Citalopram
(WSEQXVZVJXJVFP-UHFFFAOYSA-N)
Structure
- SMILES
- N#Cc1ccc2c(c1)COC2(CCCN(C)C)c1ccc(cc1)F
- Type(s)
- Approved
- ATC code(s)
- N06AB04
- Molecular Formula:
- C20H21FN2O
- Molecular Weight:
- 324.392
- Log P:
- 3.8130
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 0
- TPSA:
- 36.26
- CAS Number(s):
- 59729-33-8
Synonym(s)
1.
Citalopram
2.
Celexa
3.
Citalopram Hydrobromide
4.
Cytalopram
5.
Escitalopram
6.
Escitalopram Oxalate
7.
Lexapro
8.
Lu-10-171
9.
Seropram
10.
Lu10171
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Anxiety | FAERS: 194 Canada Vigilance: 28 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 2 | Nausea | FAERS: 192 Canada Vigilance: 43 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 3 | Completed Suicide | FAERS: 163 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 4 | Dizziness | FAERS: 159 Canada Vigilance: 37 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 5 | Feeling abnormal | FAERS: 154 Canada Vigilance: 8 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 6 | Drug ineffective | FAERS: 148 Canada Vigilance: 46 | Canada Vigilance US FAERS | |
| 7 | Tremor | FAERS: 134 Canada Vigilance: 27 | CTD SIDER Canada Vigilance US FAERS | |
| 8 | Headache | FAERS: 127 Canada Vigilance: 33 | CTD SIDER Canada Vigilance US FAERS | |
| 9 | Fatigue | FAERS: 126 Canada Vigilance: 18 | 10830154 17092960 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 10 | Vomiting | FAERS: 124 Canada Vigilance: 14 | 15765832 17092960 | CTD SIDER Canada Vigilance US FAERS |
| 11 | Somnolence | FAERS: 84 Canada Vigilance: 12 | Canada Vigilance SIDER US FAERS | |
| 12 | Agitation | FAERS: 75 Canada Vigilance: 14 | Canada Vigilance SIDER US FAERS | |
| 13 | Overdose | FAERS: 66 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 14 | Malaise | FAERS: 63 Canada Vigilance: 10 | Canada Vigilance SIDER US FAERS | |
| 15 | Erectile dysfunction | FAERS: 62 Canada Vigilance: 3 | 18173768 19295509 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 16 | Product substitution issue | FAERS: 62 Canada Vigilance: 22 | Canada Vigilance US FAERS | |
| 17 | Amnesia | FAERS: 60 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 18 | Palpitations | FAERS: 60 Canada Vigilance: 12 | Canada Vigilance SIDER US FAERS | |
| 19 | Suicide attempt | FAERS: 60 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 20 | Visual Impairment | FAERS: 59 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 21 | Serotonin Syndrome | FAERS: 58 Canada Vigilance: 4 | CTD SIDER Canada Vigilance US FAERS | |
| 22 | Drug withdrawal syndrome | FAERS: 57 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 23 | Toxicity to various agents | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Asthenia | FAERS: 53 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 25 | Syncope | FAERS: 53 Canada Vigilance: 2 | 10958266 19953465 | CTD SIDER Canada Vigilance US FAERS |
| 26 | Anger | FAERS: 48 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 27 | Medication Error | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Restlessness | FAERS: 45 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 29 | Sexual Dysfunction | FAERS: 44 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 30 | Memory impairment | FAERS: 43 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 31 | Pharmaceutical product complaint | FAERS: 42 | US FAERS | |
| 32 | Depressed mood | FAERS: 40 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 33 | Tachycardia | FAERS: 40 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 34 | Crying | FAERS: 39 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 35 | Bruxism | FAERS: 38 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 36 | Tinnitus | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 37 | Anorgasmia | FAERS: 36 | SIDER US FAERS | |
| 38 | Chills | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 39 | Drug exposure during pregnancy | FAERS: 36 | US FAERS | |
| 40 | Intentional self-injury | FAERS: 35 | US FAERS | |
| 41 | Drug abuse | FAERS: 34 | SIDER US FAERS | |
| 42 | Hypersensitivity | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 43 | Arthralgia | FAERS: 33 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 44 | Mood swings | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 45 | Aphasia | FAERS: 30 | SIDER US FAERS | |
| 46 | Pain | FAERS: 30 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 47 | Cardiac Arrest | FAERS: 29 | SIDER US FAERS | |
| 48 | Retching | FAERS: 29 | SIDER US FAERS | |
| 49 | Urticaria | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 50 | Pruritus | FAERS: 27 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 51 | Talipes | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 52 | Chest Pain | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 53 | Sopor | FAERS: 26 | US FAERS | |
| 54 | Dysgeusia | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 55 | Hypotension | FAERS: 24 Canada Vigilance: 1 | 10958266 11793617 | CTD SIDER Canada Vigilance US FAERS |
| 56 | Myalgia | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 57 | Burning sensation | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 58 | Dissociation | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 59 | Lethargy | FAERS: 23 | OFFSIDES SIDER US FAERS | |
| 60 | Maternal exposure during pregnancy | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Product quality issue | FAERS: 22 | US FAERS | |
| 62 | Abdominal Pain | FAERS: 21 Canada Vigilance: 4 | 19519270 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 63 | Abdominal discomfort | FAERS: 21 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 64 | Akathisia | FAERS: 21 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 65 | Apathy | FAERS: 21 | SIDER US FAERS | |
| 66 | Mydriasis | FAERS: 21 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 67 | Nervousness | FAERS: 21 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 68 | Alopecia | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 69 | Unevaluable event | FAERS: 20 | US FAERS | |
| 70 | Weight decreased | FAERS: 20 | SIDER US FAERS | |
| 71 | Back Pain | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 72 | Chest discomfort | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 73 | Disturbance in sexual arousal | FAERS: 19 | SIDER US FAERS | |
| 74 | Feeling Cold | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 75 | Paranoia | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 76 | Asphyxia | FAERS: 17 | US FAERS | |
| 77 | Constipation | FAERS: 17 Canada Vigilance: 1 | 12755660 | CTD SIDER Canada Vigilance US FAERS |
| 78 | Emotional distress | FAERS: 17 | OFFSIDES SIDER US FAERS | |
| 79 | Patent ductus arteriosus | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Depressed Level of Consciousness | FAERS: 16 | SIDER US FAERS | |
| 81 | Flat affect | FAERS: 16 | SIDER US FAERS | |
| 82 | Pneumonia | FAERS: 16 | SIDER US FAERS | |
| 83 | Prescribed overdose | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Quality of life decreased | FAERS: 16 | OFFSIDES US FAERS | |
| 85 | Trismus | FAERS: 16 | SIDER US FAERS | |
| 86 | Emotional disorder | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 87 | Metabolic acidosis | FAERS: 15 | US FAERS | |
| 88 | Personality Change | FAERS: 15 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 89 | Photophobia | FAERS: 15 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 90 | Alcohol interaction | FAERS: 14 | US FAERS | |
| 91 | Bipolar Disorder | FAERS: 14 Canada Vigilance: 1 |
3458554
8042916 11874219 14636399 15003088 15213579 15504660 16806624 17591516 18294096 18621943 19519270 19573494 | CTD Canada Vigilance US FAERS |
| 92 | Dyspepsia | FAERS: 14 Canada Vigilance: 2 | 15765832 | CTD SIDER Canada Vigilance US FAERS |
| 93 | Exposure during breast feeding | FAERS: 14 | US FAERS | |
| 94 | Hypomania | FAERS: 14 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 95 | Impaired work ability | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 96 | Product use issue | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 97 | Abnormal weight gain | FAERS: 13 | US FAERS | |
| 98 | Bradycardia | FAERS: 13 | CTD SIDER US FAERS | |
| 99 | Dysuria | FAERS: 13 | OFFSIDES SIDER US FAERS | |
| 100 | Incorrect dose administered | FAERS: 13 | US FAERS | |
| 101 | Joint swelling | FAERS: 13 | US FAERS | |
