Sertraline
(VGKDLMBJGBXTGI-SJCJKPOMSA-N)
Structure
- SMILES
- CN[C@H]1CC[C@H](c2c1cccc2)c1ccc(c(c1)Cl)Cl
- Type(s)
- Approved
- ATC code(s)
- N06AB06
- Molecular Formula:
- C17H17Cl2N
- Molecular Weight:
- 306.230
- Log P:
- 5.5705
- Hydrogen Bond Acceptor:
- 1
- Hydrogen Bond Donor:
- 1
- TPSA:
- 12.03
- CAS Number(s):
- 79617-96-2
Synonym(s)
1.
Sertraline
2.
Altruline
3.
Apo-Sertraline
4.
Aremis
5.
Besitran
6.
Gen-Sertraline
7.
Gladem
8.
Lustral
9.
Novo-Sertraline
10.
Rhoxal-sertraline
11.
Sealdin
12.
Sertraline Hydrochloride
13.
Sertraline Hydrochloride (1S-cis)-Isomer
14.
Zoloft
15.
ratio-Sertraline
16.
Apo Sertraline
17.
Gen Sertraline
18.
Hydrochloride, Sertraline
19.
Novo Sertraline
20.
Rhoxal sertraline
21.
ratio Sertraline
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Anxiety | FAERS: 323 Canada Vigilance: 9 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 2 | Drug ineffective | FAERS: 257 Canada Vigilance: 28 | Canada Vigilance OFFSIDES US FAERS | |
| 3 | Dizziness | FAERS: 244 Canada Vigilance: 17 | 8840377 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 4 | Nausea | FAERS: 241 Canada Vigilance: 18 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 5 | Headache | FAERS: 218 Canada Vigilance: 8 | 8617705 10596735 10732656 | CTD SIDER Canada Vigilance US FAERS |
| 6 | Product substitution issue | FAERS: 185 Canada Vigilance: 21 | Canada Vigilance US FAERS | |
| 7 | Fatigue | FAERS: 167 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 8 | Tremor | FAERS: 165 Canada Vigilance: 9 | 11210406 | CTD SIDER Canada Vigilance US FAERS |
| 9 | Feeling abnormal | FAERS: 148 Canada Vigilance: 7 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 10 | Malaise | FAERS: 128 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 11 | Agitation | FAERS: 120 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 12 | Palpitations | FAERS: 110 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 13 | Vomiting | FAERS: 103 Canada Vigilance: 11 | Canada Vigilance SIDER US FAERS | |
| 14 | Bruxism | FAERS: 100 | OFFSIDES SIDER US FAERS | |
| 15 | Suicide attempt | FAERS: 97 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 16 | Pharmaceutical product complaint | FAERS: 89 | US FAERS | |
| 17 | Therapeutic response unexpected with drug substitution | FAERS: 78 | US FAERS | |
| 18 | Depressed mood | FAERS: 77 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 19 | Serotonin Syndrome | FAERS: 77 Canada Vigilance: 4 | CTD SIDER Canada Vigilance US FAERS | |
| 20 | Anorgasmia | FAERS: 76 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 21 | Completed Suicide | FAERS: 71 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 22 | Drug withdrawal syndrome | FAERS: 68 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Toxicity to various agents | FAERS: 67 | US FAERS | |
| 24 | Drug exposure during pregnancy | FAERS: 59 | OFFSIDES US FAERS | |
| 25 | Pruritus | FAERS: 59 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 26 | Restlessness | FAERS: 59 | US FAERS | |
| 27 | Somnolence | FAERS: 59 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 28 | Asthenia | FAERS: 57 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 29 | Intentional self-injury | FAERS: 57 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 30 | Anger | FAERS: 52 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 31 | Crying | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 32 | Amnesia | FAERS: 50 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 33 | Myalgia | FAERS: 50 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 34 | Tinnitus | FAERS: 47 | SIDER US FAERS | |
| 35 | Visual Impairment | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 36 | Erectile dysfunction | FAERS: 45 | 9892316 | CTD OFFSIDES SIDER US FAERS |
| 37 | Lethargy | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 38 | Product quality issue | FAERS: 44 | US FAERS | |
| 39 | Apathy | FAERS: 43 | OFFSIDES SIDER US FAERS | |
| 40 | Abnormal weight gain | FAERS: 42 | US FAERS | |
| 41 | Night sweats | FAERS: 41 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 42 | Restless Legs Syndrome | FAERS: 40 | 17189751 18468624 | CTD US FAERS |
| 43 | Abdominal discomfort | FAERS: 36 Canada Vigilance: 6 | Canada Vigilance OFFSIDES US FAERS | |
| 44 | Dehydration | FAERS: 36 | OFFSIDES SIDER US FAERS | |
| 45 | Memory impairment | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Pain | FAERS: 36 | OFFSIDES SIDER US FAERS | |
| 47 | Arthralgia | FAERS: 35 | SIDER US FAERS | |
| 48 | Abdominal Pain | FAERS: 34 Canada Vigilance: 5 | 8166325 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 49 | Obsessive-Compulsive Disorder | FAERS: 34 | CTD US FAERS | |
| 50 | Dyspepsia | FAERS: 32 Canada Vigilance: 9 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 51 | Paranoia | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 52 | Weight decreased | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 53 | Alopecia | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 54 | Chest Pain | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 55 | Myoclonus | FAERS: 31 Canada Vigilance: 1 | CTD SIDER Canada Vigilance US FAERS | |
| 56 | Discomfort | FAERS: 30 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 57 | Medication Error | FAERS: 30 | US FAERS | |
| 58 | Overdose | FAERS: 30 | OFFSIDES US FAERS | |
| 59 | Photophobia | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 60 | Disorientation | FAERS: 29 | US FAERS | |
| 61 | Hypotension | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 62 | Syncope | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 63 | Vertigo | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 64 | Chills | FAERS: 28 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 65 | Constipation | FAERS: 28 | SIDER US FAERS | |
| 66 | Dystonia | FAERS: 28 Canada Vigilance: 1 | 9004068 9010129 9934951 | CTD OFFSIDES Canada Vigilance US FAERS |
| 67 | Emotional disorder | FAERS: 27 | US FAERS | |
| 68 | Asthenopia | FAERS: 26 | US FAERS | |
| 69 | Dysgeusia | FAERS: 26 | OFFSIDES SIDER US FAERS | |
| 70 | Mydriasis | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 71 | Erythema | FAERS: 25 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 72 | Yawning | FAERS: 25 | SIDER US FAERS | |
| 73 | Alcohol abuse | FAERS: 24 | OFFSIDES US FAERS | |
| 74 | Anhedonia | FAERS: 24 | OFFSIDES US FAERS | |
| 75 | Rhabdomyolysis | FAERS: 24 | US FAERS | |
| 76 | Back Pain | FAERS: 23 | SIDER US FAERS | |
| 77 | Emotional distress | FAERS: 23 | OFFSIDES US FAERS | |
| 78 | Trismus | FAERS: 23 | US FAERS | |
| 79 | Drug abuse | FAERS: 22 | US FAERS | |
| 80 | Mental impairment | FAERS: 22 | OFFSIDES US FAERS | |
| 81 | Muscle tightness | FAERS: 22 | OFFSIDES US FAERS | |
| 82 | Toxic Epidermal Necrolysis | FAERS: 22 | SIDER US FAERS | |
| 83 | Cardiac Arrest | FAERS: 21 | US FAERS | |
| 84 | Feeling jittery | FAERS: 21 | SIDER US FAERS | |
| 85 | Flat affect | FAERS: 21 | SIDER US FAERS | |
| 86 | Mood swings | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 87 | Cholestasis | FAERS: 20 | US FAERS | |
| 88 | Depression suicidal | FAERS: 20 | OFFSIDES US FAERS | |
| 89 | Epistaxis | FAERS: 20 | SIDER US FAERS | |
| 90 | Hypothyroidism | FAERS: 20 | SIDER US FAERS | |
| 91 | Maternal exposure during pregnancy | FAERS: 20 | US FAERS | |
| 92 | Neutropenia | FAERS: 20 | US FAERS | |
| 93 | Akathisia | FAERS: 19 | SIDER US FAERS | |
| 94 | Dissociation | FAERS: 19 | US FAERS | |
| 95 | Emotional poverty | FAERS: 19 | US FAERS | |
| 96 | Joint stiffness | FAERS: 19 | US FAERS | |
