Dasatinib
(ZBNZXTGUTAYRHI-UHFFFAOYSA-N)
Structure
- SMILES
- OCCN1CCN(CC1)c1cc(nc(n1)C)Nc1ncc(s1)C(=O)Nc1c(C)cccc1Cl
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XE06
- Molecular Formula:
- C22H26ClN7O2S
- Molecular Weight:
- 488.006
- Log P:
- 3.4624
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 3
- TPSA:
- 134.75
- CAS Number(s):
- 302962-49-8
Synonym(s)
1.
Dasatinib
2.
(18F)-N-(2-chloro-6-methylphenyl)-2-(6-(4-(2-hydroxyethyl)piperazin-1-yl)-2-methylpyrimidin-4-ylamino)thiazole-5-carboxamide
3.
BMS 354825
4.
BMS-354825
5.
BMS354825
6.
N-(2-chloro-6-methylphenyl)-2-(6-(4-(2-hydroxyethyl)piperazin-1-yl)-2-methylpyrimidin-4-ylamino)thiazole-5-carboxamide
7.
Sprycel
8.
354825, BMS
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 878 Canada Vigilance: 19 | Canada Vigilance SIDER US FAERS | |
| 2 | Headache | FAERS: 813 Canada Vigilance: 14 | Canada Vigilance SIDER US FAERS | |
| 3 | Nausea | FAERS: 737 Canada Vigilance: 17 | Canada Vigilance SIDER US FAERS | |
| 4 | Adverse event | FAERS: 702 Canada Vigilance: 7 | Canada Vigilance OFFSIDES US FAERS | |
| 5 | Malignant neoplasm progression | FAERS: 336 Canada Vigilance: 12 | Canada Vigilance OFFSIDES US FAERS | |
| 6 | Drug dose omission | FAERS: 310 | US FAERS | |
| 7 | Prescribed underdose | FAERS: 310 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 8 | Vomiting | FAERS: 287 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 9 | Arthralgia | FAERS: 236 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 10 | Pain | FAERS: 219 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 11 | Pneumonia | FAERS: 217 Canada Vigilance: 12 | Canada Vigilance SIDER US FAERS | |
| 12 | Alopecia | FAERS: 211 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 13 | Malaise | FAERS: 200 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 14 | Myalgia | FAERS: 194 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 15 | Dizziness | FAERS: 184 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 16 | Pruritus | FAERS: 160 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 17 | Constipation | FAERS: 156 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 18 | Pericardial effusion | FAERS: 156 Canada Vigilance: 12 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 19 | Asthenia | FAERS: 149 Canada Vigilance: 7 | 18608866 | CTD SIDER Canada Vigilance US FAERS |
| 20 | Weight decreased | FAERS: 147 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 21 | Drug ineffective | FAERS: 146 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 22 | Bone pain | FAERS: 132 | US FAERS | |
| 23 | Thrombocytopenia | FAERS: 127 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 24 | Pulmonary Hypertension | FAERS: 120 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 25 | White blood cell count decreased | FAERS: 120 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Abdominal Pain | FAERS: 118 | 18608866 | CTD SIDER US FAERS |
| 27 | Chest Pain | FAERS: 113 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 28 | Abdominal discomfort | FAERS: 111 | US FAERS | |
| 29 | Peripheral swelling | FAERS: 109 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 30 | Product use in unapproved indication | FAERS: 102 | US FAERS | |
| 31 | Acne | FAERS: 99 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 32 | Dehydration | FAERS: 96 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 33 | Nasopharyngitis | FAERS: 92 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 34 | Pancytopenia | FAERS: 81 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 35 | Neutropenia | FAERS: 75 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 36 | Infection | FAERS: 74 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 37 | Maternal exposure during pregnancy | FAERS: 73 | US FAERS | |
| 38 | Swelling | FAERS: 73 | US FAERS | |
| 39 | Chills | FAERS: 70 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 40 | Back Pain | FAERS: 67 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 41 | Anxiety | FAERS: 64 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 42 | Feeling abnormal | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 43 | Full blood count decreased | FAERS: 61 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 44 | Product use issue | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Urticaria | FAERS: 61 | SIDER US FAERS | |
| 46 | Musculoskeletal Pain | FAERS: 60 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 47 | Palpitations | FAERS: 60 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 48 | Pregnancy | FAERS: 60 | US FAERS | |
| 49 | Hypersensitivity | FAERS: 58 | SIDER US FAERS | |
| 50 | Influenza | FAERS: 57 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 51 | Memory impairment | FAERS: 57 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Myocardial Infarction | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 53 | Chest discomfort | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Exposure via body fluid | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Respiratory Failure | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 56 | Cerebrovascular accident | FAERS: 50 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 57 | Chylothorax | FAERS: 50 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 58 | Dysgeusia | FAERS: 50 | SIDER US FAERS | |
| 59 | Erythema | FAERS: 50 | SIDER US FAERS | |
| 60 | Lymphadenopathy | FAERS: 50 | US FAERS | |
| 61 | Stomatitis | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 62 | Dry skin | FAERS: 48 | SIDER US FAERS | |
| 63 | Colitis | FAERS: 47 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 64 | Pulmonary arterial hypertension | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 65 | Atrial Fibrillation | FAERS: 46 | SIDER US FAERS | |
| 66 | Dyspepsia | FAERS: 46 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 67 | Amnesia | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 68 | Flatulence | FAERS: 44 | US FAERS | |
| 69 | Visual Impairment | FAERS: 41 | SIDER US FAERS | |
| 70 | Pleurisy | FAERS: 39 | OFFSIDES US FAERS | |
| 71 | Product dose omission | FAERS: 39 | US FAERS | |
| 72 | Joint swelling | FAERS: 38 | US FAERS | |
| 73 | Nephrotic Syndrome | FAERS: 38 | US FAERS | |
| 74 | Exposure via father | FAERS: 37 | US FAERS | |
| 75 | Oropharyngeal pain | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 76 | Pulmonary Embolism | FAERS: 37 | SIDER US FAERS | |
| 77 | Therapy cessation | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Somnolence | FAERS: 36 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 79 | Hepatotoxicity | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Sinusitis | FAERS: 34 | US FAERS | |
| 81 | Hypotension | FAERS: 33 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 82 | Urinary tract infection | FAERS: 33 | US FAERS | |
| 83 | Flushing | FAERS: 31 | SIDER US FAERS | |
| 84 | Sepsis | FAERS: 31 | SIDER US FAERS | |
| 85 | Tinnitus | FAERS: 31 | SIDER US FAERS | |
| 86 | Burning sensation | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Incorrect product storage | FAERS: 30 | US FAERS | |
| 88 | Drug administered to patient of inappropriate age | FAERS: 29 | US FAERS | |
| 89 | Bronchitis | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 90 | Cataract | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 91 | Philadelphia chromosome positive | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 92 | Product storage error | FAERS: 26 | US FAERS | |
| 93 | Splenomegaly | FAERS: 26 | US FAERS | |
| 94 | Therapy change | FAERS: 26 | US FAERS | |
| 95 | Tremor | FAERS: 26 | SIDER US FAERS | |
| 96 | Wrong technique in product usage process | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 97 | Blood count abnormal | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 98 | Cellulitis | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 99 | Epistaxis | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 100 | Gene Mutation | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 101 | Pancreatitis | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 102 | Lethargy | FAERS: 22 | US FAERS | |
