Omeprazole
(SUBDBMMJDZJVOS-UHFFFAOYSA-N)
Structure
- SMILES
- COc1ccc2c(c1)[nH]c(n2)S(=O)Cc1ncc(c(c1C)OC)C
- Type(s)
- Approved; Investigational; Vet_approved
- ATC code(s)
- A02BC01; A02BD01; A02BD05
- Molecular Formula:
- C17H19N3O3S
- Molecular Weight:
- 345.416
- Log P:
- 3.7654
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 1
- TPSA:
- 96.31
- CAS Number(s):
- 73590-58-6; 119141-88-7; 161796-78-7
Synonym(s)
1.
Omeprazole
2.
H 168-68
3.
Omeprazole Magnesium
4.
Omeprazole Sodium
5.
Prilosec
6.
H 168 68
7.
H 16868
8.
Magnesium, Omeprazole
9.
Sodium, Omeprazole
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 964 Canada Vigilance: 253 | Canada Vigilance US FAERS | |
| 2 | Dyspepsia | FAERS: 412 Canada Vigilance: 90 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 3 | Nausea | FAERS: 346 Canada Vigilance: 85 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 4 | Dizziness | FAERS: 295 Canada Vigilance: 22 | 9056799 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 5 | Incorrect drug administration duration | FAERS: 293 | US FAERS | |
| 6 | Acute kidney injury | FAERS: 282 Canada Vigilance: 1 | CTD Canada Vigilance US FAERS | |
| 7 | Headache | FAERS: 243 Canada Vigilance: 26 | CTD SIDER Canada Vigilance US FAERS | |
| 8 | Vomiting | FAERS: 239 Canada Vigilance: 41 | 11012560 11774962 18030228 | CTD SIDER Canada Vigilance US FAERS |
| 9 | Inappropriate schedule of drug administration | FAERS: 221 | US FAERS | |
| 10 | Product substitution issue | FAERS: 206 Canada Vigilance: 97 | Canada Vigilance US FAERS | |
| 11 | Malaise | FAERS: 197 Canada Vigilance: 13 | Canada Vigilance SIDER US FAERS | |
| 12 | Chest Pain | FAERS: 153 Canada Vigilance: 13 | 15447763 16291298 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 13 | Pain | FAERS: 152 Canada Vigilance: 15 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 14 | Fatigue | FAERS: 144 Canada Vigilance: 8 | 12452401 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 15 | Abdominal discomfort | FAERS: 143 Canada Vigilance: 55 | Canada Vigilance OFFSIDES US FAERS | |
| 16 | Anxiety | FAERS: 138 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 17 | Rebound acid hypersecretion | FAERS: 135 | US FAERS | |
| 18 | Abdominal Pain | FAERS: 134 Canada Vigilance: 69 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 19 | Product use issue | FAERS: 134 | US FAERS | |
| 20 | Urticaria | FAERS: 130 Canada Vigilance: 11 | 8159596 12464168 15087098 | CTD SIDER Canada Vigilance US FAERS |
| 21 | Pruritus | FAERS: 129 Canada Vigilance: 10 | 8159596 15087098 | CTD SIDER Canada Vigilance US FAERS |
| 22 | Hypersensitivity | FAERS: 124 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 23 | Weight decreased | FAERS: 120 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 24 | Pharmaceutical product complaint | FAERS: 118 | US FAERS | |
| 25 | Arthralgia | FAERS: 115 Canada Vigilance: 4 | 7819941 | CTD SIDER Canada Vigilance US FAERS |
| 26 | Feeling abnormal | FAERS: 115 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 27 | Flatulence | FAERS: 114 Canada Vigilance: 12 | Canada Vigilance SIDER US FAERS | |
| 28 | Dysgeusia | FAERS: 108 | SIDER US FAERS | |
| 29 | Palpitations | FAERS: 103 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 30 | Asthenia | FAERS: 101 Canada Vigilance: 6 | 15741423 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 31 | Back Pain | FAERS: 88 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 32 | Constipation | FAERS: 88 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 33 | Tremor | FAERS: 85 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 34 | Incorrect dose administered | FAERS: 78 | US FAERS | |
| 35 | Product quality issue | FAERS: 78 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Erythema | FAERS: 77 | US FAERS | |
| 37 | Eructation | FAERS: 76 Canada Vigilance: 10 | Canada Vigilance SIDER US FAERS | |
| 38 | Intentional product misuse | FAERS: 76 | US FAERS | |
| 39 | Drug dose omission | FAERS: 75 | US FAERS | |
| 40 | Myalgia | FAERS: 75 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 41 | Throat irritation | FAERS: 71 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Chest discomfort | FAERS: 69 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 43 | Hyperchlorhydria | FAERS: 69 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 44 | Oropharyngeal pain | FAERS: 62 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 45 | Chills | FAERS: 58 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 46 | Rebound effect | FAERS: 58 | US FAERS | |
| 47 | Product package associated injury | FAERS: 57 | US FAERS | |
| 48 | Alopecia | FAERS: 52 Canada Vigilance: 6 | 8159596 | CTD SIDER Canada Vigilance US FAERS |
| 49 | Burning sensation | FAERS: 51 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 50 | Product use in unapproved indication | FAERS: 48 | US FAERS | |
| 51 | Adverse event | FAERS: 47 | US FAERS | |
| 52 | Chromaturia | FAERS: 47 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 53 | Somnolence | FAERS: 47 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 54 | Drug Dependence | FAERS: 46 | US FAERS | |
| 55 | Dysphonia | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 56 | Intentional drug misuse | FAERS: 43 | US FAERS | |
| 57 | Drug ineffective for unapproved indication | FAERS: 42 | US FAERS | |
| 58 | Joint swelling | FAERS: 42 | US FAERS | |
| 59 | Musculoskeletal Pain | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 60 | Pneumonia | FAERS: 41 | US FAERS | |
| 61 | Swelling | FAERS: 39 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 62 | Angioedema | FAERS: 38 Canada Vigilance: 4 | 8159596 12464168 15087098 | CTD SIDER Canada Vigilance US FAERS |
| 63 | Dehydration | FAERS: 38 | OFFSIDES US FAERS | |
| 64 | Lethargy | FAERS: 36 Canada Vigilance: 3 | 1992636 7934394 9056799 | CTD OFFSIDES Canada Vigilance US FAERS |
| 65 | Neck Pain | FAERS: 35 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 66 | Syncope | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Visual Impairment | FAERS: 35 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 68 | Overdose | FAERS: 34 | US FAERS | |
| 69 | Tinnitus | FAERS: 34 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 70 | Lip swelling | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | Medication Error | FAERS: 32 | US FAERS | |
| 72 | Toxic Epidermal Necrolysis | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 73 | Vertigo | FAERS: 32 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 74 | Product taste abnormal | FAERS: 31 | US FAERS | |
| 75 | Dysuria | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 76 | Agitation | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 77 | Flushing | FAERS: 29 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 78 | Gastritis | FAERS: 29 Canada Vigilance: 4 | 10701899 | CTD SIDER Canada Vigilance US FAERS |
| 79 | Hypoparathyroidism | FAERS: 29 | US FAERS | |
| 80 | Thirst | FAERS: 29 | SIDER US FAERS | |
| 81 | Choking | FAERS: 28 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 82 | Discomfort | FAERS: 28 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 83 | Musculoskeletal stiffness | FAERS: 28 | OFFSIDES US FAERS | |
| 84 | Tetany | FAERS: 28 | US FAERS | |
| 85 | Erectile dysfunction | FAERS: 27 Canada Vigilance: 1 | 1392958 7771409 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 86 | Gastrointestinal Pain | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 87 | No adverse event | FAERS: 27 | US FAERS | |
| 88 | Osteopenia | FAERS: 27 | OFFSIDES US FAERS | |
| 89 | Drug effect incomplete | FAERS: 26 | US FAERS | |
| 90 | Extra dose administered | FAERS: 26 | US FAERS | |
| 91 | Peripheral swelling | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 92 | Rash erythematous | FAERS: 26 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 93 | Tachycardia | FAERS: 26 | SIDER US FAERS | |
| 94 | Laceration | FAERS: 25 | US FAERS | |
| 95 | Retching | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Wrong technique in drug usage process | FAERS: 25 | OFFSIDES US FAERS | |
| 97 | Anaphylactic shock | FAERS: 24 | SIDER US FAERS | |
| 98 | Therapeutic response unexpected with drug substitution | FAERS: 24 | US FAERS | |
| 99 | Wrong technique in product usage process | FAERS: 24 | US FAERS | |
| 100 | treatment failure | FAERS: 24 | US FAERS | |
| 101 | Amnesia | FAERS: 23 | 9451708 | CTD OFFSIDES US FAERS |
| 102 | Asthma | FAERS: 23 | OFFSIDES SIDER US FAERS | |
