: 18 | US FAERS | |
| 215 | Sluggishness | FAERS: 18 | US FAERS | |
| 216 | Suicide attempt | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 217 | Accidental overdose | FAERS: 17 | US FAERS | |
| 218 | Bipolar Disorder | FAERS: 17 | US FAERS | |
| 219 | Drug ineffective for unapproved indication | FAERS: 17 | US FAERS | |
| 220 | Food Poisoning | FAERS: 17 | US FAERS | |
| 221 | Multiple Sclerosis | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 222 | Abasia | FAERS: 16 | US FAERS | |
| 223 | Angina Pectoris | FAERS: 16 | US FAERS | |
| 224 | Basal cell carcinoma | FAERS: 16 | US FAERS | |
| 225 | Diplopia | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 226 | Musculoskeletal chest pain | FAERS: 16 | US FAERS | |
| 227 | Paranasal sinus discomfort | FAERS: 16 | US FAERS | |
| 228 | Upper respiratory tract congestion | FAERS: 16 | US FAERS | |
| 229 | White blood cell count decreased | FAERS: 16 | US FAERS | |
| 230 | Cholelithiasis | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 231 | Clostridium difficile infection | FAERS: 15 | US FAERS | |
| 232 | Cyst | FAERS: 15 | US FAERS | |
| 233 | No adverse event | FAERS: 15 | US FAERS | |
| 234 | Carpal Tunnel Syndrome | FAERS: 14 | US FAERS | |
| 235 | Folliculitis | FAERS: 14 | US FAERS | |
| 236 | Initial insomnia | FAERS: 14 | US FAERS | |
| 237 | Photophobia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 238 | Presyncope | FAERS: 14 | US FAERS | |
| 239 | Pustular psoriasis | FAERS: 14 | US FAERS | |
| 240 | Skin laceration | FAERS: 14 | US FAERS | |
| 241 | Gastrointestinal infection | FAERS: 13 | US FAERS | |
| 242 | Intentional product use issue | FAERS: 13 | US FAERS | |
| 243 | Meniscus injury | FAERS: 13 | US FAERS | |
| 244 | Skin reaction | FAERS: 13 | US FAERS | |
| 245 | Abscess | FAERS: 12 | US FAERS | |
| 246 | Breast tenderness | FAERS: 12 | US FAERS | |
| 247 | Cataract operation | FAERS: 12 | US FAERS | |
| 248 | Decreased immune responsiveness | FAERS: 12 | US FAERS | |
| 249 | Feeling of body temperature change | FAERS: 12 | US FAERS | |
| 250 | Hypophagia | FAERS: 12 | US FAERS | |
| 251 | Impaired work ability | FAERS: 12 | US FAERS | |
| 252 | Middle insomnia | FAERS: 12 | US FAERS | |
| 253 | Alanine Aminotransferase Increased | FAERS: 11 | US FAERS | |
| 254 | Bedridden | FAERS: 11 | US FAERS | |
| 255 | Eye irritation | FAERS: 11 | US FAERS | |
| 256 | Facial paralysis | FAERS: 11 | US FAERS | |
| 257 | Formication | FAERS: 11 | US FAERS | |
| 258 | Paranoia | FAERS: 11 | US FAERS | |
| 259 | Sunburn | FAERS: 11 | US FAERS | |
| 260 | Angioedema | FAERS: 10 | US FAERS | |
| 261 | Arthropod bite | FAERS: 10 | US FAERS | |
| 262 | Completed Suicide | FAERS: 10 | US FAERS | |
| 263 | Deafness | FAERS: 10 | US FAERS | |
| 264 | Drug effect delayed | FAERS: 10 | US FAERS | |
| 265 | Emotional distress | FAERS: 10 | US FAERS | |
| 266 | Full blood count decreased | FAERS: 10 | US FAERS | |
| 267 | Immunosuppression | FAERS: 10 | US FAERS | |
| 268 | Increased tendency to bruise | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 269 | Pancreatic carcinoma | FAERS: 10 | US FAERS | |
| 270 | Pleurisy | FAERS: 10 | US FAERS | |
| 271 | Septic Shock | FAERS: 10 | US FAERS | |
| 272 | Synovial Cyst | FAERS: 10 | US FAERS | |
| 273 | Activities of daily living impaired | FAERS: 9 | US FAERS | |
| 274 | Blood potassium increased | FAERS: 9 | US FAERS | |
| 275 | Blood sodium decreased | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 276 | Conjunctivitis | FAERS: 9 | US FAERS | |
| 277 | Deep Vein Thrombosis | FAERS: 9 | US FAERS | |
| 278 | Extra dose administered | FAERS: 9 | US FAERS | |
| 279 | Hyperchlorhydria | FAERS: 9 | US FAERS | |
| 280 | Hypokinesia | FAERS: 9 | US FAERS | |
| 281 | Infectious Mononucleosis | FAERS: 9 | US FAERS | |
| 282 | Motion Sickness | FAERS: 9 | US FAERS | |
| 283 | Osteomyelitis | FAERS: 9 | US FAERS | |
| 284 | Pallor | FAERS: 9 | US FAERS | |
| 285 | Product use issue | FAERS: 9 | US FAERS | |
| 286 | Pulmonary Embolism | FAERS: 9 | US FAERS | |
| 287 | Pulmonary thrombosis | FAERS: 9 | US FAERS | |
| 288 | Throat cancer | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 289 | Uterine Cancer | FAERS: 9 | US FAERS | |
| 290 | nervous system disorder | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 291 | Acute kidney injury | FAERS: 8 | US FAERS | |
| 292 | Atypical pneumonia | FAERS: 8 | US FAERS | |
| 293 | Clostridium difficile colitis | FAERS: 8 | US FAERS | |
| 294 | Epilepsy | FAERS: 8 | US FAERS | |
| 295 | Facial Pain | FAERS: 8 | US FAERS | |
| 296 | Glaucoma | FAERS: 8 | US FAERS | |
| 297 | Hyperthyroidism | FAERS: 8 | US FAERS | |
| 298 | Insurance issue | FAERS: 8 | US FAERS | |
| 299 | Intentional product misuse | FAERS: 8 | US FAERS | |
| 300 | Latent Tuberculosis | FAERS: 8 | US FAERS | |
| 301 | Nerve injury | FAERS: 8 | US FAERS | |
| 302 | Nipple pain | FAERS: 8 | US FAERS | |
| 303 | Obesity | FAERS: 8 | US FAERS | |
| 304 | Overweight | FAERS: 8 | US FAERS | |
| 305 | Personality Change | FAERS: 8 | US FAERS | |
| 306 | Rosacea | FAERS: 8 | US FAERS | |
| 307 | Sinus pain | FAERS: 8 | US FAERS | |
| 308 | Thrombocytopenia | FAERS: 8 | US FAERS | |
| 309 | Anosmia | FAERS: 7 | US FAERS | |
| 310 | Blood pressure fluctuation | FAERS: 7 | US FAERS | |
| 311 | Bruxism | FAERS: 7 | US FAERS | |
| 312 | Cholecystitis | FAERS: 7 | US FAERS | |
| 313 | Coccidioidomycosis | FAERS: 7 | US FAERS | |
| 314 | Ear congestion | FAERS: 7 | US FAERS | |
| 315 | Flank Pain | FAERS: 7 | US FAERS | |
| 316 | Food Allergy | FAERS: 7 | US FAERS | |
| 317 | Gastrointestinal motility disorder | FAERS: 7 | US FAERS | |
| 318 | Gingivitis | FAERS: 7 | US FAERS | |
| 319 | Hip surgery | FAERS: 7 | US FAERS | |
| 320 | Hordeolum | FAERS: 7 | US FAERS | |
| 321 | Hunger | FAERS: 7 | US FAERS | |
| 322 | Hypothyroidism | FAERS: 7 | US FAERS | |
| 323 | Hypoxia | FAERS: 7 | US FAERS | |
| 324 | Lyme Disease | FAERS: 7 | US FAERS | |
| 325 | Mental status changes | FAERS: 7 | US FAERS | |
| 326 | Migraine with Aura | FAERS: 7 | US FAERS | |
| 327 | Nasal discomfort | FAERS: 7 | US FAERS | |
| 328 | Onychomycosis | FAERS: 7 | US FAERS | |
| 329 | Overdose | FAERS: 7 | US FAERS | |
| 330 | Pelvic Pain | FAERS: 7 | US FAERS | |
| 331 | Pharyngitis | FAERS: 7 | US FAERS | |
