MetaADEDB: Drug

MetaADEDB 2.0 @ LMMD

Paclitaxel

(RCINICONZNJXQF-MZXODVADSA-N)

Structure

SMILES: CC(=O)O[C@H]1C(=O)[C@]2(C)[C@@H](O)C[C@@H]3[C@]([C@H]2[C@@H]([C@]2(C(C1=C(C)[C@@H](OC(=O)[C@@H]([C@H](c1ccccc1)NC(=O)c1ccccc1)O)C2)(C)C)O)OC(=O)c1ccccc1)(CO3)OC(=O)C
Type(s): Approved; Vet_approved
ATC code(s): L01CD01
Molecular Formula:: C47H51NO14
Molecular Weight:: 853.906
Log P:: 4.1266
Hydrogen Bond Acceptor:: 15
Hydrogen Bond Donor:: 4
TPSA:: 221.29
CAS Number(s):: 33069-62-4; 263351-82-2

Synonym(s)

Paclitaxel

7-epi-Taxol

Anzatax

Bris Taxol

NSC-125973

Onxol

Paclitaxel, (4 alpha)-Isomer

Paxene

Praxel

10.

Taxol

11.

Taxol A

12.

7 epi Taxol

13.

NSC 125973

14.

NSC125973

15.

Taxol, Bris

External Link(s)

MeSH	D017239
PubChem Compound	36314
BindingDB	50001839
ChEBI	45863
CHEMBL	CHEMBL428647
DrugBank	DB01229
DrugCentral	2044
IUPHAR/BPS Guide to PHARMACOLOGY	2770
KEGG	dr:D00491
ZINC	96006020

Adverse Drug Event(s)