| 102 | Mental impairment | FAERS: 13 | US FAERS | |
| 103 | Muscle tightness | FAERS: 13 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 104 | Night sweats | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 105 | Restless Legs Syndrome | FAERS: 13 | 17189751 18225972 18468624 | CTD SIDER US FAERS |
| 106 | Tachyphrenia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 107 | Blood creatine phosphokinase increased | FAERS: 12 | US FAERS | |
| 108 | Disorientation | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 109 | Musculoskeletal stiffness | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 110 | Vertigo | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 111 | Accidental exposure to product by child | FAERS: 11 | US FAERS | |
| 112 | Activities of daily living impaired | FAERS: 11 | OFFSIDES US FAERS | |
| 113 | Alcohol abuse | FAERS: 11 | OFFSIDES US FAERS | |
| 114 | Drug dispensing error | FAERS: 11 | US FAERS | |
| 115 | Duodenal ulcer perforation | FAERS: 11 | US FAERS | |
| 116 | Emotional poverty | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 117 | Epilepsy | FAERS: 11 Canada Vigilance: 1 | 20707986 | CTD Canada Vigilance US FAERS |
| 118 | Epistaxis | FAERS: 11 | SIDER US FAERS | |
| 119 | Feeding disorder neonatal | FAERS: 11 | US FAERS | |
| 120 | Mental status changes | FAERS: 11 | SIDER US FAERS | |
| 121 | Myoclonus | FAERS: 11 Canada Vigilance: 1 | 16702909 18213744 18624020 | CTD SIDER Canada Vigilance US FAERS |
| 122 | Stillbirth | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 123 | Urinary Retention | FAERS: 11 | 17110829 | CTD SIDER US FAERS |
| 124 | Cleft Palate | FAERS: 10 | OFFSIDES US FAERS | |
| 125 | Drug administration error | FAERS: 10 | US FAERS | |
| 126 | Euphoric mood | FAERS: 10 | SIDER US FAERS | |
| 127 | Lip swelling | FAERS: 10 | US FAERS | |
| 128 | Obsessive-Compulsive Disorder | FAERS: 10 Canada Vigilance: 1 | CTD SIDER Canada Vigilance US FAERS | |
| 129 | Physical assault | FAERS: 10 | US FAERS | |
| 130 | Yawning | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 131 | nervous system disorder | FAERS: 10 | SIDER US FAERS | |
| 132 | Acidosis | FAERS: 9 | US FAERS | |
| 133 | Adverse event | FAERS: 9 | US FAERS | |
| 134 | Altered state of consciousness | FAERS: 9 | US FAERS | |
| 135 | Anhedonia | FAERS: 9 | OFFSIDES US FAERS | |
| 136 | Arthritis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 137 | Delirium | FAERS: 9 | 12006908 18243426 18585543 | CTD SIDER US FAERS |
| 138 | Double Outlet Right Ventricle | FAERS: 9 | US FAERS | |
| 139 | Dysarthria | FAERS: 9 | SIDER US FAERS | |
| 140 | Eye pain | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 141 | General physical health deterioration | FAERS: 9 | OFFSIDES US FAERS | |
| 142 | Neonatal disorder | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 143 | Pregnancy | FAERS: 9 | SIDER US FAERS | |
| 144 | Selective eating disorder | FAERS: 9 | US FAERS | |
| 145 | Sinus Tachycardia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 146 | Stress | FAERS: 9 | US FAERS | |
| 147 | Temperature regulation disorder | FAERS: 9 | US FAERS | |
| 148 | Urinary Incontinence | FAERS: 9 | SIDER US FAERS | |
| 149 | Wheezing | FAERS: 9 | SIDER US FAERS | |
| 150 | Wrong technique in product usage process | FAERS: 9 | US FAERS | |
| 151 | Ageusia | FAERS: 8 | SIDER US FAERS | |
| 152 | Alanine Aminotransferase Increased | FAERS: 8 | SIDER US FAERS | |
| 153 | Cardiomegaly | FAERS: 8 | US FAERS | |
| 154 | Congenital pulmonary hypertension | FAERS: 8 | US FAERS | |
| 155 | Dysphemia | FAERS: 8 | US FAERS | |
| 156 | Executive dysfunction | FAERS: 8 | US FAERS | |
| 157 | Feeling jittery | FAERS: 8 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 158 | Head circumference abnormal | FAERS: 8 | US FAERS | |
| 159 | Homicide | FAERS: 8 | US FAERS | |
| 160 | Hypospadias | FAERS: 8 | US FAERS | |
| 161 | Intentional product misuse | FAERS: 8 | US FAERS | |
| 162 | Negative thoughts | FAERS: 8 | US FAERS | |
| 163 | Obsessive thoughts | FAERS: 8 | US FAERS | |
| 164 | Opisthotonus | FAERS: 8 | US FAERS | |
| 165 | Oropharyngeal pain | FAERS: 8 | OFFSIDES US FAERS | |
| 166 | Tardive Dyskinesia | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 167 | Therapeutic response unexpected with drug substitution | FAERS: 8 | US FAERS | |
| 168 | Wrong drug administered | FAERS: 8 | US FAERS | |
| 169 | Anencephaly | FAERS: 7 | US FAERS | |
| 170 | Atrial Fibrillation | FAERS: 7 | 12503252 | CTD SIDER US FAERS |
| 171 | Croup infectious | FAERS: 7 | US FAERS | |
| 172 | Dehydration | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 173 | Dementia | FAERS: 7 | US FAERS | |
| 174 | Drug Dependence | FAERS: 7 | SIDER US FAERS | |
| 175 | Drug ineffective for unapproved indication | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 176 | Feelings of worthlessness | FAERS: 7 | US FAERS | |
| 177 | Food Allergy | FAERS: 7 | US FAERS | |
| 178 | Glaucoma | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 179 | Hyperacusis | FAERS: 7 | US FAERS | |
| 180 | Injury asphyxiation | FAERS: 7 | OFFSIDES US FAERS | |
| 181 | Microcephaly | FAERS: 7 | US FAERS | |
| 182 | Morbid thoughts | FAERS: 7 | US FAERS | |
| 183 | Priapism | FAERS: 7 Canada Vigilance: 1 | 11926728 | CTD SIDER Canada Vigilance US FAERS |
| 184 | Respiratory arrest | FAERS: 7 | US FAERS | |
| 185 | Spina Bifida | FAERS: 7 | US FAERS | |
| 186 | Splenomegaly | FAERS: 7 | US FAERS | |
| 187 | Stevens-Johnson Syndrome | FAERS: 7 Canada Vigilance: 1 | 25811541 | CTD SIDER Canada Vigilance US FAERS |
| 188 | Stridor | FAERS: 7 | US FAERS | |
| 189 | Syndactyly | FAERS: 7 | US FAERS | |
| 190 | Thirst | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 191 | Unresponsive to stimuli | FAERS: 7 | US FAERS | |
| 192 | Urinary tract infection | FAERS: 7 | SIDER US FAERS | |
| 193 | Alcohol Intolerance | FAERS: 6 | SIDER US FAERS | |
| 194 | Alopecia Areata | FAERS: 6 | US FAERS | |
| 195 | Aspartate Aminotransferase Increased | FAERS: 6 | SIDER US FAERS | |
| 196 | Blood lactate dehydrogenase increased | FAERS: 6 | US FAERS | |
| 197 | Critical Illness | FAERS: 6 | US FAERS | |
| 198 | Cystitis | FAERS: 6 | SIDER US FAERS | |
| 199 | Discomfort | FAERS: 6 | SIDER US FAERS | |
| 200 | Disease recurrence | FAERS: 6 | US FAERS | |
| 201 | Drug screen positive | FAERS: 6 | US FAERS | |
| 202 | Erection increased | FAERS: 6 | US FAERS | |
| 203 | Erythema | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 204 | Female sexual arousal disorder | FAERS: 6 | US FAERS | |
| 205 | Flatulence | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 206 | Food craving | FAERS: 6 | SIDER US FAERS | |
| 207 | Micropenis | FAERS: 6 | US FAERS | |
| 208 | Muscle Rigidity | FAERS: 6 | 21407001 | CTD SIDER US FAERS |
| 209 | Paternal exposure timing unspecified | FAERS: 6 | US FAERS | |
| 210 | Presyncope | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 211 | Psychiatric symptom | FAERS: 6 | US FAERS | |
| 212 | Pulmonary Hypertension | FAERS: 6 | SIDER US FAERS | |
| 213 | Renal Colic | FAERS: 6 | US FAERS | |
| 214 | Respiratory distress | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 215 | Rhabdomyolysis | FAERS: 6 | 12006908 | CTD SIDER US FAERS |
| 216 | Screaming | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 217 | Somnambulism | FAERS: 6 | US FAERS | |
| 218 | Ultrasound scan abnormal | FAERS: 6 | US FAERS | |
| 219 | Ventricular Fibrillation | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 220 | Weight decrease neonatal | FAERS: 6 | US FAERS | |
| 221 | jaundice | FAERS: 6 | SIDER US FAERS | |
| 222 | Accidental overdose | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 223 | Acromegaly | FAERS: 5 | US FAERS | |
| 224 | Allergy to chemicals | FAERS: 5 | US FAERS | |
| 225 | Asthma | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 226 | Bladder trabeculation | FAERS: 5 | US FAERS | |
| 227 | Blood potassium decreased | FAERS: 5 | OFFSIDES US FAERS | |
| 228 | Blood sodium decreased | FAERS: 5 | US FAERS | |
| 229 | Blunted affect | FAERS: 5 | SIDER US FAERS | |
| 230 | Breast tenderness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 231 | Catatonia | FAERS: 5 | SIDER US FAERS | |
| 232 | Cerebral vasoconstriction | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 233 | Cholestasis | FAERS: 5 | 12524417 | CTD US FAERS |
