MetaADEDB: Drug

MetaADEDB 2.0 @ LMMD

Morphine

(BQJCRHHNABKAKU-KBQPJGBKSA-N)

Structure

SMILES: O[C@H]1C=C[C@@H]2[C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)C)ccc1O
Type(s): Approved; Investigational
ATC code(s): A07DA52; N02AA01; N02AA51; N02AG01
Molecular Formula:: C17H19NO3
Molecular Weight:: 285.338
Log P:: 1.1360
Hydrogen Bond Acceptor:: 4
Hydrogen Bond Donor:: 2
TPSA:: 52.93
CAS Number(s):: 57-27-2

Synonym(s)

Morphine

Morphine Sulfate

Duramorph

MS Contin

Morphia

Morphine Chloride

Morphine Sulfate (2:1), Anhydrous

Morphine Sulfate (2:1), Pentahydrate

Oramorph SR

10.

SDZ 202-250

11.

SDZ202-250

12.

Chloride, Morphine

13.

Contin, MS

14.

SDZ 202 250

15.

SDZ 202250

16.

SDZ202 250

17.

SDZ202250

18.

Sulfate, Morphine

External Link(s)

MeSH	D009020
PubChem Compound	5288826
BindingDB	50000092
ChEBI	17303
CHEMBL	CHEMBL70
DrugBank	DB00295
DrugCentral	1845
IUPHAR/BPS Guide to PHARMACOLOGY	1627
KEGG	cpd:C01516 dr:D08233
Therapeutic Target Database	D0WE3O
ZINC	3812983

Adverse Drug Event(s)