	Name	Number of Reports	Reference(s)	Data Source
1	Flushing	FAERS: 339 Canada Vigilance: 33	7509380 7909329 15026476	CTD SIDER Canada Vigilance US FAERS
2	Erythema	FAERS: 276 Canada Vigilance: 15	7644923	CTD OFFSIDES SIDER Canada Vigilance US FAERS
3	Nausea	FAERS: 259 Canada Vigilance: 7	View details 8610231 8643966 8708721 8893895 9007120 9007121 9149030 9346219 10955861 11800032 12442916 15170980 15493358 15923795 15961435 17974278 20025538 30563934	CTD OFFSIDES SIDER Canada Vigilance US FAERS
4	Back Pain	FAERS: 253 Canada Vigilance: 22	18593679	CTD SIDER Canada Vigilance US FAERS
5	Chest discomfort	FAERS: 210 Canada Vigilance: 22		Canada Vigilance SIDER US FAERS
6	Hypersensitivity	FAERS: 209 Canada Vigilance: 1	View details 9817264 11455223 11800032 15033348 15668279	CTD SIDER Canada Vigilance US FAERS
7	Neutropenia	FAERS: 202 Canada Vigilance: 4	View details 7524159 7543559 7543699 7595726 7638640 7692001 7884419 8558189 8610231 8629032 8643966 8643967 8751544 8893894 8893895 8893896 9007121 9007123 9007126 9071336 9164208 9296218 9346218 9346219 9346221 9346223 9374088 9440737 9676843 9740541 9774950 9849468 9879778 10472783 10928183 10955861 11104554 11135224 11147586 11221961 11230474 11679185 11800032 12110496 12367796 12442916 12601542 12847320 14514973 14760117 14769840 15131032 15493357 15493358 15566651 15581045 15668279 15865068 15961435 16100454 16293865 16332718 16612156 16763792 16950614 17974278 18042835 19396017 19812061 20389300 20406837 20547415 30563934	CTD SIDER Canada Vigilance US FAERS
8	Vomiting	FAERS: 185 Canada Vigilance: 3	View details 8610231 8643966 8893895 9007120 9007121 9149030 9346219 10955861 11800032 12110496 12442916 15170980 15493358 15923795 16332718 17974278 30563934	CTD SIDER Canada Vigilance US FAERS
9	Hypotension	FAERS: 175	View details 8636011 11455223 11800032 14760117	CTD SIDER US FAERS
10	Chest Pain	FAERS: 150 Canada Vigilance: 7	8893117 19382279 20052472	CTD SIDER Canada Vigilance US FAERS
11	Pancreatic carcinoma	FAERS: 126		SIDER US FAERS
12	Fatigue	FAERS: 114 Canada Vigilance: 5	View details 8708721 10483822 14698135 14760117 16100454 17974278 18593679 30563934	CTD OFFSIDES SIDER Canada Vigilance US FAERS
13	Malaise	FAERS: 106 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
14	Asthenia	FAERS: 104	10928183 15493358	CTD OFFSIDES SIDER US FAERS
15	Thrombocytopenia	FAERS: 98 Canada Vigilance: 1	View details 7543559 7543699 8643968 8643973 9007119 9007120 9007121 9007126 9149030 9296218 9346218 9346219 10037178 10800167 11135224 11147586 11230474 12367796 14760117 15493352 15581045 15961435 16332718 16612156 16763792 17974278 19396017 20389300 20547415	CTD SIDER Canada Vigilance US FAERS
16	Tachycardia	FAERS: 97 Canada Vigilance: 4	9311449	CTD SIDER Canada Vigilance US FAERS
17	Dizziness	FAERS: 94 Canada Vigilance: 5	7909329 18418024	CTD SIDER Canada Vigilance US FAERS
18	Pain	FAERS: 94 Canada Vigilance: 1	View details 7909329 8893895 10483822 11104554 11113764 11330975 11487721 16766103 17659836 20389300	CTD OFFSIDES SIDER Canada Vigilance US FAERS
19	Bronchospasm	FAERS: 92 Canada Vigilance: 2		Canada Vigilance US FAERS
20	Alopecia	FAERS: 85	View details 7884419 8636602 8643971 8708721 8751544 8893892 8893895 9007121 9007123 9007126 9149030 9346219 9374088 9774950 11104554 11147586 12442916 15923795 15961435 16354605 20025538 30563934	CTD OFFSIDES SIDER US FAERS
21	Abdominal Pain	FAERS: 79 Canada Vigilance: 3	8708721	CTD OFFSIDES SIDER Canada Vigilance US FAERS
22	Pruritus	FAERS: 78 Canada Vigilance: 5	9149030 9774950	CTD SIDER Canada Vigilance US FAERS
23	Disease Progression	FAERS: 73		US FAERS
24	Febrile Neutropenia	FAERS: 72		OFFSIDES SIDER US FAERS
25	Cyanosis	FAERS: 71		US FAERS
26	Pneumonia	FAERS: 63	12367796 16612156	CTD SIDER US FAERS
27	White blood cell count decreased	FAERS: 63		US FAERS
28	Arthralgia	FAERS: 61	View details 7509380 7524159 7543559 7543699 7644931 7884419 8558189 8643966 8643968 8643971 8893894 9007120 9007126 9007130 9149030 9635850 9850043 9889038 10483822 11147586 11230474 11706781 11977541 12442916 14698135 15118009 15334869 16766103 18839222	CTD SIDER US FAERS
29	Respiratory Failure	FAERS: 60		OFFSIDES SIDER US FAERS
30	Anaphylactic shock	FAERS: 59		SIDER US FAERS
31	Extravasation	FAERS: 59		SIDER US FAERS
32	Malignant neoplasm progression	FAERS: 56		OFFSIDES US FAERS
33	Adverse event	FAERS: 52		US FAERS
34	Leukopenia	FAERS: 51	View details 7543699 8094467 8643973 12601542 15493352 15493358 15566651 15923795 17593098 17637549 20025538	CTD SIDER US FAERS
35	Myalgia	FAERS: 50		SIDER US FAERS
36	Sepsis	FAERS: 50	View details 9346218 9346226 9879778 12110496 15493357	CTD SIDER US FAERS
37	Pneumonitis	FAERS: 49 Canada Vigilance: 2		Canada Vigilance US FAERS
38	Cardiac Arrest	FAERS: 48		SIDER US FAERS
39	Syncope	FAERS: 46		SIDER US FAERS
40	Unresponsive to stimuli	FAERS: 44 Canada Vigilance: 2		Canada Vigilance US FAERS
41	Device Failure	FAERS: 43		US FAERS
42	Neutrophil count decreased	FAERS: 43		OFFSIDES US FAERS
43	Infection	FAERS: 40		OFFSIDES SIDER US FAERS
44	Constipation	FAERS: 38	11104554	CTD SIDER US FAERS
45	Medical device complication	FAERS: 37		US FAERS
46	Dehydration	FAERS: 36		OFFSIDES SIDER US FAERS
47	Anxiety	FAERS: 35 Canada Vigilance: 1		Canada Vigilance OFFSIDES SIDER US FAERS
48	Drug ineffective	FAERS: 35		US FAERS
49	Ascites	FAERS: 33		SIDER US FAERS
50	General physical health deterioration	FAERS: 33		US FAERS
51	Respiratory arrest	FAERS: 33		US FAERS
52	Respiratory distress	FAERS: 33 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
53	Chills	FAERS: 32		SIDER US FAERS
54	Onycholysis	FAERS: 32	12582404	CTD SIDER US FAERS
55	Wheezing	FAERS: 32 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
56	Feeling abnormal	FAERS: 31		SIDER US FAERS
57	Headache	FAERS: 31 Canada Vigilance: 2	7509380 7904060 8649555	CTD SIDER Canada Vigilance US FAERS
58	Laryngospasm	FAERS: 31		US FAERS
59	Bone pain	FAERS: 30		SIDER US FAERS
60	Palpitations	FAERS: 30 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
61	Pulmonary Embolism	FAERS: 30	20052472	CTD SIDER US FAERS
62	Stomatitis	FAERS: 30	14760117	CTD SIDER US FAERS
63	Aspartate Aminotransferase Increased	FAERS: 29		SIDER US FAERS
64	Hypoxia	FAERS: 28		OFFSIDES US FAERS
65	Transaminases increased	FAERS: 28		US FAERS
66	Unevaluable event	FAERS: 28		US FAERS
67	Alanine Aminotransferase Increased	FAERS: 27		OFFSIDES SIDER US FAERS
68	Procedural complication	FAERS: 27		US FAERS
69	Scleroderma	FAERS: 27		SIDER US FAERS
70	Weight decreased	FAERS: 27		SIDER US FAERS
71	Burning sensation	FAERS: 26 Canada Vigilance: 1		Canada Vigilance US FAERS
72	Neuropathy	FAERS: 26		SIDER US FAERS
73	Pancytopenia	FAERS: 26		SIDER US FAERS
74	Toxicity to various agents	FAERS: 26 Canada Vigilance: 1		Canada Vigilance US FAERS
75	Myocardial Infarction	FAERS: 25	View details 8893117 9135899 12677287 14682199 16354605 19702043	CTD SIDER US FAERS
76	Urticaria	FAERS: 23 Canada Vigilance: 3		Canada Vigilance SIDER US FAERS
77	Aphasia	FAERS: 22		US FAERS
78	Disseminated Intravascular Coagulation	FAERS: 21		US FAERS
79	Musculoskeletal Pain	FAERS: 21		OFFSIDES SIDER US FAERS
80	Respiratory Depression	FAERS: 21		US FAERS
81	Atrial Fibrillation	FAERS: 19	9676843 10052252	CTD SIDER US FAERS
82	Depressed Level of Consciousness	FAERS: 19		US FAERS
83	Polyneuropathy	FAERS: 19		OFFSIDES SIDER US FAERS
84	Pulmonary toxicity	FAERS: 19		US FAERS
85	Haematotoxicity	FAERS: 18		US FAERS
86	Medication Error	FAERS: 18		US FAERS
87	Stent occlusion	FAERS: 18		US FAERS
88	Vertigo	FAERS: 18	10483822	CTD SIDER US FAERS
89	Visual Impairment	FAERS: 18		SIDER US FAERS
90	Agitation	FAERS: 17		SIDER US FAERS
91	Angina Pectoris	FAERS: 17		US FAERS
92	Blood creatinine increased	FAERS: 17		OFFSIDES SIDER US FAERS
93	Pharmaceutical product complaint	FAERS: 17		US FAERS
94	Acute kidney injury	FAERS: 16		US FAERS
95	Cerebrovascular accident	FAERS: 16		SIDER US FAERS
96	Product quality issue	FAERS: 16		US FAERS
97	Thrombosis in device	FAERS: 16		US FAERS
98	Urinary Incontinence	FAERS: 16		SIDER US FAERS
99	Urinary tract infection	FAERS: 16		SIDER US FAERS
100	Cellulitis	FAERS: 15		SIDER US FAERS
101	Cold sweat	FAERS: 15 Canada Vigilance: 2		Canada Vigilance US FAERS