| 234 | Chronic Fatigue Syndrome | FAERS: 5 | US FAERS | |
| 235 | Clonus | FAERS: 5 | US FAERS | |
| 236 | Cold sweat | FAERS: 5 | SIDER US FAERS | |
| 237 | Congenital choroid plexus cyst | FAERS: 5 | US FAERS | |
| 238 | Congenital hypercoagulation | FAERS: 5 | US FAERS | |
| 239 | Congenital tricuspid valve incompetence | FAERS: 5 | US FAERS | |
| 240 | Craniosynostosis | FAERS: 5 | US FAERS | |
| 241 | Drug dose omission | FAERS: 5 | OFFSIDES US FAERS | |
| 242 | Drug exposure via breast milk | FAERS: 5 | US FAERS | |
| 243 | Dystonia | FAERS: 5 Canada Vigilance: 2 | 17414946 | CTD OFFSIDES Canada Vigilance US FAERS |
| 244 | Electrocardiogram QT interval abnormal | FAERS: 5 | US FAERS | |
| 245 | Female sexual dysfunction | FAERS: 5 | SIDER US FAERS | |
| 246 | Gaze palsy | FAERS: 5 | US FAERS | |
| 247 | Head discomfort | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 248 | Hyperreflexia | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 249 | Hyperventilation | FAERS: 5 | SIDER US FAERS | |
| 250 | Hypoplastic Left Heart Syndrome | FAERS: 5 | US FAERS | |
| 251 | Intracranial Aneurysm | FAERS: 5 | US FAERS | |
| 252 | Laceration | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 253 | Lipase increased | FAERS: 5 | US FAERS | |
| 254 | Low birth weight baby | FAERS: 5 | US FAERS | |
| 255 | Macrocytosis | FAERS: 5 | US FAERS | |
| 256 | Menorrhagia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 257 | Middle insomnia | FAERS: 5 | SIDER US FAERS | |
| 258 | Motion Sickness | FAERS: 5 | SIDER US FAERS | |
| 259 | No adverse event | FAERS: 5 | US FAERS | |
| 260 | Ocular icterus | FAERS: 5 | US FAERS | |
| 261 | Pallor | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 262 | Pericarditis | FAERS: 5 | OFFSIDES US FAERS | |
| 263 | Poisoning | FAERS: 5 | US FAERS | |
| 264 | Poor quality sleep | FAERS: 5 | OFFSIDES US FAERS | |
| 265 | Pulmonary artery stenosis | FAERS: 5 | US FAERS | |
| 266 | Reaction to drug excipients | FAERS: 5 | US FAERS | |
| 267 | Sexual inhibition | FAERS: 5 | US FAERS | |
| 268 | Shock | FAERS: 5 | SIDER US FAERS | |
| 269 | Spontaneous penile erection | FAERS: 5 | US FAERS | |
| 270 | Sudden Cardiac Death | FAERS: 5 | US FAERS | |
| 271 | Swelling | FAERS: 5 | US FAERS | |
| 272 | Tension Headache | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 273 | Tension | FAERS: 5 | SIDER US FAERS | |
| 274 | Therapy cessation | FAERS: 5 | US FAERS | |
| 275 | Throat irritation | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 276 | VIIth nerve paralysis | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 277 | Acute kidney injury | FAERS: 4 | US FAERS | |
| 278 | Agoraphobia | FAERS: 4 | OFFSIDES US FAERS | |
| 279 | Angina Pectoris | FAERS: 4 | SIDER US FAERS | |
| 280 | Ataxia | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 281 | Blood catecholamines decreased | FAERS: 4 | US FAERS | |
| 282 | Cluster Headache | FAERS: 4 | US FAERS | |
| 283 | Dissociative Amnesia | FAERS: 4 | US FAERS | |
| 284 | Drug administered to patient of inappropriate age | FAERS: 4 | US FAERS | |
| 285 | Drug prescribing error | FAERS: 4 | US FAERS | |
| 286 | Eructation | FAERS: 4 | SIDER US FAERS | |
| 287 | Facial Paresis | FAERS: 4 | SIDER US FAERS | |
| 288 | Frustration tolerance decreased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 289 | Genital swelling | FAERS: 4 | OFFSIDES US FAERS | |
| 290 | Gestational Diabetes | FAERS: 4 | US FAERS | |
| 291 | Hunger | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 292 | Hypersomnia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 293 | Hypophagia | FAERS: 4 | OFFSIDES US FAERS | |
| 294 | Hypoxia | FAERS: 4 | US FAERS | |
| 295 | Intentional product use issue | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 296 | Joint stiffness | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 297 | Multiple drug overdose | FAERS: 4 | US FAERS | |
| 298 | Nasal discomfort | FAERS: 4 | US FAERS | |
| 299 | Nocturnal emission | FAERS: 4 | US FAERS | |
| 300 | Ophthalmoplegia | FAERS: 4 | US FAERS | |
| 301 | Orgasmic sensation decreased | FAERS: 4 | US FAERS | |
| 302 | Platelet function test abnormal | FAERS: 4 | US FAERS | |
| 303 | Proteinuria | FAERS: 4 | US FAERS | |
| 304 | Saliva altered | FAERS: 4 | US FAERS | |
| 305 | Single functional kidney | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 306 | Tachyphylaxis | FAERS: 4 | US FAERS | |
| 307 | Tonic clonic movements | FAERS: 4 | US FAERS | |
| 308 | Troponin increased | FAERS: 4 | OFFSIDES US FAERS | |
| 309 | Urge Incontinence | FAERS: 4 | US FAERS | |
| 310 | Wrong patient received product | FAERS: 4 | US FAERS | |
| 311 | Abasia | FAERS: 3 | OFFSIDES US FAERS | |
| 312 | Abdominal Compartment Syndrome | FAERS: 3 | US FAERS | |
| 313 | Acne | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 314 | Adactyly | FAERS: 3 | US FAERS | |
| 315 | Anosmia | FAERS: 3 | US FAERS | |
| 316 | Arthropathy | FAERS: 3 | SIDER US FAERS | |
| 317 | Atrioventricular Septal Defect | FAERS: 3 | US FAERS | |
| 318 | Bedridden | FAERS: 3 | US FAERS | |
| 319 | Blood cholesterol increased | FAERS: 3 | SIDER US FAERS | |
| 320 | Blood pH decreased | FAERS: 3 | US FAERS | |
| 321 | Blood pressure fluctuation | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 322 | Bronchitis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 323 | Cardiac Flutter | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 324 | Cellulitis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 325 | Cerebrovascular accident | FAERS: 3 | SIDER US FAERS | |
| 326 | Diaphragmatic Hernia | FAERS: 3 | US FAERS | |
| 327 | Diffuse alopecia | FAERS: 3 | US FAERS | |
| 328 | Diplopia | FAERS: 3 Canada Vigilance: 1 | 15765832 16282858 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 329 | Drug level increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 330 | Drug-disease interaction | FAERS: 3 | US FAERS | |
| 331 | Elevated mood | FAERS: 3 | US FAERS | |
| 332 | Facial Pain | FAERS: 3 | US FAERS | |
| 333 | Female Orgasmic Disorder | FAERS: 3 | US FAERS | |
| 334 | Flushing | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 335 | Growth retardation | FAERS: 3 | US FAERS | |
| 336 | Hypermetabolism | FAERS: 3 | US FAERS | |
| 337 | Hypertensive crisis | FAERS: 3 | SIDER US FAERS | |
| 338 | Hypogeusia | FAERS: 3 | SIDER US FAERS | |
| 339 | Hypothyroidism | FAERS: 3 | SIDER US FAERS | |
| 340 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 341 | Initial insomnia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 342 | Insulin-like growth factor decreased | FAERS: 3 | US FAERS | |
| 343 | Intentional misuse | FAERS: 3 | US FAERS | |
| 344 | Long QT Syndrome | FAERS: 3 | CTD US FAERS | |
| 345 | Menstrual discomfort | FAERS: 3 | US FAERS | |
| 346 | Multiple drug overdose intentional | FAERS: 3 | US FAERS | |
| 347 | Nasopharyngitis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 348 | Neonatal aspiration | FAERS: 3 | US FAERS | |
| 349 | Osmotic demyelination syndrome | FAERS: 3 | US FAERS | |
| 350 | Posturing | FAERS: 3 | US FAERS | |
| 351 | Pre-Eclampsia | FAERS: 3 | US FAERS | |
| 352 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 353 | Psychomotor skills impaired | FAERS: 3 | US FAERS | |
| 354 | Respiratory Depression | FAERS: 3 | US FAERS | |
| 355 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 356 | Supraventricular tachycardia | FAERS: 3 | US FAERS | |
| 357 | Tachyarrhythmia | FAERS: 3 | US FAERS | |
| 358 | Thrombocytosis | FAERS: 3 | US FAERS | |
| 359 | Ventricular hypoplasia | FAERS: 3 | US FAERS | |
| 360 | Accidental death | FAERS: 2 | US FAERS | |
| 361 | Alcohol poisoning | FAERS: 2 | US FAERS | |
| 362 | Angioedema | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 363 | Angle Closure Glaucoma | FAERS: 2 | SIDER US FAERS | |
| 364 | Anorexia | FAERS: 2 | 19721108 | CTD OFFSIDES SIDER US FAERS |
| 365 | Apallic syndrome | FAERS: 2 | US FAERS | |
| 366 | Atrophic vulvovaginitis | FAERS: 2 | SIDER US FAERS | |
| 367 | Bipolar II disorder | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 368 | Blepharospasm | FAERS: 2 | SIDER US FAERS | |
| 369 | Blindness | FAERS: 2 | US FAERS | |
| 370 | Blood glucose decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 371 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 372 | Bradyphrenia | FAERS: 2 | US FAERS | |