| 103 | Lymphocytosis | FAERS: 22 | OFFSIDES US FAERS | |
| 104 | Night sweats | FAERS: 22 | US FAERS | |
| 105 | Stem cell transplant | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 106 | Respiratory tract congestion | FAERS: 21 | US FAERS | |
| 107 | Thrombosis | FAERS: 21 | SIDER US FAERS | |
| 108 | Arthropathy | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 109 | Blood creatinine increased | FAERS: 20 | SIDER US FAERS | |
| 110 | Disease Progression | FAERS: 20 | US FAERS | |
| 111 | Drug resistance | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 112 | Lymphoid tissue hyperplasia | FAERS: 20 | US FAERS | |
| 113 | Neck Pain | FAERS: 20 | US FAERS | |
| 114 | Productive Cough | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 115 | Wheezing | FAERS: 20 | US FAERS | |
| 116 | Blindness | FAERS: 19 | US FAERS | |
| 117 | General physical health deterioration | FAERS: 19 | US FAERS | |
| 118 | Hypoxia | FAERS: 19 | US FAERS | |
| 119 | Skin toxicity | FAERS: 19 | US FAERS | |
| 120 | Cytopenia | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 121 | Dysphonia | FAERS: 18 | US FAERS | |
| 122 | Neutrophil count decreased | FAERS: 18 | OFFSIDES US FAERS | |
| 123 | Ascites | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 124 | Blood iron decreased | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 125 | Feeling Cold | FAERS: 17 | US FAERS | |
| 126 | Overdose | FAERS: 17 | OFFSIDES US FAERS | |
| 127 | Blood glucose increased | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 128 | Febrile Neutropenia | FAERS: 16 | SIDER US FAERS | |
| 129 | Hypothyroidism | FAERS: 16 | US FAERS | |
| 130 | Musculoskeletal stiffness | FAERS: 16 | SIDER US FAERS | |
| 131 | Ageusia | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 132 | Gastritis | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 133 | Inappropriate schedule of drug administration | FAERS: 15 | US FAERS | |
| 134 | No adverse event | FAERS: 15 | US FAERS | |
| 135 | Toxicity to various agents | FAERS: 15 | US FAERS | |
| 136 | Back disorder | FAERS: 14 | US FAERS | |
| 137 | Skin Ulcer | FAERS: 14 | SIDER US FAERS | |
| 138 | Transaminases increased | FAERS: 14 | US FAERS | |
| 139 | Angina Pectoris | FAERS: 13 | SIDER US FAERS | |
| 140 | Angioedema | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 141 | Arthritis | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 142 | Blood glucose decreased | FAERS: 13 | US FAERS | |
| 143 | Cardiac Arrest | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 144 | Cardiotoxicity | FAERS: 13 | US FAERS | |
| 145 | Circumstance or information capable of leading to medication error | FAERS: 13 | US FAERS | |
| 146 | Discomfort | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 147 | Guillain-Barre Syndrome | FAERS: 13 | US FAERS | |
| 148 | Haematotoxicity | FAERS: 13 | OFFSIDES US FAERS | |
| 149 | Head discomfort | FAERS: 13 | US FAERS | |
| 150 | Hepatomegaly | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Medication Error | FAERS: 13 | US FAERS | |
| 152 | Menorrhagia | FAERS: 13 | US FAERS | |
| 153 | Syncope | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 154 | Accidental overdose | FAERS: 12 | US FAERS | |
| 155 | Acute myocardial infarction | FAERS: 12 | US FAERS | |
| 156 | Diabetes Mellitus | FAERS: 12 | US FAERS | |
| 157 | Dysuria | FAERS: 12 | US FAERS | |
| 158 | Enterocolitis | FAERS: 12 | US FAERS | |
| 159 | Eye irritation | FAERS: 12 | US FAERS | |
| 160 | Hyperplasia | FAERS: 12 | US FAERS | |
| 161 | Leukocytosis | FAERS: 12 | US FAERS | |
| 162 | Leukopenia | FAERS: 12 | US FAERS | |
| 163 | Limb discomfort | FAERS: 12 | US FAERS | |
| 164 | Lipase increased | FAERS: 12 | US FAERS | |
| 165 | Live Birth | FAERS: 12 | US FAERS | |
| 166 | Peripheral arterial occlusive disease | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 167 | Product quality issue | FAERS: 12 | US FAERS | |
| 168 | Pulmonary Fibrosis | FAERS: 12 | US FAERS | |
| 169 | Pulmonary congestion | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 170 | Rash erythematous | FAERS: 12 | SIDER US FAERS | |
| 171 | Right ventricular systolic pressure increased | FAERS: 12 | US FAERS | |
| 172 | Septic Shock | FAERS: 12 | US FAERS | |
| 173 | Sunburn | FAERS: 12 | US FAERS | |
| 174 | Transplant | FAERS: 12 | US FAERS | |
| 175 | Acute kidney injury | FAERS: 11 | US FAERS | |
| 176 | Agitation | FAERS: 11 | US FAERS | |
| 177 | Atelectasis | FAERS: 11 | OFFSIDES US FAERS | |
| 178 | Blast cell proliferation | FAERS: 11 | US FAERS | |
| 179 | Blood urine present | FAERS: 11 | US FAERS | |
| 180 | Clostridium difficile infection | FAERS: 11 | US FAERS | |
| 181 | Dementia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 182 | Eye pain | FAERS: 11 | US FAERS | |
| 183 | Increased tendency to bruise | FAERS: 11 | US FAERS | |
| 184 | Nephrolithiasis | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 185 | Oral pain | FAERS: 11 | US FAERS | |
| 186 | Ulcer | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 187 | Asthma | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 188 | Blood cholesterol increased | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 189 | Cystitis | FAERS: 10 | US FAERS | |
| 190 | Cytomegalovirus enterocolitis | FAERS: 10 | US FAERS | |
| 191 | Diplopia | FAERS: 10 | US FAERS | |
| 192 | Fluid overload | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 193 | Gastroenteritis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 194 | Gastrostomy | FAERS: 10 | US FAERS | |
| 195 | Glaucoma | FAERS: 10 | US FAERS | |
| 196 | Hospice Care | FAERS: 10 | US FAERS | |
| 197 | Hyperchlorhydria | FAERS: 10 | US FAERS | |
| 198 | Inflammation | FAERS: 10 | SIDER US FAERS | |
| 199 | Maternal exposure before pregnancy | FAERS: 10 | US FAERS | |
| 200 | Neuralgia | FAERS: 10 | US FAERS | |
| 201 | Pericarditis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 202 | Respiratory distress | FAERS: 10 | US FAERS | |
| 203 | Suicide attempt | FAERS: 10 | US FAERS | |
| 204 | Thirst | FAERS: 10 | US FAERS | |
| 205 | Throat irritation | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 206 | Toothache | FAERS: 10 | US FAERS | |
| 207 | Conjunctivitis | FAERS: 9 | SIDER US FAERS | |
| 208 | Dysarthria | FAERS: 9 | US FAERS | |
| 209 | Ear discomfort | FAERS: 9 | US FAERS | |
| 210 | Hydrocephalus | FAERS: 9 | US FAERS | |
| 211 | Hypersomnia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 212 | Incorrect dose administered | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 213 | MYELODYSPLASTIC SYNDROME | FAERS: 9 | US FAERS | |
| 214 | Meningitis | FAERS: 9 | US FAERS | |
| 215 | Pneumonitis | FAERS: 9 | US FAERS | |
| 216 | Prescribed overdose | FAERS: 9 | US FAERS | |
| 217 | Proteinuria | FAERS: 9 | SIDER US FAERS | |
| 218 | Restlessness | FAERS: 9 | US FAERS | |
| 219 | Tuberculosis | FAERS: 9 | US FAERS | |
| 220 | Vertigo | FAERS: 9 | SIDER US FAERS | |
| 221 | White blood cell count abnormal | FAERS: 9 | US FAERS | |
| 222 | treatment failure | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 223 | Alanine Aminotransferase Increased | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 224 | Anorexia | FAERS: 8 | 18608866 | CTD OFFSIDES SIDER US FAERS |
| 225 | Aphasia | FAERS: 8 | US FAERS | |
| 226 | Blood potassium decreased | FAERS: 8 | US FAERS | |
| 227 | Cholelithiasis | FAERS: 8 | US FAERS | |
| 228 | Deep Vein Thrombosis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 229 | Gout | FAERS: 8 | US FAERS | |
| 230 | Immunosuppression | FAERS: 8 | OFFSIDES US FAERS | |
| 231 | Lymphoma | FAERS: 8 | US FAERS | |
| 232 | Pallor | FAERS: 8 | US FAERS | |
| 233 | Petechiae | FAERS: 8 | SIDER US FAERS | |
| 234 | Polyserositis | FAERS: 8 | US FAERS | |
| 235 | Retching | FAERS: 8 | US FAERS | |
| 236 | Skin reaction | FAERS: 8 | US FAERS | |