| 332 | Pneumothorax | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 333 | Rhinitis | FAERS: 7 | US FAERS | |
| 334 | Acute myocardial infarction | FAERS: 6 | US FAERS | |
| 335 | Aneurysm | FAERS: 6 | US FAERS | |
| 336 | Anorectal discomfort | FAERS: 6 | US FAERS | |
| 337 | Aphasia | FAERS: 6 | US FAERS | |
| 338 | Appendicitis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 339 | Blood creatine phosphokinase increased | FAERS: 6 | US FAERS | |
| 340 | Bursitis | FAERS: 6 | US FAERS | |
| 341 | Cerebral disorder | FAERS: 6 | US FAERS | |
| 342 | Dental caries | FAERS: 6 | US FAERS | |
| 343 | Device related infection | FAERS: 6 | US FAERS | |
| 344 | Dysgraphia | FAERS: 6 | US FAERS | |
| 345 | Erectile dysfunction | FAERS: 6 | US FAERS | |
| 346 | Frustration tolerance decreased | FAERS: 6 | US FAERS | |
| 347 | Gastric infection | FAERS: 6 | US FAERS | |
| 348 | Hysterectomy | FAERS: 6 | US FAERS | |
| 349 | Impaired gastric emptying | FAERS: 6 | US FAERS | |
| 350 | Incontinence | FAERS: 6 | US FAERS | |
| 351 | Intracranial Aneurysm | FAERS: 6 | US FAERS | |
| 352 | Lichen Planus | FAERS: 6 | US FAERS | |
| 353 | Ligament rupture | FAERS: 6 | US FAERS | |
| 354 | Limb operation | FAERS: 6 | US FAERS | |
| 355 | Lupus-like syndrome | FAERS: 6 | US FAERS | |
| 356 | Mouth swelling | FAERS: 6 | US FAERS | |
| 357 | Multiple sclerosis relapse | FAERS: 6 | US FAERS | |
| 358 | Muscle Fatigue | FAERS: 6 | US FAERS | |
| 359 | Nodule | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 360 | Onycholysis | FAERS: 6 | US FAERS | |
| 361 | Oral candidiasis | FAERS: 6 | US FAERS | |
| 362 | Paranasal sinus hypersecretion | FAERS: 6 | US FAERS | |
| 363 | Post procedural complication | FAERS: 6 | US FAERS | |
| 364 | Pregnancy of partner | FAERS: 6 | US FAERS | |
| 365 | Restless Legs Syndrome | FAERS: 6 | US FAERS | |
| 366 | Skin Wrinkling | FAERS: 6 | US FAERS | |
| 367 | Therapeutic response delayed | FAERS: 6 | US FAERS | |
| 368 | Tooth Loss | FAERS: 6 | US FAERS | |
| 369 | Urinary Retention | FAERS: 6 | US FAERS | |
| 370 | Vitreous floaters | FAERS: 6 | US FAERS | |
| 371 | Abdominal mass | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 372 | Alcohol Intolerance | FAERS: 5 | US FAERS | |
| 373 | Animal bite | FAERS: 5 | US FAERS | |
| 374 | Arthropod sting | FAERS: 5 | US FAERS | |
| 375 | Aspartate Aminotransferase Increased | FAERS: 5 | US FAERS | |
| 376 | Blood blister | FAERS: 5 | US FAERS | |
| 377 | Breast cancer recurrent | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 378 | Cardiac Arrest | FAERS: 5 | US FAERS | |
| 379 | Cardiac Flutter | FAERS: 5 | US FAERS | |
| 380 | Choking | FAERS: 5 | US FAERS | |
| 381 | Coronary Artery Disease | FAERS: 5 | US FAERS | |
| 382 | Dysarthria | FAERS: 5 | US FAERS | |
| 383 | Erythema Multiforme | FAERS: 5 | US FAERS | |
| 384 | Exfoliative rash | FAERS: 5 | US FAERS | |
| 385 | Gastric pH decreased | FAERS: 5 | US FAERS | |
| 386 | General symptom | FAERS: 5 | US FAERS | |
| 387 | Guttate psoriasis | FAERS: 5 | US FAERS | |
| 388 | Intervertebral Disc Degeneration | FAERS: 5 | US FAERS | |
| 389 | Labyrinthitis | FAERS: 5 | US FAERS | |
| 390 | Lactose Intolerance | FAERS: 5 | US FAERS | |
| 391 | Low density lipoprotein increased | FAERS: 5 | US FAERS | |
| 392 | Lymphocyte count decreased | FAERS: 5 | US FAERS | |
| 393 | Mental impairment | FAERS: 5 | US FAERS | |
| 394 | Metrorrhagia | FAERS: 5 | US FAERS | |
| 395 | Osteoporosis | FAERS: 5 | US FAERS | |
| 396 | Pneumonitis | FAERS: 5 | US FAERS | |
| 397 | Retinal Detachment | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 398 | Skin hypertrophy | FAERS: 5 | US FAERS | |
| 399 | Spinal column stenosis | FAERS: 5 | US FAERS | |
| 400 | Squamous cell carcinoma | FAERS: 5 | US FAERS | |
| 401 | Tension | FAERS: 5 | US FAERS | |
| 402 | Tooth Extraction | FAERS: 5 | US FAERS | |
| 403 | Urinary Incontinence | FAERS: 5 | US FAERS | |
| 404 | Vitiligo | FAERS: 5 | US FAERS | |
| 405 | Wound Infection | FAERS: 5 | US FAERS | |
| 406 | Acarodermatitis | FAERS: 4 | US FAERS | |
| 407 | Accidental exposure to product by child | FAERS: 4 | US FAERS | |
| 408 | Adjustment disorder with depressed mood | FAERS: 4 | US FAERS | |
| 409 | Allergic respiratory symptom | FAERS: 4 | US FAERS | |
| 410 | Allergic sinusitis | FAERS: 4 | US FAERS | |
| 411 | Ankylosing spondylitis | FAERS: 4 | US FAERS | |
| 412 | Bipolar I disorder | FAERS: 4 | US FAERS | |
| 413 | Blood glucose fluctuation | FAERS: 4 | US FAERS | |
| 414 | Blood testosterone decreased | FAERS: 4 | US FAERS | |
| 415 | Blood triglycerides increased | FAERS: 4 | US FAERS | |
| 416 | Chloasma | FAERS: 4 | US FAERS | |
| 417 | Cluster Headache | FAERS: 4 | US FAERS | |
| 418 | Disability | FAERS: 4 | US FAERS | |
| 419 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 420 | Emergency Care | FAERS: 4 | US FAERS | |
| 421 | Epicondylitis | FAERS: 4 | US FAERS | |
| 422 | Erysipelas | FAERS: 4 | US FAERS | |
| 423 | Escherichia infection | FAERS: 4 | US FAERS | |
| 424 | Gastroenteritis | FAERS: 4 | US FAERS | |
| 425 | Gastrointestinal carcinoma | FAERS: 4 | US FAERS | |
| 426 | Gastrointestinal inflammation | FAERS: 4 | US FAERS | |
| 427 | Hepatitis | FAERS: 4 | US FAERS | |
| 428 | Hormone level abnormal | FAERS: 4 | US FAERS | |
| 429 | Hyperkeratosis | FAERS: 4 | US FAERS | |
| 430 | Hypogeusia | FAERS: 4 | US FAERS | |
| 431 | Impatience | FAERS: 4 | US FAERS | |
| 432 | Incorrect drug administration duration | FAERS: 4 | US FAERS | |
| 433 | Inflammatory marker increased | FAERS: 4 | US FAERS | |
| 434 | Infrequent bowel movements | FAERS: 4 | US FAERS | |
| 435 | Iritis | FAERS: 4 | US FAERS | |
| 436 | Joint Range of Motion Decreased | FAERS: 4 | US FAERS | |
| 437 | Laziness | FAERS: 4 | US FAERS | |
| 438 | Macular degeneration | FAERS: 4 | US FAERS | |
| 439 | Nonspecific reaction | FAERS: 4 | US FAERS | |
| 440 | Ocular discomfort | FAERS: 4 | US FAERS | |
| 441 | Otitis Media | FAERS: 4 | US FAERS | |
| 442 | Pericarditis | FAERS: 4 | US FAERS | |
| 443 | Post procedural infection | FAERS: 4 | US FAERS | |
| 444 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 445 | Pulmonary Hypertension | FAERS: 4 | US FAERS | |
| 446 | Renal mass | FAERS: 4 | US FAERS | |
| 447 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 448 | Respiratory arrest | FAERS: 4 | US FAERS | |