| 373 | Breast cancer stage III | FAERS: 2 | US FAERS | |
| 374 | Cardiac stress test abnormal | FAERS: 2 | US FAERS | |
| 375 | Cataract | FAERS: 2 | SIDER US FAERS | |
| 376 | Chorea | FAERS: 2 | US FAERS | |
| 377 | Congenital cystic kidney disease | FAERS: 2 | OFFSIDES US FAERS | |
| 378 | Conversion disorder | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 379 | Coombs test positive | FAERS: 2 | US FAERS | |
| 380 | Coronary Artery Disease | FAERS: 2 | SIDER US FAERS | |
| 381 | Craniorachischisis | FAERS: 2 | US FAERS | |
| 382 | Cystocele | FAERS: 2 | US FAERS | |
| 383 | Dacryostenosis acquired | FAERS: 2 | US FAERS | |
| 384 | Deafness Neurosensory | FAERS: 2 | US FAERS | |
| 385 | Deafness | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 386 | Deep Vein Thrombosis | FAERS: 2 | SIDER US FAERS | |
| 387 | Depression suicidal | FAERS: 2 | OFFSIDES US FAERS | |
| 388 | Diabetes Mellitus | FAERS: 2 | SIDER US FAERS | |
| 389 | Disability | FAERS: 2 | US FAERS | |
| 390 | Dissociative disorder | FAERS: 2 | US FAERS | |
| 391 | Drug Tolerance | FAERS: 2 | SIDER US FAERS | |
| 392 | Drug level above therapeutic | FAERS: 2 | US FAERS | |
| 393 | Drug toxicity | FAERS: 2 | US FAERS | |
| 394 | Economic problem | FAERS: 2 | US FAERS | |
| 395 | Eczema | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 396 | Educational problem | FAERS: 2 | US FAERS | |
| 397 | Electrocardiogram change | FAERS: 2 | US FAERS | |
| 398 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 399 | Encephalocele | FAERS: 2 | US FAERS | |
| 400 | Endothelial dysfunction | FAERS: 2 | US FAERS | |
| 401 | Exposure via ingestion | FAERS: 2 | US FAERS | |
| 402 | Eye irritation | FAERS: 2 | SIDER US FAERS | |
| 403 | Feeling of body temperature change | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 404 | Formication | FAERS: 2 | OFFSIDES US FAERS | |
| 405 | Gastroduodenitis | FAERS: 2 | US FAERS | |
| 406 | Hallucinations, mixed | FAERS: 2 | US FAERS | |
| 407 | Hostility | FAERS: 2 | SIDER US FAERS | |
| 408 | Hydrocephalus | FAERS: 2 | US FAERS | |
| 409 | Immobile | FAERS: 2 | US FAERS | |
| 410 | Impaired self-care | FAERS: 2 | US FAERS | |
| 411 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 412 | Incontinence | FAERS: 2 | OFFSIDES US FAERS | |
| 413 | Infantile apnoeic attack | FAERS: 2 | US FAERS | |
| 414 | Infection | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 415 | Infertility | FAERS: 2 | US FAERS | |
| 416 | Inflammation | FAERS: 2 | US FAERS | |
| 417 | Influenza | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 418 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 419 | Lactose Intolerance | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 420 | Limb injury | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 421 | Macular degeneration | FAERS: 2 | US FAERS | |
| 422 | Male Orgasmic Disorder | FAERS: 2 | US FAERS | |
| 423 | Mastication disorder | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 424 | Mental Retardation | FAERS: 2 | US FAERS | |
| 425 | Metrorrhagia | FAERS: 2 | SIDER US FAERS | |
| 426 | Microvascular coronary artery disease | FAERS: 2 | US FAERS | |
| 427 | Muscle Fatigue | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 428 | Myocardial fibrosis | FAERS: 2 | US FAERS | |
| 429 | Myocarditis | FAERS: 2 | SIDER US FAERS | |
| 430 | Neck Pain | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 431 | Neonatal pneumonia | FAERS: 2 | US FAERS | |
| 432 | Nerve injury | FAERS: 2 | US FAERS | |
| 433 | Neuralgia | FAERS: 2 | SIDER US FAERS | |
| 434 | Neuroleptic Malignant Syndrome | FAERS: 2 | SIDER US FAERS | |
| 435 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 436 | Nystagmus | FAERS: 2 | SIDER US FAERS | |
| 437 | Optic Neuropathy | FAERS: 2 | US FAERS | |
| 438 | Pancreatitis | FAERS: 2 | SIDER US FAERS | |
| 439 | Panic Disorder | FAERS: 2 | CTD US FAERS | |
| 440 | Panic disorder with agoraphobia | FAERS: 2 | US FAERS | |
| 441 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 442 | Polyhydramnios | FAERS: 2 | US FAERS | |
| 443 | Poor sucking reflex | FAERS: 2 | US FAERS | |
| 444 | Premature Ejaculation | FAERS: 2 | US FAERS | |
| 445 | Product solubility abnormal | FAERS: 2 | US FAERS | |
| 446 | Productive Cough | FAERS: 2 | US FAERS | |
| 447 | Pulmonary Fibrosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 448 | Pulmonary Valve Stenosis | FAERS: 2 | US FAERS | |
| 449 | Rash erythematous | FAERS: 2 | SIDER US FAERS | |
| 450 | Reproductive tract hypoplasia, male | FAERS: 2 | US FAERS | |
| 451 | Sepsis | FAERS: 2 | SIDER US FAERS | |
| 452 | Sexual relationship change | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 453 | Sinus headache | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 454 | Skin laceration | FAERS: 2 | SIDER US FAERS | |
| 455 | Slow response to stimuli | FAERS: 2 | US FAERS | |
| 456 | Sperm concentration decreased | FAERS: 2 | US FAERS | |
| 457 | Spermatozoa morphology abnormal | FAERS: 2 | US FAERS | |
| 458 | Spermatozoa progressive motility decreased | FAERS: 2 | US FAERS | |
| 459 | Streptokinase antibody increased | FAERS: 2 | US FAERS | |
| 460 | Stress at work | FAERS: 2 | SIDER US FAERS | |
| 461 | Sudden death | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 462 | Therapeutic response unexpected | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 463 | Thoracic vertebral fracture | FAERS: 2 | US FAERS | |
| 464 | Thrombocytopenia | FAERS: 2 | SIDER US FAERS | |
| 465 | Thyroid Neoplasm | FAERS: 2 | US FAERS | |
| 466 | Tongue discomfort | FAERS: 2 | US FAERS | |
| 467 | Toxicologic test abnormal | FAERS: 2 | US FAERS | |
| 468 | Transaminases increased | FAERS: 2 | US FAERS | |
| 469 | Ventricular hypertrophy | FAERS: 2 | US FAERS | |
| 470 | Violence-related symptom | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 471 | Visual acuity reduced transiently | FAERS: 2 | US FAERS | |
| 472 | Visual disturbance | FAERS: 2 | SIDER US FAERS | |
| 473 | Visual snow syndrome | FAERS: 2 | US FAERS | |
| 474 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 475 | treatment failure | FAERS: 2 | US FAERS | |
| 476 | Abdominal rigidity | FAERS: 1 | OFFSIDES US FAERS | |
| 477 | Abnormal palmar/plantar creases | FAERS: 1 | US FAERS | |
| 478 | Abscess | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 479 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 480 | Accidental exposure | FAERS: 1 | US FAERS | |
| 481 | Activation syndrome | FAERS: 1 | US FAERS | |
| 482 | Adenoiditis | FAERS: 1 | US FAERS | |
| 483 | Amniotic fluid volume decreased | FAERS: 1 | US FAERS | |
| 484 | Anaphylactic shock | FAERS: 1 | SIDER US FAERS | |
| 485 | Anophthalmos | FAERS: 1 | US FAERS | |
| 486 | Anorexia Nervosa | FAERS: 1 | US FAERS | |
| 487 | Anoxic Encephalopathy | FAERS: 1 | US FAERS | |
| 488 | Antidepressant drug level increased | FAERS: 1 | US FAERS | |
| 489 | Aortic Injury | FAERS: 1 | US FAERS | |
| 490 | Aphagia | FAERS: 1 | US FAERS | |
| 491 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 492 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 493 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 494 | Ascites | FAERS: 1 | US FAERS | |
| 495 | Atherosclerosis | FAERS: 1 | US FAERS | |
| 496 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 497 | Autonomic Dysreflexia | FAERS: 1 | US FAERS | |
| 498 | Bicuspid aortic valve | FAERS: 1 | US FAERS | |
| 499 | Bilirubinuria | FAERS: 1 | US FAERS | |
| 500 | Bipolar I disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 501 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 502 | Blood alkaline phosphatase increased | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 503 | Blood cannabinoids increased | FAERS: 1 | US FAERS | |
| 504 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 505 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 506 | Blood glucose increased | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 507 | Blood pressure orthostatic decreased | FAERS: 1 | US FAERS | |
| 508 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 509 | Blood urea increased | FAERS: 1 | US FAERS | |
| 510 | Blood urine present | FAERS: 1 | SIDER US FAERS | |
| 511 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 512 | Bradykinesia | FAERS: 1 | US FAERS | |
| 513 | Brain Death | FAERS: 1 | US FAERS | |
