PCI 32765
(XYFPWWZEPKGCCK-GOSISDBHSA-N)
Structure
- SMILES
- C=CC(=O)N1CCC[C@H](C1)n1nc(c2c1ncnc2N)c1ccc(cc1)Oc1ccccc1
- Type(s)
- Approved
- ATC code(s)
- L01XE27
- Molecular Formula:
- C25H24N6O2
- Molecular Weight:
- 440.497
- Log P:
- 4.7364
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 1
- TPSA:
- 99.16
- CAS Number(s):
- 936563-96-1
Synonym(s)
1.
PCI 32765
2.
PCI-32765
3.
PCI32765
4.
ibrutinib
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Incorrect dose administered | FAERS: 832 Canada Vigilance: 49 | Canada Vigilance US FAERS | |
| 2 | Fatigue | FAERS: 707 Canada Vigilance: 200 | Canada Vigilance SIDER US FAERS | |
| 3 | Atrial Fibrillation | FAERS: 606 Canada Vigilance: 89 | Canada Vigilance SIDER US FAERS | |
| 4 | Pneumonia | FAERS: 494 Canada Vigilance: 197 | Canada Vigilance SIDER US FAERS | |
| 5 | Disease Progression | FAERS: 361 Canada Vigilance: 13 | Canada Vigilance SIDER US FAERS | |
| 6 | Arthralgia | FAERS: 330 Canada Vigilance: 65 | Canada Vigilance SIDER US FAERS | |
| 7 | Asthenia | FAERS: 325 Canada Vigilance: 87 | Canada Vigilance SIDER US FAERS | |
| 8 | Nausea | FAERS: 286 Canada Vigilance: 55 | Canada Vigilance SIDER US FAERS | |
| 9 | Dizziness | FAERS: 250 Canada Vigilance: 63 | Canada Vigilance SIDER US FAERS | |
| 10 | Product use issue | FAERS: 249 Canada Vigilance: 27 | Canada Vigilance US FAERS | |
| 11 | Headache | FAERS: 211 Canada Vigilance: 30 | Canada Vigilance SIDER US FAERS | |
| 12 | Peripheral swelling | FAERS: 207 Canada Vigilance: 55 | Canada Vigilance US FAERS | |
| 13 | Infection | FAERS: 194 Canada Vigilance: 42 | Canada Vigilance SIDER US FAERS | |
| 14 | Malaise | FAERS: 192 Canada Vigilance: 22 | Canada Vigilance US FAERS | |
| 15 | Epistaxis | FAERS: 182 Canada Vigilance: 53 | Canada Vigilance SIDER US FAERS | |
| 16 | Cerebrovascular accident | FAERS: 170 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 17 | Weight decreased | FAERS: 170 Canada Vigilance: 39 | Canada Vigilance US FAERS | |
| 18 | Product use in unapproved indication | FAERS: 165 Canada Vigilance: 20 | Canada Vigilance US FAERS | |
| 19 | Stomatitis | FAERS: 165 Canada Vigilance: 16 | Canada Vigilance SIDER US FAERS | |
| 20 | White blood cell count decreased | FAERS: 162 Canada Vigilance: 42 | Canada Vigilance US FAERS | |
| 21 | Urinary tract infection | FAERS: 158 Canada Vigilance: 41 | Canada Vigilance SIDER US FAERS | |
| 22 | Myalgia | FAERS: 157 Canada Vigilance: 36 | Canada Vigilance US FAERS | |
| 23 | Neutropenia | FAERS: 154 Canada Vigilance: 42 | Canada Vigilance SIDER US FAERS | |
| 24 | Pain | FAERS: 154 Canada Vigilance: 34 | Canada Vigilance US FAERS | |
| 25 | Sepsis | FAERS: 153 Canada Vigilance: 29 | Canada Vigilance US FAERS | |
| 26 | Thrombocytopenia | FAERS: 152 Canada Vigilance: 18 | Canada Vigilance SIDER US FAERS | |
| 27 | Vomiting | FAERS: 150 Canada Vigilance: 29 | Canada Vigilance SIDER US FAERS | |
| 28 | Adverse event | FAERS: 133 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 29 | Constipation | FAERS: 133 Canada Vigilance: 35 | Canada Vigilance SIDER US FAERS | |
| 30 | Drug dose omission | FAERS: 132 | US FAERS | |
| 31 | Drug ineffective | FAERS: 130 Canada Vigilance: 24 | Canada Vigilance US FAERS | |
| 32 | Nasopharyngitis | FAERS: 116 Canada Vigilance: 49 | Canada Vigilance US FAERS | |
| 33 | Petechiae | FAERS: 114 Canada Vigilance: 14 | Canada Vigilance SIDER US FAERS | |
| 34 | Dehydration | FAERS: 109 Canada Vigilance: 15 | Canada Vigilance SIDER US FAERS | |
| 35 | Lymphadenopathy | FAERS: 109 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 36 | Blood count abnormal | FAERS: 104 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 37 | Back Pain | FAERS: 102 Canada Vigilance: 35 | Canada Vigilance US FAERS | |
| 38 | Hypotension | FAERS: 101 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 39 | Myocardial Infarction | FAERS: 91 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 40 | Pruritus | FAERS: 91 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 41 | Joint swelling | FAERS: 84 Canada Vigilance: 20 | Canada Vigilance US FAERS | |
| 42 | Increased tendency to bruise | FAERS: 78 Canada Vigilance: 32 | Canada Vigilance US FAERS | |
| 43 | Chest Pain | FAERS: 77 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 44 | Alopecia | FAERS: 76 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 45 | Influenza | FAERS: 74 Canada Vigilance: 19 | Canada Vigilance US FAERS | |
| 46 | Pneumonitis | FAERS: 74 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 47 | Sinusitis | FAERS: 73 Canada Vigilance: 15 | Canada Vigilance SIDER US FAERS | |
| 48 | Skin lesion | FAERS: 73 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 49 | Feeling abnormal | FAERS: 72 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 50 | Dyspepsia | FAERS: 70 Canada Vigilance: 22 | Canada Vigilance SIDER US FAERS | |
| 51 | Onychoclasis | FAERS: 70 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 52 | Abdominal discomfort | FAERS: 66 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 53 | Abdominal Pain | FAERS: 64 Canada Vigilance: 14 | Canada Vigilance SIDER US FAERS | |
| 54 | Inappropriate schedule of drug administration | FAERS: 64 | US FAERS | |
| 55 | Chills | FAERS: 63 Canada Vigilance: 17 | Canada Vigilance SIDER US FAERS | |
| 56 | Bronchitis | FAERS: 61 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 57 | Syncope | FAERS: 61 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 58 | Bone pain | FAERS: 60 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 59 | Lymphocytosis | FAERS: 60 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 60 | Pericardial effusion | FAERS: 60 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 61 | Product dose omission | FAERS: 59 Canada Vigilance: 44 | Canada Vigilance US FAERS | |
| 62 | Dry skin | FAERS: 57 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 63 | Cellulitis | FAERS: 56 Canada Vigilance: 22 | Canada Vigilance US FAERS | |
| 64 | Memory impairment | FAERS: 55 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 65 | Respiratory Failure | FAERS: 53 | US FAERS | |
| 66 | Somnolence | FAERS: 51 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 67 | White blood cell count abnormal | FAERS: 51 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 68 | Blood urine present | FAERS: 50 Canada Vigilance: 15 | Canada Vigilance US FAERS | |
| 69 | Cardiac Arrest | FAERS: 50 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Febrile Neutropenia | FAERS: 50 | US FAERS | |
| 71 | Thrombosis | FAERS: 48 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 72 | Cystitis | FAERS: 45 Canada Vigilance: 23 | Canada Vigilance US FAERS | |
| 73 | Erythema | FAERS: 45 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 74 | General physical health deterioration | FAERS: 45 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 75 | Lymphocyte count increased | FAERS: 45 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 76 | Night sweats | FAERS: 45 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 77 | Acute kidney injury | FAERS: 44 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 78 | Productive Cough | FAERS: 44 Canada Vigilance: 17 | Canada Vigilance US FAERS | |
| 79 | Hypersensitivity | FAERS: 43 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 80 | Palpitations | FAERS: 43 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 81 | Pancytopenia | FAERS: 43 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 82 | Neutrophil count decreased | FAERS: 42 Canada Vigilance: 21 | Canada Vigilance US FAERS | |
| 83 | Oropharyngeal pain | FAERS: 42 Canada Vigilance: 17 | Canada Vigilance SIDER US FAERS | |
| 84 | Leukocytosis | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 85 | Musculoskeletal Pain | FAERS: 40 Canada Vigilance: 10 | Canada Vigilance SIDER US FAERS | |
| 86 | Cataract | FAERS: 39 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 87 | Septic Shock | FAERS: 39 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 88 | Basal cell carcinoma | FAERS: 38 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 89 | Arthritis | FAERS: 36 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 90 | Depressed mood | FAERS: 36 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 91 | Skin Ulcer | FAERS: 36 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 92 | Rash erythematous | FAERS: 35 Canada Vigilance: 17 | Canada Vigilance US FAERS | |
| 93 | Urticaria | FAERS: 35 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 94 | Blood creatinine increased | FAERS: 33 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 95 | Ecchymosis | FAERS: 33 | US FAERS | |
| 96 | Wrong technique in product usage process | FAERS: 33 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 97 | Musculoskeletal stiffness | FAERS: 32 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 98 | Gout | FAERS: 31 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 99 | Splenomegaly | FAERS: 31 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 100 | Blood glucose increased | FAERS: 30 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 101 | Flatulence | FAERS: 30 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 102 | Inflammation | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 103 | Amnesia | FAERS: 29 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 104 | Clostridium difficile infection | FAERS: 29 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 105 | Hernia | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 106 | Lower respiratory tract infection | FAERS: 29 Canada Vigilance: 29 | Canada Vigilance US FAERS | |