	Name	Number of Reports	Reference(s)	Data Source
1	Nausea	FAERS: 675 Canada Vigilance: 57	View details 1416128 1749637 2058846 2208533 3415012 4577695 6111570 6614422 7023519 7200737 7324817 7849498 8279252 8829857 9168210 9836029 10193215 15025617 15954974 16116007 16219607 16507190 19671086 20062554 20529380 24954166	CTD OFFSIDES SIDER Canada Vigilance US FAERS
2	Vomiting	FAERS: 615 Canada Vigilance: 29	View details 226904 1416128 2058846 2208533 2886842 4577695 4958020 4962749 6111570 6123475 6614422 6666559 7200737 7324817 8279252 9100184 9168210 10193215 15893155 16116007 16219607 16507190 20062554 20529380	CTD SIDER Canada Vigilance US FAERS
3	Drug abuse	FAERS: 588 Canada Vigilance: 111		Canada Vigilance SIDER US FAERS
4	Pruritus	FAERS: 481 Canada Vigilance: 167	View details 1416128 1463157 2208533 3415012 3515598 4014743 6111570 6666559 7199836 7200737 7639376 7946871 8053587 8067230 8279252 8829857 8955967 9168210 9495411 9620513 9621665 9836029 10193215 10411768 10960384 15025617 15954974 16116007 16507190 16816394 18403901 19462494	CTD SIDER Canada Vigilance US FAERS
5	Drug ineffective	FAERS: 470 Canada Vigilance: 71		Canada Vigilance US FAERS
6	Overdose	FAERS: 433 Canada Vigilance: 52		Canada Vigilance OFFSIDES US FAERS
7	Somnolence	FAERS: 296 Canada Vigilance: 30		Canada Vigilance SIDER US FAERS
8	Urticaria	FAERS: 292 Canada Vigilance: 62		Canada Vigilance SIDER US FAERS
9	Pain	FAERS: 256 Canada Vigilance: 50	View details 35781 100809 583013 1508838 1594278 1821668 2058846 2311982 2417918 2475196 2716967 2798544 2886842 2889016 2902362 2914040 3344988 3345190 3666080 3883165 3951883 3963465 4073432 4102363 4582903 6107628 6111570 6119681 6132369 6133822 6323692 6409194 6664228 6688731 6711945 6771831 6776300 6960119 7133734 7237324 7486124 7496043 7562497 7571027 7574067 7711342 7832313 7849498 7892029 8046782 8093521 8278214 8446441 8487060 8657430 8803381 8876756 8884884 9100184 9364413 9469527 9645186 9696456 9718474 9737096 9809090 9920454 10473483 10840460 10910861 10960401 11166930 11375843 11435893 11501851 11521799 11785926 11888230 12063090 12065195 12065198 12133575 12351285 12380661 12505952 12535471 12595749 12710656 12911621 14511336 15047977 15109977 15112860 15215642 15275824 15317861 15374743 15454842 15504181 15541421 15621368 15645768 15694878 15810761 16009644 16012418 16043013 16076651 16099101 16103897 16153779 16192531 16192778 16219607 16273134 16310713 16405873 16430413 16601258 16730668 16877185 16914643 16938755 17113353 17142049 17201744 17604593 17638127 17977662 18088559 18215494 18469544 18473019 18481104 18633239 18699797 18723286 18774343 18834357 18950446 19058542 19317728 19388818 19530373 19571391 19617648 19751225 19833175 19838028 19851767 19910396 19918026 20062554 20225289 20232057 20347578 20529380 20551293 20568289 20670049 20713147 20719804 20727387 20727678 20727859 20885006 21081778 21235400 21332999 23296104 23300227 23562495 24008352 25714890 26476280 26683109 26688378 29655911	CTD OFFSIDES SIDER Canada Vigilance US FAERS
10	Respiratory Depression	FAERS: 240 Canada Vigilance: 16		Canada Vigilance SIDER US FAERS
11	Toxicity to various agents	FAERS: 218 Canada Vigilance: 13		Canada Vigilance US FAERS
12	Medication Error	FAERS: 213 Canada Vigilance: 4		Canada Vigilance US FAERS
13	Hypotension	FAERS: 205 Canada Vigilance: 29	View details 978195 1435476 1592228 2059834 2439840 2632409 3515598 3540975 4036983 4038443 4462236 4706749 6131355 6308526 6716269 8053587 8067230 8225663 9748077 9797622 11698066 14563657 15867047 16131531 19786862 19843797	CTD SIDER Canada Vigilance US FAERS
14	Constipation	FAERS: 181 Canada Vigilance: 3	View details 3421781 6664228 12063090 16219607 17387357 18633239 20529380 23300227 25261794 25766885	CTD SIDER Canada Vigilance US FAERS
15	Accidental overdose	FAERS: 168 Canada Vigilance: 13		Canada Vigilance SIDER US FAERS
16	Completed Suicide	FAERS: 158 Canada Vigilance: 14		Canada Vigilance US FAERS
17	Headache	FAERS: 153 Canada Vigilance: 8	8320100 10973044	CTD SIDER Canada Vigilance US FAERS
18	Drug withdrawal syndrome	FAERS: 148 Canada Vigilance: 14		Canada Vigilance SIDER US FAERS
19	Drug Dependence	FAERS: 147 Canada Vigilance: 124		Canada Vigilance SIDER US FAERS
20	Product quality issue	FAERS: 143 Canada Vigilance: 2		Canada Vigilance US FAERS
21	Mental status changes	FAERS: 140		OFFSIDES US FAERS
22	Respiratory arrest	FAERS: 140 Canada Vigilance: 16		Canada Vigilance SIDER US FAERS
23	Acute Coronary Syndrome	FAERS: 138		US FAERS
24	Cardiac Arrest	FAERS: 131 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
25	Malaise	FAERS: 126 Canada Vigilance: 13		Canada Vigilance SIDER US FAERS
26	Feeling abnormal	FAERS: 121 Canada Vigilance: 7		Canada Vigilance SIDER US FAERS
27	Depressed Level of Consciousness	FAERS: 111 Canada Vigilance: 3		Canada Vigilance SIDER US FAERS
28	Drug abuser	FAERS: 111		OFFSIDES US FAERS
29	Pharmaceutical product complaint	FAERS: 111		OFFSIDES US FAERS
30	Delirium	FAERS: 108 Canada Vigilance: 4	View details 8803381 10853216 15857733 16043013 16669750 19786862	CTD SIDER Canada Vigilance US FAERS
31	Dizziness	FAERS: 108 Canada Vigilance: 21	2208533 6111570 10960401	CTD SIDER Canada Vigilance US FAERS
32	Lethargy	FAERS: 108	6894517 12351285	CTD OFFSIDES SIDER US FAERS
33	Unresponsive to stimuli	FAERS: 99 Canada Vigilance: 12		Canada Vigilance OFFSIDES US FAERS
34	Agitation	FAERS: 97 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
35	Incorrect dose administered	FAERS: 87 Canada Vigilance: 8		Canada Vigilance US FAERS
36	Hypersensitivity	FAERS: 85 Canada Vigilance: 6		Canada Vigilance SIDER US FAERS
37	Abdominal discomfort	FAERS: 80 Canada Vigilance: 2		Canada Vigilance US FAERS
38	Acute Chest Syndrome	FAERS: 74	15001964	CTD US FAERS
39	Chest Pain	FAERS: 74 Canada Vigilance: 8	3578343 11785593	CTD SIDER Canada Vigilance US FAERS
40	Asthenia	FAERS: 71 Canada Vigilance: 9		Canada Vigilance OFFSIDES SIDER US FAERS
41	Inadequate analgesia	FAERS: 69 Canada Vigilance: 4		Canada Vigilance US FAERS
42	Urinary Retention	FAERS: 65 Canada Vigilance: 2	View details 2058846 3199606 3328681 3344988 3515598 3754625 3978926 6118772 6666559 6859567 6897554 7023519 7138720 7200737 7489438 7946871 7979117 8009339 8279252 8679366 8686825 8829857 9168210 9789679 10193215 10411768 10494374 12710656 12903414 12925183 16507190	CTD SIDER Canada Vigilance US FAERS
43	Anxiety	FAERS: 63 Canada Vigilance: 10		Canada Vigilance SIDER US FAERS
44	Respiratory Failure	FAERS: 63 Canada Vigilance: 2		Canada Vigilance OFFSIDES SIDER US FAERS
45	Tremor	FAERS: 60 Canada Vigilance: 5		Canada Vigilance SIDER US FAERS
46	Swelling	FAERS: 55		SIDER US FAERS
47	Erythema	FAERS: 52 Canada Vigilance: 29		Canada Vigilance SIDER US FAERS
48	Respiratory distress	FAERS: 51 Canada Vigilance: 1		Canada Vigilance US FAERS
49	Bradycardia	FAERS: 47 Canada Vigilance: 18	View details 978195 2059834 2894646 3365320 3540975 3736332 6093200 6308526 6360061 6716269 6864538 8955967 18389982	CTD SIDER Canada Vigilance US FAERS
50	Drug toxicity	FAERS: 47		OFFSIDES US FAERS
51	Pneumonia	FAERS: 47 Canada Vigilance: 3		Canada Vigilance US FAERS
52	Fatigue	FAERS: 46 Canada Vigilance: 6	11785593	CTD OFFSIDES SIDER Canada Vigilance US FAERS
53	Tachycardia	FAERS: 46 Canada Vigilance: 6	View details 885163 3365320 4544391 6131355 6360061	CTD SIDER Canada Vigilance US FAERS
54	Cyanosis	FAERS: 44 Canada Vigilance: 8		Canada Vigilance OFFSIDES SIDER US FAERS
55	Hypoxia	FAERS: 44 Canada Vigilance: 13	8955967 10411768 19819313	CTD OFFSIDES SIDER Canada Vigilance US FAERS
56	Abdominal Pain	FAERS: 43 Canada Vigilance: 25	View details 1749637 3963440 4958020 8250329 9052925 11506132 18501054	CTD OFFSIDES SIDER Canada Vigilance US FAERS
57	Angioedema	FAERS: 42 Canada Vigilance: 2		Canada Vigilance OFFSIDES US FAERS
58	Intentional drug misuse	FAERS: 42		US FAERS
59	Dehydration	FAERS: 41 Canada Vigilance: 1		Canada Vigilance OFFSIDES SIDER US FAERS
60	Pulmonary Embolism	FAERS: 41		SIDER US FAERS
61	Disorientation	FAERS: 40 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
62	Unevaluable event	FAERS: 40		US FAERS
63	Weight decreased	FAERS: 40 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
64	Drug dispensing error	FAERS: 39		US FAERS
65	Myoclonus	FAERS: 39	View details 1410741 1784504 2475196 3400849 7486124 7574067 7644248 7711342 7892029 8087444 8278214 8279254 8317732 9244837 9809090 10365727 11506132 12925183 17542734	CTD SIDER US FAERS
66	Accidental exposure	FAERS: 38		US FAERS
67	Amnesia	FAERS: 38 Canada Vigilance: 4	View details 2273650 11350863 15306205 15913802 16174677 16319519 16631214 16753898 16893575 16946625 17565710 17638127 18086480 18316071 18440834 19770639 20226816 20875463 21130846 21194259 24309294	CTD OFFSIDES SIDER Canada Vigilance US FAERS
68	Dysuria	FAERS: 38 Canada Vigilance: 3		Canada Vigilance OFFSIDES SIDER US FAERS
69	Post procedural complication	FAERS: 38		US FAERS
70	Chest discomfort	FAERS: 37		SIDER US FAERS
71	Palpitations	FAERS: 37 Canada Vigilance: 4		Canada Vigilance SIDER US FAERS
72	Drug diversion	FAERS: 35 Canada Vigilance: 5		Canada Vigilance US FAERS
73	Intentional product misuse	FAERS: 34 Canada Vigilance: 6		Canada Vigilance US FAERS
74	Drug administration error	FAERS: 33		US FAERS
75	Incorrect route of drug administration	FAERS: 33		US FAERS
76	Restlessness	FAERS: 33		US FAERS
77	Accidental drug intake by child	FAERS: 32		OFFSIDES US FAERS
78	Malignant neoplasm progression	FAERS: 32		OFFSIDES US FAERS
79	Memory impairment	FAERS: 32 Canada Vigilance: 1		Canada Vigilance US FAERS
80	Suicide attempt	FAERS: 32		US FAERS
81	Granuloma	FAERS: 31	9588567	CTD US FAERS
82	Back Pain	FAERS: 30	View details 7497563 8250329 10494374 10812579 14631063 16507190	CTD SIDER US FAERS
83	Drug effect incomplete	FAERS: 30		US FAERS
84	Medical device complication	FAERS: 30		OFFSIDES US FAERS