| 237 | Tachycardia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 238 | Therapy non-responder | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 239 | Uveitis | FAERS: 8 | US FAERS | |
| 240 | nervous system disorder | FAERS: 8 | SIDER US FAERS | |
| 241 | Chromaturia | FAERS: 7 | US FAERS | |
| 242 | Deafness | FAERS: 7 | US FAERS | |
| 243 | Diverticulitis | FAERS: 7 | US FAERS | |
| 244 | Enteritis | FAERS: 7 | US FAERS | |
| 245 | Eosinophilia | FAERS: 7 | US FAERS | |
| 246 | Hypertensive crisis | FAERS: 7 | US FAERS | |
| 247 | Intestinal Obstruction | FAERS: 7 | OFFSIDES US FAERS | |
| 248 | Joint injury | FAERS: 7 | US FAERS | |
| 249 | Lip swelling | FAERS: 7 | US FAERS | |
| 250 | Lymphocyte count increased | FAERS: 7 | US FAERS | |
| 251 | Poor quality sleep | FAERS: 7 | US FAERS | |
| 252 | Psoriasis | FAERS: 7 | US FAERS | |
| 253 | Pulmonary toxicity | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 254 | Renal pain | FAERS: 7 | US FAERS | |
| 255 | Stevens-Johnson Syndrome | FAERS: 7 | US FAERS | |
| 256 | Thrombocytosis | FAERS: 7 | US FAERS | |
| 257 | Unevaluable event | FAERS: 7 | US FAERS | |
| 258 | Urinary Retention | FAERS: 7 | US FAERS | |
| 259 | furuncle | FAERS: 7 | US FAERS | |
| 260 | Abasia | FAERS: 6 | US FAERS | |
| 261 | Arthropod bite | FAERS: 6 | US FAERS | |
| 262 | Aspartate Aminotransferase Increased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 263 | Blood potassium abnormal | FAERS: 6 | US FAERS | |
| 264 | Blood sodium decreased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 265 | Breast tenderness | FAERS: 6 | OFFSIDES US FAERS | |
| 266 | Cardiac Tamponade | FAERS: 6 | US FAERS | |
| 267 | Clostridium difficile colitis | FAERS: 6 | OFFSIDES US FAERS | |
| 268 | Coronary Artery Disease | FAERS: 6 | US FAERS | |
| 269 | Dermatitis acneiform | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 270 | Dermatitis | FAERS: 6 | SIDER US FAERS | |
| 271 | Disseminated Intravascular Coagulation | FAERS: 6 | US FAERS | |
| 272 | Eczema | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 273 | Electrocardiogram abnormal | FAERS: 6 | US FAERS | |
| 274 | Endocarditis | FAERS: 6 | OFFSIDES US FAERS | |
| 275 | Erysipelas | FAERS: 6 | OFFSIDES US FAERS | |
| 276 | Gastrointestinal ulcer | FAERS: 6 | SIDER US FAERS | |
| 277 | Immune thrombocytopenic purpura | FAERS: 6 | US FAERS | |
| 278 | Insurance issue | FAERS: 6 | US FAERS | |
| 279 | Lower respiratory tract infection | FAERS: 6 | US FAERS | |
| 280 | Mood swings | FAERS: 6 | US FAERS | |
| 281 | Musculoskeletal chest pain | FAERS: 6 | OFFSIDES US FAERS | |
| 282 | Musculoskeletal discomfort | FAERS: 6 | SIDER US FAERS | |
| 283 | Myopathy | FAERS: 6 | US FAERS | |
| 284 | Natural killer cell count increased | FAERS: 6 | US FAERS | |
| 285 | Photophobia | FAERS: 6 | US FAERS | |
| 286 | Pneumothorax | FAERS: 6 | US FAERS | |
| 287 | Polyneuropathy | FAERS: 6 | US FAERS | |
| 288 | Product dispensing error | FAERS: 6 | US FAERS | |
| 289 | Product physical issue | FAERS: 6 | US FAERS | |
| 290 | Protein urine present | FAERS: 6 | SIDER US FAERS | |
| 291 | Stress | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 292 | Sudden death | FAERS: 6 | OFFSIDES US FAERS | |
| 293 | Vasculitis | FAERS: 6 | US FAERS | |
| 294 | effusion | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 295 | Bone marrow necrosis | FAERS: 5 | US FAERS | |
| 296 | Cardiomegaly | FAERS: 5 | SIDER US FAERS | |
| 297 | Cerebral disorder | FAERS: 5 | US FAERS | |
| 298 | Depressed mood | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 299 | Drug effect incomplete | FAERS: 5 | US FAERS | |
| 300 | Drug exposure during pregnancy | FAERS: 5 | US FAERS | |
| 301 | Ejection Fraction Decreased | FAERS: 5 | SIDER US FAERS | |
| 302 | Erectile dysfunction | FAERS: 5 | US FAERS | |
| 303 | Facial Pain | FAERS: 5 | US FAERS | |
| 304 | Folliculitis | FAERS: 5 | US FAERS | |
| 305 | Fracture | FAERS: 5 | US FAERS | |
| 306 | Gait inability | FAERS: 5 | US FAERS | |
| 307 | Growth retardation | FAERS: 5 | US FAERS | |
| 308 | Hernia | FAERS: 5 | US FAERS | |
| 309 | Hyperpyrexia | FAERS: 5 | US FAERS | |
| 310 | Hypertensive heart disease | FAERS: 5 | US FAERS | |
| 311 | Inappropriate schedule of product administration | FAERS: 5 | US FAERS | |
| 312 | Iron deficiency | FAERS: 5 | US FAERS | |
| 313 | Laceration | FAERS: 5 | US FAERS | |
| 314 | Laryngitis | FAERS: 5 | US FAERS | |
| 315 | Onychoclasis | FAERS: 5 | US FAERS | |
| 316 | Platelet Transfusion | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 317 | Platelet count abnormal | FAERS: 5 | US FAERS | |
| 318 | Pregnancy on oral contraceptive | FAERS: 5 | US FAERS | |
| 319 | Respiratory arrest | FAERS: 5 | US FAERS | |
| 320 | Right ventricular failure | FAERS: 5 | US FAERS | |
| 321 | Shock | FAERS: 5 | SIDER US FAERS | |
| 322 | Skin irritation | FAERS: 5 | SIDER US FAERS | |
| 323 | Squamous cell carcinoma | FAERS: 5 | US FAERS | |
| 324 | Temperature intolerance | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 325 | Therapeutic response unexpected | FAERS: 5 | US FAERS | |
| 326 | Thyroid hormones decreased | FAERS: 5 | US FAERS | |
| 327 | Tooth Infection | FAERS: 5 | US FAERS | |
| 328 | Vitreous Detachment | FAERS: 5 | US FAERS | |
| 329 | Accidental exposure to product | FAERS: 4 | US FAERS | |
| 330 | Acquired gene mutation | FAERS: 4 | US FAERS | |
| 331 | Acute respiratory failure | FAERS: 4 | OFFSIDES US FAERS | |
| 332 | Agranulocytosis | FAERS: 4 | US FAERS | |
| 333 | Anaphylactic shock | FAERS: 4 | US FAERS | |
| 334 | Aortic Aneurysm | FAERS: 4 | US FAERS | |
| 335 | Atrioventricular Block | FAERS: 4 | US FAERS | |
| 336 | Blood creatine phosphokinase increased | FAERS: 4 | SIDER US FAERS | |
| 337 | Blood creatinine abnormal | FAERS: 4 | US FAERS | |
| 338 | Blood potassium increased | FAERS: 4 | US FAERS | |
| 339 | Blood urea increased | FAERS: 4 | US FAERS | |
| 340 | Bowel movement irregularity | FAERS: 4 | US FAERS | |
| 341 | Crying | FAERS: 4 | US FAERS | |
| 342 | Cytomegalovirus hepatitis | FAERS: 4 | US FAERS | |
| 343 | Delirium | FAERS: 4 | US FAERS | |
| 344 | Dental caries | FAERS: 4 | OFFSIDES US FAERS | |
| 345 | Disorientation | FAERS: 4 | US FAERS | |
| 346 | Diverticulum | FAERS: 4 | OFFSIDES US FAERS | |
| 347 | Drug administration error | FAERS: 4 | US FAERS | |
| 348 | Drug toxicity | FAERS: 4 | US FAERS | |
| 349 | Ejection fraction abnormal | FAERS: 4 | US FAERS | |
| 350 | Encephalitis | FAERS: 4 | US FAERS | |
| 351 | Erythema Nodosum | FAERS: 4 | SIDER US FAERS | |
| 352 | Fibromyalgia | FAERS: 4 | US FAERS | |
| 353 | Food Poisoning | FAERS: 4 | US FAERS | |
| 354 | Gastric ulcer | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 355 | Gastrointestinal inflammation | FAERS: 4 | OFFSIDES US FAERS | |
| 356 | Glomerulonephritis | FAERS: 4 | US FAERS | |
| 357 | Hepatitis C | FAERS: 4 | US FAERS | |
| 358 | Hordeolum | FAERS: 4 | US FAERS | |
| 359 | Hyperthyroidism | FAERS: 4 | US FAERS | |
| 360 | Ileus | FAERS: 4 | SIDER US FAERS | |
| 361 | Intermittent Claudication | FAERS: 4 | US FAERS | |
| 362 | Lymphopenia | FAERS: 4 | US FAERS | |
| 363 | Mineral supplementation | FAERS: 4 | US FAERS | |
| 364 | Multiple Myeloma | FAERS: 4 | US FAERS | |
| 365 | Muscle strain | FAERS: 4 | US FAERS | |
| 366 | Myelitis | FAERS: 4 | US FAERS | |
| 367 | Nervousness | FAERS: 4 | US FAERS | |
| 368 | Nipple pain | FAERS: 4 | US FAERS | |
| 369 | Pelvic Pain | FAERS: 4 | US FAERS | |
| 370 | Polymerase chain reaction positive | FAERS: 4 | US FAERS | |
| 371 | Portal Hypertension | FAERS: 4 | US FAERS | |
| 372 | Pregnancy on contraceptive | FAERS: 4 | US FAERS | |
| 373 | Premature Menopause | FAERS: 4 | US FAERS | |
| 374 | Rheumatoid Arthritis | FAERS: 4 | US FAERS | |
| 375 | Skin lesion | FAERS: 4 | US FAERS | |
| 376 | Sneezing | FAERS: 4 | US FAERS | |
| 377 | Squamous cell carcinoma of skin | FAERS: 4 | US FAERS | |
| 378 | Venous occlusion | FAERS: 4 | OFFSIDES US FAERS | |
| 379 | Vitreous floaters | FAERS: 4 | US FAERS | |
| 380 | Wrong technique in drug usage process | FAERS: 4 | US FAERS | |
| 381 | Accidental exposure | FAERS: 3 | OFFSIDES US FAERS | |