| 107 | Platelet count abnormal | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 108 | Swelling | FAERS: 29 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 109 | Urinary Retention | FAERS: 29 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 110 | Acne | FAERS: 28 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 111 | Deafness | FAERS: 28 | US FAERS | |
| 112 | MYELODYSPLASTIC SYNDROME | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 113 | Nephrolithiasis | FAERS: 28 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 114 | Tremor | FAERS: 28 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 115 | Blood blister | FAERS: 27 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 116 | Colitis | FAERS: 27 | US FAERS | |
| 117 | Dysphonia | FAERS: 27 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 118 | Dysuria | FAERS: 27 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 119 | Inappropriate schedule of product administration | FAERS: 27 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 120 | Anxiety | FAERS: 26 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 121 | Cytopenia | FAERS: 26 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 122 | Mantle cell lymphoma | FAERS: 26 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 123 | Sudden death | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 124 | Neck Pain | FAERS: 25 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 125 | Richter's syndrome | FAERS: 25 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 126 | Visual Impairment | FAERS: 25 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 127 | Blood potassium decreased | FAERS: 24 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 128 | Deep Vein Thrombosis | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 129 | Toxicity to various agents | FAERS: 24 | US FAERS | |
| 130 | Arthropod bite | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 131 | Atrial Flutter | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 132 | Bradycardia | FAERS: 23 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 133 | Feeling Cold | FAERS: 23 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 134 | Pulmonary Embolism | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 135 | Vertigo | FAERS: 23 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 136 | Dysgeusia | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 137 | Tachycardia | FAERS: 22 | US FAERS | |
| 138 | Blindness | FAERS: 21 | US FAERS | |
| 139 | Blood iron decreased | FAERS: 21 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 140 | Blood sodium decreased | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 141 | Chest discomfort | FAERS: 21 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 142 | Extra dose administered | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 143 | Oral pain | FAERS: 21 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 144 | Squamous cell carcinoma | FAERS: 21 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 145 | Laceration | FAERS: 20 | SIDER US FAERS | |
| 146 | Uveitis | FAERS: 20 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 147 | Arthropathy | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 148 | Dementia | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 149 | Lethargy | FAERS: 19 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 150 | Nodule | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 151 | Pericarditis | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 152 | Blood glucose decreased | FAERS: 18 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 153 | Lymphocyte count decreased | FAERS: 18 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 154 | Lymphoma | FAERS: 18 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 155 | Mental status changes | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 156 | Product use complaint | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 157 | Asthma | FAERS: 17 | US FAERS | |
| 158 | Blood potassium increased | FAERS: 17 | US FAERS | |
| 159 | Burning sensation | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 160 | Hypoxia | FAERS: 17 | US FAERS | |
| 161 | Immune thrombocytopenic purpura | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 162 | Pancreatitis | FAERS: 17 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 163 | Panniculitis | FAERS: 17 | US FAERS | |
| 164 | Poor quality sleep | FAERS: 17 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 165 | Purpura | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 166 | Therapeutic response unexpected | FAERS: 17 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 167 | Ascites | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 168 | Ejection Fraction Decreased | FAERS: 16 | US FAERS | |
| 169 | Overdose | FAERS: 16 | US FAERS | |
| 170 | Ventricular Fibrillation | FAERS: 16 | US FAERS | |
| 171 | Acute respiratory failure | FAERS: 15 | US FAERS | |
| 172 | Chromaturia | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 173 | Diverticulitis | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 174 | Hypophagia | FAERS: 15 | US FAERS | |
| 175 | Ventricular arrhythmia | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 176 | Angina Pectoris | FAERS: 14 | US FAERS | |
| 177 | Bronchopulmonary Aspergillosis | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 178 | Prescribed underdose | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 179 | Pulmonary Fibrosis | FAERS: 14 | US FAERS | |
| 180 | Transaminases increased | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 181 | Alanine Aminotransferase Increased | FAERS: 13 | US FAERS | |
| 182 | Bacterial sepsis | FAERS: 13 | US FAERS | |
| 183 | Diabetes Mellitus | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 184 | Intestinal Obstruction | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 185 | Joint injury | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 186 | Leukopenia | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 187 | Osteomyelitis | FAERS: 13 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 188 | Splenic Rupture | FAERS: 13 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 189 | Accidental overdose | FAERS: 12 | US FAERS | |
| 190 | Acute myocardial infarction | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 191 | Aspartate Aminotransferase Increased | FAERS: 12 | US FAERS | |
| 192 | Blood immunoglobulin G decreased | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 193 | Blood immunoglobulin M increased | FAERS: 12 | US FAERS | |
| 194 | Clostridium difficile colitis | FAERS: 12 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 195 | Delirium | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 196 | Drug resistance | FAERS: 12 | US FAERS | |
| 197 | Epilepsy | FAERS: 12 | US FAERS | |
| 198 | Gait inability | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 199 | Gastritis | FAERS: 12 | US FAERS | |
| 200 | Pneumothorax | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 201 | Squamous cell carcinoma of skin | FAERS: 12 | US FAERS | |
| 202 | Supraventricular tachycardia | FAERS: 12 | US FAERS | |
| 203 | Tooth Extraction | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 204 | Aphasia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 205 | Flushing | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 206 | Limb discomfort | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 207 | Osteoporosis | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 208 | Pleurisy | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 209 | Pulmonary thrombosis | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 210 | Stevens-Johnson Syndrome | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 211 | Throat irritation | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 212 | Ulcer | FAERS: 11 | US FAERS | |
| 213 | Urinary tract obstruction | FAERS: 11 | US FAERS | |
| 214 | Wheezing | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 215 | Blood immunoglobulin M decreased | FAERS: 10 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 216 | Cholelithiasis | FAERS: 10 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 217 | Conjunctivitis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 218 | Discomfort | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 219 | Disorientation | FAERS: 10 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 220 | Eye irritation | FAERS: 10 | US FAERS | |
| 221 | Failure to Thrive | FAERS: 10 | US FAERS | |
| 222 | Hypersomnia | FAERS: 10 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 223 | Polyneuropathy | FAERS: 10 | US FAERS | |
| 224 | Psoriasis | FAERS: 10 | US FAERS | |
| 225 | Scab | FAERS: 10 | US FAERS | |
| 226 | Skin laceration | FAERS: 10 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 227 | Skin reaction | FAERS: 10 | US FAERS | |
| 228 | Splenic Infarction | FAERS: 10 | US FAERS | |
| 229 | Stress | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 230 | Unevaluable event | FAERS: 10 | US FAERS | |
| 231 | Urinary Incontinence | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 232 | Biopsy | FAERS: 9 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 233 | Blood alkaline phosphatase increased | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 234 | Cardiac Tamponade | FAERS: 9 | US FAERS | |
| 235 | Cardiomegaly | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 236 | Facial paralysis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 237 | Haematotoxicity | FAERS: 9 | US FAERS | |
| 238 | Immunosuppression | FAERS: 9 | US FAERS | |