| 514 | Bronchopulmonary Dysplasia | FAERS: 1 | US FAERS | |
| 515 | Bronchospasm | FAERS: 1 | SIDER US FAERS | |
| 516 | Burning Mouth Syndrome | FAERS: 1 | US FAERS | |
| 517 | Capsular contracture associated with breast implant | FAERS: 1 | US FAERS | |
| 518 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 519 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 520 | Cerebral disorder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 521 | Choking | FAERS: 1 | SIDER US FAERS | |
| 522 | Cholelithiasis | FAERS: 1 | SIDER US FAERS | |
| 523 | Chorioretinitis | FAERS: 1 | US FAERS | |
| 524 | Chromatopsia | FAERS: 1 | SIDER US FAERS | |
| 525 | Chronic sinusitis | FAERS: 1 | OFFSIDES US FAERS | |
| 526 | Compulsive handwashing | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 527 | Congenital Hydrocephalus | FAERS: 1 | US FAERS | |
| 528 | Congenital scoliosis | FAERS: 1 | US FAERS | |
| 529 | Congenital torticollis | FAERS: 1 | US FAERS | |
| 530 | Congenital urinary tract obstruction | FAERS: 1 | US FAERS | |
| 531 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 532 | Cyanosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 533 | Dental caries | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 534 | Device occlusion | FAERS: 1 | US FAERS | |
| 535 | Device related infection | FAERS: 1 | US FAERS | |
| 536 | Dextrocardia | FAERS: 1 | US FAERS | |
| 537 | Disease Progression | FAERS: 1 | US FAERS | |
| 538 | Dissociative Identity Disorder | FAERS: 1 | US FAERS | |
| 539 | Dreamy state | FAERS: 1 | US FAERS | |
| 540 | Drug abuser | FAERS: 1 | US FAERS | |
| 541 | Drug addict | FAERS: 1 | OFFSIDES US FAERS | |
| 542 | Drug exposure before pregnancy | FAERS: 1 | US FAERS | |
| 543 | Drug level decreased | FAERS: 1 | SIDER US FAERS | |
| 544 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 545 | Dry skin | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 546 | Dysgraphia | FAERS: 1 | US FAERS | |
| 547 | Dyslexia | FAERS: 1 | US FAERS | |
| 548 | Echolalia | FAERS: 1 | US FAERS | |
| 549 | Electrocardiogram ST-T change | FAERS: 1 | US FAERS | |
| 550 | Electrocardiogram abnormal | FAERS: 1 | SIDER US FAERS | |
| 551 | Encephalomyelitis | FAERS: 1 | US FAERS | |
| 552 | Endometriosis | FAERS: 1 | US FAERS | |
| 553 | Epidermolysis | FAERS: 1 | US FAERS | |
| 554 | Erythema Multiforme | FAERS: 1 | SIDER US FAERS | |
| 555 | Excoriation | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 556 | Exophthalmos | FAERS: 1 | US FAERS | |
| 557 | Expired product administered | FAERS: 1 | US FAERS | |
| 558 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 559 | Exposure via body fluid | FAERS: 1 | US FAERS | |
| 560 | Exposure via partner | FAERS: 1 | US FAERS | |
| 561 | Eye Redness | FAERS: 1 | US FAERS | |
| 562 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 563 | Factor V Leiden mutation | FAERS: 1 | US FAERS | |
| 564 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 565 | Feeding disorder of infancy OR early childhood | FAERS: 1 | US FAERS | |
| 566 | Foaming at mouth | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 567 | Foreign body aspiration | FAERS: 1 | US FAERS | |
| 568 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 569 | Foreign travel | FAERS: 1 | US FAERS | |
| 570 | Fracture | FAERS: 1 | US FAERS | |
| 571 | Gambling | FAERS: 1 | OFFSIDES US FAERS | |
| 572 | Gamma-Glutamyltransferase Increased | FAERS: 1 | SIDER US FAERS | |
| 573 | Gastric ulcer | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 574 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 575 | Gastrointestinal hypermotility | FAERS: 1 | US FAERS | |
| 576 | Gastroschisis | FAERS: 1 | US FAERS | |
| 577 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 578 | Glutamate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 579 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 580 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 581 | Head titubation | FAERS: 1 | US FAERS | |
| 582 | Heart valve stenosis | FAERS: 1 | US FAERS | |
| 583 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 584 | Hepatic necrosis | FAERS: 1 | SIDER US FAERS | |
| 585 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 586 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 587 | Hirsutism | FAERS: 1 | US FAERS | |
| 588 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 589 | Hyperexplexia | FAERS: 1 | US FAERS | |
| 590 | Hypermobility syndrome | FAERS: 1 | US FAERS | |
| 591 | Hypokinesia | FAERS: 1 | 21407001 | CTD SIDER US FAERS |
| 592 | Hypothermia neonatal | FAERS: 1 | US FAERS | |
| 593 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 594 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 595 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 596 | Increased tendency to bruise | FAERS: 1 | SIDER US FAERS | |
| 597 | Infantile vomiting | FAERS: 1 | US FAERS | |
| 598 | Intention tremor | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 599 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 600 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 601 | Intrauterine infection | FAERS: 1 | US FAERS | |
| 602 | Intrusive thoughts | FAERS: 1 | US FAERS | |
| 603 | Iritis | FAERS: 1 | SIDER US FAERS | |
| 604 | Irregular breathing | FAERS: 1 | US FAERS | |
| 605 | Ketonuria | FAERS: 1 | US FAERS | |
| 606 | Leukocytosis | FAERS: 1 | SIDER US FAERS | |
| 607 | Libido disorder | FAERS: 1 | US FAERS | |
| 608 | Limb discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 609 | Lipomeningocele | FAERS: 1 | US FAERS | |
| 610 | Loose tooth | FAERS: 1 | US FAERS | |
| 611 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 612 | Macrocephaly | FAERS: 1 | US FAERS | |
| 613 | Magnesium Deficiency | FAERS: 1 | US FAERS | |
| 614 | Malaria | FAERS: 1 | US FAERS | |
| 615 | Mastitis | FAERS: 1 | SIDER US FAERS | |
| 616 | Maternal exposure during breast feeding | FAERS: 1 | US FAERS | |
| 617 | Medication residue present | FAERS: 1 | US FAERS | |
| 618 | Metabolic alkalosis | FAERS: 1 | US FAERS | |
| 619 | Methylenetetrahydrofolate reductase deficiency | FAERS: 1 | US FAERS | |
| 620 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 621 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 622 | Musculoskeletal Pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 623 | Musculoskeletal chest pain | FAERS: 1 | SIDER US FAERS | |
| 624 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 625 | Myocardial Infarction | FAERS: 1 Canada Vigilance: 1 | 20159412 | CTD SIDER Canada Vigilance US FAERS |
| 626 | Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 627 | Myopathy | FAERS: 1 | SIDER US FAERS | |
| 628 | Negativism | FAERS: 1 | US FAERS | |
| 629 | Neonatal respiratory depression | FAERS: 1 | US FAERS | |
| 630 | Neonatal respiratory failure | FAERS: 1 | US FAERS | |
| 631 | Nephritis | FAERS: 1 | US FAERS | |
| 632 | Nephrosclerosis | FAERS: 1 | US FAERS | |
| 633 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 634 | Nipple pain | FAERS: 1 | US FAERS | |
| 635 | Ocular discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 636 | Oliguria | FAERS: 1 | SIDER US FAERS | |
| 637 | Optic Nerve Hypoplasia | FAERS: 1 | US FAERS | |
| 638 | Oromandibular dystonia | FAERS: 1 | US FAERS | |
| 639 | Oropharyngeal discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 640 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 641 | Osteitis Deformans | FAERS: 1 | US FAERS | |
| 642 | Osteoporosis | FAERS: 1 | SIDER US FAERS | |
| 643 | Overweight | FAERS: 1 | US FAERS | |
| 644 | Oxygen consumption decreased | FAERS: 1 | US FAERS | |
| 645 | PCO2 decreased | FAERS: 1 | US FAERS | |
| 646 | PO2 increased | FAERS: 1 | US FAERS | |
| 647 | Pain of skin | FAERS: 1 | US FAERS | |
| 648 | Pancreatic enzyme abnormality | FAERS: 1 | US FAERS | |
| 649 | Paramnesia | FAERS: 1 | US FAERS | |
| 650 | Partner stress | FAERS: 1 | US FAERS | |
| 651 | Pelvic Pain | FAERS: 1 | SIDER US FAERS | |
| 652 | Pelvic kidney | FAERS: 1 | US FAERS | |
| 653 | Pemphigus | FAERS: 1 | US FAERS | |
| 654 | Peritonitis | FAERS: 1 | US FAERS | |
| 655 | Perseveration | FAERS: 1 | US FAERS | |
| 656 | Persistent genital arousal disorder | FAERS: 1 | US FAERS | |
| 657 | Petechiae | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 658 | Pharyngolaryngeal Pain | FAERS: 1 | SIDER US FAERS | |
| 659 | Phlebitis | FAERS: 1 | SIDER US FAERS | |