| 103 | Bone pain | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 104 | Myocardial Infarction | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 105 | Nervousness | FAERS: 23 | SIDER US FAERS | |
| 106 | Wheezing | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 107 | Nephrolithiasis | FAERS: 22 | US FAERS | |
| 108 | Prescribed overdose | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 109 | Regurgitation | FAERS: 22 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 110 | Arthritis | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 111 | Reaction to drug excipients | FAERS: 21 | US FAERS | |
| 112 | Eosinophilia | FAERS: 20 Canada Vigilance: 1 | CTD Canada Vigilance US FAERS | |
| 113 | Skin laceration | FAERS: 20 | OFFSIDES US FAERS | |
| 114 | Ulcer | FAERS: 20 | 9421124 12353402 12529378 | CTD US FAERS |
| 115 | Unevaluable event | FAERS: 20 | US FAERS | |
| 116 | Accidental overdose | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 117 | Atrial Fibrillation | FAERS: 19 | US FAERS | |
| 118 | Blood glucose increased | FAERS: 19 | US FAERS | |
| 119 | Drug administration error | FAERS: 19 | US FAERS | |
| 120 | Hypotension | FAERS: 19 | US FAERS | |
| 121 | Incorrect product administration duration | FAERS: 19 | US FAERS | |
| 122 | Pancreatitis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 123 | Symmetrical drug-related intertriginous and flexural exanthema | FAERS: 19 | US FAERS | |
| 124 | Tongue discomfort | FAERS: 19 | US FAERS | |
| 125 | Urinary tract infection | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 126 | jaundice | FAERS: 19 Canada Vigilance: 2 | 9695674 17266883 | CTD SIDER Canada Vigilance US FAERS |
| 127 | Eye irritation | FAERS: 18 | SIDER US FAERS | |
| 128 | Lupus-like syndrome | FAERS: 18 | US FAERS | |
| 129 | Osteoporosis | FAERS: 18 | US FAERS | |
| 130 | Disease recurrence | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 131 | Intentional product use issue | FAERS: 17 | US FAERS | |
| 132 | Night sweats | FAERS: 17 | US FAERS | |
| 133 | Onychoclasis | FAERS: 17 | US FAERS | |
| 134 | Product blister packaging issue | FAERS: 17 | US FAERS | |
| 135 | Product packaging issue | FAERS: 17 | US FAERS | |
| 136 | Renal pain | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 137 | Ageusia | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 138 | Blood creatinine increased | FAERS: 16 | SIDER US FAERS | |
| 139 | Blood magnesium decreased | FAERS: 16 | US FAERS | |
| 140 | Diabetes Mellitus | FAERS: 16 | US FAERS | |
| 141 | General physical health deterioration | FAERS: 16 | US FAERS | |
| 142 | Stress | FAERS: 16 | US FAERS | |
| 143 | Drug screen positive | FAERS: 15 | US FAERS | |
| 144 | Dry skin | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 145 | Medication residue present | FAERS: 15 | US FAERS | |
| 146 | Paranoia | FAERS: 15 | OFFSIDES US FAERS | |
| 147 | Rhabdomyolysis | FAERS: 15 | 12773066 18410837 | CTD US FAERS |
| 148 | Skin test positive | FAERS: 15 | US FAERS | |
| 149 | Alanine Aminotransferase Increased | FAERS: 14 | SIDER US FAERS | |
| 150 | Blood parathyroid hormone decreased | FAERS: 14 | US FAERS | |
| 151 | Cerebrovascular accident | FAERS: 14 | US FAERS | |
| 152 | Crying | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 153 | Gastrointestinal sounds abnormal | FAERS: 14 | US FAERS | |
| 154 | Memory impairment | FAERS: 14 | US FAERS | |
| 155 | Sepsis | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 156 | Transaminases increased | FAERS: 14 | US FAERS | |
| 157 | Urinary Incontinence | FAERS: 14 | US FAERS | |
| 158 | Clostridium difficile infection | FAERS: 13 | US FAERS | |
| 159 | Cold sweat | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 160 | Delirium | FAERS: 13 | 10701899 18410837 | CTD US FAERS |
| 161 | Drug exposure during pregnancy | FAERS: 13 | US FAERS | |
| 162 | Feeling Cold | FAERS: 13 | US FAERS | |
| 163 | Gastrointestinal carcinoma | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 164 | Product physical issue | FAERS: 13 | US FAERS | |
| 165 | Stomatitis | FAERS: 13 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 166 | Accidental exposure | FAERS: 12 | OFFSIDES US FAERS | |
| 167 | Apathy | FAERS: 12 | SIDER US FAERS | |
| 168 | Blood gastrin increased | FAERS: 12 | SIDER US FAERS | |
| 169 | Blood potassium decreased | FAERS: 12 | US FAERS | |
| 170 | Blood urine present | FAERS: 12 | US FAERS | |
| 171 | Deafness | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 172 | Depressed mood | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 173 | Disorientation | FAERS: 12 | US FAERS | |
| 174 | Drug dispensing error | FAERS: 12 | US FAERS | |
| 175 | Drug effective for unapproved indication | FAERS: 12 | US FAERS | |
| 176 | Oropharyngeal discomfort | FAERS: 12 | US FAERS | |
| 177 | Productive Cough | FAERS: 12 | OFFSIDES US FAERS | |
| 178 | Respiratory distress | FAERS: 12 | US FAERS | |
| 179 | Urine flow decreased | FAERS: 12 | US FAERS | |
| 180 | White blood cell count decreased | FAERS: 12 | US FAERS | |
| 181 | Acute psychosis | FAERS: 11 | US FAERS | |
| 182 | Cataract | FAERS: 11 | US FAERS | |
| 183 | Epilepsy | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 184 | Expired drug administered | FAERS: 11 | US FAERS | |
| 185 | Feeling jittery | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 186 | Gastric pH decreased | FAERS: 11 | US FAERS | |
| 187 | Inflammation | FAERS: 11 | US FAERS | |
| 188 | Irritable Bowel Syndrome | FAERS: 11 | SIDER US FAERS | |
| 189 | Vitamin D Deficiency | FAERS: 11 | US FAERS | |
| 190 | Anger | FAERS: 10 | US FAERS | |
| 191 | Aphonia | FAERS: 10 | US FAERS | |
| 192 | Bradycardia | FAERS: 10 | SIDER US FAERS | |
| 193 | Dermatitis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 194 | Electrolyte imbalance | FAERS: 10 | US FAERS | |
| 195 | Expired product administered | FAERS: 10 | US FAERS | |
| 196 | Inappropriate schedule of product administration | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 197 | Intellectual Disability | FAERS: 10 | US FAERS | |
| 198 | Intestinal Obstruction | FAERS: 10 | US FAERS | |
| 199 | Malabsorption | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 200 | Mental impairment | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 201 | Metabolic alkalosis | FAERS: 10 | US FAERS | |
| 202 | Pain of skin | FAERS: 10 | SIDER US FAERS | |
| 203 | Restlessness | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 204 | Thrombocytopenia | FAERS: 10 | 9695674 | CTD SIDER US FAERS |
| 205 | Urinary Retention | FAERS: 10 | US FAERS | |
| 206 | Aphasia | FAERS: 9 | US FAERS | |
| 207 | Clostridium difficile colitis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 208 | Erythema Multiforme | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 209 | Impaired work ability | FAERS: 9 | US FAERS | |
| 210 | Laryngitis | FAERS: 9 | US FAERS | |
| 211 | Lipase increased | FAERS: 9 | US FAERS | |
| 212 | Maternal exposure during pregnancy | FAERS: 9 | US FAERS | |
| 213 | Mental status changes | FAERS: 9 | OFFSIDES US FAERS | |
| 214 | Musculoskeletal discomfort | FAERS: 9 | SIDER US FAERS | |
| 215 | Myopathy | FAERS: 9 | US FAERS | |
| 216 | Nephritis | FAERS: 9 | US FAERS | |
| 217 | Polyuria | FAERS: 9 | SIDER US FAERS | |
| 218 | Psychotic symptom | FAERS: 9 | US FAERS | |
| 219 | Sneezing | FAERS: 9 | US FAERS | |
| 220 | Suicide attempt | FAERS: 9 | US FAERS | |
| 221 | Superior Mesenteric Artery Syndrome | FAERS: 9 | US FAERS | |
| 222 | Aphagia | FAERS: 8 | US FAERS | |
| 223 | Blood chromogranin A increased | FAERS: 8 | US FAERS | |
| 224 | Blood creatine phosphokinase increased | FAERS: 8 | US FAERS | |
| 225 | Breast tenderness | FAERS: 8 | OFFSIDES US FAERS | |
| 226 | Burning Mouth Syndrome | FAERS: 8 | US FAERS | |
| 227 | Cheilitis | FAERS: 8 | US FAERS | |
| 228 | Diverticulitis | FAERS: 8 | US FAERS | |
| 229 | Flank Pain | FAERS: 8 | OFFSIDES US FAERS | |
| 230 | Hepatitis | FAERS: 8 | 9725985 16096600 17266883 | CTD SIDER US FAERS |
| 231 | Hernia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 232 | Hunger | FAERS: 8 | US FAERS | |
| 233 | Hyperreflexia | FAERS: 8 | US FAERS | |
| 234 | Idiosyncratic drug reaction | FAERS: 8 | US FAERS | |
| 235 | Increased upper airway secretion | FAERS: 8 | US FAERS | |
| 236 | Joint stiffness | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 237 | Leukocytosis | FAERS: 8 | SIDER US FAERS | |
| 238 | Middle insomnia | FAERS: 8 | US FAERS | |