| 97 | Sexual Dysfunction | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 98 | Vanishing bile duct syndrome | FAERS: 19 | US FAERS | |
| 99 | Dysarthria | FAERS: 18 | 11816261 | CTD US FAERS |
| 100 | Flushing | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 101 | Head discomfort | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 102 | Hypersomnia | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 103 | Nervousness | FAERS: 18 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 104 | Urinary Incontinence | FAERS: 18 | 11147747 12138594 | CTD SIDER US FAERS |
| 105 | Antidepressant drug level increased | FAERS: 17 | US FAERS | |
| 106 | Blepharospasm | FAERS: 17 | US FAERS | |
| 107 | Blood creatine phosphokinase increased | FAERS: 17 | US FAERS | |
| 108 | Euphoric mood | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 109 | Exposure during breast feeding | FAERS: 17 | US FAERS | |
| 110 | Eye pain | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 111 | Feeling Cold | FAERS: 17 | US FAERS | |
| 112 | Impaired work ability | FAERS: 17 | OFFSIDES US FAERS | |
| 113 | Adverse event | FAERS: 16 | US FAERS | |
| 114 | Anosmia | FAERS: 16 | US FAERS | |
| 115 | Disease recurrence | FAERS: 16 | OFFSIDES US FAERS | |
| 116 | Drug Dependence | FAERS: 16 | US FAERS | |
| 117 | Gastrointestinal motility disorder | FAERS: 16 | US FAERS | |
| 118 | Hypersensitivity | FAERS: 16 | SIDER US FAERS | |
| 119 | Intrusive thoughts | FAERS: 16 | US FAERS | |
| 120 | Obsessive thoughts | FAERS: 16 | US FAERS | |
| 121 | Acute psychosis | FAERS: 15 | US FAERS | |
| 122 | Alcohol interaction | FAERS: 15 | US FAERS | |
| 123 | Bradyphrenia | FAERS: 15 | US FAERS | |
| 124 | Delirium | FAERS: 15 | 8659626 | CTD SIDER US FAERS |
| 125 | Gastritis | FAERS: 15 | SIDER US FAERS | |
| 126 | Homicide | FAERS: 15 | US FAERS | |
| 127 | Hyperventilation | FAERS: 15 | SIDER US FAERS | |
| 128 | Menorrhagia | FAERS: 15 | SIDER US FAERS | |
| 129 | Tardive Dyskinesia | FAERS: 15 | OFFSIDES US FAERS | |
| 130 | Urticaria | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 131 | Anencephaly | FAERS: 14 | US FAERS | |
| 132 | Gastrointestinal Pain | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 133 | Hepatotoxicity | FAERS: 14 | US FAERS | |
| 134 | Incorrect dose administered | FAERS: 14 | US FAERS | |
| 135 | Tachycardia | FAERS: 14 Canada Vigilance: 1 | 15707818 | CTD SIDER Canada Vigilance US FAERS |
| 136 | Torticollis | FAERS: 14 | US FAERS | |
| 137 | Chest discomfort | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 138 | Joint swelling | FAERS: 13 | US FAERS | |
| 139 | Unevaluable event | FAERS: 13 | US FAERS | |
| 140 | Wrong technique in product usage process | FAERS: 13 | US FAERS | |
| 141 | jaundice | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 142 | Blindness | FAERS: 12 | SIDER US FAERS | |
| 143 | Chromaturia | FAERS: 12 | US FAERS | |
| 144 | Depressed Level of Consciousness | FAERS: 12 | SIDER US FAERS | |
| 145 | Hepatitis | FAERS: 12 | SIDER US FAERS | |
| 146 | Migraine with Aura | FAERS: 12 | OFFSIDES US FAERS | |
| 147 | Neck Pain | FAERS: 12 | US FAERS | |
| 148 | Tension | FAERS: 12 | SIDER US FAERS | |
| 149 | Blood alkaline phosphatase increased | FAERS: 11 | SIDER US FAERS | |
| 150 | Blood sodium decreased | FAERS: 11 | US FAERS | |
| 151 | Bone pain | FAERS: 11 | OFFSIDES US FAERS | |
| 152 | Dry skin | FAERS: 11 | SIDER US FAERS | |
| 153 | Epilepsy | FAERS: 11 | OFFSIDES US FAERS | |
| 154 | Erythema Multiforme | FAERS: 11 | 19040509 | CTD SIDER US FAERS |
| 155 | Flatulence | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 156 | No adverse event | FAERS: 11 | US FAERS | |
| 157 | Poor quality sleep | FAERS: 11 | US FAERS | |
| 158 | Presyncope | FAERS: 11 | US FAERS | |
| 159 | Stevens-Johnson Syndrome | FAERS: 11 Canada Vigilance: 1 | 25811541 | CTD SIDER Canada Vigilance US FAERS |
| 160 | Stillbirth | FAERS: 11 | US FAERS | |
| 161 | Abasia | FAERS: 10 | OFFSIDES US FAERS | |
| 162 | Activities of daily living impaired | FAERS: 10 | OFFSIDES US FAERS | |
| 163 | Altered state of consciousness | FAERS: 10 | US FAERS | |
| 164 | Asphyxia | FAERS: 10 | US FAERS | |
| 165 | Bipolar Disorder | FAERS: 10 | CTD OFFSIDES US FAERS | |
| 166 | Drug administration error | FAERS: 10 | US FAERS | |
| 167 | Foreign body sensation in eyes | FAERS: 10 | US FAERS | |
| 168 | General physical health deterioration | FAERS: 10 | US FAERS | |
| 169 | Muscle Rigidity | FAERS: 10 | SIDER US FAERS | |
| 170 | Oromandibular dystonia | FAERS: 10 | US FAERS | |
| 171 | Oropharyngeal pain | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 172 | Pancreatitis | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 173 | Psoriasis | FAERS: 10 | US FAERS | |
| 174 | Throat irritation | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 175 | Ventricular Fibrillation | FAERS: 10 | US FAERS | |
| 176 | Angina Pectoris | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 177 | Aphasia | FAERS: 9 | SIDER US FAERS | |
| 178 | Carpal Tunnel Syndrome | FAERS: 9 | US FAERS | |
| 179 | Cholelithiasis | FAERS: 9 | US FAERS | |
| 180 | Conversion disorder | FAERS: 9 | SIDER US FAERS | |
| 181 | Deep Vein Thrombosis | FAERS: 9 | US FAERS | |
| 182 | Hallucinations, mixed | FAERS: 9 | US FAERS | |
| 183 | Hunger | FAERS: 9 | US FAERS | |
| 184 | Hyperreflexia | FAERS: 9 | OFFSIDES US FAERS | |
| 185 | Iritis | FAERS: 9 | US FAERS | |
| 186 | Irritable Bowel Syndrome | FAERS: 9 | US FAERS | |
| 187 | Ketoacidosis | FAERS: 9 | US FAERS | |
| 188 | Male Orgasmic Disorder | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 189 | Polyhydramnios | FAERS: 9 | US FAERS | |
| 190 | Premature Ejaculation | FAERS: 9 | SIDER US FAERS | |
| 191 | Respiratory Failure | FAERS: 9 | SIDER US FAERS | |
| 192 | Tenosynovitis | FAERS: 9 | US FAERS | |
| 193 | Wheezing | FAERS: 9 | US FAERS | |
| 194 | Wrong patient received medication | FAERS: 9 | US FAERS | |
| 195 | Accidental exposure to product by child | FAERS: 8 | US FAERS | |
| 196 | Alcohol Intolerance | FAERS: 8 | US FAERS | |
| 197 | Asthma | FAERS: 8 | OFFSIDES US FAERS | |
| 198 | Burning sensation | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 199 | Cold sweat | FAERS: 8 | SIDER US FAERS | |
| 200 | Deafness Neurosensory | FAERS: 8 | US FAERS | |
| 201 | Disturbance in sexual arousal | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 202 | Dysphonia | FAERS: 8 | SIDER US FAERS | |
| 203 | Excessive eye blinking | FAERS: 8 | US FAERS | |
| 204 | Gastric ulcer | FAERS: 8 | OFFSIDES US FAERS | |
| 205 | Poisoning | FAERS: 8 | US FAERS | |
| 206 | Pre-Eclampsia | FAERS: 8 | US FAERS | |
| 207 | Strabismus | FAERS: 8 | US FAERS | |
| 208 | Stress | FAERS: 8 | OFFSIDES US FAERS | |
| 209 | Sudden death | FAERS: 8 | US FAERS | |
| 210 | Urinary hesitation | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 211 | Acne | FAERS: 7 | US FAERS | |
| 212 | Ageusia | FAERS: 7 | US FAERS | |
| 213 | Allergic colitis | FAERS: 7 | US FAERS | |
| 214 | Blood glucose fluctuation | FAERS: 7 | US FAERS | |
| 215 | Catatonia | FAERS: 7 | 9742515 | CTD US FAERS |
| 216 | Cholecystitis | FAERS: 7 | OFFSIDES US FAERS | |
| 217 | Contraindicated drug administered | FAERS: 7 | US FAERS | |
| 218 | Drug withdrawal headache | FAERS: 7 | OFFSIDES US FAERS | |
| 219 | Dysuria | FAERS: 7 | SIDER US FAERS | |
| 220 | Facial Pain | FAERS: 7 | US FAERS | |
| 221 | Fanconi Syndrome | FAERS: 7 | US FAERS | |
| 222 | Head titubation | FAERS: 7 | US FAERS | |
| 223 | Hernia | FAERS: 7 | SIDER US FAERS | |
| 224 | Hypocoagulable state | FAERS: 7 | US FAERS | |