| 660 | Photodermatosis | FAERS: 1 | US FAERS | |
| 661 | Physical product label issue | FAERS: 1 | US FAERS | |
| 662 | Pilonidal cyst congenital | FAERS: 1 | US FAERS | |
| 663 | Platelet aggregation inhibition | FAERS: 1 | US FAERS | |
| 664 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 665 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 666 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 667 | Poor weight gain neonatal | FAERS: 1 | US FAERS | |
| 668 | Post procedural swelling | FAERS: 1 | US FAERS | |
| 669 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 670 | Postoperative infection | FAERS: 1 | US FAERS | |
| 671 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 672 | Pregnancy of partner | FAERS: 1 | US FAERS | |
| 673 | Premenstrual Dysphoric Disorder | FAERS: 1 | US FAERS | |
| 674 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 675 | Product administration error | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 676 | Product complaint | FAERS: 1 | US FAERS | |
| 677 | Product contamination physical | FAERS: 1 | US FAERS | |
| 678 | Product dose omission | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 679 | Product formulation issue | FAERS: 1 | US FAERS | |
| 680 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 681 | Product physical issue | FAERS: 1 | US FAERS | |
| 682 | Product size issue | FAERS: 1 | US FAERS | |
| 683 | Product storage error | FAERS: 1 | US FAERS | |
| 684 | Product substitution | FAERS: 1 | US FAERS | |
| 685 | Product use in unapproved indication | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 686 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 687 | Progesterone decreased | FAERS: 1 | US FAERS | |
| 688 | Protein S increased | FAERS: 1 | US FAERS | |
| 689 | Psoriasis | FAERS: 1 | SIDER US FAERS | |
| 690 | Psychomotor Agitation | FAERS: 1 | US FAERS | |
| 691 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 692 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 693 | Pyloric Stenosis | FAERS: 1 | US FAERS | |
| 694 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 695 | Rectal discharge | FAERS: 1 | US FAERS | |
| 696 | Renal dysplasia | FAERS: 1 | US FAERS | |
| 697 | Renal pain | FAERS: 1 | SIDER US FAERS | |
| 698 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 699 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 700 | Retinal exudates | FAERS: 1 | US FAERS | |
| 701 | Retinal infarction | FAERS: 1 | US FAERS | |
| 702 | Scab | FAERS: 1 | US FAERS | |
| 703 | Self Mutilation | FAERS: 1 | OFFSIDES US FAERS | |
| 704 | Self-induced vomiting | FAERS: 1 | US FAERS | |
| 705 | Sensitivity to weather change | FAERS: 1 | US FAERS | |
| 706 | Serum serotonin decreased | FAERS: 1 | US FAERS | |
| 707 | Shock symptom | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 708 | Shone complex | FAERS: 1 | US FAERS | |
| 709 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 710 | Sinusitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 711 | Skin test positive | FAERS: 1 | US FAERS | |
| 712 | Sleep Paralysis | FAERS: 1 | US FAERS | |
| 713 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 714 | Slow speech | FAERS: 1 | US FAERS | |
| 715 | Sluggishness | FAERS: 1 | SIDER US FAERS | |
| 716 | Sneezing | FAERS: 1 | US FAERS | |
| 717 | Spleen palpable | FAERS: 1 | US FAERS | |
| 718 | Staring | FAERS: 1 | US FAERS | |
| 719 | Status Epilepticus | FAERS: 1 | 11985646 | CTD US FAERS |
| 720 | Stool analysis abnormal | FAERS: 1 | US FAERS | |
| 721 | Strabismus | FAERS: 1 | US FAERS | |
| 722 | Stroke in evolution | FAERS: 1 | US FAERS | |
| 723 | Stupor | FAERS: 1 | SIDER US FAERS | |
| 724 | Sudden infant death syndrome | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 725 | Suture insertion | FAERS: 1 | US FAERS | |
| 726 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 727 | Therapeutic product ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 728 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 729 | Thermal burn | FAERS: 1 | SIDER US FAERS | |
| 730 | Thought insertion | FAERS: 1 | US FAERS | |
| 731 | Thyroid cancer stage II | FAERS: 1 | US FAERS | |
| 732 | Time perception altered | FAERS: 1 | US FAERS | |
| 733 | Tongue biting | FAERS: 1 | US FAERS | |
| 734 | Tongue blistering | FAERS: 1 | US FAERS | |
| 735 | Tongue movement disturbance | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 736 | Tooth Loss | FAERS: 1 | US FAERS | |
| 737 | Traumatic Brain Injury | FAERS: 1 | US FAERS | |
| 738 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 739 | Troponin I increased | FAERS: 1 | US FAERS | |
| 740 | Ulcer | FAERS: 1 | US FAERS | |
| 741 | Unemployment | FAERS: 1 | US FAERS | |
| 742 | Unmasking of previously unidentified disease | FAERS: 1 | US FAERS | |
| 743 | Upper-airway cough syndrome | FAERS: 1 | SIDER US FAERS | |
| 744 | Uterine spasm | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 745 | Vascular anomaly | FAERS: 1 | US FAERS | |
| 746 | Vasodilation procedure | FAERS: 1 | US FAERS | |
| 747 | Vertical Talus | FAERS: 1 | US FAERS | |
| 748 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 749 | Vulvovaginal mycotic infection | FAERS: 1 | SIDER US FAERS | |
| 750 | Weight | FAERS: 1 | US FAERS | |
| 751 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 752 | Abdominal Cramps | SIDER | ||
| 753 | Abdominal bloating | SIDER | ||
| 754 | Abnormal ejaculation | SIDER | ||
| 755 | Abnormal vision | SIDER | ||
| 756 | Abuse | OFFSIDES | ||
| 757 | Acid reflux | OFFSIDES | ||
| 758 | Acute Coronary Syndrome | SIDER | ||
| 759 | Acute bronchitis | SIDER | ||
| 760 | Acute psychosis | SIDER | ||
| 761 | Acute sinusitis | SIDER | ||
| 762 | Adenoma | OFFSIDES | ||
| 763 | Adjustment Disorders | 12006908 | CTD | |
| 764 | Affective Disorders, Psychotic | 15567215 | CTD | |
| 765 | Aggressive reaction | SIDER | ||
| 766 | Agranulocytosis | SIDER | ||
| 767 | Agraphia | OFFSIDES | ||
| 768 | Akathisia, Drug-Induced | 24568368 | CTD | |
| 769 | Alcohol problem | SIDER | ||
| 770 | Allergic sinusitis | SIDER | ||
| 771 | Allergy aggravated | SIDER | ||
| 772 | Amblyopia | SIDER | ||
| 773 | Anal Fissure | SIDER | ||
| 774 | Anastomotic stenosis | OFFSIDES | ||
| 775 | Aneurysm | SIDER | ||
| 776 | Animal bite | SIDER | ||
| 777 | Ankle Fracture | SIDER | ||
| 778 | Anorectal discomfort | SIDER | ||
| 779 | Antipsychotic drug level increased | OFFSIDES | ||
| 780 | Anxiety Disorders | CTD | ||
| 781 | Anxiety aggravated | SIDER | ||
| 782 | Anxiety attack | SIDER | ||
| 783 | Aortic valve sclerosis | OFFSIDES | ||
| 784 | Appendicitis | SIDER | ||
| 785 | Arteriosclerosis | OFFSIDES SIDER | ||
| 786 | Arthropod bite | SIDER | ||
| 787 | Arthropod sting | SIDER | ||
| 788 | Arthroscopy | OFFSIDES | ||
| 789 | Asbestosis | OFFSIDES | ||
| 790 | Aspartate aminotransferase abnormal | OFFSIDES | ||
| 791 | Asterixis | OFFSIDES | ||
| 792 | Asthenopia | SIDER | ||
| 793 | Atelectasis | OFFSIDES | ||
| 794 | Atrioventricular Block | OFFSIDES | ||
| 795 | Aura | OFFSIDES | ||
| 796 | Autistic Disorder | 18775368 19232924 | CTD | |
| 797 | Automatic bladder | OFFSIDES | ||
| 798 | Autonomic nervous system imbalance | SIDER | ||
| 799 | Autonomic neuropathy | SIDER | ||
| 800 | Back distress | SIDER | ||
| 801 | Basal cell carcinoma | OFFSIDES | ||
| 802 | Benign neoplasm of thyroid gland | OFFSIDES | ||
| 803 | Biopsy | OFFSIDES | ||
| 804 | Black hairy tongue | SIDER | ||
| 805 | Bladder discomfort | SIDER | ||
| 806 | Bladder pain | SIDER | ||
| 807 | Blood Glucose | OFFSIDES | ||
| 808 | Blood and lymphatic system disorders | SIDER | ||
| 809 | Blood cholesterol abnormal | OFFSIDES | ||
| 810 | Blood cholesterol | OFFSIDES | ||
| 811 | Blood count abnormal | OFFSIDES | ||
| 812 | Blood iron decreased | OFFSIDES | ||
| 813 | Blood sodium abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 814 | Blood sodium | OFFSIDES | ||
| 815 | Blood triglycerides | OFFSIDES | ||
| 816 | Blurred vision | OFFSIDES | ||
| 817 | Body Dysmorphic Disorders | 16528140 | CTD | |
| 818 | Bone density decreased | OFFSIDES | ||
| 819 | Bone pain | OFFSIDES SIDER | ||
| 820 | Breathing-related sleep disorder | OFFSIDES | ||
| 821 | Bronchopulmonary disease | OFFSIDES | ||
| 822 | Bursitis | OFFSIDES SIDER | ||
| 823 | Carbohydrate craving | SIDER | ||
| 824 | Carpal Tunnel Syndrome | SIDER | ||
| 825 | Catatonic reaction | SIDER | ||