| 239 | Presyncope | FAERS: 8 | US FAERS | |
| 240 | Quality of life decreased | FAERS: 8 | US FAERS | |
| 241 | Sinusitis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 242 | Stevens-Johnson Syndrome | FAERS: 8 | 25811541 | CTD SIDER US FAERS |
| 243 | Therapy cessation | FAERS: 8 | US FAERS | |
| 244 | Tooth Loss | FAERS: 8 | US FAERS | |
| 245 | Activities of daily living impaired | FAERS: 7 | US FAERS | |
| 246 | Aspartate Aminotransferase Increased | FAERS: 7 | SIDER US FAERS | |
| 247 | Blindness | FAERS: 7 | US FAERS | |
| 248 | Blood potassium increased | FAERS: 7 | US FAERS | |
| 249 | Bronchospasm | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 250 | Choking sensation | FAERS: 7 | OFFSIDES US FAERS | |
| 251 | Drug abuse | FAERS: 7 | US FAERS | |
| 252 | Drug effect delayed | FAERS: 7 | US FAERS | |
| 253 | Drug prescribing error | FAERS: 7 | US FAERS | |
| 254 | Ear congestion | FAERS: 7 | US FAERS | |
| 255 | Emotional distress | FAERS: 7 | OFFSIDES US FAERS | |
| 256 | Gastroenteritis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 257 | Hydronephrosis | FAERS: 7 | OFFSIDES US FAERS | |
| 258 | Hypersomnia | FAERS: 7 | US FAERS | |
| 259 | Ileal Stenosis | FAERS: 7 | US FAERS | |
| 260 | Infection | FAERS: 7 | SIDER US FAERS | |
| 261 | Leukopenia | FAERS: 7 | SIDER US FAERS | |
| 262 | Lower respiratory tract infection | FAERS: 7 | US FAERS | |
| 263 | Macule | FAERS: 7 | US FAERS | |
| 264 | Musculoskeletal chest pain | FAERS: 7 | US FAERS | |
| 265 | Neutropenia | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 266 | Pallor | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 267 | Petechiae | FAERS: 7 | SIDER US FAERS | |
| 268 | Photophobia | FAERS: 7 | US FAERS | |
| 269 | Product formulation issue | FAERS: 7 | US FAERS | |
| 270 | Skin irritation | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 271 | Therapeutic product cross-reactivity | FAERS: 7 | US FAERS | |
| 272 | Vasculitis | FAERS: 7 | US FAERS | |
| 273 | Vitiligo | FAERS: 7 | US FAERS | |
| 274 | Vulvovaginal burning sensation | FAERS: 7 | US FAERS | |
| 275 | Abasia | FAERS: 6 | US FAERS | |
| 276 | Abdominal tenderness | FAERS: 6 | US FAERS | |
| 277 | Abnormal weight gain | FAERS: 6 | US FAERS | |
| 278 | Acne | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 279 | Anorexia | FAERS: 6 | 7934394 | CTD OFFSIDES SIDER US FAERS |
| 280 | Arthropathy | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 281 | Bacterial disease carrier | FAERS: 6 | US FAERS | |
| 282 | Bipolar I disorder | FAERS: 6 | US FAERS | |
| 283 | Bronchitis | FAERS: 6 | US FAERS | |
| 284 | Cardiac Flutter | FAERS: 6 | US FAERS | |
| 285 | Circumstance or information capable of leading to medication error | FAERS: 6 | US FAERS | |
| 286 | Cyanosis | FAERS: 6 | US FAERS | |
| 287 | Dementia | FAERS: 6 | US FAERS | |
| 288 | Drug withdrawal syndrome | FAERS: 6 | US FAERS | |
| 289 | Eye pain | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 290 | Food Allergy | FAERS: 6 | US FAERS | |
| 291 | Hypophagia | FAERS: 6 | OFFSIDES US FAERS | |
| 292 | Incorrect route of drug administration | FAERS: 6 | US FAERS | |
| 293 | Incorrect route of product administration | FAERS: 6 | US FAERS | |
| 294 | Infrequent bowel movements | FAERS: 6 | US FAERS | |
| 295 | Limb discomfort | FAERS: 6 | US FAERS | |
| 296 | Lip and/or oral cavity cancer | FAERS: 6 | US FAERS | |
| 297 | Lipohypertrophy | FAERS: 6 | US FAERS | |
| 298 | Mood swings | FAERS: 6 | US FAERS | |
| 299 | Muscle tightness | FAERS: 6 | US FAERS | |
| 300 | Nasopharyngitis | FAERS: 6 | OFFSIDES US FAERS | |
| 301 | Obsessive thoughts | FAERS: 6 | US FAERS | |
| 302 | Polyneuropathy | FAERS: 6 | US FAERS | |
| 303 | Product complaint | FAERS: 6 | US FAERS | |
| 304 | Product solubility abnormal | FAERS: 6 | US FAERS | |
| 305 | Respiratory Failure | FAERS: 6 | US FAERS | |
| 306 | Skin lesion | FAERS: 6 | US FAERS | |
| 307 | Stertor | FAERS: 6 | US FAERS | |
| 308 | Supraventricular tachycardia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 309 | Toothache | FAERS: 6 | US FAERS | |
| 310 | Trichorrhexis | FAERS: 6 | US FAERS | |
| 311 | White blood cell count abnormal | FAERS: 6 | US FAERS | |
| 312 | Wrong drug administered | FAERS: 6 | US FAERS | |
| 313 | Anorgasmia | FAERS: 5 | US FAERS | |
| 314 | Aortic Valve Stenosis | FAERS: 5 | US FAERS | |
| 315 | Blood alkaline phosphatase increased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 316 | Blood iron decreased | FAERS: 5 | US FAERS | |
| 317 | Bone density decreased | FAERS: 5 | US FAERS | |
| 318 | Cholelithiasis | FAERS: 5 | US FAERS | |
| 319 | Coating in mouth | FAERS: 5 | US FAERS | |
| 320 | Combined immunodeficiency | FAERS: 5 | US FAERS | |
| 321 | Complication associated with device | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 322 | Cytolytic hepatitis | FAERS: 5 | US FAERS | |
| 323 | Drug screen false positive | FAERS: 5 | US FAERS | |
| 324 | Duodenal Ulcer | FAERS: 5 | CTD US FAERS | |
| 325 | Economic problem | FAERS: 5 | US FAERS | |
| 326 | Eosinophilic Fasciitis | FAERS: 5 | US FAERS | |
| 327 | Exposure via ingestion | FAERS: 5 | US FAERS | |
| 328 | Extravasation | FAERS: 5 | US FAERS | |
| 329 | Fracture | FAERS: 5 | SIDER US FAERS | |
| 330 | Gastric Dilatation | FAERS: 5 | US FAERS | |
| 331 | Gastric pH increased | FAERS: 5 | US FAERS | |
| 332 | Gastric ulcer | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 333 | Gout | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 334 | Head discomfort | FAERS: 5 | US FAERS | |
| 335 | Infantile spitting up | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 336 | Influenza | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 337 | Kounis Syndrome | FAERS: 5 | US FAERS | |
| 338 | Leukocytoclastic vasculitis | FAERS: 5 | SIDER US FAERS | |
| 339 | Limb injury | FAERS: 5 | US FAERS | |
| 340 | Lung consolidation | FAERS: 5 | US FAERS | |
| 341 | Lymphadenopathy | FAERS: 5 | SIDER US FAERS | |
| 342 | Malnutrition | FAERS: 5 | SIDER US FAERS | |
| 343 | Multi-organ disorder | FAERS: 5 | US FAERS | |
| 344 | Nocturia | FAERS: 5 | US FAERS | |
| 345 | Obesity | FAERS: 5 | US FAERS | |
| 346 | Oral pain | FAERS: 5 | US FAERS | |
| 347 | Pericardial effusion | FAERS: 5 | OFFSIDES US FAERS | |
| 348 | Pharyngolaryngeal Pain | FAERS: 5 | US FAERS | |
| 349 | Product commingling | FAERS: 5 | US FAERS | |
| 350 | Product label confusion | FAERS: 5 | US FAERS | |
| 351 | Product label issue | FAERS: 5 | US FAERS | |
| 352 | Psychiatric symptom | FAERS: 5 | US FAERS | |
| 353 | Renal Cell Carcinoma | FAERS: 5 | US FAERS | |
| 354 | Restless Legs Syndrome | FAERS: 5 | US FAERS | |
| 355 | Shock | FAERS: 5 | SIDER US FAERS | |
| 356 | Skin reaction | FAERS: 5 | US FAERS | |
| 357 | Somnambulism | FAERS: 5 | US FAERS | |
| 358 | Status Epilepticus | FAERS: 5 | OFFSIDES US FAERS | |
| 359 | Thrombosis | FAERS: 5 | US FAERS | |
| 360 | Amniotic fluid volume increased | FAERS: 4 | US FAERS | |
| 361 | Angina Pectoris | FAERS: 4 | SIDER US FAERS | |
| 362 | Anuria | FAERS: 4 | US FAERS | |
| 363 | Atrial Flutter | FAERS: 4 | US FAERS | |
| 364 | Bedridden | FAERS: 4 | US FAERS | |
| 365 | Blood cholesterol increased | FAERS: 4 | US FAERS | |
| 366 | Blood glucose decreased | FAERS: 4 | US FAERS | |
| 367 | Bone callus excessive | FAERS: 4 | US FAERS | |
| 368 | Cellulitis | FAERS: 4 | OFFSIDES US FAERS | |
| 369 | Cystitis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 370 | Dental caries | FAERS: 4 | OFFSIDES US FAERS | |
| 371 | Depressed Level of Consciousness | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 372 | Device occlusion | FAERS: 4 | US FAERS | |
| 373 | Diplopia | FAERS: 4 | SIDER US FAERS | |
| 374 | Dysarthria | FAERS: 4 | US FAERS | |
| 375 | Eosinophilic cystitis | FAERS: 4 | US FAERS | |
| 376 | Epistaxis | FAERS: 4 | SIDER US FAERS | |
| 377 | Gastrointestinal mucosal disorder | FAERS: 4 | US FAERS | |
| 378 | Gastrooesophageal sphincter insufficiency | FAERS: 4 | US FAERS | |
| 379 | Glaucoma | FAERS: 4 | US FAERS | |
| 380 | Glossitis | FAERS: 4 | SIDER US FAERS | |
| 381 | Hypertrichosis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 382 | Hypoaesthesia facial | FAERS: 4 | US FAERS | |
| 383 | Infusion Site Extravasation | FAERS: 4 | US FAERS | |
| 384 | Lactose Intolerance | FAERS: 4 | US FAERS | |
| 385 | Latent tetany | FAERS: 4 | US FAERS | |
| 386 | Lupus vasculitis | FAERS: 4 | US FAERS | |
| 387 | Myocarditis | FAERS: 4 | US FAERS | |
| 388 | Pericarditis | FAERS: 4 | US FAERS | |