| 225 | Hypomania | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 226 | Male sexual dysfunction | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 227 | Middle insomnia | FAERS: 7 | OFFSIDES US FAERS | |
| 228 | Mixed liver injury | FAERS: 7 | US FAERS | |
| 229 | Muscle Fatigue | FAERS: 7 | US FAERS | |
| 230 | Musculoskeletal discomfort | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 231 | Musculoskeletal stiffness | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 232 | Myocardial Infarction | FAERS: 7 | SIDER US FAERS | |
| 233 | Oculogyric crisis | FAERS: 7 | SIDER US FAERS | |
| 234 | Product use issue | FAERS: 7 | US FAERS | |
| 235 | Reflux laryngitis | FAERS: 7 | US FAERS | |
| 236 | Sudden Cardiac Death | FAERS: 7 | US FAERS | |
| 237 | Swelling | FAERS: 7 | US FAERS | |
| 238 | Tongue blistering | FAERS: 7 | OFFSIDES US FAERS | |
| 239 | Toothache | FAERS: 7 | US FAERS | |
| 240 | Transaminases increased | FAERS: 7 | US FAERS | |
| 241 | Vitreous floaters | FAERS: 7 | US FAERS | |
| 242 | Activation syndrome | FAERS: 6 | US FAERS | |
| 243 | Angle Closure Glaucoma | FAERS: 6 | SIDER US FAERS | |
| 244 | Anorexia | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 245 | Apparent life threatening event | FAERS: 6 | US FAERS | |
| 246 | Bladder pain | FAERS: 6 | SIDER US FAERS | |
| 247 | Blood potassium decreased | FAERS: 6 | OFFSIDES US FAERS | |
| 248 | Breast tenderness | FAERS: 6 | US FAERS | |
| 249 | Delusion of reference | FAERS: 6 | US FAERS | |
| 250 | Disease Progression | FAERS: 6 | OFFSIDES US FAERS | |
| 251 | Drug dispensing error | FAERS: 6 | US FAERS | |
| 252 | Drug dose omission | FAERS: 6 | US FAERS | |
| 253 | Exposure via breast milk | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 254 | Failure to Thrive | FAERS: 6 | US FAERS | |
| 255 | Gait inability | FAERS: 6 | US FAERS | |
| 256 | Impaired driving ability | FAERS: 6 | US FAERS | |
| 257 | Loss of personal independence in daily activities | FAERS: 6 | US FAERS | |
| 258 | Myopathy | FAERS: 6 | US FAERS | |
| 259 | Nasopharyngitis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 260 | Neonatal respiratory arrest | FAERS: 6 | US FAERS | |
| 261 | Panic Disorder | FAERS: 6 | CTD US FAERS | |
| 262 | Patent ductus arteriosus | FAERS: 6 | US FAERS | |
| 263 | Pregnancy | FAERS: 6 | SIDER US FAERS | |
| 264 | Pulmonary microemboli | FAERS: 6 | US FAERS | |
| 265 | Retching | FAERS: 6 | US FAERS | |
| 266 | Retroperitoneal fibrosis | FAERS: 6 | US FAERS | |
| 267 | Subacute hepatic failure | FAERS: 6 | US FAERS | |
| 268 | Tachyphrenia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 269 | Underweight | FAERS: 6 | US FAERS | |
| 270 | Unresponsive to stimuli | FAERS: 6 | OFFSIDES US FAERS | |
| 271 | Urinary Retention | FAERS: 6 | 9868574 17089079 | CTD SIDER US FAERS |
| 272 | Accidental exposure to product | FAERS: 5 | US FAERS | |
| 273 | Acute kidney injury | FAERS: 5 | 15707818 | CTD US FAERS |
| 274 | Angioedema | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 275 | Aspartate Aminotransferase Increased | FAERS: 5 | US FAERS | |
| 276 | Bipolar I disorder | FAERS: 5 | US FAERS | |
| 277 | Bronchospasm | FAERS: 5 | SIDER US FAERS | |
| 278 | Cataplexy | FAERS: 5 | US FAERS | |
| 279 | Chorea | FAERS: 5 | US FAERS | |
| 280 | Choreoathetosis | FAERS: 5 | SIDER US FAERS | |
| 281 | Dementia | FAERS: 5 | 12839368 | CTD US FAERS |
| 282 | Deprescribing error | FAERS: 5 | US FAERS | |
| 283 | Dermatitis | FAERS: 5 | SIDER US FAERS | |
| 284 | Diplopia | FAERS: 5 | SIDER US FAERS | |
| 285 | Drowning | FAERS: 5 | US FAERS | |
| 286 | Drug level increased | FAERS: 5 | US FAERS | |
| 287 | Drug screen false positive | FAERS: 5 | US FAERS | |
| 288 | Dyslexia | FAERS: 5 | US FAERS | |
| 289 | Epigastric discomfort | FAERS: 5 | US FAERS | |
| 290 | Executive dysfunction | FAERS: 5 | US FAERS | |
| 291 | Female Orgasmic Disorder | FAERS: 5 | US FAERS | |
| 292 | Hyperphagia | FAERS: 5 | US FAERS | |
| 293 | Myoglobin blood increased | FAERS: 5 | US FAERS | |
| 294 | Pain of skin | FAERS: 5 | US FAERS | |
| 295 | Patient uncooperative | FAERS: 5 | US FAERS | |
| 296 | Post-Traumatic Stress Disorder | FAERS: 5 | US FAERS | |
| 297 | Priapism | FAERS: 5 | 7884031 17327965 | CTD SIDER US FAERS |
| 298 | Product dose omission | FAERS: 5 | US FAERS | |
| 299 | Product taste abnormal | FAERS: 5 | US FAERS | |
| 300 | Product use in unapproved indication | FAERS: 5 | US FAERS | |
| 301 | Psychiatric symptom | FAERS: 5 | US FAERS | |
| 302 | Purulent discharge | FAERS: 5 | US FAERS | |
| 303 | Rash erythematous | FAERS: 5 | SIDER US FAERS | |
| 304 | Respiratory distress | FAERS: 5 | US FAERS | |
| 305 | Skin irritation | FAERS: 5 | US FAERS | |
| 306 | Therapy non-responder | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 307 | Wound infection staphylococcal | FAERS: 5 | US FAERS | |
| 308 | effusion | FAERS: 5 | US FAERS | |
| 309 | Accidental overdose | FAERS: 4 | US FAERS | |
| 310 | Alanine Aminotransferase Increased | FAERS: 4 | SIDER US FAERS | |
| 311 | Antidepressant drug clearance decreased | FAERS: 4 | US FAERS | |
| 312 | Autoscopy | FAERS: 4 | US FAERS | |
| 313 | Bedridden | FAERS: 4 | OFFSIDES US FAERS | |
| 314 | Bradycardia | FAERS: 4 | SIDER US FAERS | |
| 315 | Bronchopneumonia | FAERS: 4 | US FAERS | |
| 316 | Circumstance or information capable of leading to medication error | FAERS: 4 | US FAERS | |
| 317 | Congenital cystic kidney disease | FAERS: 4 | US FAERS | |
| 318 | Coronary artery insufficiency | FAERS: 4 | US FAERS | |
| 319 | Diplegia | FAERS: 4 | US FAERS | |
| 320 | Drug prescribing error | FAERS: 4 | US FAERS | |
| 321 | Economic problem | FAERS: 4 | OFFSIDES US FAERS | |
| 322 | Essential Tremor | FAERS: 4 | US FAERS | |
| 323 | Eye irritation | FAERS: 4 | US FAERS | |
| 324 | Facial paralysis | FAERS: 4 | US FAERS | |
| 325 | Fixed eruption | FAERS: 4 | US FAERS | |
| 326 | Gamma-Glutamyltransferase Increased | FAERS: 4 | US FAERS | |
| 327 | Gestational Diabetes | FAERS: 4 | US FAERS | |
| 328 | Glaucoma | FAERS: 4 | SIDER US FAERS | |
| 329 | Herbal interaction | FAERS: 4 | US FAERS | |
| 330 | Inappropriate affect | FAERS: 4 | US FAERS | |
| 331 | Intentional product misuse | FAERS: 4 | US FAERS | |
| 332 | Lip swelling | FAERS: 4 | US FAERS | |
| 333 | Lupus-like syndrome | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 334 | Mental status changes | FAERS: 4 | OFFSIDES US FAERS | |
| 335 | Metrorrhagia | FAERS: 4 | SIDER US FAERS | |
| 336 | Mood disorder due to a general medical condition | FAERS: 4 | US FAERS | |
| 337 | Musculoskeletal Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 338 | Myositis | FAERS: 4 | US FAERS | |
| 339 | Neuroleptic Malignant Syndrome | FAERS: 4 | SIDER US FAERS | |
| 340 | Orgasmic sensation decreased | FAERS: 4 | US FAERS | |
| 341 | Oropharyngeal swelling | FAERS: 4 | US FAERS | |
| 342 | Parotitis | FAERS: 4 | US FAERS | |
| 343 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 344 | Pneumothorax | FAERS: 4 | US FAERS | |
| 345 | Poverty of speech | FAERS: 4 | US FAERS | |
| 346 | Pulmonary Hypertension | FAERS: 4 | SIDER US FAERS | |
| 347 | Pulmonary arterial hypertension | FAERS: 4 | US FAERS | |
| 348 | Suppressed lactation | FAERS: 4 | US FAERS | |
| 349 | Therapy cessation | FAERS: 4 | US FAERS | |
| 350 | Anorexia Nervosa | FAERS: 3 | US FAERS | |
| 351 | Blood thyroid stimulating hormone increased | FAERS: 3 | US FAERS | |
| 352 | Borderline Personality Disorder | FAERS: 3 | OFFSIDES US FAERS | |
| 353 | Congenital diaphragmatic hernia | FAERS: 3 | US FAERS | |
| 354 | Contraindicated product administered | FAERS: 3 | US FAERS | |
| 355 | Deafness | FAERS: 3 | OFFSIDES US FAERS | |
| 356 | Diabetes Insipidus | FAERS: 3 | US FAERS | |