102	Dysgeusia	FAERS: 15	18378545	CTD SIDER US FAERS
103	Pericardial effusion	FAERS: 15		OFFSIDES US FAERS
104	Shock	FAERS: 15		SIDER US FAERS
105	Somnolence	FAERS: 15 Canada Vigilance: 3		Canada Vigilance SIDER US FAERS
106	Throat irritation	FAERS: 15 Canada Vigilance: 2		Canada Vigilance US FAERS
107	Acute myocardial infarction	FAERS: 14		US FAERS
108	Restlessness	FAERS: 14		US FAERS
109	Septic Shock	FAERS: 14		SIDER US FAERS
110	Blood alkaline phosphatase increased	FAERS: 13		OFFSIDES SIDER US FAERS
111	Bradycardia	FAERS: 13	8102012 14514973 16354605	CTD OFFSIDES SIDER US FAERS
112	Device related infection	FAERS: 13		SIDER US FAERS
113	Dyspepsia	FAERS: 13		SIDER US FAERS
114	Escherichia sepsis	FAERS: 13		US FAERS
115	Gamma-Glutamyltransferase Increased	FAERS: 13		SIDER US FAERS
116	Rash erythematous	FAERS: 13 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
117	Tremor	FAERS: 13		SIDER US FAERS
118	Cholestasis	FAERS: 12	8895755 9794924	CTD US FAERS
119	Deep Vein Thrombosis	FAERS: 12		US FAERS
120	Drug administration error	FAERS: 12		US FAERS
121	Epistaxis	FAERS: 12		SIDER US FAERS
122	Hypertensive crisis	FAERS: 12		US FAERS
123	Lethargy	FAERS: 12	8636602	CTD SIDER US FAERS
124	Peripheral motor neuropathy	FAERS: 12		SIDER US FAERS
125	Post procedural complication	FAERS: 12		US FAERS
126	Thrombosis	FAERS: 12	7907689 7907690 17145250	CTD SIDER US FAERS
127	Tumour haemorrhage	FAERS: 12		US FAERS
128	Accidental exposure	FAERS: 11		US FAERS
129	Hepatotoxicity	FAERS: 11		US FAERS
130	Hypophagia	FAERS: 11		OFFSIDES US FAERS
131	Intestinal Perforation	FAERS: 11		SIDER US FAERS
132	Memory impairment	FAERS: 11		US FAERS
133	Presyncope	FAERS: 11 Canada Vigilance: 1		Canada Vigilance US FAERS
134	Product use in unapproved indication	FAERS: 11		US FAERS
135	Skin reaction	FAERS: 11		US FAERS
136	Ventricular Fibrillation	FAERS: 11		US FAERS
137	Abdominal discomfort	FAERS: 10 Canada Vigilance: 3		Canada Vigilance OFFSIDES US FAERS
138	Cataract	FAERS: 10		US FAERS
139	Cerebral Infarction	FAERS: 10		US FAERS
140	Choking sensation	FAERS: 10		OFFSIDES US FAERS
141	Deafness	FAERS: 10	11205470	CTD SIDER US FAERS
142	Dysphonia	FAERS: 10 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
143	Ileus	FAERS: 10	8683640	CTD SIDER US FAERS
144	Pallor	FAERS: 10 Canada Vigilance: 3		Canada Vigilance US FAERS
145	Sense of oppression	FAERS: 10		US FAERS
146	nervous system disorder	FAERS: 10		SIDER US FAERS
147	Anaphylactoid Reaction	FAERS: 9		US FAERS
148	Bronchitis	FAERS: 9		SIDER US FAERS
149	Cholangitis	FAERS: 9		SIDER US FAERS
150	Ejection Fraction Decreased	FAERS: 9		US FAERS
151	Hypertransaminasaemia	FAERS: 9		US FAERS
152	Injection Site Reaction	FAERS: 9		SIDER US FAERS
153	Loss of personal independence in daily activities	FAERS: 9		US FAERS
154	Lymphopenia	FAERS: 9	7644923	CTD SIDER US FAERS
155	Musculoskeletal stiffness	FAERS: 9		OFFSIDES US FAERS
156	Neuralgia	FAERS: 9	View details 11134612 11731066 15082135 16213089 16406309 16414547 16687474 18037242 18472288 18664590 18777607 19595634 19833436 20068451	CTD SIDER US FAERS
157	Pelvic Pain	FAERS: 9		US FAERS
158	Retching	FAERS: 9		US FAERS
159	Skin lesion	FAERS: 9		SIDER US FAERS
160	treatment failure	FAERS: 9		US FAERS
161	Acute Coronary Syndrome	FAERS: 8		SIDER US FAERS
162	Acute respiratory failure	FAERS: 8		US FAERS
163	Cholangiocarcinoma	FAERS: 8		US FAERS
164	Delirium	FAERS: 8		US FAERS
165	Discomfort	FAERS: 8		SIDER US FAERS
166	Drug toxicity	FAERS: 8		US FAERS
167	Hydronephrosis	FAERS: 8		OFFSIDES US FAERS
168	Leukocytosis	FAERS: 8		US FAERS
169	Periarticular thenar erythema with onycholysis	FAERS: 8		US FAERS
170	Pericarditis	FAERS: 8		US FAERS
171	Peripheral swelling	FAERS: 8		US FAERS
172	Renal pain	FAERS: 8		US FAERS
173	Sudden death	FAERS: 8		US FAERS
174	pseudomembranous colitis	FAERS: 8		SIDER US FAERS
175	Activities of daily living impaired	FAERS: 7		US FAERS
176	Altered state of consciousness	FAERS: 7		US FAERS
177	Blood glucose increased	FAERS: 7		SIDER US FAERS
178	Blood lactate dehydrogenase increased	FAERS: 7		US FAERS
179	Blood potassium decreased	FAERS: 7		SIDER US FAERS
180	Cardiotoxicity	FAERS: 7		OFFSIDES US FAERS
181	Catheter site erythema	FAERS: 7		US FAERS
182	Colitis	FAERS: 7		OFFSIDES SIDER US FAERS
183	Device malfunction	FAERS: 7		US FAERS
184	Full blood count decreased	FAERS: 7		US FAERS
185	Gastrointestinal toxicity	FAERS: 7		US FAERS
186	Hypoaesthesia facial	FAERS: 7		US FAERS
187	Iatrogenic injury	FAERS: 7		US FAERS
188	Infusion Site Extravasation	FAERS: 7		SIDER US FAERS
189	Intestinal Obstruction	FAERS: 7		OFFSIDES SIDER US FAERS
190	Neck Pain	FAERS: 7		SIDER US FAERS
191	Oropharyngeal pain	FAERS: 7 Canada Vigilance: 1		Canada Vigilance OFFSIDES SIDER US FAERS
192	Pneumoperitoneum	FAERS: 7		US FAERS
193	Swelling	FAERS: 7		SIDER US FAERS
194	jaundice	FAERS: 7		US FAERS
195	Abasia	FAERS: 6		OFFSIDES US FAERS
196	Angioedema	FAERS: 6 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
197	Anorexia	FAERS: 6	8708721	CTD OFFSIDES SIDER US FAERS
198	Ataxia	FAERS: 6	8649555 10483822 20389300	CTD SIDER US FAERS
199	Band sensation	FAERS: 6		US FAERS
200	Blood albumin decreased	FAERS: 6		US FAERS
201	Cholecystitis	FAERS: 6		US FAERS
202	Coronary Artery Disease	FAERS: 6		US FAERS
203	Dermatitis	FAERS: 6		SIDER US FAERS
204	Encephalitis	FAERS: 6		US FAERS
205	Inflammation	FAERS: 6		US FAERS
206	Large intestine perforation	FAERS: 6		US FAERS
207	Nerve injury	FAERS: 6		SIDER US FAERS
208	Pain of skin	FAERS: 6		SIDER US FAERS
209	Pneumatosis intestinalis	FAERS: 6		US FAERS
210	Pneumothorax	FAERS: 6		OFFSIDES SIDER US FAERS
211	Pseudocirrhosis	FAERS: 6		US FAERS
212	Skin Ulcer	FAERS: 6		SIDER US FAERS
213	Troponin increased	FAERS: 6		US FAERS
214	Anal sphincter atony	FAERS: 5		US FAERS
215	Anger	FAERS: 5		US FAERS
216	Asphyxia	FAERS: 5		US FAERS
217	Atelectasis	FAERS: 5		OFFSIDES US FAERS
218	Atrial Flutter	FAERS: 5		US FAERS
219	Blindness	FAERS: 5		US FAERS
220	Blood magnesium decreased	FAERS: 5		US FAERS
221	Blood pressure immeasurable	FAERS: 5 Canada Vigilance: 1		Canada Vigilance US FAERS
222	Blood urea increased	FAERS: 5		OFFSIDES US FAERS
223	Catheter related infection	FAERS: 5		OFFSIDES SIDER US FAERS
224	Clonus	FAERS: 5		US FAERS
225	Conjunctivitis	FAERS: 5		SIDER US FAERS
226	Cystitis	FAERS: 5		US FAERS
227	Device occlusion	FAERS: 5		US FAERS
228	Diplopia	FAERS: 5	15566651	CTD US FAERS
229	Dysarthria	FAERS: 5		US FAERS
230	Empyema	FAERS: 5		US FAERS
231	Extremity necrosis	FAERS: 5		US FAERS
232	Incontinence	FAERS: 5		OFFSIDES US FAERS
233	Infusion site reaction	FAERS: 5		SIDER US FAERS
234	Metastatic Neoplasm	FAERS: 5		US FAERS
235	Mydriasis	FAERS: 5		US FAERS
236	No adverse event	FAERS: 5		US FAERS
237	Onychalgia	FAERS: 5		OFFSIDES US FAERS
238	Pharyngolaryngeal Pain	FAERS: 5		SIDER US FAERS
239	Pleurisy	FAERS: 5		US FAERS
240	Posterior reversible encephalopathy syndrome	FAERS: 5		US FAERS
241	Productive Cough	FAERS: 5		OFFSIDES SIDER US FAERS
242	Pulmonary Fibrosis	FAERS: 5	20025538	CTD SIDER US FAERS
243	Punctate keratitis	FAERS: 5		US FAERS
244	Pyogenic granuloma	FAERS: 5		US FAERS
245	Sinus Tachycardia	FAERS: 5		SIDER US FAERS
246	Sinus bradycardia	FAERS: 5		SIDER US FAERS
247	Skin toxicity	FAERS: 5		SIDER US FAERS
248	Tinnitus	FAERS: 5	9849468	CTD SIDER US FAERS
249	Uterine Cancer	FAERS: 5		US FAERS
250	VIIth nerve paralysis	FAERS: 5		SIDER US FAERS
251	Abdominal Abscess	FAERS: 4		OFFSIDES US FAERS
252	Accidental exposure to product	FAERS: 4		US FAERS
253	Ageusia	FAERS: 4		US FAERS
254	Alveolitis	FAERS: 4		US FAERS
255	Amnesia	FAERS: 4		US FAERS
256	Arthritis	FAERS: 4		OFFSIDES US FAERS
257	Bedridden	FAERS: 4		US FAERS
258	Blood sodium decreased	FAERS: 4		US FAERS
259	Cell Death	FAERS: 4		US FAERS
260	Cervix carcinoma	FAERS: 4		US FAERS
261	Choking	FAERS: 4		US FAERS
262	Cholelithiasis	FAERS: 4		US FAERS
263	Complication of device removal	FAERS: 4		US FAERS
264	Decreased eye contact	FAERS: 4		US FAERS
265	Diabetes Mellitus	FAERS: 4		US FAERS
266	Dissociative disorder	FAERS: 4		US FAERS
267	Dry skin	FAERS: 4		SIDER US FAERS
268	Dysuria	FAERS: 4	8708721	CTD OFFSIDES SIDER US FAERS
269	Eczema	FAERS: 4		US FAERS
270	Embolism	FAERS: 4		OFFSIDES SIDER US FAERS