| 389 | Pharyngitis | FAERS: 4 | SIDER US FAERS | |
| 390 | Product dose omission | FAERS: 4 | US FAERS | |
| 391 | Product packaging quantity issue | FAERS: 4 | US FAERS | |
| 392 | Reaction to excipient | FAERS: 4 | US FAERS | |
| 393 | Reflux laryngitis | FAERS: 4 | US FAERS | |
| 394 | Retinal Vein Occlusion | FAERS: 4 | US FAERS | |
| 395 | Rheumatoid Arthritis | FAERS: 4 | US FAERS | |
| 396 | Skin tightness | FAERS: 4 | US FAERS | |
| 397 | Sleep disorder due to a general medical condition | FAERS: 4 | US FAERS | |
| 398 | Snoring | FAERS: 4 | US FAERS | |
| 399 | Spinal column stenosis | FAERS: 4 | US FAERS | |
| 400 | Suspected counterfeit product | FAERS: 4 | US FAERS | |
| 401 | Therapeutic product ineffective | FAERS: 4 | US FAERS | |
| 402 | Therapy non-responder | FAERS: 4 | US FAERS | |
| 403 | Vanishing bile duct syndrome | FAERS: 4 | US FAERS | |
| 404 | Vulvovaginal inflammation | FAERS: 4 | US FAERS | |
| 405 | Wrong patient received product | FAERS: 4 | US FAERS | |
| 406 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 407 | Accidental exposure to product by child | FAERS: 3 | US FAERS | |
| 408 | Agranulocytosis | FAERS: 3 | SIDER US FAERS | |
| 409 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 410 | Anorectal discomfort | FAERS: 3 | SIDER US FAERS | |
| 411 | Antinuclear antibody increased | FAERS: 3 | US FAERS | |
| 412 | Aphthous Stomatitis | FAERS: 3 | US FAERS | |
| 413 | Apparent life threatening event | FAERS: 3 | US FAERS | |
| 414 | Asthenopia | FAERS: 3 | US FAERS | |
| 415 | Ataxia | FAERS: 3 | OFFSIDES US FAERS | |
| 416 | Bladder discomfort | FAERS: 3 | US FAERS | |
| 417 | Blood creatine increased | FAERS: 3 | US FAERS | |
| 418 | Blood phosphorus increased | FAERS: 3 | US FAERS | |
| 419 | Bradyphrenia | FAERS: 3 | US FAERS | |
| 420 | Cachexia | FAERS: 3 | US FAERS | |
| 421 | Calcium deficiency | FAERS: 3 | US FAERS | |
| 422 | Capsule issue | FAERS: 3 | US FAERS | |
| 423 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 424 | Carotid pulse abnormal | FAERS: 3 | US FAERS | |
| 425 | Cholestatic liver injury | FAERS: 3 | US FAERS | |
| 426 | Clostridium test positive | FAERS: 3 | US FAERS | |
| 427 | Depression suicidal | FAERS: 3 | OFFSIDES US FAERS | |
| 428 | Disability | FAERS: 3 | US FAERS | |
| 429 | Disease Progression | FAERS: 3 | US FAERS | |
| 430 | Documented hypersensitivity to administered drug | FAERS: 3 | US FAERS | |
| 431 | Drooling | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 432 | Drug toxicity | FAERS: 3 | US FAERS | |
| 433 | Ear discomfort | FAERS: 3 | US FAERS | |
| 434 | Eczema | FAERS: 3 | US FAERS | |
| 435 | Emotional disorder | FAERS: 3 | US FAERS | |
| 436 | Enamel anomaly | FAERS: 3 | US FAERS | |
| 437 | Erythema dyschromicum perstans | FAERS: 3 | US FAERS | |
| 438 | Facial Pain | FAERS: 3 | US FAERS | |
| 439 | False positive investigation result | FAERS: 3 | US FAERS | |
| 440 | Food Poisoning | FAERS: 3 | US FAERS | |
| 441 | Gastric mucosal lesion | FAERS: 3 | US FAERS | |
| 442 | Gastrointestinal motility disorder | FAERS: 3 | US FAERS | |
| 443 | Gastrointestinal ulcer | FAERS: 3 | US FAERS | |
| 444 | Hepatotoxicity | FAERS: 3 | US FAERS | |
| 445 | Hypoxia | FAERS: 3 | US FAERS | |
| 446 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 447 | Injection site scar | FAERS: 3 | US FAERS | |
| 448 | Joint Instability | FAERS: 3 | OFFSIDES US FAERS | |
| 449 | Long QT Syndrome | FAERS: 3 | US FAERS | |
| 450 | Mouth swelling | FAERS: 3 | US FAERS | |
| 451 | Negative thoughts | FAERS: 3 | US FAERS | |
| 452 | Neutrophil count decreased | FAERS: 3 | US FAERS | |
| 453 | Non-cardiac chest pain | FAERS: 3 | US FAERS | |
| 454 | Ocular vascular disorder | FAERS: 3 | US FAERS | |
| 455 | Oral candidiasis | FAERS: 3 | US FAERS | |
| 456 | Pneumothorax | FAERS: 3 | US FAERS | |
| 457 | Polydipsia | FAERS: 3 | US FAERS | |
| 458 | Poor quality sleep | FAERS: 3 | US FAERS | |
| 459 | Product contamination | FAERS: 3 | US FAERS | |
| 460 | Product counterfeit | FAERS: 3 | US FAERS | |
| 461 | Product measured potency issue | FAERS: 3 | US FAERS | |
| 462 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 463 | Reflux gastritis | FAERS: 3 | US FAERS | |
| 464 | Renal cyst | FAERS: 3 | US FAERS | |
| 465 | Renal tubular necrosis | FAERS: 3 | US FAERS | |
| 466 | Retinal Artery Occlusion | FAERS: 3 | US FAERS | |
| 467 | Rhinitis | FAERS: 3 | SIDER US FAERS | |
| 468 | Sensation of blood flow | FAERS: 3 | US FAERS | |
| 469 | Sinus headache | FAERS: 3 | US FAERS | |
| 470 | Skin toxicity | FAERS: 3 | US FAERS | |
| 471 | Sleep disorder due to general medical condition, insomnia type | FAERS: 3 | US FAERS | |
| 472 | Symptom masked | FAERS: 3 | US FAERS | |
| 473 | Tension Headache | FAERS: 3 | US FAERS | |
| 474 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 475 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 476 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 477 | Upper-airway cough syndrome | FAERS: 3 | US FAERS | |
| 478 | Ventricular arrhythmia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 479 | Vitreous Detachment | FAERS: 3 | US FAERS | |
| 480 | Vocal cord cyst | FAERS: 3 | US FAERS | |
| 481 | Water Intoxication | FAERS: 3 | US FAERS | |
| 482 | nervous system disorder | FAERS: 3 | SIDER US FAERS | |
| 483 | pH urine abnormal | FAERS: 3 | US FAERS | |
| 484 | Accidental drug intake by child | FAERS: 2 | US FAERS | |
| 485 | Autoimmune hepatitis | FAERS: 2 | US FAERS | |
| 486 | Back disorder | FAERS: 2 | US FAERS | |
| 487 | Bicytopenia | FAERS: 2 | US FAERS | |
| 488 | Bladder pain | FAERS: 2 | SIDER US FAERS | |
| 489 | Bladder spasm | FAERS: 2 | US FAERS | |
| 490 | Blepharospasm | FAERS: 2 | US FAERS | |
| 491 | Blood count abnormal | FAERS: 2 | US FAERS | |
| 492 | Blood iron increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 493 | Bone density abnormal | FAERS: 2 | US FAERS | |
| 494 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 495 | Bursitis | FAERS: 2 | OFFSIDES US FAERS | |
| 496 | Butterfly rash | FAERS: 2 | US FAERS | |
| 497 | Cholangitis | FAERS: 2 | US FAERS | |
| 498 | Colitis | FAERS: 2 | US FAERS | |
| 499 | Completed Suicide | FAERS: 2 | US FAERS | |
| 500 | Compression fracture | FAERS: 2 | US FAERS | |
| 501 | Compulsive lip biting | FAERS: 2 | US FAERS | |
| 502 | Cyst | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 503 | Disseminated Intravascular Coagulation | FAERS: 2 | OFFSIDES US FAERS | |
| 504 | Diverticulum | FAERS: 2 | US FAERS | |
| 505 | Documented hypersensitivity to administered product | FAERS: 2 | US FAERS | |
| 506 | Drug cross-reactivity | FAERS: 2 | US FAERS | |
| 507 | Drug therapy changed | FAERS: 2 | US FAERS | |
| 508 | Dyschezia | FAERS: 2 | US FAERS | |
| 509 | Dysplasia | FAERS: 2 | SIDER US FAERS | |
| 510 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 511 | Erythema Nodosum | FAERS: 2 | 7819941 8804848 | CTD US FAERS |
| 512 | Euphoric mood | FAERS: 2 | US FAERS | |
| 513 | Evans syndrome | FAERS: 2 | US FAERS | |
| 514 | Facial Paresis | FAERS: 2 | US FAERS | |
| 515 | Fibromyalgia | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 516 | Fibrosis | FAERS: 2 | 9627043 | CTD US FAERS |
| 517 | Forceps delivery | FAERS: 2 | US FAERS | |
| 518 | Formication | FAERS: 2 | US FAERS | |
| 519 | Frustration | FAERS: 2 | US FAERS | |
| 520 | Gamma-Glutamyltransferase Increased | FAERS: 2 | OFFSIDES US FAERS | |
| 521 | Gastrointestinal bacterial infection | FAERS: 2 | US FAERS | |
| 522 | Gastrointestinal inflammation | FAERS: 2 | US FAERS | |
| 523 | Giardiasis | FAERS: 2 | US FAERS | |
| 524 | Hair injury | FAERS: 2 | US FAERS | |
| 525 | Hepatitis C | FAERS: 2 | US FAERS | |
| 526 | Hepatomegaly | FAERS: 2 | 28108177 | CTD US FAERS |
| 527 | Hyperparathyroidism | FAERS: 2 | US FAERS | |
| 528 | Hyperpyrexia | FAERS: 2 | US FAERS | |
| 529 | Hyperventilation | FAERS: 2 | OFFSIDES US FAERS | |
| 530 | Impaired gastric emptying | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 531 | Incoherent | FAERS: 2 | US FAERS | |
| 532 | Intervertebral Disc Degeneration | FAERS: 2 | OFFSIDES US FAERS | |
| 533 | Iron deficiency | FAERS: 2 | US FAERS | |
| 534 | Loss of bladder sensation | FAERS: 2 | US FAERS | |
| 535 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 536 | Magnesium Deficiency | FAERS: 2 | 18221401 | CTD US FAERS |
| 537 | Mastication disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 538 | Metabolic acidosis | FAERS: 2 | OFFSIDES US FAERS | |