| 239 | Malignant neoplasm progression | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 240 | Muscle strain | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 241 | Neuralgia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 242 | Product difficult to swallow | FAERS: 9 | US FAERS | |
| 243 | Pyoderma Gangrenosum | FAERS: 9 | US FAERS | |
| 244 | Sciatica | FAERS: 9 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 245 | Tinnitus | FAERS: 9 | US FAERS | |
| 246 | furuncle | FAERS: 9 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 247 | jaundice | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 248 | Appendicitis | FAERS: 8 | US FAERS | |
| 249 | Bone lesion | FAERS: 8 | US FAERS | |
| 250 | Cerebral aspergillosis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 251 | Cholecystitis | FAERS: 8 | US FAERS | |
| 252 | Drug effect incomplete | FAERS: 8 | US FAERS | |
| 253 | Ear discomfort | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 254 | Eczema | FAERS: 8 | US FAERS | |
| 255 | Erythema Nodosum | FAERS: 8 | US FAERS | |
| 256 | Gastrointestinal toxicity | FAERS: 8 | US FAERS | |
| 257 | Hepatomegaly | FAERS: 8 | US FAERS | |
| 258 | Intentional product use issue | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 259 | Macular degeneration | FAERS: 8 | US FAERS | |
| 260 | Meningitis | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 261 | Pain of skin | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 262 | Product physical issue | FAERS: 8 | US FAERS | |
| 263 | Renal pain | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 264 | Respiratory distress | FAERS: 8 | US FAERS | |
| 265 | Stem cell transplant | FAERS: 8 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 266 | Synovial Cyst | FAERS: 8 | US FAERS | |
| 267 | Wound Infection | FAERS: 8 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 268 | Abasia | FAERS: 7 | US FAERS | |
| 269 | Abscess | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 270 | Activities of daily living impaired | FAERS: 7 | US FAERS | |
| 271 | Atrioventricular Block | FAERS: 7 | US FAERS | |
| 272 | Blood lactate dehydrogenase increased | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 273 | Brain Abscess | FAERS: 7 | US FAERS | |
| 274 | Cardiotoxicity | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 275 | Cheilitis | FAERS: 7 | US FAERS | |
| 276 | Diplopia | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 277 | Drug ineffective for unapproved indication | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 278 | Electrolyte imbalance | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 279 | Escherichia infection | FAERS: 7 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 280 | Fluid overload | FAERS: 7 | US FAERS | |
| 281 | Hepatotoxicity | FAERS: 7 | US FAERS | |
| 282 | Hypothyroidism | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 283 | Incontinence | FAERS: 7 | US FAERS | |
| 284 | Laryngitis | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 285 | Malnutrition | FAERS: 7 | SIDER US FAERS | |
| 286 | Menorrhagia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 287 | Neutrophil count abnormal | FAERS: 7 | US FAERS | |
| 288 | Platelet aggregation abnormal | FAERS: 7 | US FAERS | |
| 289 | Post procedural complication | FAERS: 7 | US FAERS | |
| 290 | Post procedural infection | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 291 | Pulmonary congestion | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 292 | Renal mass | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 293 | Skin toxicity | FAERS: 7 | US FAERS | |
| 294 | Therapy non-responder | FAERS: 7 | US FAERS | |
| 295 | Tooth Loss | FAERS: 7 | US FAERS | |
| 296 | Toothache | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 297 | Tumour haemorrhage | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 298 | Upper-airway cough syndrome | FAERS: 7 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 299 | Vascular rupture | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 300 | nervous system disorder | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 301 | Ageusia | FAERS: 6 | US FAERS | |
| 302 | Back disorder | FAERS: 6 | US FAERS | |
| 303 | Cardiac Flutter | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 304 | Central Nervous System Infection | FAERS: 6 | US FAERS | |
| 305 | Central nervous system lesion | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 306 | Choking | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 307 | Completed Suicide | FAERS: 6 | US FAERS | |
| 308 | Coronary Artery Disease | FAERS: 6 | US FAERS | |
| 309 | Dermatitis acneiform | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 310 | Dermatitis | FAERS: 6 | SIDER US FAERS | |
| 311 | Diffuse Large B-Cell Lymphoma | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 312 | Drug administered to patient of inappropriate age | FAERS: 6 | US FAERS | |
| 313 | Dysarthria | FAERS: 6 | US FAERS | |
| 314 | Emotional disorder | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 315 | Encephalitis | FAERS: 6 | US FAERS | |
| 316 | Eructation | FAERS: 6 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 317 | Eye pain | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 318 | Frustration tolerance decreased | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 319 | Gangrene | FAERS: 6 | US FAERS | |
| 320 | Glaucoma | FAERS: 6 | US FAERS | |
| 321 | Head discomfort | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 322 | Hepatitis | FAERS: 6 | US FAERS | |
| 323 | Hip surgery | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 324 | Initial insomnia | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 325 | Intentional product misuse | FAERS: 6 | US FAERS | |
| 326 | Intestinal Perforation | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 327 | Iritis | FAERS: 6 | US FAERS | |
| 328 | Limb injury | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 329 | Lip swelling | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 330 | Mantle cell lymphoma recurrent | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 331 | Micrographic skin surgery | FAERS: 6 | US FAERS | |
| 332 | Musculoskeletal discomfort | FAERS: 6 | SIDER US FAERS | |
| 333 | Nocturia | FAERS: 6 | US FAERS | |
| 334 | Noninfective gingivitis | FAERS: 6 | US FAERS | |
| 335 | Onychomycosis | FAERS: 6 | US FAERS | |
| 336 | Oral candidiasis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 337 | Otitis Media | FAERS: 6 | US FAERS | |
| 338 | Pharyngitis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 339 | Presyncope | FAERS: 6 | US FAERS | |
| 340 | Respiratory tract congestion | FAERS: 6 | US FAERS | |
| 341 | Sunburn | FAERS: 6 | US FAERS | |
| 342 | Unresponsive to stimuli | FAERS: 6 | US FAERS | |
| 343 | Viral upper respiratory tract infection | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 344 | skin abrasion | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 345 | Abdominal mass | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 346 | Acute Coronary Syndrome | FAERS: 5 | US FAERS | |
| 347 | Angioedema | FAERS: 5 | US FAERS | |
| 348 | Aortic Aneurysm | FAERS: 5 | US FAERS | |
| 349 | Atypical pneumonia | FAERS: 5 | US FAERS | |
| 350 | Benign Prostatic Hyperplasia | FAERS: 5 | US FAERS | |
| 351 | Blepharitis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 352 | Blood glucose abnormal | FAERS: 5 | US FAERS | |
| 353 | Blood magnesium decreased | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 354 | Blood potassium abnormal | FAERS: 5 | US FAERS | |
| 355 | Blood pressure fluctuation | FAERS: 5 | US FAERS | |
| 356 | Bronchiectasis | FAERS: 5 | US FAERS | |
| 357 | Cachexia | FAERS: 5 | US FAERS | |
| 358 | Cyst | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 359 | Decreased immune responsiveness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 360 | Disease complication | FAERS: 5 | US FAERS | |
| 361 | Drug prescribing error | FAERS: 5 | US FAERS | |
| 362 | Expired product administered | FAERS: 5 | US FAERS | |
| 363 | Full blood count decreased | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 364 | Gastric ulcer | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 365 | Gastroenteritis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 366 | Gastrointestinal infection | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 367 | Hepatitis B | FAERS: 5 | US FAERS | |
| 368 | Hydronephrosis | FAERS: 5 | US FAERS | |
| 369 | Hypertensive crisis | FAERS: 5 | US FAERS | |
| 370 | Hypokinesia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 371 | Limb operation | FAERS: 5 | US FAERS | |
| 372 | Lipase increased | FAERS: 5 | US FAERS | |
| 373 | Lymphopenia | FAERS: 5 | US FAERS | |
| 374 | Medical procedure | FAERS: 5 | US FAERS | |
| 375 | Nervousness | FAERS: 5 | US FAERS | |
| 376 | Onychalgia | FAERS: 5 | US FAERS | |
| 377 | Pallor | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 378 | Pancreatic carcinoma | FAERS: 5 | US FAERS | |
| 379 | Precancerous skin lesion | FAERS: 5 | US FAERS | |
| 380 | Product quality issue | FAERS: 5 | US FAERS | |
| 381 | Retinal Vein Occlusion | FAERS: 5 | US FAERS | |
| 382 | Rhinitis | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 383 | Skin irritation | FAERS: 5 | US FAERS | |
| 384 | Skin necrosis | FAERS: 5 | US FAERS | |
| 385 | Sneezing | FAERS: 5 | US FAERS | |
| 386 | Subcutaneous Abscess | FAERS: 5 | US FAERS | |
| 387 | Tachyarrhythmia | FAERS: 5 | US FAERS | |
| 388 | Thermal burn | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 389 | Thirst | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 390 | Thrombocytosis | FAERS: 5 | US FAERS | |
| 391 | Tonsillitis | FAERS: 5 | US FAERS | |
| 392 | Vasculitis | FAERS: 5 | US FAERS | |