85	Myocardial Infarction	FAERS: 30 Canada Vigilance: 1	7125250 10070497	CTD Canada Vigilance US FAERS
86	Acute kidney injury	FAERS: 27	10609351 18481104	CTD US FAERS
87	Leukoencephalopathy	FAERS: 26		OFFSIDES US FAERS
88	Wrong drug administered	FAERS: 25		US FAERS
89	Drug screen positive	FAERS: 24		US FAERS
90	General physical health deterioration	FAERS: 24		OFFSIDES US FAERS
91	Urinary tract infection	FAERS: 24		SIDER US FAERS
92	Circumstance or information capable of leading to medication error	FAERS: 22 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
93	Drug prescribing error	FAERS: 22		US FAERS
94	Syncope	FAERS: 22 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
95	Product substitution issue	FAERS: 21 Canada Vigilance: 5		Canada Vigilance US FAERS
96	Wrong technique in drug usage process	FAERS: 21		US FAERS
97	Altered state of consciousness	FAERS: 20		US FAERS
98	Device malfunction	FAERS: 20		US FAERS
99	Hypoventilation	FAERS: 20 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
100	Multiple drug overdose	FAERS: 20		OFFSIDES US FAERS
101	Wheezing	FAERS: 19		SIDER US FAERS
102	Burning sensation	FAERS: 18 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
103	Dysarthria	FAERS: 18 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
104	Injection site erythema	FAERS: 18		US FAERS
105	Pallor	FAERS: 18 Canada Vigilance: 10		Canada Vigilance SIDER US FAERS
106	Sepsis	FAERS: 18		SIDER US FAERS
107	Breakthrough Pain	FAERS: 17		OFFSIDES SIDER US FAERS
108	Drug exposure during pregnancy	FAERS: 17		OFFSIDES US FAERS
109	Flushing	FAERS: 17 Canada Vigilance: 22		Canada Vigilance SIDER US FAERS
110	Hypersomnia	FAERS: 17 Canada Vigilance: 1		Canada Vigilance US FAERS
111	Intentional misuse	FAERS: 17		US FAERS
112	Retching	FAERS: 17		US FAERS
113	Wrong technique in product usage process	FAERS: 17		US FAERS
114	Arthralgia	FAERS: 16 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
115	Deafness	FAERS: 16		US FAERS
116	Drug Tolerance	FAERS: 16 Canada Vigilance: 4		Canada Vigilance SIDER US FAERS
117	Intestinal Obstruction	FAERS: 16		SIDER US FAERS
118	Rhabdomyolysis	FAERS: 16	10609351	CTD SIDER US FAERS
119	Abasia	FAERS: 15		OFFSIDES US FAERS
120	Acidosis	FAERS: 15		OFFSIDES US FAERS
121	Device Failure	FAERS: 15		US FAERS
122	Disease Progression	FAERS: 15	12937158	CTD OFFSIDES SIDER US FAERS
123	Impaired gastric emptying	FAERS: 15		SIDER US FAERS
124	Infection	FAERS: 15		OFFSIDES SIDER US FAERS
125	Mental impairment	FAERS: 15 Canada Vigilance: 1		Canada Vigilance US FAERS
126	Nervousness	FAERS: 15		SIDER US FAERS
127	Stupor	FAERS: 15 Canada Vigilance: 5	17643282	CTD SIDER Canada Vigilance US FAERS
128	Victim of homicide	FAERS: 15		US FAERS
129	Chills	FAERS: 14 Canada Vigilance: 27		Canada Vigilance SIDER US FAERS
130	Cold sweat	FAERS: 14 Canada Vigilance: 3		Canada Vigilance OFFSIDES SIDER US FAERS
131	Device occlusion	FAERS: 14		US FAERS
132	Joint swelling	FAERS: 14		US FAERS
133	No adverse event	FAERS: 14		US FAERS
134	Brain Death	FAERS: 13 Canada Vigilance: 4		Canada Vigilance OFFSIDES US FAERS
135	Cellulitis	FAERS: 13		US FAERS
136	Injection site urticaria	FAERS: 13		US FAERS
137	Intentional product use issue	FAERS: 13		US FAERS
138	Metabolic acidosis	FAERS: 13 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
139	Pancreatitis	FAERS: 13 Canada Vigilance: 2		Canada Vigilance US FAERS
140	Product use issue	FAERS: 13 Canada Vigilance: 2		Canada Vigilance US FAERS
141	Pulmonary Hypertension	FAERS: 13		US FAERS
142	Thrombocytopenia	FAERS: 13		SIDER US FAERS
143	Aspartate Aminotransferase Increased	FAERS: 12 Canada Vigilance: 1		Canada Vigilance US FAERS
144	Device breakage	FAERS: 12		US FAERS
145	Device leakage	FAERS: 12		US FAERS
146	Ileus	FAERS: 12		SIDER US FAERS
147	Vertigo	FAERS: 12 Canada Vigilance: 3	2225300 20529380	CTD SIDER Canada Vigilance US FAERS
148	nervous system disorder	FAERS: 12		SIDER US FAERS
149	Accidental exposure to product	FAERS: 11 Canada Vigilance: 1		Canada Vigilance US FAERS
150	Activities of daily living impaired	FAERS: 11		US FAERS
151	Alanine Aminotransferase Increased	FAERS: 11		OFFSIDES US FAERS
152	Anorexia	FAERS: 11	16219607	CTD OFFSIDES SIDER US FAERS
153	Asthma	FAERS: 11		US FAERS
154	Blood creatinine increased	FAERS: 11		US FAERS
155	Crying	FAERS: 11 Canada Vigilance: 1		Canada Vigilance US FAERS
156	Euphoric mood	FAERS: 11 Canada Vigilance: 10		Canada Vigilance OFFSIDES SIDER US FAERS
157	Feeling Cold	FAERS: 11 Canada Vigilance: 2		Canada Vigilance US FAERS
158	Hypercapnia	FAERS: 11	19819313	CTD SIDER US FAERS
159	Paranoia	FAERS: 11 Canada Vigilance: 5		Canada Vigilance US FAERS
160	Acute myocardial infarction	FAERS: 10		OFFSIDES US FAERS
161	Anaphylactic shock	FAERS: 10		SIDER US FAERS
162	Bronchospasm	FAERS: 10 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
163	Carcinoma	FAERS: 10		US FAERS
164	Cerebrovascular accident	FAERS: 10		US FAERS
165	Dementia	FAERS: 10		US FAERS
166	Infusion site erythema	FAERS: 10		US FAERS
167	Lymphadenopathy	FAERS: 10		US FAERS
168	Mechanical ventilation complication	FAERS: 10		US FAERS
169	Neck Pain	FAERS: 10		US FAERS
170	Paraparesis	FAERS: 10	10494374	CTD US FAERS
171	Urinary Incontinence	FAERS: 10	16971632	CTD US FAERS
172	Accidental exposure to product by child	FAERS: 9 Canada Vigilance: 2		Canada Vigilance US FAERS
173	Acute respiratory failure	FAERS: 9		US FAERS
174	Asphyxia	FAERS: 9		US FAERS
175	Atrial Fibrillation	FAERS: 9	19378534	CTD SIDER US FAERS
176	Blood pH decreased	FAERS: 9		OFFSIDES US FAERS
177	Blood pressure fluctuation	FAERS: 9 Canada Vigilance: 1		Canada Vigilance US FAERS
178	Blood urea increased	FAERS: 9		OFFSIDES US FAERS
179	Catheter related complication	FAERS: 9		US FAERS
180	Device dislocation	FAERS: 9		US FAERS
181	Drug dose omission	FAERS: 9		US FAERS
182	Drug level increased	FAERS: 9 Canada Vigilance: 1		Canada Vigilance US FAERS
183	Drug screen false positive	FAERS: 9		US FAERS
184	Dyspepsia	FAERS: 9 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
185	Implant site extravasation	FAERS: 9		US FAERS
186	Mydriasis	FAERS: 9 Canada Vigilance: 1	6409656	CTD SIDER Canada Vigilance US FAERS
187	Nasopharyngitis	FAERS: 9 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
188	Poisoning	FAERS: 9	23296104	CTD US FAERS
189	Posterior reversible encephalopathy syndrome	FAERS: 9		US FAERS
190	Product tampering	FAERS: 9		US FAERS
191	Radiculopathy	FAERS: 9		US FAERS
192	Therapeutic response unexpected with drug substitution	FAERS: 9		US FAERS
193	Throat irritation	FAERS: 9		US FAERS
194	Transaminases increased	FAERS: 9		US FAERS
195	Accidental death	FAERS: 8		US FAERS
196	Bedridden	FAERS: 8 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
197	Carbon Monoxide Poisoning	FAERS: 8		US FAERS
198	Choking	FAERS: 8		US FAERS
199	Diplopia	FAERS: 8 Canada Vigilance: 2	1990925	CTD SIDER Canada Vigilance US FAERS
200	Dysgeusia	FAERS: 8		SIDER US FAERS
201	Impaired driving ability	FAERS: 8 Canada Vigilance: 3		Canada Vigilance US FAERS
202	Implant site infection	FAERS: 8		US FAERS
203	Influenza	FAERS: 8 Canada Vigilance: 3		Canada Vigilance SIDER US FAERS
204	Meningitis	FAERS: 8		US FAERS
205	Musculoskeletal Pain	FAERS: 8 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
206	Pericarditis	FAERS: 8		US FAERS
207	Peripheral swelling	FAERS: 8 Canada Vigilance: 1		Canada Vigilance US FAERS
208	Acute Lung Injury	FAERS: 7		US FAERS
209	Adverse event	FAERS: 7		US FAERS
210	Anuria	FAERS: 7	8225663	CTD US FAERS
211	Bronchial Hyperreactivity	FAERS: 7		US FAERS
212	Discomfort	FAERS: 7		SIDER US FAERS
213	Electroencephalogram abnormal	FAERS: 7		US FAERS
214	Feeling jittery	FAERS: 7		US FAERS
215	Formication	FAERS: 7 Canada Vigilance: 1		Canada Vigilance US FAERS
216	Gout	FAERS: 7 Canada Vigilance: 2		Canada Vigilance US FAERS
217	Hydronephrosis	FAERS: 7	12710656 18481104	CTD US FAERS
218	Inappropriate schedule of drug administration	FAERS: 7		US FAERS
219	Incorrect drug administration rate	FAERS: 7		US FAERS
220	Infusion site urticaria	FAERS: 7		US FAERS
221	Injection site pruritus	FAERS: 7		US FAERS
222	Mood swings	FAERS: 7		SIDER US FAERS
223	Myalgia	FAERS: 7 Canada Vigilance: 1		Canada Vigilance US FAERS
224	Neonatal respiratory distress	FAERS: 7		US FAERS
225	Paraplegia	FAERS: 7		OFFSIDES US FAERS
226	Product taste abnormal	FAERS: 7		US FAERS
227	Rash erythematous	FAERS: 7 Canada Vigilance: 16		Canada Vigilance US FAERS
228	Tooth Loss	FAERS: 7	17687962	CTD US FAERS
229	Troponin increased	FAERS: 7		US FAERS
230	Accidental underdose	FAERS: 6		US FAERS
231	Anoxic Encephalopathy	FAERS: 6		US FAERS
232	Blood glucose increased	FAERS: 6 Canada Vigilance: 2		Canada Vigilance US FAERS
233	Brain Hypoxia	FAERS: 6 Canada Vigilance: 3		Canada Vigilance US FAERS
234	Cardiomegaly	FAERS: 6		US FAERS
235	Deep Vein Thrombosis	FAERS: 6		US FAERS
236	Device kink	FAERS: 6		US FAERS
237	Drug administered to patient of inappropriate age	FAERS: 6		US FAERS
238	Drug screen negative	FAERS: 6		US FAERS
239	Dysphonia	FAERS: 6 Canada Vigilance: 1		Canada Vigilance US FAERS
240	Emotional distress	FAERS: 6		US FAERS
241	Fibromyalgia	FAERS: 6 Canada Vigilance: 1		Canada Vigilance US FAERS
242	Hydrocephalus	FAERS: 6		US FAERS
243	Hypophagia	FAERS: 6		US FAERS
244	Injection site pain	FAERS: 6 Canada Vigilance: 3		Canada Vigilance SIDER US FAERS
245	Large intestine perforation	FAERS: 6		US FAERS
246	Necrosis	FAERS: 6	14871405 17465212	CTD US FAERS
247	Neonatal respiratory depression	FAERS: 6		US FAERS
248	Personality Change	FAERS: 6 Canada Vigilance: 1		Canada Vigilance US FAERS
249	Pneumothorax	FAERS: 6		OFFSIDES SIDER US FAERS
250	Poor quality drug administered	FAERS: 6		US FAERS
251	Procedural complication	FAERS: 6		US FAERS
252	Product container issue	FAERS: 6		US FAERS
253	Product label issue	FAERS: 6		US FAERS
254	Sinus Tachycardia	FAERS: 6		US FAERS
255	Snoring	FAERS: 6		US FAERS
256	Stress	FAERS: 6 Canada Vigilance: 3		Canada Vigilance US FAERS