| 539 | Mycoplasma test positive | FAERS: 2 | US FAERS | |
| 540 | Myoclonus | FAERS: 2 | US FAERS | |
| 541 | Myositis | FAERS: 2 | US FAERS | |
| 542 | Ocular icterus | FAERS: 2 | US FAERS | |
| 543 | Oculomucocutaneous syndrome | FAERS: 2 | US FAERS | |
| 544 | Oliguria | FAERS: 2 | OFFSIDES US FAERS | |
| 545 | Oral fungal infection | FAERS: 2 | US FAERS | |
| 546 | Oropharyngeal blistering | FAERS: 2 | US FAERS | |
| 547 | Overweight | FAERS: 2 | US FAERS | |
| 548 | Pancytopenia | FAERS: 2 | SIDER US FAERS | |
| 549 | Panic Disorder | FAERS: 2 | US FAERS | |
| 550 | Pathological fracture | FAERS: 2 | US FAERS | |
| 551 | Pericarditis lupus | FAERS: 2 | US FAERS | |
| 552 | Pharyngeal swelling | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 553 | Physical disability | FAERS: 2 | OFFSIDES US FAERS | |
| 554 | Piloerection | FAERS: 2 | US FAERS | |
| 555 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 556 | Poor quality product administered | FAERS: 2 | US FAERS | |
| 557 | Pregnancy | FAERS: 2 | US FAERS | |
| 558 | Priapism | FAERS: 2 | US FAERS | |
| 559 | Product contamination microbial | FAERS: 2 | US FAERS | |
| 560 | Product contamination physical | FAERS: 2 | US FAERS | |
| 561 | Product preparation issue | FAERS: 2 | US FAERS | |
| 562 | Product selection error | FAERS: 2 | US FAERS | |
| 563 | Product storage error | FAERS: 2 | US FAERS | |
| 564 | Purpura | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 565 | Pyuria | FAERS: 2 | SIDER US FAERS | |
| 566 | Renal aneurysm | FAERS: 2 | US FAERS | |
| 567 | Respiratory arrest | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 568 | Retinal pallor | FAERS: 2 | US FAERS | |
| 569 | Retinitis Pigmentosa | FAERS: 2 | US FAERS | |
| 570 | Rhabdomyosarcoma | FAERS: 2 | US FAERS | |
| 571 | Saliva altered | FAERS: 2 | US FAERS | |
| 572 | Salt intoxication | FAERS: 2 | US FAERS | |
| 573 | Scab | FAERS: 2 | US FAERS | |
| 574 | Screaming | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 575 | Sjogren's Syndrome | FAERS: 2 | US FAERS | |
| 576 | Small intestinal bacterial overgrowth | FAERS: 2 | US FAERS | |
| 577 | Sunburn | FAERS: 2 | US FAERS | |
| 578 | Tardive Dyskinesia | FAERS: 2 | US FAERS | |
| 579 | Temperature regulation disorder | FAERS: 2 | US FAERS | |
| 580 | Therapeutic product effect decreased | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 581 | Thrombosis in device | FAERS: 2 | US FAERS | |
| 582 | Tongue biting | FAERS: 2 | US FAERS | |
| 583 | Tongue blistering | FAERS: 2 | US FAERS | |
| 584 | Transcription medication error | FAERS: 2 | US FAERS | |
| 585 | Urine cannabinoids increased | FAERS: 2 | US FAERS | |
| 586 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 587 | Venous Injury | FAERS: 2 | US FAERS | |
| 588 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 589 | Vulvovaginal mycotic infection | FAERS: 2 | US FAERS | |
| 590 | furuncle | FAERS: 2 | OFFSIDES US FAERS | |
| 591 | Abdominal mass | FAERS: 1 | US FAERS | |
| 592 | Abdominal rebound tenderness | FAERS: 1 | US FAERS | |
| 593 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 594 | Accidental exposure to product packaging | FAERS: 1 | US FAERS | |
| 595 | Achlorhydria | FAERS: 1 | 11422300 | CTD US FAERS |
| 596 | Acidosis | FAERS: 1 | US FAERS | |
| 597 | Acute prerenal failure | FAERS: 1 | US FAERS | |
| 598 | Administration site coldness | FAERS: 1 | US FAERS | |
| 599 | Akathisia | FAERS: 1 | US FAERS | |
| 600 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 601 | Alopecia totalis | FAERS: 1 | US FAERS | |
| 602 | Amylase increased | FAERS: 1 | US FAERS | |
| 603 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 604 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 605 | Aneurysm | FAERS: 1 | US FAERS | |
| 606 | Angular cheilitis | FAERS: 1 | US FAERS | |
| 607 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 608 | Anosmia | FAERS: 1 | US FAERS | |
| 609 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 610 | Arthropod bite | FAERS: 1 | US FAERS | |
| 611 | Artificial crown procedure | FAERS: 1 | US FAERS | |
| 612 | Ascites | FAERS: 1 | US FAERS | |
| 613 | Asphyxia | FAERS: 1 | US FAERS | |
| 614 | Atrioventricular Block | FAERS: 1 | 12773066 | CTD US FAERS |
| 615 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 616 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 617 | Azoospermia | FAERS: 1 | US FAERS | |
| 618 | Base excess decreased | FAERS: 1 | US FAERS | |
| 619 | Benign gastric polyp | FAERS: 1 | US FAERS | |
| 620 | Bile output increased | FAERS: 1 | US FAERS | |
| 621 | Biliary cirrhosis | FAERS: 1 | US FAERS | |
| 622 | Biopsy lymph gland abnormal | FAERS: 1 | US FAERS | |
| 623 | Biopsy | FAERS: 1 | US FAERS | |
| 624 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 625 | Blood 25-hydroxycholecalciferol decreased | FAERS: 1 | US FAERS | |
| 626 | Blood HIV RNA increased | FAERS: 1 | US FAERS | |
| 627 | Blood cannabinoids | FAERS: 1 | US FAERS | |
| 628 | Blood cortisol increased | FAERS: 1 | US FAERS | |
| 629 | Blood folate increased | FAERS: 1 | US FAERS | |
| 630 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 631 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 632 | Blood homocysteine decreased | FAERS: 1 | US FAERS | |
| 633 | Blood immunoglobulin A increased | FAERS: 1 | US FAERS | |
| 634 | Blood immunoglobulin G increased | FAERS: 1 | US FAERS | |
| 635 | Blood immunoglobulin M increased | FAERS: 1 | US FAERS | |
| 636 | Blood iron abnormal | FAERS: 1 | US FAERS | |
| 637 | Blood osmolarity decreased | FAERS: 1 | US FAERS | |
| 638 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 639 | Blood parathyroid hormone abnormal | FAERS: 1 | US FAERS | |
| 640 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 641 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 642 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 643 | Blood pressure inadequately controlled | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 644 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 645 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 646 | Blood urea increased | FAERS: 1 | US FAERS | |
| 647 | Breakthrough Pain | FAERS: 1 | US FAERS | |
| 648 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 649 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 650 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 651 | Bruxism | FAERS: 1 | OFFSIDES US FAERS | |
| 652 | Bullous lung disease | FAERS: 1 | US FAERS | |
| 653 | Candidiasis | FAERS: 1 | US FAERS | |
| 654 | Capsule physical issue | FAERS: 1 | US FAERS | |
| 655 | Carcinoembryonic antigen increased | FAERS: 1 | US FAERS | |
| 656 | Cardiac Hypertrophy | FAERS: 1 | US FAERS | |
| 657 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 658 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 659 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 660 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 661 | Chemical burn of gastrointestinal tract | FAERS: 1 | US FAERS | |
| 662 | Cholestasis | FAERS: 1 | US FAERS | |
| 663 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 664 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 665 | Clonus | FAERS: 1 | US FAERS | |
| 666 | Clostridium colitis | FAERS: 1 | US FAERS | |
| 667 | Cluster Headache | FAERS: 1 | US FAERS | |
| 668 | Cogwheel Rigidity | FAERS: 1 | US FAERS | |
| 669 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 670 | Congenital inguinal hernia | FAERS: 1 | US FAERS | |
| 671 | Conjunctivitis | FAERS: 1 | SIDER US FAERS | |
| 672 | Contact lens intolerance | FAERS: 1 | US FAERS | |
| 673 | Corneal epithelium defect | FAERS: 1 | US FAERS | |
| 674 | Corneal erosion | FAERS: 1 | US FAERS | |
| 675 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 676 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 677 | Delusional disorder, unspecified type | FAERS: 1 | US FAERS | |
| 678 | Dermatitis Herpetiformis | FAERS: 1 | US FAERS | |
| 679 | Device ineffective | FAERS: 1 | US FAERS | |
| 680 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 681 | Diffuse Large B-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 682 | Disease complication | FAERS: 1 | US FAERS | |
| 683 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 684 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 685 | Drug clearance decreased | FAERS: 1 | US FAERS | |
| 686 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 687 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 688 | Drug level below therapeutic | FAERS: 1 | US FAERS | |