| 393 | Actinic keratosis | FAERS: 4 | US FAERS | |
| 394 | Adenocarcinoma | FAERS: 4 | US FAERS | |
| 395 | Agitation | FAERS: 4 | US FAERS | |
| 396 | Aneurysm | FAERS: 4 | US FAERS | |
| 397 | Animal bite | FAERS: 4 | US FAERS | |
| 398 | Ankle Fracture | FAERS: 4 | US FAERS | |
| 399 | Aphonia | FAERS: 4 | US FAERS | |
| 400 | Aspergillus test positive | FAERS: 4 | US FAERS | |
| 401 | Atelectasis | FAERS: 4 | US FAERS | |
| 402 | Bedridden | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 403 | Blood bilirubin abnormal | FAERS: 4 | US FAERS | |
| 404 | Blood immunoglobulin A decreased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 405 | Blood sodium increased | FAERS: 4 | US FAERS | |
| 406 | Bowel movement irregularity | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 407 | Cardiac dysfunction | FAERS: 4 | US FAERS | |
| 408 | Complication associated with device | FAERS: 4 | US FAERS | |
| 409 | Crying | FAERS: 4 | US FAERS | |
| 410 | Dental caries | FAERS: 4 | US FAERS | |
| 411 | Dysgraphia | FAERS: 4 | US FAERS | |
| 412 | Endocarditis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 413 | Exposure via body fluid | FAERS: 4 | US FAERS | |
| 414 | Eye Infection | FAERS: 4 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 415 | Flank Pain | FAERS: 4 | US FAERS | |
| 416 | Food Poisoning | FAERS: 4 | US FAERS | |
| 417 | Fracture | FAERS: 4 | US FAERS | |
| 418 | Full blood count abnormal | FAERS: 4 | US FAERS | |
| 419 | Gingival Recession | FAERS: 4 | US FAERS | |
| 420 | Histiocytosis haematophagic | FAERS: 4 | US FAERS | |
| 421 | Hydrocephalus | FAERS: 4 | US FAERS | |
| 422 | Hyperleukocytosis | FAERS: 4 | US FAERS | |
| 423 | Ileus | FAERS: 4 | US FAERS | |
| 424 | Immunoglobulins abnormal | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 425 | Incoherent | FAERS: 4 | US FAERS | |
| 426 | Infarction | FAERS: 4 | US FAERS | |
| 427 | Irritable Bowel Syndrome | FAERS: 4 | US FAERS | |
| 428 | Joint stiffness | FAERS: 4 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 429 | Limb mass | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 430 | Lymphocytic infiltration | FAERS: 4 | US FAERS | |
| 431 | Mechanical ventilation | FAERS: 4 | US FAERS | |
| 432 | Mental impairment | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 433 | Middle insomnia | FAERS: 4 | US FAERS | |
| 434 | Mood swings | FAERS: 4 | US FAERS | |
| 435 | Muscle tightness | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 436 | Myocarditis | FAERS: 4 | US FAERS | |
| 437 | Necrosis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 438 | Occult blood positive | FAERS: 4 | US FAERS | |
| 439 | Optic Neuritis | FAERS: 4 | US FAERS | |
| 440 | Oral mucosal erythema | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 441 | Paranoia | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 442 | Pleuritic pain | FAERS: 4 | US FAERS | |
| 443 | Post procedural swelling | FAERS: 4 | US FAERS | |
| 444 | Product blister packaging issue | FAERS: 4 | US FAERS | |
| 445 | Pulmonary Hypertension | FAERS: 4 | US FAERS | |
| 446 | Respiratory tract infection fungal | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 447 | Restless Legs Syndrome | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 448 | Rhabdomyolysis | FAERS: 4 | US FAERS | |
| 449 | Rhinovirus infection | FAERS: 4 | US FAERS | |
| 450 | Right ventricular failure | FAERS: 4 | US FAERS | |
| 451 | Rosacea | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 452 | Spinal column stenosis | FAERS: 4 | US FAERS | |
| 453 | Squamous cell carcinoma of lung | FAERS: 4 | US FAERS | |
| 454 | Sudden Cardiac Death | FAERS: 4 | US FAERS | |
| 455 | Tuberculosis | FAERS: 4 | US FAERS | |
| 456 | Walking aid user | FAERS: 4 | US FAERS | |
| 457 | Abdominal Infection | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 458 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 459 | Acute sinusitis | FAERS: 3 | US FAERS | |
| 460 | Amyloidosis | FAERS: 3 | US FAERS | |
| 461 | Anorectal discomfort | FAERS: 3 | US FAERS | |
| 462 | Apathy | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 463 | Apparent death | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 464 | Arteriosclerosis | FAERS: 3 | US FAERS | |
| 465 | Balanoposthitis | FAERS: 3 | US FAERS | |
| 466 | Bladder Neoplasm | FAERS: 3 | US FAERS | |
| 467 | Blood calcium abnormal | FAERS: 3 | US FAERS | |
| 468 | Blood cholesterol increased | FAERS: 3 | US FAERS | |
| 469 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 470 | Blood immunoglobulin M abnormal | FAERS: 3 | US FAERS | |
| 471 | Bone abscess | FAERS: 3 | US FAERS | |
| 472 | Bowen's Disease | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 473 | Cerebral Infarction | FAERS: 3 | US FAERS | |
| 474 | Choking sensation | FAERS: 3 | US FAERS | |
| 475 | Cholestasis | FAERS: 3 | US FAERS | |
| 476 | Chylothorax | FAERS: 3 | US FAERS | |
| 477 | Dacryostenosis acquired | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 478 | Depressed Level of Consciousness | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 479 | Drug Tolerance | FAERS: 3 | US FAERS | |
| 480 | Drug administration error | FAERS: 3 | US FAERS | |
| 481 | Epicondylitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 482 | Erectile dysfunction | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 483 | Erysipelas | FAERS: 3 | US FAERS | |
| 484 | Erythema Multiforme | FAERS: 3 | US FAERS | |
| 485 | Exposure via partner | FAERS: 3 | US FAERS | |
| 486 | Gastric infection | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 487 | Gastrointestinal inflammation | FAERS: 3 | US FAERS | |
| 488 | Glossitis | FAERS: 3 | US FAERS | |
| 489 | Hemiparesis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 490 | Hepatic necrosis | FAERS: 3 | US FAERS | |
| 491 | Hepatitis C | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 492 | Hunger | FAERS: 3 | US FAERS | |
| 493 | Hyperviscosity syndrome | FAERS: 3 | US FAERS | |
| 494 | Impaired gastric emptying | FAERS: 3 | US FAERS | |
| 495 | Infected bite | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 496 | Leukoencephalopathy | FAERS: 3 | US FAERS | |
| 497 | Listeriosis | FAERS: 3 | US FAERS | |
| 498 | Loss of personal independence in daily activities | FAERS: 3 | US FAERS | |
| 499 | Lymphadenitis | FAERS: 3 | US FAERS | |
| 500 | Meningioma | FAERS: 3 | US FAERS | |
| 501 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 502 | Monoplegia | FAERS: 3 | US FAERS | |
| 503 | Mucormycosis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 504 | Musculoskeletal chest pain | FAERS: 3 | US FAERS | |
| 505 | Mydriasis | FAERS: 3 | US FAERS | |
| 506 | Myelitis | FAERS: 3 | US FAERS | |
| 507 | Myelofibrosis | FAERS: 3 | US FAERS | |
| 508 | Nail bed infection | FAERS: 3 | US FAERS | |
| 509 | Nail bed tenderness | FAERS: 3 | US FAERS | |
| 510 | No adverse event | FAERS: 3 | US FAERS | |
| 511 | Non-cardiac chest pain | FAERS: 3 | US FAERS | |
| 512 | Nonspecific reaction | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 513 | Obstruction | FAERS: 3 | US FAERS | |
| 514 | Oropharyngeal spasm | FAERS: 3 | US FAERS | |
| 515 | Osteopenia | FAERS: 3 | US FAERS | |
| 516 | Paranasal sinus hypersecretion | FAERS: 3 | US FAERS | |
| 517 | Peripheral venous disease | FAERS: 3 | US FAERS | |
| 518 | Personality Change | FAERS: 3 | US FAERS | |
| 519 | Photophobia | FAERS: 3 | US FAERS | |
| 520 | Platelet dysfunction | FAERS: 3 | US FAERS | |
| 521 | Poor peripheral circulation | FAERS: 3 | US FAERS | |
| 522 | Portal Hypertension | FAERS: 3 | US FAERS | |
| 523 | Post procedural contusion | FAERS: 3 | US FAERS | |
| 524 | Post procedural inflammation | FAERS: 3 | US FAERS | |
| 525 | Procedural complication | FAERS: 3 | US FAERS | |
| 526 | Product packaging quantity issue | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 527 | Pseudomonal sepsis | FAERS: 3 | US FAERS | |
| 528 | Pulmonary necrosis | FAERS: 3 | US FAERS | |
| 529 | Quality of life decreased | FAERS: 3 | US FAERS | |
| 530 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 531 | Retching | FAERS: 3 | US FAERS | |
| 532 | Retinal Detachment | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 533 | Scleroderma | FAERS: 3 | US FAERS | |
| 534 | Shock | FAERS: 3 | US FAERS | |
| 535 | Sinus headache | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 536 | Sinus operation | FAERS: 3 | US FAERS | |
| 537 | Sinus pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 538 | Skin Induration | FAERS: 3 | US FAERS | |
| 539 | Skin Papilloma | FAERS: 3 | US FAERS | |
| 540 | Splenic neoplasm malignancy unspecified | FAERS: 3 | US FAERS | |
| 541 | Temperature intolerance | FAERS: 3 | US FAERS | |
| 542 | Tenosynovitis | FAERS: 3 | US FAERS | |
| 543 | Terminal state | FAERS: 3 | US FAERS | |
| 544 | Therapeutic product ineffective | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 545 | Therapy cessation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 546 | Thrombotic stroke | FAERS: 3 | US FAERS | |
| 547 | Tongue discomfort | FAERS: 3 | US FAERS | |
| 548 | Tooth Infection | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 549 | Transfusion Reaction | FAERS: 3 | US FAERS | |
| 550 | Trigeminal Neuralgia | FAERS: 3 | US FAERS | |
| 551 | Urinary tract infection pseudomonal | FAERS: 3 | US FAERS | |
| 552 | VIIth nerve paralysis | FAERS: 3 | US FAERS | |
| 553 | Vaginal Discharge | FAERS: 3 | US FAERS | |
| 554 | Vertebroplasty | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 555 | Vitreous floaters | FAERS: 3 | US FAERS | |
| 556 | Vulvovaginal discomfort | FAERS: 3 | US FAERS | |
| 557 | Wound infection staphylococcal | FAERS: 3 | US FAERS | |