271	Enterococcus test positive	FAERS: 4		US FAERS
272	Enterocolitis	FAERS: 4		US FAERS
273	Eructation	FAERS: 4		US FAERS
274	Erythema Multiforme	FAERS: 4	12582404	CTD SIDER US FAERS
275	Exfoliative rash	FAERS: 4		US FAERS
276	Facial paralysis	FAERS: 4	10586344	CTD US FAERS
277	Flatulence	FAERS: 4		SIDER US FAERS
278	General symptom	FAERS: 4		US FAERS
279	Hepatitis	FAERS: 4		US FAERS
280	Hyperkeratosis	FAERS: 4		US FAERS
281	Joint Range of Motion Decreased	FAERS: 4		US FAERS
282	Leukocytoclastic vasculitis	FAERS: 4		US FAERS
283	Lip swelling	FAERS: 4		US FAERS
284	Lymphocyte count decreased	FAERS: 4		US FAERS
285	Lymphoma	FAERS: 4		US FAERS
286	Malignant ascites	FAERS: 4		US FAERS
287	Mental status changes	FAERS: 4		OFFSIDES US FAERS
288	Multiple sclerosis relapse	FAERS: 4		US FAERS
289	Myiasis	FAERS: 4		US FAERS
290	Nail toxicity	FAERS: 4		US FAERS
291	Nasopharyngitis	FAERS: 4		SIDER US FAERS
292	Ocular discomfort	FAERS: 4		US FAERS
293	Performance status decreased	FAERS: 4		US FAERS
294	Peritonitis	FAERS: 4		OFFSIDES SIDER US FAERS
295	Pleuritic pain	FAERS: 4		US FAERS
296	Rhabdomyolysis	FAERS: 4		US FAERS
297	Scotoma	FAERS: 4	7912737	CTD SIDER US FAERS
298	Screaming	FAERS: 4		US FAERS
299	Stridor	FAERS: 4 Canada Vigilance: 1		Canada Vigilance US FAERS
300	Superinfection bacterial	FAERS: 4		US FAERS
301	Terminal state	FAERS: 4		US FAERS
302	Tonsillitis	FAERS: 4		US FAERS
303	Trigeminal Neuralgia	FAERS: 4		US FAERS
304	Wrong drug administered	FAERS: 4		US FAERS
305	Acute Lung Injury	FAERS: 3		US FAERS
306	Agranulocytosis	FAERS: 3	View details 7525883 7543559 8636011 8643973 9007119 9007120 9440750 10362115 10800167	CTD US FAERS
307	Aneurysm	FAERS: 3		US FAERS
308	Ankyloglossia acquired	FAERS: 3		US FAERS
309	Aortic Aneurysm	FAERS: 3		US FAERS
310	Appendicitis	FAERS: 3		US FAERS
311	Arthropathy	FAERS: 3		US FAERS
312	Biliary tract infection	FAERS: 3		US FAERS
313	Blood glucose decreased	FAERS: 3		US FAERS
314	Breast cancer recurrent	FAERS: 3		OFFSIDES US FAERS
315	Bronchial Obstruction	FAERS: 3		OFFSIDES US FAERS
316	Bronchiectasis	FAERS: 3		US FAERS
317	Cardiac Tamponade	FAERS: 3		OFFSIDES US FAERS
318	Cardiac procedure complication	FAERS: 3		US FAERS
319	Catheter site swelling	FAERS: 3		US FAERS
320	Catheter site warmth	FAERS: 3		US FAERS
321	Clostridium difficile colitis	FAERS: 3		US FAERS
322	Culture urine positive	FAERS: 3		US FAERS
323	Cytopenia	FAERS: 3		US FAERS
324	Diffuse alopecia	FAERS: 3		US FAERS
325	Disease recurrence	FAERS: 3		US FAERS
326	Disorientation	FAERS: 3		US FAERS
327	Electromechanical dissociation	FAERS: 3		US FAERS
328	Facial Paresis	FAERS: 3		US FAERS
329	Foaming at mouth	FAERS: 3		US FAERS
330	Gastritis	FAERS: 3		US FAERS
331	Hepatic Encephalopathy	FAERS: 3	9106649 10100699	CTD SIDER US FAERS
332	Hepatomegaly	FAERS: 3		SIDER US FAERS
333	Incorrect drug administration rate	FAERS: 3		US FAERS
334	Incorrect product storage	FAERS: 3		US FAERS
335	Induration	FAERS: 3		SIDER US FAERS
336	Liquid product physical issue	FAERS: 3		US FAERS
337	Lividity	FAERS: 3		US FAERS
338	Lymphocyte count increased	FAERS: 3		US FAERS
339	Macule	FAERS: 3		US FAERS
340	Maternal exposure during pregnancy	FAERS: 3		US FAERS
341	Metabolic acidosis	FAERS: 3		US FAERS
342	Migration of implant	FAERS: 3		US FAERS
343	Monocyte count increased	FAERS: 3		US FAERS
344	Monocytopenia	FAERS: 3		US FAERS
345	Monoplegia	FAERS: 3		US FAERS
346	Oligohydramnios	FAERS: 3		US FAERS
347	PO2 decreased	FAERS: 3		OFFSIDES US FAERS
348	Papillary serous endometrial carcinoma	FAERS: 3		US FAERS
349	Paresis	FAERS: 3		US FAERS
350	Pharyngitis	FAERS: 3		SIDER US FAERS
351	Product use issue	FAERS: 3		US FAERS
352	Pulmonary Hypertension	FAERS: 3		SIDER US FAERS
353	Rales	FAERS: 3		US FAERS
354	Restless Legs Syndrome	FAERS: 3		US FAERS
355	Retinal exudates	FAERS: 3		US FAERS
356	Skin hypertrophy	FAERS: 3		OFFSIDES US FAERS
357	Supraventricular tachycardia	FAERS: 3		SIDER US FAERS
358	Thrombocytopenic purpura	FAERS: 3		US FAERS
359	Toxic Epidermal Necrolysis	FAERS: 3		SIDER US FAERS
360	Urinary tract infection fungal	FAERS: 3		US FAERS
361	Visual disturbance	FAERS: 3		OFFSIDES SIDER US FAERS
362	Vocal Cord Paralysis	FAERS: 3	18026678	CTD US FAERS
363	Abdominal mass	FAERS: 2		US FAERS
364	Abdominal rigidity	FAERS: 2		OFFSIDES US FAERS
365	Abdominal tenderness	FAERS: 2		US FAERS
366	Abscess	FAERS: 2		OFFSIDES US FAERS
367	Acanthosis	FAERS: 2		US FAERS
368	Accessory Nerve Disorder	FAERS: 2		US FAERS
369	Angiosarcoma recurrent	FAERS: 2		US FAERS
370	Aphonia	FAERS: 2		US FAERS
371	Application site erythema	FAERS: 2		US FAERS
372	Application site pain	FAERS: 2		US FAERS
373	Arterial thrombosis	FAERS: 2		US FAERS
374	Arteriosclerosis	FAERS: 2		US FAERS
375	Autoimmune thyroiditis	FAERS: 2		US FAERS
376	Biliary dilatation	FAERS: 2		US FAERS
377	Bladder spasm	FAERS: 2		US FAERS
378	Blepharitis	FAERS: 2		US FAERS
379	Blood phosphorus increased	FAERS: 2		US FAERS
380	Blood pressure fluctuation	FAERS: 2		US FAERS
381	Blood sodium increased	FAERS: 2		US FAERS
382	Blood urine present	FAERS: 2		US FAERS
383	Cancer Pain	FAERS: 2		US FAERS
384	Catheter site pruritus	FAERS: 2		US FAERS
385	Cerebral atrophy	FAERS: 2		US FAERS
386	Cerebral disorder	FAERS: 2		US FAERS
387	Cholecystitis infective	FAERS: 2		US FAERS
388	Complication of device insertion	FAERS: 2		US FAERS
389	Coronary artery perforation	FAERS: 2		US FAERS
390	Coronary artery reocclusion	FAERS: 2		US FAERS
391	Cystitis-like symptom	FAERS: 2		US FAERS
392	Device dislocation	FAERS: 2		US FAERS
393	Device migration	FAERS: 2		US FAERS
394	Disease complication	FAERS: 2		US FAERS
395	Drug resistance	FAERS: 2		US FAERS
396	Electrocardiogram abnormal	FAERS: 2		SIDER US FAERS
397	Endotracheal intubation complication	FAERS: 2		US FAERS
398	Enteritis	FAERS: 2	12759687	CTD OFFSIDES US FAERS
399	Enterococcal infection	FAERS: 2		US FAERS
400	Gastric ulcer	FAERS: 2		US FAERS
401	Gastrointestinal perforation	FAERS: 2		US FAERS
402	General physical condition abnormal	FAERS: 2		US FAERS
403	Head discomfort	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
404	Hemiparesis	FAERS: 2		US FAERS
405	Hemiplegia	FAERS: 2		US FAERS
406	Hepatitis B	FAERS: 2		US FAERS
407	Hyperpyrexia	FAERS: 2		SIDER US FAERS
408	Hyperventilation	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
409	Immunosuppression	FAERS: 2		US FAERS
410	Inadequate analgesia	FAERS: 2		US FAERS
411	Incorrect dose administered	FAERS: 2		US FAERS
412	Influenza	FAERS: 2		SIDER US FAERS
413	Infusion site rash	FAERS: 2		SIDER US FAERS
414	Infusion site swelling	FAERS: 2		US FAERS
415	Injection site erythema	FAERS: 2		US FAERS
416	Injury associated with device	FAERS: 2		US FAERS
417	Intra-abdominal pressure increased	FAERS: 2		US FAERS
418	Invasive Ductal Breast Carcinoma	FAERS: 2		US FAERS
419	Joint stiffness	FAERS: 2		US FAERS
420	Joint swelling	FAERS: 2		US FAERS
421	Limb discomfort	FAERS: 2		SIDER US FAERS
422	Limb injury	FAERS: 2		US FAERS
423	Lung consolidation	FAERS: 2		US FAERS
424	Lupus-like syndrome	FAERS: 2		US FAERS
425	Lymphadenopathy	FAERS: 2		US FAERS
426	Lymphangiosis carcinomatosa	FAERS: 2		US FAERS
427	MYELODYSPLASTIC SYNDROME	FAERS: 2		SIDER US FAERS
428	Macular degeneration	FAERS: 2		US FAERS
429	Malnutrition	FAERS: 2		SIDER US FAERS
430	Mastitis	FAERS: 2		US FAERS
431	Mediastinitis	FAERS: 2		US FAERS
432	Medical induction of coma	FAERS: 2		US FAERS
433	Metastasis	FAERS: 2		US FAERS
434	Muscle Rigidity	FAERS: 2		US FAERS
435	Myelitis	FAERS: 2		US FAERS
436	Myositis	FAERS: 2		US FAERS
437	Nasal discomfort	FAERS: 2		US FAERS
438	Nephrotic Syndrome	FAERS: 2		US FAERS
439	Neutropenic infection	FAERS: 2		US FAERS
440	No reaction on previous exposure to drug	FAERS: 2		US FAERS
441	Non-cardiac chest pain	FAERS: 2		US FAERS
442	Onychoclasis	FAERS: 2		US FAERS
443	Optic Neuritis	FAERS: 2		US FAERS
444	Ototoxicity	FAERS: 2		SIDER US FAERS
445	Overdose	FAERS: 2		US FAERS
446	Paraparesis	FAERS: 2		US FAERS
447	Perianal abscess	FAERS: 2		US FAERS
448	Porokeratosis	FAERS: 2		US FAERS
449	Portal Vein Thrombosis	FAERS: 2		US FAERS
450	Procedural nausea	FAERS: 2		US FAERS
451	Product expiration date issue	FAERS: 2		US FAERS
452	Proteinuria	FAERS: 2		US FAERS