257	Sudden death	FAERS: 6 Canada Vigilance: 3		Canada Vigilance OFFSIDES US FAERS
258	Ventricular Fibrillation	FAERS: 6 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
259	Abdominal Abscess	FAERS: 5		US FAERS
260	Anger	FAERS: 5		US FAERS
261	Aphasia	FAERS: 5		US FAERS
262	Biliary dilatation	FAERS: 5		OFFSIDES US FAERS
263	Blindness	FAERS: 5		US FAERS
264	Blood creatine phosphokinase increased	FAERS: 5		US FAERS
265	Blood glucose decreased	FAERS: 5		US FAERS
266	Blood potassium decreased	FAERS: 5		US FAERS
267	Blood testosterone decreased	FAERS: 5		US FAERS
268	Bronchitis	FAERS: 5		US FAERS
269	Bronchopneumonia	FAERS: 5		US FAERS
270	Cerebral ventricle dilatation	FAERS: 5		US FAERS
271	Depressed mood	FAERS: 5 Canada Vigilance: 1		Canada Vigilance US FAERS
272	Device damage	FAERS: 5		US FAERS
273	Emotional disorder	FAERS: 5		US FAERS
274	Erectile dysfunction	FAERS: 5		SIDER US FAERS
275	Expired drug administered	FAERS: 5		US FAERS
276	Eye pain	FAERS: 5		SIDER US FAERS
277	Inflammation	FAERS: 5 Canada Vigilance: 4		Canada Vigilance US FAERS
278	Infusion site pruritus	FAERS: 5		US FAERS
279	Intercepted drug dispensing error	FAERS: 5		US FAERS
280	Intestinal Perforation	FAERS: 5 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
281	Lip swelling	FAERS: 5		US FAERS
282	Lipase increased	FAERS: 5 Canada Vigilance: 2		Canada Vigilance US FAERS
283	Mast cell degranulation present	FAERS: 5		US FAERS
284	Medication residue present	FAERS: 5		US FAERS
285	Muscle Rigidity	FAERS: 5 Canada Vigilance: 1	View details 1172489 1676175 3023105 3600821 3780846 4350546 6298524 6420630 6663457 12191819 18699797 19755623	CTD SIDER Canada Vigilance US FAERS
286	Negative thoughts	FAERS: 5		US FAERS
287	Neonatal disorder	FAERS: 5		US FAERS
288	PCO2 increased	FAERS: 5		US FAERS
289	Post lumbar puncture syndrome	FAERS: 5		US FAERS
290	Productive Cough	FAERS: 5		US FAERS
291	Psychomotor skills impaired	FAERS: 5 Canada Vigilance: 6		Canada Vigilance US FAERS
292	Pulmonary congestion	FAERS: 5 Canada Vigilance: 3		Canada Vigilance US FAERS
293	Sluggishness	FAERS: 5		US FAERS
294	Stridor	FAERS: 5		US FAERS
295	Supraventricular tachycardia	FAERS: 5		SIDER US FAERS
296	Thrombosis	FAERS: 5 Canada Vigilance: 1		Canada Vigilance US FAERS
297	Visual disturbance	FAERS: 5		SIDER US FAERS
298	Walking aid user	FAERS: 5		US FAERS
299	Ageusia	FAERS: 4		US FAERS
300	Anaphylactoid Reaction	FAERS: 4 Canada Vigilance: 5		Canada Vigilance SIDER US FAERS
301	Angina Pectoris	FAERS: 4		US FAERS
302	Anion Gap	FAERS: 4		US FAERS
303	Anosmia	FAERS: 4		US FAERS
304	Apallic syndrome	FAERS: 4		US FAERS
305	Biliary Colic	FAERS: 4 Canada Vigilance: 3		Canada Vigilance SIDER US FAERS
306	Blood immunoglobulin A increased	FAERS: 4		US FAERS
307	Catheter site related reaction	FAERS: 4		US FAERS
308	Dental caries	FAERS: 4	17687962	CTD OFFSIDES US FAERS
309	Device intolerance	FAERS: 4		US FAERS
310	Diplegia	FAERS: 4		US FAERS
311	Documented hypersensitivity to administered product	FAERS: 4		US FAERS
312	Electrocardiogram abnormal	FAERS: 4		US FAERS
313	Electrocardiogram change	FAERS: 4		US FAERS
314	Electrolyte imbalance	FAERS: 4		US FAERS
315	Epilepsy	FAERS: 4	1331416 9583774	CTD US FAERS
316	Epistaxis	FAERS: 4 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
317	Fluid overload	FAERS: 4		OFFSIDES US FAERS
318	Foaming at mouth	FAERS: 4		US FAERS
319	Foreign body trauma	FAERS: 4		US FAERS
320	Hepatitis C	FAERS: 4 Canada Vigilance: 1	12937158	CTD OFFSIDES Canada Vigilance US FAERS
321	Impaired work ability	FAERS: 4		US FAERS
322	Incoherent	FAERS: 4		OFFSIDES US FAERS
323	Incontinence	FAERS: 4		OFFSIDES US FAERS
324	Infusion site granuloma	FAERS: 4		US FAERS
325	Infusion site mass	FAERS: 4		US FAERS
326	Infusion site pain	FAERS: 4		US FAERS
327	Injection Site Reaction	FAERS: 4 Canada Vigilance: 84		Canada Vigilance US FAERS
328	Intentional self-injury	FAERS: 4 Canada Vigilance: 1		Canada Vigilance US FAERS
329	Medication residue	FAERS: 4		US FAERS
330	Moaning	FAERS: 4		US FAERS
331	Muscle Spasticity	FAERS: 4 Canada Vigilance: 1	6176094 8087444	CTD Canada Vigilance US FAERS
332	Musculoskeletal discomfort	FAERS: 4		SIDER US FAERS
333	Narcotic intoxication	FAERS: 4		US FAERS
334	Neonatal multi-organ failure	FAERS: 4		US FAERS
335	Neonatal oversedation	FAERS: 4		US FAERS
336	Nystagmus	FAERS: 4		OFFSIDES SIDER US FAERS
337	Pancreatic carcinoma	FAERS: 4		US FAERS
338	Polyneuropathy chronic	FAERS: 4		US FAERS
339	Presyncope	FAERS: 4		SIDER US FAERS
340	Product use in unapproved indication	FAERS: 4		US FAERS
341	Pulmonary granuloma	FAERS: 4		US FAERS
342	Quality of life decreased	FAERS: 4		US FAERS
343	Restless Legs Syndrome	FAERS: 4		US FAERS
344	Screaming	FAERS: 4		US FAERS
345	Spinal column stenosis	FAERS: 4		US FAERS
346	Sudden Cardiac Death	FAERS: 4		US FAERS
347	Tinnitus	FAERS: 4		US FAERS
348	Transcranial electrical motor evoked potential monitoring abnormal	FAERS: 4		US FAERS
349	Visual Impairment	FAERS: 4 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
350	Wound dehiscence	FAERS: 4		US FAERS
351	Abscess	FAERS: 3		OFFSIDES US FAERS
352	Alcohol abuse	FAERS: 3		SIDER US FAERS
353	Anion gap abnormal	FAERS: 3 Canada Vigilance: 1		Canada Vigilance US FAERS
354	Arteriosclerosis	FAERS: 3		US FAERS
355	Ataxia	FAERS: 3		SIDER US FAERS
356	Blood potassium increased	FAERS: 3		OFFSIDES US FAERS
357	Blood sodium decreased	FAERS: 3		US FAERS
358	Brain stem syndrome	FAERS: 3		US FAERS
359	Cardiac enzymes increased	FAERS: 3		US FAERS
360	Catatonia	FAERS: 3	View details 569859 4958020 4962749 6107628 6176094 7196998	CTD OFFSIDES US FAERS
361	Chromaturia	FAERS: 3		US FAERS
362	Clonus	FAERS: 3		US FAERS
363	Coma scale abnormal	FAERS: 3		US FAERS
364	Coronary Artery Disease	FAERS: 3		US FAERS
365	Dependence	FAERS: 3 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
366	Device deployment issue	FAERS: 3		US FAERS
367	Device ineffective	FAERS: 3		US FAERS
368	Device infusion issue	FAERS: 3		US FAERS
369	Device related infection	FAERS: 3		US FAERS
370	Documented hypersensitivity to administered drug	FAERS: 3		US FAERS
371	Drooling	FAERS: 3		US FAERS
372	Dry skin	FAERS: 3		OFFSIDES SIDER US FAERS
373	Duodenal Obstruction	FAERS: 3		US FAERS
374	Ecchymosis	FAERS: 3		US FAERS
375	Endocarditis	FAERS: 3		OFFSIDES US FAERS
376	Flank Pain	FAERS: 3		US FAERS
377	Gamma-Glutamyltransferase Increased	FAERS: 3		US FAERS
378	Gastrointestinal motility disorder	FAERS: 3		US FAERS
379	Hallucinations, mixed	FAERS: 3		US FAERS
380	Head discomfort	FAERS: 3		US FAERS
381	Heat Stroke	FAERS: 3		US FAERS
382	Hepatic necrosis	FAERS: 3		US FAERS
383	Hernia	FAERS: 3		US FAERS
384	Homicide	FAERS: 3		US FAERS
385	Hyperreflexia	FAERS: 3		US FAERS
386	Hyperventilation	FAERS: 3 Canada Vigilance: 3		Canada Vigilance US FAERS
387	Hypopituitarism	FAERS: 3	14631063	CTD US FAERS
388	Hypothyroidism	FAERS: 3		US FAERS
389	Iatrogenic injury	FAERS: 3		US FAERS
390	Impaired self-care	FAERS: 3		US FAERS
391	Implant site discharge	FAERS: 3		US FAERS
392	Implant site erythema	FAERS: 3		US FAERS
393	Implant site pain	FAERS: 3		US FAERS
394	Incorrect dose administered by device	FAERS: 3		US FAERS
395	Incorrect product storage	FAERS: 3		US FAERS
396	Intelligence test abnormal	FAERS: 3		US FAERS
397	Intercepted medication error	FAERS: 3		US FAERS
398	Intraspinal abscess	FAERS: 3		US FAERS
399	Kounis Syndrome	FAERS: 3		US FAERS
400	Laceration	FAERS: 3		US FAERS
401	Locked-In Syndrome	FAERS: 3		US FAERS
402	Lymphoma	FAERS: 3		US FAERS
403	Maternal exposure during pregnancy	FAERS: 3 Canada Vigilance: 1		Canada Vigilance US FAERS
404	Medical device discomfort	FAERS: 3		US FAERS
405	Medical device pain	FAERS: 3		US FAERS
406	Meningitis herpes	FAERS: 3		US FAERS
407	Metastasis	FAERS: 3		US FAERS
408	Monoplegia	FAERS: 3		US FAERS
409	Musculoskeletal stiffness	FAERS: 3 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
410	Nerve injury	FAERS: 3		US FAERS
411	Night sweats	FAERS: 3		US FAERS
412	Oral candidiasis	FAERS: 3		US FAERS
413	Oropharyngeal pain	FAERS: 3		US FAERS
414	Osteolysis	FAERS: 3		US FAERS
415	Paresis	FAERS: 3	10609351 17961837	CTD US FAERS
416	Petechiae	FAERS: 3		US FAERS
417	Pharyngeal Stenosis	FAERS: 3		US FAERS
418	Photophobia	FAERS: 3		US FAERS
419	Physical assault	FAERS: 3		US FAERS
420	Product label confusion	FAERS: 3		US FAERS
421	Product packaging quantity issue	FAERS: 3		US FAERS
422	Product physical issue	FAERS: 3		US FAERS
423	Pump reservoir issue	FAERS: 3		US FAERS
424	Purpura	FAERS: 3 Canada Vigilance: 1		Canada Vigilance US FAERS
425	Rheumatoid Arthritis	FAERS: 3		US FAERS
426	Septic Shock	FAERS: 3		US FAERS
427	Seroma	FAERS: 3		US FAERS
428	Shock	FAERS: 3 Canada Vigilance: 3	9748077	CTD SIDER Canada Vigilance US FAERS
429	Sinus bradycardia	FAERS: 3		US FAERS
430	Sinusitis	FAERS: 3 Canada Vigilance: 2		Canada Vigilance US FAERS
431	Skin reaction	FAERS: 3		US FAERS
432	Sphincter of Oddi Dysfunction	FAERS: 3	View details 1119938 1731556 3368250 3823361 6479537 9052925 9431903 9658871 11379694 11489400 12359295	CTD US FAERS
433	Staring	FAERS: 3		US FAERS
434	Subcutaneous Abscess	FAERS: 3		US FAERS
435	Therapeutic product effect incomplete	FAERS: 3 Canada Vigilance: 5		Canada Vigilance US FAERS
436	Therapeutic response unexpected	FAERS: 3		US FAERS
437	Therapy non-responder	FAERS: 3		OFFSIDES US FAERS
438	Twiddler's syndrome	FAERS: 3		US FAERS
439	Ultrasound Doppler abnormal	FAERS: 3		US FAERS
440	Uterine Cancer	FAERS: 3		OFFSIDES US FAERS
441	Vascular pain	FAERS: 3		US FAERS
442	treatment failure	FAERS: 3		US FAERS
443	Abdominal hernia obstructive	FAERS: 2		US FAERS
444	Abnormal sleep-related event	FAERS: 2		US FAERS
445	Acne	FAERS: 2		US FAERS
446	Air Embolism	FAERS: 2		US FAERS
447	Allergy to animal	FAERS: 2		US FAERS
448	Alopecia	FAERS: 2		US FAERS
449	Analgesic drug level above therapeutic	FAERS: 2		US FAERS
450	Apathy	FAERS: 2		SIDER US FAERS
451	Aphagia	FAERS: 2		US FAERS
452	Arachnoiditis	FAERS: 2		US FAERS