| 558 | colonoscopy | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 559 | Agranulocytosis | FAERS: 2 | US FAERS | |
| 560 | Allergy to arthropod bite | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 561 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 562 | Amylase increased | FAERS: 2 | US FAERS | |
| 563 | Anal Ulcer | FAERS: 2 | US FAERS | |
| 564 | Anal fistula infection | FAERS: 2 | US FAERS | |
| 565 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 566 | Anger | FAERS: 2 | US FAERS | |
| 567 | Animal scratch | FAERS: 2 | US FAERS | |
| 568 | Antibiotic therapy | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 569 | Anuria | FAERS: 2 | US FAERS | |
| 570 | Arteritis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 571 | Atrial tachycardia | FAERS: 2 | US FAERS | |
| 572 | Autoimmune neutropenia | FAERS: 2 | US FAERS | |
| 573 | Blood albumin abnormal | FAERS: 2 | US FAERS | |
| 574 | Blood albumin decreased | FAERS: 2 | US FAERS | |
| 575 | Blood carbon monoxide increased | FAERS: 2 | US FAERS | |
| 576 | Blood creatinine abnormal | FAERS: 2 | US FAERS | |
| 577 | Blood electrolytes abnormal | FAERS: 2 | US FAERS | |
| 578 | Blood glucose fluctuation | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 579 | Blood lactate dehydrogenase decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 580 | Blood thyroid stimulating hormone increased | FAERS: 2 | US FAERS | |
| 581 | Blood viscosity abnormal | FAERS: 2 | US FAERS | |
| 582 | Bursitis infective staphylococcal | FAERS: 2 | US FAERS | |
| 583 | Bursitis | FAERS: 2 | US FAERS | |
| 584 | Carpal Tunnel Syndrome | FAERS: 2 | US FAERS | |
| 585 | Catheter placement | FAERS: 2 | US FAERS | |
| 586 | Central venous catheter removal | FAERS: 2 | US FAERS | |
| 587 | Cerebral Thrombosis | FAERS: 2 | US FAERS | |
| 588 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 589 | Chemotherapy | FAERS: 2 | US FAERS | |
| 590 | Cholangitis | FAERS: 2 | US FAERS | |
| 591 | Cold sweat | FAERS: 2 | US FAERS | |
| 592 | Colectomy | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 593 | Compression fracture | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 594 | Consciousness fluctuating | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 595 | Contrast media allergy | FAERS: 2 | US FAERS | |
| 596 | Critical Illness | FAERS: 2 | US FAERS | |
| 597 | Deafness Neurosensory | FAERS: 2 | US FAERS | |
| 598 | Device occlusion | FAERS: 2 | US FAERS | |
| 599 | Device related sepsis | FAERS: 2 | US FAERS | |
| 600 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 601 | Disease recurrence | FAERS: 2 | US FAERS | |
| 602 | Disseminated Intravascular Coagulation | FAERS: 2 | US FAERS | |
| 603 | Diverticular perforation | FAERS: 2 | US FAERS | |
| 604 | Diverticulum | FAERS: 2 | US FAERS | |
| 605 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 606 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 607 | Dyschezia | FAERS: 2 | US FAERS | |
| 608 | Dysentery | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 609 | Dysphemia | FAERS: 2 | US FAERS | |
| 610 | Ear congestion | FAERS: 2 | US FAERS | |
| 611 | Eating disorder symptom | FAERS: 2 | US FAERS | |
| 612 | Embolic cerebral infarction | FAERS: 2 | US FAERS | |
| 613 | Embolism | FAERS: 2 | US FAERS | |
| 614 | Endotracheal intubation complication | FAERS: 2 | US FAERS | |
| 615 | Enteral Nutrition | FAERS: 2 | US FAERS | |
| 616 | Enteritis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 617 | Enterocolitis | FAERS: 2 | US FAERS | |
| 618 | Evans syndrome | FAERS: 2 | US FAERS | |
| 619 | Exfoliative rash | FAERS: 2 | US FAERS | |
| 620 | Eye inflammation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 621 | Eyelid margin crusting | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 622 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 623 | Folliculitis | FAERS: 2 | US FAERS | |
| 624 | Foreign body sensation in eyes | FAERS: 2 | US FAERS | |
| 625 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 626 | Gastric Bypass | FAERS: 2 | US FAERS | |
| 627 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 628 | Gastrointestinal erosion | FAERS: 2 | US FAERS | |
| 629 | Gastrointestinal motility disorder | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 630 | Gastrostomy | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 631 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 632 | Genital Herpes | FAERS: 2 | US FAERS | |
| 633 | Granulocyte count decreased | FAERS: 2 | US FAERS | |
| 634 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 635 | Hallucinations, mixed | FAERS: 2 | US FAERS | |
| 636 | Hepatitis B core antibody positive | FAERS: 2 | US FAERS | |
| 637 | Hepatitis E | FAERS: 2 | US FAERS | |
| 638 | Human anaplasmosis | FAERS: 2 | US FAERS | |
| 639 | Hyperkeratosis | FAERS: 2 | US FAERS | |
| 640 | Hyperphagia | FAERS: 2 | US FAERS | |
| 641 | Hyperthyroidism | FAERS: 2 | US FAERS | |
| 642 | Hypertransaminasaemia | FAERS: 2 | US FAERS | |
| 643 | Hysterectomy | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 644 | Idiopathic Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 645 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 646 | Infected cyst | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 647 | Infectious pleural effusion | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 648 | Infective glossitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 649 | Infrequent bowel movements | FAERS: 2 | US FAERS | |
| 650 | Infusion site erythema | FAERS: 2 | US FAERS | |
| 651 | Infusion site swelling | FAERS: 2 | US FAERS | |
| 652 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 653 | Iridocyclitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 654 | Iron deficiency | FAERS: 2 | US FAERS | |
| 655 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 656 | Lipoma | FAERS: 2 | US FAERS | |
| 657 | Lobar Pneumonia | FAERS: 2 | US FAERS | |
| 658 | Low density lipoprotein increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 659 | Lower respiratory tract infection fungal | FAERS: 2 | US FAERS | |
| 660 | Lung Abscess | FAERS: 2 | US FAERS | |
| 661 | Lung infection pseudomonal | FAERS: 2 | US FAERS | |
| 662 | Lymphocyte count abnormal | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 663 | Lymphoma transformation | FAERS: 2 | US FAERS | |
| 664 | Malabsorption | FAERS: 2 | US FAERS | |
| 665 | Mallory-Weiss Syndrome | FAERS: 2 | US FAERS | |
| 666 | Mastoid effusion | FAERS: 2 | US FAERS | |
| 667 | Mastoiditis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 668 | Medication Error | FAERS: 2 | US FAERS | |
| 669 | Megacolon | FAERS: 2 | US FAERS | |
| 670 | Meniscus injury | FAERS: 2 | US FAERS | |
| 671 | Metastases to muscle | FAERS: 2 | US FAERS | |
| 672 | Mouth swelling | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 673 | Muscle Fatigue | FAERS: 2 | US FAERS | |
| 674 | Myocardial necrosis marker increased | FAERS: 2 | US FAERS | |
| 675 | Nail Infection | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 676 | Neurocryptococcosis | FAERS: 2 | US FAERS | |
| 677 | Neutropenic sepsis | FAERS: 2 | US FAERS | |
| 678 | Neutrophilic dermatosis | FAERS: 2 | US FAERS | |
| 679 | Oral fungal infection | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 680 | Oral infection | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 681 | Oral mucosal eruption | FAERS: 2 | US FAERS | |
| 682 | Orchitis | FAERS: 2 | US FAERS | |
| 683 | Osteolysis | FAERS: 2 | US FAERS | |
| 684 | Palatal swelling | FAERS: 2 | US FAERS | |
| 685 | Palliative Care | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 686 | Paraparesis | FAERS: 2 | US FAERS | |
| 687 | Paraplegia | FAERS: 2 | US FAERS | |
| 688 | Paresis | FAERS: 2 | US FAERS | |
| 689 | Pathological fracture | FAERS: 2 | US FAERS | |
| 690 | Penile necrosis | FAERS: 2 | US FAERS | |
| 691 | Peptic Ulcer | FAERS: 2 | US FAERS | |
| 692 | Performance status decreased | FAERS: 2 | US FAERS | |
| 693 | Plasmapheresis | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 694 | Platelet Transfusion | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 695 | Pleuropericarditis | FAERS: 2 | US FAERS | |
| 696 | Pneumococcal sepsis | FAERS: 2 | US FAERS | |
| 697 | Post procedural cellulitis | FAERS: 2 | US FAERS | |
| 698 | Post procedural persistent drain fluid | FAERS: 2 | US FAERS | |
| 699 | Post procedural stroke | FAERS: 2 | US FAERS | |
| 700 | Posterior reversible encephalopathy syndrome | FAERS: 2 | US FAERS | |
| 701 | Pre-existing condition improved | FAERS: 2 | US FAERS | |
| 702 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 703 | Product availability issue | FAERS: 2 | US FAERS | |
| 704 | Product size issue | FAERS: 2 | US FAERS | |
| 705 | Product storage error | FAERS: 2 | US FAERS | |
| 706 | Product used for unknown indication | FAERS: 2 | US FAERS | |
| 707 | Protein total decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 708 | Protein total increased | FAERS: 2 | US FAERS | |
| 709 | Psychiatric symptom | FAERS: 2 | US FAERS | |
| 710 | Psychogenic seizure | FAERS: 2 | US FAERS | |
| 711 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 712 | Rebound effect | FAERS: 2 | US FAERS | |
| 713 | Renal cyst | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 714 | Renal tubular necrosis | FAERS: 2 | US FAERS | |
| 715 | Restlessness | FAERS: 2 | US FAERS | |
| 716 | Retinal Artery Occlusion | FAERS: 2 | US FAERS | |
| 717 | Rheumatoid Arthritis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 718 | Sarcoidosis | FAERS: 2 | US FAERS | |
| 719 | Sarcoma | FAERS: 2 | US FAERS | |
| 720 | Scedosporium infection | FAERS: 2 | US FAERS | |