| 382 | Allogenic bone marrow transplantation therapy | FAERS: 3 | OFFSIDES US FAERS | |
| 383 | Ankle Fracture | FAERS: 3 | US FAERS | |
| 384 | Aphthous Stomatitis | FAERS: 3 | US FAERS | |
| 385 | Asthenopia | FAERS: 3 | US FAERS | |
| 386 | Atrial Flutter | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 387 | Bladder prolapse | FAERS: 3 | US FAERS | |
| 388 | Blast cell count increased | FAERS: 3 | OFFSIDES US FAERS | |
| 389 | Blood alkaline phosphatase increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 390 | Blood phosphorus decreased | FAERS: 3 | US FAERS | |
| 391 | Blood testosterone decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 392 | Bradycardia | FAERS: 3 | US FAERS | |
| 393 | Bronchopneumonia | FAERS: 3 | US FAERS | |
| 394 | Cardiac Flutter | FAERS: 3 | US FAERS | |
| 395 | Cataract operation | FAERS: 3 | US FAERS | |
| 396 | Choking | FAERS: 3 | US FAERS | |
| 397 | Cholecystitis | FAERS: 3 | SIDER US FAERS | |
| 398 | Cord blood transplant therapy | FAERS: 3 | US FAERS | |
| 399 | Cyanosis | FAERS: 3 | US FAERS | |
| 400 | Cyst | FAERS: 3 | SIDER US FAERS | |
| 401 | Decreased immune responsiveness | FAERS: 3 | US FAERS | |
| 402 | Demyelination | FAERS: 3 | US FAERS | |
| 403 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 404 | Device related infection | FAERS: 3 | US FAERS | |
| 405 | Diffuse Large B-Cell Lymphoma | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 406 | Duodenal Ulcer | FAERS: 3 | US FAERS | |
| 407 | Duodenal perforation | FAERS: 3 | US FAERS | |
| 408 | Emotional disorder | FAERS: 3 | US FAERS | |
| 409 | Eosinophilic Pneumonia | FAERS: 3 | US FAERS | |
| 410 | Epidermolysis | FAERS: 3 | OFFSIDES US FAERS | |
| 411 | Epigastric discomfort | FAERS: 3 | US FAERS | |
| 412 | Epstein-Barr virus associated lymphoproliferative disorder | FAERS: 3 | US FAERS | |
| 413 | Eructation | FAERS: 3 | US FAERS | |
| 414 | Escherichia infection | FAERS: 3 | US FAERS | |
| 415 | Excessive cerumen production | FAERS: 3 | US FAERS | |
| 416 | Exposure via partner | FAERS: 3 | US FAERS | |
| 417 | Extra dose administered | FAERS: 3 | US FAERS | |
| 418 | Feeling jittery | FAERS: 3 | US FAERS | |
| 419 | Feeling of body temperature change | FAERS: 3 | US FAERS | |
| 420 | Fibrosis | FAERS: 3 | US FAERS | |
| 421 | Gastric Bypass | FAERS: 3 | US FAERS | |
| 422 | Gastrointestinal infection | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 423 | Gastrointestinal toxicity | FAERS: 3 | US FAERS | |
| 424 | Hepatitis | FAERS: 3 | SIDER US FAERS | |
| 425 | Histiocytosis haematophagic | FAERS: 3 | US FAERS | |
| 426 | Hypertensive Encephalopathy | FAERS: 3 | US FAERS | |
| 427 | Impaired work ability | FAERS: 3 | US FAERS | |
| 428 | Joint stiffness | FAERS: 3 | US FAERS | |
| 429 | Lactose Intolerance | FAERS: 3 | US FAERS | |
| 430 | Laziness | FAERS: 3 | US FAERS | |
| 431 | Leukocytoclastic vasculitis | FAERS: 3 | US FAERS | |
| 432 | Lymphangitis | FAERS: 3 | US FAERS | |
| 433 | Macular degeneration | FAERS: 3 | US FAERS | |
| 434 | Macule | FAERS: 3 | US FAERS | |
| 435 | Meningeal disorder | FAERS: 3 | US FAERS | |
| 436 | Mental status changes | FAERS: 3 | US FAERS | |
| 437 | Microalbuminuria | FAERS: 3 | US FAERS | |
| 438 | Mixed Connective Tissue Disease | FAERS: 3 | US FAERS | |
| 439 | Multiple Sclerosis | FAERS: 3 | US FAERS | |
| 440 | Muscle Fatigue | FAERS: 3 | US FAERS | |
| 441 | Myelofibrosis | FAERS: 3 | US FAERS | |
| 442 | Myocarditis | FAERS: 3 | SIDER US FAERS | |
| 443 | Myoclonus | FAERS: 3 | US FAERS | |
| 444 | Myositis | FAERS: 3 | SIDER US FAERS | |
| 445 | Nasal discomfort | FAERS: 3 | US FAERS | |
| 446 | Nephritic syndrome | FAERS: 3 | US FAERS | |
| 447 | Nodule | FAERS: 3 | US FAERS | |
| 448 | Osteopenia | FAERS: 3 | US FAERS | |
| 449 | Pain of skin | FAERS: 3 | US FAERS | |
| 450 | Paranasal sinus discomfort | FAERS: 3 | US FAERS | |
| 451 | Peripheral artery occlusion | FAERS: 3 | US FAERS | |
| 452 | Pharyngitis | FAERS: 3 | US FAERS | |
| 453 | Platelet function test abnormal | FAERS: 3 | OFFSIDES US FAERS | |
| 454 | Posterior reversible encephalopathy syndrome | FAERS: 3 | SIDER US FAERS | |
| 455 | Presyncope | FAERS: 3 | US FAERS | |
| 456 | Pyelonephritis | FAERS: 3 | US FAERS | |
| 457 | Restrictive pulmonary disease | FAERS: 3 | US FAERS | |
| 458 | Sarcoidosis | FAERS: 3 | US FAERS | |
| 459 | Sciatica | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 460 | Sinus headache | FAERS: 3 | US FAERS | |
| 461 | Talipes | FAERS: 3 | US FAERS | |
| 462 | Tooth Extraction | FAERS: 3 | US FAERS | |
| 463 | Tooth Loss | FAERS: 3 | US FAERS | |
| 464 | Vascular occlusion | FAERS: 3 | US FAERS | |
| 465 | Venous thrombosis limb | FAERS: 3 | US FAERS | |
| 466 | jaundice | FAERS: 3 | US FAERS | |
| 467 | pseudomembranous colitis | FAERS: 3 | US FAERS | |
| 468 | Acidosis | FAERS: 2 | US FAERS | |
| 469 | Activated partial thromboplastin time abnormal | FAERS: 2 | US FAERS | |
| 470 | Acute Coronary Syndrome | FAERS: 2 | SIDER US FAERS | |
| 471 | Adenocarcinoma | FAERS: 2 | US FAERS | |
| 472 | Adenomatous Polyposis Coli | FAERS: 2 | US FAERS | |
| 473 | Akinesia | FAERS: 2 | US FAERS | |
| 474 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 475 | Anal Fissure | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 476 | Angle Closure Glaucoma | FAERS: 2 | US FAERS | |
| 477 | Apathy | FAERS: 2 | US FAERS | |
| 478 | Arachnoiditis | FAERS: 2 | US FAERS | |
| 479 | Arthropod sting | FAERS: 2 | US FAERS | |
| 480 | Asphyxia | FAERS: 2 | US FAERS | |
| 481 | Autoimmune thyroiditis | FAERS: 2 | US FAERS | |
| 482 | Basal cell carcinoma | FAERS: 2 | US FAERS | |
| 483 | Blepharospasm | FAERS: 2 | US FAERS | |
| 484 | Blood electrolytes decreased | FAERS: 2 | US FAERS | |
| 485 | Blood lactate dehydrogenase increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 486 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 487 | Blood pressure fluctuation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 488 | Blood thyroid stimulating hormone increased | FAERS: 2 | US FAERS | |
| 489 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 490 | Blood urea abnormal | FAERS: 2 | US FAERS | |
| 491 | Blood uric acid abnormal | FAERS: 2 | US FAERS | |
| 492 | Breast cancer recurrent | FAERS: 2 | US FAERS | |
| 493 | Bronchiectasis | FAERS: 2 | US FAERS | |
| 494 | Bronchospasm | FAERS: 2 | SIDER US FAERS | |
| 495 | Burn infection | FAERS: 2 | US FAERS | |
| 496 | Candidiasis | FAERS: 2 | US FAERS | |
| 497 | Capillary Leak Syndrome | FAERS: 2 | US FAERS | |
| 498 | Carpal Tunnel Syndrome | FAERS: 2 | US FAERS | |
| 499 | Central nervous system lesion | FAERS: 2 | US FAERS | |
| 500 | Cerebral Thrombosis | FAERS: 2 | US FAERS | |
| 501 | Choking sensation | FAERS: 2 | OFFSIDES US FAERS | |
| 502 | Cholangiocarcinoma | FAERS: 2 | US FAERS | |
| 503 | Chronic sinusitis | FAERS: 2 | OFFSIDES US FAERS | |
| 504 | Cluster Headache | FAERS: 2 | US FAERS | |
| 505 | Completed Suicide | FAERS: 2 | US FAERS | |
| 506 | Cytomegalovirus test positive | FAERS: 2 | US FAERS | |
| 507 | Depression suicidal | FAERS: 2 | US FAERS | |
| 508 | Disability | FAERS: 2 | US FAERS | |
| 509 | Drug Tolerance | FAERS: 2 | US FAERS | |
| 510 | Dysphemia | FAERS: 2 | US FAERS | |
| 511 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 512 | Emotional distress | FAERS: 2 | US FAERS | |
| 513 | Empyema | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 514 | Endodontic procedure | FAERS: 2 | US FAERS | |
| 515 | Erythema Multiforme | FAERS: 2 | SIDER US FAERS | |
| 516 | Essential Hypertension | FAERS: 2 | US FAERS | |
| 517 | Excoriation | FAERS: 2 | US FAERS | |
| 518 | Exfoliative rash | FAERS: 2 | SIDER US FAERS | |
| 519 | Eye Infection | FAERS: 2 | US FAERS | |
| 520 | Failure to Thrive | FAERS: 2 | OFFSIDES US FAERS | |
| 521 | Flank Pain | FAERS: 2 | US FAERS | |
| 522 | Food Allergy | FAERS: 2 | US FAERS | |
| 523 | Frustration tolerance decreased | FAERS: 2 | US FAERS | |
| 524 | Gastrectomy | FAERS: 2 | US FAERS | |