453	Arthritis	FAERS: 2 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
454	Ascites	FAERS: 2		OFFSIDES US FAERS
455	Autonomic nervous system imbalance	FAERS: 2		US FAERS
456	Back disorder	FAERS: 2		US FAERS
457	Bipolar Disorder	FAERS: 2	4402472 13688671	CTD US FAERS
458	Bladder dysfunction	FAERS: 2		US FAERS
459	Blood creatine increased	FAERS: 2		US FAERS
460	Blood creatine phosphokinase MB increased	FAERS: 2		US FAERS
461	Blood immunoglobulin G increased	FAERS: 2		US FAERS
462	Blood urine present	FAERS: 2		US FAERS
463	Bone pain	FAERS: 2 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
464	Breathing-related sleep disorder	FAERS: 2		US FAERS
465	Cancer Pain	FAERS: 2		US FAERS
466	Capsule physical issue	FAERS: 2		US FAERS
467	Cardiac Flutter	FAERS: 2		US FAERS
468	Cerebral vasoconstriction	FAERS: 2		US FAERS
469	Cholelithiasis	FAERS: 2	7190799 10853216	CTD US FAERS
470	Claustrophobia	FAERS: 2		US FAERS
471	Clumsiness	FAERS: 2		US FAERS
472	Consciousness fluctuating	FAERS: 2		US FAERS
473	Contraindicated product administered	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
474	Delusional perception	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
475	Dermatitis	FAERS: 2 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
476	Device alarm issue	FAERS: 2		US FAERS
477	Device computer issue	FAERS: 2		US FAERS
478	Device migration	FAERS: 2		US FAERS
479	Device power source issue	FAERS: 2		US FAERS
480	Diabetes Mellitus	FAERS: 2		US FAERS
481	Disability	FAERS: 2		US FAERS
482	Disease recurrence	FAERS: 2		US FAERS
483	Drug administered at inappropriate site	FAERS: 2		US FAERS
484	Drug clearance decreased	FAERS: 2		US FAERS
485	Drug effect delayed	FAERS: 2		US FAERS
486	Drug ineffective for unapproved indication	FAERS: 2		US FAERS
487	Drug monitoring procedure incorrectly performed	FAERS: 2 Canada Vigilance: 2		Canada Vigilance US FAERS
488	Drug resistance	FAERS: 2		OFFSIDES US FAERS
489	Dystonia	FAERS: 2		US FAERS
490	Echolalia	FAERS: 2		US FAERS
491	Electromechanical dissociation	FAERS: 2		US FAERS
492	Encephalitis	FAERS: 2		US FAERS
493	Endocrinopathy diencephalic	FAERS: 2		US FAERS
494	Eructation	FAERS: 2		US FAERS
495	Excoriation	FAERS: 2		US FAERS
496	Exposure via skin contact	FAERS: 2		US FAERS
497	Eye irritation	FAERS: 2		US FAERS
498	Fibrosis	FAERS: 2		US FAERS
499	Food Allergy	FAERS: 2		US FAERS
500	Gastric Dilatation	FAERS: 2		US FAERS
501	Gastritis	FAERS: 2		US FAERS
502	Gastrointestinal carcinoma	FAERS: 2		US FAERS
503	Gastrointestinal perforation	FAERS: 2		US FAERS
504	Gaze palsy	FAERS: 2		OFFSIDES US FAERS
505	Hemiplegia	FAERS: 2	6692145	CTD US FAERS
506	Hepatitis	FAERS: 2		SIDER US FAERS
507	Hepatosplenomegaly	FAERS: 2		US FAERS
508	Hostility	FAERS: 2		US FAERS
509	Hypertensive crisis	FAERS: 2		US FAERS
510	Hypogonadism	FAERS: 2	21332999	CTD SIDER US FAERS
511	Hyporeflexia	FAERS: 2		US FAERS
512	Implant site effusion	FAERS: 2		US FAERS
513	Implant site reaction	FAERS: 2		US FAERS
514	Implant site swelling	FAERS: 2		US FAERS
515	Inappropriate schedule of product administration	FAERS: 2		US FAERS
516	Incision site erythema	FAERS: 2		US FAERS
517	Incision site pain	FAERS: 2		US FAERS
518	Incorrect drug administration duration	FAERS: 2		US FAERS
519	Incorrect product administration duration	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
520	Infusion site reaction	FAERS: 2		US FAERS
521	Injection site granuloma	FAERS: 2		US FAERS
522	Injection site mass	FAERS: 2		US FAERS
523	Injection site nodule	FAERS: 2		US FAERS
524	Intercepted drug administration error	FAERS: 2		US FAERS
525	Intracranial Hypotension	FAERS: 2		OFFSIDES US FAERS
526	Joint Range of Motion Decreased	FAERS: 2		US FAERS
527	Lactation Disorder	FAERS: 2		US FAERS
528	Laryngitis	FAERS: 2		US FAERS
529	Leukocytosis	FAERS: 2 Canada Vigilance: 2		Canada Vigilance US FAERS
530	Life expectancy shortened	FAERS: 2		US FAERS
531	Ligament injury	FAERS: 2		US FAERS
532	Liquid product physical issue	FAERS: 2		US FAERS
533	Live Birth	FAERS: 2		US FAERS
534	Malabsorption	FAERS: 2		US FAERS
535	Manufacturing materials issue	FAERS: 2		US FAERS
536	Maternal exposure during delivery	FAERS: 2		US FAERS
537	Mediastinitis	FAERS: 2		US FAERS
538	Medical device site erythema	FAERS: 2		US FAERS
539	Metastatic Neoplasm	FAERS: 2		OFFSIDES US FAERS
540	Multiple Sclerosis	FAERS: 2		US FAERS
541	Multiple drug overdose accidental	FAERS: 2		US FAERS
542	Muscle tightness	FAERS: 2		US FAERS
543	Myoclonic Epilepsy	FAERS: 2		US FAERS
544	Narcotic Bowel Syndrome	FAERS: 2		US FAERS
545	Neonatal hypotension	FAERS: 2		US FAERS
546	Neuralgia	FAERS: 2	View details 8278214 15037816 19571391 23756650	CTD SIDER US FAERS
547	No reaction on previous exposure to drug	FAERS: 2		US FAERS
548	Nonspecific reaction	FAERS: 2		US FAERS
549	Obesity	FAERS: 2		US FAERS
550	Occupational exposure to product	FAERS: 2		US FAERS
551	Oliguria	FAERS: 2	7023519 12710656	CTD SIDER US FAERS
552	Opiates positive	FAERS: 2		US FAERS
553	Osteitis	FAERS: 2		US FAERS
554	Osteomyelitis	FAERS: 2		US FAERS
555	Oxygen consumption decreased	FAERS: 2		US FAERS
556	Oxygen saturation abnormal	FAERS: 2		US FAERS
557	PO2 decreased	FAERS: 2		US FAERS
558	Patient-device incompatibility	FAERS: 2		US FAERS
559	Pelvic mass	FAERS: 2		US FAERS
560	Peripheral embolism	FAERS: 2		US FAERS
561	Perseveration	FAERS: 2		US FAERS
562	Phlebitis	FAERS: 2 Canada Vigilance: 5		Canada Vigilance SIDER US FAERS
563	Polysubstance abuse	FAERS: 2		US FAERS
564	Poor quality sleep	FAERS: 2		US FAERS
565	Post procedural infection	FAERS: 2		US FAERS
566	Pre-existing condition improved	FAERS: 2		OFFSIDES US FAERS
567	Pregnancy	FAERS: 2		US FAERS
568	Premature Ejaculation	FAERS: 2		US FAERS
569	Prescribed overdose	FAERS: 2		US FAERS
570	Product dispensing error	FAERS: 2 Canada Vigilance: 4		Canada Vigilance US FAERS
571	Product formulation issue	FAERS: 2		US FAERS
572	Product measured potency issue	FAERS: 2		US FAERS
573	Product sterility lacking	FAERS: 2		US FAERS
574	Product storage error	FAERS: 2 Canada Vigilance: 3		Canada Vigilance US FAERS
575	Pruritus allergic	FAERS: 2		US FAERS
576	Pulmonary Fibrosis	FAERS: 2		US FAERS
577	Pulmonary toxicity	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
578	Pyelocaliectasis	FAERS: 2		US FAERS
579	Quadriparesis	FAERS: 2		US FAERS
580	Regurgitation	FAERS: 2		US FAERS
581	Renal impairment neonatal	FAERS: 2		US FAERS
582	Renal tubular necrosis	FAERS: 2		OFFSIDES US FAERS
583	Schizophrenia	FAERS: 2		US FAERS
584	Scleroderma	FAERS: 2		US FAERS
585	Serotonin Syndrome	FAERS: 2		US FAERS
586	Shoulder Pain	FAERS: 2		US FAERS
587	Skin discomfort	FAERS: 2		US FAERS
588	Slow response to stimuli	FAERS: 2		US FAERS
589	Somnambulism	FAERS: 2		US FAERS
590	Sopor	FAERS: 2		US FAERS
591	Stevens-Johnson Syndrome	FAERS: 2		US FAERS
592	Subileus	FAERS: 2		US FAERS
593	Suspected product tampering	FAERS: 2		US FAERS
594	Syringe issue	FAERS: 2		US FAERS
595	Terminal state	FAERS: 2		US FAERS
596	Theft	FAERS: 2		US FAERS
597	Toothache	FAERS: 2		US FAERS
598	Tracheobronchitis	FAERS: 2		US FAERS
599	Transcription medication error	FAERS: 2		US FAERS
600	Trichotillomania	FAERS: 2		US FAERS
601	Trismus	FAERS: 2		US FAERS
602	Troponin I increased	FAERS: 2		US FAERS
603	Umbilical cord vascular disorder	FAERS: 2		US FAERS
604	Underweight	FAERS: 2		US FAERS
605	Unresponsive to pain stimuli	FAERS: 2		US FAERS
606	Unresponsive to verbal stimuli	FAERS: 2		OFFSIDES US FAERS
607	Urinary hesitation	FAERS: 2		SIDER US FAERS
608	Venous occlusion	FAERS: 2		US FAERS
609	Viral upper respiratory tract infection	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
610	Wheelchair user	FAERS: 2		US FAERS
611	White blood cell count decreased	FAERS: 2		US FAERS
612	Wound Infection	FAERS: 2		US FAERS
613	Wrong product administered	FAERS: 2 Canada Vigilance: 5		Canada Vigilance US FAERS
614	Wrong technique in device usage process	FAERS: 2		US FAERS
615	Abdominal Infection	FAERS: 1		US FAERS
616	Abdominal rigidity	FAERS: 1		US FAERS
617	Abdominal symptom	FAERS: 1		US FAERS
618	Acquired hydrocele	FAERS: 1		US FAERS
619	Adenocarcinoma	FAERS: 1		US FAERS
620	Administration related reaction	FAERS: 1		US FAERS
621	Administration site pruritus	FAERS: 1		US FAERS
622	Administration site reaction	FAERS: 1		US FAERS
623	Agonal death struggle	FAERS: 1		US FAERS
624	Alcohol poisoning	FAERS: 1		US FAERS
625	Amaurosis	FAERS: 1		US FAERS
626	Ammonia increased	FAERS: 1		US FAERS
627	Anal Fissure	FAERS: 1		US FAERS
628	Anastomotic complication	FAERS: 1		US FAERS
629	Anastomotic ulcer	FAERS: 1		US FAERS
630	Ankle Fracture	FAERS: 1		OFFSIDES US FAERS
631	Anoxia	FAERS: 1		US FAERS
632	Aphonia	FAERS: 1		US FAERS
633	Apparent death	FAERS: 1		US FAERS
634	Arthropathy	FAERS: 1		US FAERS
635	Aspergillosis	FAERS: 1		US FAERS
636	Asterixis	FAERS: 1		US FAERS
637	Asthenopia	FAERS: 1		US FAERS
638	Aversion	FAERS: 1		US FAERS
639	Benign Prostatic Hyperplasia	FAERS: 1		US FAERS
640	Bicuspid aortic valve	FAERS: 1		US FAERS
641	Bile duct pressure increased	FAERS: 1		US FAERS
642	Bladder spasm	FAERS: 1		SIDER US FAERS
643	Blood alkaline phosphatase increased	FAERS: 1 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
644	Blood amylase increased	FAERS: 1		US FAERS
645	Blood blister	FAERS: 1		US FAERS
646	Blood brain barrier defect	FAERS: 1		US FAERS
647	Blood gases abnormal	FAERS: 1		US FAERS
648	Blood glucose abnormal	FAERS: 1		US FAERS
649	Blood glucose fluctuation	FAERS: 1		US FAERS
650	Blood lactate dehydrogenase increased	FAERS: 1		OFFSIDES US FAERS
651	Blood pH increased	FAERS: 1		US FAERS
652	Blood pressure immeasurable	FAERS: 1		US FAERS
653	Blood thyroid stimulating hormone increased	FAERS: 1		US FAERS
654	Body fat disorder	FAERS: 1		US FAERS
655	Bradyphrenia	FAERS: 1		US FAERS
656	Brain Contusion	FAERS: 1		US FAERS
657	Breast tenderness	FAERS: 1		US FAERS
658	Bronchial Obstruction	FAERS: 1		US FAERS