| 357 | Diffuse alveolar damage | FAERS: 3 | US FAERS | |
| 358 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 359 | Drug level below therapeutic | FAERS: 3 | US FAERS | |
| 360 | Drug resistance | FAERS: 3 | US FAERS | |
| 361 | Drug toxicity | FAERS: 3 | US FAERS | |
| 362 | Dyspareunia | FAERS: 3 | US FAERS | |
| 363 | Ecchymosis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 364 | Erection increased | FAERS: 3 | US FAERS | |
| 365 | Erythropenia | FAERS: 3 | US FAERS | |
| 366 | Extra dose administered | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 367 | Food craving | FAERS: 3 | US FAERS | |
| 368 | Glucocorticoid deficiency | FAERS: 3 | US FAERS | |
| 369 | Gluten sensitivity | FAERS: 3 | US FAERS | |
| 370 | Hypogeusia | FAERS: 3 | US FAERS | |
| 371 | Initial insomnia | FAERS: 3 | US FAERS | |
| 372 | Intentional drug misuse | FAERS: 3 | US FAERS | |
| 373 | Leukopenia | FAERS: 3 | SIDER US FAERS | |
| 374 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 375 | Malaria | FAERS: 3 | US FAERS | |
| 376 | Monoplegia | FAERS: 3 | US FAERS | |
| 377 | Multiple Sclerosis | FAERS: 3 | OFFSIDES US FAERS | |
| 378 | Negative thoughts | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 379 | Neuralgia | FAERS: 3 | US FAERS | |
| 380 | Nocturia | FAERS: 3 | SIDER US FAERS | |
| 381 | Partner stress | FAERS: 3 | US FAERS | |
| 382 | Personality Change | FAERS: 3 | US FAERS | |
| 383 | Physical assault | FAERS: 3 | US FAERS | |
| 384 | Platelet aggregation abnormal | FAERS: 3 | US FAERS | |
| 385 | Platelet function test abnormal | FAERS: 3 | US FAERS | |
| 386 | Poor sucking reflex | FAERS: 3 | US FAERS | |
| 387 | Premenstrual Dysphoric Disorder | FAERS: 3 | US FAERS | |
| 388 | Product solubility abnormal | FAERS: 3 | US FAERS | |
| 389 | Psychotic symptom | FAERS: 3 | US FAERS | |
| 390 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 391 | Pulmonary Fibrosis | FAERS: 3 | US FAERS | |
| 392 | Pupillary light reflex tests abnormal | FAERS: 3 | US FAERS | |
| 393 | Quality of life decreased | FAERS: 3 | US FAERS | |
| 394 | Spermatozoa progressive motility decreased | FAERS: 3 | US FAERS | |
| 395 | Stomatitis | FAERS: 3 | SIDER US FAERS | |
| 396 | Suspected counterfeit product | FAERS: 3 | US FAERS | |
| 397 | Tension Headache | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 398 | Thirst | FAERS: 3 | SIDER US FAERS | |
| 399 | Thrombocytopenia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 400 | Thrombosis | FAERS: 3 | US FAERS | |
| 401 | Tongue discomfort | FAERS: 3 | US FAERS | |
| 402 | Unmasking of previously unidentified disease | FAERS: 3 | US FAERS | |
| 403 | Urine sodium abnormal | FAERS: 3 | US FAERS | |
| 404 | Vasospasm | FAERS: 3 | US FAERS | |
| 405 | Visual brightness | FAERS: 3 | US FAERS | |
| 406 | treatment failure | FAERS: 3 | US FAERS | |
| 407 | Action Tremor | FAERS: 2 | US FAERS | |
| 408 | Acute Lung Injury | FAERS: 2 | US FAERS | |
| 409 | Acute myocardial infarction | FAERS: 2 | OFFSIDES US FAERS | |
| 410 | Alopecia Areata | FAERS: 2 | US FAERS | |
| 411 | Anticholinergic Syndrome | FAERS: 2 | OFFSIDES US FAERS | |
| 412 | Antiphospholipid Syndrome | FAERS: 2 | US FAERS | |
| 413 | Aphagia | FAERS: 2 | US FAERS | |
| 414 | Apparent death | FAERS: 2 | US FAERS | |
| 415 | Arteriosclerosis | FAERS: 2 | OFFSIDES US FAERS | |
| 416 | Ascites | FAERS: 2 | OFFSIDES US FAERS | |
| 417 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 418 | Bradykinesia | FAERS: 2 | US FAERS | |
| 419 | Cardiac discomfort | FAERS: 2 | US FAERS | |
| 420 | Choking | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 421 | Cleft Palate | FAERS: 2 | OFFSIDES US FAERS | |
| 422 | Clumsiness | FAERS: 2 | US FAERS | |
| 423 | Congenital urinary tract obstruction | FAERS: 2 | US FAERS | |
| 424 | Consciousness fluctuating | FAERS: 2 | US FAERS | |
| 425 | Disability | FAERS: 2 | US FAERS | |
| 426 | Diverticulum | FAERS: 2 | OFFSIDES US FAERS | |
| 427 | Drooling | FAERS: 2 | US FAERS | |
| 428 | Drug dose titration not performed | FAERS: 2 | US FAERS | |
| 429 | Drug exposure via breast milk | FAERS: 2 | US FAERS | |
| 430 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 431 | Drug screen positive | FAERS: 2 | OFFSIDES US FAERS | |
| 432 | Dysphemia | FAERS: 2 | US FAERS | |
| 433 | Educational problem | FAERS: 2 | US FAERS | |
| 434 | Electroencephalogram abnormal | FAERS: 2 | US FAERS | |
| 435 | Encephalomyelitis | FAERS: 2 | US FAERS | |
| 436 | Enuresis | FAERS: 2 | SIDER US FAERS | |
| 437 | Eructation | FAERS: 2 | SIDER US FAERS | |
| 438 | Feeling of body temperature change | FAERS: 2 | OFFSIDES US FAERS | |
| 439 | Feelings of worthlessness | FAERS: 2 | US FAERS | |
| 440 | Food Allergy | FAERS: 2 | US FAERS | |
| 441 | Formication | FAERS: 2 | OFFSIDES US FAERS | |
| 442 | Frustration tolerance decreased | FAERS: 2 | US FAERS | |
| 443 | Gastric Bypass | FAERS: 2 | US FAERS | |
| 444 | Glycosuria | FAERS: 2 | US FAERS | |
| 445 | Hyperparathyroidism | FAERS: 2 | OFFSIDES US FAERS | |
| 446 | Impaired quality of life | FAERS: 2 | US FAERS | |
| 447 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 448 | Increased tendency to bruise | FAERS: 2 | US FAERS | |
| 449 | Joint injury | FAERS: 2 | US FAERS | |
| 450 | Lipase increased | FAERS: 2 | US FAERS | |
| 451 | Low birth weight baby | FAERS: 2 | US FAERS | |
| 452 | Lymphomatoid Papulosis | FAERS: 2 | US FAERS | |
| 453 | Lymphopenia | FAERS: 2 | US FAERS | |
| 454 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 455 | Maternal exposure timing unspecified | FAERS: 2 | US FAERS | |
| 456 | Metamorphopsia | FAERS: 2 | US FAERS | |
| 457 | Motion Sickness | FAERS: 2 | US FAERS | |
| 458 | Muscle strain | FAERS: 2 | OFFSIDES US FAERS | |
| 459 | Muscle tone disorder | FAERS: 2 | US FAERS | |
| 460 | Mycosis Fungoides | FAERS: 2 | US FAERS | |
| 461 | N-terminal prohormone brain natriuretic peptide | FAERS: 2 | US FAERS | |
| 462 | Neonatal disorder | FAERS: 2 | US FAERS | |
| 463 | Neonatal respiratory distress | FAERS: 2 | US FAERS | |
| 464 | Neonatal respiratory failure | FAERS: 2 | US FAERS | |
| 465 | Nystagmus | FAERS: 2 | SIDER US FAERS | |
| 466 | Oliguria | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 467 | Oral pain | FAERS: 2 | US FAERS | |
| 468 | Otitis Media | FAERS: 2 | SIDER US FAERS | |
| 469 | Pallor | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 470 | Pelvic discomfort | FAERS: 2 | US FAERS | |
| 471 | Performance status decreased | FAERS: 2 | US FAERS | |
| 472 | Pharyngeal swelling | FAERS: 2 | US FAERS | |
| 473 | Phimosis | FAERS: 2 | US FAERS | |
| 474 | Pneumonia | FAERS: 2 | US FAERS | |
| 475 | Product administration error | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 476 | Product label issue | FAERS: 2 | US FAERS | |
| 477 | Product physical issue | FAERS: 2 | US FAERS | |
| 478 | Product prescribing error | FAERS: 2 | US FAERS | |
| 479 | Product shape issue | FAERS: 2 | US FAERS | |
| 480 | Purpura | FAERS: 2 | SIDER US FAERS | |
| 481 | Retinoschisis | FAERS: 2 | US FAERS | |
| 482 | Reversible cerebral vasoconstriction syndrome | FAERS: 2 | SIDER US FAERS | |
| 483 | Screaming | FAERS: 2 | US FAERS | |
| 484 | Sinusitis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 485 | Somnambulism | FAERS: 2 | SIDER US FAERS | |
| 486 | Status Epilepticus | FAERS: 2 | US FAERS | |
| 487 | Talipes | FAERS: 2 | US FAERS | |
| 488 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 489 | Trisomy 21 | FAERS: 2 | US FAERS | |
| 490 | Vaginal Discharge | FAERS: 2 | SIDER US FAERS | |
| 491 | Visual disturbance | FAERS: 2 | OFFSIDES US FAERS | |