| 449 | Respiratory distress | FAERS: 4 | US FAERS | |
| 450 | Schizophrenia | FAERS: 4 | US FAERS | |
| 451 | Sinus operation | FAERS: 4 | US FAERS | |
| 452 | Skin Erosion | FAERS: 4 | US FAERS | |
| 453 | Skin Papilloma | FAERS: 4 | US FAERS | |
| 454 | Skin discomfort | FAERS: 4 | US FAERS | |
| 455 | Subcutaneous Abscess | FAERS: 4 | US FAERS | |
| 456 | Supraventricular tachycardia | FAERS: 4 | US FAERS | |
| 457 | Temporal Arteritis | FAERS: 4 | US FAERS | |
| 458 | Therapeutic response changed | FAERS: 4 | US FAERS | |
| 459 | Tonsillitis | FAERS: 4 | US FAERS | |
| 460 | Vasculitis | FAERS: 4 | US FAERS | |
| 461 | Vitamin D Deficiency | FAERS: 4 | US FAERS | |
| 462 | Vulvovaginal mycotic infection | FAERS: 4 | US FAERS | |
| 463 | keratoacanthoma | FAERS: 4 | US FAERS | |
| 464 | skin abrasion | FAERS: 4 | US FAERS | |
| 465 | Abdominal rigidity | FAERS: 3 | US FAERS | |
| 466 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 467 | Aortic Aneurysm | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 468 | Ascites | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 469 | Atrioventricular Block | FAERS: 3 | US FAERS | |
| 470 | Autoimmune thyroiditis | FAERS: 3 | US FAERS | |
| 471 | Bladder pain | FAERS: 3 | US FAERS | |
| 472 | Bladder spasm | FAERS: 3 | US FAERS | |
| 473 | Blepharospasm | FAERS: 3 | US FAERS | |
| 474 | Blood magnesium decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 475 | Blood thyroid stimulating hormone decreased | FAERS: 3 | US FAERS | |
| 476 | Breakthrough Pain | FAERS: 3 | US FAERS | |
| 477 | Cholangitis | FAERS: 3 | US FAERS | |
| 478 | Chronic sinusitis | FAERS: 3 | US FAERS | |
| 479 | Claustrophobia | FAERS: 3 | US FAERS | |
| 480 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 481 | Dermatitis acneiform | FAERS: 3 | US FAERS | |
| 482 | Device malfunction | FAERS: 3 | US FAERS | |
| 483 | Diffuse Large B-Cell Lymphoma | FAERS: 3 | US FAERS | |
| 484 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 485 | Drug resistance | FAERS: 3 | US FAERS | |
| 486 | Dysentery | FAERS: 3 | US FAERS | |
| 487 | Early satiety | FAERS: 3 | US FAERS | |
| 488 | Endocarditis | FAERS: 3 | US FAERS | |
| 489 | Euphoric mood | FAERS: 3 | US FAERS | |
| 490 | Food craving | FAERS: 3 | US FAERS | |
| 491 | Gastrointestinal toxicity | FAERS: 3 | US FAERS | |
| 492 | General physical condition abnormal | FAERS: 3 | US FAERS | |
| 493 | Granuloma Annulare | FAERS: 3 | US FAERS | |
| 494 | Guillain-Barre Syndrome | FAERS: 3 | US FAERS | |
| 495 | Hepatitis B | FAERS: 3 | US FAERS | |
| 496 | Impetigo | FAERS: 3 | US FAERS | |
| 497 | Inappropriate affect | FAERS: 3 | US FAERS | |
| 498 | Intentional dose omission | FAERS: 3 | US FAERS | |
| 499 | Joint warmth | FAERS: 3 | US FAERS | |
| 500 | Leukopenia | FAERS: 3 | US FAERS | |
| 501 | Limb mass | FAERS: 3 | US FAERS | |
| 502 | Lipoma | FAERS: 3 | US FAERS | |
| 503 | Malnutrition | FAERS: 3 | SIDER US FAERS | |
| 504 | Meningitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 505 | Miliaria | FAERS: 3 | US FAERS | |
| 506 | Nocturia | FAERS: 3 | US FAERS | |
| 507 | Non-cardiac chest pain | FAERS: 3 | US FAERS | |
| 508 | Oropharyngeal discomfort | FAERS: 3 | US FAERS | |
| 509 | Peptic Ulcer | FAERS: 3 | US FAERS | |
| 510 | Peritonsillar Abscess | FAERS: 3 | US FAERS | |
| 511 | Physical disability | FAERS: 3 | US FAERS | |
| 512 | Post-Traumatic Stress Disorder | FAERS: 3 | US FAERS | |
| 513 | Precancerous skin lesion | FAERS: 3 | US FAERS | |
| 514 | Pregnancy test positive | FAERS: 3 | US FAERS | |
| 515 | Product quality issue | FAERS: 3 | US FAERS | |
| 516 | Protein total increased | FAERS: 3 | US FAERS | |
| 517 | Proteinuria | FAERS: 3 | US FAERS | |
| 518 | Pulmonary Fibrosis | FAERS: 3 | US FAERS | |
| 519 | Purpura | FAERS: 3 | US FAERS | |
| 520 | Quality of life decreased | FAERS: 3 | US FAERS | |
| 521 | Regurgitation | FAERS: 3 | US FAERS | |
| 522 | Rehabilitation therapy | FAERS: 3 | US FAERS | |
| 523 | Sarcoidosis | FAERS: 3 | US FAERS | |
| 524 | Sjogren's Syndrome | FAERS: 3 | US FAERS | |
| 525 | Skin tightness | FAERS: 3 | US FAERS | |
| 526 | Spinal column injury | FAERS: 3 | US FAERS | |
| 527 | Spondylitis | FAERS: 3 | US FAERS | |
| 528 | Spondylolisthesis | FAERS: 3 | US FAERS | |
| 529 | Stevens-Johnson Syndrome | FAERS: 3 | US FAERS | |
| 530 | Stupor | FAERS: 3 | US FAERS | |
| 531 | Symptom recurrence | FAERS: 3 | US FAERS | |
| 532 | Tachyphrenia | FAERS: 3 | US FAERS | |
| 533 | Teeth brittle | FAERS: 3 | US FAERS | |
| 534 | Therapy responder | FAERS: 3 | US FAERS | |
| 535 | Trismus | FAERS: 3 | US FAERS | |
| 536 | Upper respiratory tract irritation | FAERS: 3 | US FAERS | |
| 537 | Vascular pain | FAERS: 3 | US FAERS | |
| 538 | Vulvovaginal pruritus | FAERS: 3 | US FAERS | |
| 539 | Wrong schedule | FAERS: 3 | US FAERS | |
| 540 | jaundice | FAERS: 3 | US FAERS | |
| 541 | Abdominal wall infection | FAERS: 2 | US FAERS | |
| 542 | Accidental underdose | FAERS: 2 | US FAERS | |
| 543 | Ammonia increased | FAERS: 2 | US FAERS | |
| 544 | Amylase increased | FAERS: 2 | US FAERS | |
| 545 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 546 | Antibiotic therapy | FAERS: 2 | US FAERS | |
| 547 | Apparent death | FAERS: 2 | US FAERS | |
| 548 | Arterial thrombosis | FAERS: 2 | US FAERS | |
| 549 | Arteriosclerosis | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 550 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 551 | Bile acid malabsorption | FAERS: 2 | US FAERS | |
| 552 | Bile output abnormal | FAERS: 2 | US FAERS | |
| 553 | Biliary Colic | FAERS: 2 | US FAERS | |
| 554 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 555 | Blood count abnormal | FAERS: 2 | US FAERS | |
| 556 | Blood creatine increased | FAERS: 2 | US FAERS | |
| 557 | Blood potassium abnormal | FAERS: 2 | US FAERS | |
| 558 | Body surface area increased | FAERS: 2 | US FAERS | |
| 559 | Bowen's Disease | FAERS: 2 | US FAERS | |
| 560 | Bronchial Hyperreactivity | FAERS: 2 | US FAERS | |
| 561 | Bronchospasm | FAERS: 2 | US FAERS | |
| 562 | C-reactive protein abnormal | FAERS: 2 | US FAERS | |
| 563 | Cardiomegaly | FAERS: 2 | US FAERS | |
| 564 | Carotid artery occlusion | FAERS: 2 | US FAERS | |
| 565 | Cholecystitis infective | FAERS: 2 | US FAERS | |