659	Brown-Sequard Syndrome	FAERS: 1		US FAERS
660	Cardiac Hypertrophy	FAERS: 1		US FAERS
661	Cardiac discomfort	FAERS: 1		US FAERS
662	Cartilage injury	FAERS: 1		US FAERS
663	Cataract	FAERS: 1		US FAERS
664	Catheter site effusion	FAERS: 1		US FAERS
665	Catheter site inflammation	FAERS: 1		US FAERS
666	Catheter site injury	FAERS: 1		US FAERS
667	Catheter site swelling	FAERS: 1		US FAERS
668	Cerebellar infarction	FAERS: 1		US FAERS
669	Cerebral hygroma	FAERS: 1		OFFSIDES US FAERS
670	Cervix carcinoma	FAERS: 1		US FAERS
671	Cholangiectasis acquired	FAERS: 1		US FAERS
672	Cholestasis	FAERS: 1	3421781 6537876	CTD US FAERS
673	Colectomy	FAERS: 1		US FAERS
674	Colitis	FAERS: 1		US FAERS
675	Colonic Pseudo-Obstruction	FAERS: 1		US FAERS
676	Compression fracture	FAERS: 1		US FAERS
677	Confabulation	FAERS: 1		OFFSIDES US FAERS
678	Congenital Hydrocephalus	FAERS: 1		US FAERS
679	Contraindicated drug administered	FAERS: 1		US FAERS
680	Contraindicated drug prescribed	FAERS: 1		US FAERS
681	Conversion disorder	FAERS: 1		US FAERS
682	Cor pulmonale	FAERS: 1		US FAERS
683	Counterfeit drug administered	FAERS: 1		US FAERS
684	Cystic Fibrosis	FAERS: 1		US FAERS
685	Cystitis	FAERS: 1		US FAERS
686	Cyst	FAERS: 1		US FAERS
687	Deafness Neurosensory	FAERS: 1		US FAERS
688	Deformity	FAERS: 1		US FAERS
689	Demyelination	FAERS: 1		US FAERS
690	Device battery issue	FAERS: 1		US FAERS
691	Device connection issue	FAERS: 1		US FAERS
692	Device programming error	FAERS: 1		US FAERS
693	Diabetic Ketoacidosis	FAERS: 1		US FAERS
694	Diet refusal	FAERS: 1		US FAERS
695	Disease complication	FAERS: 1		US FAERS
696	Drug delivery device removal	FAERS: 1		US FAERS
697	Drug dispensed to wrong patient	FAERS: 1		US FAERS
698	Drug label confusion	FAERS: 1		US FAERS
699	Dural tear	FAERS: 1		US FAERS
700	Dyschezia	FAERS: 1		US FAERS
701	Dysgraphia	FAERS: 1		US FAERS
702	Echopraxia	FAERS: 1		US FAERS
703	Economic problem	FAERS: 1		US FAERS
704	Electrocardiogram T wave peaked	FAERS: 1		US FAERS
705	Embolic stroke	FAERS: 1		US FAERS
706	Embolism	FAERS: 1		US FAERS
707	Empyema	FAERS: 1		US FAERS
708	Endoscopy gastrointestinal abnormal	FAERS: 1		US FAERS
709	Endotracheal intubation complication	FAERS: 1		US FAERS
710	Enterobiasis	FAERS: 1		US FAERS
711	Enterococcus test positive	FAERS: 1		US FAERS
712	Enuresis	FAERS: 1		US FAERS
713	Eosinophilia	FAERS: 1		SIDER US FAERS
714	Epigastric discomfort	FAERS: 1		US FAERS
715	Eschar	FAERS: 1		OFFSIDES US FAERS
716	Euthanasia	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
717	Exposure via ingestion	FAERS: 1		US FAERS
718	Extravasation	FAERS: 1		US FAERS
719	Facial wasting	FAERS: 1		US FAERS
720	Feeding tube complication	FAERS: 1		US FAERS
721	Feeling of body temperature change	FAERS: 1		US FAERS
722	Flat affect	FAERS: 1		SIDER US FAERS
723	Fracture treatment	FAERS: 1		US FAERS
724	Fracture	FAERS: 1		US FAERS
725	Gait inability	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
726	Gastrointestinal Pain	FAERS: 1		SIDER US FAERS
727	Gastrointestinal obstruction	FAERS: 1		US FAERS
728	Gastrointestinal sounds abnormal	FAERS: 1		US FAERS
729	Gastrointestinal stenosis	FAERS: 1		US FAERS
730	Gastrointestinal stoma complication	FAERS: 1		US FAERS
731	Gastrointestinal toxicity	FAERS: 1		US FAERS
732	General symptom	FAERS: 1		US FAERS
733	Glasgow coma scale abnormal	FAERS: 1		US FAERS
734	Glaucoma	FAERS: 1		US FAERS
735	Granulocytes abnormal	FAERS: 1		US FAERS
736	Haptoglobin Decreased	FAERS: 1		US FAERS
737	Heat Exhaustion	FAERS: 1		US FAERS
738	Hepatic Encephalopathy	FAERS: 1	18633239	CTD US FAERS
739	Hepatic congestion	FAERS: 1		US FAERS
740	Hepatotoxicity	FAERS: 1		US FAERS
741	Histamine intolerance	FAERS: 1		US FAERS
742	Hyperacusis	FAERS: 1		US FAERS
743	Hypervigilance	FAERS: 1		US FAERS
744	Hypohidrosis	FAERS: 1		US FAERS
745	Hypoperfusion	FAERS: 1		US FAERS
746	Hypothalamo-pituitary disorder	FAERS: 1		US FAERS
747	Idiosyncratic drug reaction	FAERS: 1		US FAERS
748	Implant site cellulitis	FAERS: 1		US FAERS
749	Implant site erosion	FAERS: 1		US FAERS
750	Implant site induration	FAERS: 1		US FAERS
751	Inappropriate affect	FAERS: 1		OFFSIDES US FAERS
752	Inappropriate device programming	FAERS: 1		US FAERS
753	Incision site complication	FAERS: 1		US FAERS
754	Incision site infection	FAERS: 1		OFFSIDES US FAERS
755	Incision site swelling	FAERS: 1		US FAERS
756	Incision site vesicles	FAERS: 1		US FAERS
757	Incorrect drug dosage form administered	FAERS: 1		US FAERS
758	Increased viscosity of bronchial secretion	FAERS: 1		US FAERS
759	Infusion site abscess	FAERS: 1		US FAERS
760	Infusion site bruising	FAERS: 1		US FAERS
761	Infusion site rash	FAERS: 1		US FAERS
762	Infusion site streaking	FAERS: 1		US FAERS
763	Infusion site swelling	FAERS: 1		US FAERS
764	Infusion site vesicles	FAERS: 1		US FAERS
765	Injection site irritation	FAERS: 1		US FAERS
766	Injection site streaking	FAERS: 1		US FAERS
767	Intercepted product administration error	FAERS: 1		US FAERS
768	Intercepted product dispensing error	FAERS: 1		US FAERS
769	Intercepted product preparation error	FAERS: 1		US FAERS
770	Intercepted product selection error	FAERS: 1		US FAERS
771	Internal injury	FAERS: 1		US FAERS
772	Intervertebral disc compression	FAERS: 1		US FAERS
773	Intestinal Pseudo-Obstruction	FAERS: 1		US FAERS
774	Intestinal gangrene	FAERS: 1		US FAERS
775	Intestinal infarction	FAERS: 1		US FAERS
776	Irritable Bowel Syndrome	FAERS: 1		US FAERS
777	Joint injury	FAERS: 1		OFFSIDES US FAERS
778	Labile blood pressure	FAERS: 1		US FAERS
779	Laryngospasm	FAERS: 1 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
780	Leukoencephalomyelitis	FAERS: 1		US FAERS
781	Libido disorder	FAERS: 1		US FAERS
782	Limb discomfort	FAERS: 1		US FAERS
783	Lip and/or oral cavity cancer	FAERS: 1		US FAERS
784	Lip and/or oral cavity cancer recurrent	FAERS: 1		US FAERS
785	Loss of personal independence in daily activities	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
786	Lower motor neurone lesion	FAERS: 1		US FAERS
787	Lung Injury	FAERS: 1		US FAERS
788	Lymphocytic infiltration	FAERS: 1		US FAERS
789	Malabsorption from administration site	FAERS: 1		US FAERS
790	Mechanical ventilation	FAERS: 1		US FAERS
791	Medical device removal	FAERS: 1		US FAERS
792	Medical device site infection	FAERS: 1		US FAERS
793	Medical device site rash	FAERS: 1		US FAERS
794	Medical device site warmth	FAERS: 1		US FAERS
795	Medical induction of coma	FAERS: 1		US FAERS
796	Mental status changes postoperative	FAERS: 1		US FAERS
797	Metabolic alkalosis	FAERS: 1		US FAERS
798	Metastases to the respiratory system	FAERS: 1		US FAERS
799	Middle insomnia	FAERS: 1		US FAERS
800	Motion Sickness	FAERS: 1		US FAERS
801	Multiple Myeloma	FAERS: 1		US FAERS
802	Muscle strain	FAERS: 1		US FAERS
803	Mycobacterium chelonei infection	FAERS: 1		US FAERS
804	Myelitis	FAERS: 1		OFFSIDES US FAERS
805	Myocardial fibrosis	FAERS: 1		US FAERS
806	Myocardial necrosis marker increased	FAERS: 1		US FAERS
807	Myocardial necrosis	FAERS: 1		US FAERS
808	Myocarditis	FAERS: 1		US FAERS
809	Myoglobin blood increased	FAERS: 1		US FAERS
810	Narcolepsy	FAERS: 1	6107628 6176094	CTD US FAERS
811	Nasal discomfort	FAERS: 1		US FAERS
812	Neologism	FAERS: 1		US FAERS
813	Neonatal respiratory arrest	FAERS: 1		US FAERS
814	Nephrolithiasis	FAERS: 1		US FAERS
815	Nerve Degeneration	FAERS: 1		US FAERS
816	Neurogenic Bowel	FAERS: 1		US FAERS
817	Neurological complication associated with device	FAERS: 1		US FAERS
818	Neurological decompensation	FAERS: 1		US FAERS
819	Neurological examination abnormal	FAERS: 1		US FAERS
820	Neuropathic pain	FAERS: 1		US FAERS
821	Neurosensory hypoacusis	FAERS: 1		US FAERS
822	Neutropenia	FAERS: 1		US FAERS
823	Neutrophil percentage increased	FAERS: 1		US FAERS
824	No adverse effect	FAERS: 1		US FAERS
825	Obsessive-Compulsive Disorder	FAERS: 1		US FAERS
826	Obstruction	FAERS: 1		OFFSIDES US FAERS
827	Occupational exposure to drug	FAERS: 1		US FAERS
828	Oral administration complication	FAERS: 1		US FAERS
829	Oropharyngeal cancer recurrent	FAERS: 1		US FAERS
830	Oropharyngeal candidiasis	FAERS: 1		US FAERS
831	PCO2 decreased	FAERS: 1		US FAERS
832	Pain of skin	FAERS: 1		OFFSIDES US FAERS
833	Papillary muscle infarction	FAERS: 1		US FAERS
834	Paradoxical drug reaction	FAERS: 1		US FAERS
835	Pathological fracture	FAERS: 1		US FAERS
836	Patient uncooperative	FAERS: 1		US FAERS
837	Pericardial effusion	FAERS: 1		US FAERS
838	Periorbital contusion	FAERS: 1		US FAERS
839	Peritonitis	FAERS: 1	15770054	CTD OFFSIDES US FAERS
840	Phantom pain	FAERS: 1		US FAERS
841	Pharyngeal swelling	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
842	Pharyngitis	FAERS: 1		US FAERS
843	Pharyngolaryngeal Pain	FAERS: 1		US FAERS
844	Physical product label issue	FAERS: 1		US FAERS
845	Pierre Robin Syndrome	FAERS: 1		US FAERS
846	Pneumorrhachis	FAERS: 1		US FAERS
847	Polyuria	FAERS: 1		SIDER US FAERS
848	Post procedural nausea	FAERS: 1		US FAERS
849	Post procedural pulmonary embolism	FAERS: 1		US FAERS
850	Post-Traumatic Stress Disorder	FAERS: 1		US FAERS
851	Post-traumatic neck syndrome	FAERS: 1		US FAERS
852	Potentiating drug interaction	FAERS: 1		US FAERS
853	Poverty of speech	FAERS: 1		US FAERS
854	Poverty	FAERS: 1		US FAERS
855	Precancerous cells present	FAERS: 1		US FAERS
856	Procedural hypotension	FAERS: 1		US FAERS
857	Procedural nausea	FAERS: 1		US FAERS
858	Procedural site reaction	FAERS: 1		US FAERS
859	Product administration error	FAERS: 1 Canada Vigilance: 4		Canada Vigilance US FAERS
860	Product commingling	FAERS: 1		US FAERS
861	Product compounding quality issue	FAERS: 1		US FAERS
862	Product contamination physical	FAERS: 1		US FAERS
863	Product dose omission	FAERS: 1		US FAERS
864	Product dropper issue	FAERS: 1		US FAERS
865	Product expiration date issue	FAERS: 1		US FAERS
866	Product outer packaging issue	FAERS: 1		US FAERS
867	Product packaging confusion	FAERS: 1		US FAERS
868	Product packaging issue	FAERS: 1		US FAERS