| 492 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 493 | Wrong technique in drug usage process | FAERS: 2 | OFFSIDES US FAERS | |
| 494 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 495 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 496 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 497 | Acute fatty liver of pregnancy | FAERS: 1 | US FAERS | |
| 498 | Adactyly | FAERS: 1 | US FAERS | |
| 499 | Alcohol Use Disorder | FAERS: 1 | US FAERS | |
| 500 | Alopecia totalis | FAERS: 1 | US FAERS | |
| 501 | Amniotic fluid volume increased | FAERS: 1 | US FAERS | |
| 502 | Amylase increased | FAERS: 1 | US FAERS | |
| 503 | Anal Fissure | FAERS: 1 | OFFSIDES US FAERS | |
| 504 | Anaphylactic shock | FAERS: 1 | SIDER US FAERS | |
| 505 | Anti-transglutaminase antibody | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 506 | Aorticopulmonary Septal Defect | FAERS: 1 | US FAERS | |
| 507 | Aphonia | FAERS: 1 | US FAERS | |
| 508 | Atelectasis | FAERS: 1 | OFFSIDES US FAERS | |
| 509 | Atrioventricular Block | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 510 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 511 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 512 | Aversion | FAERS: 1 | US FAERS | |
| 513 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 514 | Bipolar II disorder | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 515 | Bladder spasm | FAERS: 1 | US FAERS | |
| 516 | Blepharitis | FAERS: 1 | US FAERS | |
| 517 | Blood albumin decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 518 | Blood blister | FAERS: 1 | OFFSIDES US FAERS | |
| 519 | Blood creatinine increased | FAERS: 1 | OFFSIDES US FAERS | |
| 520 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 521 | Blood pressure fluctuation | FAERS: 1 | OFFSIDES US FAERS | |
| 522 | Blood prolactin increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 523 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 524 | Blood triglycerides increased | FAERS: 1 | OFFSIDES US FAERS | |
| 525 | Blood urea increased | FAERS: 1 | US FAERS | |
| 526 | Blood urine present | FAERS: 1 | US FAERS | |
| 527 | Breast Feeding | FAERS: 1 | SIDER US FAERS | |
| 528 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 529 | Bulimia Nervosa | FAERS: 1 | US FAERS | |
| 530 | Bursitis | FAERS: 1 | OFFSIDES US FAERS | |
| 531 | CHARGE Syndrome | FAERS: 1 | US FAERS | |
| 532 | Carbon Monoxide Poisoning | FAERS: 1 | US FAERS | |
| 533 | Cellulitis | FAERS: 1 | OFFSIDES US FAERS | |
| 534 | Cerebral atrophy | FAERS: 1 | OFFSIDES US FAERS | |
| 535 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 536 | Clonus | FAERS: 1 | OFFSIDES US FAERS | |
| 537 | Cogwheel Rigidity | FAERS: 1 | US FAERS | |
| 538 | Compulsive shopping | FAERS: 1 | OFFSIDES US FAERS | |
| 539 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 540 | Confabulation | FAERS: 1 | OFFSIDES US FAERS | |
| 541 | Congenital Hydrocephalus | FAERS: 1 | US FAERS | |
| 542 | Congenital absence of cranial vault | FAERS: 1 | US FAERS | |
| 543 | Craniosynostosis | FAERS: 1 | OFFSIDES US FAERS | |
| 544 | Cyanosis | FAERS: 1 | US FAERS | |
| 545 | Diabetes Mellitus | FAERS: 1 | SIDER US FAERS | |
| 546 | Diaphragmatic Hernia | FAERS: 1 | US FAERS | |
| 547 | Dissociative disorder | FAERS: 1 | US FAERS | |
| 548 | Double Outlet Right Ventricle | FAERS: 1 | US FAERS | |
| 549 | Dreamy state | FAERS: 1 | US FAERS | |
| 550 | Drug diversion | FAERS: 1 | US FAERS | |
| 551 | Drug effect variable | FAERS: 1 | US FAERS | |
| 552 | Drug level decreased | FAERS: 1 | US FAERS | |
| 553 | Drug-disease interaction | FAERS: 1 | US FAERS | |
| 554 | Dysmorphism | FAERS: 1 | OFFSIDES US FAERS | |
| 555 | Ear discomfort | FAERS: 1 | US FAERS | |
| 556 | Eczema | FAERS: 1 | SIDER US FAERS | |
| 557 | Electrocardiogram poor R-wave progression | FAERS: 1 | US FAERS | |
| 558 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 559 | Elevated mood | FAERS: 1 | US FAERS | |
| 560 | Eosinophilia | FAERS: 1 | US FAERS | |
| 561 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 562 | Epidermolysis Bullosa | FAERS: 1 | US FAERS | |
| 563 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 564 | Feeding disorder neonatal | FAERS: 1 | US FAERS | |
| 565 | Female sexual arousal disorder | FAERS: 1 | US FAERS | |
| 566 | Flank Pain | FAERS: 1 | US FAERS | |
| 567 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 568 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 569 | Frustration | FAERS: 1 | US FAERS | |
| 570 | Gastroschisis | FAERS: 1 | US FAERS | |
| 571 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 572 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 573 | Growth retardation | FAERS: 1 | US FAERS | |
| 574 | Hemiplegia | FAERS: 1 | US FAERS | |
| 575 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 576 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 577 | Histamine intolerance | FAERS: 1 | US FAERS | |
| 578 | Histone antibody positive | FAERS: 1 | US FAERS | |
| 579 | Hostility | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 580 | Hyperacusis | FAERS: 1 | SIDER US FAERS | |
| 581 | Hyperplasia | FAERS: 1 | SIDER US FAERS | |
| 582 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 583 | Hypervigilance | FAERS: 1 | US FAERS | |
| 584 | Hypoaesthesia facial | FAERS: 1 | OFFSIDES US FAERS | |
| 585 | Hypochondriasis | FAERS: 1 | US FAERS | |
| 586 | Hypoxia | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 587 | Illiteracy | FAERS: 1 | US FAERS | |
| 588 | Immobile | FAERS: 1 | OFFSIDES US FAERS | |
| 589 | Impaired gastric emptying | FAERS: 1 | OFFSIDES US FAERS | |
| 590 | Impatience | FAERS: 1 | US FAERS | |
| 591 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 592 | Incontinence | FAERS: 1 | OFFSIDES US FAERS | |
| 593 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 594 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 595 | Increased viscosity of bronchial secretion | FAERS: 1 | US FAERS | |
| 596 | Infection | FAERS: 1 | OFFSIDES US FAERS | |
| 597 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 598 | Infertility | FAERS: 1 | US FAERS | |
| 599 | Influenza | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 600 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 601 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 602 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 603 | Iodine deficiency | FAERS: 1 | US FAERS | |
| 604 | Laceration | FAERS: 1 | US FAERS | |
| 605 | Laziness | FAERS: 1 | US FAERS | |
| 606 | Limb injury | FAERS: 1 | US FAERS | |
| 607 | Long QT Syndrome | FAERS: 1 | US FAERS | |
| 608 | Lung cyst | FAERS: 1 | US FAERS | |
| 609 | Lymphadenopathy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 610 | Lymphocyte percentage decreased | FAERS: 1 | US FAERS | |
| 611 | Mallory-Weiss Syndrome | FAERS: 1 | US FAERS | |
| 612 | Maternal exposure during breast feeding | FAERS: 1 | US FAERS | |
| 613 | Mechanical ventilation | FAERS: 1 | OFFSIDES US FAERS | |
| 614 | Meconium Aspiration Syndrome | FAERS: 1 | US FAERS | |
| 615 | Medication monitoring error | FAERS: 1 | US FAERS | |
| 616 | Medication residue present | FAERS: 1 | US FAERS | |
| 617 | Mouth swelling | FAERS: 1 | US FAERS | |
| 618 | Multiple drug overdose intentional | FAERS: 1 | OFFSIDES US FAERS | |
| 619 | Myocarditis | FAERS: 1 | US FAERS | |
| 620 | Narcolepsy | FAERS: 1 | US FAERS | |
| 621 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 622 | Neonatal respiratory depression | FAERS: 1 | US FAERS | |
| 623 | Neutrophil count abnormal | FAERS: 1 | US FAERS | |
| 624 | Obesity | FAERS: 1 | 9183245 | CTD US FAERS |
| 625 | Ocular Toxicity | FAERS: 1 | US FAERS | |