| 566 | Clubbing | FAERS: 2 | US FAERS | |
| 567 | Complication associated with device | FAERS: 2 | US FAERS | |
| 568 | Croup infectious | FAERS: 2 | US FAERS | |
| 569 | Cytomegalovirus hepatitis | FAERS: 2 | US FAERS | |
| 570 | Dacryostenosis acquired | FAERS: 2 | US FAERS | |
| 571 | Dark circles under eyes | FAERS: 2 | US FAERS | |
| 572 | Delirium | FAERS: 2 | US FAERS | |
| 573 | Disease complication | FAERS: 2 | US FAERS | |
| 574 | Dissociation | FAERS: 2 | US FAERS | |
| 575 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 576 | Duodenitis | FAERS: 2 | US FAERS | |
| 577 | Dyschezia | FAERS: 2 | US FAERS | |
| 578 | Ecchymosis | FAERS: 2 | US FAERS | |
| 579 | Economic problem | FAERS: 2 | US FAERS | |
| 580 | Endodontic procedure | FAERS: 2 | US FAERS | |
| 581 | Enlarged uvula | FAERS: 2 | US FAERS | |
| 582 | Enteritis | FAERS: 2 | US FAERS | |
| 583 | Enterococcal infection | FAERS: 2 | US FAERS | |
| 584 | Enterocolitis | FAERS: 2 | US FAERS | |
| 585 | Epinephrine increased | FAERS: 2 | US FAERS | |
| 586 | Episcleritis | FAERS: 2 | US FAERS | |
| 587 | Erythema Nodosum | FAERS: 2 | US FAERS | |
| 588 | Eye Burns | FAERS: 2 | US FAERS | |
| 589 | Eye inflammation | FAERS: 2 | US FAERS | |
| 590 | Eyelid rash | FAERS: 2 | US FAERS | |
| 591 | Feelings of worthlessness | FAERS: 2 | US FAERS | |
| 592 | Fluid overload | FAERS: 2 | US FAERS | |
| 593 | Food aversion | FAERS: 2 | US FAERS | |
| 594 | Foreign body in respiratory tract | FAERS: 2 | US FAERS | |
| 595 | Full blood count increased | FAERS: 2 | US FAERS | |
| 596 | Gastric Dilatation | FAERS: 2 | US FAERS | |
| 597 | Gastroenteritis norovirus | FAERS: 2 | US FAERS | |
| 598 | Gastrointestinal ulcer | FAERS: 2 | US FAERS | |
| 599 | Genital Herpes | FAERS: 2 | US FAERS | |
| 600 | Gingival discomfort | FAERS: 2 | US FAERS | |
| 601 | Hepatic enzyme decreased | FAERS: 2 | US FAERS | |
| 602 | Hidradenitis | FAERS: 2 | US FAERS | |
| 603 | High density lipoprotein increased | FAERS: 2 | US FAERS | |
| 604 | Hydrocephalus | FAERS: 2 | US FAERS | |
| 605 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 606 | Hyperventilation | FAERS: 2 | US FAERS | |
| 607 | Idiopathic Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 608 | Imaging procedure abnormal | FAERS: 2 | US FAERS | |
| 609 | Immune thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 610 | Immunoglobulins abnormal | FAERS: 2 | US FAERS | |
| 611 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 612 | Impaired quality of life | FAERS: 2 | US FAERS | |
| 613 | Implantable defibrillator insertion | FAERS: 2 | US FAERS | |
| 614 | Increased viscosity of upper respiratory secretion | FAERS: 2 | US FAERS | |
| 615 | Injection Site Reaction | FAERS: 2 | US FAERS | |
| 616 | Intervertebral disc disorder | FAERS: 2 | US FAERS | |
| 617 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 618 | Intestinal congestion | FAERS: 2 | US FAERS | |
| 619 | Intestinal cyst | FAERS: 2 | US FAERS | |
| 620 | Intestinal infarction | FAERS: 2 | US FAERS | |
| 621 | Intra-abdominal fluid collection | FAERS: 2 | US FAERS | |
| 622 | Libido disorder | FAERS: 2 | US FAERS | |
| 623 | Ligament injury | FAERS: 2 | US FAERS | |
| 624 | Lower respiratory tract congestion | FAERS: 2 | US FAERS | |
| 625 | Lymphopenia | FAERS: 2 | US FAERS | |
| 626 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 627 | Macule | FAERS: 2 | US FAERS | |
| 628 | Mastoiditis | FAERS: 2 | US FAERS | |
| 629 | Measles | FAERS: 2 | US FAERS | |
| 630 | Menopause | FAERS: 2 | US FAERS | |
| 631 | Morbid thoughts | FAERS: 2 | US FAERS | |
| 632 | Muscular Dystrophy | FAERS: 2 | US FAERS | |
| 633 | Myocarditis | FAERS: 2 | US FAERS | |
| 634 | Nail bed disorder | FAERS: 2 | US FAERS | |
| 635 | Neurodermatitis | FAERS: 2 | US FAERS | |
| 636 | Obsessive thoughts | FAERS: 2 | US FAERS | |
| 637 | Onychalgia | FAERS: 2 | US FAERS | |
| 638 | Open globe injury | FAERS: 2 | US FAERS | |
| 639 | Oral infection | FAERS: 2 | US FAERS | |
| 640 | Orthosis user | FAERS: 2 | US FAERS | |
| 641 | Osteonecrosis of Jaw | FAERS: 2 | US FAERS | |
| 642 | Pancytopenia | FAERS: 2 | US FAERS | |
| 643 | Panic Disorder | FAERS: 2 | US FAERS | |
| 644 | Papilloma | FAERS: 2 | US FAERS | |
| 645 | Periarthritis | FAERS: 2 | US FAERS | |
| 646 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 647 | Pertussis | FAERS: 2 | US FAERS | |
| 648 | Petechiae | FAERS: 2 | US FAERS | |
| 649 | Pharyngeal swelling | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 650 | Pityriasis Rosea | FAERS: 2 | US FAERS | |
| 651 | Polyuria | FAERS: 2 | US FAERS | |
| 652 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 653 | Post procedural pneumonia | FAERS: 2 | US FAERS | |
| 654 | Post procedural sepsis | FAERS: 2 | US FAERS | |
| 655 | Precancerous cells present | FAERS: 2 | US FAERS | |
| 656 | Premenstrual syndrome | FAERS: 2 | US FAERS | |
| 657 | Procedural complication | FAERS: 2 | US FAERS | |
| 658 | Product adhesion issue | FAERS: 2 | US FAERS | |
| 659 | Product administration error | FAERS: 2 | US FAERS | |
| 660 | Product availability issue | FAERS: 2 | US FAERS | |
| 661 | Product difficult to swallow | FAERS: 2 | US FAERS | |
| 662 | Psychiatric symptom | FAERS: 2 | US FAERS | |
| 663 | Radiculopathy | FAERS: 2 | US FAERS | |
| 664 | Rebound effect | FAERS: 2 | US FAERS | |
| 665 | Rectal abscess | FAERS: 2 | US FAERS | |
| 666 | Renal Cell Carcinoma | FAERS: 2 | US FAERS | |
| 667 | Renal cyst | FAERS: 2 | US FAERS | |
| 668 | Rheumatic Fever | FAERS: 2 | US FAERS | |
| 669 | Rhinalgia | FAERS: 2 | US FAERS | |
| 670 | Rocky Mountain Spotted Fever | FAERS: 2 | US FAERS | |
| 671 | Root canal infection | FAERS: 2 | US FAERS | |
| 672 | Sexual Dysfunction | FAERS: 2 | US FAERS | |
| 673 | Soft tissue mass | FAERS: 2 | US FAERS | |
| 674 | Sputum retention | FAERS: 2 | US FAERS | |
| 675 | Squamous cell carcinoma of lung | FAERS: 2 | US FAERS | |
| 676 | Stasis dermatitis | FAERS: 2 | US FAERS | |
| 677 | Strabismus | FAERS: 2 | US FAERS | |
| 678 | Streptococcal endocarditis | FAERS: 2 | US FAERS | |
| 679 | Stress at work | FAERS: 2 | US FAERS | |
| 680 | Syphilis | FAERS: 2 | US FAERS | |
| 681 | Temperature intolerance | FAERS: 2 | US FAERS | |
| 682 | Tendon discomfort | FAERS: 2 | US FAERS | |
| 683 | Terminal state | FAERS: 2 | US FAERS | |