453	Purulence	FAERS: 2		OFFSIDES US FAERS
454	Pyelonephritis	FAERS: 2		US FAERS
455	Radiation Pneumonitis	FAERS: 2		SIDER US FAERS
456	Reaction to drug excipients	FAERS: 2		US FAERS
457	Recall phenomenon	FAERS: 2		SIDER US FAERS
458	Retinal Degeneration	FAERS: 2		US FAERS
459	Rhinitis	FAERS: 2		OFFSIDES SIDER US FAERS
460	Scleroderma-like reaction	FAERS: 2		US FAERS
461	Secretion discharge	FAERS: 2		US FAERS
462	Seizure like phenomena	FAERS: 2		US FAERS
463	Sick Sinus Syndrome	FAERS: 2		US FAERS
464	Sinusitis	FAERS: 2		SIDER US FAERS
465	Staphylococcus test positive	FAERS: 2		US FAERS
466	Stoma Site Infection	FAERS: 2		US FAERS
467	Temperature intolerance	FAERS: 2		US FAERS
468	Therapy non-responder	FAERS: 2		US FAERS
469	Thrombophlebitis	FAERS: 2		SIDER US FAERS
470	Urinary Retention	FAERS: 2		US FAERS
471	Vaginal Discharge	FAERS: 2		US FAERS
472	Vascular calcification	FAERS: 2		US FAERS
473	Vascular pseudoaneurysm ruptured	FAERS: 2		US FAERS
474	Ventricular Dysfunction	FAERS: 2		US FAERS
475	Ventricular hypokinesia	FAERS: 2		OFFSIDES US FAERS
476	Vulvovaginal discomfort	FAERS: 2		US FAERS
477	Wound dehiscence	FAERS: 2		US FAERS
478	Wrong patient received medication	FAERS: 2		US FAERS
479	Abdominal adhesions	FAERS: 1		US FAERS
480	Accidental death	FAERS: 1		US FAERS
481	Accidental overdose	FAERS: 1		US FAERS
482	Accidental underdose	FAERS: 1		US FAERS
483	Acne	FAERS: 1		US FAERS
484	Actinic keratosis	FAERS: 1		US FAERS
485	Acute Motor Axonal Neuropathy	FAERS: 1		US FAERS
486	Acute left ventricular failure	FAERS: 1		US FAERS
487	Acute psychosis	FAERS: 1		US FAERS
488	Administration related reaction	FAERS: 1		US FAERS
489	Administration site extravasation	FAERS: 1 Canada Vigilance: 2		Canada Vigilance US FAERS
490	Adnexa uteri pain	FAERS: 1		US FAERS
491	Akathisia	FAERS: 1		US FAERS
492	Alveolar lung disease	FAERS: 1		US FAERS
493	Amaurosis Fugax	FAERS: 1		US FAERS
494	Anal Ulcer	FAERS: 1		US FAERS
495	Anal cancer metastatic	FAERS: 1		US FAERS
496	Anorectal discomfort	FAERS: 1		US FAERS
497	Anticipatory anxiety	FAERS: 1		US FAERS
498	Anuria	FAERS: 1		US FAERS
499	Aortic Rupture	FAERS: 1		US FAERS
500	Aortic dissection rupture	FAERS: 1		US FAERS
501	Apathy	FAERS: 1		US FAERS
502	Application site exfoliation	FAERS: 1		US FAERS
503	Application site vesicles	FAERS: 1		US FAERS
504	Application site warmth	FAERS: 1		US FAERS
505	Arthropod bite	FAERS: 1		US FAERS
506	Arthropod sting	FAERS: 1		US FAERS
507	Aspartate aminotransferase abnormal	FAERS: 1		US FAERS
508	Aspartate aminotransferase decreased	FAERS: 1		US FAERS
509	Asthma	FAERS: 1		US FAERS
510	Atrial tachycardia	FAERS: 1		OFFSIDES US FAERS
511	Autoimmune thrombocytopenia	FAERS: 1		US FAERS
512	Autonomic neuropathy	FAERS: 1		SIDER US FAERS
513	Back disorder	FAERS: 1		US FAERS
514	Bacteria blood identified	FAERS: 1		US FAERS
515	Bacterial test positive	FAERS: 1		US FAERS
516	Bile Duct Stenosis	FAERS: 1		US FAERS
517	Biliary sepsis	FAERS: 1		US FAERS
518	Bipolar Disorder	FAERS: 1		US FAERS
519	Bladder Neoplasm	FAERS: 1		US FAERS
520	Bladder adenocarcinoma stage unspecified	FAERS: 1		US FAERS
521	Bladder discomfort	FAERS: 1		US FAERS
522	Bladder pain	FAERS: 1		US FAERS
523	Bladder sphincter atony	FAERS: 1		US FAERS
524	Blood bilirubin abnormal	FAERS: 1		US FAERS
525	Blood count abnormal	FAERS: 1		US FAERS
526	Blood creatine phosphokinase increased	FAERS: 1		US FAERS
527	Blood culture negative	FAERS: 1		US FAERS
528	Blood electrolytes decreased	FAERS: 1		US FAERS
529	Blood glucose abnormal	FAERS: 1		US FAERS
530	Blood hyposmosis	FAERS: 1		US FAERS
531	Blood magnesium increased	FAERS: 1		US FAERS
532	Blood pH decreased	FAERS: 1		US FAERS
533	Blood potassium increased	FAERS: 1		US FAERS
534	Brain Abscess	FAERS: 1		US FAERS
535	Brain Death	FAERS: 1		US FAERS
536	Bronchial Fistula	FAERS: 1		US FAERS
537	Bronchopneumonia	FAERS: 1		US FAERS
538	Cachexia	FAERS: 1		US FAERS
539	Candidiasis	FAERS: 1		US FAERS
540	Capillary Leak Syndrome	FAERS: 1		OFFSIDES US FAERS
541	Capillary Permeability	FAERS: 1		US FAERS
542	Carcinoembryonic antigen increased	FAERS: 1		OFFSIDES US FAERS
543	Cardiac Flutter	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
544	Cardiac pseudoaneurysm	FAERS: 1		US FAERS
545	Cardiomegaly	FAERS: 1		US FAERS
546	Cardiovascular insufficiency	FAERS: 1		US FAERS
547	Catheter related complication	FAERS: 1		OFFSIDES US FAERS
548	Catheter site cellulitis	FAERS: 1		US FAERS
549	Catheter site pain	FAERS: 1		US FAERS
550	Cell marker increased	FAERS: 1		OFFSIDES US FAERS
551	Central nervous system lesion	FAERS: 1		US FAERS
552	Chemical cystitis	FAERS: 1		US FAERS
553	Chorioretinitis	FAERS: 1		US FAERS
554	Chromaturia	FAERS: 1		US FAERS
555	Chronic gastritis	FAERS: 1		US FAERS
556	Clostridium colitis	FAERS: 1		US FAERS
557	Clostridium difficile infection	FAERS: 1		US FAERS
558	Completed Suicide	FAERS: 1		US FAERS
559	Complication associated with device	FAERS: 1		US FAERS
560	Conversion disorder	FAERS: 1		US FAERS
561	Crying	FAERS: 1		US FAERS
562	Culture wound positive	FAERS: 1		US FAERS
563	Cyst	FAERS: 1		OFFSIDES SIDER US FAERS
564	Dacryostenosis acquired	FAERS: 1		US FAERS
565	Dental caries	FAERS: 1		OFFSIDES US FAERS
566	Depressed mood	FAERS: 1		US FAERS
567	Depression suicidal	FAERS: 1		US FAERS
568	Dermatomyositis	FAERS: 1		US FAERS
569	Device breakage	FAERS: 1		US FAERS
570	Device related sepsis	FAERS: 1		US FAERS
571	Diabetic Ketoacidosis	FAERS: 1		US FAERS
572	Diffuse alveolar damage	FAERS: 1		US FAERS
573	Diplegia	FAERS: 1		US FAERS
574	Diverticulitis	FAERS: 1		OFFSIDES US FAERS
575	Diverticulum	FAERS: 1		OFFSIDES US FAERS
576	Drug administered in wrong device	FAERS: 1		US FAERS
577	Drug dispensing error	FAERS: 1		US FAERS
578	Drug effect variable	FAERS: 1		US FAERS
579	Drug level increased	FAERS: 1		US FAERS
580	Drug screen false positive	FAERS: 1		US FAERS
581	Drug therapeutic incompatibility	FAERS: 1		US FAERS
582	Drug withdrawal syndrome	FAERS: 1		US FAERS
583	Ear congestion	FAERS: 1		US FAERS
584	Ear discomfort	FAERS: 1		US FAERS
585	Economic problem	FAERS: 1		US FAERS
586	Electrocardiogram ST segment abnormal	FAERS: 1		US FAERS
587	Electrocardiogram change	FAERS: 1		US FAERS
588	Electrolyte imbalance	FAERS: 1		SIDER US FAERS
589	Emphysematous Cholecystitis	FAERS: 1		US FAERS
590	Endocarditis	FAERS: 1		US FAERS
591	Endometrial Stromal Sarcoma	FAERS: 1		US FAERS
592	Enterobacter test positive	FAERS: 1		US FAERS
593	Enuresis	FAERS: 1		US FAERS
594	Eosinophil percentage increased	FAERS: 1		US FAERS
595	Epigastric discomfort	FAERS: 1		US FAERS
596	Extra dose administered	FAERS: 1		US FAERS
597	Eye irritation	FAERS: 1 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
598	Eye pain	FAERS: 1		SIDER US FAERS
599	Facial Pain	FAERS: 1		US FAERS
600	Failure to Thrive	FAERS: 1		OFFSIDES US FAERS
601	Febrile bone marrow aplasia	FAERS: 1		US FAERS
602	Fibrin D dimer increased	FAERS: 1		US FAERS
603	Fibromatosis	FAERS: 1		US FAERS
604	Flank Pain	FAERS: 1		OFFSIDES SIDER US FAERS
605	Fluid overload	FAERS: 1		US FAERS
606	Foreign body trauma	FAERS: 1		US FAERS
607	Fracture	FAERS: 1		US FAERS
608	Fungal test positive	FAERS: 1		US FAERS
609	Gammopathy	FAERS: 1		US FAERS
610	Gangrene	FAERS: 1		US FAERS
611	Gastrointestinal Pain	FAERS: 1		SIDER US FAERS
612	Gastrointestinal infection	FAERS: 1		US FAERS
613	Gastrointestinal stoma complication	FAERS: 1		US FAERS
614	Gastrointestinal stoma output increased	FAERS: 1		US FAERS
615	Gastrooesophageal cancer	FAERS: 1		US FAERS
616	Gaze palsy	FAERS: 1		US FAERS
617	Genital Herpes	FAERS: 1		US FAERS
618	Gingivitis	FAERS: 1		US FAERS
619	Grip strength decreased	FAERS: 1		US FAERS
620	Hallucinations, mixed	FAERS: 1		US FAERS
621	Hepatic necrosis	FAERS: 1		SIDER US FAERS
622	Hepatitis B virus test positive	FAERS: 1		US FAERS
623	Hypercapnia	FAERS: 1		US FAERS
624	Hyperplasia	FAERS: 1		US FAERS
625	Hypersthenuria	FAERS: 1		US FAERS
626	Hyperthyroidism	FAERS: 1		US FAERS
627	Hypertrophic Cardiomyopathy	FAERS: 1		US FAERS
628	Hypoperfusion	FAERS: 1		US FAERS
629	Hyporesponsive to stimuli	FAERS: 1		US FAERS
630	Idiopathic Pulmonary Fibrosis	FAERS: 1		US FAERS
631	Idiosyncratic drug reaction	FAERS: 1		US FAERS
632	Impaired driving ability	FAERS: 1		US FAERS