| 525 | Gastric Antral Vascular Ectasia | FAERS: 2 | US FAERS | |
| 526 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 527 | Gastrointestinal motility disorder | FAERS: 2 | US FAERS | |
| 528 | Glioblastoma Multiforme | FAERS: 2 | US FAERS | |
| 529 | Glossitis | FAERS: 2 | US FAERS | |
| 530 | Graft versus host disease in gastrointestinal tract | FAERS: 2 | US FAERS | |
| 531 | Graft versus host disease in skin | FAERS: 2 | US FAERS | |
| 532 | Granuloma Annulare | FAERS: 2 | US FAERS | |
| 533 | Heat Stroke | FAERS: 2 | US FAERS | |
| 534 | Hemiparesis | FAERS: 2 | US FAERS | |
| 535 | Hemiplegia | FAERS: 2 | US FAERS | |
| 536 | Hepatic Encephalopathy | FAERS: 2 | US FAERS | |
| 537 | Hepatosplenomegaly | FAERS: 2 | US FAERS | |
| 538 | Hip surgery | FAERS: 2 | US FAERS | |
| 539 | Hydronephrosis | FAERS: 2 | US FAERS | |
| 540 | Hydrothorax | FAERS: 2 | OFFSIDES US FAERS | |
| 541 | Hyperacusis | FAERS: 2 | US FAERS | |
| 542 | Hypophagia | FAERS: 2 | US FAERS | |
| 543 | Incoherent | FAERS: 2 | US FAERS | |
| 544 | Infected bite | FAERS: 2 | US FAERS | |
| 545 | Infectious pleural effusion | FAERS: 2 | US FAERS | |
| 546 | Initial insomnia | FAERS: 2 | US FAERS | |
| 547 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 548 | Intestinal anastomosis complication | FAERS: 2 | US FAERS | |
| 549 | Labyrinthitis | FAERS: 2 | US FAERS | |
| 550 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 551 | Leukoencephalopathy | FAERS: 2 | US FAERS | |
| 552 | Limb operation | FAERS: 2 | US FAERS | |
| 553 | Lobar Pneumonia | FAERS: 2 | US FAERS | |
| 554 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 555 | Lymphadenitis | FAERS: 2 | US FAERS | |
| 556 | Lymphocyte count decreased | FAERS: 2 | US FAERS | |
| 557 | Malabsorption | FAERS: 2 | US FAERS | |
| 558 | Marasmus | FAERS: 2 | US FAERS | |
| 559 | Mass excision | FAERS: 2 | US FAERS | |
| 560 | Menopause | FAERS: 2 | US FAERS | |
| 561 | Mesothelioma | FAERS: 2 | US FAERS | |
| 562 | Metrorrhagia | FAERS: 2 | US FAERS | |
| 563 | Middle insomnia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 564 | Miliaria | FAERS: 2 | SIDER US FAERS | |
| 565 | Muscle tightness | FAERS: 2 | OFFSIDES US FAERS | |
| 566 | Nail Infection | FAERS: 2 | US FAERS | |
| 567 | Necrosis | FAERS: 2 | US FAERS | |
| 568 | Nephrocalcinosis | FAERS: 2 | US FAERS | |
| 569 | Nerve injury | FAERS: 2 | US FAERS | |
| 570 | Neuroma | FAERS: 2 | OFFSIDES US FAERS | |
| 571 | Neutrophilic dermatosis | FAERS: 2 | US FAERS | |
| 572 | Obesity | FAERS: 2 | US FAERS | |
| 573 | Ocular discomfort | FAERS: 2 | US FAERS | |
| 574 | Onychomycosis | FAERS: 2 | US FAERS | |
| 575 | Optic Neuropathy | FAERS: 2 | US FAERS | |
| 576 | Pancreatic enzymes increased | FAERS: 2 | US FAERS | |
| 577 | Pancreatic toxicity | FAERS: 2 | US FAERS | |
| 578 | Panniculitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 579 | Periarthritis | FAERS: 2 | US FAERS | |
| 580 | Plasmacytosis | FAERS: 2 | US FAERS | |
| 581 | Platelet dysfunction | FAERS: 2 | US FAERS | |
| 582 | Pleuritic pain | FAERS: 2 | US FAERS | |
| 583 | Pneumocephalus | FAERS: 2 | US FAERS | |
| 584 | Polyarthritis | FAERS: 2 | US FAERS | |
| 585 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 586 | Porphyria non-acute | FAERS: 2 | US FAERS | |
| 587 | Post procedural complication | FAERS: 2 | US FAERS | |
| 588 | Post procedural infection | FAERS: 2 | US FAERS | |
| 589 | Proctitis | FAERS: 2 | US FAERS | |
| 590 | Product administration error | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 591 | Prothrombin time abnormal | FAERS: 2 | US FAERS | |
| 592 | Pulmonary function test decreased | FAERS: 2 | US FAERS | |
| 593 | Quadriplegia | FAERS: 2 | US FAERS | |
| 594 | Rectal fissure | FAERS: 2 | US FAERS | |
| 595 | Renal mass | FAERS: 2 | OFFSIDES US FAERS | |
| 596 | Renal tubular disorder | FAERS: 2 | US FAERS | |
| 597 | Respiratory Depression | FAERS: 2 | US FAERS | |
| 598 | Reticulocytosis | FAERS: 2 | OFFSIDES US FAERS | |
| 599 | Retinal Artery Occlusion | FAERS: 2 | US FAERS | |
| 600 | Retinal Vein Occlusion | FAERS: 2 | US FAERS | |
| 601 | Rhabdomyolysis | FAERS: 2 | SIDER US FAERS | |
| 602 | Scotoma | FAERS: 2 | US FAERS | |
| 603 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 604 | Snoring | FAERS: 2 | US FAERS | |
| 605 | Splenic Infarction | FAERS: 2 | US FAERS | |
| 606 | Splenic abscess | FAERS: 2 | US FAERS | |
| 607 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 608 | Therapeutic response changed | FAERS: 2 | US FAERS | |
| 609 | Transfusion Reaction | FAERS: 2 | US FAERS | |
| 610 | Trigeminal Neuralgia | FAERS: 2 | US FAERS | |
| 611 | Troponin I | FAERS: 2 | OFFSIDES US FAERS | |
| 612 | Tumour haemorrhage | FAERS: 2 | US FAERS | |
| 613 | Upper-airway cough syndrome | FAERS: 2 | US FAERS | |
| 614 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 615 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 616 | Ventricular arrhythmia | FAERS: 2 | SIDER US FAERS | |
| 617 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 618 | Abdominal mass | FAERS: 1 | OFFSIDES US FAERS | |
| 619 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 620 | Abscess | FAERS: 1 | US FAERS | |
| 621 | Accidental death | FAERS: 1 | US FAERS | |
| 622 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 623 | Actinic keratosis | FAERS: 1 | US FAERS | |
| 624 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 625 | Acute graft versus host disease in intestine | FAERS: 1 | US FAERS | |
| 626 | Acute left ventricular failure | FAERS: 1 | US FAERS | |
| 627 | Adams-Stokes Syndrome | FAERS: 1 | US FAERS | |
| 628 | Albuminuria | FAERS: 1 | US FAERS | |
| 629 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 630 | Altered visual depth perception | FAERS: 1 | OFFSIDES US FAERS | |
| 631 | Alveolar bone resorption | FAERS: 1 | US FAERS | |
| 632 | Amputation | FAERS: 1 | US FAERS | |
| 633 | Amylase increased | FAERS: 1 | US FAERS | |
| 634 | Anal Ulcer | FAERS: 1 | US FAERS | |
| 635 | Anal abscess | FAERS: 1 | US FAERS | |
| 636 | Anal infection | FAERS: 1 | US FAERS | |
| 637 | Aneurysm | FAERS: 1 | US FAERS | |
| 638 | Anger | FAERS: 1 | US FAERS | |
| 639 | Animal bite | FAERS: 1 | US FAERS | |
| 640 | Anosmia | FAERS: 1 | US FAERS | |
| 641 | Antibody test abnormal | FAERS: 1 | US FAERS | |
| 642 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 643 | Aortic valve calcification | FAERS: 1 | US FAERS | |
| 644 | Aphagia | FAERS: 1 | US FAERS | |
| 645 | Aphonia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 646 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 647 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 648 | Aspergillosis | FAERS: 1 | US FAERS | |
| 649 | Ataxia | FAERS: 1 | US FAERS | |
| 650 | Atrial hypertrophy | FAERS: 1 | US FAERS | |
| 651 | Atypical mycobacterium test positive | FAERS: 1 | US FAERS | |
| 652 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 653 | Bicuspid aortic valve | FAERS: 1 | US FAERS | |
| 654 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 655 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 656 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 657 | Bladder pain | FAERS: 1 | US FAERS | |
| 658 | Bladder spasm | FAERS: 1 | US FAERS | |
| 659 | Blepharitis | FAERS: 1 | US FAERS | |
| 660 | Blood albumin decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 661 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 662 | Blood chloride abnormal | FAERS: 1 | US FAERS | |
| 663 | Blood fibrinogen increased | FAERS: 1 | US FAERS | |
| 664 | Blood follicle stimulating hormone increased | FAERS: 1 | US FAERS | |
| 665 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 666 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 667 | Blood magnesium abnormal | FAERS: 1 | US FAERS | |
| 668 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 669 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 670 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 671 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 672 | Bone atrophy | FAERS: 1 | US FAERS | |