| 721 | Scrotal Infection | FAERS: 2 | US FAERS | |
| 722 | Secretion discharge | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 723 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 724 | Sinus bradycardia | FAERS: 2 | US FAERS | |
| 725 | Skin graft contracture | FAERS: 2 | US FAERS | |
| 726 | Sluggishness | FAERS: 2 | US FAERS | |
| 727 | Splenectomy | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 728 | Starvation | FAERS: 2 | US FAERS | |
| 729 | Suicide attempt | FAERS: 2 | US FAERS | |
| 730 | Superinfection bacterial | FAERS: 2 | US FAERS | |
| 731 | Superinfection | FAERS: 2 | US FAERS | |
| 732 | Systemic Inflammatory Response Syndrome | FAERS: 2 | US FAERS | |
| 733 | Tension | FAERS: 2 | US FAERS | |
| 734 | Therapeutic procedure | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 735 | Therapy change | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 736 | Thyroid hormones decreased | FAERS: 2 | US FAERS | |
| 737 | Toe operation | FAERS: 2 | US FAERS | |
| 738 | Tongue blistering | FAERS: 2 | US FAERS | |
| 739 | Tracheostomy malfunction | FAERS: 2 | US FAERS | |
| 740 | Trichorrhexis | FAERS: 2 | US FAERS | |
| 741 | Troponin increased | FAERS: 2 | US FAERS | |
| 742 | Tympanic Membrane Perforation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 743 | Umbilical hernia | FAERS: 2 | US FAERS | |
| 744 | Urinary tract infection fungal | FAERS: 2 | US FAERS | |
| 745 | Urinary tract stoma complication | FAERS: 2 | US FAERS | |
| 746 | Urine cytology abnormal | FAERS: 2 | US FAERS | |
| 747 | Urine viscosity increased | FAERS: 2 | US FAERS | |
| 748 | Vascular occlusion | FAERS: 2 | US FAERS | |
| 749 | Vitreous Detachment | FAERS: 2 | US FAERS | |
| 750 | Vulvitis | FAERS: 2 | US FAERS | |
| 751 | Vulvovaginal pain | FAERS: 2 | US FAERS | |
| 752 | West Nile viral infection | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 753 | Wound abscess | FAERS: 2 | US FAERS | |
| 754 | treatment failure | FAERS: 2 | US FAERS | |
| 755 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 756 | Abdominal cavity drainage | FAERS: 1 | US FAERS | |
| 757 | Abdominal sepsis | FAERS: 1 | US FAERS | |
| 758 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 759 | Abscess fungal | FAERS: 1 | US FAERS | |
| 760 | Acanthamoeba Infection | FAERS: 1 | US FAERS | |
| 761 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 762 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 763 | Alcohol Intolerance | FAERS: 1 | US FAERS | |
| 764 | Alveolitis | FAERS: 1 | US FAERS | |
| 765 | Ammonia increased | FAERS: 1 | US FAERS | |
| 766 | Amputation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 767 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 768 | Anal Fissure | FAERS: 1 | US FAERS | |
| 769 | Anal Fistula | FAERS: 1 | US FAERS | |
| 770 | Anal abscess | FAERS: 1 | US FAERS | |
| 771 | Angle Closure Glaucoma | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 772 | Anorectal cellulitis | FAERS: 1 | US FAERS | |
| 773 | Anosmia | FAERS: 1 | US FAERS | |
| 774 | Aphagia | FAERS: 1 | US FAERS | |
| 775 | Application site pain | FAERS: 1 | US FAERS | |
| 776 | Artificial crown procedure | FAERS: 1 | US FAERS | |
| 777 | Aspergilloma | FAERS: 1 | US FAERS | |
| 778 | Asphyxia | FAERS: 1 | US FAERS | |
| 779 | Ataxia | FAERS: 1 | US FAERS | |
| 780 | Band neutrophil percentage increased | FAERS: 1 | US FAERS | |
| 781 | Benign neoplasm of thyroid gland | FAERS: 1 | US FAERS | |
| 782 | Biopsy bone marrow abnormal | FAERS: 1 | US FAERS | |
| 783 | Biopsy skin abnormal | FAERS: 1 | US FAERS | |
| 784 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 785 | Bladder cancer recurrent | FAERS: 1 | US FAERS | |
| 786 | Bladder pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 787 | Bladder prolapse | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 788 | Blister rupture | FAERS: 1 | US FAERS | |
| 789 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 790 | Blood creatine abnormal | FAERS: 1 | US FAERS | |
| 791 | Blood immunoglobulin G abnormal | FAERS: 1 | US FAERS | |
| 792 | Blood iron abnormal | FAERS: 1 | US FAERS | |
| 793 | Blood iron increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 794 | Blood parathyroid hormone abnormal | FAERS: 1 | US FAERS | |
| 795 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 796 | Blood urea increased | FAERS: 1 | US FAERS | |
| 797 | Blood viscosity decreased | FAERS: 1 | US FAERS | |
| 798 | Body Temperature | FAERS: 1 | US FAERS | |
| 799 | Bone density decreased | FAERS: 1 | US FAERS | |
| 800 | Bone marrow infiltration | FAERS: 1 | US FAERS | |
| 801 | Bone marrow necrosis | FAERS: 1 | US FAERS | |
| 802 | Bone marrow toxicity | FAERS: 1 | US FAERS | |
| 803 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 804 | Brain Contusion | FAERS: 1 | US FAERS | |
| 805 | Brain scan abnormal | FAERS: 1 | US FAERS | |
| 806 | Breast cancer stage II | FAERS: 1 | US FAERS | |
| 807 | Breast tenderness | FAERS: 1 | US FAERS | |
| 808 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 809 | Bronchospasm | FAERS: 1 | US FAERS | |
| 810 | C-reactive protein decreased | FAERS: 1 | US FAERS | |
| 811 | CD4/CD8 ratio increased | FAERS: 1 | US FAERS | |
| 812 | Campylobacter sepsis | FAERS: 1 | US FAERS | |
| 813 | Candida pneumonia | FAERS: 1 | US FAERS | |
| 814 | Capillary Fragility | FAERS: 1 | US FAERS | |
| 815 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 816 | Cardiac Death | FAERS: 1 | US FAERS | |
| 817 | Cardiac ablation | FAERS: 1 | US FAERS | |
| 818 | Cardiac valve vegetation | FAERS: 1 | US FAERS | |
| 819 | Cardiac ventricular thrombosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 820 | Carditis | FAERS: 1 | US FAERS | |
| 821 | Carotid Artery Thrombosis | FAERS: 1 | US FAERS | |
| 822 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 823 | Cataract operation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 824 | Catheter site cellulitis | FAERS: 1 | US FAERS | |
| 825 | Catheter site pain | FAERS: 1 | US FAERS | |
| 826 | Catheter site swelling | FAERS: 1 | US FAERS | |
| 827 | Catheter site ulcer | FAERS: 1 | US FAERS | |
| 828 | Cauda Equina Syndrome | FAERS: 1 | US FAERS | |
| 829 | Cell Death | FAERS: 1 | US FAERS | |
| 830 | Central nervous system mass | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 831 | Cerebral microhaemorrhage | FAERS: 1 | US FAERS | |
| 832 | Cervical dysplasia | FAERS: 1 | US FAERS | |
| 833 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 834 | Chorioretinitis | FAERS: 1 | US FAERS | |
| 835 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 836 | Chronic graft versus host disease in liver | FAERS: 1 | US FAERS | |
| 837 | Chronic sinusitis | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 838 | Coagulation factor VIII level decreased | FAERS: 1 | US FAERS | |
| 839 | Coagulation time shortened | FAERS: 1 | US FAERS | |
| 840 | Coating in mouth | FAERS: 1 | US FAERS | |
| 841 | Complication of device removal | FAERS: 1 | US FAERS | |
| 842 | Corneal exfoliation | FAERS: 1 | US FAERS | |
| 843 | Coxsackie virus test positive | FAERS: 1 | US FAERS | |
| 844 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 845 | Cutaneous lymphoma | FAERS: 1 | US FAERS | |
| 846 | Cyanosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 847 | Cystoscopy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 848 | Cytomegalovirus test positive | FAERS: 1 | US FAERS | |
| 849 | Cytomegalovirus test | FAERS: 1 | US FAERS | |
| 850 | Delayed sleep phase | FAERS: 1 | US FAERS | |
| 851 | Delirium febrile | FAERS: 1 | US FAERS | |
| 852 | Device dislocation | FAERS: 1 | US FAERS | |
| 853 | Device malfunction | FAERS: 1 | US FAERS | |
| 854 | Device related infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 855 | Dialysis device insertion | FAERS: 1 | US FAERS | |
| 856 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 857 | Drug Dependence | FAERS: 1 | US FAERS | |
| 858 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 859 | Drug screen positive | FAERS: 1 | US FAERS | |
| 860 | Drug withdrawal headache | FAERS: 1 | US FAERS | |
| 861 | Dysplasia | FAERS: 1 | US FAERS | |
| 862 | Dystonic tremor | FAERS: 1 | US FAERS | |
| 863 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 864 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 865 | Empyema | FAERS: 1 | US FAERS | |
| 866 | Endometrial adenocarcinoma | FAERS: 1 | US FAERS | |
| 867 | Endometrial thickening | FAERS: 1 | US FAERS | |
| 868 | Endophthalmitis | FAERS: 1 | US FAERS | |
| 869 | Enterobiasis | FAERS: 1 | US FAERS | |
| 870 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 871 | Enzyme level increased | FAERS: 1 | US FAERS | |
| 872 | Eosinophilia | FAERS: 1 | US FAERS | |
| 873 | Eosinophilic myocarditis | FAERS: 1 | US FAERS | |
| 874 | Epidermal necrosis | FAERS: 1 | US FAERS | |
| 875 | Epidermolysis | FAERS: 1 | US FAERS | |
| 876 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 877 | Erythema Induratum | FAERS: 1 | US FAERS | |
| 878 | Eye excision | FAERS: 1 | US FAERS | |
| 879 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 880 | Facial Pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 881 | Facial Paresis | FAERS: 1 | US FAERS | |
| 882 | Fasciitis | FAERS: 1 | US FAERS | |
| 883 | Fat necrosis | FAERS: 1 | US FAERS | |
| 884 | Feeling jittery | FAERS: 1 | US FAERS | |
| 885 | Fixed eruption | FAERS: 1 | US FAERS | |
| 886 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 887 | Food aversion | FAERS: 1 | US FAERS | |
| 888 | Food craving | FAERS: 1 | US FAERS | |
| 889 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 890 | Gastrectomy | FAERS: 1 | US FAERS | |