| 684 | Therapeutic procedure | FAERS: 2 | US FAERS | |
| 685 | Tinea cruris | FAERS: 2 | US FAERS | |
| 686 | Trichorrhexis | FAERS: 2 | US FAERS | |
| 687 | Typhoid Fever | FAERS: 2 | US FAERS | |
| 688 | Ulnar Nerve Palsy | FAERS: 2 | US FAERS | |
| 689 | Umbilical hernia | FAERS: 2 | US FAERS | |
| 690 | Underweight | FAERS: 2 | US FAERS | |
| 691 | Uveitis | FAERS: 2 | US FAERS | |
| 692 | Varicella Zoster Virus Infection | FAERS: 2 | US FAERS | |
| 693 | Violence-related symptom | FAERS: 2 | US FAERS | |
| 694 | Viral pharyngitis | FAERS: 2 | US FAERS | |
| 695 | Vulvovaginal burning sensation | FAERS: 2 | US FAERS | |
| 696 | Vulvovaginal dryness | FAERS: 2 | US FAERS | |
| 697 | Wound dehiscence | FAERS: 2 | US FAERS | |
| 698 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 699 | Xerosis | FAERS: 2 | US FAERS | |
| 700 | colonoscopy | FAERS: 2 | US FAERS | |
| 701 | muscle injury | FAERS: 2 | US FAERS | |
| 702 | prostatitis | FAERS: 2 | US FAERS | |
| 703 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 704 | Abdominal fat apron | FAERS: 1 | US FAERS | |
| 705 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 706 | Abdominal wall cyst | FAERS: 1 | US FAERS | |
| 707 | Abscess soft tissue | FAERS: 1 | US FAERS | |
| 708 | Abstains from alcohol | FAERS: 1 | US FAERS | |
| 709 | Abulia | FAERS: 1 | US FAERS | |
| 710 | Acoustic Neuroma | FAERS: 1 | US FAERS | |
| 711 | Acquired Immunodeficiency Syndrome | FAERS: 1 | US FAERS | |
| 712 | Actinic keratosis | FAERS: 1 | US FAERS | |
| 713 | Adnexa uteri pain | FAERS: 1 | US FAERS | |
| 714 | Agoraphobia | FAERS: 1 | US FAERS | |
| 715 | Akathisia | FAERS: 1 | US FAERS | |
| 716 | Akinesia | FAERS: 1 | US FAERS | |
| 717 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 718 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 719 | Allergic cough | FAERS: 1 | US FAERS | |
| 720 | Allergic eosinophilia | FAERS: 1 | US FAERS | |
| 721 | Allergy to arthropod sting | FAERS: 1 | US FAERS | |
| 722 | Amino acid level increased | FAERS: 1 | US FAERS | |
| 723 | Ammonia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 724 | Amputation stump pain | FAERS: 1 | US FAERS | |
| 725 | Amputation | FAERS: 1 | US FAERS | |
| 726 | Anal Fistula | FAERS: 1 | US FAERS | |
| 727 | Anal inflammation | FAERS: 1 | US FAERS | |
| 728 | Animal attack | FAERS: 1 | US FAERS | |
| 729 | Ankle deformity | FAERS: 1 | US FAERS | |
| 730 | Anti-transglutaminase antibody increased | FAERS: 1 | US FAERS | |
| 731 | Anticoagulation drug level abnormal | FAERS: 1 | US FAERS | |
| 732 | Aortic stent insertion | FAERS: 1 | US FAERS | |
| 733 | Application site vesicles | FAERS: 1 | US FAERS | |
| 734 | Arthrodesis | FAERS: 1 | US FAERS | |
| 735 | Asbestosis | FAERS: 1 | US FAERS | |
| 736 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 737 | Asphyxia | FAERS: 1 | US FAERS | |
| 738 | Atrial tachycardia | FAERS: 1 | US FAERS | |
| 739 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 740 | Aversion | FAERS: 1 | US FAERS | |
| 741 | Bacterial Vaginosis | FAERS: 1 | US FAERS | |
| 742 | Bacterial disease carrier | FAERS: 1 | US FAERS | |
| 743 | Benign Neoplasm | FAERS: 1 | US FAERS | |
| 744 | Benign neoplasm of thyroid gland | FAERS: 1 | US FAERS | |
| 745 | Berylliosis | FAERS: 1 | US FAERS | |
| 746 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 747 | Bladder cancer recurrent | FAERS: 1 | US FAERS | |
| 748 | Bladder cancer stage IV | FAERS: 1 | US FAERS | |
| 749 | Blastomycosis | FAERS: 1 | US FAERS | |
| 750 | Bleeding time abnormal | FAERS: 1 | US FAERS | |
| 751 | Blepharitis | FAERS: 1 | US FAERS | |
| 752 | Blister rupture | FAERS: 1 | US FAERS | |
| 753 | Blood HIV RNA increased | FAERS: 1 | US FAERS | |
| 754 | Blood acid phosphatase increased | FAERS: 1 | US FAERS | |
| 755 | Blood creatine abnormal | FAERS: 1 | US FAERS | |
| 756 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 757 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 758 | Blood electrolytes decreased | FAERS: 1 | US FAERS | |
| 759 | Blood immunoglobulin E increased | FAERS: 1 | US FAERS | |
| 760 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 761 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 762 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 763 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 764 | Blood testosterone abnormal | FAERS: 1 | US FAERS | |
| 765 | Blood triglycerides abnormal | FAERS: 1 | US FAERS | |
| 766 | Blood zinc decreased | FAERS: 1 | US FAERS | |
| 767 | Body fat disorder | FAERS: 1 | US FAERS | |
| 768 | Bone density decreased | FAERS: 1 | US FAERS | |
| 769 | Bone formation decreased | FAERS: 1 | US FAERS | |
| 770 | Bone lesion | FAERS: 1 | US FAERS | |
| 771 | Bone swelling | FAERS: 1 | US FAERS | |
| 772 | Bradycardia | FAERS: 1 | US FAERS | |
| 773 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 774 | Brain Abscess | FAERS: 1 | US FAERS | |
| 775 | Breast cancer stage III | FAERS: 1 | US FAERS | |
| 776 | Breast discomfort | FAERS: 1 | US FAERS | |
| 777 | Breast prosthesis user | FAERS: 1 | US FAERS | |
| 778 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 779 | Bronchitis chemical | FAERS: 1 | US FAERS | |
| 780 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 781 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 782 | Burning Mouth Syndrome | FAERS: 1 | US FAERS | |
| 783 | Burning feet syndrome | FAERS: 1 | US FAERS | |
| 784 | Bursa injury | FAERS: 1 | US FAERS | |
| 785 | Cardiac infection | FAERS: 1 | US FAERS | |
| 786 | Cardiac neoplasm unspecified | FAERS: 1 | US FAERS | |
| 787 | Carotid Artery Thrombosis | FAERS: 1 | US FAERS | |
| 788 | Cartilage injury | FAERS: 1 | US FAERS | |
| 789 | Central Nervous System Infection | FAERS: 1 | US FAERS | |
| 790 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 791 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 792 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 793 | Cerebral microhaemorrhage | FAERS: 1 | US FAERS | |
| 794 | Cervical dysplasia | FAERS: 1 | US FAERS | |
| 795 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 796 | Cheilitis | FAERS: 1 | US FAERS | |
| 797 | Choking sensation | FAERS: 1 | US FAERS | |
| 798 | Cholelithotomy | FAERS: 1 | US FAERS | |