869	Product preparation error	FAERS: 1		US FAERS
870	Product prescribing error	FAERS: 1 Canada Vigilance: 6		Canada Vigilance US FAERS
871	Product prescribing issue	FAERS: 1		US FAERS
872	Product substitution error	FAERS: 1		US FAERS
873	Pseudomonas test positive	FAERS: 1		US FAERS
874	Psychiatric evaluation	FAERS: 1		US FAERS
875	Psychiatric symptom	FAERS: 1		US FAERS
876	Psychotic disorder due to a general medical condition	FAERS: 1		US FAERS
877	Pulmonary sepsis	FAERS: 1		US FAERS
878	Pulmonary thrombosis	FAERS: 1		US FAERS
879	Pupillary deformity	FAERS: 1		US FAERS
880	Purple urine bag syndrome	FAERS: 1		US FAERS
881	Purulence	FAERS: 1		US FAERS
882	Purulent discharge	FAERS: 1		US FAERS
883	Pyomyositis	FAERS: 1		US FAERS
884	Radicular pain	FAERS: 1		US FAERS
885	Reaction to drug excipients	FAERS: 1		US FAERS
886	Reaction to preservatives	FAERS: 1		US FAERS
887	Rebound psychosis	FAERS: 1		US FAERS
888	Rhonchi	FAERS: 1		US FAERS
889	Right ventricular failure	FAERS: 1		US FAERS
890	Rotator cuff syndrome	FAERS: 1		US FAERS
891	Rubber sensitivity	FAERS: 1		US FAERS
892	Sciatica	FAERS: 1	10907730	CTD US FAERS
893	Secretion discharge	FAERS: 1		OFFSIDES US FAERS
894	Similar reaction on previous exposure to drug	FAERS: 1		US FAERS
895	Sinus headache	FAERS: 1		US FAERS
896	Skeletal injury	FAERS: 1		US FAERS
897	Skin Ulcer	FAERS: 1		US FAERS
898	Skin test positive	FAERS: 1		US FAERS
899	Sleep Talking	FAERS: 1		US FAERS
900	Sleep inertia	FAERS: 1		US FAERS
901	Slow speech	FAERS: 1		US FAERS
902	Sneezing	FAERS: 1		SIDER US FAERS
903	Soft Tissue Infection	FAERS: 1		US FAERS
904	Soliloquy	FAERS: 1		US FAERS
905	Spinal cord abscess	FAERS: 1		US FAERS
906	Spinal cord infection	FAERS: 1		US FAERS
907	Splenomegaly	FAERS: 1		US FAERS
908	Spondylolisthesis	FAERS: 1		US FAERS
909	Squamous cell carcinoma	FAERS: 1		US FAERS
910	Staphylococcal mediastinitis	FAERS: 1		US FAERS
911	Staphylococcus test	FAERS: 1		US FAERS
912	Staphylococcus test positive	FAERS: 1		US FAERS
913	Starvation	FAERS: 1		US FAERS
914	Status Asthmaticus	FAERS: 1		US FAERS
915	Status Epilepticus	FAERS: 1	10812579	CTD US FAERS
916	Stem cell transplant	FAERS: 1		OFFSIDES US FAERS
917	Stenosis	FAERS: 1		US FAERS
918	Stool analysis abnormal	FAERS: 1		US FAERS
919	Subdural Effusion	FAERS: 1		US FAERS
920	Suspected counterfeit product	FAERS: 1		US FAERS
921	Tablet issue	FAERS: 1		US FAERS
922	Tardive Dyskinesia	FAERS: 1		US FAERS
923	Teeth brittle	FAERS: 1		US FAERS
924	Testicular cancer metastatic	FAERS: 1		US FAERS
925	Thalamic infarction	FAERS: 1		US FAERS
926	Therapeutic product contamination	FAERS: 1		US FAERS
927	Therapy cessation	FAERS: 1		OFFSIDES US FAERS
928	Therapy change	FAERS: 1		US FAERS
929	Thermal burn	FAERS: 1		US FAERS
930	Throat cancer	FAERS: 1		US FAERS
931	Tobacco user	FAERS: 1		US FAERS
932	Tonic clonic movements	FAERS: 1		US FAERS
933	Tooth Extraction	FAERS: 1		US FAERS
934	Toxicologic test abnormal	FAERS: 1		US FAERS
935	Trigeminal nerve paresis	FAERS: 1		US FAERS
936	Urea urine abnormal	FAERS: 1		US FAERS
937	Urethral Obstruction	FAERS: 1		US FAERS
938	Urinary sediment present	FAERS: 1		US FAERS
939	Urine amphetamine positive	FAERS: 1		US FAERS
940	Urine flow decreased	FAERS: 1		US FAERS
941	Urobilin urine present	FAERS: 1		US FAERS
942	Uvulitis	FAERS: 1		US FAERS
943	Vaginal pain	FAERS: 1		US FAERS
944	Ventricular Dysfunction	FAERS: 1		US FAERS
945	Ventricular arrhythmia	FAERS: 1		US FAERS
946	Ventricular hypertrophy	FAERS: 1		US FAERS
947	Victim of child abuse	FAERS: 1		US FAERS
948	Victim of sexual abuse	FAERS: 1		US FAERS
949	Wound infection staphylococcal	FAERS: 1		US FAERS
950	Wrong dose	FAERS: 1		US FAERS
951	Wrong patient received product	FAERS: 1 Canada Vigilance: 3		Canada Vigilance US FAERS
952	Abdominal colic			SIDER
953	Abnormal ejaculation			SIDER
954	Abnormalities, Drug-Induced		16054236	CTD
955	Abuse			OFFSIDES
956	Ache			SIDER
957	Acidosis, Respiratory		19819313	CTD
958	Acute prerenal failure			OFFSIDES
959	Adams-Stokes Syndrome		7066133	CTD
960	Adrenal Gland Diseases		10737415	CTD
961	Alcohol problem	Canada Vigilance: 1		Canada Vigilance
962	Alcohol-Related Disorders		8174503	CTD
963	Amblyopia			SIDER
964	Analgesia			OFFSIDES
965	Anxiety Disorders		17507919	CTD
966	Apnea		View details 440871 3377935 6716269 7237324 7826792 8955967 9605367 10640309 11153309 16938755 18489625	CTD
967	Application site reaction	Canada Vigilance: 1		Canada Vigilance
968	Arteriovenous fistula aneurysm			OFFSIDES
969	Arteriovenous fistula thrombosis			OFFSIDES
970	Aspiration Pneumonia			OFFSIDES
971	Atelectasis			OFFSIDES SIDER
972	Atrial tachycardia			OFFSIDES
973	Atrioventricular Block		2446361 8225663	CTD
974	Aura			OFFSIDES
975	BK virus infection			OFFSIDES
976	Band neutrophil count increased			OFFSIDES
977	Basal Ganglia Diseases		10411778	CTD
978	Bladder pain			SIDER
979	Blood bilirubin unconjugated increased			OFFSIDES
980	Blood cholinesterase decreased			OFFSIDES
981	Blood creatine abnormal	Canada Vigilance: 1		Canada Vigilance
982	Blood sodium increased			OFFSIDES
983	Blood urea abnormal			OFFSIDES
984	Blood uric acid			OFFSIDES
985	Bone lesion			OFFSIDES
986	Brain Diseases		4080616 6664239	CTD
987	Brain Ischemia		19211983	CTD
988	Brain natriuretic peptide increased			OFFSIDES
989	Breast Feeding			SIDER
990	Bulbar palsy			OFFSIDES
991	Cachexia			SIDER
992	Capgras Syndrome		16752989	CTD
993	Carbon dioxide increased			SIDER
994	Cardiomyopathy, Dilated		18628775	CTD
995	Cardiovascular insufficiency			SIDER
996	Catalepsy		View details 10058 32058 35781 36469 42617 44745 403561 569340 575200 575645 1172489 1352487 1533339 1676175 1829839 1963685 2716967 2851780 2899450 2972934 2999739 3000811 3004539 3020674 3575168 3659086 4040227 6119681 6132369 6141553 6152791 6268258 6298837 6308526 6329457 6409656 6539118 6540616 6541070 6542903 6543399 6679984 6682490 6685231 6687158 6771831 6891961 7190305 7199627 7200381 7202125 7859066 8090801 8720577 9142555 9264103 9407998 10910861 11735362 11900788 12191819 19699784 19747466	CTD
997	Central Nervous System Infection			OFFSIDES
998	Cerebral atrophy			OFFSIDES
999	Chemical and Drug Induced Liver Injury		19403290	CTD
1000	Chest tightness			SIDER
1001	Cheyne-Stokes Respiration			SIDER
1002	Choking sensation			OFFSIDES
1003	Cholecystitis		4089515	CTD OFFSIDES
1004	Chronic Obstructive Airway Disease			OFFSIDES
1005	Circulatory depression			SIDER
1006	Cirrhosis			OFFSIDES
1007	Cognition Disorders		View details 7644248 8686825 12351285 14750654 15893155 16971632	CTD
1008	Colonic Neoplasms		3963440	CTD
1009	Common Bile Duct Diseases		10626719	CTD
1010	Complex Regional Pain Syndromes		18042887	CTD
1011	Confusion		View details 3234261 7237324 8686825 15859444 16971632 19025426	CTD
1012	Conjunctival deposit			OFFSIDES
1013	Conjunctivitis	Canada Vigilance: 2		Canada Vigilance SIDER
1014	Consciousness Disorders		2436013	CTD
1015	Contact Dermatitis			OFFSIDES
1016	Corneal Ulcer			OFFSIDES
1017	Culture positive			OFFSIDES
1018	Culture wound positive			OFFSIDES
1019	Cutis anserina			SIDER
1020	Dactylitis			OFFSIDES
1021	Delayed Emergence from Anesthesia		17138196	CTD
1022	Delayed gastric emptying			SIDER
1023	Dental abscess			OFFSIDES
1024	Depressive disorder		24008352	CTD
1025	Diabetes			OFFSIDES
1026	Diabetes Insipidus		6258694	CTD
1027	Diabetic Nephropathy			OFFSIDES
1028	Diarrhea		2540324	CTD
1029	Dihydropyrimidine Dehydrogenase Deficiency			OFFSIDES
1030	Disorders of Excessive Somnolence		20529380	CTD
1031	Disseminated Intravascular Coagulation			OFFSIDES
1032	Disturbance in sexual arousal			SIDER
1033	Diuretic Effect			SIDER
1034	Diverticular perforation			OFFSIDES
1035	Drowsiness			OFFSIDES SIDER
1036	Drug Overdose		View details 440871 6739915 7832313 10609351 16971632 17542734	CTD
1037	Drug addict			OFFSIDES
1038	Dyskinesia, Drug-Induced		View details 3020674 6493634 7199627 8982660 10907730 15207281	CTD
1039	Dyspnea		10973044	CTD
1040	Eczema	Canada Vigilance: 1		Canada Vigilance
1041	Edema		6123475 12182845 17387357	CTD
1042	Encephalomyelitis, Acute Disseminated		16971632	CTD
1043	Endometrial hypertrophy			OFFSIDES
1044	Endothelial dysfunction			OFFSIDES
1045	Exanthema		6111570	CTD
1046	Exophthalmos		6409656	CTD
1047	Facial Pain		View details 11932064 14508333 17157777 18164607	CTD
1048	Failure to Thrive			OFFSIDES
1049	Fatty Liver			OFFSIDES
1050	Fecal Incontinence		16971632	CTD
1051	Femoral artery occlusion			OFFSIDES
1052	Fever		View details 6176094 6409656 9264103 11735362	CTD
1053	Flatulence			SIDER
1054	Gastroenteritis			SIDER
1055	Gastrointestinal Diseases		11180040	CTD
1056	Genital swelling			SIDER
1057	Granulocytosis			OFFSIDES
1058	Hallucinations		View details 2436013 2886842 2889016 2902362 4073432 4832250 6107628 6176094 12535471 15857731 15954974 20062554	CTD
1059	Heart Diseases		17988779	CTD
1060	Hematuria		8225663	CTD
1061	Hemorrhage		8225663 16306743	CTD
1062	Heparin-induced thrombocytopenia			OFFSIDES
1063	Heroin Dependence		16598705	CTD
1064	Herpes Labialis		2208533	CTD
1065	Hiccough			OFFSIDES
1066	Hyaline Membrane Disease		7669374	CTD
1067	Hyperalgesia		View details 230543 1784504 2475196 2557556 2798544 2998815 4582903 7752309 7892024 7892029 8278214 8371142 8876756 9809090 10193655 10473483 10910861 11068110 11150345 11865132 11973202 12136706 12787826 14649563 15037816 15733632 15964684 16414554 16601258 16675039 17038211 17055659 17123731 17240843 17325516 17466971 17670969 17761732 17893922 17912051 17977662 17996026 18042887 18221780 18227327 18400411 18559275 18664366 18701828 18766156 18774343 18950446 18976650 19038771 19489750 19571391 19591853 19996949 20031953 20053885 20081245 20178837 20184918 20447294 20713147 20714283 20727859 20830263 23756650 24709919 25714890	CTD
1068	Hyperemia		4058695	CTD
1069	Hyperesthesia		8190269 8278214	CTD
1070	Hyperkinesia			SIDER
1071	Hypertensive heart disease	Canada Vigilance: 1		Canada Vigilance
1072	Hypesthesia		10609351	CTD