| 673 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 674 | Brain Stem Glioma | FAERS: 1 | US FAERS | |
| 675 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 676 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 677 | Bruxism | FAERS: 1 | US FAERS | |
| 678 | Buccal mucosal roughening | FAERS: 1 | US FAERS | |
| 679 | Bursitis | FAERS: 1 | US FAERS | |
| 680 | Butterfly rash | FAERS: 1 | US FAERS | |
| 681 | Cachexia | FAERS: 1 | US FAERS | |
| 682 | Campylobacter infection | FAERS: 1 | US FAERS | |
| 683 | Carcinoma in Situ | FAERS: 1 | US FAERS | |
| 684 | Cardiac Hypertrophy | FAERS: 1 | US FAERS | |
| 685 | Cardiac ablation | FAERS: 1 | US FAERS | |
| 686 | Cardiac asthma | FAERS: 1 | US FAERS | |
| 687 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 688 | Cardiac infection | FAERS: 1 | US FAERS | |
| 689 | Cardiac valve abscess | FAERS: 1 | US FAERS | |
| 690 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 691 | Carditis | FAERS: 1 | US FAERS | |
| 692 | Catheter culture positive | FAERS: 1 | US FAERS | |
| 693 | Catheter placement | FAERS: 1 | US FAERS | |
| 694 | Catheter related infection | FAERS: 1 | US FAERS | |
| 695 | Catheter site discharge | FAERS: 1 | US FAERS | |
| 696 | Cell marker increased | FAERS: 1 | US FAERS | |
| 697 | Cellulitis of male external genital organ | FAERS: 1 | US FAERS | |
| 698 | Central Nervous System Infection | FAERS: 1 | US FAERS | |
| 699 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 700 | Cerebral cyst | FAERS: 1 | US FAERS | |
| 701 | Cerebrovascular stenosis | FAERS: 1 | US FAERS | |
| 702 | Cervical cord compression | FAERS: 1 | US FAERS | |
| 703 | Cervicobrachial syndrome | FAERS: 1 | US FAERS | |
| 704 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 705 | Cheilitis | FAERS: 1 | US FAERS | |
| 706 | Cholangitis | FAERS: 1 | US FAERS | |
| 707 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 708 | Cholestasis | FAERS: 1 | SIDER US FAERS | |
| 709 | Chromosomal mutation | FAERS: 1 | US FAERS | |
| 710 | Clostridium test positive | FAERS: 1 | US FAERS | |
| 711 | Coagulation factor X level decreased | FAERS: 1 | US FAERS | |
| 712 | Coating in mouth | FAERS: 1 | US FAERS | |
| 713 | Cold sweat | FAERS: 1 | US FAERS | |
| 714 | Colectomy | FAERS: 1 | US FAERS | |
| 715 | Colitis erosive | FAERS: 1 | US FAERS | |
| 716 | Complication of delivery | FAERS: 1 | US FAERS | |
| 717 | Congenital Hypothyroidism | FAERS: 1 | US FAERS | |
| 718 | Congenital hepatomegaly | FAERS: 1 | US FAERS | |
| 719 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 720 | Corneal Opacity | FAERS: 1 | US FAERS | |
| 721 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 722 | Corneal graft rejection | FAERS: 1 | US FAERS | |
| 723 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 724 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 725 | Creutzfeldt-Jakob disease | FAERS: 1 | US FAERS | |
| 726 | Cutis Laxa | FAERS: 1 | US FAERS | |
| 727 | Cystitis escherichia | FAERS: 1 | US FAERS | |
| 728 | Cytology abnormal | FAERS: 1 | US FAERS | |
| 729 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 730 | Death of relative | FAERS: 1 | US FAERS | |
| 731 | Dengue Fever | FAERS: 1 | US FAERS | |
| 732 | Dental Restoration Failure | FAERS: 1 | US FAERS | |
| 733 | Denture wearer | FAERS: 1 | US FAERS | |
| 734 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 735 | Device leakage | FAERS: 1 | US FAERS | |
| 736 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 737 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 738 | Diabetic Retinopathy | FAERS: 1 | US FAERS | |
| 739 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 740 | Drooling | FAERS: 1 | US FAERS | |
| 741 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 742 | Drug level below therapeutic | FAERS: 1 | US FAERS | |
| 743 | Drug level decreased | FAERS: 1 | US FAERS | |
| 744 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 745 | Drug screen positive | FAERS: 1 | US FAERS | |
| 746 | Dystonia | FAERS: 1 | US FAERS | |
| 747 | Ear congestion | FAERS: 1 | US FAERS | |
| 748 | Embolic stroke | FAERS: 1 | US FAERS | |
| 749 | Encephalomyelitis | FAERS: 1 | US FAERS | |
| 750 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 751 | Enterococcal sepsis | FAERS: 1 | US FAERS | |
| 752 | Epilepsy | FAERS: 1 | US FAERS | |
| 753 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 754 | Eye inflammation | FAERS: 1 | US FAERS | |
| 755 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 756 | Eyelid pain | FAERS: 1 | US FAERS | |
| 757 | Factor X Deficiency | FAERS: 1 | US FAERS | |
| 758 | Febrile infection | FAERS: 1 | US FAERS | |
| 759 | Femoral artery occlusion | FAERS: 1 | US FAERS | |
| 760 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 761 | Free prostate-specific antigen increased | FAERS: 1 | US FAERS | |
| 762 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 763 | Gamma-Glutamyltransferase Increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 764 | Gammopathy | FAERS: 1 | US FAERS | |
| 765 | Gastric infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 766 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 767 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 768 | Gastrointestinal angiodysplasia haemorrhagic | FAERS: 1 | US FAERS | |
| 769 | Gastrointestinal angiodysplasia | FAERS: 1 | US FAERS | |
| 770 | Gastrointestinal arteriovenous malformation | FAERS: 1 | US FAERS | |
| 771 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 772 | Gastrointestinal erosion | FAERS: 1 | US FAERS | |
| 773 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 774 | Gastrointestinal viral infection | FAERS: 1 | US FAERS | |
| 775 | Gastrosplenic fistula | FAERS: 1 | US FAERS | |
| 776 | Gelatinous transformation of the bone marrow | FAERS: 1 | US FAERS | |
| 777 | Gene mutation identification test positive | FAERS: 1 | US FAERS | |
| 778 | Genital pain | FAERS: 1 | US FAERS | |
| 779 | Genital tract inflammation | FAERS: 1 | US FAERS | |
| 780 | Glioma | FAERS: 1 | US FAERS | |
| 781 | Graft versus host disease in liver | FAERS: 1 | US FAERS | |
| 782 | Graft versus host disease in lung | FAERS: 1 | US FAERS | |
| 783 | Granuloma | FAERS: 1 | US FAERS | |
| 784 | Hepatic vein occlusion | FAERS: 1 | US FAERS | |
| 785 | Hepatitis B | FAERS: 1 | US FAERS | |
| 786 | Hepatitis C RNA increased | FAERS: 1 | US FAERS | |
| 787 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 788 | Herbal interaction | FAERS: 1 | US FAERS | |
| 789 | Hunger | FAERS: 1 | US FAERS | |
| 790 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 791 | Hyperventilation | FAERS: 1 | US FAERS | |
| 792 | Hypogeusia | FAERS: 1 | US FAERS | |
| 793 | Hypokinesia | FAERS: 1 | US FAERS | |
| 794 | Hypoperfusion | FAERS: 1 | US FAERS | |
| 795 | Hysterectomy | FAERS: 1 | US FAERS | |
| 796 | Idiopathic Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 797 | Immobile | FAERS: 1 | US FAERS | |
| 798 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 799 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 800 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 801 | Incision site complication | FAERS: 1 | US FAERS | |
| 802 | Incision site pain | FAERS: 1 | US FAERS | |
| 803 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 804 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 805 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 806 | Infarction | FAERS: 1 | US FAERS | |
| 807 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 808 | Infectious colitis | FAERS: 1 | US FAERS | |
| 809 | Infective tenosynovitis | FAERS: 1 | US FAERS | |
| 810 | Inguinal mass | FAERS: 1 | US FAERS | |
| 811 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 812 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 813 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 814 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 815 | Iron Overload | FAERS: 1 | US FAERS | |
| 816 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 817 | Jejunectomy | FAERS: 1 | US FAERS | |