| 799 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 800 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 801 | Chronic respiratory failure | FAERS: 1 | US FAERS | |
| 802 | Clumsiness | FAERS: 1 | US FAERS | |
| 803 | Coagulation test abnormal | FAERS: 1 | US FAERS | |
| 804 | Collagen-vascular disease | FAERS: 1 | US FAERS | |
| 805 | Complication of delivery | FAERS: 1 | US FAERS | |
| 806 | Compression fracture | FAERS: 1 | US FAERS | |
| 807 | Conversion disorder | FAERS: 1 | US FAERS | |
| 808 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 809 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 810 | Cubital Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 811 | Cyanosis | FAERS: 1 | US FAERS | |
| 812 | Cyst removal | FAERS: 1 | US FAERS | |
| 813 | Cystic Fibrosis | FAERS: 1 | US FAERS | |
| 814 | Dacryoadenitis acquired | FAERS: 1 | US FAERS | |
| 815 | Dactylitis | FAERS: 1 | US FAERS | |
| 816 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 817 | Death of relative | FAERS: 1 | US FAERS | |
| 818 | Delusional disorder, persecutory type | FAERS: 1 | US FAERS | |
| 819 | Delusional disorder, unspecified type | FAERS: 1 | US FAERS | |
| 820 | Demyelination | FAERS: 1 | US FAERS | |
| 821 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 822 | Device Failure | FAERS: 1 | US FAERS | |
| 823 | Device battery issue | FAERS: 1 | US FAERS | |
| 824 | Device dislocation | FAERS: 1 | US FAERS | |
| 825 | Device effect incomplete | FAERS: 1 | US FAERS | |
| 826 | Device occlusion | FAERS: 1 | US FAERS | |
| 827 | Device use issue | FAERS: 1 | US FAERS | |
| 828 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 829 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 830 | Diverticulum | FAERS: 1 | US FAERS | |
| 831 | Documented hypersensitivity to administered product | FAERS: 1 | US FAERS | |
| 832 | Dose calculation error | FAERS: 1 | US FAERS | |
| 833 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 834 | Drug dose titration not performed | FAERS: 1 | US FAERS | |
| 835 | Drug effect variable | FAERS: 1 | US FAERS | |
| 836 | Drug-disease interaction | FAERS: 1 | US FAERS | |
| 837 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 838 | Duodenogastric Reflux | FAERS: 1 | US FAERS | |
| 839 | Dyslexia | FAERS: 1 | US FAERS | |
| 840 | Ectopic Pregnancy | FAERS: 1 | US FAERS | |
| 841 | Elbow deformity | FAERS: 1 | US FAERS | |
| 842 | Electrolyte depletion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 843 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 844 | Embolic stroke | FAERS: 1 | US FAERS | |
| 845 | Emotional poverty | FAERS: 1 | US FAERS | |
| 846 | Enthesopathy | FAERS: 1 | US FAERS | |
| 847 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 848 | Enzyme level abnormal | FAERS: 1 | US FAERS | |
| 849 | Enzyme level increased | FAERS: 1 | US FAERS | |
| 850 | Epididymitis | FAERS: 1 | US FAERS | |
| 851 | Erection increased | FAERS: 1 | US FAERS | |
| 852 | Erythroblastosis | FAERS: 1 | US FAERS | |
| 853 | Erythrodermic psoriasis | FAERS: 1 | US FAERS | |
| 854 | Essential Tremor | FAERS: 1 | US FAERS | |
| 855 | Excessive cerumen production | FAERS: 1 | US FAERS | |
| 856 | Excessive masturbation | FAERS: 1 | US FAERS | |
| 857 | Excessive skin | FAERS: 1 | US FAERS | |
| 858 | Excoriation | FAERS: 1 | US FAERS | |
| 859 | Extranodal marginal zone B-cell lymphoma (MALT type) | FAERS: 1 | US FAERS | |
| 860 | Eye laser surgery | FAERS: 1 | US FAERS | |
| 861 | Eye operation complication | FAERS: 1 | US FAERS | |
| 862 | Eyelid infection | FAERS: 1 | US FAERS | |
| 863 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 864 | Facial Neuralgia | FAERS: 1 | US FAERS | |
| 865 | Fat necrosis | FAERS: 1 | US FAERS | |
| 866 | Fear of falling | FAERS: 1 | US FAERS | |
| 867 | Fracture pain | FAERS: 1 | US FAERS | |
| 868 | Frustration | FAERS: 1 | US FAERS | |
| 869 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 870 | Fungal rhinitis | FAERS: 1 | US FAERS | |
| 871 | Gastrectomy | FAERS: 1 | US FAERS | |
| 872 | Gastric hypermotility | FAERS: 1 | US FAERS | |
| 873 | Gastrointestinal bacterial infection | FAERS: 1 | US FAERS | |
| 874 | Gastrointestinal bacterial overgrowth | FAERS: 1 | US FAERS | |
| 875 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 876 | Gastrointestinal viral infection | FAERS: 1 | US FAERS | |
| 877 | Gene Mutation | FAERS: 1 | US FAERS | |
| 878 | General physical condition decreased | FAERS: 1 | US FAERS | |
| 879 | Genital erythema | FAERS: 1 | US FAERS | |
| 880 | Genital infection fungal | FAERS: 1 | US FAERS | |
| 881 | Gingival Recession | FAERS: 1 | US FAERS | |
| 882 | Gingival blister | FAERS: 1 | US FAERS | |
| 883 | Glycosuria | FAERS: 1 | US FAERS | |
| 884 | Granuloma | FAERS: 1 | US FAERS | |
| 885 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 886 | Hair injury | FAERS: 1 | US FAERS | |
| 887 | Heart alternation | FAERS: 1 | US FAERS | |
| 888 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 889 | Heat illness | FAERS: 1 | US FAERS | |
| 890 | Hemiplegia | FAERS: 1 | US FAERS | |
| 891 | Hepatectomy | FAERS: 1 | US FAERS | |
| 892 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 893 | Hepatitis A | FAERS: 1 | US FAERS | |
| 894 | Hepatitis B core antibody positive | FAERS: 1 | US FAERS | |
| 895 | Hepatitis C antibody positive | FAERS: 1 | US FAERS | |
| 896 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 897 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 898 | Hernia perforation | FAERS: 1 | US FAERS | |
| 899 | Herpes Zoster Oticus | FAERS: 1 | US FAERS | |
| 900 | Hirsutism | FAERS: 1 | US FAERS | |
| 901 | Hyperacusis | FAERS: 1 | US FAERS | |
| 902 | Hypercalciuria | FAERS: 1 | US FAERS | |
| 903 | Hypermetabolism | FAERS: 1 | US FAERS | |
| 904 | Hyperphagia | FAERS: 1 | US FAERS | |
| 905 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 906 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 907 | Hypervigilance | FAERS: 1 | US FAERS | |
| 908 | Hypotrichosis | FAERS: 1 | US FAERS | |
| 909 | Ileus | FAERS: 1 | US FAERS | |
| 910 | Iliac artery occlusion | FAERS: 1 | US FAERS | |
| 911 | Illiteracy | FAERS: 1 | US FAERS | |
| 912 | Illness anxiety disorder | FAERS: 1 | US FAERS | |
| 913 | Immobile | FAERS: 1 | US FAERS | |
| 914 | Implant site calcification | FAERS: 1 | US FAERS | |