| 891 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 892 | Gastroduodenitis haemorrhagic | FAERS: 1 | US FAERS | |
| 893 | Gastrointestinal adenocarcinoma | FAERS: 1 | US FAERS | |
| 894 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 895 | Gastrointestinal mucosal disorder | FAERS: 1 | US FAERS | |
| 896 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 897 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 898 | Genital erythema | FAERS: 1 | US FAERS | |
| 899 | Genital pain | FAERS: 1 | US FAERS | |
| 900 | Genital rash | FAERS: 1 | US FAERS | |
| 901 | Gingival Atrophy | FAERS: 1 | US FAERS | |
| 902 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 903 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 904 | Glossectomy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 905 | Graft versus host disease in liver | FAERS: 1 | US FAERS | |
| 906 | Granulomatous dermatitis | FAERS: 1 | US FAERS | |
| 907 | Granulomatous liver disease | FAERS: 1 | US FAERS | |
| 908 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 909 | Hair injury | FAERS: 1 | US FAERS | |
| 910 | Haptoglobin Decreased | FAERS: 1 | US FAERS | |
| 911 | Head and neck cancer metastatic | FAERS: 1 | US FAERS | |
| 912 | Heart alternation | FAERS: 1 | US FAERS | |
| 913 | Hemiplegia | FAERS: 1 | US FAERS | |
| 914 | Hemiplegic migraine | FAERS: 1 | US FAERS | |
| 915 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 916 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 917 | Hepatitis A | FAERS: 1 | US FAERS | |
| 918 | Herpes zoster cutaneous disseminated | FAERS: 1 | US FAERS | |
| 919 | Histiocytic sarcoma | FAERS: 1 | US FAERS | |
| 920 | Hordeolum | FAERS: 1 | US FAERS | |
| 921 | Human chorionic gonadotropin increased | FAERS: 1 | US FAERS | |
| 922 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 923 | Hypermetabolism | FAERS: 1 | US FAERS | |
| 924 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 925 | Hypertensive heart disease | FAERS: 1 | US FAERS | |
| 926 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 927 | Hyperventilation | FAERS: 1 | US FAERS | |
| 928 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 929 | Hypothalamo-pituitary disorder | FAERS: 1 | US FAERS | |
| 930 | Immobile | FAERS: 1 | US FAERS | |
| 931 | Immune Reconstitution Inflammatory Syndrome | FAERS: 1 | US FAERS | |
| 932 | Immunoglobulin Therapy | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 933 | Immunology test abnormal | FAERS: 1 | US FAERS | |
| 934 | Impaired self-care | FAERS: 1 | US FAERS | |
| 935 | Impaired work ability | FAERS: 1 | US FAERS | |
| 936 | Impetigo | FAERS: 1 | US FAERS | |
| 937 | Incarcerated hernia | FAERS: 1 | US FAERS | |
| 938 | Incorrect dose administered by device | FAERS: 1 | US FAERS | |
| 939 | Incorrect product formulation administered | FAERS: 1 | US FAERS | |
| 940 | Incorrect route of product administration | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 941 | Increased viscosity of upper respiratory secretion | FAERS: 1 | US FAERS | |
| 942 | Infected fistula | FAERS: 1 | US FAERS | |
| 943 | Infectious colitis | FAERS: 1 | US FAERS | |
| 944 | Inflammatory pain | FAERS: 1 | US FAERS | |
| 945 | Infusion site infection | FAERS: 1 | US FAERS | |
| 946 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 947 | Inguinal mass | FAERS: 1 | US FAERS | |
| 948 | Injection site erythema | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 949 | Injection site infection | FAERS: 1 | US FAERS | |
| 950 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 951 | Intervertebral disc compression | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 952 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 953 | Intracranial mass | FAERS: 1 | US FAERS | |
| 954 | JC polyomavirus test positive | FAERS: 1 | US FAERS | |
| 955 | JC virus infection | FAERS: 1 | US FAERS | |
| 956 | JC virus test positive | FAERS: 1 | US FAERS | |
| 957 | Joint abscess | FAERS: 1 | US FAERS | |
| 958 | Joint warmth | FAERS: 1 | US FAERS | |
| 959 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 960 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 961 | Laser Therapy | FAERS: 1 | US FAERS | |
| 962 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 963 | Lithotripsy | FAERS: 1 | US FAERS | |
| 964 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 965 | Liver function test decreased | FAERS: 1 | US FAERS | |
| 966 | Localised intraabdominal fluid collection | FAERS: 1 | US FAERS | |
| 967 | Loose tooth | FAERS: 1 | US FAERS | |
| 968 | Lower respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 969 | Lung consolidation | FAERS: 1 | US FAERS | |
| 970 | Lymph node palpable | FAERS: 1 | US FAERS | |
| 971 | Lymphatic duct injury | FAERS: 1 | US FAERS | |
| 972 | Lymphocyte percentage abnormal | FAERS: 1 | US FAERS | |
| 973 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 974 | Macule | FAERS: 1 | US FAERS | |
| 975 | Malignant anorectal neoplasm | FAERS: 1 | US FAERS | |
| 976 | Manufacturing materials issue | FAERS: 1 | US FAERS | |
| 977 | Mastectomy | FAERS: 1 | US FAERS | |
| 978 | Mastitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 979 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 980 | Measles | FAERS: 1 | US FAERS | |
| 981 | Medical device site infection | FAERS: 1 | US FAERS | |
| 982 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 983 | Metastases to peripheral vascular system | FAERS: 1 | US FAERS | |
| 984 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 985 | Microvascular coronary artery disease | FAERS: 1 | US FAERS | |
| 986 | Mitral Valve Stenosis | FAERS: 1 | US FAERS | |
| 987 | Moaning | FAERS: 1 | US FAERS | |
| 988 | Monoclonal immunoglobulin present | FAERS: 1 | US FAERS | |
| 989 | Monocyte count decreased | FAERS: 1 | US FAERS | |
| 990 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 991 | Monocytosis | FAERS: 1 | US FAERS | |
| 992 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 993 | Multimorbidity | FAERS: 1 | US FAERS | |
| 994 | Multiple allergies | FAERS: 1 | US FAERS | |
| 995 | Muscle abscess | FAERS: 1 | US FAERS | |
| 996 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 997 | Mycobacterium test positive | FAERS: 1 | US FAERS | |
| 998 | Mycobacterium tuberculosis complex test positive | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 999 | Myeloblast present | FAERS: 1 | US FAERS | |
| 1000 | Myositis | FAERS: 1 | US FAERS | |
| 1001 | Nail cuticle fissure | FAERS: 1 | US FAERS | |
| 1002 | Nasal discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1003 | Nasal herpes | FAERS: 1 | US FAERS | |
| 1004 | Nephrectomy | FAERS: 1 | US FAERS | |
| 1005 | Nephritis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1006 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 1007 | Nerve Degeneration | FAERS: 1 | US FAERS | |
| 1008 | Nerve Root Compression | FAERS: 1 | US FAERS | |
| 1009 | Nerve injury | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1010 | Neurological decompensation | FAERS: 1 | US FAERS | |
| 1011 | Nodular rash | FAERS: 1 | US FAERS | |
| 1012 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 1013 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 1014 | Ocular icterus | FAERS: 1 | US FAERS | |
| 1015 | Ocular vascular disorder | FAERS: 1 | US FAERS | |
| 1016 | Onycholysis | FAERS: 1 | US FAERS | |
| 1017 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 1018 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 1019 | Oropharyngeal candidiasis | FAERS: 1 | US FAERS | |
| 1020 | Osteomyelitis fungal | FAERS: 1 | US FAERS | |
| 1021 | Otitis Externa | FAERS: 1 | US FAERS | |
| 1022 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 1023 | Panophthalmitis | FAERS: 1 | US FAERS | |
| 1024 | Paracentesis | FAERS: 1 | US FAERS | |
| 1025 | Paraneoplastic pemphigus | FAERS: 1 | US FAERS | |
| 1026 | Parasitic gastroenteritis | FAERS: 1 | US FAERS | |
| 1027 | Parkinsonian crisis | FAERS: 1 | US FAERS | |
| 1028 | Parotitis | FAERS: 1 | US FAERS | |
| 1029 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 1030 | Pelvic mass | FAERS: 1 | US FAERS | |
| 1031 | Pemphigus | FAERS: 1 | US FAERS | |
| 1032 | Penile Infection | FAERS: 1 | US FAERS | |
| 1033 | Peptic Ulcer Perforation | FAERS: 1 | US FAERS | |
| 1034 | Periarthritis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1035 | Perineal infection | FAERS: 1 | US FAERS | |
| 1036 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 1037 | Peripheral artery occlusion | FAERS: 1 | US FAERS | |
| 1038 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 1039 | Peritoneal perforation | FAERS: 1 | US FAERS | |
| 1040 | Phlebitis | FAERS: 1 | US FAERS | |
| 1041 | Plasmablastic lymphoma | FAERS: 1 | US FAERS | |
| 1042 | Pleural Infection | FAERS: 1 | US FAERS | |
| 1043 | Pleural infection bacterial | FAERS: 1 | US FAERS | |
| 1044 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 1045 | Pneumocephalus | FAERS: 1 | US FAERS | |
| 1046 | Polyarteritis Nodosa | FAERS: 1 | US FAERS | |
| 1047 | Polyarthritis | FAERS: 1 | US FAERS | |
| 1048 | Polydipsia | FAERS: 1 | US FAERS | |
| 1049 | Polyglandular disorder | FAERS: 1 | US FAERS | |
| 1050 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 1051 | Polyomavirus test positive | FAERS: 1 | US FAERS | |
| 1052 | Polyuria | FAERS: 1 | US FAERS | |
| 1053 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 1054 | Post procedural discharge | FAERS: 1 | US FAERS | |
| 1055 | Post-traumatic pain | FAERS: 1 | US FAERS | |
| 1056 | Postoperative adhesion | FAERS: 1 | US FAERS | |
| 1057 | Postoperative thrombosis | FAERS: 1 | US FAERS | |
| 1058 | Precancerous cells present | FAERS: 1 | US FAERS | |