633	Impaired quality of life	FAERS: 1		US FAERS
634	Impaired self-care	FAERS: 1		US FAERS
635	Impaired work ability	FAERS: 1		US FAERS
636	Implant site reaction	FAERS: 1		US FAERS
637	In-stent arterial restenosis	FAERS: 1		US FAERS
638	Incision site complication	FAERS: 1		US FAERS
639	Incoherent	FAERS: 1		US FAERS
640	Incorrect drug administration duration	FAERS: 1		US FAERS
641	Incorrect route of drug administration	FAERS: 1		US FAERS
642	Infarction	FAERS: 1		SIDER US FAERS
643	Infusion site hypersensitivity	FAERS: 1		US FAERS
644	Infusion site pain	FAERS: 1		US FAERS
645	Infusion site thrombosis	FAERS: 1		US FAERS
646	Infusion site warmth	FAERS: 1		US FAERS
647	Injection site extravasation	FAERS: 1		US FAERS
648	Injection site inflammation	FAERS: 1		US FAERS
649	Injection site irritation	FAERS: 1		US FAERS
650	Injection site necrosis	FAERS: 1		US FAERS
651	Injection site plaque	FAERS: 1		US FAERS
652	Intentional product misuse	FAERS: 1		US FAERS
653	Intertrigo	FAERS: 1		US FAERS
654	Intervertebral Disc Degeneration	FAERS: 1		OFFSIDES US FAERS
655	Intracranial mass	FAERS: 1		US FAERS
656	Keratitis	FAERS: 1		SIDER US FAERS
657	Keratopathy	FAERS: 1		US FAERS
658	Klebsiella test positive	FAERS: 1		US FAERS
659	Large intestinal stenosis	FAERS: 1		US FAERS
660	Laryngitis	FAERS: 1		US FAERS
661	Larynx irritation	FAERS: 1		US FAERS
662	Liver Abscess	FAERS: 1		OFFSIDES US FAERS
663	Living in residential institution	FAERS: 1		US FAERS
664	Lobar Pneumonia	FAERS: 1		US FAERS
665	Localised intraabdominal fluid collection	FAERS: 1		US FAERS
666	Lower respiratory tract infection fungal	FAERS: 1		US FAERS
667	Lower respiratory tract infection viral	FAERS: 1		US FAERS
668	Lymphocytic infiltration	FAERS: 1		US FAERS
669	Macular pigmentation	FAERS: 1		US FAERS
670	Malignant neoplasm of ampulla of Vater	FAERS: 1		US FAERS
671	Malignant neoplasm of thymus	FAERS: 1		US FAERS
672	Mechanical complication of implant	FAERS: 1		US FAERS
673	Mediastinal mass	FAERS: 1		US FAERS
674	Medical device site reaction	FAERS: 1		US FAERS
675	Meibomian gland dysfunction	FAERS: 1		US FAERS
676	Meningioma	FAERS: 1		US FAERS
677	Menopause	FAERS: 1		US FAERS
678	Mental impairment	FAERS: 1		US FAERS
679	Metastases to adrenals	FAERS: 1		OFFSIDES US FAERS
680	Middle insomnia	FAERS: 1		US FAERS
681	Moaning	FAERS: 1		US FAERS
682	Muscle strain	FAERS: 1		US FAERS
683	Musculoskeletal chest pain	FAERS: 1		SIDER US FAERS
684	Musculoskeletal discomfort	FAERS: 1		SIDER US FAERS
685	Myasthenia Gravis	FAERS: 1		US FAERS
686	Myelodysplastic syndrome transformation	FAERS: 1		US FAERS
687	Nail Infection	FAERS: 1		US FAERS
688	Nail bed disorder	FAERS: 1		US FAERS
689	Nail bed infection	FAERS: 1		US FAERS
690	Necrosis	FAERS: 1	11468447 15680171 16027087	CTD SIDER US FAERS
691	Nephritis allergic	FAERS: 1		US FAERS
692	Nervousness	FAERS: 1		SIDER US FAERS
693	Neurogenic Bowel	FAERS: 1		US FAERS
694	Neurological decompensation	FAERS: 1		US FAERS
695	Neuromuscular toxicity	FAERS: 1		US FAERS
696	Neutropenic sepsis	FAERS: 1		OFFSIDES SIDER US FAERS
697	Night sweats	FAERS: 1		SIDER US FAERS
698	Nodule	FAERS: 1		US FAERS
699	Occult blood positive	FAERS: 1		US FAERS
700	Occupational exposure to product	FAERS: 1		US FAERS
701	Ocular vascular disorder	FAERS: 1		US FAERS
702	Oliguria	FAERS: 1		US FAERS
703	Onychomalacia	FAERS: 1		US FAERS
704	Onychomycosis	FAERS: 1		US FAERS
705	Oral candidiasis	FAERS: 1		SIDER US FAERS
706	Oropharyngeal blistering	FAERS: 1		US FAERS
707	Oropharyngeal discomfort	FAERS: 1		SIDER US FAERS
708	Osteonecrosis of Jaw	FAERS: 1		US FAERS
709	Oxygen saturation abnormal	FAERS: 1		US FAERS
710	Oxygen saturation increased	FAERS: 1		US FAERS
711	Pacemaker complication	FAERS: 1		US FAERS
712	Palmar erythema	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
713	Pancreatic Pseudocyst	FAERS: 1		US FAERS
714	Panniculitis	FAERS: 1		US FAERS
715	Papule	FAERS: 1		US FAERS
716	Paracentesis	FAERS: 1		US FAERS
717	Paraneoplastic neurological syndrome	FAERS: 1		US FAERS
718	Paranoia	FAERS: 1		US FAERS
719	Pathological fracture	FAERS: 1		US FAERS
720	Pelvic mass	FAERS: 1		US FAERS
721	Peripheral nerve palsy	FAERS: 1		US FAERS
722	Pharyngitis bacterial	FAERS: 1		US FAERS
723	Phlebitis	FAERS: 1		SIDER US FAERS
724	Phrenic nerve paralysis	FAERS: 1		US FAERS
725	Platelet count abnormal	FAERS: 1		US FAERS
726	Pleurodesis	FAERS: 1		US FAERS
727	Poisoning	FAERS: 1		US FAERS
728	Polymyositis	FAERS: 1		US FAERS
729	Poor quality drug administered	FAERS: 1		US FAERS
730	Poor quality sleep	FAERS: 1		US FAERS
731	Porphyria non-acute	FAERS: 1		US FAERS
732	Post procedural myocardial infarction	FAERS: 1		US FAERS
733	Postoperative adhesion	FAERS: 1		US FAERS
734	Postoperative infection	FAERS: 1		US FAERS
735	Postrenal failure	FAERS: 1		US FAERS
736	Posturing	FAERS: 1		US FAERS
737	Pregnancy	FAERS: 1		US FAERS
738	Procedural pneumothorax	FAERS: 1		US FAERS
739	Proctitis	FAERS: 1		US FAERS
740	Product deposit	FAERS: 1		US FAERS
741	Product label issue	FAERS: 1		US FAERS
742	Product preparation error	FAERS: 1		US FAERS
743	Product substitution issue	FAERS: 1		US FAERS
744	Protein total decreased	FAERS: 1		US FAERS
745	Protein total increased	FAERS: 1		US FAERS
746	Pseudomonas test positive	FAERS: 1		US FAERS
747	Pulmonary artery stenosis	FAERS: 1		US FAERS
748	Pulmonary necrosis	FAERS: 1		US FAERS
749	Purpura	FAERS: 1		US FAERS
750	Purulent discharge	FAERS: 1		OFFSIDES US FAERS
751	Quality of life decreased	FAERS: 1		US FAERS
752	Radiation injury	FAERS: 1		US FAERS
753	Radiculopathy	FAERS: 1		US FAERS
754	Rectal Stenosis	FAERS: 1		US FAERS
755	Refractory cytopenia with unilineage dysplasia	FAERS: 1		US FAERS
756	Regurgitation	FAERS: 1		US FAERS
757	Respiratory fatigue	FAERS: 1		US FAERS
758	Respiratory tract infection fungal	FAERS: 1		US FAERS
759	Retinal Detachment	FAERS: 1		US FAERS
760	Retinal vascular occlusion	FAERS: 1		US FAERS
761	Retinoschisis	FAERS: 1		US FAERS
762	Rheumatoid Arthritis	FAERS: 1		US FAERS
763	Rhonchi	FAERS: 1		US FAERS
764	Romberg test positive	FAERS: 1		US FAERS
765	Sarcoidosis	FAERS: 1		US FAERS
766	Sarcoma	FAERS: 1	18074150 20406837	CTD US FAERS
767	Sclerema	FAERS: 1		US FAERS
768	Sensorimotor disorder	FAERS: 1		US FAERS
769	Septic embolus	FAERS: 1		US FAERS
770	Serous cystadenocarcinoma ovary	FAERS: 1		US FAERS
771	Shoulder Pain	FAERS: 1		US FAERS
772	Similar reaction on previous exposure to drug	FAERS: 1		US FAERS
773	Skin Induration	FAERS: 1		US FAERS
774	Skin irritation	FAERS: 1		US FAERS
775	Skin laceration	FAERS: 1		US FAERS
776	Skin necrosis	FAERS: 1		SIDER US FAERS
777	Small intestine carcinoma	FAERS: 1		US FAERS
778	Sneezing	FAERS: 1		US FAERS
779	Soft tissue necrosis	FAERS: 1		US FAERS
780	Somnambulism	FAERS: 1		US FAERS
781	Sopor	FAERS: 1		US FAERS
782	Splenic vein thrombosis	FAERS: 1		US FAERS
783	Sputum culture positive	FAERS: 1		US FAERS
784	Staring	FAERS: 1		US FAERS
785	Status Asthmaticus	FAERS: 1		US FAERS
786	Status Epilepticus	FAERS: 1		US FAERS
787	Stenotrophomonas infection	FAERS: 1		US FAERS
788	Stevens-Johnson Syndrome	FAERS: 1	25811541	CTD SIDER US FAERS
789	Stoma site erythema	FAERS: 1		US FAERS
790	Stoma site pain	FAERS: 1		US FAERS
791	Stress	FAERS: 1		US FAERS
792	Subcutaneous Abscess	FAERS: 1		OFFSIDES US FAERS
793	Suicide attempt	FAERS: 1		US FAERS
794	Superinfection	FAERS: 1		US FAERS
795	Systolic hypertension	FAERS: 1		US FAERS
796	Tetany	FAERS: 1		US FAERS
797	Therapeutic product cross-reactivity	FAERS: 1		US FAERS
798	Therapeutic response unexpected	FAERS: 1		US FAERS
799	Therapy cessation	FAERS: 1		US FAERS
800	Tonic clonic movements	FAERS: 1		US FAERS
801	Toxic erythema of chemotherapy	FAERS: 1		US FAERS
802	Tracheostomy malfunction	FAERS: 1		US FAERS
803	Transaminases	FAERS: 1		US FAERS
804	Treatment related secondary malignancy	FAERS: 1		US FAERS
805	Tryptase increased	FAERS: 1		US FAERS
806	Ultrasound Doppler abnormal	FAERS: 1		US FAERS
807	Upper respiratory tract inflammation	FAERS: 1		US FAERS
808	Uveitis	FAERS: 1		US FAERS
809	Vascular occlusion	FAERS: 1		US FAERS
810	Vascular pain	FAERS: 1		US FAERS
811	Vascular rupture	FAERS: 1		US FAERS
812	Vascular stent restenosis	FAERS: 1		US FAERS
813	Vascular stent thrombosis	FAERS: 1		US FAERS