1073	Hypokalemia		17303035	CTD
1074	Hypokinesia		View details 1172489 3780846 6441955 7199627	CTD
1075	Hypotension, Orthostatic		3408531 8895280	CTD
1076	Hypotensive			SIDER
1077	Incorrect route of product administration	Canada Vigilance: 1		Canada Vigilance
1078	Induration			SIDER
1079	Infectious Mononucleosis			OFFSIDES
1080	Injection site abscess	Canada Vigilance: 1		Canada Vigilance
1081	Injection site dermatitis	Canada Vigilance: 1		Canada Vigilance
1082	Injection site inflammation	Canada Vigilance: 14		Canada Vigilance
1083	Intermittent Claudication			OFFSIDES
1084	Intervertebral Disc Degeneration			OFFSIDES
1085	Intervertebral disc disorder			OFFSIDES
1086	Intestinal Fistula			OFFSIDES
1087	Intracranial Hypertension		6123475	CTD
1088	Joint sprain			OFFSIDES
1089	Kidney Diseases		18385270	CTD
1090	Kidney Failure			OFFSIDES
1091	Labor Pain		3377935 17643282	CTD
1092	Left atrial dilatation			OFFSIDES
1093	Leukopenia neonatal			OFFSIDES
1094	Leukopenia			SIDER
1095	Lightheadedness			SIDER
1096	Lip erosion			OFFSIDES
1097	Livedo Reticularis			OFFSIDES
1098	Low Back Pain		12131127 16414554 17326594	CTD
1099	Lung Neoplasms		7848904	CTD
1100	Lyme Disease			OFFSIDES
1101	Lymphangiosis carcinomatosa			OFFSIDES
1102	Lymphocyte count abnormal			OFFSIDES
1103	Malnutrition			SIDER
1104	Mantle cell lymphoma			OFFSIDES
1105	Memory Disorders		12351285 16598705	CTD
1106	Metastases to adrenals			OFFSIDES
1107	Morphine Dependence		View details 12548 567958 1487626 1786813 2027527 2771062 3101100 3136361 3168761 3241876 3343705 3539055 3720824 3945661 4549927 4735855 4943089 6258694 6300721 6794076 7190475 7201058 7400953 7692360 7734084 7791109 7869613 7870990 7896067 8174503 8205055 8450704 8692292 8704441 8829152 8870037 8996817 9443540 9496717 9838021 10096766 10208762 10330710 10448923 10680585 11027224 11090647 11274701 11359533 11404432 11413242 11483380 11735362 11817512 11826132 11829123 11849821 12062589 12065198 12098584 12154229 12175466 12220967 12351280 12431775 12567959 12878694 12934646 15083563 15196791 15196794 15541421 15542745 15561466 15595686 15899480 15912139 16316655 16448827 16517095 16914643 17105947 17958328 17989510 18082850 18374913 18469544 18699797 18840427 19383088 19418264 19489750 19751225 20203187 20519536 20667500 20719804 21270789 21285874 21645529 22590628 24398105 26386147	CTD
1108	Movement Disorders		View details 2727012 3780846 4080616 7237324 10638634 18699797	CTD
1109	Muscle Cramp		58242	CTD
1110	Muscle Hypertonia		6110016	CTD
1111	Muscle Weakness		7486124 9748077 10910861	CTD OFFSIDES
1112	Muscle hypotonia		440871	CTD
1113	Mycobacterium fortuitum infection			OFFSIDES
1114	Myelodysplasia			OFFSIDES
1115	Myocardial Ischemia		7125250	CTD
1116	Myocardial Reperfusion Injury		15345483	CTD
1117	Nasal pruritus	Canada Vigilance: 1		Canada Vigilance
1118	Neonatal Abstinence Syndrome		2567922	CTD
1119	Neural Tube Defects		16054236	CTD
1120	Neurotoxicity Syndromes		3335815	CTD
1121	Neutropenic infection			OFFSIDES
1122	Neutrophil count decreased			OFFSIDES
1123	Nociceptive Pain		19800397 23371449 23818586	CTD
1124	Nodule			SIDER
1125	Oculogyration			OFFSIDES
1126	Opioid abuse			SIDER
1127	Opioid-Related Disorders		View details 10933337 22713680 23292329 26476280	CTD
1128	Optic Disc Edema			OFFSIDES
1129	Pain worsened			SIDER
1130	Pain, Intractable		14649563 18090443	CTD
1131	Pain, Postoperative		View details 1385919 1416128 1463157 1990925 2208533 2221451 2225300 2480073 2888421 3132194 3156020 3328681 3754625 3963440 3978926 4014743 4069717 4082466 6093636 6362693 6402201 6614422 6666559 6894517 7023519 7025875 7138720 7197476 7199836 7324817 7489438 7826792 7851354 7858363 7979117 8053587 8067230 8279252 8317732 8686825 8829857 8955967 9168210 9324179 9346148 9352758 9404164 9466103 9489595 9605375 9620513 9649989 9751910 9785072 9806696 9836029 10051932 10081529 10411768 10411778 10485772 10499756 10512278 10594409 10691220 10764172 10764173 10781294 10960384 10964147 11180040 11273950 11773815 12032009 12216602 12370684 12393765 12766657 12791116 12818978 12826854 12903414 15025617 15308911 15352968 15365421 15574544 15781537 15910349 15954974 15960271 16103386 16113981 16116007 16129988 16223384 16306736 16306743 16324861 16517329 16618299 17000818 17006078 17138196 17377106 17578980 17639920 17714570 17961837 18028044 18083469 18753471 19025426 19128627 19150592 19307970 19340462 19462494 19594851 19608840 19634546 19786862 20084599 20306057 20610555 20627697 21105483 21127283	CTD
1132	Paranasal sinus discomfort	Canada Vigilance: 1		Canada Vigilance
1133	Paraparesis, Spastic		View details 12401631 15502059 15673851 16551926 17366917	CTD
1134	Partner stress			OFFSIDES
1135	Peripheral Nervous System Diseases		20184918	CTD
1136	Peripheral arterial occlusive disease			OFFSIDES
1137	Personality Disorders		988593	CTD
1138	Piloerection			SIDER
1139	Post procedural hypothyroidism			OFFSIDES
1140	Postoperative Nausea and Vomiting		View details 7946871 8053587 9352758 9620513 10411768 10960384 16306743 16816394 19025426 19462494 20306057	CTD
1141	Prenatal Exposure Delayed Effects		View details 10446353 10638634 10737415 10865073 11474841 14519453 14750654 16054236 16598705	CTD
1142	Product complaint	Canada Vigilance: 1		Canada Vigilance
1143	Product residue present	Canada Vigilance: 1		Canada Vigilance
1144	Pseudomonal sepsis			OFFSIDES
1145	Psychomotor Agitation		2886842	CTD
1146	Psychomotor Disorders		8301543 15893155	CTD
1147	Psychoses, Substance-Induced		959325 8250329	CTD
1148	Pulmonary Edema		8001214 8941028 9645186	CTD
1149	Pulmonary function test decreased			SIDER
1150	Punding			SIDER
1151	Pupil Disorders		9173676	CTD
1152	Rectal Prolapse			OFFSIDES
1153	Reflex, Abnormal		9748077 10910861	CTD
1154	Renal Insufficiency		16306743 19403290	CTD
1155	Reperfusion Injury		19211983	CTD
1156	Respiration Disorders		6131355 23296104	CTD
1157	Respiratory Insufficiency		View details 1305443 1833029 2208533 3136361 3377935 3515598 4025903 4462236 4962749 6262092 6662192 6894517 7023519 7832313 7848954 8869763 9168210 9620513 10475320 10764173 11180027 12065195 14534517 15954974 16971632 17961837 18706994 19462494 19755623 19819313 20802053 23300227	CTD SIDER
1158	Respiratory failure aggravated			SIDER
1159	Retrocollis			OFFSIDES
1160	Rhinitis			SIDER
1161	Seizures		View details 692263 959325 999411 1595778 2311659 2854931 2872934 3011487 3015659 3123975 3362037 4000409 4082466 6301361 6326965 6653673 6664239 6872331 7127082 7422706 7634817 8162948 8645877 10446353 10638634 10642972 10865073 11474841 12180996 16103386 17011127 18042875	CTD
1162	Shivering			SIDER
1163	Shunt malfunction			OFFSIDES
1164	Sleep Apnea, Central		2334618	CTD
1165	Sleep Apnea, Obstructive		2334618	CTD
1166	Sleep Deprivation		9620513	CTD
1167	Sleep Wake Disorders		10559705	CTD
1168	Slurred speech			SIDER
1169	Spasm biliary			SIDER
1170	Spasm		View details 639858 1119938 1730179 1731556 3823361 6479537 9052925 9431903 9658871 10626719 11379694 11489400 12359295	CTD
1171	Speech Disorders		6894517 12351285	CTD
1172	Spinal Cord Diseases		8087444	CTD
1173	Spontaneous penile erection			SIDER
1174	Staphylococcal Infections		2968671	CTD
1175	Stereotypic Movement Disorder		6685231	CTD
1176	Stomatitis			SIDER
1177	Substance Dependence	Canada Vigilance: 1		Canada Vigilance
1178	Substance Withdrawal Syndrome		View details 567958 988178 1327709 1487626 1528400 1533339 1786813 2027527 2415332 2436013 2449543 2560590 2771062 3083461 3101100 3136361 3168761 3241876 3343705 3539055 3666080 3720824 3945661 4038443 4735135 4735855 4943089 6258694 6265238 6300721 6794076 7190475 7201058 7400953 7675970 7692360 7734084 7791109 7869613 7870990 7896067 8090802 8174503 8205055 8450704 8692292 8704441 8747757 8829152 8870037 8905143 8996817 9164573 9263765 9274799 9300596 9313908 9443540 9466347 9495411 9496717 9523765 9537805 9838021 9920454 10096766 10323593 10330710 10448923 10495006 10680585 10867961 10910860 10921076 11027224 11090647 11274701 11274713 11359533 11404432 11413242 11429366 11483380 11498714 11817512 11829123 11849821 11880531 12062589 12065195 12065198 12098584 12154229 12175466 12220967 12351280 12427855 12431775 12567959 12911621 12921910 14532913 14598306 14756803 15083563 15164157 15196791 15196794 15380837 15541421 15542745 15561466 15761628 15829634 15912139 16448827 16598705 16669750 16914643 16952158 17055659 17105947 17141960 17549049 17654860 17958328 17989510 18042887 18082850 18341515 18374913 18469544 18485423 18577378 18705754 18834357 18840427 19150477 19383088 19418264 19489750 19520121 19660510 19751225 20093321 20203187 20434889 20519536 20667500 20719804 20738730 21270789 21285874 21600884 21645529 24709919 28974443	CTD
1179	Substance-Related Disorders		View details 9384844 12552220 12721372 15245499 15893155 16210775 16473939 18176854 24756886	CTD
1180	Sweating			SIDER
1181	Synovitis	Canada Vigilance: 1		Canada Vigilance OFFSIDES
1182	Temporomandibular Joint Disorders		11731064	CTD
1183	Tension			SIDER
1184	Therapeutic response changed	Canada Vigilance: 2		Canada Vigilance
1185	Thirst			SIDER
1186	Tooth Injuries		17687962	CTD
1187	Tranquillisation excessive			SIDER
1188	Ulcer			SIDER
1189	Umbilical hernia			OFFSIDES
1190	Upper respiratory tract inflammation			OFFSIDES
1191	Ureteral spasm			SIDER
1192	Urethral Stenosis			SIDER
1193	Urinary tract infection pseudomonal			OFFSIDES
1194	Urination Disorders		View details 3415012 4706750 7199836 7324817 11773815 15025617 16816394	CTD
1195	Vasculitis	Canada Vigilance: 5		Canada Vigilance
1196	Vasodilation procedure			SIDER
1197	Vasodilation			SIDER
1198	Ventricular Dysfunction, Left		7995660	CTD
1199	Vision Disorders		10964147	CTD
1200	Welts			SIDER
1201	Xerostomia		8301543 19671086	CTD
1202	Yawning			SIDER
1203	anaphylaxis		2471936	CTD
1204	apprehension			SIDER
1205	kyphosis			OFFSIDES

Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141