| 1059 | Precancerous lesion excision | FAERS: 1 | US FAERS | |
| 1060 | Priapism | FAERS: 1 | US FAERS | |
| 1061 | Primary Myelofibrosis | FAERS: 1 | US FAERS | |
| 1062 | Procedural nausea | FAERS: 1 | US FAERS | |
| 1063 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 1064 | Product formulation issue | FAERS: 1 | US FAERS | |
| 1065 | Product label confusion | FAERS: 1 | US FAERS | |
| 1066 | Product leakage | FAERS: 1 | US FAERS | |
| 1067 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 1068 | Product packaging issue | FAERS: 1 | US FAERS | |
| 1069 | Prostatectomy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1070 | Prostatic specific antigen decreased | FAERS: 1 | US FAERS | |
| 1071 | Protein Deficiency | FAERS: 1 | US FAERS | |
| 1072 | Protein total abnormal | FAERS: 1 | US FAERS | |
| 1073 | Proteinuria | FAERS: 1 | US FAERS | |
| 1074 | Prurigo | FAERS: 1 | US FAERS | |
| 1075 | Pseudocyst | FAERS: 1 | US FAERS | |
| 1076 | Pseudohyperkalaemia | FAERS: 1 | US FAERS | |
| 1077 | Pseudolymphoma | FAERS: 1 | US FAERS | |
| 1078 | Psychiatric decompensation | FAERS: 1 | US FAERS | |
| 1079 | Pulmonary sepsis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1080 | Pulmonary toxicity | FAERS: 1 | US FAERS | |
| 1081 | Pulmonary vasculitis | FAERS: 1 | US FAERS | |
| 1082 | Rales | FAERS: 1 | US FAERS | |
| 1083 | Rectal Prolapse | FAERS: 1 | US FAERS | |
| 1084 | Rectal fissure | FAERS: 1 | US FAERS | |
| 1085 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 1086 | Red blood cell elliptocytes present | FAERS: 1 | US FAERS | |
| 1087 | Red blood cell morphology abnormal | FAERS: 1 | US FAERS | |
| 1088 | Refractory cancer | FAERS: 1 | US FAERS | |
| 1089 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 1090 | Renal Colic | FAERS: 1 | US FAERS | |
| 1091 | Renal vascular thrombosis | FAERS: 1 | US FAERS | |
| 1092 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 1093 | Respiratory fatigue | FAERS: 1 | US FAERS | |
| 1094 | Respiratory muscle weakness | FAERS: 1 | US FAERS | |
| 1095 | Respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 1096 | Retinal artery embolism | FAERS: 1 | US FAERS | |
| 1097 | Retinal scar | FAERS: 1 | US FAERS | |
| 1098 | Retinal vascular occlusion | FAERS: 1 | US FAERS | |
| 1099 | Retroperitoneal mass | FAERS: 1 | US FAERS | |
| 1100 | Rhonchi | FAERS: 1 | US FAERS | |
| 1101 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 1102 | Sarcoma of skin | FAERS: 1 | US FAERS | |
| 1103 | Sciatic Nerve Palsy | FAERS: 1 | US FAERS | |
| 1104 | Scleromalacia | FAERS: 1 | US FAERS | |
| 1105 | Selective eating disorder | FAERS: 1 | US FAERS | |
| 1106 | Semen viscosity decreased | FAERS: 1 | US FAERS | |
| 1107 | Sensation of blood flow | FAERS: 1 | US FAERS | |
| 1108 | Seroma | FAERS: 1 | US FAERS | |
| 1109 | Seronegative arthritis | FAERS: 1 | US FAERS | |
| 1110 | Sinonasal obstruction | FAERS: 1 | US FAERS | |
| 1111 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 1112 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 1113 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 1114 | Skin neoplasm excision | FAERS: 1 | US FAERS | |
| 1115 | Skin texture abnormal | FAERS: 1 | US FAERS | |
| 1116 | Skin tightness | FAERS: 1 | US FAERS | |
| 1117 | Sleep Talking | FAERS: 1 | US FAERS | |
| 1118 | Slow speech | FAERS: 1 | US FAERS | |
| 1119 | Soft Tissue Infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1120 | Somatic dysfunction | FAERS: 1 | US FAERS | |
| 1121 | Spermatic cord funiculitis | FAERS: 1 | US FAERS | |
| 1122 | Splenic necrosis | FAERS: 1 | US FAERS | |
| 1123 | Sputum culture positive | FAERS: 1 | US FAERS | |
| 1124 | Staphylococcal Scalded Skin Syndrome | FAERS: 1 | US FAERS | |
| 1125 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 1126 | Stasis dermatitis | FAERS: 1 | US FAERS | |
| 1127 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 1128 | Stenosis | FAERS: 1 | US FAERS | |
| 1129 | Streptococcal abscess | FAERS: 1 | US FAERS | |
| 1130 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 1131 | Swelling of eyelid | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1132 | Synovitis | FAERS: 1 | US FAERS | |
| 1133 | Systemic Scleroderma | FAERS: 1 | US FAERS | |
| 1134 | Systemic mycosis | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1135 | T-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 1136 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 1137 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 1138 | Tension Headache | FAERS: 1 | US FAERS | |
| 1139 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 1140 | Therapy partial responder | FAERS: 1 | US FAERS | |
| 1141 | Throat cancer | FAERS: 1 | US FAERS | |
| 1142 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 1143 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 1144 | Tinea cruris | FAERS: 1 | US FAERS | |
| 1145 | Tongue eruption | FAERS: 1 | US FAERS | |
| 1146 | Tongue erythema | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1147 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 1148 | Tooth repair | FAERS: 1 | US FAERS | |
| 1149 | Toxoplasmosis | FAERS: 1 | US FAERS | |
| 1150 | Transfusion related complication | FAERS: 1 | US FAERS | |
| 1151 | Transplant | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1152 | Transplantation complication | FAERS: 1 | US FAERS | |
| 1153 | Ureterolithiasis | FAERS: 1 | US FAERS | |
| 1154 | Urinary bladder polyp | FAERS: 1 | US FAERS | |
| 1155 | Urinary straining | FAERS: 1 | US FAERS | |
| 1156 | Urinary tract adhesions | FAERS: 1 | US FAERS | |
| 1157 | Urine flow decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1158 | Uterovaginal prolapse | FAERS: 1 | US FAERS | |
| 1159 | Vascular compression | FAERS: 1 | US FAERS | |
| 1160 | Vascular pain | FAERS: 1 | US FAERS | |
| 1161 | Vein collapse | FAERS: 1 | US FAERS | |
| 1162 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 1163 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 1164 | Vertebral lesion | FAERS: 1 | US FAERS | |
| 1165 | Viral pericarditis | FAERS: 1 | US FAERS | |
| 1166 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 1167 | Vulvovaginal human papilloma virus infection | FAERS: 1 | US FAERS | |
| 1168 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 1169 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 1170 | Vulvovaginal rash | FAERS: 1 | US FAERS | |
| 1171 | Zygomycosis | FAERS: 1 | US FAERS | |
| 1172 | effusion | FAERS: 1 | US FAERS | |
| 1173 | Abdominal rigidity | Canada Vigilance: 1 | Canada Vigilance | |
| 1174 | Air Embolism | Canada Vigilance: 1 | Canada Vigilance | |
| 1175 | Blood creatinine decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 1176 | Blood parathyroid hormone increased | Canada Vigilance: 1 | Canada Vigilance | |
| 1177 | Campylobacter infection | Canada Vigilance: 1 | Canada Vigilance | |
| 1178 | Cardiac Hypertrophy | Canada Vigilance: 1 | Canada Vigilance | |
| 1179 | Cardiac infection | Canada Vigilance: 1 | Canada Vigilance | |
| 1180 | Coccidioidomycosis | Canada Vigilance: 1 | Canada Vigilance | |
| 1181 | Dermatomyositis | Canada Vigilance: 1 | Canada Vigilance | |
| 1182 | Diabetic foot infection | Canada Vigilance: 1 | Canada Vigilance | |
| 1183 | Emotional distress | Canada Vigilance: 1 | Canada Vigilance | |
| 1184 | Endodontic procedure | Canada Vigilance: 1 | Canada Vigilance | |
| 1185 | Febrile infection | Canada Vigilance: 1 | Canada Vigilance | |
| 1186 | Gene Mutation | Canada Vigilance: 1 | Canada Vigilance | |
| 1187 | Gingival blister | Canada Vigilance: 1 | Canada Vigilance | |
| 1188 | Hepatic Infection | Canada Vigilance: 1 | Canada Vigilance | |
| 1189 | Hepatic cyst infection | Canada Vigilance: 1 | Canada Vigilance | |
| 1190 | Hyperacusis | Canada Vigilance: 1 | Canada Vigilance | |
| 1191 | Hypohidrosis | Canada Vigilance: 1 | Canada Vigilance | |
| 1192 | Infestation | SIDER | ||
| 1193 | Intestinal Pseudo-Obstruction | Canada Vigilance: 1 | Canada Vigilance | |
| 1194 | Labile blood pressure | Canada Vigilance: 1 | Canada Vigilance | |
| 1195 | Lip and/or oral cavity cancer | Canada Vigilance: 1 | Canada Vigilance | |
| 1196 | Lower respiratory tract infection bacterial | Canada Vigilance: 1 | Canada Vigilance | |
| 1197 | Lymphoproliferative Disorders | 23617325 | CTD | |
| 1198 | Mantle cell lymphoma refractory | Canada Vigilance: 1 | Canada Vigilance | |
| 1199 | Medical induction of coma | Canada Vigilance: 1 | Canada Vigilance | |
| 1200 | Metastases to stomach | Canada Vigilance: 1 | Canada Vigilance | |
| 1201 | Pelvic Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 1202 | Pharyngeal swelling | Canada Vigilance: 2 | Canada Vigilance | |
| 1203 | Plantar erythema | Canada Vigilance: 1 | Canada Vigilance | |
| 1204 | Post procedural constipation | Canada Vigilance: 1 | Canada Vigilance | |
| 1205 | Post procedural pneumonia | Canada Vigilance: 1 | Canada Vigilance | |
| 1206 | Product administration error | Canada Vigilance: 2 | Canada Vigilance | |
| 1207 | Product prescribing error | Canada Vigilance: 1 | Canada Vigilance | |
| 1208 | Regurgitation | Canada Vigilance: 1 | Canada Vigilance | |
| 1209 | Salivary gland pain | Canada Vigilance: 1 | Canada Vigilance | |
| 1210 | Therapeutic product effect decreased | Canada Vigilance: 2 | Canada Vigilance | |
| 1211 | Thoracic cavity drainage | Canada Vigilance: 1 | Canada Vigilance | |
| 1212 | Thyroid Neoplasm | Canada Vigilance: 1 | Canada Vigilance | |
| 1213 | Urine output increased | Canada Vigilance: 1 | Canada Vigilance | |
| 1214 | Wound Complication | Canada Vigilance: 1 | Canada Vigilance | |
| 1215 | prostatitis | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.