| 826 | Catheter placement | OFFSIDES | ||
| 827 | Cerebral Hemorrhage | 20199139 | CTD | |
| 828 | Cervical dysplasia | OFFSIDES | ||
| 829 | Chemical and Drug Induced Liver Injury | 15930079 | CTD | |
| 830 | Chest tightness | SIDER | ||
| 831 | Chest wall pain | SIDER | ||
| 832 | Child Development Disorders, Pervasive | 15782081 | CTD | |
| 833 | Choking sensation | OFFSIDES | ||
| 834 | Cholecystitis | SIDER | ||
| 835 | Choreoathetosis | SIDER | ||
| 836 | Chromaturia | SIDER | ||
| 837 | Claustrophobia | OFFSIDES | ||
| 838 | Clostridium difficile colitis | OFFSIDES | ||
| 839 | Cocaine-Related Disorders | 17613964 19859697 20155594 | CTD | |
| 840 | Colitis | OFFSIDES SIDER | ||
| 841 | Common wart | SIDER | ||
| 842 | Confabulation | OFFSIDES | ||
| 843 | Confusion | CTD | ||
| 844 | Conjunctivitis | SIDER | ||
| 845 | Contact Dermatitis | OFFSIDES | ||
| 846 | Continuous Positive Airway Pressure | OFFSIDES | ||
| 847 | Cramps of lower extremities | SIDER | ||
| 848 | Culture wound positive | OFFSIDES | ||
| 849 | Cutaneous Candidiasis | OFFSIDES | ||
| 850 | Cyst | SIDER | ||
| 851 | Debridement | OFFSIDES | ||
| 852 | Decreased Libido | OFFSIDES | ||
| 853 | Demyelination | OFFSIDES | ||
| 854 | Dental Fistula | OFFSIDES | ||
| 855 | Dependence | SIDER | ||
| 856 | Depression aggravated | SIDER | ||
| 857 | Depressive disorder |
3929308
8919332 8923094 9179637 9803478 10072706 10327919 10830154 11071022 11089775 11985646 12006908 12876551 12891283 14624186 14660288 14726801 15003088 15014590 15213579 15367045 15504660 15610935 15765832 16205517 16282858 16390910 16528140 16572486 16636635 16702909 16841623 16900938 16997047 17163295 17189754 17191266 17288694 17414231 17414946 17541890 17586780 17591516 17762323 18200405 18225972 18291301 18621943 18624020 18817980 19272758 19286776 19295509 19364246 19439248 19460188 19519270 19890998 19897271 20104069 20159412 20482225 20603788 20716693 20740488 21112465 28263910 29107002 | CTD | |
| 858 | Dermatitis acneiform | SIDER | ||
| 859 | Dermatitis | SIDER | ||
| 860 | Device Failure | OFFSIDES | ||
| 861 | Device leakage | OFFSIDES | ||
| 862 | Diabetes | OFFSIDES | ||
| 863 | Diabetic Nephropathy | OFFSIDES | ||
| 864 | Diabetic Retinopathy | OFFSIDES | ||
| 865 | Diarrhea | CTD OFFSIDES | ||
| 866 | Disorders of Excessive Somnolence | CTD | ||
| 867 | Disruptive, Impulse Control, and Conduct Disorders | 7639092 12014784 | CTD | |
| 868 | Diuresis | SIDER | ||
| 869 | Diverticulitis | SIDER | ||
| 870 | Diverticulum | OFFSIDES | ||
| 871 | Drowsiness | OFFSIDES | ||
| 872 | Drug Overdose | CTD | ||
| 873 | Drug seeking behavior | SIDER | ||
| 874 | Drug withdrawal headache | OFFSIDES | ||
| 875 | Duodenal Ulcer | SIDER | ||
| 876 | Dyschromatopsia | Canada Vigilance: 1 | Canada Vigilance | |
| 877 | Dysequilibrium | SIDER | ||
| 878 | Dyskinesia, Drug-Induced | 11642480 18157704 | CTD | |
| 879 | Dysphasia | SIDER | ||
| 880 | Dysphonia | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 881 | Dysthymic Disorder | OFFSIDES | ||
| 882 | Ear and labyrinth disorders | SIDER | ||
| 883 | Ear tube insertion | OFFSIDES | ||
| 884 | Early satiety | SIDER | ||
| 885 | Ecchymosis | SIDER | ||
| 886 | Electromechanical dissociation | OFFSIDES | ||
| 887 | Embolism | SIDER | ||
| 888 | Endocarditis | OFFSIDES | ||
| 889 | Enteritis | SIDER | ||
| 890 | Enuresis | 10830154 | CTD | |
| 891 | Eosinophilia | SIDER | ||
| 892 | Eosinophilic Fasciitis | OFFSIDES | ||
| 893 | Epididymitis | OFFSIDES | ||
| 894 | Epigastric discomfort | SIDER | ||
| 895 | Erysipelas | SIDER | ||
| 896 | Essential Tremor | Canada Vigilance: 1 | Canada Vigilance | |
| 897 | Eustachian tube disorder | OFFSIDES | ||
| 898 | Excessive eye blinking | Canada Vigilance: 1 | Canada Vigilance | |
| 899 | Excitability | SIDER | ||
| 900 | Extremity contracture | OFFSIDES | ||
| 901 | Eye Infection | SIDER | ||
| 902 | Facial paralysis | SIDER | ||
| 903 | Fever | 18213744 18243426 20233235 | CTD | |
| 904 | Fibromyalgia | OFFSIDES SIDER | ||
| 905 | Fistula discharge | OFFSIDES | ||
| 906 | Folliculitis | OFFSIDES SIDER | ||
| 907 | Food Poisoning | SIDER | ||
| 908 | Furunculosis | SIDER | ||
| 909 | Gagging | SIDER | ||
| 910 | Gait Disorders, Neurologic | 21407001 | CTD | |
| 911 | Galactorrhea | 20430243 | CTD | |
| 912 | Gastritis | SIDER | ||
| 913 | Gastroenteritis | SIDER | ||
| 914 | Gastrointestinal infection | SIDER | ||
| 915 | Genital infection | SIDER | ||
| 916 | Genital pain | SIDER | ||
| 917 | Genitourinary chlamydia infection | SIDER | ||
| 918 | Gingival erythema | OFFSIDES | ||
| 919 | Gingivitis | SIDER | ||
| 920 | Glossitis | SIDER | ||
| 921 | Gout | SIDER | ||
| 922 | Hallucinations | CTD | ||
| 923 | Heartburn | SIDER | ||
| 924 | Hemiparesis | OFFSIDES | ||
| 925 | Hemiplegia | OFFSIDES | ||
| 926 | Hepatic artery thrombosis | OFFSIDES | ||
| 927 | Hepatitis | SIDER | ||
| 928 | Hepatorenal Syndrome | 15930079 | CTD | |
| 929 | Hernia | SIDER | ||
| 930 | High frequency ablation | OFFSIDES | ||
| 931 | Hip surgery | OFFSIDES | ||
| 932 | Histoplasmosis | OFFSIDES | ||
| 933 | Hordeolum | OFFSIDES | ||
| 934 | House dust allergy | SIDER | ||
| 935 | Human papilloma virus test positive | OFFSIDES | ||
| 936 | Hyperkeratosis | OFFSIDES | ||
| 937 | Hyperkinesia | SIDER | ||
| 938 | Hyperphagia | SIDER | ||
| 939 | Hypertension worsened | SIDER | ||
| 940 | Hyperthyroidism | SIDER | ||
| 941 | Hypertrichosis | SIDER | ||
| 942 | Hypogonadism | OFFSIDES | ||
| 943 | Hypohidrosis | SIDER | ||
| 944 | Hyponatremia |
9179637
10835739 11217819 12006908 12075041 12243606 12503252 14726801 14728721 15641882 16816780 16997047 17092960 17163295 17189754 17202465 17541890 | CTD | |
| 945 | Hysteria | SIDER | ||
| 946 | Idiopathic thrombocytopenia | SIDER | ||
| 947 | Ileitis | SIDER | ||
| 948 | Impetigo | SIDER | ||
| 949 | Implant site infection | OFFSIDES | ||
| 950 | Implant site inflammation | OFFSIDES | ||
| 951 | Implant site pain | OFFSIDES | ||
| 952 | Inappropriate schedule of product administration | Canada Vigilance: 1 | Canada Vigilance | |
| 953 | Increased bronchial secretion | SIDER | ||
| 954 | Infestation | SIDER | ||
| 955 | Inflicted injury | SIDER | ||
| 956 | Influenza-like symptoms | SIDER | ||
| 957 | Infusion site mobility decreased | OFFSIDES | ||
| 958 | Insulin-requiring type 2 diabetes mellitus | OFFSIDES | ||
| 959 | Intervertebral disc disorder | OFFSIDES SIDER | ||
| 960 | Irritable Bowel Syndrome | SIDER | ||
| 961 | Ischial neuralgia | SIDER | ||
| 962 | Jaw stiffness | SIDER | ||
| 963 | Joint Instability | OFFSIDES | ||
| 964 | Joint Range of Motion Decreased | OFFSIDES | ||
| 965 | Joint injury | OFFSIDES SIDER | ||
| 966 | Joint sprain | SIDER | ||
| 967 | Keratitis | SIDER | ||
| 968 | Keratoconus | SIDER | ||
| 969 | Kidney Diseases | 17163295 | CTD | |
| 970 | Lacrimation abnormal NOS | SIDER | ||
| 971 | Laryngeal web | OFFSIDES | ||
| 972 | Laryngitis | SIDER | ||
| 973 | Latent tetany | SIDER | ||
| 974 | Leg edema | SIDER | ||
| 975 | Leukoencephalopathy | OFFSIDES | ||
| 976 | Leukopenia neonatal | OFFSIDES | ||
| 977 | Leukopenia | SIDER | ||
| 978 | Life expectancy shortened | OFFSIDES | ||
| 979 | Ligament injury | SIDER | ||
| 980 | Ligament rupture | OFFSIDES | ||
| 981 | Lightheadedness | SIDER | ||
| 982 | Lipoma | SIDER | ||
| 983 | Loop electrosurgical excision procedure | OFFSIDES | ||
| 984 | Loss of personal independence in daily activities | Canada Vigilance: 1 | Canada Vigilance | |
| 985 | Lower respiratory tract infection viral | OFFSIDES | ||
| 986 | Lumbar disc lesion | SIDER | ||
| 987 | Lymphadenitis | SIDER | ||
| 988 | Lymphadenopathy | SIDER | ||
| 989 | Lymphocytosis | SIDER | ||
| 990 | Lymphopenia | SIDER | ||
| 991 | Malnutrition | SIDER | ||
| 992 | Manic psychosis | SIDER | ||
| 993 | Medical device removal | OFFSIDES | ||
| 994 | Melancholia | SIDER | ||
| 995 | Melanosis | SIDER | ||
| 996 | Memory Disorders | 16282858 | CTD | |
| 997 | Mental disorders | 16856516 | CTD | |
| 998 | Mesenteric vascular insufficiency | OFFSIDES | ||
| 999 | Migraine aggravated | SIDER | ||
| 1000 | Miliaria | Canada Vigilance: 1 | Canada Vigilance | |
| 1001 | Mitral valve sclerosis | OFFSIDES | ||
| 1002 | Monoclonal immunoglobulin present | OFFSIDES | ||
| 1003 | Mood Disorders | 18240168 18344730 | CTD | |
| 1004 | Movement Disorders | 19519270 | CTD | |