| 689 | Drug level increased | FAERS: 1 | US FAERS | |
| 690 | Drug use for unknown indication | FAERS: 1 | US FAERS | |
| 691 | Dysbacteriosis | FAERS: 1 | US FAERS | |
| 692 | Dysentery | FAERS: 1 | US FAERS | |
| 693 | Dysphasia | FAERS: 1 | US FAERS | |
| 694 | Dysphemia | FAERS: 1 | US FAERS | |
| 695 | Early satiety | FAERS: 1 | US FAERS | |
| 696 | Echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 697 | Electrocardiogram ST segment abnormal | FAERS: 1 | US FAERS | |
| 698 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 699 | Electrolyte depletion | FAERS: 1 | US FAERS | |
| 700 | Encephalitis | FAERS: 1 | US FAERS | |
| 701 | Endodontic procedure | FAERS: 1 | OFFSIDES US FAERS | |
| 702 | Endometrial disorder | FAERS: 1 | US FAERS | |
| 703 | Enterococcal infection | FAERS: 1 | OFFSIDES US FAERS | |
| 704 | Enuresis | FAERS: 1 | US FAERS | |
| 705 | Epigastric discomfort | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 706 | Epiglottitis obstructive | FAERS: 1 | US FAERS | |
| 707 | Escherichia urinary tract infection | FAERS: 1 | OFFSIDES US FAERS | |
| 708 | Exophthalmos | FAERS: 1 | US FAERS | |
| 709 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 710 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 711 | Eye Infection | FAERS: 1 | US FAERS | |
| 712 | Eye Redness | FAERS: 1 | US FAERS | |
| 713 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 714 | Fasciitis | FAERS: 1 | US FAERS | |
| 715 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 716 | Fluid intake restriction | FAERS: 1 | US FAERS | |
| 717 | Food craving | FAERS: 1 | US FAERS | |
| 718 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 719 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 720 | Gastric Antral Vascular Ectasia | FAERS: 1 | US FAERS | |
| 721 | Gastric hypermotility | FAERS: 1 | US FAERS | |
| 722 | Gastric hypertonia | FAERS: 1 | US FAERS | |
| 723 | Gastric infection | FAERS: 1 | US FAERS | |
| 724 | Gastric polypectomy | FAERS: 1 | US FAERS | |
| 725 | Gastric ulcer helicobacter | FAERS: 1 | US FAERS | |
| 726 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 727 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 728 | Gastrointestinal stoma complication | FAERS: 1 | US FAERS | |
| 729 | Gastrointestinal ulcer perforation | FAERS: 1 | US FAERS | |
| 730 | Gastrooesophageal heterotopia | FAERS: 1 | US FAERS | |
| 731 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 732 | General symptom | FAERS: 1 | US FAERS | |
| 733 | Genital discomfort | FAERS: 1 | US FAERS | |
| 734 | Genital pain | FAERS: 1 | US FAERS | |
| 735 | Genital swelling | FAERS: 1 | US FAERS | |
| 736 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 737 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 738 | Grip strength | FAERS: 1 | US FAERS | |
| 739 | HLA marker study positive | FAERS: 1 | US FAERS | |
| 740 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 741 | Head titubation | FAERS: 1 | US FAERS | |
| 742 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 743 | Helicobacter pylori identification test positive | FAERS: 1 | US FAERS | |
| 744 | Hemiparesis | FAERS: 1 | US FAERS | |
| 745 | Hepatic Encephalopathy | FAERS: 1 | SIDER US FAERS | |
| 746 | Hepatic necrosis | FAERS: 1 | SIDER US FAERS | |
| 747 | Hepatitis E virus test positive | FAERS: 1 | US FAERS | |
| 748 | Hip Dysplasia | FAERS: 1 | US FAERS | |
| 749 | Histone antibody positive | FAERS: 1 | US FAERS | |
| 750 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 751 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 752 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 753 | Hypertrophy of tongue papillae | FAERS: 1 | US FAERS | |
| 754 | Hypogeusia | FAERS: 1 | US FAERS | |
| 755 | Hypogonadism | FAERS: 1 | US FAERS | |
| 756 | Hypokinesia | FAERS: 1 | US FAERS | |
| 757 | Hypospadias | FAERS: 1 | US FAERS | |
| 758 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 759 | Hypoventilation | FAERS: 1 | US FAERS | |
| 760 | Ileus | FAERS: 1 | US FAERS | |
| 761 | Immobile | FAERS: 1 | US FAERS | |
| 762 | In-stent arterial restenosis | FAERS: 1 | US FAERS | |
| 763 | In-stent coronary artery restenosis | FAERS: 1 | US FAERS | |
| 764 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 765 | Incorrect product formulation administered | FAERS: 1 | US FAERS | |
| 766 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 767 | Inhibitory drug interaction | FAERS: 1 | US FAERS | |
| 768 | Initial insomnia | FAERS: 1 | US FAERS | |
| 769 | Insurance issue | FAERS: 1 | US FAERS | |
| 770 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 771 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 772 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 773 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 774 | Intestinal metaplasia | FAERS: 1 | US FAERS | |
| 775 | Intoxication by breast feeding | FAERS: 1 | US FAERS | |
| 776 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 777 | Latex allergy | FAERS: 1 | US FAERS | |
| 778 | Libido disorder | FAERS: 1 | US FAERS | |
| 779 | Lichen Planus | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 780 | Ligament rupture | FAERS: 1 | US FAERS | |
| 781 | Limb operation | FAERS: 1 | US FAERS | |
| 782 | Lip pruritus | FAERS: 1 | US FAERS | |
| 783 | Lipoatrophy | FAERS: 1 | US FAERS | |
| 784 | Listeriosis | FAERS: 1 | US FAERS | |
| 785 | Live Birth | FAERS: 1 | US FAERS | |
| 786 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 787 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 788 | Lymphocyte stimulation test positive | FAERS: 1 | US FAERS | |
| 789 | Lymphoma | FAERS: 1 | US FAERS | |
| 790 | Macular degeneration | FAERS: 1 | US FAERS | |
| 791 | Mediastinitis | FAERS: 1 | US FAERS | |
| 792 | Medical device discomfort | FAERS: 1 | US FAERS | |
| 793 | Medical diet | FAERS: 1 | US FAERS | |
| 794 | Medication residue | FAERS: 1 | US FAERS | |
| 795 | Metastasis | FAERS: 1 | US FAERS | |
| 796 | Microcytosis | FAERS: 1 | US FAERS | |
| 797 | Migraine with Aura | FAERS: 1 | OFFSIDES US FAERS | |
| 798 | Mild Mental Retardation | FAERS: 1 | US FAERS | |
| 799 | Milk Allergy | FAERS: 1 | US FAERS | |
| 800 | Mineral deficiency | FAERS: 1 | US FAERS | |
| 801 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 802 | Motion Sickness | FAERS: 1 | US FAERS | |
| 803 | Multiple Endocrine Neoplasia Type 1 | FAERS: 1 | US FAERS | |
| 804 | Multiple Sclerosis | FAERS: 1 | OFFSIDES US FAERS | |
| 805 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 806 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 807 | Muscle enzyme increased | FAERS: 1 | US FAERS | |
| 808 | Muscle strain | FAERS: 1 | US FAERS | |
| 809 | Mutism | FAERS: 1 | US FAERS | |
| 810 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 811 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 812 | Nasal mucosal disorder | FAERS: 1 | US FAERS | |
| 813 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 814 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 815 | Neonatal respiratory arrest | FAERS: 1 | US FAERS | |
| 816 | Nephritis allergic | FAERS: 1 | OFFSIDES US FAERS | |
| 817 | Nephrotic Syndrome | FAERS: 1 | SIDER US FAERS | |
| 818 | Nerve injury | FAERS: 1 | US FAERS | |
| 819 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 820 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 821 | Nicotine Dependence | FAERS: 1 | US FAERS | |
| 822 | Nipple pain | FAERS: 1 | US FAERS | |
| 823 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 824 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 825 | Norepinephrine increased | FAERS: 1 | US FAERS | |
| 826 | Nystagmus | FAERS: 1 | US FAERS | |
| 827 | Obstruction | FAERS: 1 | US FAERS | |
| 828 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 829 | Ophthalmoplegic Migraine | FAERS: 1 | US FAERS | |
| 830 | Opiates positive | FAERS: 1 | US FAERS | |
| 831 | Optic Atrophy | FAERS: 1 | SIDER US FAERS | |
| 832 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 833 | Osteitis | FAERS: 1 | US FAERS | |
| 834 | Ototoxicity | FAERS: 1 | US FAERS | |
| 835 | PO2 increased | FAERS: 1 | US FAERS | |
| 836 | Palmar erythema | FAERS: 1 | US FAERS | |
| 837 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 838 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 839 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 840 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 841 | Paradoxical pain | FAERS: 1 | US FAERS | |