814	Vascular wall hypertrophy	FAERS: 1		US FAERS
815	Vasculitis	FAERS: 1		US FAERS
816	Vasospasm	FAERS: 1		US FAERS
817	Venous Thrombosis	FAERS: 1		SIDER US FAERS
818	Ventricular arrhythmia	FAERS: 1		US FAERS
819	Vitreous floaters	FAERS: 1		SIDER US FAERS
820	Vulvovaginal pain	FAERS: 1		US FAERS
821	Waist circumference increased	FAERS: 1		US FAERS
822	Water Pollution	FAERS: 1		US FAERS
823	Wernicke-Korsakoff Syndrome	FAERS: 1		US FAERS
824	Wound infection staphylococcal	FAERS: 1		US FAERS
825	Wrong technique in drug usage process	FAERS: 1		US FAERS
826	Abdominal cavity drainage			OFFSIDES
827	Abnormal cervical smear			OFFSIDES
828	Abnormal vision			SIDER
829	Abscess management			OFFSIDES
830	Acid reflux			OFFSIDES
831	Actinomycosis			OFFSIDES
832	Adenocarcinoma		8552128	CTD SIDER
833	Adnexa uteri mass			OFFSIDES
834	Adrenocortical carcinoma		22156929	CTD
835	Alcohol withdrawal syndrome			OFFSIDES
836	Alcoholic Intoxication		16402636	CTD
837	Alveolar Soft Part Sarcoma			OFFSIDES
838	Amblyopia			SIDER
839	Anal Fissure			OFFSIDES
840	Anemia, Sickle Cell		18593679	CTD
841	Anemia		View details 7525883 7543559 7644923 8610231 10800167 11147586 11230474 11371143 12208573 12367796 12601542 14760117 15493352 15493357 15581045 15923795 15961435 16100454 16332718 16612156 16763792 16914900 17974278 19396017 19812061 20051288	CTD
842	Anemic			SIDER
843	Aneuploidy		24976383 28087838	CTD
844	Anhedonia			OFFSIDES
845	Ankle Fracture			OFFSIDES
846	Aphagia			OFFSIDES
847	Aphthous Stomatitis			OFFSIDES
848	Arthroscopy			OFFSIDES
849	Atherosclerosis		17449502	CTD
850	Atrioventricular Block		8102012 17223814	CTD SIDER
851	Basal cell carcinoma			OFFSIDES
852	Bile duct stent insertion			OFFSIDES
853	Biopsy tongue abnormal			OFFSIDES
854	Blood Glucose			OFFSIDES
855	Blood amylase increased			OFFSIDES
856	Blood and lymphatic system disorders			SIDER
857	Blood calcitonin increased			OFFSIDES
858	Blood chloride decreased			OFFSIDES
859	Blood electrolytes abnormal			SIDER
860	Blood osmolarity decreased			OFFSIDES
861	Blood parathyroid hormone increased			OFFSIDES
862	Blood sodium			OFFSIDES
863	Bone Marrow Diseases		9346219 9346226 15790438	CTD
864	Bone abscess			OFFSIDES
865	Bone density decreased			OFFSIDES
866	Bone fistula			OFFSIDES
867	Bone lesion			OFFSIDES
868	Bone marrow depression			OFFSIDES
869	Bone neoplasms		15867366	CTD
870	Bone scan abnormal			OFFSIDES
871	Bone swelling			OFFSIDES
872	Brain Diseases		View details 8649555 12056715 16604029 16991134	CTD
873	Brain Edema		16132524	CTD
874	Brain Infarction		10100699	CTD
875	Brain Neoplasms		7481858	CTD
876	Bundle-Branch Block		8102012	CTD
877	Bunion operation			OFFSIDES
878	Bursitis			OFFSIDES
879	Calcific deposits removal			OFFSIDES
880	Candida pneumonia			OFFSIDES
881	Carcinoma, Endometrioid		21151415	CTD
882	Carcinoma, Large Cell		8643967	CTD
883	Carcinoma, Lewis Lung		19027286	CTD
884	Carcinoma, Ovarian Epithelial		View details 8626111 9346221 11205470 11268500 12442916 19704064 25535366 28811376	CTD
885	Carcinoma, Transitional Cell		View details 7525883 9346226 11104554 11113764 24246751	CTD
886	Carcinoma		View details 9018096 10458265 10569619 11487721 15907983 15923795 18418024	CTD
887	Cardiomyopathies		11552226	CTD
888	Catheter placement			OFFSIDES
889	Cervicobrachial syndrome			OFFSIDES
890	Chemical and Drug Induced Liver Injury		9676843 16332718 23956101	CTD
891	Chest wall pain			SIDER
892	Cholangitis, Sclerosing		19544276	CTD
893	Chondromalacia			OFFSIDES
894	Chromosomal Instability		24976383	CTD
895	Chronic sinusitis			OFFSIDES
896	Cochlear Diseases		16406077	CTD
897	Cognition Disorders		16490239	CTD
898	Colitis, Ischemic		11468447	CTD
899	Colorectal Neoplasms		18802399	CTD
900	Compression fracture			OFFSIDES
901	Confusion		View details 8649555 10100699 16604029 16991134	CTD
902	Consciousness Disorders		18418024	CTD
903	Contracture			OFFSIDES
904	Coronary Aneurysm		15804801	CTD
905	Coronary Occlusion		15657205	CTD
906	Cramps of lower extremities			SIDER
907	Creatinine renal clearance decreased			OFFSIDES
908	Cytoreductive Surgery			OFFSIDES
909	Deafness Neurosensory			SIDER
910	Debridement			OFFSIDES
911	Decreased Libido			OFFSIDES
912	Demyelinating Diseases		9149085	CTD
913	Demyelination			OFFSIDES
914	Dental Fistula			OFFSIDES
915	Dental abscess			OFFSIDES
916	Dental discomfort			OFFSIDES
917	Depressive disorder		9018096	CTD
918	Diarrhea		View details 7525883 7543699 8708721 9164208 9774950 10955861 11104554 12110496 15131032 15493358 15923795 16332718 19812061 30563934	CTD OFFSIDES
919	Diverticular perforation			OFFSIDES
920	Diverticulosis			OFFSIDES
921	Drug Eruptions		20598060	CTD
922	Duodenal Ulcer			OFFSIDES
923	Dyschezia			OFFSIDES
924	Dyspnea		18593679	CTD
925	Ear and labyrinth disorders			SIDER
926	Ear discharge			OFFSIDES
927	Edema		11731066 12859102 19260244	CTD
928	Ejection fraction abnormal			OFFSIDES
929	Endodontic procedure			OFFSIDES
930	Endometrial Neoplasms		9346228 12601542 20863554	CTD
931	Endometrial disorder			OFFSIDES
932	Enterocolitis, Neutropenic		12110496	CTD
933	Enterocolitis, Pseudomembranous		11468447	CTD
934	Epicondylitis			OFFSIDES
935	Epidermal growth factor receptor increased			OFFSIDES
936	Erectile dysfunction			OFFSIDES
937	Esophageal Neoplasms		View details 7692001 10362115 12110496 16100454 16481741 20389300	CTD
938	Esophageal Perforation			OFFSIDES
939	Esophagitis		9007133 9007139 14760117	CTD
940	Exanthema		View details 8708721 9007123 9774950 10955861	CTD
941	Excoriation			OFFSIDES
942	Extravasation of Diagnostic and Therapeutic Materials		8797774	CTD
943	Facial Nerve Diseases		10586344	CTD
944	Fallopian Tube Neoplasms		18554701	CTD
945	Fatty Liver			OFFSIDES
946	Fever		View details 7884419 8643967 8893894 9149030 9346218 9346219 9676843 9740541 9849468 10362115 12367796 14760117	CTD
947	Fibrosis			SIDER
948	Folliculitis			SIDER
949	Foreign-Body Reaction		19564562	CTD
950	Formication			OFFSIDES
951	Fungal rash			OFFSIDES
952	Gait Disorders, Neurologic		View details 8625200 9149085 11350883 20813818	CTD
953	Gastric pH increased			OFFSIDES
954	Gastrointestinal Diseases		8751544 15923795 20052472	CTD
955	Gastrointestinal ulcer			OFFSIDES
956	Generalized urticaria			SIDER
957	Genital Neoplasms, Female		8751544	CTD
958	Gingival erythema			OFFSIDES
959	Glioblastoma		7481858 17701358 18098270	CTD
960	Glioma		12874004 15201989	CTD
961	Goiter			OFFSIDES
962	Granulocytosis			OFFSIDES
963	Granuloma			OFFSIDES
964	Hallucinations		16604029	CTD
965	Head and Neck Neoplasms		View details 7692001 8643971 9149030 19396017	CTD
966	Hearing Loss, Bilateral		9849468	CTD
967	Heart Block		7578376 16354605	CTD
968	Heart Diseases		View details 7904060 8554453 8677355 10037178 15668279	CTD
969	Heart failure		View details 7595726 8629032 8893895 10550159 10577856 10828864 11296620 11583187 15173858 15865068 16354605 16739356	CTD
970	Hemangiosarcoma		9774950	CTD
971	Hoarseness		8683640	CTD SIDER
972	Hyperalgesia		View details 7509380 11134612 11731066 11738263 14984413 15041441 15082137 15875786 16213089 16361064 16406309 16414547 16480831 16530964 16632831 16687474 16854522 17005179 17174526 18037242 18234883 18472288 18664590 18777607 18846037 19027286 19276613 19336915 19833436 20068451 20184918 21050491 21118710 21233199 27474498 28587902	CTD
973	Hyperbilirubinemia		15131032	CTD
974	Hypercreatininaemia			OFFSIDES
975	Hyperglycemia		8626111 15493358	CTD
976	Hyperpigmentation			OFFSIDES
977	Hypesthesia		View details 7509380 7904620 7909329 8625200 9149085 11350883 15997923 16414547	CTD
978	Hypokinesia			SIDER
979	Hyporeflexia			SIDER
980	Hypotension, Orthostatic		9849495	CTD
981	Hypotensive			SIDER
982	Hypotrichosis			SIDER
983	Hysterectomy			OFFSIDES
984	Infestation			SIDER
985	Influenza-like symptoms			SIDER
986	Infusion site inflammation			SIDER
987	Infusion site mobility decreased			OFFSIDES
988	Injection site infection			SIDER
989	Intubation			OFFSIDES
990	Jaw lesion excision			OFFSIDES
991	Joint sprain			OFFSIDES
992	Keratoconjunctivitis Sicca			SIDER
993	Kidney Diseases		8751544 9057954 9164208	CTD
994	Kidney Failure			OFFSIDES
995	Kidney Neoplasm			OFFSIDES
996	Language Disorders		8649555	CTD
997	Left atrial dilatation			OFFSIDES