| 818 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 819 | Large intestine erosion | FAERS: 1 | US FAERS | |
| 820 | Laryngospasm | FAERS: 1 | US FAERS | |
| 821 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 822 | Leukodystrophy | FAERS: 1 | US FAERS | |
| 823 | Libido disorder | FAERS: 1 | US FAERS | |
| 824 | Lichen Planus | FAERS: 1 | US FAERS | |
| 825 | Limb injury | FAERS: 1 | US FAERS | |
| 826 | Limb mass | FAERS: 1 | US FAERS | |
| 827 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 828 | Lipids abnormal | FAERS: 1 | US FAERS | |
| 829 | Localised intraabdominal fluid collection | FAERS: 1 | US FAERS | |
| 830 | Loose tooth | FAERS: 1 | US FAERS | |
| 831 | Low birth weight baby | FAERS: 1 | US FAERS | |
| 832 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 833 | Lung consolidation | FAERS: 1 | US FAERS | |
| 834 | Lyme Disease | FAERS: 1 | US FAERS | |
| 835 | Lymph node palpable | FAERS: 1 | US FAERS | |
| 836 | Lymphangiosis carcinomatosa | FAERS: 1 | US FAERS | |
| 837 | Lymphatic duct injury | FAERS: 1 | US FAERS | |
| 838 | Malaria | FAERS: 1 | US FAERS | |
| 839 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 840 | Mastitis | FAERS: 1 | US FAERS | |
| 841 | Mastoiditis | FAERS: 1 | US FAERS | |
| 842 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 843 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 844 | Megacolon | FAERS: 1 | US FAERS | |
| 845 | Melanoma recurrent | FAERS: 1 | US FAERS | |
| 846 | Meningioma | FAERS: 1 | US FAERS | |
| 847 | Meniscus injury | FAERS: 1 | US FAERS | |
| 848 | Mesenteritis | FAERS: 1 | US FAERS | |
| 849 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 850 | Metastasis | FAERS: 1 | US FAERS | |
| 851 | Metastatic Neoplasm | FAERS: 1 | OFFSIDES US FAERS | |
| 852 | Metastatic uterine cancer | FAERS: 1 | US FAERS | |
| 853 | Monoclonal immunoglobulin present | FAERS: 1 | US FAERS | |
| 854 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 855 | Multiple gated acquisition scan abnormal | FAERS: 1 | US FAERS | |
| 856 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 857 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 858 | Myasthenic Syndrome | FAERS: 1 | US FAERS | |
| 859 | Mydriasis | FAERS: 1 | US FAERS | |
| 860 | Myeloblast count decreased | FAERS: 1 | US FAERS | |
| 861 | Myelocytosis | FAERS: 1 | OFFSIDES US FAERS | |
| 862 | Myocardial strain | FAERS: 1 | US FAERS | |
| 863 | Natural killer T cell count increased | FAERS: 1 | US FAERS | |
| 864 | Nerve root lesion | FAERS: 1 | US FAERS | |
| 865 | Neuritis | FAERS: 1 | US FAERS | |
| 866 | Neutropenic infection | FAERS: 1 | US FAERS | |
| 867 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 868 | Neutrophilic panniculitis | FAERS: 1 | US FAERS | |
| 869 | Nipple inflammation | FAERS: 1 | US FAERS | |
| 870 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 871 | Obesity surgery | FAERS: 1 | US FAERS | |
| 872 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 873 | Ocular Toxicity | FAERS: 1 | OFFSIDES US FAERS | |
| 874 | Ocular icterus | FAERS: 1 | US FAERS | |
| 875 | Olfactory Nerve Disorder | FAERS: 1 | US FAERS | |
| 876 | Oncologic complication | FAERS: 1 | US FAERS | |
| 877 | Ophthalmoplegia | FAERS: 1 | OFFSIDES US FAERS | |
| 878 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 879 | Optic Neuritis | FAERS: 1 | SIDER US FAERS | |
| 880 | Oral infection | FAERS: 1 | US FAERS | |
| 881 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 882 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 883 | Orchitis | FAERS: 1 | US FAERS | |
| 884 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 885 | Osteonecrosis of Jaw | FAERS: 1 | US FAERS | |
| 886 | Osteoporosis | FAERS: 1 | US FAERS | |
| 887 | Otitis Media | FAERS: 1 | US FAERS | |
| 888 | PO2 decreased | FAERS: 1 | US FAERS | |
| 889 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 890 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 891 | Paracentesis | FAERS: 1 | US FAERS | |
| 892 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 893 | Paraparesis | FAERS: 1 | US FAERS | |
| 894 | Paternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 895 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 896 | Pelvic abscess | FAERS: 1 | US FAERS | |
| 897 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 898 | Periodontitis | FAERS: 1 | OFFSIDES US FAERS | |
| 899 | Peripheral artery stenosis | FAERS: 1 | US FAERS | |
| 900 | Peripheral motor neuropathy | FAERS: 1 | US FAERS | |
| 901 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 902 | Personality Change | FAERS: 1 | OFFSIDES US FAERS | |
| 903 | Pleural decortication | FAERS: 1 | US FAERS | |
| 904 | Pleurodesis | FAERS: 1 | US FAERS | |
| 905 | Poisoning | FAERS: 1 | US FAERS | |
| 906 | Polyarteritis Nodosa | FAERS: 1 | US FAERS | |
| 907 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 908 | Polyomavirus test positive | FAERS: 1 | US FAERS | |
| 909 | Polyuria | FAERS: 1 | US FAERS | |
| 910 | Post procedural cellulitis | FAERS: 1 | US FAERS | |
| 911 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 912 | Potentiating drug interaction | FAERS: 1 | US FAERS | |
| 913 | Pregnancy of partner | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 914 | Pregnancy test positive | FAERS: 1 | US FAERS | |
| 915 | Premenstrual syndrome | FAERS: 1 | US FAERS | |
| 916 | Procalcitonin increased | FAERS: 1 | US FAERS | |
| 917 | Product complaint | FAERS: 1 | US FAERS | |
| 918 | Product counterfeit | FAERS: 1 | US FAERS | |
| 919 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 920 | Product label issue | FAERS: 1 | US FAERS | |
| 921 | Product quality control issue | FAERS: 1 | US FAERS | |
| 922 | Product size issue | FAERS: 1 | US FAERS | |
| 923 | Product supply issue | FAERS: 1 | US FAERS | |
| 924 | Product use complaint | FAERS: 1 | US FAERS | |
| 925 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 926 | Prostatectomy | FAERS: 1 | US FAERS | |
| 927 | Pseudomonal sepsis | FAERS: 1 | US FAERS | |
| 928 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 929 | Pulmonary artery stenosis | FAERS: 1 | US FAERS | |
| 930 | Pulmonary sepsis | FAERS: 1 | US FAERS | |
| 931 | Purpura | FAERS: 1 | US FAERS | |
| 932 | Pyostomatitis vegetans | FAERS: 1 | US FAERS | |
| 933 | Radiation Pneumonitis | FAERS: 1 | US FAERS | |
| 934 | Radiation injury | FAERS: 1 | US FAERS | |
| 935 | Rales | FAERS: 1 | US FAERS | |
| 936 | Rectal polyp | FAERS: 1 | US FAERS | |
| 937 | Reflux laryngitis | FAERS: 1 | US FAERS | |
| 938 | Refusal of treatment by relative | FAERS: 1 | US FAERS | |
| 939 | Remission not achieved | FAERS: 1 | US FAERS | |
| 940 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 941 | Renal abscess | FAERS: 1 | US FAERS | |
| 942 | Renal cancer metastatic | FAERS: 1 | OFFSIDES US FAERS | |
| 943 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 944 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 945 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 946 | Retinal scar | FAERS: 1 | US FAERS | |
| 947 | Retinal toxicity | FAERS: 1 | US FAERS | |
| 948 | Rhinovirus infection | FAERS: 1 | US FAERS | |
| 949 | Right Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 950 | Rocky Mountain Spotted Fever | FAERS: 1 | US FAERS | |
| 951 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 952 | Rubber sensitivity | FAERS: 1 | US FAERS | |
| 953 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 954 | Sacroiliitis | FAERS: 1 | US FAERS | |
| 955 | Salmonella sepsis | FAERS: 1 | US FAERS | |
| 956 | Salpingo-oophorectomy unilateral | FAERS: 1 | US FAERS | |
| 957 | Sarcoma | FAERS: 1 | US FAERS | |
| 958 | Scleroderma | FAERS: 1 | US FAERS | |
| 959 | Screaming | FAERS: 1 | US FAERS | |
| 960 | Sensitive skin | FAERS: 1 | US FAERS | |
| 961 | Serositis | FAERS: 1 | US FAERS | |
| 962 | Sinus pain | FAERS: 1 | US FAERS | |
| 963 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 964 | Skin neoplasm excision | FAERS: 1 | US FAERS | |
| 965 | Sluggishness | FAERS: 1 | US FAERS | |