| 842 | Paratyphoid Fever | FAERS: 1 | US FAERS | |
| 843 | Paresis | FAERS: 1 | US FAERS | |
| 844 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 845 | Pemphigus | FAERS: 1 | US FAERS | |
| 846 | Penile swelling | FAERS: 1 | US FAERS | |
| 847 | Perivascular dermatitis | FAERS: 1 | US FAERS | |
| 848 | Personality Change | FAERS: 1 | US FAERS | |
| 849 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 850 | Phlebitis | FAERS: 1 | US FAERS | |
| 851 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 852 | Post procedural complication | FAERS: 1 | OFFSIDES US FAERS | |
| 853 | Post procedural infection | FAERS: 1 | US FAERS | |
| 854 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 855 | Postural Orthostatic Tachycardia Syndrome | FAERS: 1 | US FAERS | |
| 856 | Precancerous cells present | FAERS: 1 | US FAERS | |
| 857 | Proctitis | FAERS: 1 | US FAERS | |
| 858 | Product advertising issue | FAERS: 1 | US FAERS | |
| 859 | Product appearance confusion | FAERS: 1 | US FAERS | |
| 860 | Product compounding quality issue | FAERS: 1 | US FAERS | |
| 861 | Product container issue | FAERS: 1 | US FAERS | |
| 862 | Product container seal issue | FAERS: 1 | US FAERS | |
| 863 | Product dispensing error | FAERS: 1 | US FAERS | |
| 864 | Product outer packaging issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 865 | Product prescribing error | FAERS: 1 | US FAERS | |
| 866 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 867 | Product residue present | FAERS: 1 | US FAERS | |
| 868 | Product size issue | FAERS: 1 | US FAERS | |
| 869 | Product tampering | FAERS: 1 | US FAERS | |
| 870 | Product use complaint | FAERS: 1 | US FAERS | |
| 871 | Prostate examination abnormal | FAERS: 1 | US FAERS | |
| 872 | Protein urine present | FAERS: 1 | SIDER US FAERS | |
| 873 | Proteinuria | FAERS: 1 Canada Vigilance: 1 | 7802778 8356994 8442906 | CTD SIDER Canada Vigilance US FAERS |
| 874 | Psoriasis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 875 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 876 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 877 | Pustular psoriasis | FAERS: 1 | US FAERS | |
| 878 | Pyloric Stenosis | FAERS: 1 | US FAERS | |
| 879 | Rales | FAERS: 1 | US FAERS | |
| 880 | Reaction to food additive | FAERS: 1 | US FAERS | |
| 881 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 882 | Rectal discharge | FAERS: 1 | US FAERS | |
| 883 | Refusal of treatment by relative | FAERS: 1 | US FAERS | |
| 884 | Regurgitation of food | FAERS: 1 | US FAERS | |
| 885 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 886 | Respiratory fume inhalation disorder | FAERS: 1 | US FAERS | |
| 887 | Retinal Vascular Disorder | FAERS: 1 | US FAERS | |
| 888 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 889 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 890 | Scan abdomen abnormal | FAERS: 1 | US FAERS | |
| 891 | Schizophrenia | FAERS: 1 | US FAERS | |
| 892 | Scleroderma | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 893 | Secretion discharge | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 894 | Semen abnormal | FAERS: 1 | US FAERS | |
| 895 | Sensory integrative dysfunction | FAERS: 1 | US FAERS | |
| 896 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 897 | Serum Sickness | FAERS: 1 | US FAERS | |
| 898 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 899 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 900 | Skeletal injury | FAERS: 1 | US FAERS | |
| 901 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 902 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 903 | Skin discomfort | FAERS: 1 | US FAERS | |
| 904 | Sluggishness | FAERS: 1 | US FAERS | |
| 905 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 906 | Splenomegaly | FAERS: 1 | US FAERS | |
| 907 | Spondylitis | FAERS: 1 | US FAERS | |
| 908 | Spontaneous penile erection | FAERS: 1 | US FAERS | |
| 909 | Staphylococcal Scalded Skin Syndrome | FAERS: 1 | US FAERS | |
| 910 | Stent occlusion | FAERS: 1 | US FAERS | |
| 911 | Streptococcus test positive | FAERS: 1 | US FAERS | |
| 912 | Stress ulcer | FAERS: 1 | US FAERS | |
| 913 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 914 | Teeth brittle | FAERS: 1 | US FAERS | |
| 915 | Therapeutic product effect incomplete | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 916 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 917 | Thermal burn | FAERS: 1 | US FAERS | |
| 918 | Throat cancer | FAERS: 1 | US FAERS | |
| 919 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 920 | Thyroid cancer metastatic | FAERS: 1 | US FAERS | |
| 921 | Thyroiditis | FAERS: 1 | US FAERS | |
| 922 | Tooth Extraction | FAERS: 1 | OFFSIDES US FAERS | |
| 923 | Toxoplasmosis | FAERS: 1 | US FAERS | |
| 924 | Transmission of drug via semen | FAERS: 1 | US FAERS | |
| 925 | Trismus | FAERS: 1 | US FAERS | |
| 926 | Troponin I increased | FAERS: 1 | US FAERS | |
| 927 | Tuberculosis | FAERS: 1 | US FAERS | |
| 928 | Type III immune complex mediated reaction | FAERS: 1 | US FAERS | |
| 929 | Urethritis noninfective | FAERS: 1 | US FAERS | |
| 930 | Urethritis | FAERS: 1 | US FAERS | |
| 931 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 932 | Urine bilirubin increased | FAERS: 1 | US FAERS | |
| 933 | Urine osmolarity increased | FAERS: 1 | US FAERS | |
| 934 | Urine potassium increased | FAERS: 1 | US FAERS | |
| 935 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 936 | Venous occlusion | FAERS: 1 | US FAERS | |
| 937 | Vessel perforation | FAERS: 1 | US FAERS | |
| 938 | Vibratory sense increased | FAERS: 1 | US FAERS | |
| 939 | Visual disturbance | FAERS: 1 | SIDER US FAERS | |
| 940 | Vitamin B12 abnormal | FAERS: 1 | US FAERS | |
| 941 | Vitamin B6 abnormal | FAERS: 1 | US FAERS | |
| 942 | Vitamin D abnormal | FAERS: 1 | US FAERS | |
| 943 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 944 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 945 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 946 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 947 | Wheelchair user | FAERS: 1 | US FAERS | |
| 948 | Wrong product administered | FAERS: 1 | US FAERS | |
| 949 | Yawning | FAERS: 1 | US FAERS | |
| 950 | colonoscopy | FAERS: 1 | US FAERS | |
| 951 | prostatitis | FAERS: 1 | US FAERS | |
| 952 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 953 | Abnormal vision | SIDER | ||
| 954 | Abscess | Canada Vigilance: 1 | Canada Vigilance | |
| 955 | Acid reflux | OFFSIDES | ||
| 956 | Actinic keratosis | OFFSIDES | ||
| 957 | Acute myocardial infarction | OFFSIDES | ||
| 958 | Acute sinusitis | OFFSIDES | ||
| 959 | Adnexa uteri mass | OFFSIDES | ||
| 960 | Agraphia | OFFSIDES | ||
| 961 | Albuminuria | SIDER | ||
| 962 | Altered bowel function | OFFSIDES | ||
| 963 | Amaurosis Fugax | OFFSIDES | ||
| 964 | Anemia, Hemolytic | 1992636 | CTD | |
| 965 | Anemia | 7802778 9799915 | CTD | |
| 966 | Anhedonia | OFFSIDES | ||
| 967 | Anterior Ischemic Optic Neuropathy | SIDER | ||
| 968 | Anti-erythropoietin antibody positive | OFFSIDES | ||
| 969 | Antithrombin III decreased | OFFSIDES | ||
| 970 | Aortic Aneurysm | OFFSIDES | ||
| 971 | Appendectomy | OFFSIDES | ||
| 972 | Appendicitis | OFFSIDES | ||
| 973 | Arthritis aggravated | SIDER | ||
| 974 | Aspiration Pneumonia | OFFSIDES | ||
| 975 | Asthma aggravated | SIDER | ||
| 976 | Atelectasis | OFFSIDES | ||
| 977 | Atrial tachycardia | OFFSIDES | ||
| 978 | Aura | OFFSIDES | ||
| 979 | Autoimmune inner ear disease | OFFSIDES | ||
| 980 | Azotemia | 7802778 | CTD | |
| 981 | Barrett Esophagus | 12601409 | CTD | |
| 982 | Benign Neoplasm | OFFSIDES | ||
| 983 | Biliary sepsis | OFFSIDES | ||
| 984 | Biopsy breast abnormal | OFFSIDES | ||
| 985 | Blood Coagulation Disorders | 19483382 | CTD | |
| 986 | Blood Glucose | OFFSIDES | ||
| 987 | Blood and lymphatic system disorders | SIDER | ||
| 988 | Blood cholesterol | OFFSIDES | ||
| 989 | Blood creatinine decreased | OFFSIDES | ||
| 990 | Blood sodium increased | OFFSIDES | ||
| 991 | Blood sodium | OFFSIDES | ||
| 992 | Blood triglycerides increased | OFFSIDES | ||
| 993 | Bloody peritoneal effluent | OFFSIDES | ||
| 994 | Bone erosion | OFFSIDES | ||
| 995 | Bone fragmentation | OFFSIDES | ||
| 996 | Bone lesion | OFFSIDES | ||
| 997 | Brain scan abnormal | OFFSIDES | ||
| 998 | Breast Cyst | OFFSIDES | ||
| 999 | Breast cancer recurrent | OFFSIDES | ||
| 1000 | Bronchopneumonia | OFFSIDES | ||
| 1001 | Cardiac Tamponade | OFFSIDES | ||
| 1002 | Carotid bruit | OFFSIDES | ||