998	Leukoencephalopathy			SIDER
999	Leukopenia neonatal			OFFSIDES
1000	Life expectancy shortened			OFFSIDES
1001	Ligament rupture			OFFSIDES
1002	Lightheadedness			SIDER
1003	Listeria sepsis			OFFSIDES
1004	Liver Neoplasms, Experimental		18058816	CTD
1005	Liver neoplasms		9018096 9849468 11468447	CTD
1006	Loose tooth			OFFSIDES
1007	Lung Diseases, Interstitial		16612156	CTD
1008	Lung Neoplasms		View details 8683640 9722903 15907983 18455578 21975929	CTD
1009	Lung diseases		9007123	CTD
1010	Lymphoma, Non-Hodgkin		10800167 14749477	CTD
1011	Malignant neoplasm of pancreas			SIDER
1012	Mammary Neoplasms, Experimental		9231689 20838997	CTD
1013	Markedly reduced dietary intake			OFFSIDES
1014	Mass excision			OFFSIDES
1015	Mastectomy			OFFSIDES
1016	Melanoma, Experimental		1359143	CTD
1017	Meniscus removal			OFFSIDES
1018	Mesothelioma		21645609	CTD
1019	Metaplasia			OFFSIDES
1020	Metastatic pain			SIDER
1021	Mobility Limitation		17005179	CTD
1022	Mononucleosis syndrome			OFFSIDES
1023	Mood swings			SIDER
1024	Morganella infection			OFFSIDES
1025	Motor Skills Disorders		19027286	CTD
1026	Mouth Neoplasms		12912971	CTD
1027	Multiple Myeloma		14749477 15728126 16969509	CTD
1028	Muscle Cramp		8708721 9149085 10483822	CTD
1029	Muscle Weakness		View details 7904620 8710063 9149085 11350883 15997923 17611715	CTD
1030	Myelodysplasia			OFFSIDES
1031	Myelosuppression			SIDER
1032	Myocardial Ischemia		View details 7578376 8102012 8569460 8629032	CTD
1033	Nail Diseases		12442916	CTD
1034	Nail bed tenderness			SIDER
1035	Nail changes			SIDER
1036	Nail discomfort			SIDER
1037	Nail pigmentation			SIDER
1038	Necrolysis epidermal			SIDER
1039	Necrotizing Enterocolitis			SIDER
1040	Neoplasm Metastasis		View details 7543699 7638640 8552128 8893892 8913442 9018096 9676843 9849468 10458265 11401310 15170980 15867366 17637549 18058816 19826135 21975929 24246751	CTD
1041	Neoplasm Recurrence, Local		11706781 18455578	CTD
1042	Neoplasms, Experimental		View details 17701358 17878523 18098270 18829547 20705681 22233293	CTD
1043	Neoplasms, Germ Cell and Embryonal		17593098	CTD
1044	Neoplasms, Unknown Primary		11468447	CTD
1045	Neoplasms		16334120 16763792 20433922	CTD
1046	Nephrolithiasis			OFFSIDES
1047	Nerve Degeneration		View details 7837287 7912506 9149085 9553960 11022860 11134612 12859102 16797537 17010629 18809400 19027286 19260244 21050491	CTD
1048	Neuritis		8893892	CTD SIDER
1049	Neuroendocrine Tumors		11468447	CTD
1050	Neuromuscular Diseases		7692001 8708721	CTD
1051	Neuropathy, Painful		27474498	CTD
1052	Neurotoxicity Syndromes		View details 9149085 10553948 11022860 12187335 15330181	CTD
1053	Neutropenic colitis			SIDER
1054	Nocturia			SIDER
1055	Nutritional condition abnormal			OFFSIDES
1056	Obstruction			OFFSIDES
1057	Open reduction of fracture			OFFSIDES
1058	Oral Cavity Fistula			OFFSIDES
1059	Oral discharge			OFFSIDES
1060	Oral pain			SIDER
1061	Oral polypectomy			OFFSIDES
1062	Orthostatic intolerance			OFFSIDES
1063	Osteitis Deformans			OFFSIDES
1064	Osteolysis		15867366	CTD OFFSIDES
1065	Osteomyelitis			OFFSIDES
1066	Osteopenia			OFFSIDES
1067	Osteosarcoma		16140185	CTD
1068	Osteosclerosis			OFFSIDES
1069	Osteotomy			OFFSIDES
1070	Overweight			OFFSIDES
1071	PCO2 decreased			OFFSIDES
1072	Pancreatitis			SIDER
1073	Paresthesia		View details 7509380 7904620 7909329 8625200 8643971 8708721 8797774 8893895 9007130 9149085 9266440 9849468 10483822 10955861 11104554 11113764 11230474 11350883 11401310 12187335 14514973 14760066 15923795 16414547 17611715	CTD
1074	Parkinson Disease		8552128	CTD
1075	Perihepatic discomfort			OFFSIDES
1076	Periodontitis			OFFSIDES
1077	Peripheral Nervous System Diseases		View details 7481858 7509380 7524159 7543559 7601264 7692001 7850713 7884419 7904620 7907208 7912506 8610231 8625200 8643967 8667418 8683640 8710063 8751544 8797774 8866126 8893892 9007119 9007121 9007122 9007133 9266440 9337680 9346218 9346219 9346221 9346223 9635850 9740541 9748043 9849468 10586344 10928183 11104554 11113764 11206272 11268500 11330975 11350883 11679185 11706781 11731066 11738263 12601542 12825825 12831778 12859102 12911718 14597872 14599877 14654561 14760066 14769840 15170980 15319252 15566651 15642899 15756015 15913989 15948540 15958131 15997923 16000582 16021477 16193394 16284715 16332718 16406309 16414547 16442593 16530964 16612156 16797537 16854522 16939848 16950614 17005179 17508942 17509163 17611715 17637549 17659836 17686523 17974278 18270703 18472288 18664590 18754875 18777607 18809400 19027286 19091544 19151569 19260244 19396017 19429028 19473225 19576881 19595634 19755835 19812061 20184918 20486471 20578381 20813818 20863554 20932997 21118710 21233199 21865574 22079976 26883566 27736846 28587902	CTD
1078	Peritonsillitis			OFFSIDES
1079	Pharyngeal swelling	Canada Vigilance: 1		Canada Vigilance
1080	Photodermatosis			OFFSIDES
1081	Physical disability			OFFSIDES
1082	Pneumocystis jiroveci pneumonia			OFFSIDES
1083	Pneumopericardium			OFFSIDES
1084	Polydipsia			SIDER
1085	Polyuria			SIDER
1086	Posterior Leukoencephalopathy Syndrome		18554701	CTD
1087	Postmenopausal bleeding			OFFSIDES
1088	Primary sequestrum			OFFSIDES
1089	Prostate examination abnormal			OFFSIDES
1090	Prostatic Neoplasms		View details 10881025 15492279 16356831 16442593 16729912 17136230 17172428 20052472	CTD
1091	Protein total abnormal			OFFSIDES
1092	Prurigo			SIDER
1093	Pseudomonal sepsis			OFFSIDES
1094	Puncture site pain			OFFSIDES
1095	Radicular pain			OFFSIDES
1096	Rectal fissure			OFFSIDES
1097	Recurrence		7884419	CTD
1098	Redness			SIDER
1099	Reflex, Abnormal		View details 7904620 9149085 10483822 14760066 17611715	CTD
1100	Renal Insufficiency		11104554	CTD
1101	Renal cyst			OFFSIDES
1102	Salpingo-oophorectomy			OFFSIDES
1103	Sciatic Neuropathy		11022860 11134612	CTD
1104	Sclerosis		12582404	CTD
1105	Seizures		15026476 19637953	CTD
1106	Sensation Disorders		View details 7644931 8643968 12189532 12911718 15082135	CTD
1107	Signs and Symptoms, Digestive		9346223	CTD
1108	Skeletal injury			OFFSIDES
1109	Skin Neoplasms		9774950	CTD
1110	Sleep Wake Disorders		12911718	CTD
1111	Soft Tissue Infection			OFFSIDES
1112	Soft Tissue Neoplasms		7543699	CTD
1113	Somatosensory Disorders		View details 7543699 9553960 11487721 19260244	CTD
1114	Spinal Cord Diseases		11022860 11134612	CTD
1115	Spinal claudication			OFFSIDES
1116	Spinal column stenosis			OFFSIDES
1117	Spondylolisthesis			OFFSIDES
1118	Squamous cell carcinoma of lung			SIDER
1119	Stomach Neoplasms		View details 9858922 15923795 15961435 16332718 17637549 18396642 18506536 19755835 19812061 21289336 21586171	CTD
1120	Stomatocytes present			OFFSIDES
1121	Superior Vena Cava Syndrome			OFFSIDES
1122	Synovial Cyst			OFFSIDES
1123	Synovitis			OFFSIDES
1124	Tachycardia, Ventricular		7578376 8102012	CTD
1125	Taste Disorders		7904060	CTD
1126	Tauopathies		16930453	CTD
1127	Tendinitis			OFFSIDES
1128	Tenosynovitis			OFFSIDES
1129	Tension			SIDER
1130	Testicular Neoplasms		17593098	CTD
1131	Thoracotomy			OFFSIDES
1132	Thromboembolism		15493358	CTD
1133	Toe operation			OFFSIDES
1134	Tonsillar Neoplasms		8683640	CTD
1135	Tooth Extraction			OFFSIDES
1136	Tooth Infection			OFFSIDES
1137	Tooth Loss			OFFSIDES
1138	Tooth repair			OFFSIDES
1139	Troponin I increased			OFFSIDES
1140	Ulcer			OFFSIDES
1141	Urethritis			OFFSIDES
1142	Urge Incontinence			OFFSIDES
1143	Urine flow decreased			OFFSIDES
1144	Urine output increased			SIDER
1145	Urologic Neoplasms		9440750 15493358	CTD
1146	Uterine Neoplasms		9774950	CTD
1147	Uterine Polyp			OFFSIDES
1148	Ventricular Dysfunction, Left		View details 8893117 8893894 8893896 9374088 10472783 10577856 10828864 11147586 11583187 15865068	CTD
1149	Ventricular bigeminy			SIDER
1150	Ventricular failure			SIDER
1151	Vision Disorders		7913722 9722903 10483822	CTD
1152	Vitiligo			SIDER
1153	Vulvovaginal burning sensation	Canada Vigilance: 1		Canada Vigilance
1154	Walking aid user			OFFSIDES
1155	Wound Debridement			OFFSIDES
1156	anaphylaxis		7509380 7524159	CTD
1157	kyphosis			OFFSIDES
1158	leiomyosarcoma		9774950	CTD
1159	leukemia		7904060	CTD
1160	liposarcoma		17353645	CTD
1161	melanoma		View details 12025231 12040289 16342250 19826135 20389300	CTD

Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141