| 966 | Solar dermatitis | FAERS: 1 | US FAERS | |
| 967 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 968 | Spinal cord abscess | FAERS: 1 | US FAERS | |
| 969 | Spinal cord infection | FAERS: 1 | US FAERS | |
| 970 | Splenic Rupture | FAERS: 1 | US FAERS | |
| 971 | Sputum culture positive | FAERS: 1 | US FAERS | |
| 972 | Squamous cell carcinoma of lung | FAERS: 1 | US FAERS | |
| 973 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 974 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 975 | Subcutaneous Abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 976 | Subdural Effusion | FAERS: 1 | US FAERS | |
| 977 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 978 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 979 | Syndactyly | FAERS: 1 | US FAERS | |
| 980 | Systemic Scleroderma | FAERS: 1 | US FAERS | |
| 981 | T-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 982 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 983 | Teeth brittle | FAERS: 1 | US FAERS | |
| 984 | Temperature regulation disorder | FAERS: 1 | US FAERS | |
| 985 | Tenorrhaphy | FAERS: 1 | US FAERS | |
| 986 | Tension Headache | FAERS: 1 | US FAERS | |
| 987 | Teratoma | FAERS: 1 | US FAERS | |
| 988 | Terminal state | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 989 | Tetanus | FAERS: 1 | US FAERS | |
| 990 | Thirst decreased | FAERS: 1 | US FAERS | |
| 991 | Thoracic cavity drainage | FAERS: 1 | US FAERS | |
| 992 | Thoracostomy | FAERS: 1 | US FAERS | |
| 993 | Throat cancer | FAERS: 1 | US FAERS | |
| 994 | Thrombectomy | FAERS: 1 | US FAERS | |
| 995 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 996 | Thrombophlebitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 997 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 998 | Thyroidectomy | FAERS: 1 | US FAERS | |
| 999 | Thyroiditis | FAERS: 1 | US FAERS | |
| 1000 | Tongue blistering | FAERS: 1 | US FAERS | |
| 1001 | Tonsillitis | FAERS: 1 | US FAERS | |
| 1002 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 1003 | Transplantation complication | FAERS: 1 | US FAERS | |
| 1004 | Troponin T increased | FAERS: 1 | US FAERS | |
| 1005 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 1006 | UGT1A1 gene polymorphism | FAERS: 1 | US FAERS | |
| 1007 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 1008 | Underweight | FAERS: 1 | US FAERS | |
| 1009 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 1010 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 1011 | Ureteral stent insertion | FAERS: 1 | US FAERS | |
| 1012 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 1013 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 1014 | Urine output increased | FAERS: 1 | US FAERS | |
| 1015 | Uterine Prolapse | FAERS: 1 | US FAERS | |
| 1016 | VIIth nerve paralysis | FAERS: 1 | SIDER US FAERS | |
| 1017 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 1018 | Vascular rupture | FAERS: 1 | US FAERS | |
| 1019 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 1020 | Viral load increased | FAERS: 1 | US FAERS | |
| 1021 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 1022 | Visual disturbance | FAERS: 1 | SIDER US FAERS | |
| 1023 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 1024 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 1025 | Wound abscess | FAERS: 1 | US FAERS | |
| 1026 | Wrong drug | FAERS: 1 | US FAERS | |
| 1027 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 1028 | Xerophthalmia | FAERS: 1 | US FAERS | |
| 1029 | neurofibroma | FAERS: 1 | US FAERS | |
| 1030 | rhinoplasty | FAERS: 1 | US FAERS | |
| 1031 | skin abrasion | FAERS: 1 | US FAERS | |
| 1032 | Anemia | 29803841 | CTD | |
| 1033 | Ankle brachial index decreased | OFFSIDES | ||
| 1034 | Astigmatism | OFFSIDES | ||
| 1035 | Auricular swelling | SIDER | ||
| 1036 | Bacterial sepsis | Canada Vigilance: 1 | Canada Vigilance | |
| 1037 | Bacterial test positive | OFFSIDES | ||
| 1038 | Blood and lymphatic system disorders | SIDER | ||
| 1039 | Blood sodium | OFFSIDES | ||
| 1040 | Blood thyroid stimulating hormone abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 1041 | Bone density decreased | OFFSIDES | ||
| 1042 | Bone lesion | OFFSIDES | ||
| 1043 | Brain Death | Canada Vigilance: 1 | Canada Vigilance | |
| 1044 | Bullous conditions | SIDER | ||
| 1045 | Calcium low | SIDER | ||
| 1046 | Central nervous system mass | OFFSIDES | ||
| 1047 | Cerebrovascular Insufficiency | OFFSIDES | ||
| 1048 | Chemical and Drug Induced Liver Injury | 18608866 23956101 | CTD | |
| 1049 | Chemotherapy | Canada Vigilance: 1 | Canada Vigilance | |
| 1050 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 1051 | Chronic ulcerative colitis | OFFSIDES | ||
| 1052 | Coma scale abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 1053 | Contact Dermatitis | OFFSIDES | ||
| 1054 | Cor pulmonale | OFFSIDES SIDER | ||
| 1055 | Creatinine increased | SIDER | ||
| 1056 | Cytogenetic analysis abnormal | OFFSIDES | ||
| 1057 | Diabetes mellitus inadequate control | Canada Vigilance: 1 | Canada Vigilance | |
| 1058 | Diarrhea | OFFSIDES | ||
| 1059 | Diastolic dysfunction | SIDER | ||
| 1060 | Disturbance in sexual arousal | SIDER | ||
| 1061 | Drug withdrawal headache | OFFSIDES | ||
| 1062 | Ear and labyrinth disorders | SIDER | ||
| 1063 | Ecchymosis | SIDER | ||
| 1064 | Electromechanical dissociation | OFFSIDES | ||
| 1065 | Embolism | SIDER | ||
| 1066 | Erythrosis | OFFSIDES SIDER | ||
| 1067 | Escherichia urinary tract infection | OFFSIDES | ||
| 1068 | Eyelid infection | OFFSIDES | ||
| 1069 | Femoral arterial stenosis | OFFSIDES | ||
| 1070 | Fibrin increased | OFFSIDES | ||
| 1071 | Gastrointestinal mucosal disorder | OFFSIDES | ||
| 1072 | Gastrointestinal obstruction | OFFSIDES | ||
| 1073 | Genital rash | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 1074 | Genital swelling | SIDER | ||
| 1075 | Hemothorax | OFFSIDES | ||
| 1076 | Hormone Therapy | OFFSIDES | ||
| 1077 | Iliac artery stenosis | OFFSIDES | ||
| 1078 | Infestation | SIDER | ||
| 1079 | Leukaemic infiltration brain | OFFSIDES | ||
| 1080 | Leukemia, Myeloid, Chronic-Phase | 23825585 | CTD | |
| 1081 | Leukopenia neonatal | OFFSIDES | ||
| 1082 | Livedo Reticularis | SIDER | ||
| 1083 | Lymphedema | OFFSIDES | ||
| 1084 | Medical device implantation | OFFSIDES | ||
| 1085 | Metamyelocyte count increased | OFFSIDES | ||
| 1086 | Metastatic Renal Cell Carcinoma | OFFSIDES | ||
| 1087 | Miliaria Rubra | SIDER | ||
| 1088 | Miscarriage of partner | Canada Vigilance: 1 | Canada Vigilance | |
| 1089 | Muscle Weakness | OFFSIDES | ||
| 1090 | Myelodysplasia | OFFSIDES | ||
| 1091 | Myelosuppression | SIDER | ||
| 1092 | Myopericarditis | OFFSIDES | ||
| 1093 | Neoplasm Invasiveness | 21106725 | CTD | |
| 1094 | Neoplasms, Experimental | 19878872 20682659 | CTD | |
| 1095 | Neuropathy | SIDER | ||
| 1096 | Neutropenic colitis | SIDER | ||
| 1097 | Palliative Care | Canada Vigilance: 1 | Canada Vigilance | |
| 1098 | Papule | Canada Vigilance: 1 | Canada Vigilance | |
| 1099 | Phlebitis | OFFSIDES | ||
| 1100 | Pitting edema | SIDER | ||
| 1101 | Platelet aggregation abnormal | SIDER | ||
| 1102 | Pneumocystis jiroveci pneumonia | OFFSIDES | ||
| 1103 | Polycythemia Vera | 18717827 | CTD | |
| 1104 | Polymyositis | OFFSIDES | ||
| 1105 | Protein-losing gastroenteropathy | SIDER | ||
| 1106 | Prurigo | SIDER | ||
| 1107 | Quality of life decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 1108 | Rash follicular | SIDER | ||
| 1109 | Retroperitoneal lymphadenopathy | OFFSIDES | ||
| 1110 | Rhinorrhea | OFFSIDES | ||
| 1111 | Scrotal irritation | Canada Vigilance: 1 | Canada Vigilance | |
| 1112 | Supraventricular tachyarrhythmia | OFFSIDES | ||
| 1113 | Systemic lupus erythematosus rash | SIDER | ||
| 1114 | Troponin increased | SIDER | ||
| 1115 | Vasectomy | OFFSIDES | ||
| 1116 | Ventricular Dysfunction | SIDER | ||
| 1117 | Ventricular failure | SIDER | ||
| 1118 | Vitamin B 12 Deficiency | OFFSIDES | ||
| 1119 | leukemia | 28243904 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.