| 1003 | Catatonia | 2224697 | CTD | |
| 1004 | Catheter related infection | OFFSIDES | ||
| 1005 | Cerebral aspergillosis | OFFSIDES | ||
| 1006 | Cervicobrachial syndrome | OFFSIDES | ||
| 1007 | Chemical and Drug Induced Liver Injury | 16096600 17266883 | CTD | |
| 1008 | Chloasma | OFFSIDES | ||
| 1009 | Chromosome Aberrations | 31369745 | CTD | |
| 1010 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 1011 | Cleft Palate | Canada Vigilance: 2 | Canada Vigilance | |
| 1012 | Confusion | 2224697 9451708 | CTD | |
| 1013 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 1014 | Consciousness Disorders | 8769288 15741423 | CTD | |
| 1015 | Constipation aggravated | SIDER | ||
| 1016 | Creatinine increased | SIDER | ||
| 1017 | Culture wound positive | OFFSIDES | ||
| 1018 | Cystocele | OFFSIDES | ||
| 1019 | Debridement | OFFSIDES | ||
| 1020 | Deglutition Disorders | 10566755 | CTD | |
| 1021 | Dental abscess | OFFSIDES | ||
| 1022 | Depression aggravated | SIDER | ||
| 1023 | Dermatomyositis | 16445794 | CTD | |
| 1024 | Diabetes | OFFSIDES | ||
| 1025 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 1026 | Diarrhea | CTD OFFSIDES | ||
| 1027 | Disorders of Excessive Somnolence | 18493207 | CTD | |
| 1028 | Drowsiness | OFFSIDES | ||
| 1029 | Drug Eruptions | 8356994 17432815 | CTD | |
| 1030 | Duodenitis | SIDER | ||
| 1031 | Dyspareunia | OFFSIDES | ||
| 1032 | Dyspnea | 1992636 | CTD | |
| 1033 | Ear and labyrinth disorders | SIDER | ||
| 1034 | Edema | 11341670 26970604 | CTD | |
| 1035 | Encephalomalacia | OFFSIDES | ||
| 1036 | Endocarditis | OFFSIDES | ||
| 1037 | Engraft failure | OFFSIDES | ||
| 1038 | Enlargement abdomen | SIDER | ||
| 1039 | Epidermal necrosis | SIDER | ||
| 1040 | Epigastric pain | SIDER | ||
| 1041 | Epstein-Barr virus antibody positive | OFFSIDES | ||
| 1042 | Esophagitis | CTD | ||
| 1043 | Excoriation | OFFSIDES | ||
| 1044 | Facial Neuralgia | OFFSIDES | ||
| 1045 | Facial paralysis | 19617305 | CTD | |
| 1046 | Febrile Neutropenia | OFFSIDES | ||
| 1047 | Fever | 9799915 10566755 | CTD | |
| 1048 | Flat affect | SIDER | ||
| 1049 | Fundic gland polyp | SIDER | ||
| 1050 | Galactorrhea-Hyperprolactinemia | 20726208 | CTD | |
| 1051 | Gastrinoma | SIDER | ||
| 1052 | Gastroduodenitis | OFFSIDES | ||
| 1053 | Gastrointestinal Diseases | 19617305 | CTD | |
| 1054 | Gastrointestinal Hemorrhage | 9017686 15943857 | CTD | |
| 1055 | Gastrointestinal candidiasis | SIDER | ||
| 1056 | Genital rash | OFFSIDES | ||
| 1057 | Gingivitis | Canada Vigilance: 1 | Canada Vigilance | |
| 1058 | Glycosuria | 8442906 | CTD SIDER | |
| 1059 | Granulocytosis | OFFSIDES | ||
| 1060 | Granuloma | OFFSIDES | ||
| 1061 | Gynecomastia | 1392958 1682578 7771409 | CTD | |
| 1062 | Hallucinations | 10701899 | CTD | |
| 1063 | Heartburn | CTD | ||
| 1064 | Helicobacter Infections | CTD | ||
| 1065 | Hematuria | 7802778 | CTD | |
| 1066 | Hemorrhage | 9695674 26970604 | CTD | |
| 1067 | Hiccough | OFFSIDES | ||
| 1068 | Hypercalcemia | 10978407 | CTD | |
| 1069 | Hypesthesia | 2265010 | CTD | |
| 1070 | Hypocalcemia | 18221401 | CTD | |
| 1071 | Hyponatremia | 8769288 15741423 18410837 | CTD | |
| 1072 | Immune reconstitution syndrome | OFFSIDES | ||
| 1073 | Increased tendency to bruise | Canada Vigilance: 1 | Canada Vigilance | |
| 1074 | Infestation | SIDER | ||
| 1075 | Inflammatory Bowel Diseases | 8071518 | CTD | |
| 1076 | Infusion site mobility decreased | OFFSIDES | ||
| 1077 | Injection Site Reaction | SIDER | ||
| 1078 | Joint Range of Motion Decreased | OFFSIDES | ||
| 1079 | Joint sprain | OFFSIDES | ||
| 1080 | Kidney Diseases | 30452898 | CTD | |
| 1081 | Kidney Failure | OFFSIDES | ||
| 1082 | Lacrimation decreased | SIDER | ||
| 1083 | Laryngopharyngeal Reflux | 15995512 | CTD | |
| 1084 | Laryngospasm | OFFSIDES | ||
| 1085 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 1086 | Left atrial dilatation | OFFSIDES | ||
| 1087 | Leg edema | SIDER | ||
| 1088 | Leishmaniasis, Cutaneous | 19248655 | CTD | |
| 1089 | Lesion excision | OFFSIDES | ||
| 1090 | Lightheadedness | SIDER | ||
| 1091 | Liver Failure, Acute | 1553942 | CTD | |
| 1092 | Liver Neoplasms, Experimental | 22687989 | CTD | |
| 1093 | Liver neoplasms | 28108177 | CTD | |
| 1094 | Loose tooth | OFFSIDES | ||
| 1095 | Malignant neoplasm progression | OFFSIDES | ||
| 1096 | Malocclusion | OFFSIDES | ||
| 1097 | Mastectomy | OFFSIDES | ||
| 1098 | Mechanical urticaria | OFFSIDES | ||
| 1099 | Meningocele | Canada Vigilance: 1 | Canada Vigilance | |
| 1100 | Metastatic Neoplasm | OFFSIDES | ||
| 1101 | Metatarsalgia | OFFSIDES | ||
| 1102 | Micturition frequency decreased | OFFSIDES | ||
| 1103 | Migraine aggravated | SIDER | ||
| 1104 | Mitral valve sclerosis | OFFSIDES | ||
| 1105 | Monoplegia | OFFSIDES | ||
| 1106 | Mucosal atrophy | SIDER | ||
| 1107 | Multiple sclerosis relapse | OFFSIDES | ||
| 1108 | Muscle Weakness | 1355231 9466609 16758264 | CTD OFFSIDES | |
| 1109 | Myasthenic Syndrome | Canada Vigilance: 1 | Canada Vigilance | |
| 1110 | Myelodysplasia | OFFSIDES | ||
| 1111 | Necrosis | 7924729 | CTD SIDER | |
| 1112 | Neoplasm Invasiveness | 25826687 | CTD | |
| 1113 | Nephritis, Interstitial |
1341422
7802778 7934394 8356994 8529303 9044464 9412948 9627043 9882866 10222687 10566755 10924942 10978407 11774962 11803011 12601409 15004262 15219071 16630752 19682153 20573087 | CTD | |
| 1114 | Nephrosis | SIDER | ||
| 1115 | Neuromuscular Diseases | 9466609 | CTD | |
| 1116 | Neurosensory hypoacusis | OFFSIDES | ||
| 1117 | Nodule | OFFSIDES SIDER | ||
| 1118 | Occult blood positive | OFFSIDES | ||
| 1119 | Olfaction Disorders | 15936486 | CTD | |
| 1120 | Ophthalmoplegia | OFFSIDES | ||
| 1121 | Optic Neuritis | SIDER | ||
| 1122 | Optic Neuropathy, Ischemic | 9224084 | CTD | |
| 1123 | Oral administration complication | Canada Vigilance: 1 | Canada Vigilance | |
| 1124 | Orthopnea | OFFSIDES | ||
| 1125 | Osteitis Deformans | OFFSIDES | ||
| 1126 | Osteochondrosis | OFFSIDES | ||
| 1127 | Osteolysis | OFFSIDES | ||
| 1128 | Otitis Media | SIDER | ||
| 1129 | Panniculitis | Canada Vigilance: 1 | Canada Vigilance | |
| 1130 | Papilledema | 9224084 | CTD | |
| 1131 | Paresthesia | 2265010 9466609 | CTD | |
| 1132 | Peptic Ulcer Hemorrhage | 11421865 | CTD | |
| 1133 | Peptic Ulcer | Canada Vigilance: 1 | CTD Canada Vigilance | |
| 1134 | Periodontitis | OFFSIDES | ||
| 1135 | Polymyalgia Rheumatica | SIDER | ||
| 1136 | Poor dental condition | OFFSIDES | ||
| 1137 | Post procedural cellulitis | OFFSIDES | ||
| 1138 | Postmenopausal bleeding | OFFSIDES | ||
| 1139 | Postoperative Hemorrhage | 15943857 | CTD | |
| 1140 | Primary sequestrum | OFFSIDES | ||
| 1141 | Pseudolymphoma | Canada Vigilance: 1 | Canada Vigilance | |
| 1142 | Psychoses, Substance-Induced | 10701899 | CTD | |
| 1143 | Pulmonary Hypertension | OFFSIDES | ||
| 1144 | Rectocele | OFFSIDES | ||
| 1145 | Reflex, Abnormal | 2265010 | CTD | |
| 1146 | Renal Insufficiency | 9627043 10924942 | CTD | |
| 1147 | Retroperitoneal lymphadenopathy | OFFSIDES | ||
| 1148 | Retrosternal pain | SIDER | ||
| 1149 | Rhinorrhea | OFFSIDES | ||
| 1150 | Scotoma | SIDER | ||
| 1151 | Seizures | 18221401 | CTD | |
| 1152 | Septic Shock | OFFSIDES | ||
| 1153 | Serum gastrin increased | SIDER | ||
| 1154 | Sinus bradycardia | OFFSIDES | ||
| 1155 | Skin Abnormalities | 8159596 | CTD | |
| 1156 | Stomach Diseases | 11292068 18545984 | CTD | |
| 1157 | Tachycardia, Ventricular | 20204717 | CTD | |
| 1158 | Tendinitis | OFFSIDES | ||
| 1159 | Tension | SIDER | ||
| 1160 | Therapeutic response changed | Canada Vigilance: 29 | Canada Vigilance | |
| 1161 | Therapy change | Canada Vigilance: 1 | Canada Vigilance | |
| 1162 | Ulcerative stomatitis | SIDER | ||
| 1163 | Ultrasound breast abnormal | OFFSIDES | ||
| 1164 | Urinary tract inflammation | OFFSIDES | ||
| 1165 | Urination Disorders | 9044464 10566755 | CTD | |
| 1166 | Urine output increased | SIDER | ||
| 1167 | Vascular purpura | SIDER | ||
| 1168 | Vasculitis, Leukocytoclastic, Cutaneous | 11807212 12219273 | CTD | |
| 1169 | Venous thrombosis limb | OFFSIDES | ||
| 1170 | Vision Disorders | 9224084 11773867 | CTD | |
| 1171 | Vocal Cord Dysfunction | Canada Vigilance: 1 | Canada Vigilance | |
| 1172 | Vulvovaginal dryness | OFFSIDES | ||
| 1173 | Weight Gain | OFFSIDES | ||
| 1174 | Wound infection staphylococcal | OFFSIDES | ||
| 1175 | Zollinger-Ellison syndrome | CTD SIDER | ||
| 1176 | anaphylaxis | 9988207 12681212 16397810 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.