| 626 | Ocular icterus | FAERS: 1 | US FAERS | |
| 627 | Opisthotonus | FAERS: 1 | US FAERS | |
| 628 | Oppositional Defiant Disorder | FAERS: 1 | US FAERS | |
| 629 | Optic Neuritis | FAERS: 1 | SIDER US FAERS | |
| 630 | Oral mucosal erythema | FAERS: 1 | OFFSIDES US FAERS | |
| 631 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 632 | Oropharyngeal scar | FAERS: 1 | US FAERS | |
| 633 | Osteopenia | FAERS: 1 | OFFSIDES US FAERS | |
| 634 | Ototoxicity | FAERS: 1 | OFFSIDES US FAERS | |
| 635 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 636 | Papule | FAERS: 1 | US FAERS | |
| 637 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 638 | Pelvic Floor Muscle Weakness | FAERS: 1 | US FAERS | |
| 639 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 640 | Penile swelling | FAERS: 1 | US FAERS | |
| 641 | Perseveration | FAERS: 1 | US FAERS | |
| 642 | Petechiae | FAERS: 1 | US FAERS | |
| 643 | Plasmapheresis | FAERS: 1 | US FAERS | |
| 644 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 645 | Pleurothotonus | FAERS: 1 | US FAERS | |
| 646 | Polydipsia | FAERS: 1 | US FAERS | |
| 647 | Poor feeding infant | FAERS: 1 | US FAERS | |
| 648 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 649 | Post lumbar puncture syndrome | FAERS: 1 | US FAERS | |
| 650 | Post procedural complication | FAERS: 1 | US FAERS | |
| 651 | Postural Orthostatic Tachycardia Syndrome | FAERS: 1 | US FAERS | |
| 652 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 653 | Preictal state | FAERS: 1 | US FAERS | |
| 654 | Premature Menopause | FAERS: 1 | US FAERS | |
| 655 | Premenstrual syndrome | FAERS: 1 | US FAERS | |
| 656 | Product coating issue | FAERS: 1 | US FAERS | |
| 657 | Product dispensing error | FAERS: 1 | US FAERS | |
| 658 | Product formulation issue | FAERS: 1 | US FAERS | |
| 659 | Product preparation issue | FAERS: 1 | US FAERS | |
| 660 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 661 | Product size issue | FAERS: 1 | US FAERS | |
| 662 | Product storage error | FAERS: 1 | US FAERS | |
| 663 | Product substitution | FAERS: 1 | US FAERS | |
| 664 | Product substitution error | FAERS: 1 | US FAERS | |
| 665 | Product use complaint | FAERS: 1 | US FAERS | |
| 666 | Psychogenic seizure | FAERS: 1 | US FAERS | |
| 667 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 668 | Rales | FAERS: 1 | US FAERS | |
| 669 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 670 | Renal pain | FAERS: 1 | SIDER US FAERS | |
| 671 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 672 | Retinal depigmentation | FAERS: 1 | US FAERS | |
| 673 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 674 | Rubella antibody positive | FAERS: 1 | US FAERS | |
| 675 | Schizoaffective Disorder | FAERS: 1 | US FAERS | |
| 676 | School refusal | FAERS: 1 | US FAERS | |
| 677 | Secretion discharge | FAERS: 1 | US FAERS | |
| 678 | Selective eating disorder | FAERS: 1 | US FAERS | |
| 679 | Sepsis | FAERS: 1 | US FAERS | |
| 680 | Serratia test positive | FAERS: 1 | US FAERS | |
| 681 | Sexual Aversion Disorder | FAERS: 1 | US FAERS | |
| 682 | Sexual abuse | FAERS: 1 | US FAERS | |
| 683 | Sexual relationship change | FAERS: 1 | US FAERS | |
| 684 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 685 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 686 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 687 | Skin lesion | FAERS: 1 | OFFSIDES US FAERS | |
| 688 | Skin tightness | FAERS: 1 | US FAERS | |
| 689 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 690 | Sleep inertia | FAERS: 1 | US FAERS | |
| 691 | Sluggishness | FAERS: 1 | US FAERS | |
| 692 | Sneezing | FAERS: 1 | US FAERS | |
| 693 | Sperm concentration decreased | FAERS: 1 | US FAERS | |
| 694 | Spermatozoa abnormal | FAERS: 1 | US FAERS | |
| 695 | Splenomegaly | FAERS: 1 | US FAERS | |
| 696 | Spontaneous penile erection | FAERS: 1 | US FAERS | |
| 697 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 698 | Staring | FAERS: 1 | US FAERS | |
| 699 | Steatohepatitis | FAERS: 1 | US FAERS | |
| 700 | Struck by lightning | FAERS: 1 | US FAERS | |
| 701 | Stupor | FAERS: 1 | SIDER US FAERS | |
| 702 | Tattoo | FAERS: 1 | US FAERS | |
| 703 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 704 | Therapeutic response changed | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 705 | Therapy change | FAERS: 1 | US FAERS | |
| 706 | Thirst decreased | FAERS: 1 | US FAERS | |
| 707 | Tongue biting | FAERS: 1 | US FAERS | |
| 708 | Tongue eruption | FAERS: 1 | US FAERS | |
| 709 | Tooth Infection | FAERS: 1 | OFFSIDES US FAERS | |
| 710 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 711 | Transmission of drug via semen | FAERS: 1 | US FAERS | |
| 712 | Urge Incontinence | FAERS: 1 | US FAERS | |
| 713 | Vascular calcification | FAERS: 1 | OFFSIDES US FAERS | |
| 714 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 715 | Vertebral artery hypoplasia | FAERS: 1 | US FAERS | |
| 716 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 717 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 718 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 719 | Abdominal Infection | OFFSIDES | ||
| 720 | Abdominal adhesions | OFFSIDES | ||
| 721 | Abdominal mass | OFFSIDES | ||
| 722 | Abdominal strangulated hernia | OFFSIDES | ||
| 723 | Abnormal cervical smear | OFFSIDES | ||
| 724 | Abnormal vision | SIDER | ||
| 725 | Abuse | OFFSIDES | ||
| 726 | Acid reflux | OFFSIDES | ||
| 727 | Acromegaly | OFFSIDES | ||
| 728 | Actinic keratosis | OFFSIDES | ||
| 729 | Actinomycosis | OFFSIDES | ||
| 730 | Acute Coronary Syndrome | SIDER | ||
| 731 | Acute respiratory failure | OFFSIDES | ||
| 732 | Acute sinusitis | OFFSIDES | ||
| 733 | Adenitis | OFFSIDES | ||
| 734 | Affective Disorders, Psychotic | 9853693 | CTD | |
| 735 | Aggressive reaction | SIDER | ||
| 736 | Agitation postoperative | OFFSIDES | ||
| 737 | Agranulocytosis | SIDER | ||
| 738 | Agraphia | OFFSIDES | ||
| 739 | Akathisia, Drug-Induced | 24568368 | CTD | |
| 740 | Alcohol-Related Disorders | 22164246 | CTD | |
| 741 | Alveoloplasty | OFFSIDES | ||
| 742 | Amenorrhea | 17414262 | CTD | |
| 743 | Amphetamines | OFFSIDES | ||
| 744 | Analgesia | OFFSIDES | ||
| 745 | Anaphylactoid Reaction | SIDER | ||
| 746 | Androgens decreased | OFFSIDES | ||
| 747 | Aneurysm | OFFSIDES | ||
| 748 | Anisocoria | 7819940 | CTD | |
| 749 | Anorectal discomfort | SIDER | ||
| 750 | Anoxic Encephalopathy | OFFSIDES | ||
| 751 | Anticonvulsant drug level below therapeutic | OFFSIDES | ||
| 752 | Antinuclear antibody increased | OFFSIDES | ||
| 753 | Anxiety Disorders | CTD | ||
| 754 | Aortic Aneurysm | OFFSIDES | ||
| 755 | Aphthous Stomatitis | SIDER | ||
| 756 | Arteriovenous fistula thrombosis | OFFSIDES | ||
| 757 | Arthritis | OFFSIDES | ||
| 758 | Arthropathy | OFFSIDES SIDER | ||
| 759 | Artificial crown procedure | OFFSIDES | ||
| 760 | Asbestosis | OFFSIDES | ||
| 761 | Aspergillosis | OFFSIDES | ||
| 762 | Ataxia | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 763 | Atherosclerosis | OFFSIDES | ||
| 764 | Atrial arrhythmia | SIDER | ||
| 765 | Atrial tachycardia | OFFSIDES | ||
| 766 | Atrophic vulvovaginitis | SIDER | ||
| 767 | Aura | OFFSIDES | ||
| 768 | Autistic Disorder | 18775368 | CTD | |
| 769 | Autonomic neuropathy | SIDER | ||
| 770 | BREAST PAIN FEMALE | SIDER | ||
| 771 | Bacteria tissue specimen identified | OFFSIDES | ||
| 772 | Balanoposthitis | SIDER | ||
| 773 | Basal Ganglia Diseases | 9723116 11869410 | CTD | |
| 774 | Benign Neoplasm | SIDER | ||
| 775 | Biopsy bladder abnormal | OFFSIDES | ||
| 776 | Biopsy | OFFSIDES | ||
| 777 | Bladder neck obstruction | OFFSIDES | ||