| 1005 | Multiple Sclerosis | OFFSIDES | ||
| 1006 | Muscle Weakness | OFFSIDES | ||
| 1007 | Muscle hypotonia | 20233235 | CTD | |
| 1008 | Mutism | OFFSIDES | ||
| 1009 | Myopia | SIDER | ||
| 1010 | Nasal Flaring | Canada Vigilance: 1 | Canada Vigilance | |
| 1011 | Nasal Polyps | SIDER | ||
| 1012 | Necrolysis epidermal | SIDER | ||
| 1013 | Neonatal respiratory distress | Canada Vigilance: 4 | Canada Vigilance | |
| 1014 | Neoplasm Metastasis | 25038229 | CTD | |
| 1015 | Neoplasms | 10487422 | CTD | |
| 1016 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 1017 | Nephrolithiasis | SIDER | ||
| 1018 | Nerve root lesion | SIDER | ||
| 1019 | Nervous tension | OFFSIDES | ||
| 1020 | Nervous tremulousness | SIDER | ||
| 1021 | Neurobehavioral Manifestations | 9169247 10367559 18200405 | CTD | |
| 1022 | Neurologic Manifestations | 18291301 | CTD | |
| 1023 | Neuropathy | SIDER | ||
| 1024 | Neurotransmitter level altered | SIDER | ||
| 1025 | Neutropenia | Canada Vigilance: 1 | Canada Vigilance | |
| 1026 | Neutropenic infection | OFFSIDES | ||
| 1027 | Nicotine Dependence | OFFSIDES | ||
| 1028 | Nocturia | 20199139 | CTD SIDER | |
| 1029 | Nodule | OFFSIDES | ||
| 1030 | Non-cardiac chest pain | OFFSIDES | ||
| 1031 | Obesity | SIDER | ||
| 1032 | Olfaction Disorders | 17873697 | CTD | |
| 1033 | Onychomycosis | SIDER | ||
| 1034 | Open reduction of fracture | OFFSIDES | ||
| 1035 | Open wound | OFFSIDES | ||
| 1036 | Oral infection | OFFSIDES | ||
| 1037 | Oral pain | SIDER | ||
| 1038 | Oral torus | OFFSIDES | ||
| 1039 | Orchitis noninfective | SIDER | ||
| 1040 | Oropharyngeal spasm | OFFSIDES | ||
| 1041 | Osteomyelitis | OFFSIDES | ||
| 1042 | Osteopenia | OFFSIDES | ||
| 1043 | Otitis Externa | SIDER | ||
| 1044 | Otitis Media | SIDER | ||
| 1045 | Pancreatic enzymes increased | Canada Vigilance: 1 | Canada Vigilance | |
| 1046 | Pancytopenia | SIDER | ||
| 1047 | Paranoid reaction | SIDER | ||
| 1048 | Paresthesia | 17092960 | CTD | |
| 1049 | Parkinsonian Disorders | 21407001 | CTD | |
| 1050 | Pathological fracture | Canada Vigilance: 1 | Canada Vigilance | |
| 1051 | Pelvic Inflammatory Disease | SIDER | ||
| 1052 | Performance status decreased | SIDER | ||
| 1053 | Periodontal destruction | SIDER | ||
| 1054 | Periodontal operation | OFFSIDES | ||
| 1055 | Periodontitis | OFFSIDES | ||
| 1056 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 1057 | Pharyngitis | 12755660 | CTD SIDER | |
| 1058 | Physical disability | OFFSIDES | ||
| 1059 | Polyuria | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 1060 | Post procedural infection | OFFSIDES | ||
| 1061 | Post-traumatic neck syndrome | SIDER | ||
| 1062 | Post-traumatic pain | SIDER | ||
| 1063 | Pregnancy test positive | SIDER | ||
| 1064 | Premenstrual Tension | SIDER | ||
| 1065 | Premenstrual syndrome | 18344730 | CTD SIDER | |
| 1066 | Prenatal Exposure Delayed Effects | 18411854 | CTD | |
| 1067 | Prinzmetal's variant angina | 20159412 | CTD | |
| 1068 | Proctocolitis | OFFSIDES SIDER | ||
| 1069 | Prolonged menses | SIDER | ||
| 1070 | Protein total increased | OFFSIDES | ||
| 1071 | Prothrombin level decreased | SIDER | ||
| 1072 | Psoriasis flare-up | SIDER | ||
| 1073 | Psychoses, Substance-Induced | 21112465 | CTD | |
| 1074 | Psychotic Disorders | 10830154 | CTD | |
| 1075 | Pulmonary Embolism | SIDER | ||
| 1076 | Pulmonary Infarction | OFFSIDES | ||
| 1077 | Pulmonary radiation injury | OFFSIDES | ||
| 1078 | Punctate keratitis | OFFSIDES | ||
| 1079 | Purpura | SIDER | ||
| 1080 | Pyelonephritis | SIDER | ||
| 1081 | Pyuria | OFFSIDES | ||
| 1082 | Radiation associated pain | OFFSIDES | ||
| 1083 | Radical hysterectomy | OFFSIDES | ||
| 1084 | Radiculopathy | SIDER | ||
| 1085 | Raynaud Disease | 17103176 | CTD | |
| 1086 | Rectal tenesmus | OFFSIDES | ||
| 1087 | Reflex, Abnormal | 18213744 20233235 | CTD | |
| 1088 | Reflux gastritis | OFFSIDES SIDER | ||
| 1089 | Reflux laryngitis | OFFSIDES | ||
| 1090 | Renal cyst | OFFSIDES | ||
| 1091 | Respiratory Insufficiency | 22951378 | CTD | |
| 1092 | Restlessness aggravated | SIDER | ||
| 1093 | Retinal Detachment | SIDER | ||
| 1094 | Rheumatoid Arthritis | SIDER | ||
| 1095 | Rhinitis perennial | SIDER | ||
| 1096 | Rhinitis | SIDER | ||
| 1097 | Risus sardonicus | OFFSIDES | ||
| 1098 | Sacroiliitis | SIDER | ||
| 1099 | Salpingitis | SIDER | ||
| 1100 | Sciatica | SIDER | ||
| 1101 | Scotoma | SIDER | ||
| 1102 | Sedation complication | Canada Vigilance: 1 | Canada Vigilance | |
| 1103 | Seizures | CTD | ||
| 1104 | Sensation of blood flow | SIDER | ||
| 1105 | Sequestrectomy | OFFSIDES | ||
| 1106 | Shivering | SIDER | ||
| 1107 | Shoulder Pain | SIDER | ||
| 1108 | Sialorrhea | 10830154 | CTD | |
| 1109 | Sinus Arrest, Cardiac | 15767228 | CTD | |
| 1110 | Sinus bradycardia | OFFSIDES SIDER | ||
| 1111 | Sinus operation | OFFSIDES | ||
| 1112 | Skin Induration | OFFSIDES | ||
| 1113 | Skin Papilloma | SIDER | ||
| 1114 | Skin hypertrophy | OFFSIDES | ||
| 1115 | Skin irritation | SIDER | ||
| 1116 | Skin lesion | OFFSIDES | ||
| 1117 | Skin nodule | SIDER | ||
| 1118 | Skin tightness | OFFSIDES | ||
| 1119 | Sleep Bruxism | 11157444 | CTD | |
| 1120 | Sleep Initiation and Maintenance Disorders | 10665628 15765832 19721108 | CTD | |
| 1121 | Sleep Talking | OFFSIDES SIDER | ||
| 1122 | Sleep Wake Disorders | 16572486 19519270 | CTD | |
| 1123 | Snoring | SIDER | ||
| 1124 | Soft Tissue Injuries | OFFSIDES | ||
| 1125 | Speech Disorders | 19519270 | CTD | |
| 1126 | Stomatitis | SIDER | ||
| 1127 | Subcutaneous nodule | OFFSIDES | ||
| 1128 | Substance Withdrawal Syndrome | 16390910 18411854 18480703 | CTD | |
| 1129 | Substance-Related Disorders | 19272758 | CTD | |
| 1130 | Suicidal tendency | SIDER | ||
| 1131 | Suicide | SIDER | ||
| 1132 | Sunburn | SIDER | ||
| 1133 | Suture related complication | OFFSIDES | ||
| 1134 | Sweating | SIDER | ||
| 1135 | Tendinitis | OFFSIDES | ||
| 1136 | Tenosynovitis | SIDER | ||
| 1137 | Tetany | SIDER | ||
| 1138 | Therapeutic product effect decreased | Canada Vigilance: 2 | Canada Vigilance | |
| 1139 | Therapeutic response changed | Canada Vigilance: 3 | Canada Vigilance | |
| 1140 | Therapy change | Canada Vigilance: 1 | Canada Vigilance | |
| 1141 | Thrombophlebitis | OFFSIDES | ||
| 1142 | Thrombosis | SIDER | ||
| 1143 | Thyroiditis | SIDER | ||
| 1144 | Tolerance development | SIDER | ||
| 1145 | Tonsillitis | SIDER | ||
| 1146 | Tooth Erosion | SIDER | ||
| 1147 | Tooth Extraction | OFFSIDES | ||
| 1148 | Tooth Infection | OFFSIDES SIDER | ||
| 1149 | Tooth repair | OFFSIDES | ||
| 1150 | Toothache | SIDER | ||
| 1151 | Torsades de Pointes | CTD | ||
| 1152 | Torticollis | SIDER | ||
| 1153 | Toxic Epidermal Necrolysis | SIDER | ||
| 1154 | Tracheitis | SIDER | ||
| 1155 | Tracheobronchitis | SIDER | ||
| 1156 | Trauma | SIDER | ||
| 1157 | Tuberculosis | SIDER | ||
| 1158 | Tympanic Membrane Perforation | SIDER | ||
| 1159 | Ulcerative stomatitis | SIDER | ||
| 1160 | Umbilical hernia | Canada Vigilance: 1 | Canada Vigilance | |
| 1161 | Upset stomach | SIDER | ||
| 1162 | Ureteral stent insertion | OFFSIDES | ||
| 1163 | Urethral fistula | OFFSIDES | ||
| 1164 | Urinary hesitation | SIDER | ||
| 1165 | Urine output increased | SIDER | ||
| 1166 | Vaginal Discharge | SIDER | ||
| 1167 | Vaginal dryness | SIDER | ||
| 1168 | Vascular purpura | SIDER | ||
| 1169 | Venous Insufficiency | OFFSIDES | ||
| 1170 | Venous Thromboembolism | 15567215 | CTD | |
| 1171 | Ventricular arrhythmia | SIDER | ||
| 1172 | Vertebral artery occlusion | OFFSIDES | ||
| 1173 | Viral upper respiratory tract infection | SIDER | ||
| 1174 | Vision Disorders | 17762323 | CTD | |
| 1175 | Vitamin B 12 Deficiency | OFFSIDES | ||
| 1176 | Vitamin K Deficiency | OFFSIDES | ||
| 1177 | Vitreous Detachment | SIDER | ||
| 1178 | Vulvovaginal dryness | SIDER | ||
| 1179 | Waist circumference increased | OFFSIDES | ||
| 1180 | Walking aid user | OFFSIDES | ||
| 1181 | Weight Gain | OFFSIDES | ||
| 1182 | Wound Infection | SIDER | ||
| 1183 | Wrong technique in drug usage process | OFFSIDES | ||
| 1184 | Xerophthalmia | SIDER | ||
| 1185 | Xerosis | Canada Vigilance: 1 | Canada Vigilance | |
| 1186 | Xerostomia | 10665628 15765832 16282858 | CTD | |
| 1187 | carbuncle | SIDER | ||
| 1188 | furuncle | SIDER | ||
| 1189 | muscle injury | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.