| 915 | Implantable defibrillator replacement | FAERS: 1 | US FAERS | |
| 916 | Incisional hernia | FAERS: 1 | US FAERS | |
| 917 | Incoherent | FAERS: 1 | US FAERS | |
| 918 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 919 | Incorrect product dosage form administered | FAERS: 1 | US FAERS | |
| 920 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 921 | Infarction | FAERS: 1 | US FAERS | |
| 922 | Infected bite | FAERS: 1 | US FAERS | |
| 923 | Infective glossitis | FAERS: 1 | US FAERS | |
| 924 | Inflammatory pain | FAERS: 1 | US FAERS | |
| 925 | Infusion site infection | FAERS: 1 | US FAERS | |
| 926 | Inhibitory drug interaction | FAERS: 1 | US FAERS | |
| 927 | Injection site erythema | FAERS: 1 | US FAERS | |
| 928 | Injection site nodule | FAERS: 1 | US FAERS | |
| 929 | Insulin Resistance | FAERS: 1 | US FAERS | |
| 930 | Intention tremor | FAERS: 1 | US FAERS | |
| 931 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 932 | Intercostal neuralgia | FAERS: 1 | US FAERS | |
| 933 | Intestinal scarring | FAERS: 1 | US FAERS | |
| 934 | Iron deficiency | FAERS: 1 | US FAERS | |
| 935 | Itching scar | FAERS: 1 | US FAERS | |
| 936 | Joint Instability | FAERS: 1 | US FAERS | |
| 937 | Joint deposit | FAERS: 1 | US FAERS | |
| 938 | Joint destruction | FAERS: 1 | US FAERS | |
| 939 | Keratosis pilaris | FAERS: 1 | US FAERS | |
| 940 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 941 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 942 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 943 | Large intestine perforation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 944 | Laryngeal atrophy | FAERS: 1 | US FAERS | |
| 945 | Laryngeal cancer stage II | FAERS: 1 | US FAERS | |
| 946 | Laryngeal neoplasm | FAERS: 1 | US FAERS | |
| 947 | Left ventricular heave | FAERS: 1 | US FAERS | |
| 948 | Leprosy | FAERS: 1 | US FAERS | |
| 949 | Leukocytosis | FAERS: 1 | US FAERS | |
| 950 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 951 | Ligament pain | FAERS: 1 | US FAERS | |
| 952 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 953 | Lip erythema | FAERS: 1 | US FAERS | |
| 954 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 955 | Lipase increased | FAERS: 1 | US FAERS | |
| 956 | Liver Abscess | FAERS: 1 | US FAERS | |
| 957 | Local reaction | FAERS: 1 | US FAERS | |
| 958 | Lung Abscess | FAERS: 1 | US FAERS | |
| 959 | Lung squamous cell carcinoma stage III | FAERS: 1 | US FAERS | |
| 960 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 961 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 962 | Lymphoid tissue hyperplasia | FAERS: 1 | US FAERS | |
| 963 | Macrocytosis | FAERS: 1 | US FAERS | |
| 964 | Macular rupture | FAERS: 1 | US FAERS | |
| 965 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 966 | Malignant melanoma in situ | FAERS: 1 | US FAERS | |
| 967 | Malignant melanoma stage I | FAERS: 1 | US FAERS | |
| 968 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 969 | Mallory-Weiss Syndrome | FAERS: 1 | US FAERS | |
| 970 | Medical device site pain | FAERS: 1 | US FAERS | |
| 971 | Meningioma | FAERS: 1 | US FAERS | |
| 972 | Meningitis enterococcal | FAERS: 1 | US FAERS | |
| 973 | Menstrual discomfort | FAERS: 1 | US FAERS | |
| 974 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 975 | Mesenteric Panniculitis | FAERS: 1 | US FAERS | |
| 976 | Mesothelioma | FAERS: 1 | US FAERS | |
| 977 | Metaplasia | FAERS: 1 | US FAERS | |
| 978 | Mononucleosis heterophile test positive | FAERS: 1 | US FAERS | |
| 979 | Monoplegia | FAERS: 1 | US FAERS | |
| 980 | Morning Sickness | FAERS: 1 | US FAERS | |
| 981 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 982 | Mumps | FAERS: 1 | US FAERS | |
| 983 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 984 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 985 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 986 | Mycobacterium tuberculosis complex test | FAERS: 1 | US FAERS | |
| 987 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 988 | Mycotic allergy | FAERS: 1 | US FAERS | |
| 989 | Mydriasis | FAERS: 1 | US FAERS | |
| 990 | Myositis | FAERS: 1 | US FAERS | |
| 991 | Nail bed tenderness | FAERS: 1 | US FAERS | |
| 992 | Needle issue | FAERS: 1 | US FAERS | |
| 993 | Nerve Block | FAERS: 1 | US FAERS | |
| 994 | Neuritis | FAERS: 1 | US FAERS | |
| 995 | Neurogenic Bowel | FAERS: 1 | US FAERS | |
| 996 | Neurosyphilis | FAERS: 1 | US FAERS | |
| 997 | Neutrophil Pelger-Huet anomaly present | FAERS: 1 | US FAERS | |
| 998 | Noninfective gingivitis | FAERS: 1 | US FAERS | |
| 999 | Nuclear magnetic resonance imaging joint | FAERS: 1 | US FAERS | |
| 1000 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 1001 | Obstruction | FAERS: 1 | US FAERS | |
| 1002 | Ocular Rosacea | FAERS: 1 | US FAERS | |
| 1003 | Ophthalmic vein thrombosis | FAERS: 1 | US FAERS | |
| 1004 | Ophthalmoplegia | FAERS: 1 | US FAERS | |
| 1005 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 1006 | Osteitis Deformans | FAERS: 1 | US FAERS | |
| 1007 | Osteitis | FAERS: 1 | US FAERS | |
| 1008 | Osteopenia | FAERS: 1 | US FAERS | |
| 1009 | Oxygen Consumption | FAERS: 1 | US FAERS | |
| 1010 | Packaging design issue | FAERS: 1 | US FAERS | |
| 1011 | Pain management | FAERS: 1 | US FAERS | |
| 1012 | Painful ejaculation | FAERS: 1 | US FAERS | |
| 1013 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 1014 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 1015 | Penile curvature | FAERS: 1 | US FAERS | |
| 1016 | Penile erythema | FAERS: 1 | US FAERS | |
| 1017 | Penile swelling | FAERS: 1 | US FAERS | |
| 1018 | Peripheral arthritis | FAERS: 1 | US FAERS | |
| 1019 | Perirectal abscess | FAERS: 1 | US FAERS | |
| 1020 | Physical assault | FAERS: 1 | US FAERS | |
| 1021 | Pityriasis Rubra Pilaris | FAERS: 1 | US FAERS | |
| 1022 | Poisoning | FAERS: 1 | US FAERS | |
| 1023 | Polyarthritis | FAERS: 1 | US FAERS | |
| 1024 | Polychondritis | FAERS: 1 | US FAERS | |
| 1025 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 1026 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 1027 | Positron emission tomogram abnormal | FAERS: 1 | US FAERS | |
| 1028 | Post inflammatory pigmentation change | FAERS: 1 | US FAERS | |
| 1029 | Post lumbar puncture syndrome | FAERS: 1 | US FAERS | |
| 1030 | Postoperative thrombosis | FAERS: 1 | US FAERS | |