| 778 | Blood 1,25-dihydroxycholecalciferol decreased | OFFSIDES | ||
| 779 | Blood Glucose | OFFSIDES | ||
| 780 | Blood amylase increased | OFFSIDES | ||
| 781 | Blood and lymphatic system disorders | SIDER | ||
| 782 | Blood antidiuretic hormone decreased | OFFSIDES | ||
| 783 | Blood cannabinoids | Canada Vigilance: 1 | Canada Vigilance | |
| 784 | Blood chloride decreased | OFFSIDES | ||
| 785 | Blood cholesterol abnormal | OFFSIDES | ||
| 786 | Blood cholesterol increased | SIDER | ||
| 787 | Blood cholesterol | OFFSIDES | ||
| 788 | Blood glucose decreased | OFFSIDES | ||
| 789 | Blood immunoglobulin A decreased | OFFSIDES | ||
| 790 | Blood immunoglobulin G increased | OFFSIDES | ||
| 791 | Blood immunoglobulin M decreased | OFFSIDES | ||
| 792 | Blood potassium increased | OFFSIDES | ||
| 793 | Blood sodium | OFFSIDES | ||
| 794 | Blood triglycerides | OFFSIDES | ||
| 795 | Blurred vision | OFFSIDES | ||
| 796 | Bone density decreased | OFFSIDES | ||
| 797 | Bone density increased | OFFSIDES | ||
| 798 | Bone erosion | OFFSIDES | ||
| 799 | Bone lesion | OFFSIDES | ||
| 800 | Bone scan abnormal | OFFSIDES | ||
| 801 | Bone trimming | OFFSIDES | ||
| 802 | Brain Death | OFFSIDES | ||
| 803 | Brain Edema | 19782326 | CTD | |
| 804 | Bronchitis | OFFSIDES SIDER | ||
| 805 | Bullous eruption | SIDER | ||
| 806 | Call-Fleming syndrome | SIDER | ||
| 807 | Cardiac infection | OFFSIDES | ||
| 808 | Carotid bruit | OFFSIDES | ||
| 809 | Carotid pulse decreased | OFFSIDES | ||
| 810 | Cartilage injury | OFFSIDES | ||
| 811 | Cataract | OFFSIDES SIDER | ||
| 812 | Catheter related infection | OFFSIDES | ||
| 813 | Catheter site erythema | OFFSIDES | ||
| 814 | Causalgia | OFFSIDES | ||
| 815 | Central venous catheter removal | OFFSIDES | ||
| 816 | Cerebral vasoconstriction | SIDER | ||
| 817 | Chemical and Drug Induced Liver Injury | 10048942 15930079 22387747 | CTD | |
| 818 | Choking sensation | OFFSIDES | ||
| 819 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 820 | Chronic respiratory failure | OFFSIDES | ||
| 821 | Chronic sinusitis | OFFSIDES | ||
| 822 | Cirrhosis | OFFSIDES | ||
| 823 | Clostridium colitis | OFFSIDES | ||
| 824 | Clostridium difficile colitis | OFFSIDES | ||
| 825 | Cocaine-Related Disorders | 15730354 | CTD | |
| 826 | Cognition Disorders | 19996254 | CTD | |
| 827 | Colitis | SIDER | ||
| 828 | Colon adenoma | OFFSIDES | ||
| 829 | Compression fracture | OFFSIDES | ||
| 830 | Compulsive Personality Disorder | SIDER | ||
| 831 | Concomitant disease progression | OFFSIDES | ||
| 832 | Confusion | 9048728 | CTD | |
| 833 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 834 | Conjunctivitis | SIDER | ||
| 835 | Cramps of lower extremities | SIDER | ||
| 836 | Cystitis | SIDER | ||
| 837 | Cystocele | OFFSIDES | ||
| 838 | Debridement | OFFSIDES | ||
| 839 | Decreased Libido | OFFSIDES | ||
| 840 | Demyelination | OFFSIDES | ||
| 841 | Dental Fistula | OFFSIDES | ||
| 842 | Dental abscess | OFFSIDES | ||
| 843 | Dental caries | OFFSIDES SIDER | ||
| 844 | Dental prosthesis user | OFFSIDES | ||
| 845 | Denture wearer | OFFSIDES | ||
| 846 | Depression aggravated | SIDER | ||
| 847 | Depression, Postpartum | 15229064 | CTD | |
| 848 | Depressive disorder |
1806626
2258378 7726327 7819940 8166325 8195456 8659626 8743774 8840377 9256580 9448656 9532352 9832348 10347338 10363731 11062791 11235924 11816261 12586234 15014590 15708425 15766301 15819475 15932816 16089243 16239768 16337893 16636635 16741197 16880481 17089079 17630870 18072985 18780003 18822694 19736359 20305041 22387747 24194395 24865413 26952715 | CTD | |
| 849 | Device breakage | OFFSIDES | ||
| 850 | Diabetes | OFFSIDES | ||
| 851 | Diabetes Mellitus, Experimental | 26593071 | CTD | |
| 852 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 853 | Diabetic Foot | OFFSIDES | ||
| 854 | Diabetic Nephropathy | OFFSIDES | ||
| 855 | Diabetic Retinopathy | OFFSIDES | ||
| 856 | Diabetic foot infection | OFFSIDES | ||
| 857 | Diabetic gastropathy | OFFSIDES | ||
| 858 | Diarrhea | CTD OFFSIDES | ||
| 859 | Diuresis | SIDER | ||
| 860 | Diverticulitis | OFFSIDES SIDER | ||
| 861 | Diverticulosis | OFFSIDES | ||
| 862 | Drowsiness | SIDER | ||
| 863 | Drug addict | OFFSIDES | ||
| 864 | Duodenal Obstruction | OFFSIDES | ||
| 865 | Duodenal Ulcer | OFFSIDES | ||
| 866 | Duodenitis | OFFSIDES | ||
| 867 | Dysmenorrhea | OFFSIDES | ||
| 868 | Dysphasia | SIDER | ||
| 869 | Dysthymic Disorder | OFFSIDES | ||
| 870 | Ear and labyrinth disorders | SIDER | ||
| 871 | Ear discharge | OFFSIDES | ||
| 872 | Endodontic procedure | OFFSIDES | ||
| 873 | Enlargement abdomen | SIDER | ||
| 874 | Enterocele | OFFSIDES | ||
| 875 | Enzyme Induction | SIDER | ||
| 876 | Epidural Abscess | OFFSIDES | ||
| 877 | Epidural lipomatosis | OFFSIDES | ||
| 878 | Erosive gastritis | OFFSIDES | ||
| 879 | Esophageal Stenosis | OFFSIDES | ||
| 880 | Excoriation | OFFSIDES | ||
| 881 | Exophthalmos | SIDER | ||
| 882 | Eyelid Diseases | OFFSIDES | ||
| 883 | Fatty Liver | OFFSIDES | ||
| 884 | Febrile Neutropenia | OFFSIDES | ||
| 885 | Female sexual dysfunction | SIDER | ||
| 886 | Femoral arterial stenosis | OFFSIDES | ||
| 887 | Fibromyalgia | OFFSIDES | ||
| 888 | Fistula repair | OFFSIDES | ||
| 889 | Fluid replacement | OFFSIDES | ||
| 890 | Fracture | Canada Vigilance: 2 | Canada Vigilance SIDER | |
| 891 | Fungal rash | OFFSIDES | ||
| 892 | Gallop rhythm present | OFFSIDES | ||
| 893 | Gambling | OFFSIDES | ||
| 894 | Gangrene | OFFSIDES | ||
| 895 | Gastroenteritis | SIDER | ||
| 896 | Gastrointestinal Diseases | 2258378 9832348 10596735 | CTD | |
| 897 | Gastrointestinal arteriovenous malformation | OFFSIDES | ||
| 898 | Gingival Hyperplasia | SIDER | ||
| 899 | Gingivectomy | OFFSIDES | ||
| 900 | Glossitis | SIDER | ||
| 901 | Gout | OFFSIDES | ||
| 902 | Hallucinations | 9864082 11210406 15096091 | CTD | |
| 903 | Hematuria | 16337893 | CTD | |
| 904 | Hemoptysis | 16337893 | CTD | |
| 905 | Hepatitis B | OFFSIDES | ||
| 906 | Hepatitis C | OFFSIDES | ||
| 907 | Hepatocellular Adenoma | SIDER | ||
| 908 | Hepatomegaly | SIDER | ||
| 909 | Hernia obstructive | OFFSIDES | ||
| 910 | Hip surgery | OFFSIDES | ||
| 911 | Huntington Disease | 18403212 | CTD | |
| 912 | Hyperglycemia | 26593071 | CTD | |
| 913 | Hyperkinesia | SIDER | ||
| 914 | Hyperpigmentation | OFFSIDES | ||
| 915 | Hypertension worsened | SIDER | ||
| 916 | Hypertensive emergency | OFFSIDES | ||
| 917 | Hypertrichosis | SIDER | ||
| 918 | Hypertrophy | SIDER | ||
| 919 | Hypogonadism | 29850907 | CTD | |
| 920 | Hypokinesia | OFFSIDES SIDER | ||
| 921 | Hyponatremia | 8166325 8804257 | CTD | |
| 922 | Hypophagia | OFFSIDES | ||
| 923 | Hyporeflexia | SIDER | ||
| 924 | Hypotension, Orthostatic | 8840377 | CTD | |
| 925 | Hypoventilation | SIDER | ||
| 926 | Hysterectomy | OFFSIDES | ||
| 927 | Hysteria | SIDER | ||
| 928 | Incorrect drug administration duration | OFFSIDES | ||
| 929 | Infusion site mobility decreased | OFFSIDES | ||
| 930 | Injection site scar | OFFSIDES | ||
| 931 | Insulin Resistance | 17728140 26593071 | CTD | |
| 932 | Intention tremor | OFFSIDES | ||
| 933 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 934 | Intervertebral disc disorder | OFFSIDES | ||
| 935 | Intestinal Obstruction | OFFSIDES | ||
| 936 | Intracranial Aneurysm | OFFSIDES | ||
| 937 | Intraocular inflammation | OFFSIDES | ||
| 938 | Joint sprain | OFFSIDES | ||
| 939 | Kidney Failure | OFFSIDES | ||
| 940 | Labored breathing | SIDER | ||
| 941 | Labyrinthine disorder | SIDER | ||
| 942 | Lacrimation abnormal NOS | SIDER | ||
| 943 | Laryngitis | SIDER | ||
| 944 | Laryngospasm | OFFSIDES SIDER | ||