| 1031 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 1032 | Product distribution issue | FAERS: 1 | US FAERS | |
| 1033 | Product packaging issue | FAERS: 1 | US FAERS | |
| 1034 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 1035 | Product substitution issue | FAERS: 1 | US FAERS | |
| 1036 | Product supply issue | FAERS: 1 | US FAERS | |
| 1037 | Prostate cancer recurrent | FAERS: 1 | US FAERS | |
| 1038 | Protein urine present | FAERS: 1 | US FAERS | |
| 1039 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 1040 | Pseudoxanthoma Elasticum | FAERS: 1 | US FAERS | |
| 1041 | Psychiatric decompensation | FAERS: 1 | US FAERS | |
| 1042 | Pulmonary Fistula | FAERS: 1 | US FAERS | |
| 1043 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 1044 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 1045 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 1046 | Radiation associated pain | FAERS: 1 | US FAERS | |
| 1047 | Rectal Prolapse | FAERS: 1 | US FAERS | |
| 1048 | Rectal discharge | FAERS: 1 | US FAERS | |
| 1049 | Rectal spasm | FAERS: 1 | US FAERS | |
| 1050 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 1051 | Reflux gastritis | FAERS: 1 | US FAERS | |
| 1052 | Renal cancer metastatic | FAERS: 1 | US FAERS | |
| 1053 | Renal tubular acidosis | FAERS: 1 | US FAERS | |
| 1054 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 1055 | Respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 1056 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 1057 | Resting Tremor | FAERS: 1 | US FAERS | |
| 1058 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 1059 | Retrograde amnesia | FAERS: 1 | US FAERS | |
| 1060 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 1061 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 1062 | Rheumatoid factor increased | FAERS: 1 | US FAERS | |
| 1063 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 1064 | Saliva altered | FAERS: 1 | US FAERS | |
| 1065 | Sarcoma | FAERS: 1 | US FAERS | |
| 1066 | Scleritis | FAERS: 1 | US FAERS | |
| 1067 | Scleroderma | FAERS: 1 | US FAERS | |
| 1068 | Seasonal Affective Disorder | FAERS: 1 | US FAERS | |
| 1069 | Sensitive skin | FAERS: 1 | US FAERS | |
| 1070 | Sensitivity to weather change | FAERS: 1 | US FAERS | |
| 1071 | Serum Sickness | FAERS: 1 | US FAERS | |
| 1072 | Serum sickness-like reaction | FAERS: 1 | US FAERS | |
| 1073 | Shoulder deformity | FAERS: 1 | US FAERS | |
| 1074 | Sinus polyp | FAERS: 1 | US FAERS | |
| 1075 | Skeletal injury | FAERS: 1 | US FAERS | |
| 1076 | Skin neoplasm excision | FAERS: 1 | US FAERS | |
| 1077 | Sleep Talking | FAERS: 1 | US FAERS | |
| 1078 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 1079 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 1080 | Slow speech | FAERS: 1 | US FAERS | |
| 1081 | Small cell lung cancer metastatic | FAERS: 1 | US FAERS | |
| 1082 | Snoring | FAERS: 1 | US FAERS | |
| 1083 | Soft Tissue Infection | FAERS: 1 | US FAERS | |
| 1084 | Soft tissue inflammation | FAERS: 1 | US FAERS | |
| 1085 | Soft tissue swelling | FAERS: 1 | US FAERS | |
| 1086 | Solar lentigo | FAERS: 1 | US FAERS | |
| 1087 | Spermatozoa abnormal | FAERS: 1 | US FAERS | |
| 1088 | Spinal Stenosis | FAERS: 1 | US FAERS | |
| 1089 | Spinal cord infection | FAERS: 1 | US FAERS | |
| 1090 | Splinter | FAERS: 1 | US FAERS | |
| 1091 | Stoma site discomfort | FAERS: 1 | US FAERS | |
| 1092 | Superficial vein prominence | FAERS: 1 | US FAERS | |
| 1093 | Superior limbic keratoconjunctivitis | FAERS: 1 | US FAERS | |
| 1094 | Suture rupture | FAERS: 1 | US FAERS | |
| 1095 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 1096 | Symmetrical drug-related intertriginous and flexural exanthema | FAERS: 1 | US FAERS | |
| 1097 | Synovitis | FAERS: 1 | US FAERS | |
| 1098 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 1099 | Systolic dysfunction | FAERS: 1 | US FAERS | |
| 1100 | Systolic hypertension | FAERS: 1 | US FAERS | |
| 1101 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 1102 | Therapeutic product ineffective | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1103 | Therapeutic product ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 1104 | Thermal burn | FAERS: 1 | US FAERS | |
| 1105 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 1106 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 1107 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 1108 | Thyroid hormones increased | FAERS: 1 | US FAERS | |
| 1109 | Tick-borne fever | FAERS: 1 | US FAERS | |
| 1110 | Tinea Pedis | FAERS: 1 | US FAERS | |
| 1111 | Toe operation | FAERS: 1 | US FAERS | |
| 1112 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 1113 | Tooth repair | FAERS: 1 | US FAERS | |
| 1114 | Torticollis | FAERS: 1 | US FAERS | |
| 1115 | Total lung capacity abnormal | FAERS: 1 | US FAERS | |
| 1116 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 1117 | Tracheostomy infection | FAERS: 1 | US FAERS | |
| 1118 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 1119 | Tubular breast carcinoma | FAERS: 1 | US FAERS | |
| 1120 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 1121 | Type III immune complex mediated reaction | FAERS: 1 | US FAERS | |
| 1122 | Unhealthy diet | FAERS: 1 | US FAERS | |
| 1123 | Urine output increased | FAERS: 1 | US FAERS | |
| 1124 | Urticarial vasculitis | FAERS: 1 | US FAERS | |
| 1125 | Uterine Polyp | FAERS: 1 | US FAERS | |
| 1126 | Vaginal mucosal blistering | FAERS: 1 | US FAERS | |
| 1127 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 1128 | Viral load increased | FAERS: 1 | US FAERS | |
| 1129 | Viral uveitis | FAERS: 1 | US FAERS | |
| 1130 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 1131 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 1132 | Vulvovaginal rash | FAERS: 1 | US FAERS | |
| 1133 | Walking aid user | FAERS: 1 | US FAERS | |
| 1134 | Wheelchair user | FAERS: 1 | US FAERS | |
| 1135 | White matter lesion | FAERS: 1 | US FAERS | |
| 1136 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 1137 | Xeroderma | FAERS: 1 | US FAERS | |
| 1138 | cancer surgery | FAERS: 1 | US FAERS | |
| 1139 | Candida pneumonia | Canada Vigilance: 1 | Canada Vigilance | |
| 1140 | Drug exposure before pregnancy | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.