| 945 | Left atrial dilatation | OFFSIDES | ||
| 946 | Leukorrhea | SIDER | ||
| 947 | Life expectancy shortened | OFFSIDES | ||
| 948 | Ligament injury | OFFSIDES | ||
| 949 | Limb discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 950 | Lipase | OFFSIDES | ||
| 951 | Loose tooth | OFFSIDES | ||
| 952 | Lumbar radiculopathy | OFFSIDES | ||
| 953 | Lung Abscess | OFFSIDES | ||
| 954 | Lung consolidation | OFFSIDES | ||
| 955 | Lung hyperinflation | OFFSIDES | ||
| 956 | Lupus Erythematosus, Cutaneous | 19040509 | CTD | |
| 957 | Lyme Disease | OFFSIDES | ||
| 958 | Lymphocytosis | OFFSIDES | ||
| 959 | Lymphoma | SIDER | ||
| 960 | Lymphoplasmacytoid lymphoma/immunocytoma | OFFSIDES | ||
| 961 | Lysosomal Storage Diseases | 28551711 | CTD | |
| 962 | Malabsorption | OFFSIDES | ||
| 963 | Malignant neoplasm progression | OFFSIDES | ||
| 964 | Malnutrition | SIDER | ||
| 965 | Manic psychosis | SIDER | ||
| 966 | Mass excision | OFFSIDES | ||
| 967 | Mastication disorder | OFFSIDES | ||
| 968 | Mastitis acute female | SIDER | ||
| 969 | Mastitis | SIDER | ||
| 970 | Medical device complication | OFFSIDES | ||
| 971 | Medical device removal | OFFSIDES | ||
| 972 | Meningioma | OFFSIDES | ||
| 973 | Mental disorders | 16856516 | CTD | |
| 974 | Metabolic acidosis | OFFSIDES | ||
| 975 | Metastatic Neoplasm | OFFSIDES | ||
| 976 | Microalbuminuria | OFFSIDES | ||
| 977 | Migraine Disorders | 8869767 11589524 16342007 | CTD | |
| 978 | Mitochondrial Diseases | 22387747 | CTD | |
| 979 | Mixed Connective Tissue Disease | OFFSIDES | ||
| 980 | Monoparesis | SIDER | ||
| 981 | Mood Disorders | 15610935 | CTD | |
| 982 | Morganella infection | OFFSIDES | ||
| 983 | Movement Disorders | 11816261 | CTD | |
| 984 | Mucosal erosion | OFFSIDES | ||
| 985 | Multiple Myeloma | OFFSIDES | ||
| 986 | Muscle Spasticity | 10084445 | CTD | |
| 987 | Muscle Weakness | OFFSIDES | ||
| 988 | Muscle relaxant therapy | SIDER | ||
| 989 | Musculoskeletal chest pain | OFFSIDES | ||
| 990 | Myasthenia Gravis | 18154484 | CTD | |
| 991 | Myxedema | 19934393 | CTD | |
| 992 | Necrolysis epidermal | SIDER | ||
| 993 | Necrosis | SIDER | ||
| 994 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 995 | Nephrolithiasis | OFFSIDES | ||
| 996 | Nervous tension | OFFSIDES | ||
| 997 | Neuritis | SIDER | ||
| 998 | Ocular discomfort | OFFSIDES | ||
| 999 | Oral discharge | OFFSIDES | ||
| 1000 | Oral fungal infection | OFFSIDES | ||
| 1001 | Oral infection | OFFSIDES | ||
| 1002 | Oral mucosal exfoliation | OFFSIDES | ||
| 1003 | Oral polypectomy | OFFSIDES | ||
| 1004 | Osteolysis | OFFSIDES | ||
| 1005 | Osteomyelitis | OFFSIDES | ||
| 1006 | Osteopetrosis | OFFSIDES | ||
| 1007 | Osteoporosis | OFFSIDES | ||
| 1008 | Osteosclerosis | OFFSIDES | ||
| 1009 | Overweight | OFFSIDES | ||
| 1010 | Pancytopenia | SIDER | ||
| 1011 | Panic disorder with agoraphobia | OFFSIDES | ||
| 1012 | Papilloma | OFFSIDES | ||
| 1013 | Paracentesis | OFFSIDES | ||
| 1014 | Paranoid reaction | SIDER | ||
| 1015 | Paresthesia | 18004152 | CTD | |
| 1016 | Parkinsonian Disorders | 9660102 15968847 | CTD | |
| 1017 | Peptic Ulcer | SIDER | ||
| 1018 | Periodontal operation | OFFSIDES | ||
| 1019 | Periodontitis | OFFSIDES | ||
| 1020 | Pharyngitis | SIDER | ||
| 1021 | Phlebitis | OFFSIDES | ||
| 1022 | Physical disability | OFFSIDES | ||
| 1023 | Plagiocephaly | OFFSIDES | ||
| 1024 | Plasmacytoma | OFFSIDES | ||
| 1025 | Polymyalgia Rheumatica | OFFSIDES | ||
| 1026 | Polyuria | SIDER | ||
| 1027 | Poor personal hygiene | OFFSIDES | ||
| 1028 | Portal vein pressure increased | OFFSIDES | ||
| 1029 | Post procedural infection | OFFSIDES | ||
| 1030 | Post procedural pneumonia | OFFSIDES | ||
| 1031 | Postoperative ileus | OFFSIDES | ||
| 1032 | Precordial pain | SIDER | ||
| 1033 | Pregnancy test negative | Canada Vigilance: 1 | Canada Vigilance | |
| 1034 | Prescribed overdose | OFFSIDES | ||
| 1035 | Pressure of speech | Canada Vigilance: 1 | Canada Vigilance | |
| 1036 | Primary sequestrum | OFFSIDES | ||
| 1037 | Procedural site reaction | OFFSIDES | ||
| 1038 | Proctitis | SIDER | ||
| 1039 | Productive Cough | OFFSIDES | ||
| 1040 | Prolapse repair | OFFSIDES | ||
| 1041 | Prostatectomy | OFFSIDES | ||
| 1042 | Protein total decreased | OFFSIDES | ||
| 1043 | Psychotic Disorders | 9742515 11869410 | CTD | |
| 1044 | Pulmonary Edema | 19782326 | CTD | |
| 1045 | Pulmonary Infarction | OFFSIDES | ||
| 1046 | Pulmonary radiation injury | OFFSIDES | ||
| 1047 | Purulence | OFFSIDES | ||
| 1048 | Pyelonephritis | SIDER | ||
| 1049 | REM Sleep Behavior Disorder | 20672438 | CTD | |
| 1050 | Rash follicular | SIDER | ||
| 1051 | Rebound hypertension | OFFSIDES | ||
| 1052 | Rectal Prolapse | OFFSIDES | ||
| 1053 | Rectal tenesmus | SIDER | ||
| 1054 | Rectocele | OFFSIDES | ||
| 1055 | Regurgitation of food | OFFSIDES | ||
| 1056 | Renal cyst | OFFSIDES | ||
| 1057 | Respiratory syncytial virus test positive | OFFSIDES | ||
| 1058 | Reticulocyte count increased | OFFSIDES | ||
| 1059 | Retrosternal pain | SIDER | ||
| 1060 | Rhinitis | SIDER | ||
| 1061 | Rhinorrhea | OFFSIDES | ||
| 1062 | Risus sardonicus | OFFSIDES | ||
| 1063 | Ruptured cerebral aneurysm | OFFSIDES | ||
| 1064 | Saliva altered | OFFSIDES | ||
| 1065 | Schizophrenia | 7543499 | CTD | |
| 1066 | Scotoma | SIDER | ||
| 1067 | Seizures | 10900533 14730090 18582188 | CTD | |
| 1068 | Self Mutilation | 11151486 | CTD | |
| 1069 | Senile dementia | OFFSIDES | ||
| 1070 | Serum Sickness | SIDER | ||
| 1071 | Shock | SIDER | ||
| 1072 | Sinus operation | OFFSIDES | ||
| 1073 | Sinus polyp | OFFSIDES | ||
| 1074 | Sjogren's Syndrome | OFFSIDES | ||
| 1075 | Skin cold clammy | SIDER | ||
| 1076 | Sleep Bruxism | 11157444 | CTD | |
| 1077 | Sleep Initiation and Maintenance Disorders | 10363731 16636635 | CTD | |
| 1078 | Spinal fusion surgery | OFFSIDES | ||
| 1079 | Spondylolisthesis | OFFSIDES | ||
| 1080 | Spondylolysis | OFFSIDES | ||
| 1081 | Stem cell transplant | OFFSIDES | ||
| 1082 | Stridor | SIDER | ||
| 1083 | Subcutaneous Abscess | OFFSIDES | ||
| 1084 | Substance Withdrawal Syndrome | 7726327 | CTD | |
| 1085 | Suicide | SIDER | ||
| 1086 | Superior Vena Cava Syndrome | OFFSIDES | ||
| 1087 | Sweating | SIDER | ||
| 1088 | Thoracic cavity drainage | OFFSIDES | ||
| 1089 | Thoracic vertebral fracture | OFFSIDES | ||
| 1090 | Thoracotomy | OFFSIDES | ||
| 1091 | Thrombophlebitis | OFFSIDES | ||
| 1092 | Thrombosis in device | OFFSIDES | ||
| 1093 | Tinea Pedis | OFFSIDES | ||
| 1094 | Tinea Versicolor | OFFSIDES | ||
| 1095 | Tinea cruris | OFFSIDES | ||
| 1096 | Tooth Extraction | OFFSIDES | ||
| 1097 | Tooth Loss | OFFSIDES | ||
| 1098 | Tooth caries aggravated NOS | SIDER | ||
| 1099 | Tooth repair | OFFSIDES | ||
| 1100 | Tympanic Membrane Perforation | OFFSIDES | ||
| 1101 | Ulcerative stomatitis | SIDER | ||
| 1102 | Urine output increased | SIDER | ||
| 1103 | Uterine Prolapse | OFFSIDES | ||
| 1104 | Uterine spasm | OFFSIDES | ||
| 1105 | Vascular insufficiency | OFFSIDES | ||
| 1106 | Vascular purpura | SIDER | ||
| 1107 | Vasculitis | SIDER | ||
| 1108 | Vasodilation procedure | SIDER | ||
| 1109 | Vasodilation | SIDER | ||
| 1110 | Vena cava filter insertion | OFFSIDES | ||
| 1111 | Vertebral column mass | OFFSIDES | ||
| 1112 | Vertebroplasty | OFFSIDES | ||
| 1113 | Vitamin A Deficiency | OFFSIDES | ||
| 1114 | Weight Gain | OFFSIDES | ||
| 1115 | Wheelchair user | OFFSIDES | ||
| 1116 | Xerophthalmia | SIDER | ||
| 1117 | colonoscopy | OFFSIDES | ||
| 1118 | kyphosis | OFFSIDES | ||
| 1119 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120269
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.